aboutsummaryrefslogtreecommitdiff
path: root/docs/examples/web/models_obj_loading.js
diff options
context:
space:
mode:
authorvictorfisac <victorfisac@gmail.com>2017-03-06 09:40:04 +0100
committervictorfisac <victorfisac@gmail.com>2017-03-06 09:40:04 +0100
commit9261c3b8dc03d093bff5246a18ad9310ae8eaeb3 (patch)
treeaf87165723ac563ee1a7e1c605c7a4df821d74ea /docs/examples/web/models_obj_loading.js
parente8630c78d069a1cba50b1a78108663ebc19e5b9b (diff)
parentb734802743f2089c8d649b27aea48ab71fa653b3 (diff)
downloadraylib-9261c3b8dc03d093bff5246a18ad9310ae8eaeb3.tar.gz
raylib-9261c3b8dc03d093bff5246a18ad9310ae8eaeb3.zip
Merge remote-tracking branch 'refs/remotes/raysan5/develop' into develop
Diffstat (limited to 'docs/examples/web/models_obj_loading.js')
-rw-r--r--docs/examples/web/models_obj_loading.js50580
1 files changed, 50580 insertions, 0 deletions
diff --git a/docs/examples/web/models_obj_loading.js b/docs/examples/web/models_obj_loading.js
new file mode 100644
index 00000000..8491af04
--- /dev/null
+++ b/docs/examples/web/models_obj_loading.js
@@ -0,0 +1,50580 @@
+
+var Module;
+
+if (typeof Module === 'undefined') Module = {};
+
+if (!Module.expectedDataFileDownloads) {
+ Module.expectedDataFileDownloads = 0;
+ Module.finishedDataFileDownloads = 0;
+}
+Module.expectedDataFileDownloads++;
+(function() {
+ var loadPackage = function(metadata) {
+
+ var PACKAGE_PATH;
+ if (typeof window === 'object') {
+ PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
+ } else if (typeof location !== 'undefined') {
+ // worker
+ PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
+ } else {
+ throw 'using preloaded data can only be done on a web page or in a web worker';
+ }
+ var PACKAGE_NAME = 'models_obj_loading.data';
+ var REMOTE_PACKAGE_BASE = 'models_obj_loading.data';
+ if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
+ Module['locateFile'] = Module['locateFilePackage'];
+ Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
+ }
+ var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ?
+ Module['locateFile'](REMOTE_PACKAGE_BASE) :
+ ((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE);
+
+ var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
+ var PACKAGE_UUID = metadata.package_uuid;
+
+ function fetchRemotePackage(packageName, packageSize, callback, errback) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', packageName, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onprogress = function(event) {
+ var url = packageName;
+ var size = packageSize;
+ if (event.total) size = event.total;
+ if (event.loaded) {
+ if (!xhr.addedTotal) {
+ xhr.addedTotal = true;
+ if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
+ Module.dataFileDownloads[url] = {
+ loaded: event.loaded,
+ total: size
+ };
+ } else {
+ Module.dataFileDownloads[url].loaded = event.loaded;
+ }
+ var total = 0;
+ var loaded = 0;
+ var num = 0;
+ for (var download in Module.dataFileDownloads) {
+ var data = Module.dataFileDownloads[download];
+ total += data.total;
+ loaded += data.loaded;
+ num++;
+ }
+ total = Math.ceil(total * Module.expectedDataFileDownloads/num);
+ if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
+ } else if (!Module.dataFileDownloads) {
+ if (Module['setStatus']) Module['setStatus']('Downloading data...');
+ }
+ };
+ xhr.onload = function(event) {
+ var packageData = xhr.response;
+ callback(packageData);
+ };
+ xhr.send(null);
+ };
+
+ function handleError(error) {
+ console.error('package error:', error);
+ };
+
+ var fetched = null, fetchedCallback = null;
+ fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
+ if (fetchedCallback) {
+ fetchedCallback(data);
+ fetchedCallback = null;
+ } else {
+ fetched = data;
+ }
+ }, handleError);
+
+ function runWithFS() {
+
+ function assert(check, msg) {
+ if (!check) throw msg + new Error().stack;
+ }
+Module['FS_createPath']('/', 'resources', true, true);
+Module['FS_createPath']('/resources', 'model', true, true);
+
+ function DataRequest(start, end, crunched, audio) {
+ this.start = start;
+ this.end = end;
+ this.crunched = crunched;
+ this.audio = audio;
+ }
+ DataRequest.prototype = {
+ requests: {},
+ open: function(mode, name) {
+ this.name = name;
+ this.requests[name] = this;
+ Module['addRunDependency']('fp ' + this.name);
+ },
+ send: function() {},
+ onload: function() {
+ var byteArray = this.byteArray.subarray(this.start, this.end);
+
+ this.finish(byteArray);
+
+ },
+ finish: function(byteArray) {
+ var that = this;
+
+ Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
+ Module['removeRunDependency']('fp ' + that.name);
+
+ this.requests[this.name] = null;
+ },
+ };
+
+ var files = metadata.files;
+ for (i = 0; i < files.length; ++i) {
+ new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename);
+ }
+
+
+ function processPackageData(arrayBuffer) {
+ Module.finishedDataFileDownloads++;
+ assert(arrayBuffer, 'Loading data file failed.');
+ assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
+ var byteArray = new Uint8Array(arrayBuffer);
+ var curr;
+
+ // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though
+ // (we may be allocating before malloc is ready, during startup).
+ if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting');
+ var ptr = Module['getMemory'](byteArray.length);
+ Module['HEAPU8'].set(byteArray, ptr);
+ DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length);
+
+ var files = metadata.files;
+ for (i = 0; i < files.length; ++i) {
+ DataRequest.prototype.requests[files[i].filename].onload();
+ }
+ Module['removeRunDependency']('datafile_models_obj_loading.data');
+
+ };
+ Module['addRunDependency']('datafile_models_obj_loading.data');
+
+ if (!Module.preloadResults) Module.preloadResults = {};
+
+ Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
+ if (fetched) {
+ processPackageData(fetched);
+ fetched = null;
+ } else {
+ fetchedCallback = processPackageData;
+ }
+
+ }
+ if (Module['calledRun']) {
+ runWithFS();
+ } else {
+ if (!Module['preRun']) Module['preRun'] = [];
+ Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
+ }
+
+ }
+ loadPackage({"files": [{"audio": 0, "start": 0, "crunched": 0, "end": 2748249, "filename": "/resources/model/dwarf.obj"}, {"audio": 0, "start": 2748249, "crunched": 0, "end": 4022872, "filename": "/resources/model/dwarf_diffuse.png"}], "remote_package_size": 4022872, "package_uuid": "e7903c6f-6424-4eec-9ca9-573c243d7358"});
+
+})();
+
+// The Module object: Our interface to the outside world. We import
+// and export values on it, and do the work to get that through
+// closure compiler if necessary. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to do an eval in order to handle the closure compiler
+// case, where this code here is minified but Module was defined
+// elsewhere (e.g. case 4 above). We also need to check if Module
+// already exists (e.g. case 3 above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module;
+if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = {};
+for (var key in Module) {
+ if (Module.hasOwnProperty(key)) {
+ moduleOverrides[key] = Module[key];
+ }
+}
+
+// The environment setup code below is customized to use Module.
+// *** Environment setup code ***
+var ENVIRONMENT_IS_WEB = typeof window === 'object';
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+var ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
+var ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
+var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+if (ENVIRONMENT_IS_NODE) {
+ // Expose functionality in the same simple way that the shells work
+ // Note that we pollute the global namespace here, otherwise we break in node
+ if (!Module['print']) Module['print'] = function print(x) {
+ process['stdout'].write(x + '\n');
+ };
+ if (!Module['printErr']) Module['printErr'] = function printErr(x) {
+ process['stderr'].write(x + '\n');
+ };
+
+ var nodeFS = require('fs');
+ var nodePath = require('path');
+
+ Module['read'] = function read(filename, binary) {
+ filename = nodePath['normalize'](filename);
+ var ret = nodeFS['readFileSync'](filename);
+ // The path is absolute if the normalized version is the same as the resolved.
+ if (!ret && filename != nodePath['resolve'](filename)) {
+ filename = path.join(__dirname, '..', 'src', filename);
+ ret = nodeFS['readFileSync'](filename);
+ }
+ if (ret && !binary) ret = ret.toString();
+ return ret;
+ };
+
+ Module['readBinary'] = function readBinary(filename) {
+ var ret = Module['read'](filename, true);
+ if (!ret.buffer) {
+ ret = new Uint8Array(ret);
+ }
+ assert(ret.buffer);
+ return ret;
+ };
+
+ Module['load'] = function load(f) {
+ globalEval(read(f));
+ };
+
+ if (!Module['thisProgram']) {
+ if (process['argv'].length > 1) {
+ Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
+ } else {
+ Module['thisProgram'] = 'unknown-program';
+ }
+ }
+
+ Module['arguments'] = process['argv'].slice(2);
+
+ if (typeof module !== 'undefined') {
+ module['exports'] = Module;
+ }
+
+ process['on']('uncaughtException', function(ex) {
+ // suppress ExitStatus exceptions from showing an error
+ if (!(ex instanceof ExitStatus)) {
+ throw ex;
+ }
+ });
+
+ Module['inspect'] = function () { return '[Emscripten Module object]'; };
+}
+else if (ENVIRONMENT_IS_SHELL) {
+ if (!Module['print']) Module['print'] = print;
+ if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm
+
+ if (typeof read != 'undefined') {
+ Module['read'] = read;
+ } else {
+ Module['read'] = function read() { throw 'no read() available (jsc?)' };
+ }
+
+ Module['readBinary'] = function readBinary(f) {
+ if (typeof readbuffer === 'function') {
+ return new Uint8Array(readbuffer(f));
+ }
+ var data = read(f, 'binary');
+ assert(typeof data === 'object');
+ return data;
+ };
+
+ if (typeof scriptArgs != 'undefined') {
+ Module['arguments'] = scriptArgs;
+ } else if (typeof arguments != 'undefined') {
+ Module['arguments'] = arguments;
+ }
+
+}
+else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ Module['read'] = function read(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.send(null);
+ return xhr.responseText;
+ };
+
+ if (typeof arguments != 'undefined') {
+ Module['arguments'] = arguments;
+ }
+
+ if (typeof console !== 'undefined') {
+ if (!Module['print']) Module['print'] = function print(x) {
+ console.log(x);
+ };
+ if (!Module['printErr']) Module['printErr'] = function printErr(x) {
+ console.log(x);
+ };
+ } else {
+ // Probably a worker, and without console.log. We can do very little here...
+ var TRY_USE_DUMP = false;
+ if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
+ dump(x);
+ }) : (function(x) {
+ // self.postMessage(x); // enable this if you want stdout to be sent as messages
+ }));
+ }
+
+ if (ENVIRONMENT_IS_WORKER) {
+ Module['load'] = importScripts;
+ }
+
+ if (typeof Module['setWindowTitle'] === 'undefined') {
+ Module['setWindowTitle'] = function(title) { document.title = title };
+ }
+}
+else {
+ // Unreachable because SHELL is dependant on the others
+ throw 'Unknown runtime environment. Where are we?';
+}
+
+function globalEval(x) {
+ eval.call(null, x);
+}
+if (!Module['load'] && Module['read']) {
+ Module['load'] = function load(f) {
+ globalEval(Module['read'](f));
+ };
+}
+if (!Module['print']) {
+ Module['print'] = function(){};
+}
+if (!Module['printErr']) {
+ Module['printErr'] = Module['print'];
+}
+if (!Module['arguments']) {
+ Module['arguments'] = [];
+}
+if (!Module['thisProgram']) {
+ Module['thisProgram'] = './this.program';
+}
+
+// *** Environment setup code ***
+
+// Closure helpers
+Module.print = Module['print'];
+Module.printErr = Module['printErr'];
+
+// Callbacks
+Module['preRun'] = [];
+Module['postRun'] = [];
+
+// Merge back in the overrides
+for (var key in moduleOverrides) {
+ if (moduleOverrides.hasOwnProperty(key)) {
+ Module[key] = moduleOverrides[key];
+ }
+}
+
+
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+//========================================
+// Runtime code shared with compiler
+//========================================
+
+var Runtime = {
+ setTempRet0: function (value) {
+ tempRet0 = value;
+ },
+ getTempRet0: function () {
+ return tempRet0;
+ },
+ stackSave: function () {
+ return STACKTOP;
+ },
+ stackRestore: function (stackTop) {
+ STACKTOP = stackTop;
+ },
+ getNativeTypeSize: function (type) {
+ switch (type) {
+ case 'i1': case 'i8': return 1;
+ case 'i16': return 2;
+ case 'i32': return 4;
+ case 'i64': return 8;
+ case 'float': return 4;
+ case 'double': return 8;
+ default: {
+ if (type[type.length-1] === '*') {
+ return Runtime.QUANTUM_SIZE; // A pointer
+ } else if (type[0] === 'i') {
+ var bits = parseInt(type.substr(1));
+ assert(bits % 8 === 0);
+ return bits/8;
+ } else {
+ return 0;
+ }
+ }
+ }
+ },
+ getNativeFieldSize: function (type) {
+ return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
+ },
+ STACK_ALIGN: 16,
+ prepVararg: function (ptr, type) {
+ if (type === 'double' || type === 'i64') {
+ // move so the load is aligned
+ if (ptr & 7) {
+ assert((ptr & 7) === 4);
+ ptr += 4;
+ }
+ } else {
+ assert((ptr & 3) === 0);
+ }
+ return ptr;
+ },
+ getAlignSize: function (type, size, vararg) {
+ // we align i64s and doubles on 64-bit boundaries, unlike x86
+ if (!vararg && (type == 'i64' || type == 'double')) return 8;
+ if (!type) return Math.min(size, 8); // align structures internally to 64 bits
+ return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
+ },
+ dynCall: function (sig, ptr, args) {
+ if (args && args.length) {
+ if (!args.splice) args = Array.prototype.slice.call(args);
+ args.splice(0, 0, ptr);
+ return Module['dynCall_' + sig].apply(null, args);
+ } else {
+ return Module['dynCall_' + sig].call(null, ptr);
+ }
+ },
+ functionPointers: [],
+ addFunction: function (func) {
+ for (var i = 0; i < Runtime.functionPointers.length; i++) {
+ if (!Runtime.functionPointers[i]) {
+ Runtime.functionPointers[i] = func;
+ return 2*(1 + i);
+ }
+ }
+ throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
+ },
+ removeFunction: function (index) {
+ Runtime.functionPointers[(index-2)/2] = null;
+ },
+ warnOnce: function (text) {
+ if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
+ if (!Runtime.warnOnce.shown[text]) {
+ Runtime.warnOnce.shown[text] = 1;
+ Module.printErr(text);
+ }
+ },
+ funcWrappers: {},
+ getFuncWrapper: function (func, sig) {
+ assert(sig);
+ if (!Runtime.funcWrappers[sig]) {
+ Runtime.funcWrappers[sig] = {};
+ }
+ var sigCache = Runtime.funcWrappers[sig];
+ if (!sigCache[func]) {
+ sigCache[func] = function dynCall_wrapper() {
+ return Runtime.dynCall(sig, func, arguments);
+ };
+ }
+ return sigCache[func];
+ },
+ getCompilerSetting: function (name) {
+ throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
+ },
+ stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; },
+ staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
+ dynamicAlloc: function (size) { var ret = DYNAMICTOP;DYNAMICTOP = (DYNAMICTOP + size)|0;DYNAMICTOP = (((DYNAMICTOP)+15)&-16); if (DYNAMICTOP >= TOTAL_MEMORY) { var success = enlargeMemory(); if (!success) { DYNAMICTOP = ret; return 0; } }; return ret; },
+ alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
+ makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
+ GLOBAL_BASE: 8,
+ QUANTUM_SIZE: 4,
+ __dummy__: 0
+}
+
+
+
+Module["Runtime"] = Runtime;
+
+
+
+//========================================
+// Runtime essentials
+//========================================
+
+var __THREW__ = 0; // Used in checking for thrown exceptions.
+
+var ABORT = false; // whether we are quitting the application. no code should run after this. set in exit() and abort()
+var EXITSTATUS = 0;
+
+var undef = 0;
+// tempInt is used for 32-bit signed values or smaller. tempBigInt is used
+// for 32-bit unsigned values or more than 32 bits. TODO: audit all uses of tempInt
+var tempValue, tempInt, tempBigInt, tempInt2, tempBigInt2, tempPair, tempBigIntI, tempBigIntR, tempBigIntS, tempBigIntP, tempBigIntD, tempDouble, tempFloat;
+var tempI64, tempI64b;
+var tempRet0, tempRet1, tempRet2, tempRet3, tempRet4, tempRet5, tempRet6, tempRet7, tempRet8, tempRet9;
+
+function assert(condition, text) {
+ if (!condition) {
+ abort('Assertion failed: ' + text);
+ }
+}
+
+var globalScope = this;
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+ var func = Module['_' + ident]; // closure exported function
+ if (!func) {
+ try {
+ func = eval('_' + ident); // explicit lookup
+ } catch(e) {}
+ }
+ assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
+ return func;
+}
+
+var cwrap, ccall;
+(function(){
+ var JSfuncs = {
+ // Helpers for cwrap -- it can't refer to Runtime directly because it might
+ // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
+ // out what the minified function name is.
+ 'stackSave': function() {
+ Runtime.stackSave()
+ },
+ 'stackRestore': function() {
+ Runtime.stackRestore()
+ },
+ // type conversion from js to c
+ 'arrayToC' : function(arr) {
+ var ret = Runtime.stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ },
+ 'stringToC' : function(str) {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) { // null string
+ // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+ ret = Runtime.stackAlloc((str.length << 2) + 1);
+ writeStringToMemory(str, ret);
+ }
+ return ret;
+ }
+ };
+ // For fast lookup of conversion functions
+ var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};
+
+ // C calling interface.
+ ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = Runtime.stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ if (returnType === 'string') ret = Pointer_stringify(ret);
+ if (stack !== 0) {
+ if (opts && opts.async) {
+ EmterpreterAsync.asyncFinalizers.push(function() {
+ Runtime.stackRestore(stack);
+ });
+ return;
+ }
+ Runtime.stackRestore(stack);
+ }
+ return ret;
+ }
+
+ var sourceRegex = /^function\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
+ function parseJSFunc(jsfunc) {
+ // Match the body and the return value of a javascript function source
+ var parsed = jsfunc.toString().match(sourceRegex).slice(1);
+ return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
+ }
+ var JSsource = {};
+ for (var fun in JSfuncs) {
+ if (JSfuncs.hasOwnProperty(fun)) {
+ // Elements of toCsource are arrays of three items:
+ // the code, and the return value
+ JSsource[fun] = parseJSFunc(JSfuncs[fun]);
+ }
+ }
+
+
+ cwrap = function cwrap(ident, returnType, argTypes) {
+ argTypes = argTypes || [];
+ var cfunc = getCFunc(ident);
+ // When the function takes numbers and returns a number, we can just return
+ // the original function
+ var numericArgs = argTypes.every(function(type){ return type === 'number'});
+ var numericRet = (returnType !== 'string');
+ if ( numericRet && numericArgs) {
+ return cfunc;
+ }
+ // Creation of the arguments list (["$1","$2",...,"$nargs"])
+ var argNames = argTypes.map(function(x,i){return '$'+i});
+ var funcstr = "(function(" + argNames.join(',') + ") {";
+ var nargs = argTypes.length;
+ if (!numericArgs) {
+ // Generate the code needed to convert the arguments from javascript
+ // values to pointers
+ funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
+ for (var i = 0; i < nargs; i++) {
+ var arg = argNames[i], type = argTypes[i];
+ if (type === 'number') continue;
+ var convertCode = JSsource[type + 'ToC']; // [code, return]
+ funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
+ funcstr += convertCode.body + ';';
+ funcstr += arg + '=' + convertCode.returnValue + ';';
+ }
+ }
+
+ // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
+ var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
+ // Call the function
+ funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
+ if (!numericRet) { // Return type can only by 'string' or 'number'
+ // Convert the result to a string
+ var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
+ funcstr += 'ret = ' + strgfy + '(ret);';
+ }
+ if (!numericArgs) {
+ // If we had a stack, restore it
+ funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
+ }
+ funcstr += 'return ret})';
+ return eval(funcstr);
+ };
+})();
+Module["ccall"] = ccall;
+Module["cwrap"] = cwrap;
+
+function setValue(ptr, value, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': HEAP8[((ptr)>>0)]=value; break;
+ case 'i8': HEAP8[((ptr)>>0)]=value; break;
+ case 'i16': HEAP16[((ptr)>>1)]=value; break;
+ case 'i32': HEAP32[((ptr)>>2)]=value; break;
+ case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
+ case 'float': HEAPF32[((ptr)>>2)]=value; break;
+ case 'double': HEAPF64[((ptr)>>3)]=value; break;
+ default: abort('invalid type for setValue: ' + type);
+ }
+}
+Module["setValue"] = setValue;
+
+
+function getValue(ptr, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': return HEAP8[((ptr)>>0)];
+ case 'i8': return HEAP8[((ptr)>>0)];
+ case 'i16': return HEAP16[((ptr)>>1)];
+ case 'i32': return HEAP32[((ptr)>>2)];
+ case 'i64': return HEAP32[((ptr)>>2)];
+ case 'float': return HEAPF32[((ptr)>>2)];
+ case 'double': return HEAPF64[((ptr)>>3)];
+ default: abort('invalid type for setValue: ' + type);
+ }
+ return null;
+}
+Module["getValue"] = getValue;
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+var ALLOC_STATIC = 2; // Cannot be freed
+var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
+var ALLOC_NONE = 4; // Do not allocate
+Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
+Module["ALLOC_STACK"] = ALLOC_STACK;
+Module["ALLOC_STATIC"] = ALLOC_STATIC;
+Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
+Module["ALLOC_NONE"] = ALLOC_NONE;
+
+// allocate(): This is for internal use. You can use it yourself as well, but the interface
+// is a little tricky (see docs right below). The reason is that it is optimized
+// for multiple syntaxes to save space in generated code. So you should
+// normally not use allocate(), and instead allocate memory using _malloc(),
+// initialize it with setValue(), and so forth.
+// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
+// in *bytes* (note that this is sometimes confusing: the next parameter does not
+// affect this!)
+// @types: Either an array of types, one for each byte (or 0 if no type at that position),
+// or a single type which is used for the entire block. This only matters if there
+// is initial data - if @slab is a number, then this does not matter at all and is
+// ignored.
+// @allocator: How to allocate memory, see ALLOC_*
+function allocate(slab, types, allocator, ptr) {
+ var zeroinit, size;
+ if (typeof slab === 'number') {
+ zeroinit = true;
+ size = slab;
+ } else {
+ zeroinit = false;
+ size = slab.length;
+ }
+
+ var singleType = typeof types === 'string' ? types : null;
+
+ var ret;
+ if (allocator == ALLOC_NONE) {
+ ret = ptr;
+ } else {
+ ret = [_malloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
+ }
+
+ if (zeroinit) {
+ var ptr = ret, stop;
+ assert((ret & 3) == 0);
+ stop = ret + (size & ~3);
+ for (; ptr < stop; ptr += 4) {
+ HEAP32[((ptr)>>2)]=0;
+ }
+ stop = ret + size;
+ while (ptr < stop) {
+ HEAP8[((ptr++)>>0)]=0;
+ }
+ return ret;
+ }
+
+ if (singleType === 'i8') {
+ if (slab.subarray || slab.slice) {
+ HEAPU8.set(slab, ret);
+ } else {
+ HEAPU8.set(new Uint8Array(slab), ret);
+ }
+ return ret;
+ }
+
+ var i = 0, type, typeSize, previousType;
+ while (i < size) {
+ var curr = slab[i];
+
+ if (typeof curr === 'function') {
+ curr = Runtime.getFunctionIndex(curr);
+ }
+
+ type = singleType || types[i];
+ if (type === 0) {
+ i++;
+ continue;
+ }
+
+ if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
+
+ setValue(ret+i, curr, type);
+
+ // no need to look up size unless type changes, so cache it
+ if (previousType !== type) {
+ typeSize = Runtime.getNativeTypeSize(type);
+ previousType = type;
+ }
+ i += typeSize;
+ }
+
+ return ret;
+}
+Module["allocate"] = allocate;
+
+// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
+function getMemory(size) {
+ if (!staticSealed) return Runtime.staticAlloc(size);
+ if ((typeof _sbrk !== 'undefined' && !_sbrk.called) || !runtimeInitialized) return Runtime.dynamicAlloc(size);
+ return _malloc(size);
+}
+Module["getMemory"] = getMemory;
+
+function Pointer_stringify(ptr, /* optional */ length) {
+ if (length === 0 || !ptr) return '';
+ // TODO: use TextDecoder
+ // Find the length, and check for UTF while doing so
+ var hasUtf = 0;
+ var t;
+ var i = 0;
+ while (1) {
+ t = HEAPU8[(((ptr)+(i))>>0)];
+ hasUtf |= t;
+ if (t == 0 && !length) break;
+ i++;
+ if (length && i == length) break;
+ }
+ if (!length) length = i;
+
+ var ret = '';
+
+ if (hasUtf < 128) {
+ var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
+ var curr;
+ while (length > 0) {
+ curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
+ ret = ret ? ret + curr : curr;
+ ptr += MAX_CHUNK;
+ length -= MAX_CHUNK;
+ }
+ return ret;
+ }
+ return Module['UTF8ToString'](ptr);
+}
+Module["Pointer_stringify"] = Pointer_stringify;
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+ var str = '';
+ while (1) {
+ var ch = HEAP8[((ptr++)>>0)];
+ if (!ch) return str;
+ str += String.fromCharCode(ch);
+ }
+}
+Module["AsciiToString"] = AsciiToString;
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+ return writeAsciiToMemory(str, outPtr, false);
+}
+Module["stringToAscii"] = stringToAscii;
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ArrayToString(u8Array, idx) {
+ var u0, u1, u2, u3, u4, u5;
+
+ var str = '';
+ while (1) {
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ u0 = u8Array[idx++];
+ if (!u0) return str;
+ if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+ u1 = u8Array[idx++] & 63;
+ if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+ u2 = u8Array[idx++] & 63;
+ if ((u0 & 0xF0) == 0xE0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ u3 = u8Array[idx++] & 63;
+ if ((u0 & 0xF8) == 0xF0) {
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
+ } else {
+ u4 = u8Array[idx++] & 63;
+ if ((u0 & 0xFC) == 0xF8) {
+ u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
+ } else {
+ u5 = u8Array[idx++] & 63;
+ u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
+ }
+ }
+ }
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ }
+ }
+}
+Module["UTF8ArrayToString"] = UTF8ArrayToString;
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ToString(ptr) {
+ return UTF8ArrayToString(HEAPU8,ptr);
+}
+Module["UTF8ToString"] = UTF8ToString;
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+// outIdx: The starting offset in the array to begin the copying.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
+ if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+ return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) {
+ if (outIdx >= endIdx) break;
+ outU8Array[outIdx++] = u;
+ } else if (u <= 0x7FF) {
+ if (outIdx + 1 >= endIdx) break;
+ outU8Array[outIdx++] = 0xC0 | (u >> 6);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xFFFF) {
+ if (outIdx + 2 >= endIdx) break;
+ outU8Array[outIdx++] = 0xE0 | (u >> 12);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x1FFFFF) {
+ if (outIdx + 3 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF0 | (u >> 18);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x3FFFFFF) {
+ if (outIdx + 4 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF8 | (u >> 24);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 5 >= endIdx) break;
+ outU8Array[outIdx++] = 0xFC | (u >> 30);
+ outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ outU8Array[outIdx] = 0;
+ return outIdx - startIdx;
+}
+Module["stringToUTF8Array"] = stringToUTF8Array;
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+ return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+Module["stringToUTF8"] = stringToUTF8;
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF8(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) {
+ ++len;
+ } else if (u <= 0x7FF) {
+ len += 2;
+ } else if (u <= 0xFFFF) {
+ len += 3;
+ } else if (u <= 0x1FFFFF) {
+ len += 4;
+ } else if (u <= 0x3FFFFFF) {
+ len += 5;
+ } else {
+ len += 6;
+ }
+ }
+ return len;
+}
+Module["lengthBytesUTF8"] = lengthBytesUTF8;
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function UTF16ToString(ptr) {
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+ if (codeUnit == 0)
+ return str;
+ ++i;
+ // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+ str += String.fromCharCode(codeUnit);
+ }
+}
+Module["UTF16ToString"] = UTF16ToString;
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 2) return 0;
+ maxBytesToWrite -= 2; // Null terminator.
+ var startPtr = outPtr;
+ var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+ for (var i = 0; i < numCharsToWrite; ++i) {
+ // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ HEAP16[((outPtr)>>1)]=codeUnit;
+ outPtr += 2;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP16[((outPtr)>>1)]=0;
+ return outPtr - startPtr;
+}
+Module["stringToUTF16"] = stringToUTF16;
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+ return str.length*2;
+}
+Module["lengthBytesUTF16"] = lengthBytesUTF16;
+
+function UTF32ToString(ptr) {
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+ if (utf32 == 0)
+ return str;
+ ++i;
+ // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ if (utf32 >= 0x10000) {
+ var ch = utf32 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ } else {
+ str += String.fromCharCode(utf32);
+ }
+ }
+}
+Module["UTF32ToString"] = UTF32ToString;
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 4) return 0;
+ var startPtr = outPtr;
+ var endPtr = startPtr + maxBytesToWrite - 4;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+ var trailSurrogate = str.charCodeAt(++i);
+ codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+ }
+ HEAP32[((outPtr)>>2)]=codeUnit;
+ outPtr += 4;
+ if (outPtr + 4 > endPtr) break;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP32[((outPtr)>>2)]=0;
+ return outPtr - startPtr;
+}
+Module["stringToUTF32"] = stringToUTF32;
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i);
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+ len += 4;
+ }
+
+ return len;
+}
+Module["lengthBytesUTF32"] = lengthBytesUTF32;
+
+function demangle(func) {
+ var hasLibcxxabi = !!Module['___cxa_demangle'];
+ if (hasLibcxxabi) {
+ try {
+ var buf = _malloc(func.length);
+ writeStringToMemory(func.substr(1), buf);
+ var status = _malloc(4);
+ var ret = Module['___cxa_demangle'](buf, 0, 0, status);
+ if (getValue(status, 'i32') === 0 && ret) {
+ return Pointer_stringify(ret);
+ }
+ // otherwise, libcxxabi failed, we can try ours which may return a partial result
+ } catch(e) {
+ // failure when using libcxxabi, we can try ours which may return a partial result
+ } finally {
+ if (buf) _free(buf);
+ if (status) _free(status);
+ if (ret) _free(ret);
+ }
+ }
+ var i = 3;
+ // params, etc.
+ var basicTypes = {
+ 'v': 'void',
+ 'b': 'bool',
+ 'c': 'char',
+ 's': 'short',
+ 'i': 'int',
+ 'l': 'long',
+ 'f': 'float',
+ 'd': 'double',
+ 'w': 'wchar_t',
+ 'a': 'signed char',
+ 'h': 'unsigned char',
+ 't': 'unsigned short',
+ 'j': 'unsigned int',
+ 'm': 'unsigned long',
+ 'x': 'long long',
+ 'y': 'unsigned long long',
+ 'z': '...'
+ };
+ var subs = [];
+ var first = true;
+ function dump(x) {
+ //return;
+ if (x) Module.print(x);
+ Module.print(func);
+ var pre = '';
+ for (var a = 0; a < i; a++) pre += ' ';
+ Module.print (pre + '^');
+ }
+ function parseNested() {
+ i++;
+ if (func[i] === 'K') i++; // ignore const
+ var parts = [];
+ while (func[i] !== 'E') {
+ if (func[i] === 'S') { // substitution
+ i++;
+ var next = func.indexOf('_', i);
+ var num = func.substring(i, next) || 0;
+ parts.push(subs[num] || '?');
+ i = next+1;
+ continue;
+ }
+ if (func[i] === 'C') { // constructor
+ parts.push(parts[parts.length-1]);
+ i += 2;
+ continue;
+ }
+ var size = parseInt(func.substr(i));
+ var pre = size.toString().length;
+ if (!size || !pre) { i--; break; } // counter i++ below us
+ var curr = func.substr(i + pre, size);
+ parts.push(curr);
+ subs.push(curr);
+ i += pre + size;
+ }
+ i++; // skip E
+ return parts;
+ }
+ function parse(rawList, limit, allowVoid) { // main parser
+ limit = limit || Infinity;
+ var ret = '', list = [];
+ function flushList() {
+ return '(' + list.join(', ') + ')';
+ }
+ var name;
+ if (func[i] === 'N') {
+ // namespaced N-E
+ name = parseNested().join('::');
+ limit--;
+ if (limit === 0) return rawList ? [name] : name;
+ } else {
+ // not namespaced
+ if (func[i] === 'K' || (first && func[i] === 'L')) i++; // ignore const and first 'L'
+ var size = parseInt(func.substr(i));
+ if (size) {
+ var pre = size.toString().length;
+ name = func.substr(i + pre, size);
+ i += pre + size;
+ }
+ }
+ first = false;
+ if (func[i] === 'I') {
+ i++;
+ var iList = parse(true);
+ var iRet = parse(true, 1, true);
+ ret += iRet[0] + ' ' + name + '<' + iList.join(', ') + '>';
+ } else {
+ ret = name;
+ }
+ paramLoop: while (i < func.length && limit-- > 0) {
+ //dump('paramLoop');
+ var c = func[i++];
+ if (c in basicTypes) {
+ list.push(basicTypes[c]);
+ } else {
+ switch (c) {
+ case 'P': list.push(parse(true, 1, true)[0] + '*'); break; // pointer
+ case 'R': list.push(parse(true, 1, true)[0] + '&'); break; // reference
+ case 'L': { // literal
+ i++; // skip basic type
+ var end = func.indexOf('E', i);
+ var size = end - i;
+ list.push(func.substr(i, size));
+ i += size + 2; // size + 'EE'
+ break;
+ }
+ case 'A': { // array
+ var size = parseInt(func.substr(i));
+ i += size.toString().length;
+ if (func[i] !== '_') throw '?';
+ i++; // skip _
+ list.push(parse(true, 1, true)[0] + ' [' + size + ']');
+ break;
+ }
+ case 'E': break paramLoop;
+ default: ret += '?' + c; break paramLoop;
+ }
+ }
+ }
+ if (!allowVoid && list.length === 1 && list[0] === 'void') list = []; // avoid (void)
+ if (rawList) {
+ if (ret) {
+ list.push(ret + '?');
+ }
+ return list;
+ } else {
+ return ret + flushList();
+ }
+ }
+ var parsed = func;
+ try {
+ // Special-case the entry point, since its name differs from other name mangling.
+ if (func == 'Object._main' || func == '_main') {
+ return 'main()';
+ }
+ if (typeof func === 'number') func = Pointer_stringify(func);
+ if (func[0] !== '_') return func;
+ if (func[1] !== '_') return func; // C function
+ if (func[2] !== 'Z') return func;
+ switch (func[3]) {
+ case 'n': return 'operator new()';
+ case 'd': return 'operator delete()';
+ }
+ parsed = parse();
+ } catch(e) {
+ parsed += '?';
+ }
+ if (parsed.indexOf('?') >= 0 && !hasLibcxxabi) {
+ Runtime.warnOnce('warning: a problem occurred in builtin C++ name demangling; build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling');
+ }
+ return parsed;
+}
+
+function demangleAll(text) {
+ return text.replace(/__Z[\w\d_]+/g, function(x) { var y = demangle(x); return x === y ? x : (x + ' [' + y + ']') });
+}
+
+function jsStackTrace() {
+ var err = new Error();
+ if (!err.stack) {
+ // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
+ // so try that as a special-case.
+ try {
+ throw new Error(0);
+ } catch(e) {
+ err = e;
+ }
+ if (!err.stack) {
+ return '(no stack trace available)';
+ }
+ }
+ return err.stack.toString();
+}
+
+function stackTrace() {
+ return demangleAll(jsStackTrace());
+}
+Module["stackTrace"] = stackTrace;
+
+// Memory management
+
+var PAGE_SIZE = 4096;
+
+function alignMemoryPage(x) {
+ if (x % 4096 > 0) {
+ x += (4096 - (x % 4096));
+ }
+ return x;
+}
+
+var HEAP;
+var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
+
+var STATIC_BASE = 0, STATICTOP = 0, staticSealed = false; // static area
+var STACK_BASE = 0, STACKTOP = 0, STACK_MAX = 0; // stack area
+var DYNAMIC_BASE = 0, DYNAMICTOP = 0; // dynamic area handled by sbrk
+
+
+function abortOnCannotGrowMemory() {
+ abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
+}
+
+function enlargeMemory() {
+ abortOnCannotGrowMemory();
+}
+
+
+var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
+var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 67108864;
+
+var totalMemory = 64*1024;
+while (totalMemory < TOTAL_MEMORY || totalMemory < 2*TOTAL_STACK) {
+ if (totalMemory < 16*1024*1024) {
+ totalMemory *= 2;
+ } else {
+ totalMemory += 16*1024*1024
+ }
+}
+if (totalMemory !== TOTAL_MEMORY) {
+ TOTAL_MEMORY = totalMemory;
+}
+
+// Initialize the runtime's memory
+// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
+assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']),
+ 'JS engine does not provide full typed array support');
+
+var buffer;
+
+
+
+buffer = new ArrayBuffer(TOTAL_MEMORY);
+HEAP8 = new Int8Array(buffer);
+HEAP16 = new Int16Array(buffer);
+HEAP32 = new Int32Array(buffer);
+HEAPU8 = new Uint8Array(buffer);
+HEAPU16 = new Uint16Array(buffer);
+HEAPU32 = new Uint32Array(buffer);
+HEAPF32 = new Float32Array(buffer);
+HEAPF64 = new Float64Array(buffer);
+
+
+// Endianness check (note: assumes compiler arch was little-endian)
+HEAP32[0] = 255;
+assert(HEAPU8[0] === 255 && HEAPU8[3] === 0, 'Typed arrays 2 must be run on a little-endian system');
+
+Module['HEAP'] = HEAP;
+Module['buffer'] = buffer;
+Module['HEAP8'] = HEAP8;
+Module['HEAP16'] = HEAP16;
+Module['HEAP32'] = HEAP32;
+Module['HEAPU8'] = HEAPU8;
+Module['HEAPU16'] = HEAPU16;
+Module['HEAPU32'] = HEAPU32;
+Module['HEAPF32'] = HEAPF32;
+Module['HEAPF64'] = HEAPF64;
+
+function callRuntimeCallbacks(callbacks) {
+ while(callbacks.length > 0) {
+ var callback = callbacks.shift();
+ if (typeof callback == 'function') {
+ callback();
+ continue;
+ }
+ var func = callback.func;
+ if (typeof func === 'number') {
+ if (callback.arg === undefined) {
+ Runtime.dynCall('v', func);
+ } else {
+ Runtime.dynCall('vi', func, [callback.arg]);
+ }
+ } else {
+ func(callback.arg === undefined ? null : callback.arg);
+ }
+ }
+}
+
+var __ATPRERUN__ = []; // functions called before the runtime is initialized
+var __ATINIT__ = []; // functions called during startup
+var __ATMAIN__ = []; // functions called when main() is to be run
+var __ATEXIT__ = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the runtime has exited
+
+var runtimeInitialized = false;
+var runtimeExited = false;
+
+
+function preRun() {
+ // compatibility - merge in anything from Module['preRun'] at this time
+ if (Module['preRun']) {
+ if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+ while (Module['preRun'].length) {
+ addOnPreRun(Module['preRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function ensureInitRuntime() {
+ if (runtimeInitialized) return;
+ runtimeInitialized = true;
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+ callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+ callRuntimeCallbacks(__ATEXIT__);
+ runtimeExited = true;
+}
+
+function postRun() {
+ // compatibility - merge in anything from Module['postRun'] at this time
+ if (Module['postRun']) {
+ if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+ while (Module['postRun'].length) {
+ addOnPostRun(Module['postRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+Module["addOnPreRun"] = addOnPreRun;
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+Module["addOnInit"] = addOnInit;
+
+function addOnPreMain(cb) {
+ __ATMAIN__.unshift(cb);
+}
+Module["addOnPreMain"] = addOnPreMain;
+
+function addOnExit(cb) {
+ __ATEXIT__.unshift(cb);
+}
+Module["addOnExit"] = addOnExit;
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+Module["addOnPostRun"] = addOnPostRun;
+
+// Tools
+
+
+function intArrayFromString(stringy, dontAddNull, length /* optional */) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+Module["intArrayFromString"] = intArrayFromString;
+
+function intArrayToString(array) {
+ var ret = [];
+ for (var i = 0; i < array.length; i++) {
+ var chr = array[i];
+ if (chr > 0xFF) {
+ chr &= 0xFF;
+ }
+ ret.push(String.fromCharCode(chr));
+ }
+ return ret.join('');
+}
+Module["intArrayToString"] = intArrayToString;
+
+function writeStringToMemory(string, buffer, dontAddNull) {
+ var array = intArrayFromString(string, dontAddNull);
+ var i = 0;
+ while (i < array.length) {
+ var chr = array[i];
+ HEAP8[(((buffer)+(i))>>0)]=chr;
+ i = i + 1;
+ }
+}
+Module["writeStringToMemory"] = writeStringToMemory;
+
+function writeArrayToMemory(array, buffer) {
+ for (var i = 0; i < array.length; i++) {
+ HEAP8[((buffer++)>>0)]=array[i];
+ }
+}
+Module["writeArrayToMemory"] = writeArrayToMemory;
+
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+ for (var i = 0; i < str.length; ++i) {
+ HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
+ }
+ // Null-terminate the pointer to the HEAP.
+ if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
+}
+Module["writeAsciiToMemory"] = writeAsciiToMemory;
+
+function unSign(value, bits, ignore) {
+ if (value >= 0) {
+ return value;
+ }
+ return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
+ : Math.pow(2, bits) + value;
+}
+function reSign(value, bits, ignore) {
+ if (value <= 0) {
+ return value;
+ }
+ var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
+ : Math.pow(2, bits-1);
+ if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
+ // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
+ // TODO: In i64 mode 1, resign the two parts separately and safely
+ value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
+ }
+ return value;
+}
+
+
+// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
+if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
+ var ah = a >>> 16;
+ var al = a & 0xffff;
+ var bh = b >>> 16;
+ var bl = b & 0xffff;
+ return (al*bl + ((ah*bl + al*bh) << 16))|0;
+};
+Math.imul = Math['imul'];
+
+
+if (!Math['clz32']) Math['clz32'] = function(x) {
+ x = x >>> 0;
+ for (var i = 0; i < 32; i++) {
+ if (x & (1 << (31 - i))) return i;
+ }
+ return 32;
+};
+Math.clz32 = Math['clz32']
+
+var Math_abs = Math.abs;
+var Math_cos = Math.cos;
+var Math_sin = Math.sin;
+var Math_tan = Math.tan;
+var Math_acos = Math.acos;
+var Math_asin = Math.asin;
+var Math_atan = Math.atan;
+var Math_atan2 = Math.atan2;
+var Math_exp = Math.exp;
+var Math_log = Math.log;
+var Math_sqrt = Math.sqrt;
+var Math_ceil = Math.ceil;
+var Math_floor = Math.floor;
+var Math_pow = Math.pow;
+var Math_imul = Math.imul;
+var Math_fround = Math.fround;
+var Math_min = Math.min;
+var Math_clz32 = Math.clz32;
+
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+
+function getUniqueRunDependency(id) {
+ return id;
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+}
+Module["addRunDependency"] = addRunDependency;
+
+function removeRunDependency(id) {
+ runDependencies--;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+}
+Module["removeRunDependency"] = removeRunDependency;
+
+Module["preloadedImages"] = {}; // maps url to image data
+Module["preloadedAudios"] = {}; // maps url to audio data
+
+
+
+var memoryInitializer = null;
+
+
+
+// === Body ===
+
+var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }];
+
+function _emscripten_asm_const_2(code, a0, a1) {
+ return ASM_CONSTS[code](a0, a1);
+}
+
+
+
+STATIC_BASE = 8;
+
+STATICTOP = STATIC_BASE + 24304;
+ /* global initializers */ __ATINIT__.push();
+
+
+/* memory initializer */ allocate([0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,3,0,0,194,1,0,0,0,0,64,64,0,0,64,64,0,0,64,64,0,0,0,0,0,0,192,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,52,66,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,1], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
+/* memory initializer */ allocate([128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,0,0,0,0,20,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,3,0,0,0,7,0,0,0,15,0,0,0,31,0,0,0,63,0,0,0,127,0,0,0,255,0,0,0,255,1,0,0,255,3,0,0,255,7,0,0,255,15,0,0,255,31,0,0,255,63,0,0,255,127,0,0,255,255,0,0,0,0,0,0,255,255,255,255,253,255,255,255,249,255,255,255,241,255,255,255,225,255,255,255,193,255,255,255,129,255,255,255,1,255,255,255,1,254,255,255,1,252,255,255,1,248,255,255,1,240,255,255,1,224,255,255,1,192,255,255,1,128,255,255,1,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,184,26,0,0,184,26,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,4,0,0,0,222,88,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,114,97,121,108,105,98,32,91,109,111,100,101,108,115,93,32,101,120,97,109,112,108,101,32,45,32,111,98,106,32,109,111,100,101,108,32,108,111,97,100,105,110,103,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,46,111,98,106,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,95,100,105,102,102,117,115,101,46,112,110,103,0,40,99,41,32,68,119,97,114,102,32,51,68,32,109,111,100,101,108,32,98,121,32,68,97,118,105,100,32,77,111,114,101,110,111,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,53,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+1998);
+/* memory initializer */ allocate([83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,118,101,114,116,101,120,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,91,86,65,79,32,73,68,32,37,105,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,115,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,109,111,100,101,108,77,97,116,114,105,120,0,118,105,101,119,68,105,114,0,99,111,108,65,109,98,105,101,110,116,0,99,111,108,83,112,101,99,117,108,97,114,0,103,108,111,115,115,105,110,101,115,115,0,117,115,101,78,111,114,109,97,108,0,117,115,101,83,112,101,99,117,108,97,114,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,108,111,99,97,116,105,111,110,32,102,111,114,32,37,115,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,99,97,110,39,116,32,102,111,112,101,110,0,112,110,103,0,98,109,112,0,116,103,97,0,106,112,103,0,103,105,102,0,112,115,100,0,112,105,99,0,100,100,115,0,112,107,109,0,107,116,120,0,112,118,114,0,97,115,116,99,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,102,105,108,101,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,114,98,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,37,50,46,48,102,32,70,80,83,0,111,98,106,0,91,37,115,93,32,77,111,100,101,108,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,77,111,100,101,108,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,82,65,77,32,97,110,100,32,86,82,65,77,0,73,78,70,79,58,32,0,69,82,82,79,82,58,32,0,87,65,82,78,73,78,71,58,32,0,114,116,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,65,83,84,67,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,98,108,111,99,107,115,58,32,37,105,120,37,105,0,91,37,115,93,32,65,83,84,67,32,98,108,111,99,107,32,115,105,122,101,32,99,111,110,102,105,103,117,114,97,116,105,111,110,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,86,82,32,118,50,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,117,112,100,97,116,101,32,121,111,117,114,32,102,105,108,101,115,32,116,111,32,80,86,82,32,118,51,0,91,37,115,93,32,75,84,88,32,105,109,97,103,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,75,84,88,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,102,105,108,101,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,80,75,77,32,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,68,68,83,32,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,104,101,97,100,101,114,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,102,108,97,103,115,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,98,105,116,32,99,111,117,110,116,58,32,48,120,37,120,0,80,105,116,99,104,32,111,114,32,108,105,110,101,97,114,32,115,105,122,101,58,32,37,105,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,109,97,120,32,118,97,108,117,101,32,62,32,50,53,53,0,83,128,246,52,0,110,111,116,32,66,77,80,0,117,110,107,110,111,119,110,32,66,77,80,0,98,97,100,32,66,77,80,0,109,111,110,111,99,104,114,111,109,101,0,66,77,80,32,82,76,69,0,110,111,116,32,71,73,70,0,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,47,49,54,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,109,101,109,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,49,54,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,109,103,95,110,32,61,61,32,51,0,98,97,100,32,112,110,103,32,115,105,103,0,110,111,32,83,79,73,0,110,111,32,83,79,70,0,98,97,100,32,83,79,70,32,108,101,110,0,111,110,108,121,32,56,45,98,105,116,0,110,111,32,104,101,97,100,101,114,32,104,101,105,103,104,116,0,48,32,119,105,100,116,104,0,98,97,100,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,82,71,66,98,97,100,32,99,111,109,112,111,110,101,110,116,32,73,68,0,98,97,100,32,72,0,98,97,100,32,86,0,98,97,100,32,84,81,0,101,120,112,101,99,116,101,100,32,109,97,114,107,101,114,0,98,97,100,32,68,82,73,32,108,101,110,0,98,97,100,32,68,81,84,32,116,121,112,101,0,98,97,100,32,68,81,84,32,116,97,98,108,101,0,0,1,8,16,9,2,3,10,17,24,32,25,18,11,4,5,12,19,26,33,40,48,41,34,27,20,13,6,7,14,21,28,35,42,49,56,57,50,43,36,29,22,15,23,30,37,44,51,58,59,52,45,38,31,39,46,53,60,61,54,47,55,62,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,98,97,100,32,68,72,84,32,104,101,97,100,101,114,0,98,97,100,32,99,111,100,101,32,108,101,110,103,116,104,115,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,114,101,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,102,111,114,109,97,116,0,116,103,97,95,99,111,109,112,32,61,61,32,83,84,66,73,95,114,103,98,0,115,116,98,105,95,95,116,103,97,95,108,111,97,100,0,98,97,100,32,112,97,108,101,116,116,101,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,48,0,98,97,100,32,102,105,108,101,0,80,73,67,84,0,110,111,116,32,80,83,68,0,119,114,111,110,103,32,118,101,114,115,105,111,110,0,119,114,111,110,103,32,99,104,97,110,110,101,108,32,99,111,117,110,116,0,117,110,115,117,112,112,111,114,116,101,100,32,98,105,116,32,100,101,112,116,104,0,119,114,111,110,103,32,99,111,108,111,114,32,102,111,114,109,97,116,0,98,97,100,32,73,109,97,103,101,32,68,101,115,99,114,105,112,116,111,114,0,109,105,115,115,105,110,103,32,99,111,108,111,114,32,116,97,98,108,101,0,117,110,107,110,111,119,110,32,99,111,100,101,0,110,111,32,99,108,101,97,114,32,99,111,100,101,0,116,111,111,32,109,97,110,121,32,99,111,100,101,115,0,105,108,108,101,103,97,108,32,99,111,100,101,32,105,110,32,114,97,115,116,101,114,0,105,110,118,97,108,105,100,0,98,97,100,32,98,112,112,0,98,97,100,32,109,97,115,107,115,0,98,97,100,32,114,101,113,95,99,111,109,112,0,106,117,110,107,32,98,101,102,111,114,101,32,109,97,114,107,101,114,0,99,97,110,39,116,32,109,101,114,103,101,32,100,99,32,97,110,100,32,97,99,0,110,32,62,61,32,48,32,38,38,32,110,32,60,32,40,105,110,116,41,32,40,115,105,122,101,111,102,40,115,116,98,105,95,95,98,109,97,115,107,41,47,115,105,122,101,111,102,40,42,115,116,98,105,95,95,98,109,97,115,107,41,41,0,115,116,98,105,95,95,101,120,116,101,110,100,95,114,101,99,101,105,118,101,0,40,40,40,106,45,62,99,111,100,101,95,98,117,102,102,101,114,41,32,62,62,32,40,51,50,32,45,32,104,45,62,115,105,122,101,91,99,93,41,41,32,38,32,115,116,98,105,95,95,98,109,97,115,107,91,104,45,62,115,105,122,101,91,99,93,93,41,32,61,61,32,104,45,62,99,111,100,101,91,99,93,0,115,116,98,105,95,95,106,112,101,103,95,104,117,102,102,95,100,101,99,111,100,101,0,98,97,100,32,83,79,83,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,98,97,100,32,83,79,83,32,108,101,110,0,98,97,100,32,68,67,32,104,117,102,102,0,98,97,100,32,65,67,32,104,117,102,102,0,98,97,100,32,83,79,83,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,77,97,116,114,105,120,0,99,111,108,68,105,102,102,117,115,101,0,116,101,120,116,117,114,101,48,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,108,105,103,104,116,115,91,120,93,46,112,111,115,105,116,105,111,110,0,0,0,0,0,0,0,0,0,0,0,0,0,0,116,121,112,101,0,0,100,105,102,102,117,115,101,0,0,105,110,116,101,110,115,105,116,121,0,0,112,111,115,105,116,105,111,110,0,0,100,105,114,101,99,116,105,111,110,0,0,99,111,110,101,65,110,103,108,101,0,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+8718);
+/* memory initializer */ allocate([83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,114,119,97], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+18958);
+/* memory initializer */ allocate([17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,46,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+23766);
+
+
+
+
+
+/* no memory initializer */
+var tempDoublePtr = Runtime.alignMemory(allocate(12, "i8", ALLOC_STATIC), 8);
+
+assert(tempDoublePtr % 8 == 0);
+
+function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
+
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+}
+
+function copyTempDouble(ptr) {
+
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+ HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
+
+ HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
+
+ HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
+
+ HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
+
+}
+
+// {{PRE_LIBRARY}}
+
+
+
+ var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},packAlignment:4,unpackAlignment:4,init:function () {
+ GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
+ for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
+ GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
+ }
+ },recordError:function recordError(errorCode) {
+ if (!GL.lastError) {
+ GL.lastError = errorCode;
+ }
+ },getNewId:function (table) {
+ var ret = GL.counter++;
+ for (var i = table.length; i < ret; i++) {
+ table[i] = null;
+ }
+ return ret;
+ },MINI_TEMP_BUFFER_SIZE:16,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
+ var source = '';
+ for (var i = 0; i < count; ++i) {
+ var frag;
+ if (length) {
+ var len = HEAP32[(((length)+(i*4))>>2)];
+ if (len < 0) {
+ frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
+ } else {
+ frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
+ }
+ } else {
+ frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
+ }
+ source += frag;
+ }
+ return source;
+ },createContext:function (canvas, webGLContextAttributes) {
+ if (typeof webGLContextAttributes.majorVersion === 'undefined' && typeof webGLContextAttributes.minorVersion === 'undefined') {
+ webGLContextAttributes.majorVersion = 1;
+ webGLContextAttributes.minorVersion = 0;
+ }
+ var ctx;
+ var errorInfo = '?';
+ function onContextCreationError(event) {
+ errorInfo = event.statusMessage || errorInfo;
+ }
+ try {
+ canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
+ try {
+ if (webGLContextAttributes.majorVersion == 1 && webGLContextAttributes.minorVersion == 0) {
+ ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
+ } else if (webGLContextAttributes.majorVersion == 2 && webGLContextAttributes.minorVersion == 0) {
+ ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
+ } else {
+ throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
+ }
+ } finally {
+ canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
+ }
+ if (!ctx) throw ':(';
+ } catch (e) {
+ Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
+ return 0;
+ }
+ // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
+
+ if (!ctx) return 0;
+ return GL.registerContext(ctx, webGLContextAttributes);
+ },registerContext:function (ctx, webGLContextAttributes) {
+ var handle = GL.getNewId(GL.contexts);
+ var context = {
+ handle: handle,
+ version: webGLContextAttributes.majorVersion,
+ GLctx: ctx
+ };
+ // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
+ if (ctx.canvas) ctx.canvas.GLctxObject = context;
+ GL.contexts[handle] = context;
+ if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) {
+ GL.initExtensions(context);
+ }
+ return handle;
+ },makeContextCurrent:function (contextHandle) {
+ var context = GL.contexts[contextHandle];
+ if (!context) return false;
+ GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
+ GL.currentContext = context; // Active Emscripten GL layer context object.
+ return true;
+ },getContext:function (contextHandle) {
+ return GL.contexts[contextHandle];
+ },deleteContext:function (contextHandle) {
+ if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
+ if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
+ if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
+ GL.contexts[contextHandle] = null;
+ },initExtensions:function (context) {
+ // If this function is called without a specific context object, init the extensions of the currently active context.
+ if (!context) context = GL.currentContext;
+
+ if (context.initExtensionsDone) return;
+ context.initExtensionsDone = true;
+
+ var GLctx = context.GLctx;
+
+ context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
+
+ // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
+
+ if (context.version < 2) {
+ // Extension available from Firefox 26 and Google Chrome 30
+ var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
+ if (instancedArraysExt) {
+ GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
+ GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
+ GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
+ }
+
+ // Extension available from Firefox 25 and WebKit
+ var vaoExt = GLctx.getExtension('OES_vertex_array_object');
+ if (vaoExt) {
+ GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
+ GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
+ GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
+ GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
+ }
+
+ var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
+ if (drawBuffersExt) {
+ GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
+ }
+ }
+
+ // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
+ // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
+ // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
+ // here, as long as they don't produce a performance impact for users that might not be using those extensions.
+ // E.g. debugging-related extensions should probably be off by default.
+ var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
+ "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
+ "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
+ "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
+ "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
+ "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
+ "EXT_shader_texture_lod" ];
+
+ function shouldEnableAutomatically(extension) {
+ var ret = false;
+ automaticallyEnabledExtensions.forEach(function(include) {
+ if (ext.indexOf(include) != -1) {
+ ret = true;
+ }
+ });
+ return ret;
+ }
+
+ var exts = GLctx.getSupportedExtensions();
+ if (exts && exts.length > 0) {
+ GLctx.getSupportedExtensions().forEach(function(ext) {
+ if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
+ GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
+ }
+ });
+ }
+ },populateUniformTable:function (program) {
+ var p = GL.programs[program];
+ GL.programInfos[program] = {
+ uniforms: {},
+ maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
+ maxAttributeLength: -1 // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
+ };
+
+ var ptable = GL.programInfos[program];
+ var utable = ptable.uniforms;
+ // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
+ // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
+ var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
+ for (var i = 0; i < numUniforms; ++i) {
+ var u = GLctx.getActiveUniform(p, i);
+
+ var name = u.name;
+ ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
+
+ // Strip off any trailing array specifier we might have got, e.g. "[0]".
+ if (name.indexOf(']', name.length-1) !== -1) {
+ var ls = name.lastIndexOf('[');
+ name = name.slice(0, ls);
+ }
+
+ // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
+ // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
+ // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
+ var loc = GLctx.getUniformLocation(p, name);
+ var id = GL.getNewId(GL.uniforms);
+ utable[name] = [u.size, id];
+ GL.uniforms[id] = loc;
+
+ for (var j = 1; j < u.size; ++j) {
+ var n = name + '['+j+']';
+ loc = GLctx.getUniformLocation(p, n);
+ id = GL.getNewId(GL.uniforms);
+
+ GL.uniforms[id] = loc;
+ }
+ }
+ }};function _emscripten_glIsRenderbuffer(renderbuffer) {
+ var rb = GL.renderbuffers[renderbuffer];
+ if (!rb) return 0;
+ return GLctx.isRenderbuffer(rb);
+ }
+
+ function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx.stencilMaskSeparate(x0, x1) }
+
+
+
+ function _emscripten_get_now() {
+ if (!_emscripten_get_now.actual) {
+ if (ENVIRONMENT_IS_NODE) {
+ _emscripten_get_now.actual = function _emscripten_get_now_actual() {
+ var t = process['hrtime']();
+ return t[0] * 1e3 + t[1] / 1e6;
+ }
+ } else if (typeof dateNow !== 'undefined') {
+ _emscripten_get_now.actual = dateNow;
+ } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
+ _emscripten_get_now.actual = function _emscripten_get_now_actual() { return self['performance']['now'](); };
+ } else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
+ _emscripten_get_now.actual = function _emscripten_get_now_actual() { return performance['now'](); };
+ } else {
+ _emscripten_get_now.actual = Date.now;
+ }
+ }
+ return _emscripten_get_now.actual();
+ }var GLFW={Window:function (id, width, height, title, monitor, share) {
+ this.id = id;
+ this.x = 0;
+ this.y = 0;
+ this.storedX = 0; // Used to store X before fullscreen
+ this.storedY = 0; // Used to store Y before fullscreen
+ this.width = width;
+ this.height = height;
+ this.storedWidth = width; // Used to store width before fullscreen
+ this.storedHeight = height; // Used to store height before fullscreen
+ this.title = title;
+ this.monitor = monitor;
+ this.share = share;
+ this.attributes = GLFW.hints;
+ this.inputModes = {
+ 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
+ 0x00033002:0, // GLFW_STICKY_KEYS
+ 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
+ };
+ this.buttons = 0;
+ this.keys = new Array();
+ this.shouldClose = 0;
+ this.title = null;
+ this.windowPosFunc = null; // GLFWwindowposfun
+ this.windowSizeFunc = null; // GLFWwindowsizefun
+ this.windowCloseFunc = null; // GLFWwindowclosefun
+ this.windowRefreshFunc = null; // GLFWwindowrefreshfun
+ this.windowFocusFunc = null; // GLFWwindowfocusfun
+ this.windowIconifyFunc = null; // GLFWwindowiconifyfun
+ this.framebufferSizeFunc = null; // GLFWframebuffersizefun
+ this.mouseButtonFunc = null; // GLFWmousebuttonfun
+ this.cursorPosFunc = null; // GLFWcursorposfun
+ this.cursorEnterFunc = null; // GLFWcursorenterfun
+ this.scrollFunc = null; // GLFWscrollfun
+ this.keyFunc = null; // GLFWkeyfun
+ this.charFunc = null; // GLFWcharfun
+ this.userptr = null;
+ },WindowFromId:function (id) {
+ if (id <= 0 || !GLFW.windows) return null;
+ return GLFW.windows[id - 1];
+ },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
+ switch (keycode) {
+ case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
+ case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
+ case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
+ case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
+ case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
+ case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
+ case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
+ case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
+ case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
+ case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
+ case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
+ case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
+ case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
+ case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
+ case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
+ case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
+ case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
+ case 0x61:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+ case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
+ case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
+ case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
+ case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
+ case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
+ case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
+ case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
+ case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
+ case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
+ case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
+ case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
+ case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
+ case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
+ case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
+ case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
+ case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
+ case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
+ case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
+ case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
+ case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
+ case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
+ case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
+ case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
+ case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
+ case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
+ case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
+ case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
+ case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
+ case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
+ case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
+ case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
+ case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
+ case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
+ case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
+ case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
+ case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
+ case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
+ case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
+ case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
+ case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
+ case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
+ case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
+ case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
+ case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
+ case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
+ case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
+ case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
+ case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
+ case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
+ case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
+ case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
+ case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
+ case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
+ case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
+ case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
+ case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
+ case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
+ case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
+ case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
+ case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
+ case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
+ case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
+ case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
+ case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
+ case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
+ case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
+ case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
+ case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
+ case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
+ case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
+ case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
+ case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
+ case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
+ case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
+ case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
+ case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
+ case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
+ case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
+ case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
+ case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
+ case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
+ case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
+ case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
+ case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
+ case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
+ case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
+ case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
+ case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
+ case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
+ // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
+ // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
+ case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
+ case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
+ case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
+ case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
+ // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
+ // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
+ // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
+ // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
+ case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
+
+ // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
+ default:return -1; // GLFW_KEY_UNKNOWN
+ };
+ },getModBits:function (win) {
+ var mod = 0;
+ if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
+ if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
+ if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
+ if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
+ return mod;
+ },onKeyPress:function (event) {
+ if (!GLFW.active || !GLFW.active.charFunc) return;
+
+ // correct unicode charCode is only available with onKeyPress event
+ var charCode = event.charCode;
+ if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
+
+
+ Runtime.dynCall('vii', GLFW.active.charFunc, [GLFW.active.id, charCode]);
+ },onKeyChanged:function (event, status) {
+ if (!GLFW.active) return;
+
+ var key = GLFW.DOMToGLFWKeyCode(event.keyCode);
+ if (key == -1) return;
+
+ GLFW.active.keys[key] = status;
+ if (!GLFW.active.keyFunc) return;
+
+
+ Runtime.dynCall('viiiii', GLFW.active.keyFunc, [GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active)]);
+ },onKeydown:function (event) {
+ GLFW.onKeyChanged(event, 1); // GLFW_PRESS
+
+ // This logic comes directly from the sdl implementation. We cannot
+ // call preventDefault on all keydown events otherwise onKeyPress will
+ // not get called
+ if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
+ event.preventDefault();
+ }
+ },onKeyup:function (event) {
+ GLFW.onKeyChanged(event, 0); // GLFW_RELEASE
+ },onMousemove:function (event) {
+ if (!GLFW.active) return;
+
+ Browser.calculateMouseEvent(event);
+
+ if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
+
+
+ Runtime.dynCall('vidd', GLFW.active.cursorPosFunc, [GLFW.active.id, Browser.mouseX, Browser.mouseY]);
+ },onMouseButtonChanged:function (event, status) {
+ if (!GLFW.active || !GLFW.active.mouseButtonFunc) return;
+
+ Browser.calculateMouseEvent(event);
+
+ if (event.target != Module["canvas"]) return;
+
+ if (status == 1) { // GLFW_PRESS
+ try {
+ event.target.setCapture();
+ } catch (e) {}
+ }
+
+ // DOM and glfw have different button codes
+ var eventButton = event['button'];
+ if (eventButton > 0) {
+ if (eventButton == 1) {
+ eventButton = 2;
+ } else {
+ eventButton = 1;
+ }
+ }
+
+
+ Runtime.dynCall('viiii', GLFW.active.mouseButtonFunc, [GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)]);
+ },onMouseButtonDown:function (event) {
+ if (!GLFW.active) return;
+ GLFW.active.buttons |= (1 << event['button']);
+ GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
+ },onMouseButtonUp:function (event) {
+ if (!GLFW.active) return;
+ GLFW.active.buttons &= ~(1 << event['button']);
+ GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
+ },onMouseWheel:function (event) {
+ // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
+ var delta = -Browser.getMouseWheelDelta(event);
+ delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
+ GLFW.wheelPos += delta;
+
+ if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
+
+
+ var sx = 0;
+ var sy = 0;
+ if (event.type == 'mousewheel') {
+ sx = event.wheelDeltaX;
+ sy = event.wheelDeltaY;
+ } else {
+ sx = event.deltaX;
+ sy = event.deltaY;
+ }
+
+ Runtime.dynCall('vidd', GLFW.active.scrollFunc, [GLFW.active.id, sx, sy]);
+
+ event.preventDefault();
+ },onFullScreenEventChange:function () {
+ if (!GLFW.active) return;
+
+ if (document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
+ GLFW.active.storedX = GLFW.active.x;
+ GLFW.active.storedY = GLFW.active.y;
+ GLFW.active.storedWidth = GLFW.active.width;
+ GLFW.active.storedHeight = GLFW.active.height;
+ GLFW.active.x = GLFW.active.y = 0;
+ GLFW.active.width = screen.width;
+ GLFW.active.height = screen.height;
+ } else {
+ GLFW.active.x = GLFW.active.storedX;
+ GLFW.active.y = GLFW.active.storedY;
+ GLFW.active.width = GLFW.active.storedWidth;
+ GLFW.active.height = GLFW.active.storedHeight;
+ }
+
+ Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
+
+ if (!GLFW.active.windowSizeFunc) return;
+
+
+ Runtime.dynCall('viii', GLFW.active.windowSizeFunc, [GLFW.active.id, GLFW.active.width, GLFW.active.height]);
+ },requestFullScreen:function () {
+ var RFS = Module["canvas"]['requestFullscreen'] ||
+ Module["canvas"]['requestFullScreen'] ||
+ Module["canvas"]['mozRequestFullScreen'] ||
+ Module["canvas"]['webkitRequestFullScreen'] ||
+ (function() {});
+ RFS.apply(Module["canvas"], []);
+ },cancelFullScreen:function () {
+ var CFS = document['exitFullscreen'] ||
+ document['cancelFullScreen'] ||
+ document['mozCancelFullScreen'] ||
+ document['webkitCancelFullScreen'] ||
+ (function() {});
+ CFS.apply(document, []);
+ },getTime:function () {
+ return _emscripten_get_now() / 1000;
+ },setWindowTitle:function (winid, title) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ win.title = Pointer_stringify(title);
+ if (GLFW.active.id == win.id) {
+ document.title = win.title;
+ }
+ },setKeyCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.keyFunc = cbfun;
+ },setCharCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.charFunc = cbfun;
+ },setMouseButtonCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.mouseButtonFunc = cbfun;
+ },setCursorPosCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.cursorPosFunc = cbfun;
+ },setScrollCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.scrollFunc = cbfun;
+ },setWindowSizeCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowSizeFunc = cbfun;
+ },setWindowCloseCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowCloseFunc = cbfun;
+ },setWindowRefreshCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowRefreshFunc = cbfun;
+ },getKey:function (winid, key) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return win.keys[key];
+ },getMouseButton:function (winid, button) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return (win.buttons & (1 << button)) > 0;
+ },getCursorPos:function (winid, x, y) {
+ setValue(x, Browser.mouseX, 'double');
+ setValue(y, Browser.mouseY, 'double');
+ },getMousePos:function (winid, x, y) {
+ setValue(x, Browser.mouseX, 'i32');
+ setValue(y, Browser.mouseY, 'i32');
+ },setCursorPos:function (winid, x, y) {
+ },getWindowPos:function (winid, x, y) {
+ var wx = 0;
+ var wy = 0;
+
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ wx = win.x;
+ wy = win.y;
+ }
+
+ setValue(x, wx, 'i32');
+ setValue(y, wy, 'i32');
+ },setWindowPos:function (winid, x, y) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.x = x;
+ win.y = y;
+ },getWindowSize:function (winid, width, height) {
+ var ww = 0;
+ var wh = 0;
+
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ ww = win.width;
+ wh = win.height;
+ }
+
+ setValue(width, ww, 'i32');
+ setValue(height, wh, 'i32');
+ },setWindowSize:function (winid, width, height) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ if (GLFW.active.id == win.id) {
+ if (width == screen.width && height == screen.height) {
+ GLFW.requestFullScreen();
+ } else {
+ GLFW.cancelFullScreen();
+ Browser.setCanvasSize(width, height);
+ win.width = width;
+ win.height = height;
+ }
+ }
+
+ if (!win.windowResizeFunc) return;
+
+
+ Runtime.dynCall('viii', win.windowResizeFunc, [win.id, width, height]);
+ },createWindow:function (width, height, title, monitor, share) {
+ var i, id;
+ for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
+ if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
+
+ // id for window
+ id = i + 1;
+
+ // not valid
+ if (width <= 0 || height <= 0) return 0;
+
+ if (monitor) {
+ GLFW.requestFullScreen();
+ } else {
+ Browser.setCanvasSize(width, height);
+ }
+
+ // Create context when there are no existing alive windows
+ for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
+ if (i == GLFW.windows.length) {
+ var contextAttributes = {
+ antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
+ depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS
+ stencil: (GLFW.hints[0x00021006] > 0) // GLFW_STENCIL_BITS
+ }
+ Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
+ }
+
+ // If context creation failed, do not return a valid window
+ if (!Module.ctx) return 0;
+
+ // Get non alive id
+ var win = new GLFW.Window(id, width, height, title, monitor, share);
+
+ // Set window to array
+ if (id - 1 == GLFW.windows.length) {
+ GLFW.windows.push(win);
+ } else {
+ GLFW.windows[id - 1] = win;
+ }
+
+ GLFW.active = win;
+ return win.id;
+ },destroyWindow:function (winid) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ if (win.windowCloseFunc)
+ Runtime.dynCall('vi', win.windowCloseFunc, [win.id]);
+
+ GLFW.windows[win.id - 1] = null;
+ if (GLFW.active.id == win.id)
+ GLFW.active = null;
+
+ // Destroy context when no alive windows
+ for (var i = 0; i < GLFW.windows.length; i++)
+ if (GLFW.windows[i] !== null) return;
+
+ Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
+ },swapBuffers:function (winid) {
+ },GLFW2ParamToGLFW3Param:function (param) {
+ table = {
+ 0x00030001:0, // GLFW_MOUSE_CURSOR
+ 0x00030002:0, // GLFW_STICKY_KEYS
+ 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
+ 0x00030004:0, // GLFW_SYSTEM_KEYS
+ 0x00030005:0, // GLFW_KEY_REPEAT
+ 0x00030006:0, // GLFW_AUTO_POLL_EVENTS
+ 0x00020001:0, // GLFW_OPENED
+ 0x00020002:0, // GLFW_ACTIVE
+ 0x00020003:0, // GLFW_ICONIFIED
+ 0x00020004:0, // GLFW_ACCELERATED
+ 0x00020005:0x00021001, // GLFW_RED_BITS
+ 0x00020006:0x00021002, // GLFW_GREEN_BITS
+ 0x00020007:0x00021003, // GLFW_BLUE_BITS
+ 0x00020008:0x00021004, // GLFW_ALPHA_BITS
+ 0x00020009:0x00021005, // GLFW_DEPTH_BITS
+ 0x0002000A:0x00021006, // GLFW_STENCIL_BITS
+ 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
+ 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
+ 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
+ 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
+ 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
+ 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
+ 0x00020011:0x0002100C, // GLFW_STEREO
+ 0x00020012:0, // GLFW_WINDOW_NO_RESIZE
+ 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
+ 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
+ 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
+ 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
+ 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
+ 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
+ };
+ return table[param];
+ }};function _glfwGetVideoModes(monitor, count) {
+ setValue(count, 0, 'i32');
+ return 0;
+ }
+
+ function _glLinkProgram(program) {
+ GLctx.linkProgram(GL.programs[program]);
+ GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
+ GL.populateUniformTable(program);
+ }
+
+ function _glBindTexture(target, texture) {
+ GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
+ }
+
+ function _emscripten_glStencilFunc(x0, x1, x2) { GLctx.stencilFunc(x0, x1, x2) }
+
+ function _glGetString(name_) {
+ if (GL.stringCache[name_]) return GL.stringCache[name_];
+ var ret;
+ switch(name_) {
+ case 0x1F00 /* GL_VENDOR */:
+ case 0x1F01 /* GL_RENDERER */:
+ case 0x1F02 /* GL_VERSION */:
+ ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x1F03 /* GL_EXTENSIONS */:
+ var exts = GLctx.getSupportedExtensions();
+ var gl_exts = [];
+ for (var i in exts) {
+ gl_exts.push(exts[i]);
+ gl_exts.push("GL_" + exts[i]);
+ }
+ ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+ ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL);
+ break;
+ default:
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ return 0;
+ }
+ GL.stringCache[name_] = ret;
+ return ret;
+ }
+
+ function _emscripten_glUniform3iv(location, count, value) {
+ location = GL.uniforms[location];
+ count *= 3;
+ value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
+ GLctx.uniform3iv(location, value);
+ }
+
+ function _emscripten_glShaderSource(shader, count, string, length) {
+ var source = GL.getSource(shader, count, string, length);
+ GLctx.shaderSource(GL.shaders[shader], source);
+ }
+
+ function _emscripten_glReleaseShaderCompiler() {
+ // NOP (as allowed by GLES 2.0 spec)
+ }
+
+ function _glfwSetScrollCallback(winid, cbfun) {
+ GLFW.setScrollCallback(winid, cbfun);
+ }
+
+ function _emscripten_glTexParameterf(x0, x1, x2) { GLctx.texParameterf(x0, x1, x2) }
+
+ function _emscripten_glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) }
+
+ function _glCompileShader(shader) {
+ GLctx.compileShader(GL.shaders[shader]);
+ }
+
+
+
+
+ var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
+
+ var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
+
+ function ___setErrNo(value) {
+ if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
+ return value;
+ }
+
+ var PATH={splitPath:function (filename) {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },normalizeArray:function (parts, allowAboveRoot) {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === '.') {
+ parts.splice(i, 1);
+ } else if (last === '..') {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up--; up) {
+ parts.unshift('..');
+ }
+ }
+ return parts;
+ },normalize:function (path) {
+ var isAbsolute = path.charAt(0) === '/',
+ trailingSlash = path.substr(-1) === '/';
+ // Normalize the path
+ path = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), !isAbsolute).join('/');
+ if (!path && !isAbsolute) {
+ path = '.';
+ }
+ if (path && trailingSlash) {
+ path += '/';
+ }
+ return (isAbsolute ? '/' : '') + path;
+ },dirname:function (path) {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return '.';
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },basename:function (path) {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === '/') return '/';
+ var lastSlash = path.lastIndexOf('/');
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash+1);
+ },extname:function (path) {
+ return PATH.splitPath(path)[3];
+ },join:function () {
+ var paths = Array.prototype.slice.call(arguments, 0);
+ return PATH.normalize(paths.join('/'));
+ },join2:function (l, r) {
+ return PATH.normalize(l + '/' + r);
+ },resolve:function () {
+ var resolvedPath = '',
+ resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? arguments[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path !== 'string') {
+ throw new TypeError('Arguments to path.resolve must be strings');
+ } else if (!path) {
+ return ''; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + '/' + resolvedPath;
+ resolvedAbsolute = path.charAt(0) === '/';
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
+ return !!p;
+ }), !resolvedAbsolute).join('/');
+ return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+ },relative:function (from, to) {
+ from = PATH.resolve(from).substr(1);
+ to = PATH.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== '') break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== '') break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split('/'));
+ var toParts = trim(to.split('/'));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push('..');
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join('/');
+ }};
+
+ var TTY={ttys:[],init:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process['stdin']['setEncoding']('utf8');
+ // }
+ },shutdown:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process['stdin']['pause']();
+ // }
+ },register:function (dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },stream_ops:{open:function (stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },close:function (stream) {
+ // flush any pending line data
+ stream.tty.ops.flush(stream.tty);
+ },flush:function (stream) {
+ stream.tty.ops.flush(stream.tty);
+ },read:function (stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ for (var i = 0; i < length; i++) {
+ try {
+ stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }},default_tty_ops:{get_char:function (tty) {
+ if (!tty.input.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = new Buffer(BUFSIZE);
+ var bytesRead = 0;
+
+ var fd = process.stdin.fd;
+ // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
+ var usingDevice = false;
+ try {
+ fd = fs.openSync('/dev/stdin', 'r');
+ usingDevice = true;
+ } catch (e) {}
+
+ bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
+
+ if (usingDevice) { fs.closeSync(fd); }
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString('utf-8');
+ } else {
+ result = null;
+ }
+
+ } else if (typeof window != 'undefined' &&
+ typeof window.prompt == 'function') {
+ // Browser.
+ result = window.prompt('Input: '); // returns null on cancel
+ if (result !== null) {
+ result += '\n';
+ }
+ } else if (typeof readline == 'function') {
+ // Command line.
+ result = readline();
+ if (result !== null) {
+ result += '\n';
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ tty.input = intArrayFromString(result, true);
+ }
+ return tty.input.shift();
+ },put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ Module['print'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ Module['print'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }},default_tty1_ops:{put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ Module['printErr'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ Module['printErr'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }}};
+
+ var MEMFS={ops_table:null,mount:function (mount) {
+ return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.buffer.byteLength which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },getFileDataAsRegularArray:function (node) {
+ if (node.contents && node.contents.subarray) {
+ var arr = [];
+ for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
+ return arr; // Returns a copy of the original data.
+ }
+ return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
+ },getFileDataAsTypedArray:function (node) {
+ if (!node.contents) return new Uint8Array;
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },expandFileStorage:function (node, newCapacity) {
+ // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
+ // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
+ // increase the size.
+ if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
+ node.contents = MEMFS.getFileDataAsRegularArray(node);
+ node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
+ }
+
+ if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
+ var prevCapacity = node.contents ? node.contents.buffer.byteLength : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ return;
+ }
+ // Not using a typed array to back the file storage. Use a standard JS array instead.
+ if (!node.contents && newCapacity > 0) node.contents = [];
+ while (node.contents.length < newCapacity) node.contents.push(0);
+ },resizeFileStorage:function (node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ return;
+ }
+ if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ return;
+ }
+ // Backing with a JS array.
+ if (!node.contents) node.contents = [];
+ if (node.contents.length > newSize) node.contents.length = newSize;
+ else while (node.contents.length < newSize) node.contents.push(0);
+ node.usedBytes = newSize;
+ },node_ops:{getattr:function (node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },lookup:function (parent, name) {
+ throw FS.genericErrors[ERRNO_CODES.ENOENT];
+ },mknod:function (parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },rename:function (old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ }
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ old_node.parent = new_dir;
+ },unlink:function (parent, name) {
+ delete parent.contents[name];
+ },rmdir:function (parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ delete parent.contents[name];
+ },readdir:function (node) {
+ var entries = ['.', '..']
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },readlink:function (node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return node.link;
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) { // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+ if (canOwn) { // Can we just reuse the buffer we are given?
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position+length);
+ if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
+ else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position+length);
+ return length;
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ },allocate:function (stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if ( !(flags & 2) &&
+ (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
+ // We can't emulate MAP_SHARED when the file is not backed by the buffer
+ // we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < stream.node.usedBytes) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = _malloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
+ }
+ buffer.set(contents, ptr);
+ }
+ return { ptr: ptr, allocated: allocated };
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (mmapFlags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+
+ var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ }}};
+
+ var IDBFS={dbs:{},indexedDB:function () {
+ if (typeof indexedDB !== 'undefined') return indexedDB;
+ var ret = null;
+ if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ assert(ret, 'IDBFS used, but indexedDB not supported');
+ return ret;
+ },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
+ // reuse all of the core MEMFS functionality
+ return MEMFS.mount.apply(null, arguments);
+ },syncfs:function (mount, populate, callback) {
+ IDBFS.getLocalSet(mount, function(err, local) {
+ if (err) return callback(err);
+
+ IDBFS.getRemoteSet(mount, function(err, remote) {
+ if (err) return callback(err);
+
+ var src = populate ? remote : local;
+ var dst = populate ? local : remote;
+
+ IDBFS.reconcile(src, dst, callback);
+ });
+ });
+ },getDB:function (name, callback) {
+ // check the cache first
+ var db = IDBFS.dbs[name];
+ if (db) {
+ return callback(null, db);
+ }
+
+ var req;
+ try {
+ req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+ } catch (e) {
+ return callback(e);
+ }
+ req.onupgradeneeded = function(e) {
+ var db = e.target.result;
+ var transaction = e.target.transaction;
+
+ var fileStore;
+
+ if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+ fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ } else {
+ fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+ }
+
+ if (!fileStore.indexNames.contains('timestamp')) {
+ fileStore.createIndex('timestamp', 'timestamp', { unique: false });
+ }
+ };
+ req.onsuccess = function() {
+ db = req.result;
+
+ // add to the cache
+ IDBFS.dbs[name] = db;
+ callback(null, db);
+ };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },getLocalSet:function (mount, callback) {
+ var entries = {};
+
+ function isRealDir(p) {
+ return p !== '.' && p !== '..';
+ };
+ function toAbsolute(root) {
+ return function(p) {
+ return PATH.join2(root, p);
+ }
+ };
+
+ var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+
+ while (check.length) {
+ var path = check.pop();
+ var stat;
+
+ try {
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+ }
+
+ entries[path] = { timestamp: stat.mtime };
+ }
+
+ return callback(null, { type: 'local', entries: entries });
+ },getRemoteSet:function (mount, callback) {
+ var entries = {};
+
+ IDBFS.getDB(mount.mountpoint, function(err, db) {
+ if (err) return callback(err);
+
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
+ transaction.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ var index = store.index('timestamp');
+
+ index.openKeyCursor().onsuccess = function(event) {
+ var cursor = event.target.result;
+
+ if (!cursor) {
+ return callback(null, { type: 'remote', db: db, entries: entries });
+ }
+
+ entries[cursor.primaryKey] = { timestamp: cursor.key };
+
+ cursor.continue();
+ };
+ });
+ },loadLocalEntry:function (path, callback) {
+ var stat, node;
+
+ try {
+ var lookup = FS.lookupPath(path);
+ node = lookup.node;
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode });
+ } else if (FS.isFile(stat.mode)) {
+ // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+ // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+ node.contents = MEMFS.getFileDataAsTypedArray(node);
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+ },storeLocalEntry:function (path, entry, callback) {
+ try {
+ if (FS.isDir(entry.mode)) {
+ FS.mkdir(path, entry.mode);
+ } else if (FS.isFile(entry.mode)) {
+ FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+
+ FS.chmod(path, entry.mode);
+ FS.utime(path, entry.timestamp, entry.timestamp);
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },removeLocalEntry:function (path, callback) {
+ try {
+ var lookup = FS.lookupPath(path);
+ var stat = FS.stat(path);
+
+ if (FS.isDir(stat.mode)) {
+ FS.rmdir(path);
+ } else if (FS.isFile(stat.mode)) {
+ FS.unlink(path);
+ }
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },loadRemoteEntry:function (store, path, callback) {
+ var req = store.get(path);
+ req.onsuccess = function(event) { callback(null, event.target.result); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },storeRemoteEntry:function (store, path, entry, callback) {
+ var req = store.put(entry, path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },removeRemoteEntry:function (store, path, callback) {
+ var req = store.delete(path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },reconcile:function (src, dst, callback) {
+ var total = 0;
+
+ var create = [];
+ Object.keys(src.entries).forEach(function (key) {
+ var e = src.entries[key];
+ var e2 = dst.entries[key];
+ if (!e2 || e.timestamp > e2.timestamp) {
+ create.push(key);
+ total++;
+ }
+ });
+
+ var remove = [];
+ Object.keys(dst.entries).forEach(function (key) {
+ var e = dst.entries[key];
+ var e2 = src.entries[key];
+ if (!e2) {
+ remove.push(key);
+ total++;
+ }
+ });
+
+ if (!total) {
+ return callback(null);
+ }
+
+ var errored = false;
+ var completed = 0;
+ var db = src.type === 'remote' ? src.db : dst.db;
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return callback(err);
+ }
+ return;
+ }
+ if (++completed >= total) {
+ return callback(null);
+ }
+ };
+
+ transaction.onerror = function(e) {
+ done(this.error);
+ e.preventDefault();
+ };
+
+ // sort paths in ascending order so directory entries are created
+ // before the files inside them
+ create.sort().forEach(function (path) {
+ if (dst.type === 'local') {
+ IDBFS.loadRemoteEntry(store, path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeLocalEntry(path, entry, done);
+ });
+ } else {
+ IDBFS.loadLocalEntry(path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeRemoteEntry(store, path, entry, done);
+ });
+ }
+ });
+
+ // sort paths in descending order so files are deleted before their
+ // parent directories
+ remove.sort().reverse().forEach(function(path) {
+ if (dst.type === 'local') {
+ IDBFS.removeLocalEntry(path, done);
+ } else {
+ IDBFS.removeRemoteEntry(store, path, done);
+ }
+ });
+ }};
+
+ var NODEFS={isWindows:false,staticInit:function () {
+ NODEFS.isWindows = !!process.platform.match(/^win/);
+ },mount:function (mount) {
+ assert(ENVIRONMENT_IS_NODE);
+ return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node = FS.createNode(parent, name, mode);
+ node.node_ops = NODEFS.node_ops;
+ node.stream_ops = NODEFS.stream_ops;
+ return node;
+ },getMode:function (path) {
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ if (NODEFS.isWindows) {
+ // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
+ // propagate write bits to execute bits.
+ stat.mode = stat.mode | ((stat.mode & 146) >> 1);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return stat.mode;
+ },realPath:function (node) {
+ var parts = [];
+ while (node.parent !== node) {
+ parts.push(node.name);
+ node = node.parent;
+ }
+ parts.push(node.mount.opts.root);
+ parts.reverse();
+ return PATH.join.apply(null, parts);
+ },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
+ flags &= ~0100000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ if (flags in NODEFS.flagsToPermissionStringMap) {
+ return NODEFS.flagsToPermissionStringMap[flags];
+ } else {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ },node_ops:{getattr:function (node) {
+ var path = NODEFS.realPath(node);
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
+ // See http://support.microsoft.com/kb/140365
+ if (NODEFS.isWindows && !stat.blksize) {
+ stat.blksize = 4096;
+ }
+ if (NODEFS.isWindows && !stat.blocks) {
+ stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
+ }
+ return {
+ dev: stat.dev,
+ ino: stat.ino,
+ mode: stat.mode,
+ nlink: stat.nlink,
+ uid: stat.uid,
+ gid: stat.gid,
+ rdev: stat.rdev,
+ size: stat.size,
+ atime: stat.atime,
+ mtime: stat.mtime,
+ ctime: stat.ctime,
+ blksize: stat.blksize,
+ blocks: stat.blocks
+ };
+ },setattr:function (node, attr) {
+ var path = NODEFS.realPath(node);
+ try {
+ if (attr.mode !== undefined) {
+ fs.chmodSync(path, attr.mode);
+ // update the common node structure mode as well
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ var date = new Date(attr.timestamp);
+ fs.utimesSync(path, date, date);
+ }
+ if (attr.size !== undefined) {
+ fs.truncateSync(path, attr.size);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },lookup:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ var mode = NODEFS.getMode(path);
+ return NODEFS.createNode(parent, name, mode);
+ },mknod:function (parent, name, mode, dev) {
+ var node = NODEFS.createNode(parent, name, mode, dev);
+ // create the backing node for this in the fs root as well
+ var path = NODEFS.realPath(node);
+ try {
+ if (FS.isDir(node.mode)) {
+ fs.mkdirSync(path, node.mode);
+ } else {
+ fs.writeFileSync(path, '', { mode: node.mode });
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return node;
+ },rename:function (oldNode, newDir, newName) {
+ var oldPath = NODEFS.realPath(oldNode);
+ var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
+ try {
+ fs.renameSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },unlink:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.unlinkSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },rmdir:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.rmdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readdir:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ return fs.readdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },symlink:function (parent, newName, oldPath) {
+ var newPath = PATH.join2(NODEFS.realPath(parent), newName);
+ try {
+ fs.symlinkSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readlink:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ path = fs.readlinkSync(path);
+ path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
+ return path;
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }},stream_ops:{open:function (stream) {
+ var path = NODEFS.realPath(stream.node);
+ try {
+ if (FS.isFile(stream.node.mode)) {
+ stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },close:function (stream) {
+ try {
+ if (FS.isFile(stream.node.mode) && stream.nfd) {
+ fs.closeSync(stream.nfd);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },read:function (stream, buffer, offset, length, position) {
+ if (length === 0) return 0; // node errors on 0 length reads
+ // FIXME this is terrible.
+ var nbuffer = new Buffer(length);
+ var res;
+ try {
+ res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ if (res > 0) {
+ for (var i = 0; i < res; i++) {
+ buffer[offset + i] = nbuffer[i];
+ }
+ }
+ return res;
+ },write:function (stream, buffer, offset, length, position) {
+ // FIXME this is terrible.
+ var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
+ var res;
+ try {
+ res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return res;
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ try {
+ var stat = fs.fstatSync(stream.nfd);
+ position += stat.size;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }
+ }
+
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ return position;
+ }}};
+
+ var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
+ assert(ENVIRONMENT_IS_WORKER);
+ if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
+ var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
+ var createdParents = {};
+ function ensureParent(path) {
+ // return the parent node, creating subdirs as necessary
+ var parts = path.split('/');
+ var parent = root;
+ for (var i = 0; i < parts.length-1; i++) {
+ var curr = parts.slice(0, i+1).join('/');
+ if (!createdParents[curr]) {
+ createdParents[curr] = WORKERFS.createNode(parent, curr, WORKERFS.DIR_MODE, 0);
+ }
+ parent = createdParents[curr];
+ }
+ return parent;
+ }
+ function base(path) {
+ var parts = path.split('/');
+ return parts[parts.length-1];
+ }
+ // We also accept FileList here, by using Array.prototype
+ Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
+ WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
+ });
+ (mount.opts["blobs"] || []).forEach(function(obj) {
+ WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
+ });
+ (mount.opts["packages"] || []).forEach(function(pack) {
+ pack['metadata'].files.forEach(function(file) {
+ var name = file.filename.substr(1); // remove initial slash
+ WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
+ });
+ });
+ return root;
+ },createNode:function (parent, name, mode, dev, contents, mtime) {
+ var node = FS.createNode(parent, name, mode);
+ node.mode = mode;
+ node.node_ops = WORKERFS.node_ops;
+ node.stream_ops = WORKERFS.stream_ops;
+ node.timestamp = (mtime || new Date).getTime();
+ assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
+ if (mode === WORKERFS.FILE_MODE) {
+ node.size = contents.size;
+ node.contents = contents;
+ } else {
+ node.size = 4096;
+ node.contents = {};
+ }
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },node_ops:{getattr:function (node) {
+ return {
+ dev: 1,
+ ino: undefined,
+ mode: node.mode,
+ nlink: 1,
+ uid: 0,
+ gid: 0,
+ rdev: undefined,
+ size: node.size,
+ atime: new Date(node.timestamp),
+ mtime: new Date(node.timestamp),
+ ctime: new Date(node.timestamp),
+ blksize: 4096,
+ blocks: Math.ceil(node.size / 4096),
+ };
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ },lookup:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ },mknod:function (parent, name, mode, dev) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rename:function (oldNode, newDir, newName) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },unlink:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rmdir:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readdir:function (node) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },symlink:function (parent, newName, oldPath) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readlink:function (node) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ if (position >= stream.node.size) return 0;
+ var chunk = stream.node.contents.slice(position, position + length);
+ var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
+ buffer.set(new Uint8Array(ab), offset);
+ return chunk.size;
+ },write:function (stream, buffer, offset, length, position) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.size;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ }}};
+
+ var _stdin=allocate(1, "i32*", ALLOC_STATIC);
+
+ var _stdout=allocate(1, "i32*", ALLOC_STATIC);
+
+ var _stderr=allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,handleFSError:function (e) {
+ if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
+ return ___setErrNo(e.errno);
+ },lookupPath:function (path, opts) {
+ path = PATH.resolve(FS.cwd(), path);
+ opts = opts || {};
+
+ if (!path) return { path: '', node: null };
+
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ for (var key in defaults) {
+ if (opts[key] === undefined) {
+ opts[key] = defaults[key];
+ }
+ }
+
+ if (opts.recurse_count > 8) { // max recursive lookup of 8
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+
+ // split the path
+ var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), false);
+
+ // start at the root
+ var current = FS.root;
+ var current_path = '/';
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length-1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH.resolve(PATH.dirname(current_path), link);
+
+ var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
+ current = lookup.node;
+
+ if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+ }
+ }
+ }
+
+ return { path: current_path, node: current };
+ },getPath:function (node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+ }
+ path = path ? node.name + '/' + path : node.name;
+ node = node.parent;
+ }
+ },hashName:function (parentid, name) {
+ var hash = 0;
+
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },hashAddNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },hashRemoveNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },lookupNode:function (parent, name) {
+ var err = FS.mayLookup(parent);
+ if (err) {
+ throw new FS.ErrnoError(err, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },createNode:function (parent, name, mode, rdev) {
+ if (!FS.FSNode) {
+ FS.FSNode = function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+ };
+
+ FS.FSNode.prototype = {};
+
+ // compatibility
+ var readMode = 292 | 73;
+ var writeMode = 146;
+
+ // NOTE we must use Object.defineProperties instead of individual calls to
+ // Object.defineProperty in order to make closure compiler happy
+ Object.defineProperties(FS.FSNode.prototype, {
+ read: {
+ get: function() { return (this.mode & readMode) === readMode; },
+ set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
+ },
+ write: {
+ get: function() { return (this.mode & writeMode) === writeMode; },
+ set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
+ },
+ isFolder: {
+ get: function() { return FS.isDir(this.mode); }
+ },
+ isDevice: {
+ get: function() { return FS.isChrdev(this.mode); }
+ }
+ });
+ }
+
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },destroyNode:function (node) {
+ FS.hashRemoveNode(node);
+ },isRoot:function (node) {
+ return node === node.parent;
+ },isMountpoint:function (node) {
+ return !!node.mounted;
+ },isFile:function (mode) {
+ return (mode & 61440) === 32768;
+ },isDir:function (mode) {
+ return (mode & 61440) === 16384;
+ },isLink:function (mode) {
+ return (mode & 61440) === 40960;
+ },isChrdev:function (mode) {
+ return (mode & 61440) === 8192;
+ },isBlkdev:function (mode) {
+ return (mode & 61440) === 24576;
+ },isFIFO:function (mode) {
+ return (mode & 61440) === 4096;
+ },isSocket:function (mode) {
+ return (mode & 49152) === 49152;
+ },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
+ var flags = FS.flagModes[str];
+ if (typeof flags === 'undefined') {
+ throw new Error('Unknown file open mode: ' + str);
+ }
+ return flags;
+ },flagsToPermissionString:function (flag) {
+ var perms = ['r', 'w', 'rw'][flag & 3];
+ if ((flag & 512)) {
+ perms += 'w';
+ }
+ return perms;
+ },nodePermissions:function (node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
+ return ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },mayLookup:function (dir) {
+ var err = FS.nodePermissions(dir, 'x');
+ if (err) return err;
+ if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
+ return 0;
+ },mayCreate:function (dir, name) {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return ERRNO_CODES.EEXIST;
+ } catch (e) {
+ }
+ return FS.nodePermissions(dir, 'wx');
+ },mayDelete:function (dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var err = FS.nodePermissions(dir, 'wx');
+ if (err) {
+ return err;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return ERRNO_CODES.ENOTDIR;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return ERRNO_CODES.EBUSY;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return 0;
+ },mayOpen:function (node, flags) {
+ if (!node) {
+ return ERRNO_CODES.ENOENT;
+ }
+ if (FS.isLink(node.mode)) {
+ return ERRNO_CODES.ELOOP;
+ } else if (FS.isDir(node.mode)) {
+ if ((flags & 2097155) !== 0 || // opening for write
+ (flags & 512)) {
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
+ fd_start = fd_start || 0;
+ fd_end = fd_end || FS.MAX_OPEN_FDS;
+ for (var fd = fd_start; fd <= fd_end; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
+ },getStream:function (fd) {
+ return FS.streams[fd];
+ },createStream:function (stream, fd_start, fd_end) {
+ if (!FS.FSStream) {
+ FS.FSStream = function(){};
+ FS.FSStream.prototype = {};
+ // compatibility
+ Object.defineProperties(FS.FSStream.prototype, {
+ object: {
+ get: function() { return this.node; },
+ set: function(val) { this.node = val; }
+ },
+ isRead: {
+ get: function() { return (this.flags & 2097155) !== 1; }
+ },
+ isWrite: {
+ get: function() { return (this.flags & 2097155) !== 0; }
+ },
+ isAppend: {
+ get: function() { return (this.flags & 1024); }
+ }
+ });
+ }
+ // clone it, so we can return an instance of FSStream
+ var newStream = new FS.FSStream();
+ for (var p in stream) {
+ newStream[p] = stream[p];
+ }
+ stream = newStream;
+ var fd = FS.nextfd(fd_start, fd_end);
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },closeStream:function (fd) {
+ FS.streams[fd] = null;
+ },chrdev_stream_ops:{open:function (stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },llseek:function () {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }},major:function (dev) {
+ return ((dev) >> 8);
+ },minor:function (dev) {
+ return ((dev) & 0xff);
+ },makedev:function (ma, mi) {
+ return ((ma) << 8 | (mi));
+ },registerDevice:function (dev, ops) {
+ FS.devices[dev] = { stream_ops: ops };
+ },getDevice:function (dev) {
+ return FS.devices[dev];
+ },getMounts:function (mount) {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push.apply(check, m.mounts);
+ }
+
+ return mounts;
+ },syncfs:function (populate, callback) {
+ if (typeof(populate) === 'function') {
+ callback = populate;
+ populate = false;
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return callback(err);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ callback(null);
+ }
+ };
+
+ // sync all mounts
+ mounts.forEach(function (mount) {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },mount:function (type, opts, mountpoint) {
+ var root = mountpoint === '/';
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ }
+
+ var mount = {
+ type: type,
+ opts: opts,
+ mountpoint: mountpoint,
+ mounts: []
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },unmount:function (mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach(function (hash) {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.indexOf(current.mount) !== -1) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },lookup:function (parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },mknod:function (path, mode, dev) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === '.' || name === '..') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.mayCreate(parent, name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },create:function (path, mode) {
+ mode = mode !== undefined ? mode : 438 /* 0666 */;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },mkdir:function (path, mode) {
+ mode = mode !== undefined ? mode : 511 /* 0777 */;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },mkdev:function (path, mode, dev) {
+ if (typeof(dev) === 'undefined') {
+ dev = mode;
+ mode = 438 /* 0666 */;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },symlink:function (oldpath, newpath) {
+ if (!PATH.resolve(oldpath)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var newname = PATH.basename(newpath);
+ var err = FS.mayCreate(parent, newname);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },rename:function (old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+ try {
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var err = FS.mayDelete(old_dir, old_name, isdir);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ err = new_node ?
+ FS.mayDelete(new_dir, new_name, isdir) :
+ FS.mayCreate(new_dir, new_name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ err = FS.nodePermissions(old_dir, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['willMovePath']) {
+ FS.trackingDelegate['willMovePath'](old_path, new_path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ try {
+ if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ },rmdir:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, true);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ return node.node_ops.readdir(node);
+ },unlink:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, false);
+ if (err) {
+ // POSIX says unlink should set EPERM, not EISDIR
+ if (err === ERRNO_CODES.EISDIR) err = ERRNO_CODES.EPERM;
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readlink:function (path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },stat:function (path, dontFollow) {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return node.node_ops.getattr(node);
+ },lstat:function (path) {
+ return FS.stat(path, true);
+ },chmod:function (path, mode, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },lchmod:function (path, mode) {
+ FS.chmod(path, mode, true);
+ },fchmod:function (fd, mode) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chmod(stream.node, mode);
+ },chown:function (path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ // we ignore the uid / gid for now
+ });
+ },lchown:function (path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },fchown:function (fd, uid, gid) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chown(stream.node, uid, gid);
+ },truncate:function (path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.nodePermissions(node, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },ftruncate:function (fd, len) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ FS.truncate(stream.node, len);
+ },utime:function (path, atime, mtime) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },open:function (path, flags, mode, fd_start, fd_end) {
+ if (path === "") {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
+ mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path === 'object') {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {
+ // ignore
+ }
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var err = FS.mayOpen(node, flags);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512)) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node: node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags: flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ }, fd_start, fd_end);
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module['logReadFiles'] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ Module['printErr']('read file: ' + path);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['onOpenFile']) {
+ var trackingFlags = 0;
+ if ((flags & 2097155) !== 1) {
+ trackingFlags |= FS.tracking.openFlags.READ;
+ }
+ if ((flags & 2097155) !== 0) {
+ trackingFlags |= FS.tracking.openFlags.WRITE;
+ }
+ FS.trackingDelegate['onOpenFile'](path, trackingFlags);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
+ }
+ return stream;
+ },close:function (stream) {
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ },llseek:function (stream, offset, whence) {
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },read:function (stream, buffer, offset, length, position) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var seeking = true;
+ if (typeof position === 'undefined') {
+ position = stream.position;
+ seeking = false;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = true;
+ if (typeof position === 'undefined') {
+ position = stream.position;
+ seeking = false;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ try {
+ if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
+ }
+ return bytesWritten;
+ },allocate:function (stream, offset, length) {
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ // TODO if PROT is PROT_WRITE, make sure we have write access
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EACCES);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!stream || !stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },munmap:function (stream) {
+ return 0;
+ },ioctl:function (stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },readFile:function (path, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'r';
+ opts.encoding = opts.encoding || 'binary';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === 'utf8') {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === 'binary') {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },writeFile:function (path, data, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'w';
+ opts.encoding = opts.encoding || 'utf8';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (opts.encoding === 'utf8') {
+ var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
+ } else if (opts.encoding === 'binary') {
+ FS.write(stream, data, 0, data.length, 0, opts.canOwn);
+ }
+ FS.close(stream);
+ },cwd:function () {
+ return FS.currentPath;
+ },chdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ var err = FS.nodePermissions(lookup.node, 'x');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ FS.currentPath = lookup.path;
+ },createDefaultDirectories:function () {
+ FS.mkdir('/tmp');
+ FS.mkdir('/home');
+ FS.mkdir('/home/web_user');
+ },createDefaultDevices:function () {
+ // create /dev
+ FS.mkdir('/dev');
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: function() { return 0; },
+ write: function(stream, buffer, offset, length, pos) { return length; }
+ });
+ FS.mkdev('/dev/null', FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using Module['printErr']
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev('/dev/tty', FS.makedev(5, 0));
+ FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+ // setup /dev/[u]random
+ var random_device;
+ if (typeof crypto !== 'undefined') {
+ // for modern web browsers
+ var randomBuffer = new Uint8Array(1);
+ random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+ } else if (ENVIRONMENT_IS_NODE) {
+ // for nodejs
+ random_device = function() { return require('crypto').randomBytes(1)[0]; };
+ } else {
+ // default for ES5 platforms
+ random_device = function() { return (Math.random()*256)|0; };
+ }
+ FS.createDevice('/dev', 'random', random_device);
+ FS.createDevice('/dev', 'urandom', random_device);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir('/dev/shm');
+ FS.mkdir('/dev/shm/tmp');
+ },createSpecialDirectories:function () {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir('/proc');
+ FS.mkdir('/proc/self');
+ FS.mkdir('/proc/self/fd');
+ FS.mount({
+ mount: function() {
+ var node = FS.createNode('/proc/self', 'fd', 16384 | 0777, 73);
+ node.node_ops = {
+ lookup: function(parent, name) {
+ var fd = +name;
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: 'fake' },
+ node_ops: { readlink: function() { return stream.path } }
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, '/proc/self/fd');
+ },createStandardStreams:function () {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (Module['stdin']) {
+ FS.createDevice('/dev', 'stdin', Module['stdin']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdin');
+ }
+ if (Module['stdout']) {
+ FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdout');
+ }
+ if (Module['stderr']) {
+ FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+ } else {
+ FS.symlink('/dev/tty1', '/dev/stderr');
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open('/dev/stdin', 'r');
+ assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
+
+ var stdout = FS.open('/dev/stdout', 'w');
+ assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
+
+ var stderr = FS.open('/dev/stderr', 'w');
+ assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
+ },ensureErrnoError:function () {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = function ErrnoError(errno, node) {
+ //Module.printErr(stackTrace()); // useful for debugging
+ this.node = node;
+ this.setErrno = function(errno) {
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ };
+ this.setErrno(errno);
+ this.message = ERRNO_MESSAGES[errno];
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+ [ERRNO_CODES.ENOENT].forEach(function(code) {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = '<generic error, no stack>';
+ });
+ },staticInit:function () {
+ FS.ensureErrnoError();
+
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, '/');
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ 'MEMFS': MEMFS,
+ 'IDBFS': IDBFS,
+ 'NODEFS': NODEFS,
+ 'WORKERFS': WORKERFS,
+ };
+ },init:function (input, output, error) {
+ assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+ FS.init.initialized = true;
+
+ FS.ensureErrnoError();
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ Module['stdin'] = input || Module['stdin'];
+ Module['stdout'] = output || Module['stdout'];
+ Module['stderr'] = error || Module['stderr'];
+
+ FS.createStandardStreams();
+ },quit:function () {
+ FS.init.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ var fflush = Module['_fflush'];
+ if (fflush) fflush(0);
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },getMode:function (canRead, canWrite) {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ },joinPath:function (parts, forceRelative) {
+ var path = PATH.join.apply(null, parts);
+ if (forceRelative && path[0] == '/') path = path.substr(1);
+ return path;
+ },absolutePath:function (relative, base) {
+ return PATH.resolve(base, relative);
+ },standardizePath:function (path) {
+ return PATH.normalize(path);
+ },findObject:function (path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (ret.exists) {
+ return ret.object;
+ } else {
+ ___setErrNo(ret.error);
+ return null;
+ }
+ },analyzePath:function (path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {
+ }
+ var ret = {
+ isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+ parentExists: false, parentPath: null, parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === '/';
+ } catch (e) {
+ ret.error = e.errno;
+ };
+ return ret;
+ },createFolder:function (parent, name, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.mkdir(path, mode);
+ },createPath:function (parent, path, canRead, canWrite) {
+ parent = typeof parent === 'string' ? parent : FS.getPath(parent);
+ var parts = path.split('/').reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },createFile:function (parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
+ var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
+ var mode = FS.getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data === 'string') {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 'w');
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },createDevice:function (parent, name, input, output) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open: function(stream) {
+ stream.seekable = false;
+ },
+ close: function(stream) {
+ // flush any pending line data
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read: function(stream, buffer, offset, length, pos /* ignored */) {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: function(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },createLink:function (parent, name, target, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ return FS.symlink(target, path);
+ },forceLoadFile:function (obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ var success = true;
+ if (typeof XMLHttpRequest !== 'undefined') {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (Module['read']) {
+ // Command-line.
+ try {
+ // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+ // read() will try to parse UTF8.
+ obj.contents = intArrayFromString(Module['read'](obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ success = false;
+ }
+ } else {
+ throw new Error('Cannot load without read() or XMLHttpRequest.');
+ }
+ if (!success) ___setErrNo(ERRNO_CODES.EIO);
+ return success;
+ },createLazyFile:function (parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = []; // Loaded chunks. Index is the chunk number
+ }
+ LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+ if (idx > this.length-1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize)|0;
+ return this.getter(chunkNum)[chunkOffset];
+ }
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ }
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open('HEAD', url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var chunkSize = 1024*1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (function(from, to) {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType('text/plain; charset=x-user-defined');
+ }
+
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(xhr.response || []);
+ } else {
+ return intArrayFromString(xhr.responseText || '', true);
+ }
+ });
+ var lazyArray = this;
+ lazyArray.setDataGetter(function(chunkNum) {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum+1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ }
+ if (typeof XMLHttpRequest !== 'undefined') {
+ if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperty(lazyArray, "length", {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ });
+ Object.defineProperty(lazyArray, "chunkSize", {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ });
+
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperty(node, "usedBytes", {
+ get: function() { return this.contents.length; }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach(function(key) {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ return fn.apply(null, arguments);
+ };
+ });
+ // use a custom read function
+ stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ var contents = stream.node.contents;
+ if (position >= contents.length)
+ return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) { // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+ Browser.init();
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ var handled = false;
+ Module['preloadPlugins'].forEach(function(plugin) {
+ if (handled) return;
+ if (plugin['canHandle'](fullname)) {
+ plugin['handle'](byteArray, fullname, finish, function() {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ });
+ handled = true;
+ }
+ });
+ if (!handled) finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == 'string') {
+ Browser.asyncLoad(url, function(byteArray) {
+ processData(byteArray);
+ }, onerror);
+ } else {
+ processData(url);
+ }
+ },indexedDB:function () {
+ return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ },DB_NAME:function () {
+ return 'EM_FS_' + window.location.pathname;
+ },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
+ console.log('creating db');
+ var db = openRequest.result;
+ db.createObjectStore(FS.DB_STORE_NAME);
+ };
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+ putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
+ putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ },loadFilesFromDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = onerror; // no database to load from
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ try {
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+ } catch(e) {
+ onerror(e);
+ return;
+ }
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var getRequest = files.get(path);
+ getRequest.onsuccess = function getRequest_onsuccess() {
+ if (FS.analyzePath(path).exists) {
+ FS.unlink(path);
+ }
+ FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+ ok++;
+ if (ok + fail == total) finish();
+ };
+ getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
+ if (path[0] !== '/') {
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = FS.getStream(dirfd);
+ if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ dir = dirstream.path;
+ }
+ path = PATH.join2(dir, path);
+ }
+ return path;
+ },doStat:function (func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ // an error occurred while trying to look up the path; we should just report ENOTDIR
+ return -ERRNO_CODES.ENOTDIR;
+ }
+ throw e;
+ }
+ HEAP32[((buf)>>2)]=stat.dev;
+ HEAP32[(((buf)+(4))>>2)]=0;
+ HEAP32[(((buf)+(8))>>2)]=stat.ino;
+ HEAP32[(((buf)+(12))>>2)]=stat.mode;
+ HEAP32[(((buf)+(16))>>2)]=stat.nlink;
+ HEAP32[(((buf)+(20))>>2)]=stat.uid;
+ HEAP32[(((buf)+(24))>>2)]=stat.gid;
+ HEAP32[(((buf)+(28))>>2)]=stat.rdev;
+ HEAP32[(((buf)+(32))>>2)]=0;
+ HEAP32[(((buf)+(36))>>2)]=stat.size;
+ HEAP32[(((buf)+(40))>>2)]=4096;
+ HEAP32[(((buf)+(44))>>2)]=stat.blocks;
+ HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(52))>>2)]=0;
+ HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(60))>>2)]=0;
+ HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(68))>>2)]=0;
+ HEAP32[(((buf)+(72))>>2)]=stat.ino;
+ return 0;
+ },doMsync:function (addr, stream, len, flags) {
+ var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
+ FS.msync(stream, buffer, 0, len, flags);
+ },doMkdir:function (path, mode) {
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ },doMknod:function (path, mode, dev) {
+ // we don't want this in the JS API as it uses mknod to create all nodes.
+ switch (mode & 61440) {
+ case 32768:
+ case 8192:
+ case 24576:
+ case 4096:
+ case 49152:
+ break;
+ default: return -ERRNO_CODES.EINVAL;
+ }
+ FS.mknod(path, mode, dev);
+ return 0;
+ },doReadlink:function (path, buf, bufsize) {
+ if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
+ var ret = FS.readlink(path);
+ ret = ret.slice(0, Math.max(0, bufsize));
+ writeStringToMemory(ret, buf, true);
+ return ret.length;
+ },doAccess:function (path, amode) {
+ if (amode & ~7) {
+ // need a valid mode
+ return -ERRNO_CODES.EINVAL;
+ }
+ var node;
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ var perms = '';
+ if (amode & 4) perms += 'r';
+ if (amode & 2) perms += 'w';
+ if (amode & 1) perms += 'x';
+ if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+ return -ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },doDup:function (path, flags, suggestFD) {
+ var suggest = FS.getStream(suggestFD);
+ if (suggest) FS.close(suggest);
+ return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
+ },doReadv:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.read(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ }
+ return ret;
+ },doWritev:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.write(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ }
+ return ret;
+ },varargs:0,get:function (varargs) {
+ SYSCALLS.varargs += 4;
+ var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+ return ret;
+ },getStr:function () {
+ var ret = Pointer_stringify(SYSCALLS.get());
+ return ret;
+ },getStreamFromFD:function () {
+ var stream = FS.getStream(SYSCALLS.get());
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return stream;
+ },getSocketFromFD:function () {
+ var socket = SOCKFS.getSocket(SYSCALLS.get());
+ if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return socket;
+ },getSocketAddress:function (allowNull) {
+ var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ if (allowNull && addrp === 0) return null;
+ var info = __read_sockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ },get64:function () {
+ var low = SYSCALLS.get(), high = SYSCALLS.get();
+ if (low >= 0) assert(high === 0);
+ else assert(high === -1);
+ return low;
+ },getZero:function () {
+ assert(SYSCALLS.get() === 0);
+ }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // ioctl
+ var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
+ switch (op) {
+ case 21505: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ case 21506: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ var argp = SYSCALLS.get();
+ HEAP32[((argp)>>2)]=0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return -ERRNO_CODES.EINVAL; // not supported
+ }
+ case 21531: {
+ var argp = SYSCALLS.get();
+ return FS.ioctl(stream, op, argp);
+ }
+ default: abort('bad ioctl syscall ' + op);
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function _emscripten_glSampleCoverage(x0, x1) { GLctx.sampleCoverage(x0, x1) }
+
+ function _glDeleteTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((textures)+(i*4))>>2)];
+ var texture = GL.textures[id];
+ if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+ }
+
+ function _emscripten_glFrustum() {
+ Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
+ }
+
+ function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) }
+
+ function _glfwSetWindowSizeCallback(winid, cbfun) {
+ GLFW.setWindowSizeCallback(winid, cbfun);
+ }
+
+ function _emscripten_glGetTexParameterfv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+ }
+
+ function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
+ location = GL.uniforms[location];
+ GLctx.uniform4i(location, v0, v1, v2, v3);
+ }
+
+ function _emscripten_glBindRenderbuffer(target, renderbuffer) {
+ GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
+ }
+
+ function _emscripten_glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) }
+
+
+ function _emscripten_memcpy_big(dest, src, num) {
+ HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
+ return dest;
+ }
+ Module["_memcpy"] = _memcpy;
+
+ function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) }
+
+ function _emscripten_glTexParameterfv(target, pname, params) {
+ var param = HEAPF32[((params)>>2)];
+ GLctx.texParameterf(target, pname, param);
+ }
+
+ function _emscripten_glLinkProgram(program) {
+ GLctx.linkProgram(GL.programs[program]);
+ GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
+ GL.populateUniformTable(program);
+ }
+
+ function _glUniform1f(location, v0) {
+ location = GL.uniforms[location];
+ GLctx.uniform1f(location, v0);
+ }
+
+ function _emscripten_glUniform3f(location, v0, v1, v2) {
+ location = GL.uniforms[location];
+ GLctx.uniform3f(location, v0, v1, v2);
+ }
+
+ function _emscripten_glGetObjectParameterivARB() {
+ Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
+ }
+
+ function _emscripten_glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) }
+
+ function _emscripten_glUniform3i(location, v0, v1, v2) {
+ location = GL.uniforms[location];
+ GLctx.uniform3i(location, v0, v1, v2);
+ }
+
+ function _emscripten_glStencilOp(x0, x1, x2) { GLctx.stencilOp(x0, x1, x2) }
+
+ function _glCreateShader(shaderType) {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+ return id;
+ }
+
+ function _glUniform1i(location, v0) {
+ location = GL.uniforms[location];
+ GLctx.uniform1i(location, v0);
+ }
+
+ function _emscripten_glBindAttribLocation(program, index, name) {
+ name = Pointer_stringify(name);
+ GLctx.bindAttribLocation(GL.programs[program], index, name);
+ }
+
+ var _cosf=Math_cos;
+
+ function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+ var heapView;
+ if (data) {
+ heapView = HEAPU8.subarray((data),(data+imageSize));
+ } else {
+ heapView = null;
+ }
+ GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView);
+ }
+
+ function _glDisable(x0) { GLctx.disable(x0) }
+
+ function _emscripten_glEnableVertexAttribArray(index) {
+ GLctx.enableVertexAttribArray(index);
+ }
+
+
+ Module["_memset"] = _memset;
+
+ var _BDtoILow=true;
+
+ function _glfwMakeContextCurrent(winid) {}
+
+
+ var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,registerRemoveEventListeners:function () {
+ if (!JSEvents.removeEventListenersRegistered) {
+ __ATEXIT__.push(function() {
+ for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
+ JSEvents._removeHandler(i);
+ }
+ });
+ JSEvents.removeEventListenersRegistered = true;
+ }
+ },findEventTarget:function (target) {
+ if (target) {
+ if (typeof target == "number") {
+ target = Pointer_stringify(target);
+ }
+ if (target == '#window') return window;
+ else if (target == '#document') return document;
+ else if (target == '#screen') return window.screen;
+ else if (target == '#canvas') return Module['canvas'];
+
+ if (typeof target == 'string') return document.getElementById(target);
+ else return target;
+ } else {
+ // The sensible target varies between events, but use window as the default
+ // since DOM events mostly can default to that. Specific callback registrations
+ // override their own defaults.
+ return window;
+ }
+ },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
+ function arraysHaveEqualContent(arrA, arrB) {
+ if (arrA.length != arrB.length) return false;
+
+ for(var i in arrA) {
+ if (arrA[i] != arrB[i]) return false;
+ }
+ return true;
+ }
+ // Test if the given call was already queued, and if so, don't add it again.
+ for(var i in JSEvents.deferredCalls) {
+ var call = JSEvents.deferredCalls[i];
+ if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
+ return;
+ }
+ }
+ JSEvents.deferredCalls.push({
+ targetFunction: targetFunction,
+ precedence: precedence,
+ argsList: argsList
+ });
+
+ JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
+ },removeDeferredCalls:function (targetFunction) {
+ for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+ if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
+ JSEvents.deferredCalls.splice(i, 1);
+ --i;
+ }
+ }
+ },canPerformEventHandlerRequests:function () {
+ return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
+ },runDeferredCalls:function () {
+ if (!JSEvents.canPerformEventHandlerRequests()) {
+ return;
+ }
+ for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+ var call = JSEvents.deferredCalls[i];
+ JSEvents.deferredCalls.splice(i, 1);
+ --i;
+ call.targetFunction.apply(this, call.argsList);
+ }
+ },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
+ for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == target &&
+ (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ },_removeHandler:function (i) {
+ var h = JSEvents.eventHandlers[i];
+ h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
+ JSEvents.eventHandlers.splice(i, 1);
+ },registerOrRemoveHandler:function (eventHandler) {
+ var jsEventHandler = function jsEventHandler(event) {
+ // Increment nesting count for the event handler.
+ ++JSEvents.inEventHandler;
+ JSEvents.currentEventHandler = eventHandler;
+ // Process any old deferred calls the user has placed.
+ JSEvents.runDeferredCalls();
+ // Process the actual event, calls back to user C code handler.
+ eventHandler.handlerFunc(event);
+ // Process any new deferred calls that were placed right now from this event handler.
+ JSEvents.runDeferredCalls();
+ // Out of event handler - restore nesting count.
+ --JSEvents.inEventHandler;
+ }
+
+ if (eventHandler.callbackfunc) {
+ eventHandler.eventListenerFunc = jsEventHandler;
+ eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
+ JSEvents.eventHandlers.push(eventHandler);
+ JSEvents.registerRemoveEventListeners();
+ } else {
+ for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == eventHandler.target
+ && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ }
+ },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.keyEvent) {
+ JSEvents.keyEvent = _malloc( 164 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+ writeStringToMemory(e.key ? e.key : "", JSEvents.keyEvent + 0 );
+ writeStringToMemory(e.code ? e.code : "", JSEvents.keyEvent + 32 );
+ HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location;
+ HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey;
+ HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey;
+ HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey;
+ HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey;
+ HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat;
+ writeStringToMemory(e.locale ? e.locale : "", JSEvents.keyEvent + 88 );
+ writeStringToMemory(e.char ? e.char : "", JSEvents.keyEvent + 120 );
+ HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode;
+ HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode;
+ HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which;
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.keyEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },getBoundingClientRectOrZeros:function (target) {
+ return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
+ },fillMouseEventData:function (eventStruct, e, target) {
+ HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
+ HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
+ HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
+ HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
+ HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
+ HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
+ HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
+ HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
+ HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
+ HEAP16[(((eventStruct)+(40))>>1)]=e.button;
+ HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
+ HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
+ HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
+
+ if (Module['canvas']) {
+ var rect = Module['canvas'].getBoundingClientRect();
+ HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
+ HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
+ } else { // Canvas is not initialized, return 0.
+ HEAP32[(((eventStruct)+(60))>>2)]=0;
+ HEAP32[(((eventStruct)+(64))>>2)]=0;
+ }
+ if (target) {
+ var rect = JSEvents.getBoundingClientRectOrZeros(target);
+ HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
+ HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
+ } else { // No specific target passed, return 0.
+ HEAP32[(((eventStruct)+(52))>>2)]=0;
+ HEAP32[(((eventStruct)+(56))>>2)]=0;
+ }
+ JSEvents.previousScreenX = e.screenX;
+ JSEvents.previousScreenY = e.screenY;
+ },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.mouseEvent) {
+ JSEvents.mouseEvent = _malloc( 72 );
+ }
+ target = JSEvents.findEventTarget(target);
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+ JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.mouseEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ // In IE, mousedown events don't either allow deferred calls to be run!
+ if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.wheelEvent) {
+ JSEvents.wheelEvent = _malloc( 104 );
+ }
+ target = JSEvents.findEventTarget(target);
+ // The DOM Level 3 events spec event 'wheel'
+ var wheelHandlerFunc = function(event) {
+ var e = event || window.event;
+ JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
+ HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"];
+ HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"];
+ HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"];
+ HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"];
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+ // The 'mousewheel' event as implemented in Safari 6.0.5
+ var mouseWheelHandlerFunc = function(event) {
+ var e = event || window.event;
+ JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
+ HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"];
+ HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-e["wheelDeltaY"] /* Invert to unify direction with the DOM Level 3 wheel event. */;
+ HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
+ HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: true,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },pageScrollPos:function () {
+ if (window.pageXOffset > 0 || window.pageYOffset > 0) {
+ return [window.pageXOffset, window.pageYOffset];
+ }
+ if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
+ return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
+ }
+ return [document.body.scrollLeft|0, document.body.scrollTop|0];
+ },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.uiEvent) {
+ JSEvents.uiEvent = _malloc( 36 );
+ }
+
+ if (eventTypeString == "scroll" && !target) {
+ target = document; // By default read scroll events on document rather than window.
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+ if (e.target != target) {
+ // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
+ // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
+ // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
+ // causing a new scroll, etc..
+ return;
+ }
+ var scrollPos = JSEvents.pageScrollPos();
+ HEAP32[((JSEvents.uiEvent)>>2)]=e.detail;
+ HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth;
+ HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight;
+ HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth;
+ HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight;
+ HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth;
+ HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight;
+ HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0];
+ HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1];
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.uiEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },getNodeNameForTarget:function (target) {
+ if (!target) return '';
+ if (target == window) return '#window';
+ if (target == window.screen) return '#screen';
+ return (target && target.nodeName) ? target.nodeName : '';
+ },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.focusEvent) {
+ JSEvents.focusEvent = _malloc( 256 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var nodeName = JSEvents.getNodeNameForTarget(e.target);
+ var id = e.target.id ? e.target.id : '';
+ writeStringToMemory(nodeName, JSEvents.focusEvent + 0 );
+ writeStringToMemory(id, JSEvents.focusEvent + 128 );
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.focusEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },tick:function () {
+ if (window['performance'] && window['performance']['now']) return window['performance']['now']();
+ else return Date.now();
+ },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.deviceOrientationEvent) {
+ JSEvents.deviceOrientationEvent = _malloc( 40 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
+ HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha;
+ HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta;
+ HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma;
+ HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute;
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceOrientationEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.deviceMotionEvent) {
+ JSEvents.deviceMotionEvent = _malloc( 80 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma;
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceMotionEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },screenOrientation:function () {
+ if (!window.screen) return undefined;
+ return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
+ },fillOrientationChangeEventData:function (eventStruct, e) {
+ var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
+ var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
+
+ var orientationString = JSEvents.screenOrientation();
+ var orientation = orientations.indexOf(orientationString);
+ if (orientation == -1) {
+ orientation = orientations2.indexOf(orientationString);
+ }
+
+ HEAP32[((eventStruct)>>2)]=1 << orientation;
+ HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
+ },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.orientationChangeEvent) {
+ JSEvents.orientationChangeEvent = _malloc( 8 );
+ }
+
+ if (!target) {
+ target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e);
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.orientationChangeEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
+ eventTypeString = "mozorientationchange";
+ }
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },fullscreenEnabled:function () {
+ return document.fullscreenEnabled || document.mozFullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
+ },fillFullscreenChangeEventData:function (eventStruct, e) {
+ var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
+ var isFullscreen = !!fullscreenElement;
+ HEAP32[((eventStruct)>>2)]=isFullscreen;
+ HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
+ // If transitioning to fullscreen, report info about the element that is now fullscreen.
+ // If transitioning to windowed mode, report info about the element that just was fullscreen.
+ var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
+ var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
+ var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
+ writeStringToMemory(nodeName, eventStruct + 8 );
+ writeStringToMemory(id, eventStruct + 136 );
+ HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
+ HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
+ HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
+ HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
+ if (isFullscreen) {
+ JSEvents.previousFullscreenElement = fullscreenElement;
+ }
+ },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.fullscreenChangeEvent) {
+ JSEvents.fullscreenChangeEvent = _malloc( 280 );
+ }
+
+ if (!target) {
+ target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e);
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.fullscreenChangeEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },resizeCanvasForFullscreen:function (target, strategy) {
+ var restoreOldStyle = __registerRestoreOldStyle(target);
+ var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
+ var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
+ var rect = target.getBoundingClientRect();
+ var windowedCssWidth = rect.right - rect.left;
+ var windowedCssHeight = rect.bottom - rect.top;
+ var windowedRttWidth = target.width;
+ var windowedRttHeight = target.height;
+
+ if (strategy.scaleMode == 3) {
+ __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
+ cssWidth = windowedCssWidth;
+ cssHeight = windowedCssHeight;
+ } else if (strategy.scaleMode == 2) {
+ if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
+ var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
+ __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
+ cssHeight = desiredCssHeight;
+ } else {
+ var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
+ __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
+ cssWidth = desiredCssWidth;
+ }
+ }
+
+ // If we are adding padding, must choose a background color or otherwise Chrome will give the
+ // padding a default white color. Do it only if user has not customized their own background color.
+ if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
+ // IE11 does the same, but requires the color to be set in the document body.
+ if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
+ // Firefox always shows black letterboxes independent of style color.
+
+ target.style.width = cssWidth + 'px';
+ target.style.height = cssHeight + 'px';
+
+ if (strategy.filteringMode == 1) {
+ target.style.imageRendering = 'optimizeSpeed';
+ target.style.imageRendering = '-moz-crisp-edges';
+ target.style.imageRendering = '-o-crisp-edges';
+ target.style.imageRendering = '-webkit-optimize-contrast';
+ target.style.imageRendering = 'optimize-contrast';
+ target.style.imageRendering = 'crisp-edges';
+ target.style.imageRendering = 'pixelated';
+ }
+
+ var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
+ if (strategy.canvasResolutionScaleMode != 0) {
+ target.width = cssWidth * dpiScale;
+ target.height = cssHeight * dpiScale;
+ if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height);
+ }
+ return restoreOldStyle;
+ },requestFullscreen:function (target, strategy) {
+ // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
+ if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
+ JSEvents.resizeCanvasForFullscreen(target, strategy);
+ }
+
+ if (target.requestFullscreen) {
+ target.requestFullscreen();
+ } else if (target.msRequestFullscreen) {
+ target.msRequestFullscreen();
+ } else if (target.mozRequestFullScreen) {
+ target.mozRequestFullScreen();
+ } else if (target.mozRequestFullscreen) {
+ target.mozRequestFullscreen();
+ } else if (target.webkitRequestFullscreen) {
+ target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
+ } else {
+ if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
+ return -1;
+ } else {
+ return -3;
+ }
+ }
+
+ if (strategy.canvasResizedCallback) {
+ Runtime.dynCall('iiii', strategy.canvasResizedCallback, [37, 0, strategy.canvasResizedCallbackUserData]);
+ }
+
+ return 0;
+ },fillPointerlockChangeEventData:function (eventStruct, e) {
+ var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
+ var isPointerlocked = !!pointerLockElement;
+ HEAP32[((eventStruct)>>2)]=isPointerlocked;
+ var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
+ var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
+ writeStringToMemory(nodeName, eventStruct + 4 );
+ writeStringToMemory(id, eventStruct + 132);
+ },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.pointerlockChangeEvent) {
+ JSEvents.pointerlockChangeEvent = _malloc( 260 );
+ }
+
+ if (!target) {
+ target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e);
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.pointerlockChangeEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },requestPointerLock:function (target) {
+ if (target.requestPointerLock) {
+ target.requestPointerLock();
+ } else if (target.mozRequestPointerLock) {
+ target.mozRequestPointerLock();
+ } else if (target.webkitRequestPointerLock) {
+ target.webkitRequestPointerLock();
+ } else if (target.msRequestPointerLock) {
+ target.msRequestPointerLock();
+ } else {
+ // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
+ // or if the whole browser just doesn't support the feature.
+ if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
+ return -3;
+ } else {
+ return -1;
+ }
+ }
+ return 0;
+ },fillVisibilityChangeEventData:function (eventStruct, e) {
+ var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
+ var visibilityState = visibilityStates.indexOf(document.visibilityState);
+
+ HEAP32[((eventStruct)>>2)]=document.hidden;
+ HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
+ },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.visibilityChangeEvent) {
+ JSEvents.visibilityChangeEvent = _malloc( 8 );
+ }
+
+ if (!target) {
+ target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e);
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.visibilityChangeEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.touchEvent) {
+ JSEvents.touchEvent = _malloc( 1684 );
+ }
+
+ target = JSEvents.findEventTarget(target);
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var touches = {};
+ for(var i = 0; i < e.touches.length; ++i) {
+ var touch = e.touches[i];
+ touches[touch.identifier] = touch;
+ }
+ for(var i = 0; i < e.changedTouches.length; ++i) {
+ var touch = e.changedTouches[i];
+ touches[touch.identifier] = touch;
+ touch.changed = true;
+ }
+ for(var i = 0; i < e.targetTouches.length; ++i) {
+ var touch = e.targetTouches[i];
+ touches[touch.identifier].onTarget = true;
+ }
+
+ var ptr = JSEvents.touchEvent;
+ HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
+ HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
+ HEAP32[(((ptr)+(12))>>2)]=e.altKey;
+ HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
+ ptr += 20; // Advance to the start of the touch array.
+ var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
+ var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
+ var numTouches = 0;
+ for(var i in touches) {
+ var t = touches[i];
+ HEAP32[((ptr)>>2)]=t.identifier;
+ HEAP32[(((ptr)+(4))>>2)]=t.screenX;
+ HEAP32[(((ptr)+(8))>>2)]=t.screenY;
+ HEAP32[(((ptr)+(12))>>2)]=t.clientX;
+ HEAP32[(((ptr)+(16))>>2)]=t.clientY;
+ HEAP32[(((ptr)+(20))>>2)]=t.pageX;
+ HEAP32[(((ptr)+(24))>>2)]=t.pageY;
+ HEAP32[(((ptr)+(28))>>2)]=t.changed;
+ HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
+ if (canvasRect) {
+ HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
+ HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
+ } else {
+ HEAP32[(((ptr)+(44))>>2)]=0;
+ HEAP32[(((ptr)+(48))>>2)]=0;
+ }
+ HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
+ HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
+
+ ptr += 52;
+
+ if (++numTouches >= 32) {
+ break;
+ }
+ }
+ HEAP32[((JSEvents.touchEvent)>>2)]=numTouches;
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.touchEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493
+ // Once the above bug is resolved, enable the following condition if possible:
+ // allowsDeferredCalls: eventTypeString == 'touchstart',
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },fillGamepadEventData:function (eventStruct, e) {
+ HEAPF64[((eventStruct)>>3)]=e.timestamp;
+ for(var i = 0; i < e.axes.length; ++i) {
+ HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
+ }
+ for(var i = 0; i < e.buttons.length; ++i) {
+ if (typeof(e.buttons[i]) === 'object') {
+ HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
+ } else {
+ HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
+ }
+ }
+ for(var i = 0; i < e.buttons.length; ++i) {
+ if (typeof(e.buttons[i]) === 'object') {
+ HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
+ } else {
+ HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
+ }
+ }
+ HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
+ HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
+ HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
+ HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
+ writeStringToMemory(e.id, eventStruct + 1304 );
+ writeStringToMemory(e.mapping, eventStruct + 1368 );
+ },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.gamepadEvent) {
+ JSEvents.gamepadEvent = _malloc( 1432 );
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad);
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.gamepadEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: true,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var confirmationMessage = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]);
+
+ if (confirmationMessage) {
+ confirmationMessage = Pointer_stringify(confirmationMessage);
+ }
+ if (confirmationMessage) {
+ e.preventDefault();
+ e.returnValue = confirmationMessage;
+ return confirmationMessage;
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
+ HEAPF64[((eventStruct)>>3)]=e.chargingTime;
+ HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
+ HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
+ HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
+ },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.batteryEvent) {
+ JSEvents.batteryEvent = _malloc( 32 );
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery());
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.batteryEvent, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!target) {
+ target = Module['canvas'];
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ }};function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel");
+ return 0;
+ }
+
+ function _glBindFramebuffer(target, framebuffer) {
+ GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
+ }
+
+ function ___lock() {}
+
+ function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx.blendFuncSeparate(x0, x1, x2, x3) }
+
+ function _glCullFace(x0) { GLctx.cullFace(x0) }
+
+ function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
+ if (!pointer) {
+ // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
+ // if pointer == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
+ }
+
+ function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx.vertexAttrib3f(x0, x1, x2, x3) }
+
+ function _emscripten_glEnable(x0) { GLctx.enable(x0) }
+
+ function _emscripten_glNormalPointer() {
+ Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
+ }
+
+
+ var _emscripten_GetProcAddress=undefined;
+ Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress;
+
+
+ function _eglWaitClient() {
+ EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
+ return 1;
+ }var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) {
+ EGL.errorCode = code;
+ },chooseConfig:function (display, attribList, config, config_size, numConfigs) {
+ if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
+ EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
+ return 0;
+ }
+ // TODO: read attribList.
+ if ((!config || !config_size) && !numConfigs) {
+ EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
+ return 0;
+ }
+ if (numConfigs) {
+ HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
+ }
+ if (config && config_size > 0) {
+ HEAP32[((config)>>2)]=62002;
+ }
+
+ EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
+ return 1;
+ }};function _eglGetProcAddress(name_) {
+ return _emscripten_GetProcAddress(name_);
+ }
+
+ function _glDeleteProgram(id) {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+ GL.programInfos[id] = null;
+ }
+
+
+
+ function _emscripten_set_main_loop_timing(mode, value) {
+ Browser.mainLoop.timingMode = mode;
+ Browser.mainLoop.timingValue = value;
+
+ if (!Browser.mainLoop.func) {
+ return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
+ }
+
+ if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
+ setTimeout(Browser.mainLoop.runner, value); // doing this each time means that on exception, we stop
+ };
+ Browser.mainLoop.method = 'timeout';
+ } else if (mode == 1 /*EM_TIMING_RAF*/) {
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
+ Browser.requestAnimationFrame(Browser.mainLoop.runner);
+ };
+ Browser.mainLoop.method = 'rAF';
+ } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
+ if (!window['setImmediate']) {
+ // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
+ var setImmediates = [];
+ var emscriptenMainLoopMessageId = '__emcc';
+ function Browser_setImmediate_messageHandler(event) {
+ if (event.source === window && event.data === emscriptenMainLoopMessageId) {
+ event.stopPropagation();
+ setImmediates.shift()();
+ }
+ }
+ window.addEventListener("message", Browser_setImmediate_messageHandler, true);
+ window['setImmediate'] = function Browser_emulated_setImmediate(func) {
+ setImmediates.push(func);
+ window.postMessage(emscriptenMainLoopMessageId, "*");
+ }
+ }
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
+ window['setImmediate'](Browser.mainLoop.runner);
+ };
+ Browser.mainLoop.method = 'immediate';
+ }
+ return 0;
+ }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
+ Module['noExitRuntime'] = true;
+
+ assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
+
+ Browser.mainLoop.func = func;
+ Browser.mainLoop.arg = arg;
+
+ var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
+
+ Browser.mainLoop.runner = function Browser_mainLoop_runner() {
+ if (ABORT) return;
+ if (Browser.mainLoop.queue.length > 0) {
+ var start = Date.now();
+ var blocker = Browser.mainLoop.queue.shift();
+ blocker.func(blocker.arg);
+ if (Browser.mainLoop.remainingBlockers) {
+ var remaining = Browser.mainLoop.remainingBlockers;
+ var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
+ if (blocker.counted) {
+ Browser.mainLoop.remainingBlockers = next;
+ } else {
+ // not counted, but move the progress along a tiny bit
+ next = next + 0.5; // do not steal all the next one's progress
+ Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
+ }
+ }
+ console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
+ Browser.mainLoop.updateStatus();
+ setTimeout(Browser.mainLoop.runner, 0);
+ return;
+ }
+
+ // catch pauses from non-main loop sources
+ if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+
+ // Implement very basic swap interval control
+ Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
+ if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
+ // Not the scheduled time to render this frame - skip.
+ Browser.mainLoop.scheduler();
+ return;
+ }
+
+ // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
+ // VBO double-buffering and reduce GPU stalls.
+
+ if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
+ Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
+ Browser.mainLoop.method = ''; // just warn once per call to set main loop
+ }
+
+ Browser.mainLoop.runIter(function() {
+ if (typeof arg !== 'undefined') {
+ Runtime.dynCall('vi', func, [arg]);
+ } else {
+ Runtime.dynCall('v', func);
+ }
+ });
+
+ // catch pauses from the main loop itself
+ if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+
+ // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
+ // to queue the newest produced audio samples.
+ // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
+ // do not need to be hardcoded into this function, but can be more generic.
+ if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
+
+ Browser.mainLoop.scheduler();
+ }
+
+ if (!noSetTiming) {
+ if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
+ else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
+
+ Browser.mainLoop.scheduler();
+ }
+
+ if (simulateInfiniteLoop) {
+ throw 'SimulateInfiniteLoop';
+ }
+ }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
+ Browser.mainLoop.scheduler = null;
+ Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
+ },resume:function () {
+ Browser.mainLoop.currentlyRunningMainloop++;
+ var timingMode = Browser.mainLoop.timingMode;
+ var timingValue = Browser.mainLoop.timingValue;
+ var func = Browser.mainLoop.func;
+ Browser.mainLoop.func = null;
+ _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
+ _emscripten_set_main_loop_timing(timingMode, timingValue);
+ Browser.mainLoop.scheduler();
+ },updateStatus:function () {
+ if (Module['setStatus']) {
+ var message = Module['statusMessage'] || 'Please wait...';
+ var remaining = Browser.mainLoop.remainingBlockers;
+ var expected = Browser.mainLoop.expectedBlockers;
+ if (remaining) {
+ if (remaining < expected) {
+ Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
+ } else {
+ Module['setStatus'](message);
+ }
+ } else {
+ Module['setStatus']('');
+ }
+ }
+ },runIter:function (func) {
+ if (ABORT) return;
+ if (Module['preMainLoop']) {
+ var preRet = Module['preMainLoop']();
+ if (preRet === false) {
+ return; // |return false| skips a frame
+ }
+ }
+ try {
+ func();
+ } catch (e) {
+ if (e instanceof ExitStatus) {
+ return;
+ } else {
+ if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
+ throw e;
+ }
+ }
+ if (Module['postMainLoop']) Module['postMainLoop']();
+ }},isFullScreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
+ if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
+
+ if (Browser.initted) return;
+ Browser.initted = true;
+
+ try {
+ new Blob();
+ Browser.hasBlobConstructor = true;
+ } catch(e) {
+ Browser.hasBlobConstructor = false;
+ console.log("warning: no blob constructor, cannot create blobs with mimetypes");
+ }
+ Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
+ Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
+ if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
+ console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
+ Module.noImageDecoding = true;
+ }
+
+ // Support for plugins that can process preloaded files. You can add more of these to
+ // your app by creating and appending to Module.preloadPlugins.
+ //
+ // Each plugin is asked if it can handle a file based on the file's name. If it can,
+ // it is given the file's raw data. When it is done, it calls a callback with the file's
+ // (possibly modified) data. For example, a plugin might decompress a file, or it
+ // might create some side data structure for use later (like an Image element, etc.).
+
+ var imagePlugin = {};
+ imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
+ return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
+ };
+ imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
+ var b = null;
+ if (Browser.hasBlobConstructor) {
+ try {
+ b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+ if (b.size !== byteArray.length) { // Safari bug #118630
+ // Safari's Blob can only take an ArrayBuffer
+ b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
+ }
+ } catch(e) {
+ Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
+ }
+ }
+ if (!b) {
+ var bb = new Browser.BlobBuilder();
+ bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
+ b = bb.getBlob();
+ }
+ var url = Browser.URLObject.createObjectURL(b);
+ var img = new Image();
+ img.onload = function img_onload() {
+ assert(img.complete, 'Image ' + name + ' could not be decoded');
+ var canvas = document.createElement('canvas');
+ canvas.width = img.width;
+ canvas.height = img.height;
+ var ctx = canvas.getContext('2d');
+ ctx.drawImage(img, 0, 0);
+ Module["preloadedImages"][name] = canvas;
+ Browser.URLObject.revokeObjectURL(url);
+ if (onload) onload(byteArray);
+ };
+ img.onerror = function img_onerror(event) {
+ console.log('Image ' + url + ' could not be decoded');
+ if (onerror) onerror();
+ };
+ img.src = url;
+ };
+ Module['preloadPlugins'].push(imagePlugin);
+
+ var audioPlugin = {};
+ audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
+ return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
+ };
+ audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
+ var done = false;
+ function finish(audio) {
+ if (done) return;
+ done = true;
+ Module["preloadedAudios"][name] = audio;
+ if (onload) onload(byteArray);
+ }
+ function fail() {
+ if (done) return;
+ done = true;
+ Module["preloadedAudios"][name] = new Audio(); // empty shim
+ if (onerror) onerror();
+ }
+ if (Browser.hasBlobConstructor) {
+ try {
+ var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+ } catch(e) {
+ return fail();
+ }
+ var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
+ var audio = new Audio();
+ audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
+ audio.onerror = function audio_onerror(event) {
+ if (done) return;
+ console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
+ function encode64(data) {
+ var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+ var PAD = '=';
+ var ret = '';
+ var leftchar = 0;
+ var leftbits = 0;
+ for (var i = 0; i < data.length; i++) {
+ leftchar = (leftchar << 8) | data[i];
+ leftbits += 8;
+ while (leftbits >= 6) {
+ var curr = (leftchar >> (leftbits-6)) & 0x3f;
+ leftbits -= 6;
+ ret += BASE[curr];
+ }
+ }
+ if (leftbits == 2) {
+ ret += BASE[(leftchar&3) << 4];
+ ret += PAD + PAD;
+ } else if (leftbits == 4) {
+ ret += BASE[(leftchar&0xf) << 2];
+ ret += PAD;
+ }
+ return ret;
+ }
+ audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
+ finish(audio); // we don't wait for confirmation this worked - but it's worth trying
+ };
+ audio.src = url;
+ // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
+ Browser.safeSetTimeout(function() {
+ finish(audio); // try to use it even though it is not necessarily ready to play
+ }, 10000);
+ } else {
+ return fail();
+ }
+ };
+ Module['preloadPlugins'].push(audioPlugin);
+
+ // Canvas event setup
+
+ var canvas = Module['canvas'];
+ function pointerLockChange() {
+ Browser.pointerLock = document['pointerLockElement'] === canvas ||
+ document['mozPointerLockElement'] === canvas ||
+ document['webkitPointerLockElement'] === canvas ||
+ document['msPointerLockElement'] === canvas;
+ }
+ if (canvas) {
+ // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
+ // Module['forcedAspectRatio'] = 4 / 3;
+
+ canvas.requestPointerLock = canvas['requestPointerLock'] ||
+ canvas['mozRequestPointerLock'] ||
+ canvas['webkitRequestPointerLock'] ||
+ canvas['msRequestPointerLock'] ||
+ function(){};
+ canvas.exitPointerLock = document['exitPointerLock'] ||
+ document['mozExitPointerLock'] ||
+ document['webkitExitPointerLock'] ||
+ document['msExitPointerLock'] ||
+ function(){}; // no-op if function does not exist
+ canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
+
+
+ document.addEventListener('pointerlockchange', pointerLockChange, false);
+ document.addEventListener('mozpointerlockchange', pointerLockChange, false);
+ document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
+ document.addEventListener('mspointerlockchange', pointerLockChange, false);
+
+ if (Module['elementPointerLock']) {
+ canvas.addEventListener("click", function(ev) {
+ if (!Browser.pointerLock && canvas.requestPointerLock) {
+ canvas.requestPointerLock();
+ ev.preventDefault();
+ }
+ }, false);
+ }
+ }
+ },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
+ if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
+
+ var ctx;
+ var contextHandle;
+ if (useWebGL) {
+ // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
+ var contextAttributes = {
+ antialias: false,
+ alpha: false
+ };
+
+ if (webGLContextAttributes) {
+ for (var attribute in webGLContextAttributes) {
+ contextAttributes[attribute] = webGLContextAttributes[attribute];
+ }
+ }
+
+ contextHandle = GL.createContext(canvas, contextAttributes);
+ if (contextHandle) {
+ ctx = GL.getContext(contextHandle).GLctx;
+ }
+ // Set the background of the WebGL canvas to black
+ canvas.style.backgroundColor = "black";
+ } else {
+ ctx = canvas.getContext('2d');
+ }
+
+ if (!ctx) return null;
+
+ if (setInModule) {
+ if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
+
+ Module.ctx = ctx;
+ if (useWebGL) GL.makeContextCurrent(contextHandle);
+ Module.useWebGL = useWebGL;
+ Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
+ Browser.init();
+ }
+ return ctx;
+ },destroyContext:function (canvas, useWebGL, setInModule) {},fullScreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
+ Browser.lockPointer = lockPointer;
+ Browser.resizeCanvas = resizeCanvas;
+ Browser.vrDevice = vrDevice;
+ if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
+ if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
+ if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
+
+ var canvas = Module['canvas'];
+ function fullScreenChange() {
+ Browser.isFullScreen = false;
+ var canvasContainer = canvas.parentNode;
+ if ((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] ||
+ document['mozFullScreenElement'] || document['mozFullscreenElement'] ||
+ document['fullScreenElement'] || document['fullscreenElement'] ||
+ document['msFullScreenElement'] || document['msFullscreenElement'] ||
+ document['webkitCurrentFullScreenElement']) === canvasContainer) {
+ canvas.cancelFullScreen = document['cancelFullScreen'] ||
+ document['mozCancelFullScreen'] ||
+ document['webkitCancelFullScreen'] ||
+ document['msExitFullscreen'] ||
+ document['exitFullscreen'] ||
+ function() {};
+ canvas.cancelFullScreen = canvas.cancelFullScreen.bind(document);
+ if (Browser.lockPointer) canvas.requestPointerLock();
+ Browser.isFullScreen = true;
+ if (Browser.resizeCanvas) Browser.setFullScreenCanvasSize();
+ } else {
+
+ // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
+ canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+ canvasContainer.parentNode.removeChild(canvasContainer);
+
+ if (Browser.resizeCanvas) Browser.setWindowedCanvasSize();
+ }
+ if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullScreen);
+ Browser.updateCanvasDimensions(canvas);
+ }
+
+ if (!Browser.fullScreenHandlersInstalled) {
+ Browser.fullScreenHandlersInstalled = true;
+ document.addEventListener('fullscreenchange', fullScreenChange, false);
+ document.addEventListener('mozfullscreenchange', fullScreenChange, false);
+ document.addEventListener('webkitfullscreenchange', fullScreenChange, false);
+ document.addEventListener('MSFullscreenChange', fullScreenChange, false);
+ }
+
+ // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
+ var canvasContainer = document.createElement("div");
+ canvas.parentNode.insertBefore(canvasContainer, canvas);
+ canvasContainer.appendChild(canvas);
+
+ // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
+ canvasContainer.requestFullScreen = canvasContainer['requestFullScreen'] ||
+ canvasContainer['mozRequestFullScreen'] ||
+ canvasContainer['msRequestFullscreen'] ||
+ (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
+
+ if (vrDevice) {
+ canvasContainer.requestFullScreen({ vrDisplay: vrDevice });
+ } else {
+ canvasContainer.requestFullScreen();
+ }
+ },nextRAF:0,fakeRequestAnimationFrame:function (func) {
+ // try to keep 60fps between calls to here
+ var now = Date.now();
+ if (Browser.nextRAF === 0) {
+ Browser.nextRAF = now + 1000/60;
+ } else {
+ while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
+ Browser.nextRAF += 1000/60;
+ }
+ }
+ var delay = Math.max(Browser.nextRAF - now, 0);
+ setTimeout(func, delay);
+ },requestAnimationFrame:function requestAnimationFrame(func) {
+ if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
+ Browser.fakeRequestAnimationFrame(func);
+ } else {
+ if (!window.requestAnimationFrame) {
+ window.requestAnimationFrame = window['requestAnimationFrame'] ||
+ window['mozRequestAnimationFrame'] ||
+ window['webkitRequestAnimationFrame'] ||
+ window['msRequestAnimationFrame'] ||
+ window['oRequestAnimationFrame'] ||
+ Browser.fakeRequestAnimationFrame;
+ }
+ window.requestAnimationFrame(func);
+ }
+ },safeCallback:function (func) {
+ return function() {
+ if (!ABORT) return func.apply(null, arguments);
+ };
+ },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
+ Browser.allowAsyncCallbacks = false;
+ },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
+ Browser.allowAsyncCallbacks = true;
+ if (Browser.queuedAsyncCallbacks.length > 0) {
+ var callbacks = Browser.queuedAsyncCallbacks;
+ Browser.queuedAsyncCallbacks = [];
+ callbacks.forEach(function(func) {
+ func();
+ });
+ }
+ },safeRequestAnimationFrame:function (func) {
+ return Browser.requestAnimationFrame(function() {
+ if (ABORT) return;
+ if (Browser.allowAsyncCallbacks) {
+ func();
+ } else {
+ Browser.queuedAsyncCallbacks.push(func);
+ }
+ });
+ },safeSetTimeout:function (func, timeout) {
+ Module['noExitRuntime'] = true;
+ return setTimeout(function() {
+ if (ABORT) return;
+ if (Browser.allowAsyncCallbacks) {
+ func();
+ } else {
+ Browser.queuedAsyncCallbacks.push(func);
+ }
+ }, timeout);
+ },safeSetInterval:function (func, timeout) {
+ Module['noExitRuntime'] = true;
+ return setInterval(function() {
+ if (ABORT) return;
+ if (Browser.allowAsyncCallbacks) {
+ func();
+ } // drop it on the floor otherwise, next interval will kick in
+ }, timeout);
+ },getMimetype:function (name) {
+ return {
+ 'jpg': 'image/jpeg',
+ 'jpeg': 'image/jpeg',
+ 'png': 'image/png',
+ 'bmp': 'image/bmp',
+ 'ogg': 'audio/ogg',
+ 'wav': 'audio/wav',
+ 'mp3': 'audio/mpeg'
+ }[name.substr(name.lastIndexOf('.')+1)];
+ },getUserMedia:function (func) {
+ if(!window.getUserMedia) {
+ window.getUserMedia = navigator['getUserMedia'] ||
+ navigator['mozGetUserMedia'];
+ }
+ window.getUserMedia(func);
+ },getMovementX:function (event) {
+ return event['movementX'] ||
+ event['mozMovementX'] ||
+ event['webkitMovementX'] ||
+ 0;
+ },getMovementY:function (event) {
+ return event['movementY'] ||
+ event['mozMovementY'] ||
+ event['webkitMovementY'] ||
+ 0;
+ },getMouseWheelDelta:function (event) {
+ var delta = 0;
+ switch (event.type) {
+ case 'DOMMouseScroll':
+ delta = event.detail;
+ break;
+ case 'mousewheel':
+ delta = event.wheelDelta;
+ break;
+ case 'wheel':
+ delta = event['deltaY'];
+ break;
+ default:
+ throw 'unrecognized mouse wheel event: ' + event.type;
+ }
+ return delta;
+ },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
+ if (Browser.pointerLock) {
+ // When the pointer is locked, calculate the coordinates
+ // based on the movement of the mouse.
+ // Workaround for Firefox bug 764498
+ if (event.type != 'mousemove' &&
+ ('mozMovementX' in event)) {
+ Browser.mouseMovementX = Browser.mouseMovementY = 0;
+ } else {
+ Browser.mouseMovementX = Browser.getMovementX(event);
+ Browser.mouseMovementY = Browser.getMovementY(event);
+ }
+
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
+ Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
+ } else {
+ // just add the mouse delta to the current absolut mouse position
+ // FIXME: ideally this should be clamped against the canvas size and zero
+ Browser.mouseX += Browser.mouseMovementX;
+ Browser.mouseY += Browser.mouseMovementY;
+ }
+ } else {
+ // Otherwise, calculate the movement based on the changes
+ // in the coordinates.
+ var rect = Module["canvas"].getBoundingClientRect();
+ var cw = Module["canvas"].width;
+ var ch = Module["canvas"].height;
+
+ // Neither .scrollX or .pageXOffset are defined in a spec, but
+ // we prefer .scrollX because it is currently in a spec draft.
+ // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
+ var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
+ var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
+
+ if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
+ var touch = event.touch;
+ if (touch === undefined) {
+ return; // the "touch" property is only defined in SDL
+
+ }
+ var adjustedX = touch.pageX - (scrollX + rect.left);
+ var adjustedY = touch.pageY - (scrollY + rect.top);
+
+ adjustedX = adjustedX * (cw / rect.width);
+ adjustedY = adjustedY * (ch / rect.height);
+
+ var coords = { x: adjustedX, y: adjustedY };
+
+ if (event.type === 'touchstart') {
+ Browser.lastTouches[touch.identifier] = coords;
+ Browser.touches[touch.identifier] = coords;
+ } else if (event.type === 'touchend' || event.type === 'touchmove') {
+ var last = Browser.touches[touch.identifier];
+ if (!last) last = coords;
+ Browser.lastTouches[touch.identifier] = last;
+ Browser.touches[touch.identifier] = coords;
+ }
+ return;
+ }
+
+ var x = event.pageX - (scrollX + rect.left);
+ var y = event.pageY - (scrollY + rect.top);
+
+ // the canvas might be CSS-scaled compared to its backbuffer;
+ // SDL-using content will want mouse coordinates in terms
+ // of backbuffer units.
+ x = x * (cw / rect.width);
+ y = y * (ch / rect.height);
+
+ Browser.mouseMovementX = x - Browser.mouseX;
+ Browser.mouseMovementY = y - Browser.mouseY;
+ Browser.mouseX = x;
+ Browser.mouseY = y;
+ }
+ },xhrLoad:function (url, onload, onerror) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onload = function xhr_onload() {
+ if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+ onload(xhr.response);
+ } else {
+ onerror();
+ }
+ };
+ xhr.onerror = onerror;
+ xhr.send(null);
+ },asyncLoad:function (url, onload, onerror, noRunDep) {
+ Browser.xhrLoad(url, function(arrayBuffer) {
+ assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
+ onload(new Uint8Array(arrayBuffer));
+ if (!noRunDep) removeRunDependency('al ' + url);
+ }, function(event) {
+ if (onerror) {
+ onerror();
+ } else {
+ throw 'Loading data file "' + url + '" failed.';
+ }
+ });
+ if (!noRunDep) addRunDependency('al ' + url);
+ },resizeListeners:[],updateResizeListeners:function () {
+ var canvas = Module['canvas'];
+ Browser.resizeListeners.forEach(function(listener) {
+ listener(canvas.width, canvas.height);
+ });
+ },setCanvasSize:function (width, height, noUpdates) {
+ var canvas = Module['canvas'];
+ Browser.updateCanvasDimensions(canvas, width, height);
+ if (!noUpdates) Browser.updateResizeListeners();
+ },windowedWidth:0,windowedHeight:0,setFullScreenCanvasSize:function () {
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
+ flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
+ HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
+ }
+ Browser.updateResizeListeners();
+ },setWindowedCanvasSize:function () {
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
+ flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
+ HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
+ }
+ Browser.updateResizeListeners();
+ },updateCanvasDimensions:function (canvas, wNative, hNative) {
+ if (wNative && hNative) {
+ canvas.widthNative = wNative;
+ canvas.heightNative = hNative;
+ } else {
+ wNative = canvas.widthNative;
+ hNative = canvas.heightNative;
+ }
+ var w = wNative;
+ var h = hNative;
+ if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
+ if (w/h < Module['forcedAspectRatio']) {
+ w = Math.round(h * Module['forcedAspectRatio']);
+ } else {
+ h = Math.round(w / Module['forcedAspectRatio']);
+ }
+ }
+ if (((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] ||
+ document['mozFullScreenElement'] || document['mozFullscreenElement'] ||
+ document['fullScreenElement'] || document['fullscreenElement'] ||
+ document['msFullScreenElement'] || document['msFullscreenElement'] ||
+ document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
+ var factor = Math.min(screen.width / w, screen.height / h);
+ w = Math.round(w * factor);
+ h = Math.round(h * factor);
+ }
+ if (Browser.resizeCanvas) {
+ if (canvas.width != w) canvas.width = w;
+ if (canvas.height != h) canvas.height = h;
+ if (typeof canvas.style != 'undefined') {
+ canvas.style.removeProperty( "width");
+ canvas.style.removeProperty("height");
+ }
+ } else {
+ if (canvas.width != wNative) canvas.width = wNative;
+ if (canvas.height != hNative) canvas.height = hNative;
+ if (typeof canvas.style != 'undefined') {
+ if (w != wNative || h != hNative) {
+ canvas.style.setProperty( "width", w + "px", "important");
+ canvas.style.setProperty("height", h + "px", "important");
+ } else {
+ canvas.style.removeProperty( "width");
+ canvas.style.removeProperty("height");
+ }
+ }
+ }
+ },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
+ var handle = Browser.nextWgetRequestHandle;
+ Browser.nextWgetRequestHandle++;
+ return handle;
+ }};
+
+ function _glAttachShader(program, shader) {
+ GLctx.attachShader(GL.programs[program],
+ GL.shaders[shader]);
+ }
+
+ function _glfwGetPrimaryMonitor() {
+ return 1;
+ }
+
+
+ function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var data = GLctx.getVertexAttrib(index, pname);
+ if (typeof data == 'number' || typeof data == 'boolean') {
+ switch (type) {
+ case 'Integer': HEAP32[((params)>>2)]=data; break;
+ case 'Float': HEAPF32[((params)>>2)]=data; break;
+ case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
+ default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
+ case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
+ case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
+ default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+ }
+ }
+ }
+ }function _emscripten_glGetVertexAttribfv(index, pname, params) {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
+ }
+
+ function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart");
+ return 0;
+ }
+
+ function _glUniform3f(location, v0, v1, v2) {
+ location = GL.uniforms[location];
+ GLctx.uniform3f(location, v0, v1, v2);
+ }
+
+ function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+ function _emscripten_glDeleteBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((buffers)+(i*4))>>2)];
+ var buffer = GL.buffers[id];
+
+ // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+ // correspond to existing buffer objects."
+ if (!buffer) continue;
+
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+
+ if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+ if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+ }
+ }
+
+ function _emscripten_glTexParameteriv(target, pname, params) {
+ var param = HEAP32[((params)>>2)];
+ GLctx.texParameteri(target, pname, param);
+ }
+
+ function _glDrawElements(mode, count, type, indices) {
+
+ GLctx.drawElements(mode, count, type, indices);
+
+ }
+
+ function _glfwTerminate() {
+ window.removeEventListener("keydown", GLFW.onKeydown, true);
+ window.removeEventListener("keypress", GLFW.onKeyPress, true);
+ window.removeEventListener("keyup", GLFW.onKeyup, true);
+ Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
+ Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
+ Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
+ Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
+ Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
+ Module["canvas"].width = Module["canvas"].height = 1;
+ GLFW.windows = null;
+ GLFW.active = null;
+ }
+
+ function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform matrix
+ view = GL.miniTempBufferViews[3];
+ for (var i = 0; i < 4; i++) {
+ view[i] = HEAPF32[(((value)+(i*4))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+ }
+ GLctx.uniformMatrix2fv(location, transpose, view);
+ }
+
+ function _emscripten_glDeleteShader(id) {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+ }
+
+ function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // open
+ var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
+ var stream = FS.open(pathname, flags, mode);
+ return stream.fd;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // close
+ var stream = SYSCALLS.getStreamFromFD();
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function _llvm_stacksave() {
+ var self = _llvm_stacksave;
+ if (!self.LLVM_SAVEDSTACKS) {
+ self.LLVM_SAVEDSTACKS = [];
+ }
+ self.LLVM_SAVEDSTACKS.push(Runtime.stackSave());
+ return self.LLVM_SAVEDSTACKS.length-1;
+ }
+
+ function _emscripten_glGetVertexAttribiv(index, pname, params) {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
+ }
+
+ function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform matrix
+ view = GL.miniTempBufferViews[15];
+ for (var i = 0; i < 16; i++) {
+ view[i] = HEAPF32[(((value)+(i*4))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+ }
+ GLctx.uniformMatrix4fv(location, transpose, view);
+ }
+
+ function _glVertexAttrib3f(x0, x1, x2, x3) { GLctx.vertexAttrib3f(x0, x1, x2, x3) }
+
+ function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
+ GLctx['drawArraysInstanced'](mode, first, count, primcount);
+ }
+
+ function _emscripten_glEnableClientState() {
+ Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
+ }
+
+ function _emscripten_glGetPointerv() {
+ Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
+ }
+
+ function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // llseek
+ var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
+ var offset = offset_low;
+ assert(offset_high === 0);
+ FS.llseek(stream, offset, whence);
+ HEAP32[((result)>>2)]=stream.position;
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // writev
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doWritev(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // readv
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doReadv(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function _emscripten_glStencilMask(x0) { GLctx.stencilMask(x0) }
+
+ function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx.stencilFuncSeparate(x0, x1, x2, x3) }
+
+
+ Module["_i64Subtract"] = _i64Subtract;
+
+
+ Module["_i64Add"] = _i64Add;
+
+ function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend");
+ return 0;
+ }
+
+ function _glUseProgram(program) {
+ GLctx.useProgram(program ? GL.programs[program] : null);
+ }
+
+ var _sinf=Math_sin;
+
+ function _emscripten_glDisableVertexAttribArray(index) {
+ GLctx.disableVertexAttribArray(index);
+ }
+
+ function _emscripten_glVertexAttrib1f(x0, x1) { GLctx.vertexAttrib1f(x0, x1) }
+
+ function _emscripten_glFinish() { GLctx.finish() }
+
+ function _glDrawArrays(mode, first, count) {
+
+ GLctx.drawArrays(mode, first, count);
+
+ }
+
+ function _emscripten_glDepthFunc(x0) { GLctx.depthFunc(x0) }
+
+ function _sysconf(name) {
+ // long sysconf(int name);
+ // http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html
+ switch(name) {
+ case 30: return PAGE_SIZE;
+ case 85: return totalMemory / PAGE_SIZE;
+ case 132:
+ case 133:
+ case 12:
+ case 137:
+ case 138:
+ case 15:
+ case 235:
+ case 16:
+ case 17:
+ case 18:
+ case 19:
+ case 20:
+ case 149:
+ case 13:
+ case 10:
+ case 236:
+ case 153:
+ case 9:
+ case 21:
+ case 22:
+ case 159:
+ case 154:
+ case 14:
+ case 77:
+ case 78:
+ case 139:
+ case 80:
+ case 81:
+ case 82:
+ case 68:
+ case 67:
+ case 164:
+ case 11:
+ case 29:
+ case 47:
+ case 48:
+ case 95:
+ case 52:
+ case 51:
+ case 46:
+ return 200809;
+ case 79:
+ return 0;
+ case 27:
+ case 246:
+ case 127:
+ case 128:
+ case 23:
+ case 24:
+ case 160:
+ case 161:
+ case 181:
+ case 182:
+ case 242:
+ case 183:
+ case 184:
+ case 243:
+ case 244:
+ case 245:
+ case 165:
+ case 178:
+ case 179:
+ case 49:
+ case 50:
+ case 168:
+ case 169:
+ case 175:
+ case 170:
+ case 171:
+ case 172:
+ case 97:
+ case 76:
+ case 32:
+ case 173:
+ case 35:
+ return -1;
+ case 176:
+ case 177:
+ case 7:
+ case 155:
+ case 8:
+ case 157:
+ case 125:
+ case 126:
+ case 92:
+ case 93:
+ case 129:
+ case 130:
+ case 131:
+ case 94:
+ case 91:
+ return 1;
+ case 74:
+ case 60:
+ case 69:
+ case 70:
+ case 4:
+ return 1024;
+ case 31:
+ case 42:
+ case 72:
+ return 32;
+ case 87:
+ case 26:
+ case 33:
+ return 2147483647;
+ case 34:
+ case 1:
+ return 47839;
+ case 38:
+ case 36:
+ return 99;
+ case 43:
+ case 37:
+ return 2048;
+ case 0: return 2097152;
+ case 3: return 65536;
+ case 28: return 32768;
+ case 44: return 32767;
+ case 75: return 16384;
+ case 39: return 1000;
+ case 89: return 700;
+ case 71: return 256;
+ case 40: return 255;
+ case 2: return 100;
+ case 180: return 64;
+ case 25: return 20;
+ case 5: return 16;
+ case 6: return 6;
+ case 73: return 4;
+ case 84: {
+ if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1;
+ return 1;
+ }
+ }
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ }
+
+ function _emscripten_glUniform4iv(location, count, value) {
+ location = GL.uniforms[location];
+ count *= 4;
+ value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
+ GLctx.uniform4iv(location, value);
+ }
+
+ function _glClear(x0) { GLctx.clear(x0) }
+
+ function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+ function _emscripten_glUniform3fv(location, count, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform
+ view = GL.miniTempBufferViews[2];
+ view[0] = HEAPF32[((value)>>2)];
+ view[1] = HEAPF32[(((value)+(4))>>2)];
+ view[2] = HEAPF32[(((value)+(8))>>2)];
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
+ }
+ GLctx.uniform3fv(location, view);
+ }
+
+ function _emscripten_glIsTexture(texture) {
+ var texture = GL.textures[texture];
+ if (!texture) return 0;
+ return GLctx.isTexture(texture);
+ }
+
+ function _glEnableVertexAttribArray(index) {
+ GLctx.enableVertexAttribArray(index);
+ }
+
+ function _emscripten_glAttachShader(program, shader) {
+ GLctx.attachShader(GL.programs[program],
+ GL.shaders[shader]);
+ }
+
+ function _glUniform4f(location, v0, v1, v2, v3) {
+ location = GL.uniforms[location];
+ GLctx.uniform4f(location, v0, v1, v2, v3);
+ }
+
+ function _glfwCreateWindow(width, height, title, monitor, share) {
+ return GLFW.createWindow(width, height, title, monitor, share);
+ }
+
+ function _glfwDefaultWindowHints() {
+ GLFW.hints = GLFW.defaultHints;
+ }
+
+ function _pthread_cleanup_pop() {
+ assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!');
+ __ATEXIT__.pop();
+ _pthread_cleanup_push.level = __ATEXIT__.length;
+ }
+
+ function _emscripten_glClearStencil(x0) { GLctx.clearStencil(x0) }
+
+ function _emscripten_glDetachShader(program, shader) {
+ GLctx.detachShader(GL.programs[program],
+ GL.shaders[shader]);
+ }
+
+ function _emscripten_glDeleteVertexArrays(n, vaos) {
+ for(var i = 0; i < n; i++) {
+ var id = HEAP32[(((vaos)+(i*4))>>2)];
+ GLctx['deleteVertexArray'](GL.vaos[id]);
+ GL.vaos[id] = null;
+ }
+ }
+
+ function _glfwInit() {
+ if (GLFW.windows) return 1; // GL_TRUE
+
+ GLFW.initialTime = GLFW.getTime();
+ GLFW.hints = GLFW.defaultHints;
+ GLFW.windows = new Array()
+ GLFW.active = null;
+
+ window.addEventListener("keydown", GLFW.onKeydown, true);
+ window.addEventListener("keypress", GLFW.onKeyPress, true);
+ window.addEventListener("keyup", GLFW.onKeyup, true);
+ Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
+ Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
+ Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
+ Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
+ Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
+
+ Browser.resizeListeners.push(function(width, height) {
+ GLFW.onFullScreenEventChange();
+ });
+ return 1; // GL_TRUE
+ }
+
+ function _emscripten_glGetTexParameteriv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+ }
+
+ function _glfwSwapBuffers(winid) {
+ GLFW.swapBuffers(winid);
+ }
+
+ function _emscripten_glGenerateMipmap(x0) { GLctx.generateMipmap(x0) }
+
+ function _emscripten_glCullFace(x0) { GLctx.cullFace(x0) }
+
+ function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
+ location = GL.uniforms[location];
+ GLctx.uniform4f(location, v0, v1, v2, v3);
+ }
+
+ function _glDisableVertexAttribArray(index) {
+ GLctx.disableVertexAttribArray(index);
+ }
+
+ function _emscripten_glUseProgram(program) {
+ GLctx.useProgram(program ? GL.programs[program] : null);
+ }
+
+ function _emscripten_glHint(x0, x1) { GLctx.hint(x0, x1) }
+
+ function _emscripten_glUniform2fv(location, count, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform
+ view = GL.miniTempBufferViews[1];
+ view[0] = HEAPF32[((value)>>2)];
+ view[1] = HEAPF32[(((value)+(4))>>2)];
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
+ }
+ GLctx.uniform2fv(location, view);
+ }
+
+ function _glfwSwapInterval(interval) {
+ interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
+ if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
+ else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
+ }
+
+ function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ log = log.substr(0, maxLength - 1);
+ if (maxLength > 0 && infoLog) {
+ writeStringToMemory(log, infoLog);
+ if (length) HEAP32[((length)>>2)]=log.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+ function _abort() {
+ Module['abort']();
+ }
+
+ function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+ GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
+ GL.renderbuffers[renderbuffer]);
+ }
+
+ var _tan=Math_tan;
+
+ function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+ var heapView;
+ if (data) {
+ heapView = HEAPU8.subarray((data),(data+imageSize));
+ } else {
+ heapView = null;
+ }
+ GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView);
+ }
+
+ function _emscripten_glIsBuffer(buffer) {
+ var b = GL.buffers[buffer];
+ if (!b) return 0;
+ return GLctx.isBuffer(b);
+ }
+
+ function _emscripten_glUniform2iv(location, count, value) {
+ location = GL.uniforms[location];
+ count *= 2;
+ value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
+ GLctx.uniform2iv(location, value);
+ }
+
+ function _emscripten_glVertexAttrib1fv(index, v) {
+ v = HEAPF32.subarray((v)>>2,(v+4)>>2);
+ GLctx.vertexAttrib1fv(index, v);
+ }
+
+ function _glEnable(x0) { GLctx.enable(x0) }
+
+ var _fabs=Math_abs;
+
+
+
+ function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
+ function roundedToNextMultipleOf(x, y) {
+ return Math.floor((x + y - 1) / y) * y
+ }
+ var plainRowSize = width * sizePerPixel;
+ var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
+ return (height <= 0) ? 0 :
+ ((height - 1) * alignedRowSize + plainRowSize);
+ }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
+ var sizePerPixel;
+ var numChannels;
+ switch(format) {
+ case 0x1906 /* GL_ALPHA */:
+ case 0x1909 /* GL_LUMINANCE */:
+ case 0x1902 /* GL_DEPTH_COMPONENT */:
+ case 0x1903 /* GL_RED */:
+ numChannels = 1;
+ break;
+ case 0x190A /* GL_LUMINANCE_ALPHA */:
+ case 0x8227 /* GL_RG */:
+ numChannels = 2;
+ break;
+ case 0x1907 /* GL_RGB */:
+ case 0x8C40 /* GL_SRGB_EXT */:
+ numChannels = 3;
+ break;
+ case 0x1908 /* GL_RGBA */:
+ case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
+ numChannels = 4;
+ break;
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return {
+ pixels: null,
+ internalFormat: 0x0
+ };
+ }
+ switch (type) {
+ case 0x1401 /* GL_UNSIGNED_BYTE */:
+ sizePerPixel = numChannels*1;
+ break;
+ case 0x1403 /* GL_UNSIGNED_SHORT */:
+ case 0x8D61 /* GL_HALF_FLOAT_OES */:
+ sizePerPixel = numChannels*2;
+ break;
+ case 0x1405 /* GL_UNSIGNED_INT */:
+ case 0x1406 /* GL_FLOAT */:
+ sizePerPixel = numChannels*4;
+ break;
+ case 0x84FA /* UNSIGNED_INT_24_8_WEBGL/UNSIGNED_INT_24_8 */:
+ sizePerPixel = 4;
+ break;
+ case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
+ case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
+ case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
+ sizePerPixel = 2;
+ break;
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return {
+ pixels: null,
+ internalFormat: 0x0
+ };
+ }
+ var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
+ if (type == 0x1401 /* GL_UNSIGNED_BYTE */) {
+ pixels = HEAPU8.subarray((pixels),(pixels+bytes));
+ } else if (type == 0x1406 /* GL_FLOAT */) {
+ pixels = HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
+ } else if (type == 0x1405 /* GL_UNSIGNED_INT */ || type == 0x84FA /* UNSIGNED_INT_24_8_WEBGL */) {
+ pixels = HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
+ } else {
+ pixels = HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
+ }
+ return {
+ pixels: pixels,
+ internalFormat: internalFormat
+ };
+ }function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
+ var pixelData;
+ if (pixels) {
+ pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, -1).pixels;
+ } else {
+ pixelData = null;
+ }
+ GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
+ }
+
+ function _emscripten_glPolygonOffset(x0, x1) { GLctx.polygonOffset(x0, x1) }
+
+ var _emscripten_asm_const_int=true;
+
+ function _emscripten_glUniform2f(location, v0, v1) {
+ location = GL.uniforms[location];
+ GLctx.uniform2f(location, v0, v1);
+ }
+
+ function _glGetAttribLocation(program, name) {
+ program = GL.programs[program];
+ name = Pointer_stringify(name);
+ return GLctx.getAttribLocation(program, name);
+ }
+
+ function _glfwWindowHint(target, hint) {
+ GLFW.hints[target] = hint;
+ }
+
+ function _emscripten_glUniform2i(location, v0, v1) {
+ location = GL.uniforms[location];
+ GLctx.uniform2i(location, v0, v1);
+ }
+
+ function _glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) }
+
+ function _glCreateProgram() {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ program.name = id;
+ GL.programs[id] = program;
+ return id;
+ }
+
+ function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
+ var renderbuffer = GL.renderbuffers[id];
+ if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
+ GLctx.deleteRenderbuffer(renderbuffer);
+ renderbuffer.name = 0;
+ GL.renderbuffers[id] = null;
+ }
+ }
+
+ function _emscripten_glGetBufferParameteriv(target, value, data) {
+ if (!data) {
+ // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+ // if data == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
+ }
+
+
+ function emscriptenWebGLGetUniform(program, location, params, type) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
+ if (typeof data == 'number' || typeof data == 'boolean') {
+ switch (type) {
+ case 'Integer': HEAP32[((params)>>2)]=data; break;
+ case 'Float': HEAPF32[((params)>>2)]=data; break;
+ default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
+ case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
+ default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+ }
+ }
+ }
+ }function _emscripten_glGetUniformiv(program, location, params) {
+ emscriptenWebGLGetUniform(program, location, params, 'Integer');
+ }
+
+ function _emscripten_glDepthMask(x0) { GLctx.depthMask(x0) }
+
+
+ function _emscripten_glDepthRangef(x0, x1) { GLctx.depthRange(x0, x1) }
+
+ function _emscripten_glDepthRange(x0, x1) { GLctx.depthRange(x0, x1) }
+
+ function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) {
+ if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
+ if (!target) target = document;
+ else {
+ target = JSEvents.findEventTarget(target);
+ if (!target) return -4;
+ }
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange");
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange");
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange");
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange");
+ return 0;
+ }
+
+ function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
+ var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
+ HEAP32[((range)>>2)]=result.rangeMin;
+ HEAP32[(((range)+(4))>>2)]=result.rangeMax;
+ HEAP32[((precision)>>2)]=result.precision;
+ }
+
+ function _emscripten_glUniform1fv(location, count, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform
+ view = GL.miniTempBufferViews[0];
+ view[0] = HEAPF32[((value)>>2)];
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
+ }
+ GLctx.uniform1fv(location, view);
+ }
+
+ function _glDeleteBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((buffers)+(i*4))>>2)];
+ var buffer = GL.buffers[id];
+
+ // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+ // correspond to existing buffer objects."
+ if (!buffer) continue;
+
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+
+ if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+ if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+ }
+ }
+
+ var _atan2=Math_atan2;
+
+ function _emscripten_glBindProgramARB() {
+ Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
+ }
+
+ function _emscripten_glBindTexture(target, texture) {
+ GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
+ }
+
+ function _emscripten_glCheckFramebufferStatus(x0) { return GLctx.checkFramebufferStatus(x0) }
+
+ function _emscripten_glDeleteProgram(id) {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+ GL.programInfos[id] = null;
+ }
+
+ function _emscripten_glDisable(x0) { GLctx.disable(x0) }
+
+ function _emscripten_glVertexAttrib3fv(index, v) {
+ v = HEAPF32.subarray((v)>>2,(v+12)>>2);
+ GLctx.vertexAttrib3fv(index, v);
+ }
+
+ function _glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) }
+
+ function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
+ program = GL.programs[program];
+ var info = GLctx.getActiveAttrib(program, index);
+ if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
+
+ var infoname = info.name.slice(0, Math.max(0, bufSize - 1));
+ if (bufSize > 0 && name) {
+ writeStringToMemory(infoname, name);
+ if (length) HEAP32[((length)>>2)]=infoname.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+
+ if (size) HEAP32[((size)>>2)]=info.size;
+ if (type) HEAP32[((type)>>2)]=info.type;
+ }
+
+ function _emscripten_glIsFramebuffer(framebuffer) {
+ var fb = GL.framebuffers[framebuffer];
+ if (!fb) return 0;
+ return GLctx.isFramebuffer(fb);
+ }
+
+ function _emscripten_glLineWidth(x0) { GLctx.lineWidth(x0) }
+
+ function _glfwGetCursorPos(winid, x, y) {
+ GLFW.getCursorPos(winid, x, y);
+ }
+
+ function _emscripten_glGetString(name_) {
+ if (GL.stringCache[name_]) return GL.stringCache[name_];
+ var ret;
+ switch(name_) {
+ case 0x1F00 /* GL_VENDOR */:
+ case 0x1F01 /* GL_RENDERER */:
+ case 0x1F02 /* GL_VERSION */:
+ ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x1F03 /* GL_EXTENSIONS */:
+ var exts = GLctx.getSupportedExtensions();
+ var gl_exts = [];
+ for (var i in exts) {
+ gl_exts.push(exts[i]);
+ gl_exts.push("GL_" + exts[i]);
+ }
+ ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+ ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL);
+ break;
+ default:
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ return 0;
+ }
+ GL.stringCache[name_] = ret;
+ return ret;
+ }
+
+ function _emscripten_glGetAttribLocation(program, name) {
+ program = GL.programs[program];
+ name = Pointer_stringify(name);
+ return GLctx.getAttribLocation(program, name);
+ }
+
+ function _emscripten_glRotatef() {
+ Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
+ }
+
+
+ function emscriptenWebGLGet(name_, p, type) {
+ // Guard against user passing a null pointer.
+ // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
+ // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
+ // better to report an error instead of doing anything random.
+ if (!p) {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var ret = undefined;
+ switch(name_) { // Handle a few trivial GLES values
+ case 0x8DFA: // GL_SHADER_COMPILER
+ ret = 1;
+ break;
+ case 0x8DF8: // GL_SHADER_BINARY_FORMATS
+ if (type !== 'Integer' && type !== 'Integer64') {
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ }
+ return; // Do not write anything to the out pointer, since no binary formats are supported.
+ case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
+ ret = 0;
+ break;
+ case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
+ // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
+ // so implement it ourselves to allow C++ GLES2 code get the length.
+ var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
+ ret = formats.length;
+ break;
+ case 0x8B9A: // GL_IMPLEMENTATION_COLOR_READ_TYPE
+ ret = 0x1401; // GL_UNSIGNED_BYTE
+ break;
+ case 0x8B9B: // GL_IMPLEMENTATION_COLOR_READ_FORMAT
+ ret = 0x1908; // GL_RGBA
+ break;
+ }
+
+ if (ret === undefined) {
+ var result = GLctx.getParameter(name_);
+ switch (typeof(result)) {
+ case "number":
+ ret = result;
+ break;
+ case "boolean":
+ ret = result ? 1 : 0;
+ break;
+ case "string":
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ case "object":
+ if (result === null) {
+ // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
+ // can mean an invalid name_, which we need to report as an error
+ switch(name_) {
+ case 0x8894: // ARRAY_BUFFER_BINDING
+ case 0x8B8D: // CURRENT_PROGRAM
+ case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
+ case 0x8CA6: // FRAMEBUFFER_BINDING
+ case 0x8CA7: // RENDERBUFFER_BINDING
+ case 0x8069: // TEXTURE_BINDING_2D
+ case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
+ ret = 0;
+ break;
+ }
+ default: {
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ }
+ }
+ } else if (result instanceof Float32Array ||
+ result instanceof Uint32Array ||
+ result instanceof Int32Array ||
+ result instanceof Array) {
+ for (var i = 0; i < result.length; ++i) {
+ switch (type) {
+ case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break;
+ case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
+ case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break;
+ default: throw 'internal glGet error, bad type: ' + type;
+ }
+ }
+ return;
+ } else if (result instanceof WebGLBuffer ||
+ result instanceof WebGLProgram ||
+ result instanceof WebGLFramebuffer ||
+ result instanceof WebGLRenderbuffer ||
+ result instanceof WebGLTexture) {
+ ret = result.name | 0;
+ } else {
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ }
+ break;
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ }
+ }
+
+ switch (type) {
+ case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break;
+ case 'Integer': HEAP32[((p)>>2)]=ret; break;
+ case 'Float': HEAPF32[((p)>>2)]=ret; break;
+ case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
+ default: throw 'internal glGet error, bad type: ' + type;
+ }
+ }function _emscripten_glGetIntegerv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Integer');
+ }
+
+ function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
+ var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
+ HEAP32[((params)>>2)]=result;
+ }
+
+ function _llvm_stackrestore(p) {
+ var self = _llvm_stacksave;
+ var ret = self.LLVM_SAVEDSTACKS[p];
+ self.LLVM_SAVEDSTACKS.splice(p, 1);
+ Runtime.stackRestore(ret);
+ }
+
+ function _glfwSetWindowShouldClose(winid, value) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.shouldClose = value;
+ }
+
+ function _emscripten_glClientActiveTexture() {
+ Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
+ }
+
+ function _glGenBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx.createBuffer();
+ if (!buffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.buffers);
+ buffer.name = id;
+ GL.buffers[id] = buffer;
+ HEAP32[(((buffers)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ log = log.substr(0, maxLength - 1);
+ if (maxLength > 0 && infoLog) {
+ writeStringToMemory(log, infoLog);
+ if (length) HEAP32[((length)>>2)]=log.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _glfwGetTime() {
+ return GLFW.getTime() - GLFW.initialTime;
+ }
+
+ function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
+ }
+
+ function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx.stencilOpSeparate(x0, x1, x2, x3) }
+
+ function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
+ var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+ if (!data.pixels) {
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ return;
+ }
+ GLctx.readPixels(x, y, width, height, format, type, data.pixels);
+ }
+
+ function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
+ var heapView;
+ if (data) {
+ heapView = HEAPU8.subarray((data),(data+imageSize));
+ } else {
+ heapView = null;
+ }
+ GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, heapView);
+ }
+
+ function _emscripten_glGetError() {
+ // First return any GL error generated by the emscripten library_gl.js interop layer.
+ if (GL.lastError) {
+ var error = GL.lastError;
+ GL.lastError = 0/*GL_NO_ERROR*/;
+ return error;
+ } else { // If there were none, return the GL error from the browser GL context.
+ return GLctx.getError();
+ }
+ }
+
+ function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+ GLctx.framebufferTexture2D(target, attachment, textarget,
+ GL.textures[texture], level);
+ }
+
+ function _pthread_cleanup_push(routine, arg) {
+ __ATEXIT__.push(function() { Runtime.dynCall('vi', routine, [arg]) })
+ _pthread_cleanup_push.level = __ATEXIT__.length;
+ }
+
+ function _emscripten_glIsEnabled(x0) { return GLctx.isEnabled(x0) }
+
+ function _glClearDepthf(x0) { GLctx.clearDepth(x0) }
+
+
+ Module["_memmove"] = _memmove;
+
+ function _glGenTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var texture = GLctx.createTexture();
+ if (!texture) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
+ while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.textures);
+ texture.name = id;
+ GL.textures[id] = texture;
+ HEAP32[(((textures)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) }
+
+ function _glDepthFunc(x0) { GLctx.depthFunc(x0) }
+
+ function _emscripten_glClearDepthf(x0) { GLctx.clearDepth(x0) }
+
+ function _emscripten_glClear(x0) { GLctx.clear(x0) }
+
+ function _emscripten_glBindBuffer(target, buffer) {
+ var bufferObj = buffer ? GL.buffers[buffer] : null;
+
+
+ GLctx.bindBuffer(target, bufferObj);
+ }
+
+ function _emscripten_glGetUniformfv(program, location, params) {
+ emscriptenWebGLGetUniform(program, location, params, 'Float');
+ }
+
+ function _glGetProgramiv(program, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+ var ptable = GL.programInfos[program];
+ if (ptable) {
+ HEAP32[((p)>>2)]=ptable.maxUniformLength;
+ return;
+ } else if (program < GL.counter) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ } else {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ }
+ } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+ var ptable = GL.programInfos[program];
+ if (ptable) {
+ if (ptable.maxAttributeLength == -1) {
+ var program = GL.programs[program];
+ var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
+ ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+ for(var i = 0; i < numAttribs; ++i) {
+ var activeAttrib = GLctx.getActiveAttrib(program, i);
+ ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+ }
+ }
+ HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+ return;
+ } else if (program < GL.counter) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ } else {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ }
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+ }
+ }
+
+ function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+ GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr);
+ }
+
+ function _emscripten_glGetProgramiv(program, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+ var ptable = GL.programInfos[program];
+ if (ptable) {
+ HEAP32[((p)>>2)]=ptable.maxUniformLength;
+ return;
+ } else if (program < GL.counter) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ } else {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ }
+ } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+ var ptable = GL.programInfos[program];
+ if (ptable) {
+ if (ptable.maxAttributeLength == -1) {
+ var program = GL.programs[program];
+ var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
+ ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+ for(var i = 0; i < numAttribs; ++i) {
+ var activeAttrib = GLctx.getActiveAttrib(program, i);
+ ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+ }
+ }
+ HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+ return;
+ } else if (program < GL.counter) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ } else {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ }
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+ }
+ }
+
+ function _emscripten_glDrawRangeElements() {
+ Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
+ }
+
+ function _glGetUniformLocation(program, name) {
+ name = Pointer_stringify(name);
+
+ var arrayOffset = 0;
+ // If user passed an array accessor "[index]", parse the array index off the accessor.
+ if (name.indexOf(']', name.length-1) !== -1) {
+ var ls = name.lastIndexOf('[');
+ var arrayIndex = name.slice(ls+1, -1);
+ if (arrayIndex.length > 0) {
+ arrayOffset = parseInt(arrayIndex);
+ if (arrayOffset < 0) {
+ return -1;
+ }
+ }
+ name = name.slice(0, ls);
+ }
+
+ var ptable = GL.programInfos[program];
+ if (!ptable) {
+ return -1;
+ }
+ var utable = ptable.uniforms;
+ var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+ if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+ return uniformInfo[1]+arrayOffset;
+ } else {
+ return -1;
+ }
+ }
+
+ function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
+ var result = GLctx.getAttachedShaders(GL.programs[program]);
+ var len = result.length;
+ if (len > maxCount) {
+ len = maxCount;
+ }
+ HEAP32[((count)>>2)]=len;
+ for (var i = 0; i < len; ++i) {
+ var id = GL.shaders.indexOf(result[i]);
+ HEAP32[(((shaders)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glGenRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var renderbuffer = GLctx.createRenderbuffer();
+ if (!renderbuffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.renderbuffers);
+ renderbuffer.name = id;
+ GL.renderbuffers[id] = renderbuffer;
+ HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glFrontFace(x0) { GLctx.frontFace(x0) }
+
+ function _emscripten_glActiveTexture(x0) { GLctx.activeTexture(x0) }
+
+ function _emscripten_glUniform1iv(location, count, value) {
+ location = GL.uniforms[location];
+ value = HEAP32.subarray((value)>>2,(value+count*4)>>2);
+ GLctx.uniform1iv(location, value);
+ }
+
+ function _glUniform4fv(location, count, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform
+ view = GL.miniTempBufferViews[3];
+ view[0] = HEAPF32[((value)>>2)];
+ view[1] = HEAPF32[(((value)+(4))>>2)];
+ view[2] = HEAPF32[(((value)+(8))>>2)];
+ view[3] = HEAPF32[(((value)+(12))>>2)];
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+ }
+ GLctx.uniform4fv(location, view);
+ }
+
+ function _emscripten_glTexCoordPointer() {
+ Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
+ }
+
+ function _emscripten_glGetInfoLogARB() {
+ Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
+ }
+
+
+ function __exit(status) {
+ // void _exit(int status);
+ // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
+ Module['exit'](status);
+ }function _exit(status) {
+ __exit(status);
+ }
+
+ function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx.renderbufferStorage(x0, x1, x2, x3) }
+
+ function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) }
+
+ function _glfwSetCursorPosCallback(winid, cbfun) {
+ GLFW.setCursorPosCallback(winid, cbfun);
+ }
+
+ function _glBindAttribLocation(program, index, name) {
+ name = Pointer_stringify(name);
+ GLctx.bindAttribLocation(GL.programs[program], index, name);
+ }
+
+ function _emscripten_glShaderBinary() {
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ }
+
+ function _emscripten_glIsProgram(program) {
+ var program = GL.programs[program];
+ if (!program) return 0;
+ return GLctx.isProgram(program);
+ }
+
+ function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx.blendColor(x0, x1, x2, x3) }
+
+ function _emscripten_glGetShaderiv(shader, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+ }
+
+ function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform matrix
+ view = GL.miniTempBufferViews[8];
+ for (var i = 0; i < 9; i++) {
+ view[i] = HEAPF32[(((value)+(i*4))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
+ }
+ GLctx.uniformMatrix3fv(location, transpose, view);
+ }
+
+ function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx.vertexAttrib2f(x0, x1, x2) }
+
+ function _emscripten_glUniform4fv(location, count, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform
+ view = GL.miniTempBufferViews[3];
+ view[0] = HEAPF32[((value)>>2)];
+ view[1] = HEAPF32[(((value)+(4))>>2)];
+ view[2] = HEAPF32[(((value)+(8))>>2)];
+ view[3] = HEAPF32[(((value)+(12))>>2)];
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+ }
+ GLctx.uniform4fv(location, view);
+ }
+
+ function _glBufferSubData(target, offset, size, data) {
+ GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+ }
+
+ function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+
+ log = log.substr(0, maxLength - 1);
+ if (maxLength > 0 && infoLog) {
+ writeStringToMemory(log, infoLog);
+ if (length) HEAP32[((length)>>2)]=log.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _emscripten_glGenFramebuffers(n, ids) {
+ for (var i = 0; i < n; ++i) {
+ var framebuffer = GLctx.createFramebuffer();
+ if (!framebuffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.framebuffers);
+ framebuffer.name = id;
+ GL.framebuffers[id] = framebuffer;
+ HEAP32[(((ids)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _glGetShaderiv(shader, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+ }
+
+ function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx.blendEquationSeparate(x0, x1) }
+
+ function _glfwSetWindowIconifyCallback(winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowIconifyFunc = cbfun;
+ }
+
+ function _emscripten_glUniform1i(location, v0) {
+ location = GL.uniforms[location];
+ GLctx.uniform1i(location, v0);
+ }
+
+ function _emscripten_glGenTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var texture = GLctx.createTexture();
+ if (!texture) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
+ while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.textures);
+ texture.name = id;
+ GL.textures[id] = texture;
+ HEAP32[(((textures)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glVertexAttrib2fv(index, v) {
+ v = HEAPF32.subarray((v)>>2,(v+8)>>2);
+ GLctx.vertexAttrib2fv(index, v);
+ }
+
+ function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
+ program = GL.programs[program];
+ var info = GLctx.getActiveUniform(program, index);
+ if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
+
+ var infoname = info.name.slice(0, Math.max(0, bufSize - 1));
+ if (bufSize > 0 && name) {
+ writeStringToMemory(infoname, name);
+ if (length) HEAP32[((length)>>2)]=infoname.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+
+ if (size) HEAP32[((size)>>2)]=info.size;
+ if (type) HEAP32[((type)>>2)]=info.type;
+ }
+
+ function _emscripten_glDeleteObjectARB() {
+ Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
+ }
+
+ function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove");
+ return 0;
+ }
+
+ function _emscripten_glUniform1f(location, v0) {
+ location = GL.uniforms[location];
+ GLctx.uniform1f(location, v0);
+ }
+
+ function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+ GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr);
+ }
+
+ function _glShaderSource(shader, count, string, length) {
+ var source = GL.getSource(shader, count, string, length);
+ GLctx.shaderSource(GL.shaders[shader], source);
+ }
+
+ var _sqrtf=Math_sqrt;
+
+ function _emscripten_glDrawArrays(mode, first, count) {
+
+ GLctx.drawArrays(mode, first, count);
+
+ }
+
+ function _emscripten_glGenBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx.createBuffer();
+ if (!buffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.buffers);
+ buffer.name = id;
+ GL.buffers[id] = buffer;
+ HEAP32[(((buffers)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glClearDepth(x0) { GLctx.clearDepth(x0) }
+
+ function _glfwSetCharCallback(winid, cbfun) {
+ GLFW.setCharCallback(winid, cbfun);
+ }
+
+ function _emscripten_glGetUniformLocation(program, name) {
+ name = Pointer_stringify(name);
+
+ var arrayOffset = 0;
+ // If user passed an array accessor "[index]", parse the array index off the accessor.
+ if (name.indexOf(']', name.length-1) !== -1) {
+ var ls = name.lastIndexOf('[');
+ var arrayIndex = name.slice(ls+1, -1);
+ if (arrayIndex.length > 0) {
+ arrayOffset = parseInt(arrayIndex);
+ if (arrayOffset < 0) {
+ return -1;
+ }
+ }
+ name = name.slice(0, ls);
+ }
+
+ var ptable = GL.programInfos[program];
+ if (!ptable) {
+ return -1;
+ }
+ var utable = ptable.uniforms;
+ var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+ if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+ return uniformInfo[1]+arrayOffset;
+ } else {
+ return -1;
+ }
+ }
+
+ function _glActiveTexture(x0) { GLctx.activeTexture(x0) }
+
+ function _glBindBuffer(target, buffer) {
+ var bufferObj = buffer ? GL.buffers[buffer] : null;
+
+
+ GLctx.bindBuffer(target, bufferObj);
+ }
+
+ function _emscripten_glVertexAttrib4fv(index, v) {
+ v = HEAPF32.subarray((v)>>2,(v+16)>>2);
+ GLctx.vertexAttrib4fv(index, v);
+ }
+
+ function _emscripten_glScissor(x0, x1, x2, x3) { GLctx.scissor(x0, x1, x2, x3) }
+
+ function _glfwSetCursorEnterCallback(winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.cursorEnterFunc = cbfun;
+ }
+
+
+ Module["_bitshift64Lshr"] = _bitshift64Lshr;
+
+ function _glBufferData(target, size, data, usage) {
+ switch (usage) { // fix usages, WebGL only has *_DRAW
+ case 0x88E1: // GL_STREAM_READ
+ case 0x88E2: // GL_STREAM_COPY
+ usage = 0x88E0; // GL_STREAM_DRAW
+ break;
+ case 0x88E5: // GL_STATIC_READ
+ case 0x88E6: // GL_STATIC_COPY
+ usage = 0x88E4; // GL_STATIC_DRAW
+ break;
+ case 0x88E9: // GL_DYNAMIC_READ
+ case 0x88EA: // GL_DYNAMIC_COPY
+ usage = 0x88E8; // GL_DYNAMIC_DRAW
+ break;
+ }
+ if (!data) {
+ GLctx.bufferData(target, size, usage);
+ } else {
+ GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
+ }
+ }
+
+ var _BDtoIHigh=true;
+
+ function _emscripten_glIsShader(shader) {
+ var s = GL.shaders[shader];
+ if (!s) return 0;
+ return GLctx.isShader(s);
+ }
+
+ function _emscripten_glDrawBuffers(n, bufs) {
+ var bufArray = [];
+ for (var i = 0; i < n; i++)
+ bufArray.push(HEAP32[(((bufs)+(i*4))>>2)]);
+
+ GLctx['drawBuffers'](bufArray);
+ }
+
+ function _emscripten_glBindFramebuffer(target, framebuffer) {
+ GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
+ }
+
+ function _emscripten_glBlendEquation(x0) { GLctx.blendEquation(x0) }
+
+ function _emscripten_glBufferSubData(target, offset, size, data) {
+ GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+ }
+
+ function _emscripten_glBufferData(target, size, data, usage) {
+ switch (usage) { // fix usages, WebGL only has *_DRAW
+ case 0x88E1: // GL_STREAM_READ
+ case 0x88E2: // GL_STREAM_COPY
+ usage = 0x88E0; // GL_STREAM_DRAW
+ break;
+ case 0x88E5: // GL_STATIC_READ
+ case 0x88E6: // GL_STATIC_COPY
+ usage = 0x88E4; // GL_STATIC_DRAW
+ break;
+ case 0x88E9: // GL_DYNAMIC_READ
+ case 0x88EA: // GL_DYNAMIC_COPY
+ usage = 0x88E8; // GL_DYNAMIC_DRAW
+ break;
+ }
+ if (!data) {
+ GLctx.bufferData(target, size, usage);
+ } else {
+ GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
+ }
+ }
+
+ function _sbrk(bytes) {
+ // Implement a Linux-like 'memory area' for our 'process'.
+ // Changes the size of the memory area by |bytes|; returns the
+ // address of the previous top ('break') of the memory area
+ // We control the "dynamic" memory - DYNAMIC_BASE to DYNAMICTOP
+ var self = _sbrk;
+ if (!self.called) {
+ DYNAMICTOP = alignMemoryPage(DYNAMICTOP); // make sure we start out aligned
+ self.called = true;
+ assert(Runtime.dynamicAlloc);
+ self.alloc = Runtime.dynamicAlloc;
+ Runtime.dynamicAlloc = function() { abort('cannot dynamically allocate, sbrk now has control') };
+ }
+ var ret = DYNAMICTOP;
+ if (bytes != 0) {
+ var success = self.alloc(bytes);
+ if (!success) return -1 >>> 0; // sbrk failure code
+ }
+ return ret; // Previous break location.
+ }
+
+
+ Module["_bitshift64Shl"] = _bitshift64Shl;
+
+ var _BItoD=true;
+
+ function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
+ var result = GLctx.getShaderSource(GL.shaders[shader]);
+ if (!result) return; // If an error occurs, nothing will be written to length or source.
+ result = result.slice(0, Math.max(0, bufSize - 1));
+ if (bufSize > 0 && source) {
+ writeStringToMemory(result, source);
+ if (length) HEAP32[((length)>>2)]=result.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _glfwSetKeyCallback(winid, cbfun) {
+ GLFW.setKeyCallback(winid, cbfun);
+ }
+
+ function _emscripten_glGetFloatv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Float');
+ }
+
+ function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+ var pixelData;
+ if (pixels) {
+ var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
+ pixelData = data.pixels;
+ internalFormat = data.internalFormat;
+ } else {
+ pixelData = null;
+ }
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+ }
+
+ function ___assert_fail(condition, filename, line, func) {
+ ABORT = true;
+ throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace();
+ }
+
+ function _emscripten_glVertexAttribDivisor(index, divisor) {
+ GLctx['vertexAttribDivisor'](index, divisor);
+ }
+
+ function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
+ GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
+ }
+
+ function _emscripten_glDrawElements(mode, count, type, indices) {
+
+ GLctx.drawElements(mode, count, type, indices);
+
+ }
+
+ function _glfwSetMouseButtonCallback(winid, cbfun) {
+ GLFW.setMouseButtonCallback(winid, cbfun);
+ }
+
+ function _emscripten_glCreateProgram() {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ program.name = id;
+ GL.programs[id] = program;
+ return id;
+ }
+
+ function _emscripten_glDeleteFramebuffers(n, framebuffers) {
+ for (var i = 0; i < n; ++i) {
+ var id = HEAP32[(((framebuffers)+(i*4))>>2)];
+ var framebuffer = GL.framebuffers[id];
+ if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+ GLctx.deleteFramebuffer(framebuffer);
+ framebuffer.name = 0;
+ GL.framebuffers[id] = null;
+ }
+ }
+
+ function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) }
+
+ function _emscripten_glBindVertexArray(vao) {
+ GLctx['bindVertexArray'](GL.vaos[vao]);
+ }
+
+ function _emscripten_glLoadMatrixf() {
+ Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
+ }
+
+ function _glDeleteShader(id) {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+ }
+
+ function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+
+ log = log.substr(0, maxLength - 1);
+ if (maxLength > 0 && infoLog) {
+ writeStringToMemory(log, infoLog);
+ if (length) HEAP32[((length)>>2)]=log.length;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+ var pixelData;
+ if (pixels) {
+ var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
+ pixelData = data.pixels;
+ internalFormat = data.internalFormat;
+ } else {
+ pixelData = null;
+ }
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+ }
+
+ function _glPixelStorei(pname, param) {
+ if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
+ GL.packAlignment = param;
+ } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+ GL.unpackAlignment = param;
+ }
+ GLctx.pixelStorei(pname, param);
+ }
+
+ function ___unlock() {}
+
+ function _emscripten_glColorPointer() {
+ Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
+ }
+
+ function _glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) }
+
+ function _glfwPollEvents() {}
+
+ function _glVertexAttrib2f(x0, x1, x2) { GLctx.vertexAttrib2f(x0, x1, x2) }
+
+ function _glfwDestroyWindow(winid) {
+ return GLFW.destroyWindow(winid);
+ }
+
+ function _emscripten_glFlush() { GLctx.flush() }
+
+ function _glfwSetErrorCallback(cbfun) {
+ GLFW.errorFunc = cbfun;
+ }
+
+ function _emscripten_glCreateShader(shaderType) {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+ return id;
+ }
+
+ function _glUniformMatrix4fv(location, count, transpose, value) {
+ location = GL.uniforms[location];
+ var view;
+ if (count === 1) {
+ // avoid allocation for the common case of uploading one uniform matrix
+ view = GL.miniTempBufferViews[15];
+ for (var i = 0; i < 16; i++) {
+ view[i] = HEAPF32[(((value)+(i*4))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+ }
+ GLctx.uniformMatrix4fv(location, transpose, view);
+ }
+
+ function _emscripten_glValidateProgram(program) {
+ GLctx.validateProgram(GL.programs[program]);
+ }
+
+ function _glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) }
+
+ function _glFrontFace(x0) { GLctx.frontFace(x0) }
+
+ function _emscripten_glColorMask(x0, x1, x2, x3) { GLctx.colorMask(x0, x1, x2, x3) }
+
+ function _emscripten_glPixelStorei(pname, param) {
+ if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
+ GL.packAlignment = param;
+ } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+ GL.unpackAlignment = param;
+ }
+ GLctx.pixelStorei(pname, param);
+ }
+
+ function _emscripten_glDeleteTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((textures)+(i*4))>>2)];
+ var texture = GL.textures[id];
+ if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+ }
+
+ function _emscripten_glCompileShader(shader) {
+ GLctx.compileShader(GL.shaders[shader]);
+ }
+
+ function _emscripten_glGenVertexArrays(n, arrays) {
+
+ for(var i = 0; i < n; i++) {
+ var vao = GLctx['createVertexArray']();
+ if (!vao) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.vaos);
+ vao.name = id;
+ GL.vaos[id] = vao;
+ HEAP32[(((arrays)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _time(ptr) {
+ var ret = (Date.now()/1000)|0;
+ if (ptr) {
+ HEAP32[((ptr)>>2)]=ret;
+ }
+ return ret;
+ }
+
+ function _pthread_self() {
+ //FIXME: assumes only a single thread
+ return 0;
+ }
+
+ function _emscripten_glGetBooleanv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Boolean');
+ }
+
+ function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // fcntl64
+ var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
+ switch (cmd) {
+ case 0: {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -ERRNO_CODES.EINVAL;
+ }
+ var newStream;
+ newStream = FS.open(stream.path, stream.flags, 0, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 12:
+ case 12: {
+ var arg = SYSCALLS.get();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(((arg)+(offset))>>1)]=2;
+ return 0;
+ }
+ case 13:
+ case 14:
+ case 13:
+ case 14:
+ return 0; // Pretend that the locking is successful.
+ case 16:
+ case 8:
+ return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
+ case 9:
+ // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ default: {
+ return -ERRNO_CODES.EINVAL;
+ }
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+var GLctx; GL.init()
+FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;
+__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });
+if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); }
+Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
+ Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
+ Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
+ Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
+ Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
+ Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
+ Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) }
+STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
+
+staticSealed = true; // seal the static portion of memory
+
+STACK_MAX = STACK_BASE + TOTAL_STACK;
+
+DYNAMIC_BASE = DYNAMICTOP = Runtime.alignMemory(STACK_MAX);
+
+assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");
+
+ var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_DYNAMIC);
+
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+ try {
+ Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vd(index,a1) {
+ try {
+ Module["dynCall_vd"](index,a1);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vid(index,a1,a2) {
+ try {
+ Module["dynCall_vid"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vi(index,a1) {
+ try {
+ Module["dynCall_vi"](index,a1);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vii(index,a1,a2) {
+ try {
+ Module["dynCall_vii"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_ii(index,a1) {
+ try {
+ return Module["dynCall_ii"](index,a1);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viddd(index,a1,a2,a3,a4) {
+ try {
+ Module["dynCall_viddd"](index,a1,a2,a3,a4);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vidd(index,a1,a2,a3) {
+ try {
+ Module["dynCall_vidd"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+ try {
+ return Module["dynCall_iiii"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ try {
+ Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ try {
+ Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+ try {
+ Module["dynCall_viii"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vidddd(index,a1,a2,a3,a4,a5) {
+ try {
+ Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdi(index,a1,a2) {
+ try {
+ Module["dynCall_vdi"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ try {
+ Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ try {
+ Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_iii(index,a1,a2) {
+ try {
+ return Module["dynCall_iii"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_i(index) {
+ try {
+ return Module["dynCall_i"](index);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
+ try {
+ return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
+ try {
+ Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdddd(index,a1,a2,a3,a4) {
+ try {
+ Module["dynCall_vdddd"](index,a1,a2,a3,a4);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdd(index,a1,a2) {
+ try {
+ Module["dynCall_vdd"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_v(index) {
+ try {
+ Module["dynCall_v"](index);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viid(index,a1,a2,a3) {
+ try {
+ Module["dynCall_viid"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+ try {
+ Module["dynCall_viiii"](index,a1,a2,a3,a4);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ asm["setThrew"](1, 0);
+ }
+}
+
+Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };
+
+Module.asmLibraryArg = { "abort": abort, "assert": assert, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_iiiiii": invoke_iiiiii, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_eglGetProcAddress": _eglGetProcAddress, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_glVertexAttrib4f": _glVertexAttrib4f, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_sbrk": _sbrk, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_sysconf": _sysconf, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_fabs": _fabs, "_glUniform4f": _glUniform4f, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_tan": _tan, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_glVertexAttrib3f": _glVertexAttrib3f, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_pthread_cleanup_push": _pthread_cleanup_push, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "___syscall146": ___syscall146, "_glfwDestroyWindow": _glfwDestroyWindow, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_atan2": _atan2, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glClear": _emscripten_glClear, "_glDrawElements": _glDrawElements, "_glBufferSubData": _glBufferSubData, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_glUniform3f": _glUniform3f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_glGenTextures": _glGenTextures, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_glGetString": _glGetString, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_glCreateShader": _glCreateShader, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_eglWaitClient": _eglWaitClient, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glEnable": _emscripten_glEnable, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "_glDisable": _glDisable, "___lock": ___lock, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_glBindFramebuffer": _glBindFramebuffer, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_asm_const_2": _emscripten_asm_const_2, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_glCullFace": _glCullFace, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_glfwPollEvents": _glfwPollEvents, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_glfwGetVideoModes": _glfwGetVideoModes, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "___syscall221": ___syscall221, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_glClearDepthf": _glClearDepthf, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glDisable": _emscripten_glDisable, "_glfwSetCharCallback": _glfwSetCharCallback, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glHint": _emscripten_glHint, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_sqrtf": _sqrtf, "_glActiveTexture": _glActiveTexture, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_glfwTerminate": _glfwTerminate, "_glFrontFace": _glFrontFace, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_glfwSwapInterval": _glfwSwapInterval, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_glUniform1f": _glUniform1f, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_glGetProgramiv": _glGetProgramiv, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_glUniform4fv": _glUniform4fv, "_emscripten_glFrustum": _emscripten_glFrustum, "_glVertexAttrib2f": _glVertexAttrib2f, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_sinf": _sinf, "__exit": __exit, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glBindAttribLocation": _glBindAttribLocation, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_pthread_self": _pthread_self, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_cosf": _cosf, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_glTexParameteri": _glTexParameteri, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "cttz_i8": cttz_i8 };
+// EMSCRIPTEN_START_ASM
+var asm = (function(global, env, buffer) {
+ 'use asm';
+
+
+ var HEAP8 = new global.Int8Array(buffer);
+ var HEAP16 = new global.Int16Array(buffer);
+ var HEAP32 = new global.Int32Array(buffer);
+ var HEAPU8 = new global.Uint8Array(buffer);
+ var HEAPU16 = new global.Uint16Array(buffer);
+ var HEAPU32 = new global.Uint32Array(buffer);
+ var HEAPF32 = new global.Float32Array(buffer);
+ var HEAPF64 = new global.Float64Array(buffer);
+
+
+ var STACKTOP=env.STACKTOP|0;
+ var STACK_MAX=env.STACK_MAX|0;
+ var tempDoublePtr=env.tempDoublePtr|0;
+ var ABORT=env.ABORT|0;
+ var cttz_i8=env.cttz_i8|0;
+
+ var __THREW__ = 0;
+ var threwValue = 0;
+ var setjmpId = 0;
+ var undef = 0;
+ var nan = global.NaN, inf = global.Infinity;
+ var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
+
+ var tempRet0 = 0;
+ var tempRet1 = 0;
+ var tempRet2 = 0;
+ var tempRet3 = 0;
+ var tempRet4 = 0;
+ var tempRet5 = 0;
+ var tempRet6 = 0;
+ var tempRet7 = 0;
+ var tempRet8 = 0;
+ var tempRet9 = 0;
+ var Math_floor=global.Math.floor;
+ var Math_abs=global.Math.abs;
+ var Math_sqrt=global.Math.sqrt;
+ var Math_pow=global.Math.pow;
+ var Math_cos=global.Math.cos;
+ var Math_sin=global.Math.sin;
+ var Math_tan=global.Math.tan;
+ var Math_acos=global.Math.acos;
+ var Math_asin=global.Math.asin;
+ var Math_atan=global.Math.atan;
+ var Math_atan2=global.Math.atan2;
+ var Math_exp=global.Math.exp;
+ var Math_log=global.Math.log;
+ var Math_ceil=global.Math.ceil;
+ var Math_imul=global.Math.imul;
+ var Math_min=global.Math.min;
+ var Math_clz32=global.Math.clz32;
+ var abort=env.abort;
+ var assert=env.assert;
+ var invoke_viiiii=env.invoke_viiiii;
+ var invoke_vd=env.invoke_vd;
+ var invoke_vid=env.invoke_vid;
+ var invoke_vi=env.invoke_vi;
+ var invoke_vii=env.invoke_vii;
+ var invoke_ii=env.invoke_ii;
+ var invoke_viddd=env.invoke_viddd;
+ var invoke_vidd=env.invoke_vidd;
+ var invoke_iiii=env.invoke_iiii;
+ var invoke_viiiiiiii=env.invoke_viiiiiiii;
+ var invoke_viiiiii=env.invoke_viiiiii;
+ var invoke_viii=env.invoke_viii;
+ var invoke_vidddd=env.invoke_vidddd;
+ var invoke_vdi=env.invoke_vdi;
+ var invoke_viiiiiii=env.invoke_viiiiiii;
+ var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
+ var invoke_iii=env.invoke_iii;
+ var invoke_i=env.invoke_i;
+ var invoke_iiiiii=env.invoke_iiiiii;
+ var invoke_vdddddd=env.invoke_vdddddd;
+ var invoke_vdddd=env.invoke_vdddd;
+ var invoke_vdd=env.invoke_vdd;
+ var invoke_v=env.invoke_v;
+ var invoke_viid=env.invoke_viid;
+ var invoke_viiii=env.invoke_viiii;
+ var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
+ var _glUseProgram=env._glUseProgram;
+ var _emscripten_glShaderSource=env._emscripten_glShaderSource;
+ var _glfwCreateWindow=env._glfwCreateWindow;
+ var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
+ var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
+ var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
+ var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
+ var _emscripten_glCullFace=env._emscripten_glCullFace;
+ var _emscripten_glIsProgram=env._emscripten_glIsProgram;
+ var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
+ var _emscripten_glViewport=env._emscripten_glViewport;
+ var _emscripten_glFrontFace=env._emscripten_glFrontFace;
+ var _eglGetProcAddress=env._eglGetProcAddress;
+ var ___assert_fail=env.___assert_fail;
+ var _glDeleteProgram=env._glDeleteProgram;
+ var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
+ var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
+ var _emscripten_glUseProgram=env._emscripten_glUseProgram;
+ var _glVertexAttrib4f=env._glVertexAttrib4f;
+ var _glBindBuffer=env._glBindBuffer;
+ var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
+ var _glGetShaderInfoLog=env._glGetShaderInfoLog;
+ var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback;
+ var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback;
+ var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing;
+ var _sbrk=env._sbrk;
+ var _glBlendFunc=env._glBlendFunc;
+ var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
+ var _glGetAttribLocation=env._glGetAttribLocation;
+ var _glDisableVertexAttribArray=env._glDisableVertexAttribArray;
+ var _emscripten_memcpy_big=env._emscripten_memcpy_big;
+ var _emscripten_glReadPixels=env._emscripten_glReadPixels;
+ var _sysconf=env._sysconf;
+ var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
+ var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
+ var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback;
+ var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
+ var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
+ var _fabs=env._fabs;
+ var _glUniform4f=env._glUniform4f;
+ var _llvm_stacksave=env._llvm_stacksave;
+ var _emscripten_glUniform1i=env._emscripten_glUniform1i;
+ var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
+ var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
+ var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback;
+ var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
+ var _glfwInit=env._glfwInit;
+ var _tan=env._tan;
+ var _glGenBuffers=env._glGenBuffers;
+ var _glShaderSource=env._glShaderSource;
+ var _emscripten_glGetString=env._emscripten_glGetString;
+ var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
+ var _glVertexAttrib3f=env._glVertexAttrib3f;
+ var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
+ var _emscripten_glScissor=env._emscripten_glScissor;
+ var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
+ var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
+ var _pthread_cleanup_push=env._pthread_cleanup_push;
+ var ___syscall145=env.___syscall145;
+ var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
+ var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
+ var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
+ var ___syscall140=env.___syscall140;
+ var _glfwSetErrorCallback=env._glfwSetErrorCallback;
+ var _glfwDefaultWindowHints=env._glfwDefaultWindowHints;
+ var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
+ var ___syscall146=env.___syscall146;
+ var _glfwDestroyWindow=env._glfwDestroyWindow;
+ var _pthread_cleanup_pop=env._pthread_cleanup_pop;
+ var _emscripten_glColorPointer=env._emscripten_glColorPointer;
+ var _emscripten_glAttachShader=env._emscripten_glAttachShader;
+ var _glVertexAttribPointer=env._glVertexAttribPointer;
+ var _emscripten_glUniform2i=env._emscripten_glUniform2i;
+ var _emscripten_glUniform2f=env._emscripten_glUniform2f;
+ var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
+ var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
+ var _atan2=env._atan2;
+ var _glGetProgramInfoLog=env._glGetProgramInfoLog;
+ var _glfwSetScrollCallback=env._glfwSetScrollCallback;
+ var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
+ var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
+ var _emscripten_glGenTextures=env._emscripten_glGenTextures;
+ var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
+ var _llvm_stackrestore=env._llvm_stackrestore;
+ var _glfwMakeContextCurrent=env._glfwMakeContextCurrent;
+ var _emscripten_glClear=env._emscripten_glClear;
+ var _glDrawElements=env._glDrawElements;
+ var _glBufferSubData=env._glBufferSubData;
+ var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
+ var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
+ var _glViewport=env._glViewport;
+ var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
+ var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
+ var ___setErrNo=env.___setErrNo;
+ var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
+ var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
+ var _glDeleteTextures=env._glDeleteTextures;
+ var _glDepthFunc=env._glDepthFunc;
+ var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
+ var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
+ var _glUniform3f=env._glUniform3f;
+ var _emscripten_glFlush=env._emscripten_glFlush;
+ var _emscripten_glUniform4i=env._emscripten_glUniform4i;
+ var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
+ var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
+ var _emscripten_glGetError=env._emscripten_glGetError;
+ var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
+ var _emscripten_glBufferData=env._emscripten_glBufferData;
+ var _emscripten_glUniform3i=env._emscripten_glUniform3i;
+ var _emscripten_glRotatef=env._emscripten_glRotatef;
+ var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
+ var _glEnable=env._glEnable;
+ var _glGenTextures=env._glGenTextures;
+ var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
+ var _glGetString=env._glGetString;
+ var _emscripten_glClearStencil=env._emscripten_glClearStencil;
+ var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
+ var emscriptenWebGLGet=env.emscriptenWebGLGet;
+ var _glCreateShader=env._glCreateShader;
+ var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
+ var _eglWaitClient=env._eglWaitClient;
+ var _emscripten_get_now=env._emscripten_get_now;
+ var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
+ var _glAttachShader=env._glAttachShader;
+ var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
+ var _emscripten_glEnable=env._emscripten_glEnable;
+ var _glCreateProgram=env._glCreateProgram;
+ var _glUniformMatrix4fv=env._glUniformMatrix4fv;
+ var _emscripten_glClearDepth=env._emscripten_glClearDepth;
+ var _glDisable=env._glDisable;
+ var ___lock=env.___lock;
+ var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
+ var ___syscall6=env.___syscall6;
+ var ___syscall5=env.___syscall5;
+ var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
+ var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
+ var _time=env._time;
+ var _glBindFramebuffer=env._glBindFramebuffer;
+ var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
+ var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
+ var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
+ var _exit=env._exit;
+ var _emscripten_asm_const_2=env._emscripten_asm_const_2;
+ var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
+ var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
+ var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
+ var _glCullFace=env._glCullFace;
+ var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
+ var _glfwPollEvents=env._glfwPollEvents;
+ var _emscripten_glUniform4f=env._emscripten_glUniform4f;
+ var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
+ var _glfwGetVideoModes=env._glfwGetVideoModes;
+ var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
+ var _emscripten_glFinish=env._emscripten_glFinish;
+ var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
+ var _emscripten_glDrawElements=env._emscripten_glDrawElements;
+ var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
+ var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
+ var ___syscall221=env.___syscall221;
+ var _glCompressedTexImage2D=env._glCompressedTexImage2D;
+ var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
+ var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
+ var _glClearDepthf=env._glClearDepthf;
+ var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
+ var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
+ var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
+ var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
+ var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose;
+ var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
+ var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
+ var _glBindTexture=env._glBindTexture;
+ var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
+ var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
+ var _emscripten_glDisable=env._emscripten_glDisable;
+ var _glfwSetCharCallback=env._glfwSetCharCallback;
+ var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
+ var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
+ var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
+ var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
+ var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
+ var _glDrawArrays=env._glDrawArrays;
+ var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
+ var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
+ var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
+ var _glCompileShader=env._glCompileShader;
+ var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
+ var _emscripten_glHint=env._emscripten_glHint;
+ var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
+ var _sqrtf=env._sqrtf;
+ var _glActiveTexture=env._glActiveTexture;
+ var _glfwSwapBuffers=env._glfwSwapBuffers;
+ var _emscripten_glDepthMask=env._emscripten_glDepthMask;
+ var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback;
+ var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
+ var _glfwTerminate=env._glfwTerminate;
+ var _glFrontFace=env._glFrontFace;
+ var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
+ var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
+ var _glfwSwapInterval=env._glfwSwapInterval;
+ var _glUniform1i=env._glUniform1i;
+ var _glEnableVertexAttribArray=env._glEnableVertexAttribArray;
+ var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
+ var _abort=env._abort;
+ var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
+ var _glDeleteBuffers=env._glDeleteBuffers;
+ var _glBufferData=env._glBufferData;
+ var _glTexImage2D=env._glTexImage2D;
+ var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
+ var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
+ var _glUniform1f=env._glUniform1f;
+ var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
+ var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
+ var _glDeleteShader=env._glDeleteShader;
+ var _emscripten_glUniform1f=env._emscripten_glUniform1f;
+ var _glGetProgramiv=env._glGetProgramiv;
+ var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
+ var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
+ var _glfwGetTime=env._glfwGetTime;
+ var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
+ var _emscripten_glBlendColor=env._emscripten_glBlendColor;
+ var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
+ var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
+ var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
+ var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback;
+ var _emscripten_glCreateShader=env._emscripten_glCreateShader;
+ var _emscripten_glStencilMask=env._emscripten_glStencilMask;
+ var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
+ var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
+ var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor;
+ var _glLinkProgram=env._glLinkProgram;
+ var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
+ var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback;
+ var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
+ var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
+ var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
+ var _glGetShaderiv=env._glGetShaderiv;
+ var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
+ var _glGetUniformLocation=env._glGetUniformLocation;
+ var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
+ var _emscripten_glCompileShader=env._emscripten_glCompileShader;
+ var _glClear=env._glClear;
+ var _glUniform4fv=env._glUniform4fv;
+ var _emscripten_glFrustum=env._emscripten_glFrustum;
+ var _glVertexAttrib2f=env._glVertexAttrib2f;
+ var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
+ var _sinf=env._sinf;
+ var __exit=env.__exit;
+ var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
+ var _emscripten_glUniform3f=env._emscripten_glUniform3f;
+ var _emscripten_glStencilOp=env._emscripten_glStencilOp;
+ var _glBindAttribLocation=env._glBindAttribLocation;
+ var _glPixelStorei=env._glPixelStorei;
+ var _emscripten_glColorMask=env._emscripten_glColorMask;
+ var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
+ var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
+ var _emscripten_glIsTexture=env._emscripten_glIsTexture;
+ var _pthread_self=env._pthread_self;
+ var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
+ var _emscripten_glLineWidth=env._emscripten_glLineWidth;
+ var _emscripten_glBindTexture=env._emscripten_glBindTexture;
+ var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback;
+ var _glfwGetCursorPos=env._glfwGetCursorPos;
+ var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
+ var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
+ var ___syscall54=env.___syscall54;
+ var ___unlock=env.___unlock;
+ var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
+ var _emscripten_glDepthRange=env._emscripten_glDepthRange;
+ var _emscripten_set_main_loop=env._emscripten_set_main_loop;
+ var _emscripten_glIsShader=env._emscripten_glIsShader;
+ var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
+ var _glfwWindowHint=env._glfwWindowHint;
+ var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
+ var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
+ var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
+ var _cosf=env._cosf;
+ var _glfwSetKeyCallback=env._glfwSetKeyCallback;
+ var _emscripten_glClearColor=env._emscripten_glClearColor;
+ var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
+ var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
+ var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
+ var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
+ var _glTexParameteri=env._glTexParameteri;
+ var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
+ var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
+ var _emscripten_glDetachShader=env._emscripten_glDetachShader;
+ var _glClearColor=env._glClearColor;
+ var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback;
+ var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback;
+ var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
+ var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
+ var tempFloat = 0.0;
+
+// EMSCRIPTEN_START_FUNCS
+function stackAlloc(size) {
+ size = size|0;
+ var ret = 0;
+ ret = STACKTOP;
+ STACKTOP = (STACKTOP + size)|0;
+ STACKTOP = (STACKTOP + 15)&-16;
+
+ return ret|0;
+}
+function stackSave() {
+ return STACKTOP|0;
+}
+function stackRestore(top) {
+ top = top|0;
+ STACKTOP = top;
+}
+function establishStackSpace(stackBase, stackMax) {
+ stackBase = stackBase|0;
+ stackMax = stackMax|0;
+ STACKTOP = stackBase;
+ STACK_MAX = stackMax;
+}
+
+function setThrew(threw, value) {
+ threw = threw|0;
+ value = value|0;
+ if ((__THREW__|0) == 0) {
+ __THREW__ = threw;
+ threwValue = value;
+ }
+}
+function copyTempFloat(ptr) {
+ ptr = ptr|0;
+ HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0];
+ HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0];
+ HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0];
+ HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0];
+}
+function copyTempDouble(ptr) {
+ ptr = ptr|0;
+ HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0];
+ HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0];
+ HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0];
+ HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0];
+ HEAP8[tempDoublePtr+4>>0] = HEAP8[ptr+4>>0];
+ HEAP8[tempDoublePtr+5>>0] = HEAP8[ptr+5>>0];
+ HEAP8[tempDoublePtr+6>>0] = HEAP8[ptr+6>>0];
+ HEAP8[tempDoublePtr+7>>0] = HEAP8[ptr+7>>0];
+}
+
+function setTempRet0(value) {
+ value = value|0;
+ tempRet0 = value;
+}
+function getTempRet0() {
+ return tempRet0|0;
+}
+
+function _main() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $dwarf$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 544|0;
+ $dwarf$byval_copy = sp + 280|0;
+ $0 = sp + 24|0;
+ $1 = sp;
+ $2 = HEAP32[152>>2]|0;
+ $3 = HEAP32[156>>2]|0;
+ _InitWindow($2,$3,7448);
+ _LoadModel($0,7492);
+ _memcpy((212|0),($0|0),256)|0;
+ _LoadTexture($1,7518);
+ ;HEAP32[468>>2]=HEAP32[$1>>2]|0;HEAP32[468+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[468+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[468+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[468+16>>2]=HEAP32[$1+16>>2]|0;
+ ;HEAP32[(392)>>2]=HEAP32[$1>>2]|0;HEAP32[(392)+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[(392)+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[(392)+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[(392)+16>>2]=HEAP32[$1+16>>2]|0;
+ _emscripten_set_main_loop((1|0),0,1);
+ ;HEAP32[$dwarf$byval_copy>>2]=HEAP32[468>>2]|0;HEAP32[$dwarf$byval_copy+4>>2]=HEAP32[468+4>>2]|0;HEAP32[$dwarf$byval_copy+8>>2]=HEAP32[468+8>>2]|0;HEAP32[$dwarf$byval_copy+12>>2]=HEAP32[468+12>>2]|0;HEAP32[$dwarf$byval_copy+16>>2]=HEAP32[468+16>>2]|0;
+ _UnloadTexture($dwarf$byval_copy);
+ _memcpy(($dwarf$byval_copy|0),(212|0),256)|0;
+ _UnloadModel($dwarf$byval_copy);
+ _CloseWindow();
+ STACKTOP = sp;return 0;
+}
+function _UpdateDrawFrame() {
+ var $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dwarf$byval_copy = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0;
+ var stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 320|0;
+ $$byval_copy2 = sp + 272|0;
+ $position$byval_copy = sp + 260|0;
+ $dwarf$byval_copy = sp;
+ $0 = sp + 316|0;
+ $1 = sp + 256|0;
+ $2 = sp + 312|0;
+ _BeginDrawing();
+ HEAP8[$0>>0] = -11;
+ $3 = ((($0)) + 1|0);
+ HEAP8[$3>>0] = -11;
+ $4 = ((($0)) + 2|0);
+ HEAP8[$4>>0] = -11;
+ $5 = ((($0)) + 3|0);
+ HEAP8[$5>>0] = -1;
+ ;HEAP8[$$byval_copy2>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$0+3>>0]|0;
+ _ClearBackground($$byval_copy2);
+ dest=$$byval_copy2; src=160; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _Begin3dMode($$byval_copy2);
+ HEAP32[$1>>2] = -1;
+ _memcpy(($dwarf$byval_copy|0),(212|0),256)|0;
+ ;HEAP32[$position$byval_copy>>2]=HEAP32[200>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[200+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[200+8>>2]|0;
+ ;HEAP8[$$byval_copy2>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$1+3>>0]|0;
+ _DrawModel($dwarf$byval_copy,$position$byval_copy,2.0,$$byval_copy2);
+ _DrawGrid(10,1.0);
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[200>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[200+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[200+8>>2]|0;
+ _DrawGizmo($$byval_copy2);
+ _End3dMode();
+ $6 = HEAP32[152>>2]|0;
+ $7 = (($6) + -200)|0;
+ $8 = HEAP32[156>>2]|0;
+ $9 = (($8) + -20)|0;
+ HEAP8[$2>>0] = -126;
+ $10 = ((($2)) + 1|0);
+ HEAP8[$10>>0] = -126;
+ $11 = ((($2)) + 2|0);
+ HEAP8[$11>>0] = -126;
+ $12 = ((($2)) + 3|0);
+ HEAP8[$12>>0] = -1;
+ ;HEAP8[$$byval_copy2>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$2+3>>0]|0;
+ _DrawText(7552,$7,$9,10,$$byval_copy2);
+ _DrawFPS(10,10);
+ _EndDrawing();
+ STACKTOP = sp;return;
+}
+function _VectorSubtract($agg$result,$v1,$v2) {
+ $agg$result = $agg$result|0;
+ $v1 = $v1|0;
+ $v2 = $v2|0;
+ var $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[$v1>>2];
+ $1 = +HEAPF32[$v2>>2];
+ $2 = $0 - $1;
+ $3 = ((($v1)) + 4|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = ((($v2)) + 4|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = $4 - $6;
+ $8 = ((($v1)) + 8|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = ((($v2)) + 8|0);
+ $11 = +HEAPF32[$10>>2];
+ $12 = $9 - $11;
+ HEAPF32[$agg$result>>2] = $2;
+ $13 = ((($agg$result)) + 4|0);
+ HEAPF32[$13>>2] = $7;
+ $14 = ((($agg$result)) + 8|0);
+ HEAPF32[$14>>2] = $12;
+ return;
+}
+function _VectorCrossProduct($agg$result,$v1,$v2) {
+ $agg$result = $agg$result|0;
+ $v1 = $v1|0;
+ $v2 = $v2|0;
+ var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0;
+ var $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($v1)) + 4|0);
+ $1 = +HEAPF32[$0>>2];
+ $2 = ((($v2)) + 8|0);
+ $3 = +HEAPF32[$2>>2];
+ $4 = $1 * $3;
+ $5 = ((($v1)) + 8|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = ((($v2)) + 4|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $6 * $8;
+ $10 = $4 - $9;
+ $11 = +HEAPF32[$v2>>2];
+ $12 = $6 * $11;
+ $13 = +HEAPF32[$v1>>2];
+ $14 = $3 * $13;
+ $15 = $12 - $14;
+ $16 = $8 * $13;
+ $17 = $1 * $11;
+ $18 = $16 - $17;
+ HEAPF32[$agg$result>>2] = $10;
+ $19 = ((($agg$result)) + 4|0);
+ HEAPF32[$19>>2] = $15;
+ $20 = ((($agg$result)) + 8|0);
+ HEAPF32[$20>>2] = $18;
+ return;
+}
+function _VectorLength($v) {
+ $v = $v|0;
+ var $0 = 0.0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[$v>>2];
+ $1 = $0 * $0;
+ $2 = ((($v)) + 4|0);
+ $3 = +HEAPF32[$2>>2];
+ $4 = $3 * $3;
+ $5 = $1 + $4;
+ $6 = ((($v)) + 8|0);
+ $7 = +HEAPF32[$6>>2];
+ $8 = $7 * $7;
+ $9 = $5 + $8;
+ $sqrtf = (+Math_sqrt((+$9)));
+ return (+$sqrtf);
+}
+function _VectorNormalize($v) {
+ $v = $v|0;
+ var $$op = 0.0, $0 = 0.0, $1 = 0, $10 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $v$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $v$byval_copy = sp;
+ ;HEAP32[$v$byval_copy>>2]=HEAP32[$v>>2]|0;HEAP32[$v$byval_copy+4>>2]=HEAP32[$v+4>>2]|0;HEAP32[$v$byval_copy+8>>2]=HEAP32[$v+8>>2]|0;
+ $0 = (+_VectorLength($v$byval_copy));
+ $1 = $0 == 0.0;
+ $$op = 1.0 / $0;
+ $2 = $1 ? 1.0 : $$op;
+ $3 = +HEAPF32[$v>>2];
+ $4 = $3 * $2;
+ HEAPF32[$v>>2] = $4;
+ $5 = ((($v)) + 4|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = $2 * $6;
+ HEAPF32[$5>>2] = $7;
+ $8 = ((($v)) + 8|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = $2 * $9;
+ HEAPF32[$8>>2] = $10;
+ STACKTOP = sp;return;
+}
+function _VectorTransform($v,$mat) {
+ $v = $v|0;
+ $mat = $mat|0;
+ var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0;
+ var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0;
+ var $45 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[$v>>2];
+ $1 = ((($v)) + 4|0);
+ $2 = +HEAPF32[$1>>2];
+ $3 = ((($v)) + 8|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = +HEAPF32[$mat>>2];
+ $6 = $0 * $5;
+ $7 = ((($mat)) + 4|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $2 * $8;
+ $10 = $6 + $9;
+ $11 = ((($mat)) + 8|0);
+ $12 = +HEAPF32[$11>>2];
+ $13 = $4 * $12;
+ $14 = $10 + $13;
+ $15 = ((($mat)) + 12|0);
+ $16 = +HEAPF32[$15>>2];
+ $17 = $16 + $14;
+ HEAPF32[$v>>2] = $17;
+ $18 = ((($mat)) + 16|0);
+ $19 = +HEAPF32[$18>>2];
+ $20 = $0 * $19;
+ $21 = ((($mat)) + 20|0);
+ $22 = +HEAPF32[$21>>2];
+ $23 = $2 * $22;
+ $24 = $20 + $23;
+ $25 = ((($mat)) + 24|0);
+ $26 = +HEAPF32[$25>>2];
+ $27 = $4 * $26;
+ $28 = $24 + $27;
+ $29 = ((($mat)) + 28|0);
+ $30 = +HEAPF32[$29>>2];
+ $31 = $30 + $28;
+ HEAPF32[$1>>2] = $31;
+ $32 = ((($mat)) + 32|0);
+ $33 = +HEAPF32[$32>>2];
+ $34 = $0 * $33;
+ $35 = ((($mat)) + 36|0);
+ $36 = +HEAPF32[$35>>2];
+ $37 = $2 * $36;
+ $38 = $34 + $37;
+ $39 = ((($mat)) + 40|0);
+ $40 = +HEAPF32[$39>>2];
+ $41 = $4 * $40;
+ $42 = $38 + $41;
+ $43 = ((($mat)) + 44|0);
+ $44 = +HEAPF32[$43>>2];
+ $45 = $44 + $42;
+ HEAPF32[$3>>2] = $45;
+ return;
+}
+function _VectorZero($agg$result) {
+ $agg$result = $agg$result|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ ;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0;
+ return;
+}
+function _MatrixTranspose($mat) {
+ $mat = $mat|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($mat)) + 4|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($mat)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($mat)) + 12|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ((($mat)) + 16|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($mat)) + 24|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ((($mat)) + 28|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ((($mat)) + 32|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ((($mat)) + 36|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = ((($mat)) + 44|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ((($mat)) + 48|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = ((($mat)) + 52|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = ((($mat)) + 56|0);
+ $23 = HEAP32[$22>>2]|0;
+ HEAP32[$0>>2] = $7;
+ HEAP32[$2>>2] = $13;
+ HEAP32[$4>>2] = $19;
+ HEAP32[$6>>2] = $1;
+ HEAP32[$8>>2] = $15;
+ HEAP32[$10>>2] = $21;
+ HEAP32[$12>>2] = $3;
+ HEAP32[$14>>2] = $9;
+ HEAP32[$16>>2] = $23;
+ HEAP32[$18>>2] = $5;
+ HEAP32[$20>>2] = $11;
+ HEAP32[$22>>2] = $17;
+ return;
+}
+function _MatrixInvert($mat) {
+ $mat = $mat|0;
+ var $0 = 0.0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0;
+ var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
+ var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0.0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0;
+ var $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0;
+ var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0;
+ var $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0;
+ var $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0;
+ var $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0;
+ var $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[$mat>>2];
+ $1 = ((($mat)) + 16|0);
+ $2 = +HEAPF32[$1>>2];
+ $3 = ((($mat)) + 32|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = ((($mat)) + 48|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = ((($mat)) + 4|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = ((($mat)) + 20|0);
+ $10 = +HEAPF32[$9>>2];
+ $11 = ((($mat)) + 36|0);
+ $12 = +HEAPF32[$11>>2];
+ $13 = ((($mat)) + 52|0);
+ $14 = +HEAPF32[$13>>2];
+ $15 = ((($mat)) + 8|0);
+ $16 = +HEAPF32[$15>>2];
+ $17 = ((($mat)) + 24|0);
+ $18 = +HEAPF32[$17>>2];
+ $19 = ((($mat)) + 40|0);
+ $20 = +HEAPF32[$19>>2];
+ $21 = ((($mat)) + 56|0);
+ $22 = +HEAPF32[$21>>2];
+ $23 = ((($mat)) + 12|0);
+ $24 = +HEAPF32[$23>>2];
+ $25 = ((($mat)) + 28|0);
+ $26 = +HEAPF32[$25>>2];
+ $27 = ((($mat)) + 44|0);
+ $28 = +HEAPF32[$27>>2];
+ $29 = ((($mat)) + 60|0);
+ $30 = +HEAPF32[$29>>2];
+ $31 = $0 * $10;
+ $32 = $2 * $8;
+ $33 = $31 - $32;
+ $34 = $0 * $12;
+ $35 = $4 * $8;
+ $36 = $34 - $35;
+ $37 = $0 * $14;
+ $38 = $6 * $8;
+ $39 = $37 - $38;
+ $40 = $2 * $12;
+ $41 = $4 * $10;
+ $42 = $40 - $41;
+ $43 = $2 * $14;
+ $44 = $6 * $10;
+ $45 = $43 - $44;
+ $46 = $4 * $14;
+ $47 = $6 * $12;
+ $48 = $46 - $47;
+ $49 = $16 * $26;
+ $50 = $18 * $24;
+ $51 = $49 - $50;
+ $52 = $16 * $28;
+ $53 = $20 * $24;
+ $54 = $52 - $53;
+ $55 = $16 * $30;
+ $56 = $22 * $24;
+ $57 = $55 - $56;
+ $58 = $18 * $28;
+ $59 = $20 * $26;
+ $60 = $58 - $59;
+ $61 = $18 * $30;
+ $62 = $22 * $26;
+ $63 = $61 - $62;
+ $64 = $20 * $30;
+ $65 = $22 * $28;
+ $66 = $64 - $65;
+ $67 = $33 * $66;
+ $68 = $36 * $63;
+ $69 = $67 - $68;
+ $70 = $39 * $60;
+ $71 = $70 + $69;
+ $72 = $42 * $57;
+ $73 = $72 + $71;
+ $74 = $45 * $54;
+ $75 = $73 - $74;
+ $76 = $48 * $51;
+ $77 = $76 + $75;
+ $78 = 1.0 / $77;
+ $79 = $10 * $66;
+ $80 = $12 * $63;
+ $81 = $79 - $80;
+ $82 = $14 * $60;
+ $83 = $82 + $81;
+ $84 = $78 * $83;
+ $85 = $2 * $66;
+ $86 = $4 * $63;
+ $87 = $86 - $85;
+ $88 = $6 * $60;
+ $89 = $87 - $88;
+ $90 = $78 * $89;
+ $91 = $48 * $26;
+ $92 = $45 * $28;
+ $93 = $91 - $92;
+ $94 = $42 * $30;
+ $95 = $93 + $94;
+ $96 = $78 * $95;
+ $97 = $18 * $48;
+ $98 = $45 * $20;
+ $99 = $98 - $97;
+ $100 = $42 * $22;
+ $101 = $99 - $100;
+ $102 = $101 * $78;
+ $103 = -$8;
+ $104 = $66 * $103;
+ $105 = $12 * $57;
+ $106 = $104 + $105;
+ $107 = $14 * $54;
+ $108 = $106 - $107;
+ $109 = $78 * $108;
+ $110 = $0 * $66;
+ $111 = $4 * $57;
+ $112 = $110 - $111;
+ $113 = $6 * $54;
+ $114 = $113 + $112;
+ $115 = $78 * $114;
+ $116 = -$24;
+ $117 = $48 * $116;
+ $118 = $39 * $28;
+ $119 = $117 + $118;
+ $120 = $36 * $30;
+ $121 = $119 - $120;
+ $122 = $78 * $121;
+ $123 = $16 * $48;
+ $124 = $39 * $20;
+ $125 = $123 - $124;
+ $126 = $36 * $22;
+ $127 = $125 + $126;
+ $128 = $127 * $78;
+ $129 = $8 * $63;
+ $130 = $10 * $57;
+ $131 = $129 - $130;
+ $132 = $14 * $51;
+ $133 = $132 + $131;
+ $134 = $78 * $133;
+ $135 = $0 * $63;
+ $136 = $2 * $57;
+ $137 = $136 - $135;
+ $138 = $6 * $51;
+ $139 = $137 - $138;
+ $140 = $78 * $139;
+ $141 = $45 * $24;
+ $142 = $39 * $26;
+ $143 = $141 - $142;
+ $144 = $33 * $30;
+ $145 = $143 + $144;
+ $146 = $78 * $145;
+ $147 = $16 * $45;
+ $148 = $18 * $39;
+ $149 = $148 - $147;
+ $150 = $33 * $22;
+ $151 = $149 - $150;
+ $152 = $151 * $78;
+ $153 = $60 * $103;
+ $154 = $10 * $54;
+ $155 = $153 + $154;
+ $156 = $12 * $51;
+ $157 = $155 - $156;
+ $158 = $78 * $157;
+ $159 = $0 * $60;
+ $160 = $2 * $54;
+ $161 = $159 - $160;
+ $162 = $4 * $51;
+ $163 = $162 + $161;
+ $164 = $78 * $163;
+ $165 = $42 * $116;
+ $166 = $36 * $26;
+ $167 = $165 + $166;
+ $168 = $33 * $28;
+ $169 = $167 - $168;
+ $170 = $169 * $78;
+ $171 = $16 * $42;
+ $172 = $36 * $18;
+ $173 = $171 - $172;
+ $174 = $33 * $20;
+ $175 = $173 + $174;
+ $176 = $175 * $78;
+ HEAPF32[$mat>>2] = $84;
+ HEAPF32[$7>>2] = $109;
+ HEAPF32[$15>>2] = $134;
+ HEAPF32[$23>>2] = $158;
+ HEAPF32[$1>>2] = $90;
+ HEAPF32[$9>>2] = $115;
+ HEAPF32[$17>>2] = $140;
+ HEAPF32[$25>>2] = $164;
+ HEAPF32[$3>>2] = $96;
+ HEAPF32[$11>>2] = $122;
+ HEAPF32[$19>>2] = $146;
+ HEAPF32[$27>>2] = $170;
+ HEAPF32[$5>>2] = $102;
+ HEAPF32[$13>>2] = $128;
+ HEAPF32[$21>>2] = $152;
+ HEAPF32[$29>>2] = $176;
+ return;
+}
+function _MatrixIdentity($agg$result) {
+ $agg$result = $agg$result|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0;
+ $result$sroa$5 = sp + 32|0;
+ $result$sroa$6 = sp + 16|0;
+ $result$sroa$7 = sp;
+ ;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0;
+ ;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0;
+ ;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0;
+ HEAPF32[$agg$result>>2] = 1.0;
+ $0 = ((($agg$result)) + 4|0);
+ ;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0;
+ $1 = ((($agg$result)) + 20|0);
+ HEAPF32[$1>>2] = 1.0;
+ $2 = ((($agg$result)) + 24|0);
+ ;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0;
+ $3 = ((($agg$result)) + 40|0);
+ HEAPF32[$3>>2] = 1.0;
+ $4 = ((($agg$result)) + 44|0);
+ ;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0;
+ $5 = ((($agg$result)) + 60|0);
+ HEAPF32[$5>>2] = 1.0;
+ STACKTOP = sp;return;
+}
+function _MatrixTranslate($agg$result,$x,$y,$z) {
+ $agg$result = $agg$result|0;
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF32[$agg$result>>2] = 1.0;
+ $0 = ((($agg$result)) + 4|0);
+ $1 = ((($agg$result)) + 20|0);
+ ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0;
+ HEAPF32[$1>>2] = 1.0;
+ $2 = ((($agg$result)) + 24|0);
+ $3 = ((($agg$result)) + 40|0);
+ ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;
+ HEAPF32[$3>>2] = 1.0;
+ $4 = ((($agg$result)) + 44|0);
+ HEAPF32[$4>>2] = 0.0;
+ $5 = ((($agg$result)) + 48|0);
+ HEAPF32[$5>>2] = $x;
+ $6 = ((($agg$result)) + 52|0);
+ HEAPF32[$6>>2] = $y;
+ $7 = ((($agg$result)) + 56|0);
+ HEAPF32[$7>>2] = $z;
+ $8 = ((($agg$result)) + 60|0);
+ HEAPF32[$8>>2] = 1.0;
+ return;
+}
+function _MatrixRotate($agg$result,$axis,$angle) {
+ $agg$result = $agg$result|0;
+ $axis = $axis|0;
+ $angle = +$angle;
+ var $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0;
+ var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0;
+ var $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0;
+ var $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0.0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0;
+ var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0;
+ var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0;
+ var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $mat = 0, $or$cond = 0, $sqrtf = 0.0, $x$0 = 0.0, $y$0 = 0.0, $z$0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $mat = sp;
+ _MatrixIdentity($mat);
+ $0 = +HEAPF32[$axis>>2];
+ $1 = ((($axis)) + 4|0);
+ $2 = +HEAPF32[$1>>2];
+ $3 = ((($axis)) + 8|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = $0 * $0;
+ $6 = $2 * $2;
+ $7 = $5 + $6;
+ $8 = $4 * $4;
+ $9 = $7 + $8;
+ $sqrtf = (+Math_sqrt((+$9)));
+ $10 = $sqrtf != 1.0;
+ $11 = $sqrtf != 0.0;
+ $or$cond = $10 & $11;
+ if ($or$cond) {
+ $12 = 1.0 / $sqrtf;
+ $13 = $0 * $12;
+ $14 = $2 * $12;
+ $15 = $4 * $12;
+ $x$0 = $13;$y$0 = $14;$z$0 = $15;
+ } else {
+ $x$0 = $0;$y$0 = $2;$z$0 = $4;
+ }
+ $16 = (+Math_sin((+$angle)));
+ $17 = (+Math_cos((+$angle)));
+ $18 = 1.0 - $17;
+ $19 = +HEAPF32[$mat>>2];
+ $20 = ((($mat)) + 16|0);
+ $21 = +HEAPF32[$20>>2];
+ $22 = ((($mat)) + 32|0);
+ $23 = +HEAPF32[$22>>2];
+ $24 = ((($mat)) + 48|0);
+ $25 = +HEAPF32[$24>>2];
+ $26 = ((($mat)) + 4|0);
+ $27 = +HEAPF32[$26>>2];
+ $28 = ((($mat)) + 20|0);
+ $29 = +HEAPF32[$28>>2];
+ $30 = ((($mat)) + 36|0);
+ $31 = +HEAPF32[$30>>2];
+ $32 = ((($mat)) + 52|0);
+ $33 = +HEAPF32[$32>>2];
+ $34 = ((($mat)) + 8|0);
+ $35 = +HEAPF32[$34>>2];
+ $36 = ((($mat)) + 24|0);
+ $37 = +HEAPF32[$36>>2];
+ $38 = ((($mat)) + 40|0);
+ $39 = +HEAPF32[$38>>2];
+ $40 = ((($mat)) + 56|0);
+ $41 = +HEAPF32[$40>>2];
+ $42 = $x$0 * $x$0;
+ $43 = $42 * $18;
+ $44 = $17 + $43;
+ $45 = $y$0 * $x$0;
+ $46 = $45 * $18;
+ $47 = $z$0 * $16;
+ $48 = $47 + $46;
+ $49 = $z$0 * $x$0;
+ $50 = $49 * $18;
+ $51 = $y$0 * $16;
+ $52 = $50 - $51;
+ $53 = $46 - $47;
+ $54 = $y$0 * $y$0;
+ $55 = $54 * $18;
+ $56 = $17 + $55;
+ $57 = $z$0 * $y$0;
+ $58 = $57 * $18;
+ $59 = $x$0 * $16;
+ $60 = $59 + $58;
+ $61 = $51 + $50;
+ $62 = $58 - $59;
+ $63 = $z$0 * $z$0;
+ $64 = $63 * $18;
+ $65 = $17 + $64;
+ $66 = $19 * $44;
+ $67 = $48 * $27;
+ $68 = $66 + $67;
+ $69 = $52 * $35;
+ $70 = $68 + $69;
+ $71 = $21 * $44;
+ $72 = $48 * $29;
+ $73 = $71 + $72;
+ $74 = $52 * $37;
+ $75 = $73 + $74;
+ $76 = $23 * $44;
+ $77 = $48 * $31;
+ $78 = $76 + $77;
+ $79 = $52 * $39;
+ $80 = $78 + $79;
+ $81 = $44 * $25;
+ $82 = $48 * $33;
+ $83 = $81 + $82;
+ $84 = $52 * $41;
+ $85 = $83 + $84;
+ $86 = $19 * $53;
+ $87 = $56 * $27;
+ $88 = $86 + $87;
+ $89 = $60 * $35;
+ $90 = $88 + $89;
+ $91 = $21 * $53;
+ $92 = $56 * $29;
+ $93 = $91 + $92;
+ $94 = $60 * $37;
+ $95 = $93 + $94;
+ $96 = $23 * $53;
+ $97 = $56 * $31;
+ $98 = $96 + $97;
+ $99 = $60 * $39;
+ $100 = $98 + $99;
+ $101 = $53 * $25;
+ $102 = $56 * $33;
+ $103 = $101 + $102;
+ $104 = $60 * $41;
+ $105 = $103 + $104;
+ $106 = $19 * $61;
+ $107 = $62 * $27;
+ $108 = $106 + $107;
+ $109 = $65 * $35;
+ $110 = $108 + $109;
+ $111 = $21 * $61;
+ $112 = $62 * $29;
+ $113 = $111 + $112;
+ $114 = $65 * $37;
+ $115 = $113 + $114;
+ $116 = $23 * $61;
+ $117 = $62 * $31;
+ $118 = $116 + $117;
+ $119 = $65 * $39;
+ $120 = $118 + $119;
+ $121 = $61 * $25;
+ $122 = $62 * $33;
+ $123 = $121 + $122;
+ $124 = $65 * $41;
+ $125 = $123 + $124;
+ $126 = ((($mat)) + 12|0);
+ $127 = HEAP32[$126>>2]|0;
+ $128 = ((($mat)) + 28|0);
+ $129 = HEAP32[$128>>2]|0;
+ $130 = ((($mat)) + 44|0);
+ $131 = HEAP32[$130>>2]|0;
+ $132 = ((($mat)) + 60|0);
+ $133 = HEAP32[$132>>2]|0;
+ HEAPF32[$agg$result>>2] = $70;
+ $134 = ((($agg$result)) + 4|0);
+ HEAPF32[$134>>2] = $90;
+ $135 = ((($agg$result)) + 8|0);
+ HEAPF32[$135>>2] = $110;
+ $136 = ((($agg$result)) + 12|0);
+ HEAP32[$136>>2] = $127;
+ $137 = ((($agg$result)) + 16|0);
+ HEAPF32[$137>>2] = $75;
+ $138 = ((($agg$result)) + 20|0);
+ HEAPF32[$138>>2] = $95;
+ $139 = ((($agg$result)) + 24|0);
+ HEAPF32[$139>>2] = $115;
+ $140 = ((($agg$result)) + 28|0);
+ HEAP32[$140>>2] = $129;
+ $141 = ((($agg$result)) + 32|0);
+ HEAPF32[$141>>2] = $80;
+ $142 = ((($agg$result)) + 36|0);
+ HEAPF32[$142>>2] = $100;
+ $143 = ((($agg$result)) + 40|0);
+ HEAPF32[$143>>2] = $120;
+ $144 = ((($agg$result)) + 44|0);
+ HEAP32[$144>>2] = $131;
+ $145 = ((($agg$result)) + 48|0);
+ HEAPF32[$145>>2] = $85;
+ $146 = ((($agg$result)) + 52|0);
+ HEAPF32[$146>>2] = $105;
+ $147 = ((($agg$result)) + 56|0);
+ HEAPF32[$147>>2] = $125;
+ $148 = ((($agg$result)) + 60|0);
+ HEAP32[$148>>2] = $133;
+ STACKTOP = sp;return;
+}
+function _MatrixScale($agg$result,$x,$y,$z) {
+ $agg$result = $agg$result|0;
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0;
+ $result$sroa$5 = sp + 32|0;
+ $result$sroa$6 = sp + 16|0;
+ $result$sroa$7 = sp;
+ ;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0;
+ ;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0;
+ ;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0;
+ HEAPF32[$agg$result>>2] = $x;
+ $0 = ((($agg$result)) + 4|0);
+ ;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0;
+ $1 = ((($agg$result)) + 20|0);
+ HEAPF32[$1>>2] = $y;
+ $2 = ((($agg$result)) + 24|0);
+ ;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0;
+ $3 = ((($agg$result)) + 40|0);
+ HEAPF32[$3>>2] = $z;
+ $4 = ((($agg$result)) + 44|0);
+ ;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0;
+ $5 = ((($agg$result)) + 60|0);
+ HEAPF32[$5>>2] = 1.0;
+ STACKTOP = sp;return;
+}
+function _MatrixMultiply($agg$result,$left,$right) {
+ $agg$result = $agg$result|0;
+ $left = $left|0;
+ $right = $right|0;
+ var $0 = 0.0, $1 = 0.0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0.0;
+ var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
+ var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0.0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0.0;
+ var $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0;
+ var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0.0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
+ var $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0;
+ var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0;
+ var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0;
+ var $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0;
+ var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[$right>>2];
+ $1 = +HEAPF32[$left>>2];
+ $2 = $0 * $1;
+ $3 = ((($right)) + 16|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = ((($left)) + 4|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = $4 * $6;
+ $8 = $2 + $7;
+ $9 = ((($right)) + 32|0);
+ $10 = +HEAPF32[$9>>2];
+ $11 = ((($left)) + 8|0);
+ $12 = +HEAPF32[$11>>2];
+ $13 = $10 * $12;
+ $14 = $8 + $13;
+ $15 = ((($right)) + 48|0);
+ $16 = +HEAPF32[$15>>2];
+ $17 = ((($left)) + 12|0);
+ $18 = +HEAPF32[$17>>2];
+ $19 = $16 * $18;
+ $20 = $14 + $19;
+ $21 = ((($left)) + 16|0);
+ $22 = +HEAPF32[$21>>2];
+ $23 = $0 * $22;
+ $24 = ((($left)) + 20|0);
+ $25 = +HEAPF32[$24>>2];
+ $26 = $4 * $25;
+ $27 = $23 + $26;
+ $28 = ((($left)) + 24|0);
+ $29 = +HEAPF32[$28>>2];
+ $30 = $10 * $29;
+ $31 = $27 + $30;
+ $32 = ((($left)) + 28|0);
+ $33 = +HEAPF32[$32>>2];
+ $34 = $16 * $33;
+ $35 = $31 + $34;
+ $36 = ((($left)) + 32|0);
+ $37 = +HEAPF32[$36>>2];
+ $38 = $0 * $37;
+ $39 = ((($left)) + 36|0);
+ $40 = +HEAPF32[$39>>2];
+ $41 = $4 * $40;
+ $42 = $38 + $41;
+ $43 = ((($left)) + 40|0);
+ $44 = +HEAPF32[$43>>2];
+ $45 = $10 * $44;
+ $46 = $42 + $45;
+ $47 = ((($left)) + 44|0);
+ $48 = +HEAPF32[$47>>2];
+ $49 = $16 * $48;
+ $50 = $46 + $49;
+ $51 = ((($left)) + 48|0);
+ $52 = +HEAPF32[$51>>2];
+ $53 = $0 * $52;
+ $54 = ((($left)) + 52|0);
+ $55 = +HEAPF32[$54>>2];
+ $56 = $4 * $55;
+ $57 = $53 + $56;
+ $58 = ((($left)) + 56|0);
+ $59 = +HEAPF32[$58>>2];
+ $60 = $10 * $59;
+ $61 = $57 + $60;
+ $62 = ((($left)) + 60|0);
+ $63 = +HEAPF32[$62>>2];
+ $64 = $16 * $63;
+ $65 = $61 + $64;
+ $66 = ((($right)) + 4|0);
+ $67 = +HEAPF32[$66>>2];
+ $68 = $1 * $67;
+ $69 = ((($right)) + 20|0);
+ $70 = +HEAPF32[$69>>2];
+ $71 = $6 * $70;
+ $72 = $68 + $71;
+ $73 = ((($right)) + 36|0);
+ $74 = +HEAPF32[$73>>2];
+ $75 = $12 * $74;
+ $76 = $72 + $75;
+ $77 = ((($right)) + 52|0);
+ $78 = +HEAPF32[$77>>2];
+ $79 = $18 * $78;
+ $80 = $76 + $79;
+ $81 = $22 * $67;
+ $82 = $25 * $70;
+ $83 = $81 + $82;
+ $84 = $29 * $74;
+ $85 = $83 + $84;
+ $86 = $33 * $78;
+ $87 = $85 + $86;
+ $88 = $37 * $67;
+ $89 = $40 * $70;
+ $90 = $88 + $89;
+ $91 = $44 * $74;
+ $92 = $90 + $91;
+ $93 = $48 * $78;
+ $94 = $92 + $93;
+ $95 = $52 * $67;
+ $96 = $55 * $70;
+ $97 = $95 + $96;
+ $98 = $59 * $74;
+ $99 = $97 + $98;
+ $100 = $63 * $78;
+ $101 = $99 + $100;
+ $102 = ((($right)) + 8|0);
+ $103 = +HEAPF32[$102>>2];
+ $104 = $1 * $103;
+ $105 = ((($right)) + 24|0);
+ $106 = +HEAPF32[$105>>2];
+ $107 = $6 * $106;
+ $108 = $104 + $107;
+ $109 = ((($right)) + 40|0);
+ $110 = +HEAPF32[$109>>2];
+ $111 = $12 * $110;
+ $112 = $108 + $111;
+ $113 = ((($right)) + 56|0);
+ $114 = +HEAPF32[$113>>2];
+ $115 = $18 * $114;
+ $116 = $112 + $115;
+ $117 = $22 * $103;
+ $118 = $25 * $106;
+ $119 = $117 + $118;
+ $120 = $29 * $110;
+ $121 = $119 + $120;
+ $122 = $33 * $114;
+ $123 = $121 + $122;
+ $124 = $37 * $103;
+ $125 = $40 * $106;
+ $126 = $124 + $125;
+ $127 = $44 * $110;
+ $128 = $126 + $127;
+ $129 = $48 * $114;
+ $130 = $128 + $129;
+ $131 = $52 * $103;
+ $132 = $55 * $106;
+ $133 = $131 + $132;
+ $134 = $59 * $110;
+ $135 = $133 + $134;
+ $136 = $63 * $114;
+ $137 = $135 + $136;
+ $138 = ((($right)) + 12|0);
+ $139 = +HEAPF32[$138>>2];
+ $140 = $1 * $139;
+ $141 = ((($right)) + 28|0);
+ $142 = +HEAPF32[$141>>2];
+ $143 = $6 * $142;
+ $144 = $140 + $143;
+ $145 = ((($right)) + 44|0);
+ $146 = +HEAPF32[$145>>2];
+ $147 = $12 * $146;
+ $148 = $144 + $147;
+ $149 = ((($right)) + 60|0);
+ $150 = +HEAPF32[$149>>2];
+ $151 = $18 * $150;
+ $152 = $148 + $151;
+ $153 = $22 * $139;
+ $154 = $25 * $142;
+ $155 = $153 + $154;
+ $156 = $29 * $146;
+ $157 = $155 + $156;
+ $158 = $33 * $150;
+ $159 = $157 + $158;
+ $160 = $37 * $139;
+ $161 = $40 * $142;
+ $162 = $160 + $161;
+ $163 = $44 * $146;
+ $164 = $162 + $163;
+ $165 = $48 * $150;
+ $166 = $164 + $165;
+ $167 = $52 * $139;
+ $168 = $55 * $142;
+ $169 = $167 + $168;
+ $170 = $59 * $146;
+ $171 = $169 + $170;
+ $172 = $63 * $150;
+ $173 = $171 + $172;
+ HEAPF32[$agg$result>>2] = $20;
+ $174 = ((($agg$result)) + 4|0);
+ HEAPF32[$174>>2] = $80;
+ $175 = ((($agg$result)) + 8|0);
+ HEAPF32[$175>>2] = $116;
+ $176 = ((($agg$result)) + 12|0);
+ HEAPF32[$176>>2] = $152;
+ $177 = ((($agg$result)) + 16|0);
+ HEAPF32[$177>>2] = $35;
+ $178 = ((($agg$result)) + 20|0);
+ HEAPF32[$178>>2] = $87;
+ $179 = ((($agg$result)) + 24|0);
+ HEAPF32[$179>>2] = $123;
+ $180 = ((($agg$result)) + 28|0);
+ HEAPF32[$180>>2] = $159;
+ $181 = ((($agg$result)) + 32|0);
+ HEAPF32[$181>>2] = $50;
+ $182 = ((($agg$result)) + 36|0);
+ HEAPF32[$182>>2] = $94;
+ $183 = ((($agg$result)) + 40|0);
+ HEAPF32[$183>>2] = $130;
+ $184 = ((($agg$result)) + 44|0);
+ HEAPF32[$184>>2] = $166;
+ $185 = ((($agg$result)) + 48|0);
+ HEAPF32[$185>>2] = $65;
+ $186 = ((($agg$result)) + 52|0);
+ HEAPF32[$186>>2] = $101;
+ $187 = ((($agg$result)) + 56|0);
+ HEAPF32[$187>>2] = $137;
+ $188 = ((($agg$result)) + 60|0);
+ HEAPF32[$188>>2] = $173;
+ return;
+}
+function _MatrixFrustum($agg$result,$left,$right,$bottom,$top,$near,$far) {
+ $agg$result = $agg$result|0;
+ $left = +$left;
+ $right = +$right;
+ $bottom = +$bottom;
+ $top = +$top;
+ $near = +$near;
+ $far = +$far;
+ var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
+ var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0.0;
+ var $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $right - $left;
+ $1 = $0;
+ $2 = $top - $bottom;
+ $3 = $2;
+ $4 = $far - $near;
+ $5 = $4;
+ $6 = $near * 2.0;
+ $7 = $1;
+ $8 = $6 / $7;
+ $9 = $8;
+ $10 = $3;
+ $11 = $6 / $10;
+ $12 = $11;
+ $13 = $left + $right;
+ $14 = $13 / $7;
+ $15 = $14;
+ $16 = $bottom + $top;
+ $17 = $16 / $10;
+ $18 = $17;
+ $19 = $near + $far;
+ $20 = -$19;
+ $21 = $5;
+ $22 = $20 / $21;
+ $23 = $22;
+ $24 = $near * $far;
+ $25 = $24 * 2.0;
+ $26 = -$25;
+ $27 = $26 / $21;
+ $28 = $27;
+ HEAPF32[$agg$result>>2] = $9;
+ $29 = ((($agg$result)) + 4|0);
+ HEAPF32[$29>>2] = 0.0;
+ $30 = ((($agg$result)) + 8|0);
+ HEAPF32[$30>>2] = $15;
+ $31 = ((($agg$result)) + 12|0);
+ HEAPF32[$31>>2] = 0.0;
+ $32 = ((($agg$result)) + 16|0);
+ HEAPF32[$32>>2] = 0.0;
+ $33 = ((($agg$result)) + 20|0);
+ HEAPF32[$33>>2] = $12;
+ $34 = ((($agg$result)) + 24|0);
+ HEAPF32[$34>>2] = $18;
+ $35 = ((($agg$result)) + 28|0);
+ HEAPF32[$35>>2] = 0.0;
+ $36 = ((($agg$result)) + 32|0);
+ HEAPF32[$36>>2] = 0.0;
+ $37 = ((($agg$result)) + 36|0);
+ HEAPF32[$37>>2] = 0.0;
+ $38 = ((($agg$result)) + 40|0);
+ HEAPF32[$38>>2] = $23;
+ $39 = ((($agg$result)) + 44|0);
+ HEAPF32[$39>>2] = $28;
+ $40 = ((($agg$result)) + 48|0);
+ HEAPF32[$40>>2] = 0.0;
+ $41 = ((($agg$result)) + 52|0);
+ HEAPF32[$41>>2] = 0.0;
+ $42 = ((($agg$result)) + 56|0);
+ HEAPF32[$42>>2] = -1.0;
+ $43 = ((($agg$result)) + 60|0);
+ HEAPF32[$43>>2] = 0.0;
+ return;
+}
+function _MatrixOrtho($agg$result,$left,$right,$bottom,$top,$near,$far) {
+ $agg$result = $agg$result|0;
+ $left = +$left;
+ $right = +$right;
+ $bottom = +$bottom;
+ $top = +$top;
+ $near = +$near;
+ $far = +$far;
+ var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $0 = $right - $left;
+ $1 = $0;
+ $2 = $top - $bottom;
+ $3 = $2;
+ $4 = $far - $near;
+ $5 = $4;
+ $6 = 2.0 / $1;
+ $7 = 2.0 / $3;
+ $8 = -2.0 / $5;
+ $9 = $left + $right;
+ $10 = -$9;
+ $11 = $1;
+ $12 = $10 / $11;
+ $13 = $12;
+ $14 = $bottom + $top;
+ $15 = -$14;
+ $16 = $3;
+ $17 = $15 / $16;
+ $18 = $17;
+ $19 = $near + $far;
+ $20 = -$19;
+ $21 = $5;
+ $22 = $20 / $21;
+ $23 = $22;
+ HEAPF32[$agg$result>>2] = $6;
+ $24 = ((($agg$result)) + 4|0);
+ HEAPF32[$24>>2] = 0.0;
+ $25 = ((($agg$result)) + 8|0);
+ HEAPF32[$25>>2] = 0.0;
+ $26 = ((($agg$result)) + 12|0);
+ HEAPF32[$26>>2] = $13;
+ $27 = ((($agg$result)) + 16|0);
+ HEAPF32[$27>>2] = 0.0;
+ $28 = ((($agg$result)) + 20|0);
+ HEAPF32[$28>>2] = $7;
+ $29 = ((($agg$result)) + 24|0);
+ HEAPF32[$29>>2] = 0.0;
+ $30 = ((($agg$result)) + 28|0);
+ HEAPF32[$30>>2] = $18;
+ $31 = ((($agg$result)) + 32|0);
+ HEAPF32[$31>>2] = 0.0;
+ $32 = ((($agg$result)) + 36|0);
+ HEAPF32[$32>>2] = 0.0;
+ $33 = ((($agg$result)) + 40|0);
+ HEAPF32[$33>>2] = $8;
+ $34 = ((($agg$result)) + 44|0);
+ HEAPF32[$34>>2] = $23;
+ $35 = ((($agg$result)) + 48|0);
+ HEAPF32[$35>>2] = 0.0;
+ $36 = ((($agg$result)) + 52|0);
+ HEAPF32[$36>>2] = 0.0;
+ $37 = ((($agg$result)) + 56|0);
+ HEAPF32[$37>>2] = 0.0;
+ $38 = ((($agg$result)) + 60|0);
+ HEAPF32[$38>>2] = 1.0;
+ return;
+}
+function _MatrixLookAt($agg$result,$eye,$target,$up) {
+ $agg$result = $agg$result|0;
+ $eye = $eye|0;
+ $target = $target|0;
+ $up = $up|0;
+ var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
+ var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, $x = 0, $x$byval_copy = 0, $y = 0, $z = 0, $z$byval_copy1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $x$byval_copy = sp + 48|0;
+ $z$byval_copy1 = sp + 36|0;
+ $z = sp + 24|0;
+ $x = sp + 12|0;
+ $y = sp;
+ ;HEAP32[$z$byval_copy1>>2]=HEAP32[$eye>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$eye+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$eye+8>>2]|0;
+ ;HEAP32[$x$byval_copy>>2]=HEAP32[$target>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$target+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$target+8>>2]|0;
+ _VectorSubtract($z,$z$byval_copy1,$x$byval_copy);
+ _VectorNormalize($z);
+ ;HEAP32[$z$byval_copy1>>2]=HEAP32[$up>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$up+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$up+8>>2]|0;
+ ;HEAP32[$x$byval_copy>>2]=HEAP32[$z>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$z+8>>2]|0;
+ _VectorCrossProduct($x,$z$byval_copy1,$x$byval_copy);
+ _VectorNormalize($x);
+ ;HEAP32[$z$byval_copy1>>2]=HEAP32[$z>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$z+8>>2]|0;
+ ;HEAP32[$x$byval_copy>>2]=HEAP32[$x>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$x+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$x+8>>2]|0;
+ _VectorCrossProduct($y,$z$byval_copy1,$x$byval_copy);
+ _VectorNormalize($y);
+ $0 = +HEAPF32[$x>>2];
+ $1 = ((($x)) + 4|0);
+ $2 = +HEAPF32[$1>>2];
+ $3 = ((($x)) + 8|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = +HEAPF32[$eye>>2];
+ $6 = $0 * $5;
+ $7 = ((($eye)) + 4|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $2 * $8;
+ $10 = $6 + $9;
+ $11 = ((($eye)) + 8|0);
+ $12 = +HEAPF32[$11>>2];
+ $13 = $4 * $12;
+ $14 = $10 + $13;
+ $15 = -$14;
+ $16 = +HEAPF32[$y>>2];
+ $17 = ((($y)) + 4|0);
+ $18 = +HEAPF32[$17>>2];
+ $19 = ((($y)) + 8|0);
+ $20 = +HEAPF32[$19>>2];
+ $21 = $5 * $16;
+ $22 = $8 * $18;
+ $23 = $21 + $22;
+ $24 = $12 * $20;
+ $25 = $23 + $24;
+ $26 = -$25;
+ $27 = +HEAPF32[$z>>2];
+ $28 = ((($z)) + 4|0);
+ $29 = +HEAPF32[$28>>2];
+ $30 = ((($z)) + 8|0);
+ $31 = +HEAPF32[$30>>2];
+ $32 = $5 * $27;
+ $33 = $8 * $29;
+ $34 = $32 + $33;
+ $35 = $12 * $31;
+ $36 = $34 + $35;
+ $37 = -$36;
+ HEAPF32[$agg$result>>2] = $0;
+ $38 = ((($agg$result)) + 4|0);
+ HEAPF32[$38>>2] = $16;
+ $39 = ((($agg$result)) + 8|0);
+ HEAPF32[$39>>2] = $27;
+ $40 = ((($agg$result)) + 12|0);
+ HEAPF32[$40>>2] = 0.0;
+ $41 = ((($agg$result)) + 16|0);
+ HEAPF32[$41>>2] = $2;
+ $42 = ((($agg$result)) + 20|0);
+ HEAPF32[$42>>2] = $18;
+ $43 = ((($agg$result)) + 24|0);
+ HEAPF32[$43>>2] = $29;
+ $44 = ((($agg$result)) + 28|0);
+ HEAPF32[$44>>2] = 0.0;
+ $45 = ((($agg$result)) + 32|0);
+ HEAPF32[$45>>2] = $4;
+ $46 = ((($agg$result)) + 36|0);
+ HEAPF32[$46>>2] = $20;
+ $47 = ((($agg$result)) + 40|0);
+ HEAPF32[$47>>2] = $31;
+ $48 = ((($agg$result)) + 44|0);
+ HEAPF32[$48>>2] = 0.0;
+ $49 = ((($agg$result)) + 48|0);
+ HEAPF32[$49>>2] = $15;
+ $50 = ((($agg$result)) + 52|0);
+ HEAPF32[$50>>2] = $26;
+ $51 = ((($agg$result)) + 56|0);
+ HEAPF32[$51>>2] = $37;
+ $52 = ((($agg$result)) + 60|0);
+ HEAPF32[$52>>2] = 1.0;
+ STACKTOP = sp;return;
+}
+function _InitWindow($width,$height,$title) {
+ $width = $width|0;
+ $height = $height|0;
+ $title = $title|0;
+ var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ _TraceLog(0,7587,$vararg_buffer);
+ HEAP32[488>>2] = $title;
+ _InitGraphicsDevice($width,$height);
+ _LoadDefaultFont();
+ _InitTimer();
+ (_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(5|0))|0);
+ (_emscripten_set_touchstart_callback((7616|0),(0|0),1,(6|0))|0);
+ (_emscripten_set_touchend_callback((7616|0),(0|0),1,(6|0))|0);
+ (_emscripten_set_touchmove_callback((7616|0),(0|0),1,(6|0))|0);
+ (_emscripten_set_touchcancel_callback((7616|0),(0|0),1,(6|0))|0);
+ $0 = HEAP32[492>>2]|0;
+ $1 = (+($0|0));
+ $2 = $1 * 0.5;
+ HEAPF32[8>>2] = $2;
+ $3 = HEAP32[496>>2]|0;
+ $4 = (+($3|0));
+ $5 = $4 * 0.5;
+ HEAPF32[(12)>>2] = $5;
+ $6 = HEAP32[500>>2]|0;
+ $7 = ($6|0)==(0);
+ if ($7) {
+ STACKTOP = sp;return;
+ }
+ _SetTargetFPS(60);
+ _LogoAnimation();
+ STACKTOP = sp;return;
+}
+function _SetTargetFPS($fps) {
+ $fps = $fps|0;
+ var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = (+($fps|0));
+ $1 = 1.0 / $0;
+ HEAPF64[16>>3] = $1;
+ $2 = $1;
+ $3 = $2 * 1000.0;
+ $4 = $3;
+ HEAPF64[$vararg_buffer>>3] = $4;
+ _TraceLog(0,7624,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _CloseWindow() {
+ var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ _UnloadDefaultFont();
+ _rlglClose();
+ $0 = HEAP32[504>>2]|0;
+ _glfwDestroyWindow(($0|0));
+ _glfwTerminate();
+ _TraceLog(0,7668,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _GetScreenWidth() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[492>>2]|0;
+ return ($0|0);
+}
+function _GetScreenHeight() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[496>>2]|0;
+ return ($0|0);
+}
+function _ClearBackground($color) {
+ $color = $color|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP8[$color>>0]|0;
+ $1 = ((($color)) + 1|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = ((($color)) + 2|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = ((($color)) + 3|0);
+ $6 = HEAP8[$5>>0]|0;
+ _rlClearColor($0,$2,$4,$6);
+ return;
+}
+function _BeginDrawing() {
+ var $0 = 0.0, $1 = 0.0, $2 = 0.0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $downscaleView$byval_copy = sp;
+ $0 = (+_GetTime());
+ HEAPF64[24>>3] = $0;
+ $1 = +HEAPF64[32>>3];
+ $2 = $0 - $1;
+ HEAPF64[40>>3] = $2;
+ HEAPF64[32>>3] = $0;
+ _rlClearScreenBuffers();
+ _rlLoadIdentity();
+ dest=$downscaleView$byval_copy; src=512; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ (_MatrixToFloat($downscaleView$byval_copy)|0);
+ _rlMultMatrixf(576);
+ STACKTOP = sp;return;
+}
+function _MatrixToFloat($mat) {
+ $mat = $mat|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$mat>>2]|0;
+ HEAP32[576>>2] = $0;
+ $1 = ((($mat)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ HEAP32[(580)>>2] = $2;
+ $3 = ((($mat)) + 8|0);
+ $4 = HEAP32[$3>>2]|0;
+ HEAP32[(584)>>2] = $4;
+ $5 = ((($mat)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ HEAP32[(588)>>2] = $6;
+ $7 = ((($mat)) + 16|0);
+ $8 = HEAP32[$7>>2]|0;
+ HEAP32[(592)>>2] = $8;
+ $9 = ((($mat)) + 20|0);
+ $10 = HEAP32[$9>>2]|0;
+ HEAP32[(596)>>2] = $10;
+ $11 = ((($mat)) + 24|0);
+ $12 = HEAP32[$11>>2]|0;
+ HEAP32[(600)>>2] = $12;
+ $13 = ((($mat)) + 28|0);
+ $14 = HEAP32[$13>>2]|0;
+ HEAP32[(604)>>2] = $14;
+ $15 = ((($mat)) + 32|0);
+ $16 = HEAP32[$15>>2]|0;
+ HEAP32[(608)>>2] = $16;
+ $17 = ((($mat)) + 36|0);
+ $18 = HEAP32[$17>>2]|0;
+ HEAP32[(612)>>2] = $18;
+ $19 = ((($mat)) + 40|0);
+ $20 = HEAP32[$19>>2]|0;
+ HEAP32[(616)>>2] = $20;
+ $21 = ((($mat)) + 44|0);
+ $22 = HEAP32[$21>>2]|0;
+ HEAP32[(620)>>2] = $22;
+ $23 = ((($mat)) + 48|0);
+ $24 = HEAP32[$23>>2]|0;
+ HEAP32[(624)>>2] = $24;
+ $25 = ((($mat)) + 52|0);
+ $26 = HEAP32[$25>>2]|0;
+ HEAP32[(628)>>2] = $26;
+ $27 = ((($mat)) + 56|0);
+ $28 = HEAP32[$27>>2]|0;
+ HEAP32[(632)>>2] = $28;
+ $29 = ((($mat)) + 60|0);
+ $30 = HEAP32[$29>>2]|0;
+ HEAP32[(636)>>2] = $30;
+ return (576|0);
+}
+function _EndDrawing() {
+ var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglDraw();
+ _SwapBuffers();
+ _PollInputEvents();
+ $0 = (+_GetTime());
+ HEAPF64[24>>3] = $0;
+ $1 = +HEAPF64[32>>3];
+ $2 = $0 - $1;
+ HEAPF64[48>>3] = $2;
+ HEAPF64[32>>3] = $0;
+ $3 = +HEAPF64[40>>3];
+ $4 = $3 + $2;
+ HEAPF64[56>>3] = $4;
+ $5 = +HEAPF64[16>>3];
+ $6 = $4 < $5;
+ if (!($6)) {
+ return;
+ }
+ while(1) {
+ $7 = (+_GetTime());
+ HEAPF64[24>>3] = $7;
+ $8 = +HEAPF64[32>>3];
+ $9 = $7 - $8;
+ HEAPF64[32>>3] = $7;
+ $10 = +HEAPF64[56>>3];
+ $11 = $10 + $9;
+ HEAPF64[56>>3] = $11;
+ $12 = +HEAPF64[16>>3];
+ $13 = $11 < $12;
+ if (!($13)) {
+ break;
+ }
+ }
+ return;
+}
+function _Begin3dMode($camera) {
+ $camera = $camera|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0;
+ var $8 = 0.0, $9 = 0.0, $cameraView = 0, $cameraView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 160|0;
+ $cameraView$byval_copy = sp + 88|0;
+ $$byval_copy1 = sp + 76|0;
+ $$byval_copy = sp + 64|0;
+ $cameraView = sp;
+ _rlglDraw();
+ $0 = (_IsVrDeviceReady()|0);
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ _BeginVrDrawing();
+ }
+ _rlMatrixMode(0);
+ _rlPushMatrix();
+ _rlLoadIdentity();
+ $2 = HEAP32[492>>2]|0;
+ $3 = (+($2|0));
+ $4 = HEAP32[496>>2]|0;
+ $5 = (+($4|0));
+ $6 = $3 / $5;
+ $7 = ((($camera)) + 36|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $8;
+ $10 = $9 * 3.1415926535897931;
+ $11 = $10 / 360.0;
+ $12 = (+Math_tan((+$11)));
+ $13 = $12 * 0.01;
+ $14 = $6;
+ $15 = $14 * $13;
+ $16 = -$15;
+ $17 = -$13;
+ _rlFrustum($16,$15,$17,$13,0.01,1000.0);
+ _rlMatrixMode(1);
+ _rlLoadIdentity();
+ $18 = ((($camera)) + 12|0);
+ $19 = ((($camera)) + 24|0);
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$camera>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$camera+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$camera+8>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$18+8>>2]|0;
+ ;HEAP32[$cameraView$byval_copy>>2]=HEAP32[$19>>2]|0;HEAP32[$cameraView$byval_copy+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$cameraView$byval_copy+8>>2]=HEAP32[$19+8>>2]|0;
+ _MatrixLookAt($cameraView,$$byval_copy,$$byval_copy1,$cameraView$byval_copy);
+ dest=$cameraView$byval_copy; src=$cameraView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ (_MatrixToFloat($cameraView$byval_copy)|0);
+ _rlMultMatrixf(576);
+ _rlEnableDepthTest();
+ STACKTOP = sp;return;
+}
+function _End3dMode() {
+ var $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglDraw();
+ $0 = (_IsVrDeviceReady()|0);
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ _EndVrDrawing();
+ }
+ _rlMatrixMode(0);
+ _rlPopMatrix();
+ _rlMatrixMode(1);
+ _rlLoadIdentity();
+ _rlDisableDepthTest();
+ return;
+}
+function _GetFPS() {
+ var $0 = 0.0, $1 = 0.0, $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF64[56>>3];
+ $1 = 1.0 / $0;
+ $2 = $1;
+ return (+$2);
+}
+function _IsMouseButtonPressed($button) {
+ $button = $button|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $pressed$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (8720 + ($button)|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = (8723 + ($button)|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ($1<<24>>24)!=($3<<24>>24);
+ $5 = ($1<<24>>24)==(1);
+ $or$cond = $5 & $4;
+ $pressed$0 = $or$cond&1;
+ return ($pressed$0|0);
+}
+function _IsMouseButtonReleased($button) {
+ $button = $button|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $released$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (8720 + ($button)|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = (8723 + ($button)|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ($1<<24>>24)!=($3<<24>>24);
+ $5 = ($1<<24>>24)==(0);
+ $or$cond = $5 & $4;
+ $released$0 = $or$cond&1;
+ return ($released$0|0);
+}
+function _GetMousePosition($agg$result) {
+ $agg$result = $agg$result|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = 8;
+ $1 = $0;
+ $2 = HEAP32[$1>>2]|0;
+ $3 = (($0) + 4)|0;
+ $4 = $3;
+ $5 = HEAP32[$4>>2]|0;
+ $6 = $agg$result;
+ $7 = $6;
+ HEAP32[$7>>2] = $2;
+ $8 = (($6) + 4)|0;
+ $9 = $8;
+ HEAP32[$9>>2] = $5;
+ return;
+}
+function _rlMatrixMode($mode) {
+ $mode = $mode|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ switch ($mode|0) {
+ case 0: {
+ HEAP32[744>>2] = 680;
+ break;
+ }
+ case 1: {
+ HEAP32[744>>2] = 748;
+ break;
+ }
+ default: {
+ }
+ }
+ HEAP32[812>>2] = $mode;
+ return;
+}
+function _rlPushMatrix() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = HEAP32[816>>2]|0;
+ $1 = ($0|0)==(15);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = 16;
+ _TraceLog(1,8726,$vararg_buffer);
+ }
+ $2 = HEAP32[816>>2]|0;
+ $3 = (820 + ($2<<6)|0);
+ $4 = HEAP32[744>>2]|0;
+ dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _rlLoadIdentity();
+ $5 = HEAP32[816>>2]|0;
+ $6 = (($5) + 1)|0;
+ HEAP32[816>>2] = $6;
+ $7 = HEAP32[812>>2]|0;
+ $8 = ($7|0)==(1);
+ if (!($8)) {
+ STACKTOP = sp;return;
+ }
+ HEAP32[1844>>2] = 1;
+ STACKTOP = sp;return;
+}
+function _rlLoadIdentity() {
+ var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $0 = sp;
+ $1 = HEAP32[744>>2]|0;
+ _MatrixIdentity($0);
+ dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlPopMatrix() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[816>>2]|0;
+ $1 = ($0|0)>(0);
+ if (!($1)) {
+ return;
+ }
+ $2 = HEAP32[816>>2]|0;
+ $3 = (($2) + -1)|0;
+ $4 = (820 + ($3<<6)|0);
+ $5 = HEAP32[744>>2]|0;
+ _memmove(($5|0),($4|0),64)|0;
+ $6 = HEAP32[816>>2]|0;
+ $7 = (($6) + -1)|0;
+ HEAP32[816>>2] = $7;
+ return;
+}
+function _rlTranslatef($x,$y,$z) {
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $matTranslation = 0, $matTranslation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $matTranslation$byval_copy = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $matTranslation = sp + 64|0;
+ $0 = sp;
+ _MatrixTranslate($matTranslation,$x,$y,$z);
+ _MatrixTranspose($matTranslation);
+ $1 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matTranslation$byval_copy; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$$byval_copy,$matTranslation$byval_copy);
+ dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlRotatef($angleDeg,$x,$y,$z) {
+ $angleDeg = +$angleDeg;
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $axis = 0, $matRotation = 0, $matRotation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 336|0;
+ $matRotation$byval_copy = sp + 272|0;
+ $$byval_copy = sp + 208|0;
+ $matRotation = sp + 144|0;
+ $axis = sp + 128|0;
+ $0 = sp + 64|0;
+ $1 = sp;
+ _MatrixIdentity($matRotation);
+ HEAPF32[$axis>>2] = $x;
+ $2 = ((($axis)) + 4|0);
+ HEAPF32[$2>>2] = $y;
+ $3 = ((($axis)) + 8|0);
+ HEAPF32[$3>>2] = $z;
+ _VectorNormalize($axis);
+ $4 = $angleDeg;
+ $5 = $4 * 0.017453292519943295;
+ $6 = $5;
+ ;HEAP32[$matRotation$byval_copy>>2]=HEAP32[$axis>>2]|0;HEAP32[$matRotation$byval_copy+4>>2]=HEAP32[$axis+4>>2]|0;HEAP32[$matRotation$byval_copy+8>>2]=HEAP32[$axis+8>>2]|0;
+ _MatrixRotate($0,$matRotation$byval_copy,$6);
+ dest=$matRotation; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixTranspose($matRotation);
+ $7 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matRotation$byval_copy; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($1,$$byval_copy,$matRotation$byval_copy);
+ dest=$7; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlScalef($x,$y,$z) {
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $matScale = 0, $matScale$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $matScale$byval_copy = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $matScale = sp + 64|0;
+ $0 = sp;
+ _MatrixScale($matScale,$x,$y,$z);
+ _MatrixTranspose($matScale);
+ $1 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matScale$byval_copy; src=$matScale; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$$byval_copy,$matScale$byval_copy);
+ dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlMultMatrixf($m) {
+ $m = $m|0;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $mat = 0, $mat$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $mat$byval_copy = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $mat = sp + 64|0;
+ $0 = sp;
+ $1 = HEAP32[$m>>2]|0;
+ HEAP32[$mat>>2] = $1;
+ $2 = ((($mat)) + 4|0);
+ $3 = ((($m)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ HEAP32[$2>>2] = $4;
+ $5 = ((($mat)) + 8|0);
+ $6 = ((($m)) + 8|0);
+ $7 = HEAP32[$6>>2]|0;
+ HEAP32[$5>>2] = $7;
+ $8 = ((($mat)) + 12|0);
+ $9 = ((($m)) + 12|0);
+ $10 = HEAP32[$9>>2]|0;
+ HEAP32[$8>>2] = $10;
+ $11 = ((($mat)) + 16|0);
+ $12 = ((($m)) + 16|0);
+ $13 = HEAP32[$12>>2]|0;
+ HEAP32[$11>>2] = $13;
+ $14 = ((($mat)) + 20|0);
+ $15 = ((($m)) + 20|0);
+ $16 = HEAP32[$15>>2]|0;
+ HEAP32[$14>>2] = $16;
+ $17 = ((($mat)) + 24|0);
+ $18 = ((($m)) + 24|0);
+ $19 = HEAP32[$18>>2]|0;
+ HEAP32[$17>>2] = $19;
+ $20 = ((($mat)) + 28|0);
+ $21 = ((($m)) + 28|0);
+ $22 = HEAP32[$21>>2]|0;
+ HEAP32[$20>>2] = $22;
+ $23 = ((($mat)) + 32|0);
+ $24 = ((($m)) + 32|0);
+ $25 = HEAP32[$24>>2]|0;
+ HEAP32[$23>>2] = $25;
+ $26 = ((($mat)) + 36|0);
+ $27 = ((($m)) + 36|0);
+ $28 = HEAP32[$27>>2]|0;
+ HEAP32[$26>>2] = $28;
+ $29 = ((($mat)) + 40|0);
+ $30 = ((($m)) + 40|0);
+ $31 = HEAP32[$30>>2]|0;
+ HEAP32[$29>>2] = $31;
+ $32 = ((($mat)) + 44|0);
+ $33 = ((($m)) + 44|0);
+ $34 = HEAP32[$33>>2]|0;
+ HEAP32[$32>>2] = $34;
+ $35 = ((($mat)) + 48|0);
+ $36 = ((($m)) + 48|0);
+ $37 = HEAP32[$36>>2]|0;
+ HEAP32[$35>>2] = $37;
+ $38 = ((($mat)) + 52|0);
+ $39 = ((($m)) + 52|0);
+ $40 = HEAP32[$39>>2]|0;
+ HEAP32[$38>>2] = $40;
+ $41 = ((($mat)) + 56|0);
+ $42 = ((($m)) + 56|0);
+ $43 = HEAP32[$42>>2]|0;
+ HEAP32[$41>>2] = $43;
+ $44 = ((($mat)) + 60|0);
+ $45 = ((($m)) + 60|0);
+ $46 = HEAP32[$45>>2]|0;
+ HEAP32[$44>>2] = $46;
+ $47 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$47; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$mat$byval_copy; src=$mat; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$$byval_copy,$mat$byval_copy);
+ dest=$47; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlFrustum($left,$right,$bottom,$top,$near,$far) {
+ $left = +$left;
+ $right = +$right;
+ $bottom = +$bottom;
+ $top = +$top;
+ $near = +$near;
+ $far = +$far;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $matPerps = 0, $matPerps$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $matPerps$byval_copy = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $matPerps = sp + 64|0;
+ $0 = sp;
+ _MatrixFrustum($matPerps,$left,$right,$bottom,$top,$near,$far);
+ _MatrixTranspose($matPerps);
+ $1 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matPerps$byval_copy; src=$matPerps; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$$byval_copy,$matPerps$byval_copy);
+ dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlOrtho($left,$right,$bottom,$top,$near,$far) {
+ $left = +$left;
+ $right = +$right;
+ $bottom = +$bottom;
+ $top = +$top;
+ $near = +$near;
+ $far = +$far;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $matOrtho = 0, $matOrtho$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $matOrtho$byval_copy = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $matOrtho = sp + 64|0;
+ $0 = sp;
+ _MatrixOrtho($matOrtho,$left,$right,$bottom,$top,$near,$far);
+ _MatrixTranspose($matOrtho);
+ $1 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matOrtho$byval_copy; src=$matOrtho; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$$byval_copy,$matOrtho$byval_copy);
+ dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlViewport($x,$y,$width,$height) {
+ $x = $x|0;
+ $y = $y|0;
+ $width = $width|0;
+ $height = $height|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glViewport(($x|0),($y|0),($width|0),($height|0));
+ return;
+}
+function _rlBegin($mode) {
+ $mode = $mode|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[1848>>2] = $mode;
+ return;
+}
+function _rlEnd() {
+ var $$byval_copy = 0, $$lcssa = 0, $$promoted = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
+ var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0;
+ var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
+ var $15 = 0.0, $150 = 0, $151 = 0.0, $152 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
+ var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
+ var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
+ var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond16 = 0, $exitcond17 = 0, $exitcond18 = 0;
+ var $i$013 = 0, $i1$011 = 0, $i2$04 = 0, $i4$05 = 0, $i6$09 = 0, $i7$07 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $$byval_copy = sp;
+ $0 = HEAP32[1844>>2]|0;
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = HEAP32[1852>>2]|0;
+ $3 = ($2|0)>(0);
+ if ($3) {
+ $i$013 = 0;
+ while(1) {
+ $4 = HEAP32[1856>>2]|0;
+ $5 = (($4) + (($i$013*12)|0)|0);
+ $6 = HEAP32[744>>2]|0;
+ dest=$$byval_copy; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _VectorTransform($5,$$byval_copy);
+ $7 = (($i$013) + 1)|0;
+ $8 = HEAP32[1852>>2]|0;
+ $9 = ($7|0)<($8|0);
+ if ($9) {
+ $i$013 = $7;
+ } else {
+ $$lcssa = $8;
+ break;
+ }
+ }
+ HEAP32[1844>>2] = 0;
+ $10 = ($$lcssa|0)>(0);
+ if ($10) {
+ $i1$011 = 0;
+ while(1) {
+ $11 = HEAP32[1856>>2]|0;
+ $12 = (($11) + (($i1$011*12)|0)|0);
+ $13 = +HEAPF32[$12>>2];
+ $14 = (((($11) + (($i1$011*12)|0)|0)) + 4|0);
+ $15 = +HEAPF32[$14>>2];
+ $16 = (((($11) + (($i1$011*12)|0)|0)) + 8|0);
+ $17 = +HEAPF32[$16>>2];
+ _rlVertex3f($13,$15,$17);
+ $18 = (($i1$011) + 1)|0;
+ $19 = HEAP32[1852>>2]|0;
+ $20 = ($18|0)<($19|0);
+ if ($20) {
+ $i1$011 = $18;
+ } else {
+ break;
+ }
+ }
+ }
+ } else {
+ HEAP32[1844>>2] = 0;
+ }
+ HEAP32[1852>>2] = 0;
+ }
+ $21 = HEAP32[1848>>2]|0;
+ switch ($21|0) {
+ case 0: {
+ $22 = HEAP32[1860>>2]|0;
+ $23 = HEAP32[(1868)>>2]|0;
+ $24 = ($22|0)>($23|0);
+ if (!($24)) {
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ }
+ $25 = (($22) - ($23))|0;
+ $i2$04 = 0;
+ while(1) {
+ $26 = HEAP32[(1868)>>2]|0;
+ $27 = $26 << 2;
+ $28 = (($27) + -4)|0;
+ $29 = HEAP32[(1880)>>2]|0;
+ $30 = (($29) + ($28)|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = (($29) + ($27)|0);
+ HEAP8[$32>>0] = $31;
+ $33 = HEAP32[(1868)>>2]|0;
+ $34 = $33 << 2;
+ $35 = (($34) + -3)|0;
+ $36 = HEAP32[(1880)>>2]|0;
+ $37 = (($36) + ($35)|0);
+ $38 = HEAP8[$37>>0]|0;
+ $39 = $34 | 1;
+ $40 = (($36) + ($39)|0);
+ HEAP8[$40>>0] = $38;
+ $41 = HEAP32[(1868)>>2]|0;
+ $42 = $41 << 2;
+ $43 = (($42) + -2)|0;
+ $44 = HEAP32[(1880)>>2]|0;
+ $45 = (($44) + ($43)|0);
+ $46 = HEAP8[$45>>0]|0;
+ $47 = $42 | 2;
+ $48 = (($44) + ($47)|0);
+ HEAP8[$48>>0] = $46;
+ $49 = HEAP32[(1868)>>2]|0;
+ $50 = $49 << 2;
+ $51 = (($50) + -1)|0;
+ $52 = HEAP32[(1880)>>2]|0;
+ $53 = (($52) + ($51)|0);
+ $54 = HEAP8[$53>>0]|0;
+ $55 = $50 | 3;
+ $56 = (($52) + ($55)|0);
+ HEAP8[$56>>0] = $54;
+ $57 = HEAP32[(1868)>>2]|0;
+ $58 = (($57) + 1)|0;
+ HEAP32[(1868)>>2] = $58;
+ $59 = (($i2$04) + 1)|0;
+ $exitcond = ($59|0)==($25|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i2$04 = $59;
+ }
+ }
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 1: {
+ $60 = HEAP32[1908>>2]|0;
+ $61 = HEAP32[(1916)>>2]|0;
+ $62 = ($60|0)>($61|0);
+ if (!($62)) {
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ }
+ $63 = (($60) - ($61))|0;
+ $i4$05 = 0;
+ while(1) {
+ $64 = HEAP32[(1916)>>2]|0;
+ $65 = $64 << 2;
+ $66 = (($65) + -4)|0;
+ $67 = HEAP32[(1928)>>2]|0;
+ $68 = (($67) + ($66)|0);
+ $69 = HEAP8[$68>>0]|0;
+ $70 = (($67) + ($65)|0);
+ HEAP8[$70>>0] = $69;
+ $71 = HEAP32[(1916)>>2]|0;
+ $72 = $71 << 2;
+ $73 = (($72) + -3)|0;
+ $74 = HEAP32[(1928)>>2]|0;
+ $75 = (($74) + ($73)|0);
+ $76 = HEAP8[$75>>0]|0;
+ $77 = $72 | 1;
+ $78 = (($74) + ($77)|0);
+ HEAP8[$78>>0] = $76;
+ $79 = HEAP32[(1916)>>2]|0;
+ $80 = $79 << 2;
+ $81 = (($80) + -2)|0;
+ $82 = HEAP32[(1928)>>2]|0;
+ $83 = (($82) + ($81)|0);
+ $84 = HEAP8[$83>>0]|0;
+ $85 = $80 | 2;
+ $86 = (($82) + ($85)|0);
+ HEAP8[$86>>0] = $84;
+ $87 = HEAP32[(1916)>>2]|0;
+ $88 = $87 << 2;
+ $89 = (($88) + -1)|0;
+ $90 = HEAP32[(1928)>>2]|0;
+ $91 = (($90) + ($89)|0);
+ $92 = HEAP8[$91>>0]|0;
+ $93 = $88 | 3;
+ $94 = (($90) + ($93)|0);
+ HEAP8[$94>>0] = $92;
+ $95 = HEAP32[(1916)>>2]|0;
+ $96 = (($95) + 1)|0;
+ HEAP32[(1916)>>2] = $96;
+ $97 = (($i4$05) + 1)|0;
+ $exitcond16 = ($97|0)==($63|0);
+ if ($exitcond16) {
+ break;
+ } else {
+ $i4$05 = $97;
+ }
+ }
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 2: {
+ $98 = HEAP32[1956>>2]|0;
+ $99 = HEAP32[(1964)>>2]|0;
+ $100 = ($98|0)>($99|0);
+ if ($100) {
+ $101 = (($98) - ($99))|0;
+ $i6$09 = 0;
+ while(1) {
+ $102 = HEAP32[(1964)>>2]|0;
+ $103 = $102 << 2;
+ $104 = (($103) + -4)|0;
+ $105 = HEAP32[(1976)>>2]|0;
+ $106 = (($105) + ($104)|0);
+ $107 = HEAP8[$106>>0]|0;
+ $108 = (($105) + ($103)|0);
+ HEAP8[$108>>0] = $107;
+ $109 = HEAP32[(1964)>>2]|0;
+ $110 = $109 << 2;
+ $111 = (($110) + -3)|0;
+ $112 = HEAP32[(1976)>>2]|0;
+ $113 = (($112) + ($111)|0);
+ $114 = HEAP8[$113>>0]|0;
+ $115 = $110 | 1;
+ $116 = (($112) + ($115)|0);
+ HEAP8[$116>>0] = $114;
+ $117 = HEAP32[(1964)>>2]|0;
+ $118 = $117 << 2;
+ $119 = (($118) + -2)|0;
+ $120 = HEAP32[(1976)>>2]|0;
+ $121 = (($120) + ($119)|0);
+ $122 = HEAP8[$121>>0]|0;
+ $123 = $118 | 2;
+ $124 = (($120) + ($123)|0);
+ HEAP8[$124>>0] = $122;
+ $125 = HEAP32[(1964)>>2]|0;
+ $126 = $125 << 2;
+ $127 = (($126) + -1)|0;
+ $128 = HEAP32[(1976)>>2]|0;
+ $129 = (($128) + ($127)|0);
+ $130 = HEAP8[$129>>0]|0;
+ $131 = $126 | 3;
+ $132 = (($128) + ($131)|0);
+ HEAP8[$132>>0] = $130;
+ $133 = HEAP32[(1964)>>2]|0;
+ $134 = (($133) + 1)|0;
+ HEAP32[(1964)>>2] = $134;
+ $135 = (($i6$09) + 1)|0;
+ $exitcond18 = ($135|0)==($101|0);
+ if ($exitcond18) {
+ break;
+ } else {
+ $i6$09 = $135;
+ }
+ }
+ }
+ $136 = HEAP32[1956>>2]|0;
+ $137 = HEAP32[(1960)>>2]|0;
+ $138 = ($136|0)>($137|0);
+ if (!($138)) {
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ }
+ $139 = HEAP32[(1972)>>2]|0;
+ $$promoted = HEAP32[(1960)>>2]|0;
+ $140 = (($136) + ($$promoted))|0;
+ $141 = (($136) - ($137))|0;
+ $143 = $$promoted;$i7$07 = 0;
+ while(1) {
+ $142 = $143 << 1;
+ $144 = (($139) + ($142<<2)|0);
+ HEAPF32[$144>>2] = 0.0;
+ $145 = $143 << 1;
+ $146 = $145 | 1;
+ $147 = (($139) + ($146<<2)|0);
+ HEAPF32[$147>>2] = 0.0;
+ $148 = (($143) + 1)|0;
+ $149 = (($i7$07) + 1)|0;
+ $exitcond17 = ($149|0)==($141|0);
+ if ($exitcond17) {
+ break;
+ } else {
+ $143 = $148;$i7$07 = $149;
+ }
+ }
+ $150 = (($140) - ($137))|0;
+ HEAP32[(1960)>>2] = $150;
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ $151 = +HEAPF32[2004>>2];
+ $152 = $151 + 4.9999998736893758E-5;
+ HEAPF32[2004>>2] = $152;
+ STACKTOP = sp;return;
+ }
+ }
+}
+function _rlVertex3f($x,$y,$z) {
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $0 = HEAP32[1844>>2]|0;
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = HEAP32[1852>>2]|0;
+ $3 = HEAP32[1856>>2]|0;
+ $4 = (($3) + (($2*12)|0)|0);
+ HEAPF32[$4>>2] = $x;
+ $5 = HEAP32[1852>>2]|0;
+ $6 = HEAP32[1856>>2]|0;
+ $7 = (((($6) + (($5*12)|0)|0)) + 4|0);
+ HEAPF32[$7>>2] = $y;
+ $8 = HEAP32[1852>>2]|0;
+ $9 = HEAP32[1856>>2]|0;
+ $10 = (((($9) + (($8*12)|0)|0)) + 8|0);
+ HEAPF32[$10>>2] = $z;
+ $11 = HEAP32[1852>>2]|0;
+ $12 = (($11) + 1)|0;
+ HEAP32[1852>>2] = $12;
+ STACKTOP = sp;return;
+ }
+ $13 = HEAP32[1848>>2]|0;
+ switch ($13|0) {
+ case 0: {
+ $14 = HEAP32[1860>>2]|0;
+ $15 = ($14|0)<(2048);
+ if ($15) {
+ $16 = ($14*3)|0;
+ $17 = HEAP32[(1872)>>2]|0;
+ $18 = (($17) + ($16<<2)|0);
+ HEAPF32[$18>>2] = $x;
+ $19 = HEAP32[1860>>2]|0;
+ $20 = ($19*3)|0;
+ $21 = (($20) + 1)|0;
+ $22 = HEAP32[(1872)>>2]|0;
+ $23 = (($22) + ($21<<2)|0);
+ HEAPF32[$23>>2] = $y;
+ $24 = HEAP32[1860>>2]|0;
+ $25 = ($24*3)|0;
+ $26 = (($25) + 2)|0;
+ $27 = HEAP32[(1872)>>2]|0;
+ $28 = (($27) + ($26<<2)|0);
+ HEAPF32[$28>>2] = $z;
+ $29 = HEAP32[1860>>2]|0;
+ $30 = (($29) + 1)|0;
+ HEAP32[1860>>2] = $30;
+ STACKTOP = sp;return;
+ } else {
+ _TraceLog(1,8764,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+ break;
+ }
+ case 1: {
+ $31 = HEAP32[1908>>2]|0;
+ $32 = ($31|0)<(6144);
+ if ($32) {
+ $33 = ($31*3)|0;
+ $34 = HEAP32[(1920)>>2]|0;
+ $35 = (($34) + ($33<<2)|0);
+ HEAPF32[$35>>2] = $x;
+ $36 = HEAP32[1908>>2]|0;
+ $37 = ($36*3)|0;
+ $38 = (($37) + 1)|0;
+ $39 = HEAP32[(1920)>>2]|0;
+ $40 = (($39) + ($38<<2)|0);
+ HEAPF32[$40>>2] = $y;
+ $41 = HEAP32[1908>>2]|0;
+ $42 = ($41*3)|0;
+ $43 = (($42) + 2)|0;
+ $44 = HEAP32[(1920)>>2]|0;
+ $45 = (($44) + ($43<<2)|0);
+ HEAPF32[$45>>2] = $z;
+ $46 = HEAP32[1908>>2]|0;
+ $47 = (($46) + 1)|0;
+ HEAP32[1908>>2] = $47;
+ STACKTOP = sp;return;
+ } else {
+ _TraceLog(1,8789,$vararg_buffer1);
+ STACKTOP = sp;return;
+ }
+ break;
+ }
+ case 2: {
+ $48 = HEAP32[1956>>2]|0;
+ $49 = ($48|0)<(4096);
+ if ($49) {
+ $50 = ($48*3)|0;
+ $51 = HEAP32[(1968)>>2]|0;
+ $52 = (($51) + ($50<<2)|0);
+ HEAPF32[$52>>2] = $x;
+ $53 = HEAP32[1956>>2]|0;
+ $54 = ($53*3)|0;
+ $55 = (($54) + 1)|0;
+ $56 = HEAP32[(1968)>>2]|0;
+ $57 = (($56) + ($55<<2)|0);
+ HEAPF32[$57>>2] = $y;
+ $58 = HEAP32[1956>>2]|0;
+ $59 = ($58*3)|0;
+ $60 = (($59) + 2)|0;
+ $61 = HEAP32[(1968)>>2]|0;
+ $62 = (($61) + ($60<<2)|0);
+ HEAPF32[$62>>2] = $z;
+ $63 = HEAP32[1956>>2]|0;
+ $64 = (($63) + 1)|0;
+ HEAP32[1956>>2] = $64;
+ $65 = HEAP32[2008>>2]|0;
+ $66 = (($65) + -1)|0;
+ $67 = HEAP32[2012>>2]|0;
+ $68 = (($67) + (($66*144)|0)|0);
+ $69 = HEAP32[$68>>2]|0;
+ $70 = (($69) + 1)|0;
+ HEAP32[$68>>2] = $70;
+ STACKTOP = sp;return;
+ } else {
+ _TraceLog(1,8818,$vararg_buffer3);
+ STACKTOP = sp;return;
+ }
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+}
+function _rlVertex2f($x,$y) {
+ $x = +$x;
+ $y = +$y;
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[2004>>2];
+ _rlVertex3f($x,$y,$0);
+ return;
+}
+function _rlTexCoord2f($x,$y) {
+ $x = +$x;
+ $y = +$y;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[1848>>2]|0;
+ $1 = ($0|0)==(2);
+ if (!($1)) {
+ return;
+ }
+ $2 = HEAP32[(1960)>>2]|0;
+ $3 = $2 << 1;
+ $4 = HEAP32[(1972)>>2]|0;
+ $5 = (($4) + ($3<<2)|0);
+ HEAPF32[$5>>2] = $x;
+ $6 = HEAP32[(1960)>>2]|0;
+ $7 = $6 << 1;
+ $8 = $7 | 1;
+ $9 = HEAP32[(1972)>>2]|0;
+ $10 = (($9) + ($8<<2)|0);
+ HEAPF32[$10>>2] = $y;
+ $11 = HEAP32[(1960)>>2]|0;
+ $12 = (($11) + 1)|0;
+ HEAP32[(1960)>>2] = $12;
+ return;
+}
+function _rlNormal3f($x,$y,$z) {
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function _rlColor4ub($x,$y,$z,$w) {
+ $x = $x|0;
+ $y = $y|0;
+ $z = $z|0;
+ $w = $w|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[1848>>2]|0;
+ switch ($0|0) {
+ case 0: {
+ $1 = HEAP32[(1868)>>2]|0;
+ $2 = $1 << 2;
+ $3 = HEAP32[(1880)>>2]|0;
+ $4 = (($3) + ($2)|0);
+ HEAP8[$4>>0] = $x;
+ $5 = HEAP32[(1868)>>2]|0;
+ $6 = $5 << 2;
+ $7 = $6 | 1;
+ $8 = HEAP32[(1880)>>2]|0;
+ $9 = (($8) + ($7)|0);
+ HEAP8[$9>>0] = $y;
+ $10 = HEAP32[(1868)>>2]|0;
+ $11 = $10 << 2;
+ $12 = $11 | 2;
+ $13 = HEAP32[(1880)>>2]|0;
+ $14 = (($13) + ($12)|0);
+ HEAP8[$14>>0] = $z;
+ $15 = HEAP32[(1868)>>2]|0;
+ $16 = $15 << 2;
+ $17 = $16 | 3;
+ $18 = HEAP32[(1880)>>2]|0;
+ $19 = (($18) + ($17)|0);
+ HEAP8[$19>>0] = $w;
+ $20 = HEAP32[(1868)>>2]|0;
+ $21 = (($20) + 1)|0;
+ HEAP32[(1868)>>2] = $21;
+ return;
+ break;
+ }
+ case 1: {
+ $22 = HEAP32[(1916)>>2]|0;
+ $23 = $22 << 2;
+ $24 = HEAP32[(1928)>>2]|0;
+ $25 = (($24) + ($23)|0);
+ HEAP8[$25>>0] = $x;
+ $26 = HEAP32[(1916)>>2]|0;
+ $27 = $26 << 2;
+ $28 = $27 | 1;
+ $29 = HEAP32[(1928)>>2]|0;
+ $30 = (($29) + ($28)|0);
+ HEAP8[$30>>0] = $y;
+ $31 = HEAP32[(1916)>>2]|0;
+ $32 = $31 << 2;
+ $33 = $32 | 2;
+ $34 = HEAP32[(1928)>>2]|0;
+ $35 = (($34) + ($33)|0);
+ HEAP8[$35>>0] = $z;
+ $36 = HEAP32[(1916)>>2]|0;
+ $37 = $36 << 2;
+ $38 = $37 | 3;
+ $39 = HEAP32[(1928)>>2]|0;
+ $40 = (($39) + ($38)|0);
+ HEAP8[$40>>0] = $w;
+ $41 = HEAP32[(1916)>>2]|0;
+ $42 = (($41) + 1)|0;
+ HEAP32[(1916)>>2] = $42;
+ return;
+ break;
+ }
+ case 2: {
+ $43 = HEAP32[(1964)>>2]|0;
+ $44 = $43 << 2;
+ $45 = HEAP32[(1976)>>2]|0;
+ $46 = (($45) + ($44)|0);
+ HEAP8[$46>>0] = $x;
+ $47 = HEAP32[(1964)>>2]|0;
+ $48 = $47 << 2;
+ $49 = $48 | 1;
+ $50 = HEAP32[(1976)>>2]|0;
+ $51 = (($50) + ($49)|0);
+ HEAP8[$51>>0] = $y;
+ $52 = HEAP32[(1964)>>2]|0;
+ $53 = $52 << 2;
+ $54 = $53 | 2;
+ $55 = HEAP32[(1976)>>2]|0;
+ $56 = (($55) + ($54)|0);
+ HEAP8[$56>>0] = $z;
+ $57 = HEAP32[(1964)>>2]|0;
+ $58 = $57 << 2;
+ $59 = $58 | 3;
+ $60 = HEAP32[(1976)>>2]|0;
+ $61 = (($60) + ($59)|0);
+ HEAP8[$61>>0] = $w;
+ $62 = HEAP32[(1964)>>2]|0;
+ $63 = (($62) + 1)|0;
+ HEAP32[(1964)>>2] = $63;
+ return;
+ break;
+ }
+ default: {
+ return;
+ }
+ }
+}
+function _rlColor3f($x,$y,$z) {
+ $x = +$x;
+ $y = +$y;
+ $z = +$z;
+ var $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $x * 255.0;
+ $1 = (~~(($0))&255);
+ $2 = $y * 255.0;
+ $3 = (~~(($2))&255);
+ $4 = $z * 255.0;
+ $5 = (~~(($4))&255);
+ _rlColor4ub($1,$3,$5,-1);
+ return;
+}
+function _rlEnableTexture($id) {
+ $id = $id|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[2008>>2]|0;
+ $1 = (($0) + -1)|0;
+ $2 = HEAP32[2012>>2]|0;
+ $3 = (((($2) + (($1*144)|0)|0)) + 8|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==($id|0);
+ if ($5) {
+ return;
+ }
+ $6 = (($2) + (($1*144)|0)|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)>(0);
+ if ($8) {
+ $9 = (($0) + 1)|0;
+ HEAP32[2008>>2] = $9;
+ }
+ $10 = HEAP32[2008>>2]|0;
+ $11 = (($10) + -1)|0;
+ $12 = HEAP32[2012>>2]|0;
+ $13 = (((($12) + (($11*144)|0)|0)) + 8|0);
+ HEAP32[$13>>2] = $id;
+ $14 = HEAP32[2008>>2]|0;
+ $15 = (($14) + -1)|0;
+ $16 = HEAP32[2012>>2]|0;
+ $17 = (($16) + (($15*144)|0)|0);
+ HEAP32[$17>>2] = 0;
+ return;
+}
+function _rlDisableTexture() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function _rlEnableRenderTexture($id) {
+ $id = $id|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glBindFramebuffer(36160,($id|0));
+ return;
+}
+function _rlDisableRenderTexture() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glBindFramebuffer(36160,0);
+ return;
+}
+function _rlEnableDepthTest() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glEnable(2929);
+ return;
+}
+function _rlDisableDepthTest() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glDisable(2929);
+ return;
+}
+function _rlDeleteTextures($id) {
+ $id = $id|0;
+ var $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $0 = sp;
+ HEAP32[$0>>2] = $id;
+ $1 = ($id|0)==(0);
+ if (!($1)) {
+ _glDeleteTextures(1,($0|0));
+ }
+ STACKTOP = sp;return;
+}
+function _rlDeleteVertexArrays($id) {
+ $id = $id|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = sp + 4|0;
+ HEAP32[$0>>2] = $id;
+ $1 = HEAP32[2016>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ STACKTOP = sp;return;
+ }
+ $3 = ($id|0)==(0);
+ if (!($3)) {
+ $4 = HEAP32[2020>>2]|0;
+ FUNCTION_TABLE_vii[$4 & 63](1,$0);
+ }
+ $5 = HEAP32[$0>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $5;
+ _TraceLog(0,8843,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _rlDeleteBuffers($id) {
+ $id = $id|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = sp + 4|0;
+ HEAP32[$0>>2] = $id;
+ $1 = ($id|0)==(0);
+ if ($1) {
+ STACKTOP = sp;return;
+ }
+ _glDeleteBuffers(1,($0|0));
+ $2 = HEAP32[2016>>2]|0;
+ $3 = ($2|0)==(0);
+ if (!($3)) {
+ STACKTOP = sp;return;
+ }
+ $4 = HEAP32[$0>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $4;
+ _TraceLog(0,8891,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _rlClearColor($r,$g,$b,$a) {
+ $r = $r|0;
+ $g = $g|0;
+ $b = $b|0;
+ $a = $a|0;
+ var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+($r&255));
+ $1 = $0 / 255.0;
+ $2 = (+($g&255));
+ $3 = $2 / 255.0;
+ $4 = (+($b&255));
+ $5 = $4 / 255.0;
+ $6 = (+($a&255));
+ $7 = $6 / 255.0;
+ _glClearColor((+$1),(+$3),(+$5),(+$7));
+ return;
+}
+function _rlClearScreenBuffers() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glClear(16640);
+ return;
+}
+function _rlGetVersion() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return 4;
+}
+function _rlglInit($width,$height) {
+ $width = $width|0;
+ $height = $height|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $8 = 0, $9 = 0, $exitcond = 0;
+ var $exitcond10 = 0, $exitcond11 = 0, $i$04 = 0, $i1$03 = 0, $i2$02 = 0, $numExt$0$lcssa = 0, $numExt$05 = 0, $pixels = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0, $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0;
+ var $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer36 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 2448|0;
+ $vararg_buffer36 = sp + 2168|0;
+ $vararg_buffer34 = sp + 2160|0;
+ $vararg_buffer31 = sp + 2152|0;
+ $vararg_buffer29 = sp + 2144|0;
+ $vararg_buffer27 = sp + 2136|0;
+ $vararg_buffer25 = sp + 2128|0;
+ $vararg_buffer23 = sp + 2120|0;
+ $vararg_buffer21 = sp + 2112|0;
+ $vararg_buffer19 = sp + 2104|0;
+ $vararg_buffer17 = sp + 2096|0;
+ $vararg_buffer15 = sp + 2088|0;
+ $vararg_buffer13 = sp + 2080|0;
+ $vararg_buffer10 = sp + 2072|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $pixels = sp + 2432|0;
+ $0 = sp + 2384|0;
+ $1 = sp + 2368|0;
+ $2 = sp + 2304|0;
+ $3 = sp + 2240|0;
+ $4 = sp + 2176|0;
+ $5 = (_glGetString(7936)|0);
+ HEAP32[$vararg_buffer>>2] = $5;
+ _TraceLog(0,8946,$vararg_buffer);
+ $6 = (_glGetString(7937)|0);
+ HEAP32[$vararg_buffer1>>2] = $6;
+ _TraceLog(0,8964,$vararg_buffer1);
+ $7 = (_glGetString(7938)|0);
+ HEAP32[$vararg_buffer4>>2] = $7;
+ _TraceLog(0,8982,$vararg_buffer4);
+ $8 = (_glGetString(35724)|0);
+ HEAP32[$vararg_buffer7>>2] = $8;
+ _TraceLog(0,9000,$vararg_buffer7);
+ $9 = (_glGetString(7939)|0);
+ $10 = (_strlen($9)|0);
+ $11 = (($10) + 1)|0;
+ $12 = (_malloc($11)|0);
+ _memcpy(($12|0),($9|0),($11|0))|0;
+ $13 = (_strtok($12,9018)|0);
+ HEAP32[$vararg_buffer7>>2] = $13;
+ $14 = ($13|0)==(0|0);
+ if ($14) {
+ $numExt$0$lcssa = -1;
+ } else {
+ $numExt$05 = 0;
+ while(1) {
+ $15 = (($numExt$05) + 1)|0;
+ $16 = (_strtok(0,9018)|0);
+ $17 = (($vararg_buffer7) + ($15<<2)|0);
+ HEAP32[$17>>2] = $16;
+ $18 = ($16|0)==(0|0);
+ if ($18) {
+ $numExt$0$lcssa = $numExt$05;
+ break;
+ } else {
+ $numExt$05 = $15;
+ }
+ }
+ }
+ _free($12);
+ HEAP32[$vararg_buffer10>>2] = $numExt$0$lcssa;
+ _TraceLog(0,9020,$vararg_buffer10);
+ $19 = ($numExt$0$lcssa|0)>(0);
+ if ($19) {
+ $i$04 = 0;
+ while(1) {
+ $20 = (($vararg_buffer7) + ($i$04<<2)|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = (_strcmp($21,9055)|0);
+ $23 = ($22|0)==(0);
+ if ($23) {
+ HEAP32[2016>>2] = 1;
+ $24 = (_eglGetProcAddress((9082|0))|0);
+ HEAP32[2024>>2] = $24;
+ $25 = (_eglGetProcAddress((9103|0))|0);
+ HEAP32[2028>>2] = $25;
+ $26 = (_eglGetProcAddress((9124|0))|0);
+ HEAP32[2020>>2] = $26;
+ }
+ $27 = HEAP32[$20>>2]|0;
+ $28 = (_strcmp($27,9148)|0);
+ $29 = ($28|0)==(0);
+ if ($29) {
+ HEAP32[2032>>2] = 1;
+ }
+ $30 = HEAP32[$20>>2]|0;
+ $31 = (_strcmp($30,9168)|0);
+ $32 = ($31|0)==(0);
+ if ($32) {
+ label = 11;
+ } else {
+ $33 = (_strcmp($30,9200)|0);
+ $34 = ($33|0)==(0);
+ if ($34) {
+ label = 11;
+ } else {
+ $35 = (_strcmp($30,9233)|0);
+ $36 = ($35|0)==(0);
+ if ($36) {
+ label = 11;
+ }
+ }
+ }
+ if ((label|0) == 11) {
+ label = 0;
+ HEAP32[2036>>2] = 1;
+ }
+ $37 = HEAP32[$20>>2]|0;
+ $38 = (_strcmp($37,9273)|0);
+ $39 = ($38|0)==(0);
+ if ($39) {
+ label = 14;
+ } else {
+ $40 = (_strcmp($37,9309)|0);
+ $41 = ($40|0)==(0);
+ if ($41) {
+ label = 14;
+ }
+ }
+ if ((label|0) == 14) {
+ label = 0;
+ HEAP32[2040>>2] = 1;
+ }
+ $42 = HEAP32[$20>>2]|0;
+ $43 = (_strcmp($42,9342)|0);
+ $44 = ($43|0)==(0);
+ if ($44) {
+ HEAP32[2044>>2] = 1;
+ }
+ $45 = HEAP32[$20>>2]|0;
+ $46 = (_strcmp($45,9367)|0);
+ $47 = ($46|0)==(0);
+ if ($47) {
+ HEAP32[2048>>2] = 1;
+ }
+ $48 = HEAP32[$20>>2]|0;
+ $49 = (_strcmp($48,9400)|0);
+ $50 = ($49|0)==(0);
+ if ($50) {
+ HEAP32[2052>>2] = 1;
+ }
+ $51 = (($i$04) + 1)|0;
+ $exitcond11 = ($51|0)==($numExt$0$lcssa|0);
+ if ($exitcond11) {
+ break;
+ } else {
+ $i$04 = $51;
+ }
+ }
+ }
+ $52 = HEAP32[2016>>2]|0;
+ $53 = ($52|0)==(0);
+ if ($53) {
+ _TraceLog(2,9511,$vararg_buffer15);
+ } else {
+ _TraceLog(0,9436,$vararg_buffer13);
+ }
+ $54 = HEAP32[2032>>2]|0;
+ $55 = ($54|0)==(0);
+ if ($55) {
+ _TraceLog(2,9647,$vararg_buffer19);
+ } else {
+ _TraceLog(0,9572,$vararg_buffer17);
+ }
+ $56 = HEAP32[2036>>2]|0;
+ $57 = ($56|0)==(0);
+ if (!($57)) {
+ _TraceLog(0,9739,$vararg_buffer21);
+ }
+ $58 = HEAP32[2040>>2]|0;
+ $59 = ($58|0)==(0);
+ if (!($59)) {
+ _TraceLog(0,9785,$vararg_buffer23);
+ }
+ $60 = HEAP32[2044>>2]|0;
+ $61 = ($60|0)==(0);
+ if (!($61)) {
+ _TraceLog(0,9832,$vararg_buffer25);
+ }
+ $62 = HEAP32[2048>>2]|0;
+ $63 = ($62|0)==(0);
+ if (!($63)) {
+ _TraceLog(0,9883,$vararg_buffer27);
+ }
+ $64 = HEAP32[2052>>2]|0;
+ $65 = ($64|0)==(0);
+ if (!($65)) {
+ _TraceLog(0,9930,$vararg_buffer29);
+ }
+ HEAP32[$pixels>>2] = -1;
+ $66 = (_rlglLoadTexture($pixels,1,1,7,1)|0);
+ HEAP32[2056>>2] = $66;
+ $67 = ($66|0)==(0);
+ if ($67) {
+ _TraceLog(2,10028,$vararg_buffer34);
+ } else {
+ HEAP32[$vararg_buffer31>>2] = $66;
+ _TraceLog(0,9977,$vararg_buffer31);
+ }
+ _LoadDefaultShader($0);
+ dest=2060; src=$0; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=2108; src=$0; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _LoadDefaultBuffers();
+ $68 = (_malloc(49152)|0);
+ HEAP32[1856>>2] = $68;
+ $i1$03 = 0;
+ while(1) {
+ $69 = HEAP32[1856>>2]|0;
+ $70 = (($69) + (($i1$03*12)|0)|0);
+ _VectorZero($1);
+ ;HEAP32[$70>>2]=HEAP32[$1>>2]|0;HEAP32[$70+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$70+8>>2]=HEAP32[$1+8>>2]|0;
+ $71 = (($i1$03) + 1)|0;
+ $exitcond10 = ($71|0)==(4096);
+ if ($exitcond10) {
+ break;
+ } else {
+ $i1$03 = $71;
+ }
+ }
+ $72 = (_malloc(36864)|0);
+ HEAP32[2012>>2] = $72;
+ $i2$02 = 0;
+ while(1) {
+ $73 = (((($72) + (($i2$02*144)|0)|0)) + 8|0);
+ HEAP32[$73>>2] = 0;
+ $74 = (($72) + (($i2$02*144)|0)|0);
+ HEAP32[$74>>2] = 0;
+ $75 = (($i2$02) + 1)|0;
+ $exitcond = ($75|0)==(256);
+ if ($exitcond) {
+ break;
+ } else {
+ $i2$02 = $75;
+ }
+ }
+ HEAP32[2008>>2] = 1;
+ $76 = HEAP32[2056>>2]|0;
+ $77 = HEAP32[2012>>2]|0;
+ $78 = ((($77)) + 8|0);
+ HEAP32[$78>>2] = $76;
+ HEAP32[1848>>2] = 1;
+ _MatrixIdentity($2);
+ dest=820; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(884); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(948); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1012); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1076); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1140); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1204); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1268); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1332); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1396); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1460); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1524); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1588); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1652); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1716); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($2);
+ dest=(1780); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($3);
+ dest=680; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=748; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[744>>2] = 748;
+ _glDepthFunc(515);
+ _glDisable(2929);
+ _glBlendFunc(770,771);
+ _glEnable(3042);
+ _glCullFace(1029);
+ _glFrontFace(2305);
+ _glEnable(2884);
+ _glClearColor(0.0,0.0,0.0,1.0);
+ _glClearDepthf(1.0);
+ _glClear(16640);
+ HEAP32[2156>>2] = $width;
+ HEAP32[2160>>2] = $height;
+ _TraceLog(0,10067,$vararg_buffer36);
+ STACKTOP = sp;return;
+}
+function _rlglLoadTexture($data,$width,$height,$textureFormat,$mipmapCount) {
+ $data = $data|0;
+ $width = $width|0;
+ $height = $height|0;
+ $textureFormat = $textureFormat|0;
+ $mipmapCount = $mipmapCount|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $id = 0, $or$cond = 0, $or$cond18 = 0, $or$cond20 = 0, $or$cond22 = 0, $or$cond7 = 0, $switch = 0, $textureFormat$off = 0, $textureFormat$off14 = 0, $textureFormat$off15 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0;
+ var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0;
+ $vararg_buffer15 = sp + 64|0;
+ $vararg_buffer11 = sp + 48|0;
+ $vararg_buffer9 = sp + 40|0;
+ $vararg_buffer7 = sp + 32|0;
+ $vararg_buffer5 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $id = sp + 68|0;
+ _glBindTexture(3553,0);
+ HEAP32[$id>>2] = 0;
+ $0 = HEAP32[2036>>2]|0;
+ $1 = ($0|0)==(0);
+ $2 = $textureFormat & -4;
+ $switch = ($2|0)==(8);
+ $or$cond22 = $switch & $1;
+ if ($or$cond22) {
+ _TraceLog(2,10114,$vararg_buffer);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $3 = HEAP32[2040>>2]|0;
+ $4 = ($3|0)==(0);
+ $5 = ($textureFormat|0)==(12);
+ $or$cond7 = $5 & $4;
+ if ($or$cond7) {
+ _TraceLog(2,10158,$vararg_buffer1);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $6 = HEAP32[2044>>2]|0;
+ $7 = ($6|0)==(0);
+ $textureFormat$off = (($textureFormat) + -13)|0;
+ $8 = ($textureFormat$off>>>0)<(2);
+ $or$cond = $8 & $7;
+ if ($or$cond) {
+ _TraceLog(2,10203,$vararg_buffer3);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $9 = HEAP32[2048>>2]|0;
+ $10 = ($9|0)==(0);
+ $textureFormat$off14 = (($textureFormat) + -15)|0;
+ $11 = ($textureFormat$off14>>>0)<(2);
+ $or$cond18 = $11 & $10;
+ if ($or$cond18) {
+ _TraceLog(2,10248,$vararg_buffer5);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $12 = HEAP32[2052>>2]|0;
+ $13 = ($12|0)==(0);
+ $textureFormat$off15 = (($textureFormat) + -17)|0;
+ $14 = ($textureFormat$off15>>>0)<(2);
+ $or$cond20 = $14 & $13;
+ if ($or$cond20) {
+ _TraceLog(2,10293,$vararg_buffer7);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ _glGenTextures(1,($id|0));
+ $15 = HEAP32[$id>>2]|0;
+ _glBindTexture(3553,($15|0));
+ do {
+ switch ($textureFormat|0) {
+ case 1: {
+ _glTexImage2D(3553,0,6409,($width|0),($height|0),0,6409,5121,($data|0));
+ break;
+ }
+ case 2: {
+ _glTexImage2D(3553,0,6410,($width|0),($height|0),0,6410,5121,($data|0));
+ break;
+ }
+ case 3: {
+ _glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,33635,($data|0));
+ break;
+ }
+ case 4: {
+ _glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,5121,($data|0));
+ break;
+ }
+ case 5: {
+ _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32820,($data|0));
+ break;
+ }
+ case 6: {
+ _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32819,($data|0));
+ break;
+ }
+ case 7: {
+ _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,5121,($data|0));
+ break;
+ }
+ case 8: {
+ $16 = HEAP32[2036>>2]|0;
+ $17 = ($16|0)==(0);
+ if (!($17)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,33776);
+ }
+ break;
+ }
+ case 9: {
+ $18 = HEAP32[2036>>2]|0;
+ $19 = ($18|0)==(0);
+ if (!($19)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,33777);
+ }
+ break;
+ }
+ case 10: {
+ $20 = HEAP32[2036>>2]|0;
+ $21 = ($20|0)==(0);
+ if (!($21)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,33778);
+ }
+ break;
+ }
+ case 11: {
+ $22 = HEAP32[2036>>2]|0;
+ $23 = ($22|0)==(0);
+ if (!($23)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,33779);
+ }
+ break;
+ }
+ case 12: {
+ $24 = HEAP32[2040>>2]|0;
+ $25 = ($24|0)==(0);
+ if (!($25)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,36196);
+ }
+ break;
+ }
+ case 13: {
+ $26 = HEAP32[2044>>2]|0;
+ $27 = ($26|0)==(0);
+ if (!($27)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,37492);
+ }
+ break;
+ }
+ case 14: {
+ $28 = HEAP32[2044>>2]|0;
+ $29 = ($28|0)==(0);
+ if (!($29)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,37496);
+ }
+ break;
+ }
+ case 15: {
+ $30 = HEAP32[2048>>2]|0;
+ $31 = ($30|0)==(0);
+ if (!($31)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,35840);
+ }
+ break;
+ }
+ case 16: {
+ $32 = HEAP32[2048>>2]|0;
+ $33 = ($32|0)==(0);
+ if (!($33)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,35842);
+ }
+ break;
+ }
+ case 17: {
+ $34 = HEAP32[2052>>2]|0;
+ $35 = ($34|0)==(0);
+ if (!($35)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,37808);
+ }
+ break;
+ }
+ case 18: {
+ $36 = HEAP32[2052>>2]|0;
+ $37 = ($36|0)==(0);
+ if (!($37)) {
+ _LoadCompressedTexture($data,$width,$height,$mipmapCount,37815);
+ }
+ break;
+ }
+ default: {
+ _TraceLog(2,10338,$vararg_buffer9);
+ }
+ }
+ } while(0);
+ $38 = HEAP32[2032>>2]|0;
+ $39 = ($38|0)==(0);
+ if ($39) {
+ _glTexParameteri(3553,10242,33071);
+ _glTexParameteri(3553,10243,33071);
+ } else {
+ _glTexParameteri(3553,10242,10497);
+ _glTexParameteri(3553,10243,10497);
+ }
+ _glTexParameteri(3553,10240,9728);
+ _glTexParameteri(3553,10241,9728);
+ _glBindTexture(3553,0);
+ $40 = HEAP32[$id>>2]|0;
+ $41 = ($40|0)==(0);
+ if ($41) {
+ _TraceLog(2,10909,$vararg_buffer15);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ } else {
+ HEAP32[$vararg_buffer11>>2] = $40;
+ $vararg_ptr13 = ((($vararg_buffer11)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $width;
+ $vararg_ptr14 = ((($vararg_buffer11)) + 8|0);
+ HEAP32[$vararg_ptr14>>2] = $height;
+ _TraceLog(0,10367,$vararg_buffer11);
+ $$0 = HEAP32[$id>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ return (0)|0;
+}
+function _rlglClose() {
+ var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ _UnloadDefaultShader();
+ _UnloadStandardShader();
+ _UnloadDefaultBuffers();
+ _glDeleteTextures(1,(2056|0));
+ $0 = HEAP32[2056>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $0;
+ _TraceLog(0,10416,$vararg_buffer);
+ $1 = HEAP32[2164>>2]|0;
+ $2 = ($1|0)>(0);
+ if (!($2)) {
+ $10 = HEAP32[2012>>2]|0;
+ _free($10);
+ STACKTOP = sp;return;
+ }
+ $3 = HEAP32[2164>>2]|0;
+ $4 = ($3|0)>(0);
+ if ($4) {
+ $i$01 = 0;
+ while(1) {
+ $5 = (2168 + ($i$01<<2)|0);
+ $6 = HEAP32[$5>>2]|0;
+ _free($6);
+ $7 = (($i$01) + 1)|0;
+ $8 = HEAP32[2164>>2]|0;
+ $9 = ($7|0)<($8|0);
+ if ($9) {
+ $i$01 = $7;
+ } else {
+ break;
+ }
+ }
+ }
+ HEAP32[2164>>2] = 0;
+ $10 = HEAP32[2012>>2]|0;
+ _free($10);
+ STACKTOP = sp;return;
+}
+function _rlglDraw() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _UpdateDefaultBuffers();
+ $0 = HEAP32[2200>>2]|0;
+ $1 = ($0|0)!=(0);
+ $2 = HEAP32[2204>>2]|0;
+ $3 = ($2|0)!=(0);
+ $or$cond = $1 & $3;
+ if ($or$cond) {
+ _DrawDefaultBuffers(2);
+ return;
+ } else {
+ _DrawDefaultBuffers(1);
+ return;
+ }
+}
+function _rlglLoadMesh($mesh,$dynamic) {
+ $mesh = $mesh|0;
+ $dynamic = $dynamic|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $9 = 0, $vaoId = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, $vboId = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $vaoId = sp + 48|0;
+ $vboId = sp + 20|0;
+ $0 = ((($mesh)) + 36|0);
+ $1 = ((($mesh)) + 40|0);
+ $2 = ((($mesh)) + 44|0);
+ $3 = ((($mesh)) + 48|0);
+ $4 = ((($mesh)) + 52|0);
+ $5 = ((($mesh)) + 56|0);
+ $6 = ((($mesh)) + 60|0);
+ $7 = ((($mesh)) + 64|0);
+ $8 = ($dynamic|0)!=(0);
+ $$ = $8 ? 35048 : 35044;
+ ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0;HEAP32[$0+16>>2]=0|0;HEAP32[$0+20>>2]=0|0;HEAP32[$0+24>>2]=0|0;HEAP32[$0+28>>2]=0|0;
+ HEAP32[$vaoId>>2] = 0;
+ ;HEAP32[$vboId>>2]=0|0;HEAP32[$vboId+4>>2]=0|0;HEAP32[$vboId+8>>2]=0|0;HEAP32[$vboId+12>>2]=0|0;HEAP32[$vboId+16>>2]=0|0;HEAP32[$vboId+20>>2]=0|0;HEAP32[$vboId+24>>2]=0|0;
+ $9 = HEAP32[2016>>2]|0;
+ $10 = ($9|0)==(0);
+ if (!($10)) {
+ $11 = HEAP32[2024>>2]|0;
+ FUNCTION_TABLE_vii[$11 & 63](1,$vaoId);
+ $12 = HEAP32[2028>>2]|0;
+ $13 = HEAP32[$vaoId>>2]|0;
+ FUNCTION_TABLE_vi[$12 & 31]($13);
+ }
+ _glGenBuffers(1,($vboId|0));
+ $14 = HEAP32[$vboId>>2]|0;
+ _glBindBuffer(34962,($14|0));
+ $15 = HEAP32[$mesh>>2]|0;
+ $16 = ($15*12)|0;
+ $17 = ((($mesh)) + 8|0);
+ $18 = HEAP32[$17>>2]|0;
+ _glBufferData(34962,($16|0),($18|0),($$|0));
+ _glVertexAttribPointer(0,3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(0);
+ $19 = ((($vboId)) + 4|0);
+ _glGenBuffers(1,($19|0));
+ $20 = HEAP32[$19>>2]|0;
+ _glBindBuffer(34962,($20|0));
+ $21 = HEAP32[$mesh>>2]|0;
+ $22 = $21 << 3;
+ $23 = ((($mesh)) + 12|0);
+ $24 = HEAP32[$23>>2]|0;
+ _glBufferData(34962,($22|0),($24|0),($$|0));
+ _glVertexAttribPointer(1,2,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(1);
+ $25 = ((($mesh)) + 20|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($26|0)==(0|0);
+ if ($27) {
+ _glVertexAttrib3f(2,1.0,1.0,1.0);
+ _glDisableVertexAttribArray(2);
+ } else {
+ $28 = ((($vboId)) + 8|0);
+ _glGenBuffers(1,($28|0));
+ $29 = HEAP32[$28>>2]|0;
+ _glBindBuffer(34962,($29|0));
+ $30 = HEAP32[$mesh>>2]|0;
+ $31 = ($30*12)|0;
+ $32 = HEAP32[$25>>2]|0;
+ _glBufferData(34962,($31|0),($32|0),($$|0));
+ _glVertexAttribPointer(2,3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(2);
+ }
+ $33 = ((($mesh)) + 28|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = ($34|0)==(0|0);
+ if ($35) {
+ _glVertexAttrib4f(3,1.0,1.0,1.0,1.0);
+ _glDisableVertexAttribArray(3);
+ } else {
+ $36 = ((($vboId)) + 12|0);
+ _glGenBuffers(1,($36|0));
+ $37 = HEAP32[$36>>2]|0;
+ _glBindBuffer(34962,($37|0));
+ $38 = HEAP32[$mesh>>2]|0;
+ $39 = $38 << 2;
+ $40 = HEAP32[$33>>2]|0;
+ _glBufferData(34962,($39|0),($40|0),($$|0));
+ _glVertexAttribPointer(3,4,5121,1,0,(0|0));
+ _glEnableVertexAttribArray(3);
+ }
+ $41 = ((($mesh)) + 24|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = ($42|0)==(0|0);
+ if ($43) {
+ _glVertexAttrib3f(4,0.0,0.0,0.0);
+ _glDisableVertexAttribArray(4);
+ } else {
+ $44 = ((($vboId)) + 16|0);
+ _glGenBuffers(1,($44|0));
+ $45 = HEAP32[$44>>2]|0;
+ _glBindBuffer(34962,($45|0));
+ $46 = HEAP32[$mesh>>2]|0;
+ $47 = ($46*12)|0;
+ $48 = HEAP32[$41>>2]|0;
+ _glBufferData(34962,($47|0),($48|0),($$|0));
+ _glVertexAttribPointer(4,3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(4);
+ }
+ $49 = ((($mesh)) + 16|0);
+ $50 = HEAP32[$49>>2]|0;
+ $51 = ($50|0)==(0|0);
+ if ($51) {
+ _glVertexAttrib2f(5,0.0,0.0);
+ _glDisableVertexAttribArray(5);
+ } else {
+ $52 = ((($vboId)) + 20|0);
+ _glGenBuffers(1,($52|0));
+ $53 = HEAP32[$52>>2]|0;
+ _glBindBuffer(34962,($53|0));
+ $54 = HEAP32[$mesh>>2]|0;
+ $55 = $54 << 3;
+ $56 = HEAP32[$49>>2]|0;
+ _glBufferData(34962,($55|0),($56|0),($$|0));
+ _glVertexAttribPointer(5,2,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(5);
+ }
+ $57 = ((($mesh)) + 32|0);
+ $58 = HEAP32[$57>>2]|0;
+ $59 = ($58|0)==(0|0);
+ if (!($59)) {
+ $60 = ((($vboId)) + 24|0);
+ _glGenBuffers(1,($60|0));
+ $61 = HEAP32[$60>>2]|0;
+ _glBindBuffer(34963,($61|0));
+ $62 = ((($mesh)) + 4|0);
+ $63 = HEAP32[$62>>2]|0;
+ $64 = ($63*6)|0;
+ $65 = HEAP32[$57>>2]|0;
+ _glBufferData(34963,($64|0),($65|0),35044);
+ }
+ $66 = HEAP32[$vboId>>2]|0;
+ HEAP32[$1>>2] = $66;
+ $67 = HEAP32[$19>>2]|0;
+ HEAP32[$2>>2] = $67;
+ $68 = ((($vboId)) + 8|0);
+ $69 = HEAP32[$68>>2]|0;
+ HEAP32[$3>>2] = $69;
+ $70 = ((($vboId)) + 12|0);
+ $71 = HEAP32[$70>>2]|0;
+ HEAP32[$4>>2] = $71;
+ $72 = ((($vboId)) + 16|0);
+ $73 = HEAP32[$72>>2]|0;
+ HEAP32[$5>>2] = $73;
+ $74 = ((($vboId)) + 20|0);
+ $75 = HEAP32[$74>>2]|0;
+ HEAP32[$6>>2] = $75;
+ $76 = ((($vboId)) + 24|0);
+ $77 = HEAP32[$76>>2]|0;
+ HEAP32[$7>>2] = $77;
+ $78 = HEAP32[2016>>2]|0;
+ $79 = ($78|0)==(0);
+ if ($79) {
+ _TraceLog(0,10575,$vararg_buffer3);
+ STACKTOP = sp;return;
+ }
+ $80 = HEAP32[$vaoId>>2]|0;
+ $81 = ($80|0)==(0);
+ if ($81) {
+ _TraceLog(2,10534,$vararg_buffer1);
+ STACKTOP = sp;return;
+ } else {
+ HEAP32[$0>>2] = $80;
+ HEAP32[$vararg_buffer>>2] = $80;
+ _TraceLog(0,10481,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+}
+function _rlglDrawMesh($mesh,$material,$transform) {
+ $mesh = $mesh|0;
+ $material = $material|0;
+ $transform = $transform|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0, $150 = 0;
+ var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0.0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
+ var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0;
+ var $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0.0;
+ var $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0.0;
+ var $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0;
+ var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $eye$01 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $matModelView = 0, $matProjection = 0, $matView = 0;
+ var $modelview$byval_copy1 = 0, $vColorDiffuse = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 400|0;
+ $matMVP$byval_copy = sp + 336|0;
+ $modelview$byval_copy1 = sp + 272|0;
+ $vColorDiffuse = sp + 256|0;
+ $matView = sp + 192|0;
+ $matProjection = sp + 128|0;
+ $matModelView = sp + 64|0;
+ $matMVP = sp;
+ $0 = HEAP32[2200>>2]|0;
+ $1 = ($0|0)!=(0);
+ $$ = $1 ? 2 : 1;
+ $2 = HEAP32[$material>>2]|0;
+ _glUseProgram(($2|0));
+ $3 = ((($material)) + 108|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = (+($4&255));
+ $6 = $5 / 255.0;
+ HEAPF32[$vColorDiffuse>>2] = $6;
+ $7 = ((($vColorDiffuse)) + 4|0);
+ $8 = ((($material)) + 109|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = (+($9&255));
+ $11 = $10 / 255.0;
+ HEAPF32[$7>>2] = $11;
+ $12 = ((($vColorDiffuse)) + 8|0);
+ $13 = ((($material)) + 110|0);
+ $14 = HEAP8[$13>>0]|0;
+ $15 = (+($14&255));
+ $16 = $15 / 255.0;
+ HEAPF32[$12>>2] = $16;
+ $17 = ((($vColorDiffuse)) + 12|0);
+ $18 = ((($material)) + 111|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = (+($19&255));
+ $21 = $20 / 255.0;
+ HEAPF32[$17>>2] = $21;
+ $22 = ((($material)) + 32|0);
+ $23 = HEAP32[$22>>2]|0;
+ _glUniform4fv(($23|0),1,($vColorDiffuse|0));
+ dest=$matView; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matProjection; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$modelview$byval_copy1; src=$transform; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matMVP$byval_copy; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($matModelView,$modelview$byval_copy1,$matMVP$byval_copy);
+ $24 = HEAP32[$material>>2]|0;
+ $25 = HEAP32[2208>>2]|0;
+ $26 = ($24|0)==($25|0);
+ if ($26) {
+ dest=$modelview$byval_copy1; src=$transform; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixTranspose($modelview$byval_copy1);
+ _MatrixInvert($modelview$byval_copy1);
+ $27 = HEAP32[$material>>2]|0;
+ $28 = (_glGetUniformLocation(($27|0),(10623|0))|0);
+ dest=$matMVP$byval_copy; src=$modelview$byval_copy1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $29 = (_MatrixToFloat($matMVP$byval_copy)|0);
+ _glUniformMatrix4fv(($28|0),1,0,($29|0));
+ $30 = HEAP32[$material>>2]|0;
+ $31 = (_glGetUniformLocation(($30|0),(10635|0))|0);
+ $32 = ((($matView)) + 8|0);
+ $33 = +HEAPF32[$32>>2];
+ $34 = ((($matView)) + 24|0);
+ $35 = +HEAPF32[$34>>2];
+ $36 = ((($matView)) + 40|0);
+ $37 = +HEAPF32[$36>>2];
+ _glUniform3f(($31|0),(+$33),(+$35),(+$37));
+ dest=$matMVP$byval_copy; src=$material; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetShaderLights($matMVP$byval_copy);
+ $38 = HEAP32[$material>>2]|0;
+ $39 = (_glGetUniformLocation(($38|0),(10643|0))|0);
+ $40 = ((($material)) + 112|0);
+ $41 = HEAP8[$40>>0]|0;
+ $42 = (+($41&255));
+ $43 = $42 / 255.0;
+ $44 = ((($material)) + 113|0);
+ $45 = HEAP8[$44>>0]|0;
+ $46 = (+($45&255));
+ $47 = $46 / 255.0;
+ $48 = ((($material)) + 114|0);
+ $49 = HEAP8[$48>>0]|0;
+ $50 = (+($49&255));
+ $51 = $50 / 255.0;
+ $52 = ((($material)) + 115|0);
+ $53 = HEAP8[$52>>0]|0;
+ $54 = (+($53&255));
+ $55 = $54 / 255.0;
+ _glUniform4f(($39|0),(+$43),(+$47),(+$51),(+$55));
+ $56 = HEAP32[$material>>2]|0;
+ $57 = (_glGetUniformLocation(($56|0),(10654|0))|0);
+ $58 = ((($material)) + 116|0);
+ $59 = HEAP8[$58>>0]|0;
+ $60 = (+($59&255));
+ $61 = $60 / 255.0;
+ $62 = ((($material)) + 117|0);
+ $63 = HEAP8[$62>>0]|0;
+ $64 = (+($63&255));
+ $65 = $64 / 255.0;
+ $66 = ((($material)) + 118|0);
+ $67 = HEAP8[$66>>0]|0;
+ $68 = (+($67&255));
+ $69 = $68 / 255.0;
+ $70 = ((($material)) + 119|0);
+ $71 = HEAP8[$70>>0]|0;
+ $72 = (+($71&255));
+ $73 = $72 / 255.0;
+ _glUniform4f(($57|0),(+$61),(+$65),(+$69),(+$73));
+ $74 = HEAP32[$material>>2]|0;
+ $75 = (_glGetUniformLocation(($74|0),(10666|0))|0);
+ $76 = ((($material)) + 120|0);
+ $77 = +HEAPF32[$76>>2];
+ _glUniform1f(($75|0),(+$77));
+ }
+ _glActiveTexture(33984);
+ $78 = ((($material)) + 48|0);
+ $79 = HEAP32[$78>>2]|0;
+ _glBindTexture(3553,($79|0));
+ $80 = ((($material)) + 36|0);
+ $81 = HEAP32[$80>>2]|0;
+ _glUniform1i(($81|0),0);
+ $82 = ((($material)) + 68|0);
+ $83 = HEAP32[$82>>2]|0;
+ $84 = ($83|0)==(0);
+ if (!($84)) {
+ $85 = ((($material)) + 40|0);
+ $86 = HEAP32[$85>>2]|0;
+ $87 = ($86|0)==(-1);
+ if (!($87)) {
+ $88 = HEAP32[$material>>2]|0;
+ $89 = (_glGetUniformLocation(($88|0),(10677|0))|0);
+ _glUniform1i(($89|0),1);
+ _glActiveTexture(33985);
+ $90 = HEAP32[$82>>2]|0;
+ _glBindTexture(3553,($90|0));
+ $91 = HEAP32[$85>>2]|0;
+ _glUniform1i(($91|0),1);
+ }
+ }
+ $92 = ((($material)) + 88|0);
+ $93 = HEAP32[$92>>2]|0;
+ $94 = ($93|0)==(0);
+ if (!($94)) {
+ $95 = ((($material)) + 44|0);
+ $96 = HEAP32[$95>>2]|0;
+ $97 = ($96|0)==(-1);
+ if (!($97)) {
+ $98 = HEAP32[$material>>2]|0;
+ $99 = (_glGetUniformLocation(($98|0),(10687|0))|0);
+ _glUniform1i(($99|0),1);
+ _glActiveTexture(33986);
+ $100 = HEAP32[$92>>2]|0;
+ _glBindTexture(3553,($100|0));
+ $101 = HEAP32[$95>>2]|0;
+ _glUniform1i(($101|0),2);
+ }
+ }
+ $102 = HEAP32[2016>>2]|0;
+ $103 = ($102|0)==(0);
+ if ($103) {
+ $107 = ((($mesh)) + 40|0);
+ $108 = HEAP32[$107>>2]|0;
+ _glBindBuffer(34962,($108|0));
+ $109 = ((($material)) + 4|0);
+ $110 = HEAP32[$109>>2]|0;
+ _glVertexAttribPointer(($110|0),3,5126,0,0,(0|0));
+ $111 = HEAP32[$109>>2]|0;
+ _glEnableVertexAttribArray(($111|0));
+ $112 = ((($mesh)) + 44|0);
+ $113 = HEAP32[$112>>2]|0;
+ _glBindBuffer(34962,($113|0));
+ $114 = ((($material)) + 8|0);
+ $115 = HEAP32[$114>>2]|0;
+ _glVertexAttribPointer(($115|0),2,5126,0,0,(0|0));
+ $116 = HEAP32[$114>>2]|0;
+ _glEnableVertexAttribArray(($116|0));
+ $117 = ((($material)) + 16|0);
+ $118 = HEAP32[$117>>2]|0;
+ $119 = ($118|0)==(-1);
+ if (!($119)) {
+ $120 = ((($mesh)) + 48|0);
+ $121 = HEAP32[$120>>2]|0;
+ _glBindBuffer(34962,($121|0));
+ $122 = HEAP32[$117>>2]|0;
+ _glVertexAttribPointer(($122|0),3,5126,0,0,(0|0));
+ $123 = HEAP32[$117>>2]|0;
+ _glEnableVertexAttribArray(($123|0));
+ }
+ $124 = ((($material)) + 24|0);
+ $125 = HEAP32[$124>>2]|0;
+ $126 = ($125|0)==(-1);
+ do {
+ if (!($126)) {
+ $127 = ((($mesh)) + 52|0);
+ $128 = HEAP32[$127>>2]|0;
+ $129 = ($128|0)==(0);
+ if ($129) {
+ _glVertexAttrib4f(($125|0),1.0,1.0,1.0,1.0);
+ $132 = HEAP32[$124>>2]|0;
+ _glDisableVertexAttribArray(($132|0));
+ break;
+ } else {
+ _glBindBuffer(34962,($128|0));
+ $130 = HEAP32[$124>>2]|0;
+ _glVertexAttribPointer(($130|0),4,5121,1,0,(0|0));
+ $131 = HEAP32[$124>>2]|0;
+ _glEnableVertexAttribArray(($131|0));
+ break;
+ }
+ }
+ } while(0);
+ $133 = ((($material)) + 20|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = ($134|0)==(-1);
+ if (!($135)) {
+ $136 = ((($mesh)) + 56|0);
+ $137 = HEAP32[$136>>2]|0;
+ _glBindBuffer(34962,($137|0));
+ $138 = HEAP32[$133>>2]|0;
+ _glVertexAttribPointer(($138|0),3,5126,0,0,(0|0));
+ $139 = HEAP32[$133>>2]|0;
+ _glEnableVertexAttribArray(($139|0));
+ }
+ $140 = ((($material)) + 12|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = ($141|0)==(-1);
+ if (!($142)) {
+ $143 = ((($mesh)) + 60|0);
+ $144 = HEAP32[$143>>2]|0;
+ _glBindBuffer(34962,($144|0));
+ $145 = HEAP32[$140>>2]|0;
+ _glVertexAttribPointer(($145|0),2,5126,0,0,(0|0));
+ $146 = HEAP32[$140>>2]|0;
+ _glEnableVertexAttribArray(($146|0));
+ }
+ $147 = ((($mesh)) + 32|0);
+ $148 = HEAP32[$147>>2]|0;
+ $149 = ($148|0)==(0|0);
+ if (!($149)) {
+ $150 = HEAP32[(2000)>>2]|0;
+ _glBindBuffer(34963,($150|0));
+ }
+ } else {
+ $104 = HEAP32[2028>>2]|0;
+ $105 = ((($mesh)) + 36|0);
+ $106 = HEAP32[$105>>2]|0;
+ FUNCTION_TABLE_vi[$104 & 31]($106);
+ }
+ $151 = ((($material)) + 28|0);
+ $152 = ((($mesh)) + 32|0);
+ $153 = HEAP32[$152>>2]|0;
+ $154 = ($153|0)==(0|0);
+ $155 = HEAP32[$mesh>>2]|0;
+ $156 = ((($mesh)) + 4|0);
+ $157 = HEAP32[$156>>2]|0;
+ $158 = ($157*3)|0;
+ $eye$01 = 0;
+ while(1) {
+ if ($1) {
+ dest=$modelview$byval_copy1; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matMVP$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetStereoView($eye$01,$modelview$byval_copy1,$matMVP$byval_copy);
+ } else {
+ dest=748; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ }
+ dest=$modelview$byval_copy1; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matMVP$byval_copy; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($matMVP,$modelview$byval_copy1,$matMVP$byval_copy);
+ $159 = HEAP32[$151>>2]|0;
+ dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $160 = (_MatrixToFloat($matMVP$byval_copy)|0);
+ _glUniformMatrix4fv(($159|0),1,0,($160|0));
+ if ($154) {
+ _glDrawArrays(4,0,($155|0));
+ } else {
+ _glDrawElements(4,($158|0),5123,(0|0));
+ }
+ $161 = (($eye$01) + 1)|0;
+ $162 = ($161|0)<($$|0);
+ if ($162) {
+ $eye$01 = $161;
+ } else {
+ break;
+ }
+ }
+ $163 = HEAP32[$82>>2]|0;
+ $164 = ($163|0)==(0);
+ if (!($164)) {
+ _glActiveTexture(33985);
+ _glBindTexture(3553,0);
+ }
+ $165 = HEAP32[$92>>2]|0;
+ $166 = ($165|0)==(0);
+ if (!($166)) {
+ _glActiveTexture(33986);
+ _glBindTexture(3553,0);
+ }
+ _glActiveTexture(33984);
+ _glBindTexture(3553,0);
+ $167 = HEAP32[2016>>2]|0;
+ $168 = ($167|0)==(0);
+ if (!($168)) {
+ $169 = HEAP32[2028>>2]|0;
+ FUNCTION_TABLE_vi[$169 & 31](0);
+ _glUseProgram(0);
+ dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=748; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ _glBindBuffer(34962,0);
+ $170 = ((($mesh)) + 32|0);
+ $171 = HEAP32[$170>>2]|0;
+ $172 = ($171|0)==(0|0);
+ if ($172) {
+ _glUseProgram(0);
+ dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=748; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ _glBindBuffer(34963,0);
+ _glUseProgram(0);
+ dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=748; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlglUnloadMesh($mesh) {
+ $mesh = $mesh|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($mesh)) + 8|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if (!($2)) {
+ _free($1);
+ }
+ $3 = ((($mesh)) + 12|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(0|0);
+ if (!($5)) {
+ _free($4);
+ }
+ $6 = ((($mesh)) + 20|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)==(0|0);
+ if (!($8)) {
+ _free($7);
+ }
+ $9 = ((($mesh)) + 28|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($10|0)==(0|0);
+ if (!($11)) {
+ _free($10);
+ }
+ $12 = ((($mesh)) + 24|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($13|0)==(0|0);
+ if (!($14)) {
+ _free($13);
+ }
+ $15 = ((($mesh)) + 16|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = ($16|0)==(0|0);
+ if (!($17)) {
+ _free($16);
+ }
+ $18 = ((($mesh)) + 32|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = ($19|0)==(0|0);
+ if (!($20)) {
+ _free($19);
+ }
+ $21 = ((($mesh)) + 40|0);
+ $22 = HEAP32[$21>>2]|0;
+ _rlDeleteBuffers($22);
+ $23 = ((($mesh)) + 44|0);
+ $24 = HEAP32[$23>>2]|0;
+ _rlDeleteBuffers($24);
+ $25 = ((($mesh)) + 48|0);
+ $26 = HEAP32[$25>>2]|0;
+ _rlDeleteBuffers($26);
+ $27 = ((($mesh)) + 52|0);
+ $28 = HEAP32[$27>>2]|0;
+ _rlDeleteBuffers($28);
+ $29 = ((($mesh)) + 56|0);
+ $30 = HEAP32[$29>>2]|0;
+ _rlDeleteBuffers($30);
+ $31 = ((($mesh)) + 60|0);
+ $32 = HEAP32[$31>>2]|0;
+ _rlDeleteBuffers($32);
+ $33 = ((($mesh)) + 64|0);
+ $34 = HEAP32[$33>>2]|0;
+ _rlDeleteBuffers($34);
+ $35 = ((($mesh)) + 36|0);
+ $36 = HEAP32[$35>>2]|0;
+ _rlDeleteVertexArrays($36);
+ return;
+}
+function _GetDefaultTexture($agg$result) {
+ $agg$result = $agg$result|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[2056>>2]|0;
+ HEAP32[$agg$result>>2] = $0;
+ $1 = ((($agg$result)) + 4|0);
+ HEAP32[$1>>2] = 1;
+ $2 = ((($agg$result)) + 8|0);
+ HEAP32[$2>>2] = 1;
+ $3 = ((($agg$result)) + 12|0);
+ HEAP32[$3>>2] = 1;
+ $4 = ((($agg$result)) + 16|0);
+ HEAP32[$4>>2] = 7;
+ return;
+}
+function _GetDefaultShader($agg$result) {
+ $agg$result = $agg$result|0;
+ var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ dest=$agg$result; src=2060; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _GetShaderLocation($shader,$uniformName) {
+ $shader = $shader|0;
+ $uniformName = $uniformName|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = HEAP32[$shader>>2]|0;
+ $1 = (_glGetUniformLocation(($0|0),($uniformName|0))|0);
+ $2 = ($1|0)==(-1);
+ if (!($2)) {
+ STACKTOP = sp;return ($1|0);
+ }
+ $3 = HEAP32[$shader>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $3;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $uniformName;
+ _TraceLog(3,10699,$vararg_buffer);
+ STACKTOP = sp;return ($1|0);
+}
+function _SetMatrixProjection($proj) {
+ $proj = $proj|0;
+ var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ dest=680; src=$proj; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _SetMatrixModelview($view) {
+ $view = $view|0;
+ var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ dest=748; src=$view; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _IsVrDeviceReady() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[2604>>2]|0;
+ $1 = HEAP32[2200>>2]|0;
+ $2 = ($1|0)!=(0);
+ $not$ = ($0|0)!=(0);
+ $3 = $not$ & $2;
+ $4 = $3&1;
+ return ($4|0);
+}
+function _BeginVrDrawing() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[2256>>2]|0;
+ _rlEnableRenderTexture($0);
+ _rlClearScreenBuffers();
+ HEAP32[2204>>2] = 1;
+ return;
+}
+function _EndVrDrawing() {
+ var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ _rlDisableRenderTexture();
+ _rlClearScreenBuffers();
+ $0 = HEAP32[2156>>2]|0;
+ $1 = HEAP32[2160>>2]|0;
+ _rlViewport(0,0,$0,$1);
+ _rlMatrixMode(0);
+ _rlLoadIdentity();
+ $2 = HEAP32[2156>>2]|0;
+ $3 = (+($2|0));
+ $4 = HEAP32[2160>>2]|0;
+ $5 = (+($4|0));
+ _rlOrtho(0.0,$3,$5,0.0,0.0,1.0);
+ _rlMatrixMode(1);
+ _rlLoadIdentity();
+ dest=2108; src=(2300); stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $6 = HEAP32[(2260)>>2]|0;
+ _rlEnableTexture($6);
+ _rlPushMatrix();
+ _rlBegin(2);
+ _rlColor4ub(-1,-1,-1,-1);
+ _rlTexCoord2f(0.0,1.0);
+ _rlVertex2f(0.0,0.0);
+ _rlTexCoord2f(0.0,0.0);
+ $7 = HEAP32[(2268)>>2]|0;
+ $8 = (+($7|0));
+ _rlVertex2f(0.0,$8);
+ _rlTexCoord2f(1.0,0.0);
+ $9 = HEAP32[(2264)>>2]|0;
+ $10 = (+($9|0));
+ $11 = HEAP32[(2268)>>2]|0;
+ $12 = (+($11|0));
+ _rlVertex2f($10,$12);
+ _rlTexCoord2f(1.0,1.0);
+ $13 = HEAP32[(2264)>>2]|0;
+ $14 = (+($13|0));
+ _rlVertex2f($14,0.0);
+ _rlEnd();
+ _rlPopMatrix();
+ _UpdateDefaultBuffers();
+ _DrawDefaultBuffers(1);
+ dest=2108; src=2060; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _rlDisableDepthTest();
+ HEAP32[2204>>2] = 0;
+ return;
+}
+function _stbi_load($filename,$x,$y,$comp,$req_comp) {
+ $filename = $filename|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__fopen($filename)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ _stbi__err(10754);
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ $2 = (_stbi_load_from_file($0,$x,$y,$comp,$req_comp)|0);
+ (_fclose($0)|0);
+ $$0 = $2;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi_load_from_file($f,$x,$y,$comp,$req_comp) {
+ $f = $f|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $s = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 192|0;
+ $s = sp;
+ _stbi__start_file($s,$f);
+ $0 = (_stbi__load_flip($s,$x,$y,$comp,$req_comp)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ STACKTOP = sp;return ($0|0);
+ }
+ $2 = ((($s)) + 172|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($s)) + 168|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = $3;
+ $7 = $5;
+ $8 = (($7) - ($6))|0;
+ (_fseek($f,$8,1)|0);
+ STACKTOP = sp;return ($0|0);
+}
+function _stbi_zlib_decode_malloc_guesssize_headerflag($buffer,$len,$initial_size,$outlen,$parse_header) {
+ $buffer = $buffer|0;
+ $len = $len|0;
+ $initial_size = $initial_size|0;
+ $outlen = $outlen|0;
+ $parse_header = $parse_header|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 4080|0;
+ $a = sp;
+ $0 = (_stbi__malloc($initial_size)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ HEAP32[$a>>2] = $buffer;
+ $2 = (($buffer) + ($len)|0);
+ $3 = ((($a)) + 4|0);
+ HEAP32[$3>>2] = $2;
+ $4 = (_stbi__do_zlib($a,$0,$initial_size,1,$parse_header)|0);
+ $5 = ($4|0)==(0);
+ if ($5) {
+ $16 = ((($a)) + 20|0);
+ $17 = HEAP32[$16>>2]|0;
+ _free($17);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $6 = ($outlen|0)==(0|0);
+ if (!($6)) {
+ $7 = ((($a)) + 16|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($a)) + 20|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = $8;
+ $12 = $10;
+ $13 = (($11) - ($12))|0;
+ HEAP32[$outlen>>2] = $13;
+ }
+ $14 = ((($a)) + 20|0);
+ $15 = HEAP32[$14>>2]|0;
+ $$0 = $15;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__tga_read_rgb16($s,$out) {
+ $s = $s|0;
+ $out = $out|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get16le($s)|0);
+ $1 = $0 >>> 10;
+ $2 = $1 & 31;
+ $3 = $0 >>> 5;
+ $4 = $3 & 31;
+ $5 = $0 & 31;
+ $6 = ($2*255)|0;
+ $7 = (($6>>>0) / 31)&-1;
+ $8 = $7&255;
+ HEAP8[$out>>0] = $8;
+ $9 = ($4*255)|0;
+ $10 = (($9>>>0) / 31)&-1;
+ $11 = $10&255;
+ $12 = ((($out)) + 1|0);
+ HEAP8[$12>>0] = $11;
+ $13 = ($5*255)|0;
+ $14 = (($13>>>0) / 31)&-1;
+ $15 = $14&255;
+ $16 = ((($out)) + 2|0);
+ HEAP8[$16>>0] = $15;
+ return;
+}
+function _LoadImage($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $image$sroa$0$0 = 0, $image$sroa$0$09 = 0, $image$sroa$12$0 = 0;
+ var $image$sroa$12$05 = 0, $image$sroa$12$06 = 0, $image$sroa$15$0 = 0, $image$sroa$15$03 = 0, $image$sroa$15$04 = 0, $image$sroa$17$0 = 0, $image$sroa$17$01 = 0, $image$sroa$17$02 = 0, $image$sroa$9$0 = 0, $image$sroa$9$07 = 0, $image$sroa$9$08 = 0, $imgBpp = 0, $imgHeight = 0, $imgWidth = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $imgWidth = sp + 128|0;
+ $imgHeight = sp + 124|0;
+ $imgBpp = sp + 120|0;
+ $0 = sp + 100|0;
+ $1 = sp + 80|0;
+ $2 = sp + 60|0;
+ $3 = sp + 40|0;
+ $4 = sp + 20|0;
+ $5 = (_GetExtension($fileName)|0);
+ $6 = (_strcmp($5,10766)|0);
+ $7 = ($6|0)==(0);
+ do {
+ if ($7) {
+ label = 8;
+ } else {
+ $8 = (_GetExtension($fileName)|0);
+ $9 = (_strcmp($8,10770)|0);
+ $10 = ($9|0)==(0);
+ if ($10) {
+ label = 8;
+ } else {
+ $11 = (_GetExtension($fileName)|0);
+ $12 = (_strcmp($11,10774)|0);
+ $13 = ($12|0)==(0);
+ if ($13) {
+ label = 8;
+ } else {
+ $14 = (_GetExtension($fileName)|0);
+ $15 = (_strcmp($14,10778)|0);
+ $16 = ($15|0)==(0);
+ if ($16) {
+ label = 8;
+ } else {
+ $17 = (_GetExtension($fileName)|0);
+ $18 = (_strcmp($17,10782)|0);
+ $19 = ($18|0)==(0);
+ if ($19) {
+ label = 8;
+ } else {
+ $20 = (_GetExtension($fileName)|0);
+ $21 = (_strcmp($20,10786)|0);
+ $22 = ($21|0)==(0);
+ if ($22) {
+ label = 8;
+ } else {
+ $23 = (_GetExtension($fileName)|0);
+ $24 = (_strcmp($23,10790)|0);
+ $25 = ($24|0)==(0);
+ if ($25) {
+ label = 8;
+ } else {
+ $31 = (_GetExtension($fileName)|0);
+ $32 = (_strcmp($31,10794)|0);
+ $33 = ($32|0)==(0);
+ if ($33) {
+ _LoadDDS($0,$fileName);
+ $34 = HEAP32[$0>>2]|0;
+ $35 = ((($0)) + 4|0);
+ $36 = HEAP32[$35>>2]|0;
+ $37 = ((($0)) + 8|0);
+ $38 = HEAP32[$37>>2]|0;
+ $39 = ((($0)) + 12|0);
+ $40 = HEAP32[$39>>2]|0;
+ $41 = ((($0)) + 16|0);
+ $42 = HEAP32[$41>>2]|0;
+ $image$sroa$0$0 = $34;$image$sroa$12$0 = $38;$image$sroa$15$0 = $40;$image$sroa$17$0 = $42;$image$sroa$9$0 = $36;
+ label = 22;
+ break;
+ }
+ $43 = (_GetExtension($fileName)|0);
+ $44 = (_strcmp($43,10798)|0);
+ $45 = ($44|0)==(0);
+ if ($45) {
+ _LoadPKM($1,$fileName);
+ $46 = HEAP32[$1>>2]|0;
+ $47 = ((($1)) + 4|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = ((($1)) + 8|0);
+ $50 = HEAP32[$49>>2]|0;
+ $51 = ((($1)) + 12|0);
+ $52 = HEAP32[$51>>2]|0;
+ $53 = ((($1)) + 16|0);
+ $54 = HEAP32[$53>>2]|0;
+ $image$sroa$0$0 = $46;$image$sroa$12$0 = $50;$image$sroa$15$0 = $52;$image$sroa$17$0 = $54;$image$sroa$9$0 = $48;
+ label = 22;
+ break;
+ }
+ $55 = (_GetExtension($fileName)|0);
+ $56 = (_strcmp($55,10802)|0);
+ $57 = ($56|0)==(0);
+ if ($57) {
+ _LoadKTX($2,$fileName);
+ $58 = HEAP32[$2>>2]|0;
+ $59 = ((($2)) + 4|0);
+ $60 = HEAP32[$59>>2]|0;
+ $61 = ((($2)) + 8|0);
+ $62 = HEAP32[$61>>2]|0;
+ $63 = ((($2)) + 12|0);
+ $64 = HEAP32[$63>>2]|0;
+ $65 = ((($2)) + 16|0);
+ $66 = HEAP32[$65>>2]|0;
+ $image$sroa$0$0 = $58;$image$sroa$12$0 = $62;$image$sroa$15$0 = $64;$image$sroa$17$0 = $66;$image$sroa$9$0 = $60;
+ label = 22;
+ break;
+ }
+ $67 = (_GetExtension($fileName)|0);
+ $68 = (_strcmp($67,10806)|0);
+ $69 = ($68|0)==(0);
+ if ($69) {
+ _LoadPVR($3,$fileName);
+ $70 = HEAP32[$3>>2]|0;
+ $71 = ((($3)) + 4|0);
+ $72 = HEAP32[$71>>2]|0;
+ $73 = ((($3)) + 8|0);
+ $74 = HEAP32[$73>>2]|0;
+ $75 = ((($3)) + 12|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = ((($3)) + 16|0);
+ $78 = HEAP32[$77>>2]|0;
+ $image$sroa$0$0 = $70;$image$sroa$12$0 = $74;$image$sroa$15$0 = $76;$image$sroa$17$0 = $78;$image$sroa$9$0 = $72;
+ label = 22;
+ break;
+ }
+ $79 = (_GetExtension($fileName)|0);
+ $80 = (_strcmp($79,10810)|0);
+ $81 = ($80|0)==(0);
+ if ($81) {
+ _LoadASTC($4,$fileName);
+ $82 = HEAP32[$4>>2]|0;
+ $83 = ((($4)) + 4|0);
+ $84 = HEAP32[$83>>2]|0;
+ $85 = ((($4)) + 8|0);
+ $86 = HEAP32[$85>>2]|0;
+ $87 = ((($4)) + 12|0);
+ $88 = HEAP32[$87>>2]|0;
+ $89 = ((($4)) + 16|0);
+ $90 = HEAP32[$89>>2]|0;
+ $image$sroa$0$0 = $82;$image$sroa$12$0 = $86;$image$sroa$15$0 = $88;$image$sroa$17$0 = $90;$image$sroa$9$0 = $84;
+ label = 22;
+ } else {
+ $image$sroa$12$06 = 0;$image$sroa$15$04 = 0;$image$sroa$17$02 = 0;$image$sroa$9$08 = 0;
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ } while(0);
+ L22: do {
+ if ((label|0) == 8) {
+ HEAP32[$imgWidth>>2] = 0;
+ HEAP32[$imgHeight>>2] = 0;
+ HEAP32[$imgBpp>>2] = 0;
+ $26 = (_stbi_load($fileName,$imgWidth,$imgHeight,$imgBpp,0)|0);
+ $27 = HEAP32[$imgWidth>>2]|0;
+ $28 = HEAP32[$imgHeight>>2]|0;
+ $29 = HEAP32[$imgBpp>>2]|0;
+ switch ($29|0) {
+ case 1: {
+ $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 1;$image$sroa$9$0 = $27;
+ label = 22;
+ break L22;
+ break;
+ }
+ case 2: {
+ $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 2;$image$sroa$9$0 = $27;
+ label = 22;
+ break L22;
+ break;
+ }
+ case 3: {
+ $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 4;$image$sroa$9$0 = $27;
+ label = 22;
+ break L22;
+ break;
+ }
+ default: {
+ $30 = ($29|0)==(4);
+ $$ = $30 ? 7 : 0;
+ $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = $$;$image$sroa$9$0 = $27;
+ label = 22;
+ break L22;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 22) {
+ $91 = ($image$sroa$0$0|0)==(0|0);
+ if ($91) {
+ $image$sroa$12$06 = $image$sroa$12$0;$image$sroa$15$04 = $image$sroa$15$0;$image$sroa$17$02 = $image$sroa$17$0;$image$sroa$9$08 = $image$sroa$9$0;
+ } else {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $image$sroa$9$0;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $image$sroa$12$0;
+ _TraceLog(0,10815,$vararg_buffer);
+ $image$sroa$0$09 = $image$sroa$0$0;$image$sroa$12$05 = $image$sroa$12$0;$image$sroa$15$03 = $image$sroa$15$0;$image$sroa$17$01 = $image$sroa$17$0;$image$sroa$9$07 = $image$sroa$9$0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$09;
+ $92 = ((($agg$result)) + 4|0);
+ HEAP32[$92>>2] = $image$sroa$9$07;
+ $93 = ((($agg$result)) + 8|0);
+ HEAP32[$93>>2] = $image$sroa$12$05;
+ $94 = ((($agg$result)) + 12|0);
+ HEAP32[$94>>2] = $image$sroa$15$03;
+ $95 = ((($agg$result)) + 16|0);
+ HEAP32[$95>>2] = $image$sroa$17$01;
+ STACKTOP = sp;return;
+ }
+ }
+ HEAP32[$vararg_buffer3>>2] = $fileName;
+ _TraceLog(2,10854,$vararg_buffer3);
+ $image$sroa$0$09 = 0;$image$sroa$12$05 = $image$sroa$12$06;$image$sroa$15$03 = $image$sroa$15$04;$image$sroa$17$01 = $image$sroa$17$02;$image$sroa$9$07 = $image$sroa$9$08;
+ HEAP32[$agg$result>>2] = $image$sroa$0$09;
+ $92 = ((($agg$result)) + 4|0);
+ HEAP32[$92>>2] = $image$sroa$9$07;
+ $93 = ((($agg$result)) + 8|0);
+ HEAP32[$93>>2] = $image$sroa$12$05;
+ $94 = ((($agg$result)) + 12|0);
+ HEAP32[$94>>2] = $image$sroa$15$03;
+ $95 = ((($agg$result)) + 16|0);
+ HEAP32[$95>>2] = $image$sroa$17$01;
+ STACKTOP = sp;return;
+}
+function _LoadImageEx($agg$result,$pixels,$width,$height) {
+ $agg$result = $agg$result|0;
+ $pixels = $pixels|0;
+ $width = $width|0;
+ $height = $height|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $width << 2;
+ $1 = Math_imul($0, $height)|0;
+ $2 = (_malloc($1)|0);
+ $3 = ($1|0)>(0);
+ if ($3) {
+ $4 = Math_imul($height, $width)|0;
+ $5 = $4 << 2;
+ $6 = (($5) + -1)|0;
+ $7 = $6 >>> 2;
+ $i$02 = 0;$k$01 = 0;
+ while(1) {
+ $8 = (($pixels) + ($k$01<<2)|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = (($2) + ($i$02)|0);
+ HEAP8[$10>>0] = $9;
+ $11 = (((($pixels) + ($k$01<<2)|0)) + 1|0);
+ $12 = HEAP8[$11>>0]|0;
+ $13 = $i$02 | 1;
+ $14 = (($2) + ($13)|0);
+ HEAP8[$14>>0] = $12;
+ $15 = (((($pixels) + ($k$01<<2)|0)) + 2|0);
+ $16 = HEAP8[$15>>0]|0;
+ $17 = $i$02 | 2;
+ $18 = (($2) + ($17)|0);
+ HEAP8[$18>>0] = $16;
+ $19 = (((($pixels) + ($k$01<<2)|0)) + 3|0);
+ $20 = HEAP8[$19>>0]|0;
+ $21 = $i$02 | 3;
+ $22 = (($2) + ($21)|0);
+ HEAP8[$22>>0] = $20;
+ $23 = (($k$01) + 1)|0;
+ $24 = (($i$02) + 4)|0;
+ $exitcond = ($k$01|0)==($7|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$02 = $24;$k$01 = $23;
+ }
+ }
+ }
+ HEAP32[$agg$result>>2] = $2;
+ $25 = ((($agg$result)) + 4|0);
+ HEAP32[$25>>2] = $width;
+ $26 = ((($agg$result)) + 8|0);
+ HEAP32[$26>>2] = $height;
+ $27 = ((($agg$result)) + 12|0);
+ HEAP32[$27>>2] = 1;
+ $28 = ((($agg$result)) + 16|0);
+ HEAP32[$28>>2] = 7;
+ return;
+}
+function _LoadTexture($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $image = 0, $image$byval_copy1 = 0, $texture$sroa$0$0 = 0, $texture$sroa$3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 96|0;
+ $image$byval_copy1 = sp + 64|0;
+ $vararg_buffer = sp;
+ $texture$sroa$3 = sp + 8|0;
+ $image = sp + 44|0;
+ $0 = sp + 24|0;
+ _LoadImage($image,$fileName);
+ $1 = HEAP32[$image>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if ($2) {
+ _TraceLog(2,10909,$vararg_buffer);
+ $texture$sroa$0$0 = 0;
+ } else {
+ ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
+ _LoadTextureFromImage($0,$image$byval_copy1);
+ $3 = HEAP32[$0>>2]|0;
+ $4 = ((($0)) + 4|0);
+ ;HEAP32[$texture$sroa$3>>2]=HEAP32[$4>>2]|0;HEAP32[$texture$sroa$3+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$texture$sroa$3+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$texture$sroa$3+12>>2]=HEAP32[$4+12>>2]|0;
+ ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
+ _UnloadImage($image$byval_copy1);
+ $texture$sroa$0$0 = $3;
+ }
+ HEAP32[$agg$result>>2] = $texture$sroa$0$0;
+ $5 = ((($agg$result)) + 4|0);
+ ;HEAP32[$5>>2]=HEAP32[$texture$sroa$3>>2]|0;HEAP32[$5+4>>2]=HEAP32[$texture$sroa$3+4>>2]|0;HEAP32[$5+8>>2]=HEAP32[$texture$sroa$3+8>>2]|0;HEAP32[$5+12>>2]=HEAP32[$texture$sroa$3+12>>2]|0;
+ STACKTOP = sp;return;
+}
+function _LoadTextureFromImage($agg$result,$image) {
+ $agg$result = $agg$result|0;
+ $image = $image|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$image>>2]|0;
+ $1 = ((($image)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($image)) + 8|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($image)) + 16|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($image)) + 12|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = (_rlglLoadTexture($0,$2,$4,$6,$8)|0);
+ $10 = HEAP32[$1>>2]|0;
+ $11 = HEAP32[$3>>2]|0;
+ $12 = HEAP32[$7>>2]|0;
+ $13 = HEAP32[$5>>2]|0;
+ HEAP32[$agg$result>>2] = $9;
+ $14 = ((($agg$result)) + 4|0);
+ HEAP32[$14>>2] = $10;
+ $15 = ((($agg$result)) + 8|0);
+ HEAP32[$15>>2] = $11;
+ $16 = ((($agg$result)) + 12|0);
+ HEAP32[$16>>2] = $12;
+ $17 = ((($agg$result)) + 16|0);
+ HEAP32[$17>>2] = $13;
+ return;
+}
+function _UnloadImage($image) {
+ $image = $image|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$image>>2]|0;
+ _free($0);
+ return;
+}
+function _UnloadTexture($texture) {
+ $texture = $texture|0;
+ var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = HEAP32[$texture>>2]|0;
+ $1 = ($0|0)==(0);
+ if ($1) {
+ STACKTOP = sp;return;
+ }
+ _rlDeleteTextures($0);
+ $2 = HEAP32[$texture>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $2;
+ _TraceLog(0,10938,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _GetImageData($image) {
+ $image = $image|0;
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
+ var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
+ var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0;
+ var $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
+ var $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0;
+ var $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$01 = 0, $k$02 = 0, $k$1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = ((($image)) + 4|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($image)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = $1 << 2;
+ $5 = Math_imul($4, $3)|0;
+ $6 = (_malloc($5)|0);
+ $7 = HEAP32[$0>>2]|0;
+ $8 = HEAP32[$2>>2]|0;
+ $9 = Math_imul($8, $7)|0;
+ $10 = ($9|0)>(0);
+ if (!($10)) {
+ STACKTOP = sp;return ($6|0);
+ }
+ $11 = ((($image)) + 16|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = HEAP32[$0>>2]|0;
+ $14 = HEAP32[$2>>2]|0;
+ $15 = Math_imul($14, $13)|0;
+ $16 = HEAP32[$image>>2]|0;
+ $i$01 = 0;$k$02 = 0;
+ while(1) {
+ switch ($12|0) {
+ case 1: {
+ $17 = (($16) + ($k$02)|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = (($6) + ($i$01<<2)|0);
+ HEAP8[$19>>0] = $18;
+ $20 = (($16) + ($k$02)|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$22>>0] = $21;
+ $23 = (($16) + ($k$02)|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$25>>0] = $24;
+ $26 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$26>>0] = -1;
+ $27 = (($k$02) + 1)|0;
+ $k$1 = $27;
+ break;
+ }
+ case 2: {
+ $28 = (($16) + ($k$02)|0);
+ $29 = HEAP8[$28>>0]|0;
+ $30 = (($6) + ($i$01<<2)|0);
+ HEAP8[$30>>0] = $29;
+ $31 = (($16) + ($k$02)|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$33>>0] = $32;
+ $34 = (($16) + ($k$02)|0);
+ $35 = HEAP8[$34>>0]|0;
+ $36 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$36>>0] = $35;
+ $37 = (($k$02) + 1)|0;
+ $38 = (($16) + ($37)|0);
+ $39 = HEAP8[$38>>0]|0;
+ $40 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$40>>0] = $39;
+ $41 = (($k$02) + 2)|0;
+ $k$1 = $41;
+ break;
+ }
+ case 5: {
+ $42 = (($16) + ($k$02<<1)|0);
+ $43 = HEAP16[$42>>1]|0;
+ $44 = $43&65535;
+ $45 = $44 >>> 11;
+ $46 = (+($45|0));
+ $47 = $46 * 8.0;
+ $48 = (~~(($47))&255);
+ $49 = (($6) + ($i$01<<2)|0);
+ HEAP8[$49>>0] = $48;
+ $50 = $44 >>> 6;
+ $51 = $50 & 31;
+ $52 = (+($51|0));
+ $53 = $52 * 8.0;
+ $54 = (~~(($53))&255);
+ $55 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$55>>0] = $54;
+ $56 = $44 >>> 1;
+ $57 = $56 & 31;
+ $58 = (+($57|0));
+ $59 = $58 * 8.0;
+ $60 = (~~(($59))&255);
+ $61 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$61>>0] = $60;
+ $62 = $44 & 1;
+ $63 = (0 - ($62))|0;
+ $64 = $63&255;
+ $65 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$65>>0] = $64;
+ $66 = (($k$02) + 1)|0;
+ $k$1 = $66;
+ break;
+ }
+ case 3: {
+ $67 = (($16) + ($k$02<<1)|0);
+ $68 = HEAP16[$67>>1]|0;
+ $69 = $68&65535;
+ $70 = $69 >>> 11;
+ $71 = (+($70|0));
+ $72 = $71 * 8.0;
+ $73 = (~~(($72))&255);
+ $74 = (($6) + ($i$01<<2)|0);
+ HEAP8[$74>>0] = $73;
+ $75 = $69 >>> 5;
+ $76 = $75 & 63;
+ $77 = (+($76|0));
+ $78 = $77 * 4.0;
+ $79 = (~~(($78))&255);
+ $80 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$80>>0] = $79;
+ $81 = $69 & 31;
+ $82 = (+($81|0));
+ $83 = $82 * 8.0;
+ $84 = (~~(($83))&255);
+ $85 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$85>>0] = $84;
+ $86 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$86>>0] = -1;
+ $87 = (($k$02) + 1)|0;
+ $k$1 = $87;
+ break;
+ }
+ case 6: {
+ $88 = (($16) + ($k$02<<1)|0);
+ $89 = HEAP16[$88>>1]|0;
+ $90 = $89&65535;
+ $91 = $90 >>> 12;
+ $92 = (+($91|0));
+ $93 = $92 * 17.0;
+ $94 = (~~(($93))&255);
+ $95 = (($6) + ($i$01<<2)|0);
+ HEAP8[$95>>0] = $94;
+ $96 = $90 >>> 8;
+ $97 = $96 & 15;
+ $98 = (+($97|0));
+ $99 = $98 * 17.0;
+ $100 = (~~(($99))&255);
+ $101 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$101>>0] = $100;
+ $102 = $90 >>> 4;
+ $103 = $102 & 15;
+ $104 = (+($103|0));
+ $105 = $104 * 17.0;
+ $106 = (~~(($105))&255);
+ $107 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$107>>0] = $106;
+ $108 = $90 & 15;
+ $109 = (+($108|0));
+ $110 = $109 * 17.0;
+ $111 = (~~(($110))&255);
+ $112 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$112>>0] = $111;
+ $113 = (($k$02) + 1)|0;
+ $k$1 = $113;
+ break;
+ }
+ case 7: {
+ $114 = (($16) + ($k$02)|0);
+ $115 = HEAP8[$114>>0]|0;
+ $116 = (($6) + ($i$01<<2)|0);
+ HEAP8[$116>>0] = $115;
+ $117 = (($k$02) + 1)|0;
+ $118 = (($16) + ($117)|0);
+ $119 = HEAP8[$118>>0]|0;
+ $120 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$120>>0] = $119;
+ $121 = (($k$02) + 2)|0;
+ $122 = (($16) + ($121)|0);
+ $123 = HEAP8[$122>>0]|0;
+ $124 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$124>>0] = $123;
+ $125 = (($k$02) + 3)|0;
+ $126 = (($16) + ($125)|0);
+ $127 = HEAP8[$126>>0]|0;
+ $128 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$128>>0] = $127;
+ $129 = (($k$02) + 4)|0;
+ $k$1 = $129;
+ break;
+ }
+ case 4: {
+ $130 = (($16) + ($k$02)|0);
+ $131 = HEAP8[$130>>0]|0;
+ $132 = (($6) + ($i$01<<2)|0);
+ HEAP8[$132>>0] = $131;
+ $133 = (($k$02) + 1)|0;
+ $134 = (($16) + ($133)|0);
+ $135 = HEAP8[$134>>0]|0;
+ $136 = (((($6) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$136>>0] = $135;
+ $137 = (($k$02) + 2)|0;
+ $138 = (($16) + ($137)|0);
+ $139 = HEAP8[$138>>0]|0;
+ $140 = (((($6) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$140>>0] = $139;
+ $141 = (((($6) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$141>>0] = -1;
+ $142 = (($k$02) + 3)|0;
+ $k$1 = $142;
+ break;
+ }
+ default: {
+ _TraceLog(2,10988,$vararg_buffer);
+ $k$1 = $k$02;
+ }
+ }
+ $143 = (($i$01) + 1)|0;
+ $144 = ($143|0)<($15|0);
+ if ($144) {
+ $i$01 = $143;$k$02 = $k$1;
+ } else {
+ break;
+ }
+ }
+ STACKTOP = sp;return ($6|0);
+}
+function _ImageFormat($image,$newFormat) {
+ $image = $image|0;
+ $newFormat = $newFormat|0;
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
+ var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
+ var $170 = 0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0;
+ var $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
+ var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0.0;
+ var $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0.0;
+ var $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
+ var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
+ var $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
+ var $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
+ var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0;
+ var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
+ var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$017 = 0, $i1$019 = 0, $i12$028 = 0;
+ var $i13$031 = 0, $i2$021 = 0, $i3$024 = 0, $i7$026 = 0, $image$byval_copy = 0, $k$018 = 0, $k$123 = 0, $k$230 = 0, $or$cond = 0, $roundf = 0.0, $roundf10 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $roundf4 = 0.0, $roundf5 = 0.0, $roundf6 = 0.0, $roundf7 = 0.0, $roundf8 = 0.0, $roundf9 = 0.0, $vararg_buffer = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $image$byval_copy = sp + 4|0;
+ $vararg_buffer = sp;
+ $0 = ((($image)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==($newFormat|0);
+ if ($2) {
+ STACKTOP = sp;return;
+ }
+ $3 = ($1|0)<(8);
+ $4 = ($newFormat|0)<(8);
+ $or$cond = $4 & $3;
+ if (!($or$cond)) {
+ _TraceLog(2,11034,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+ ;HEAP32[$image$byval_copy>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy+16>>2]=HEAP32[$image+16>>2]|0;
+ $5 = (_GetImageData($image$byval_copy)|0);
+ $6 = HEAP32[$image>>2]|0;
+ _free($6);
+ HEAP32[$0>>2] = $newFormat;
+ switch ($newFormat|0) {
+ case 1: {
+ $7 = ((($image)) + 4|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($image)) + 8|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = Math_imul($10, $8)|0;
+ $12 = (_malloc($11)|0);
+ HEAP32[$image>>2] = $12;
+ $13 = HEAP32[$7>>2]|0;
+ $14 = HEAP32[$9>>2]|0;
+ $15 = Math_imul($14, $13)|0;
+ $16 = ($15|0)>(0);
+ if ($16) {
+ $i$017 = 0;
+ while(1) {
+ $17 = (($5) + ($i$017<<2)|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = (+($18&255));
+ $20 = $19 * 0.29899999499320984;
+ $21 = (((($5) + ($i$017<<2)|0)) + 1|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = (+($22&255));
+ $24 = $23 * 0.58700001239776611;
+ $25 = $20 + $24;
+ $26 = (((($5) + ($i$017<<2)|0)) + 2|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = (+($27&255));
+ $29 = $28 * 0.11400000005960464;
+ $30 = $25 + $29;
+ $31 = (~~(($30))&255);
+ $32 = HEAP32[$image>>2]|0;
+ $33 = (($32) + ($i$017)|0);
+ HEAP8[$33>>0] = $31;
+ $34 = (($i$017) + 1)|0;
+ $35 = HEAP32[$7>>2]|0;
+ $36 = HEAP32[$9>>2]|0;
+ $37 = Math_imul($36, $35)|0;
+ $38 = ($34|0)<($37|0);
+ if ($38) {
+ $i$017 = $34;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 2: {
+ $39 = ((($image)) + 4|0);
+ $40 = HEAP32[$39>>2]|0;
+ $41 = ((($image)) + 8|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = $40 << 1;
+ $44 = Math_imul($43, $42)|0;
+ $45 = (_malloc($44)|0);
+ HEAP32[$image>>2] = $45;
+ $46 = HEAP32[$39>>2]|0;
+ $47 = HEAP32[$41>>2]|0;
+ $48 = $46 << 1;
+ $49 = Math_imul($48, $47)|0;
+ $50 = ($49|0)>(0);
+ if ($50) {
+ $i1$019 = 0;$k$018 = 0;
+ while(1) {
+ $51 = (($5) + ($k$018<<2)|0);
+ $52 = HEAP8[$51>>0]|0;
+ $53 = (+($52&255));
+ $54 = $53 * 0.29899999499320984;
+ $55 = (((($5) + ($k$018<<2)|0)) + 1|0);
+ $56 = HEAP8[$55>>0]|0;
+ $57 = (+($56&255));
+ $58 = $57 * 0.58700001239776611;
+ $59 = $54 + $58;
+ $60 = (((($5) + ($k$018<<2)|0)) + 2|0);
+ $61 = HEAP8[$60>>0]|0;
+ $62 = (+($61&255));
+ $63 = $62 * 0.11400000005960464;
+ $64 = $59 + $63;
+ $65 = (~~(($64))&255);
+ $66 = HEAP32[$image>>2]|0;
+ $67 = (($66) + ($i1$019)|0);
+ HEAP8[$67>>0] = $65;
+ $68 = (((($5) + ($k$018<<2)|0)) + 3|0);
+ $69 = HEAP8[$68>>0]|0;
+ $70 = $i1$019 | 1;
+ $71 = HEAP32[$image>>2]|0;
+ $72 = (($71) + ($70)|0);
+ HEAP8[$72>>0] = $69;
+ $73 = (($k$018) + 1)|0;
+ $74 = (($i1$019) + 2)|0;
+ $75 = HEAP32[$39>>2]|0;
+ $76 = HEAP32[$41>>2]|0;
+ $77 = $75 << 1;
+ $78 = Math_imul($77, $76)|0;
+ $79 = ($74|0)<($78|0);
+ if ($79) {
+ $i1$019 = $74;$k$018 = $73;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 3: {
+ $80 = ((($image)) + 4|0);
+ $81 = HEAP32[$80>>2]|0;
+ $82 = ((($image)) + 8|0);
+ $83 = HEAP32[$82>>2]|0;
+ $84 = $81 << 1;
+ $85 = Math_imul($84, $83)|0;
+ $86 = (_malloc($85)|0);
+ HEAP32[$image>>2] = $86;
+ $87 = HEAP32[$80>>2]|0;
+ $88 = HEAP32[$82>>2]|0;
+ $89 = Math_imul($88, $87)|0;
+ $90 = ($89|0)>(0);
+ if ($90) {
+ $91 = HEAP8[$5>>0]|0;
+ $92 = (+($91&255));
+ $93 = $92 * 31.0;
+ $94 = $93 / 255.0;
+ $roundf8 = (+_roundf($94));
+ $95 = (~~(($roundf8))&255);
+ $96 = ((($5)) + 1|0);
+ $97 = HEAP8[$96>>0]|0;
+ $98 = (+($97&255));
+ $99 = $98 * 63.0;
+ $100 = $99 / 255.0;
+ $roundf9 = (+_roundf($100));
+ $101 = (~~(($roundf9))&255);
+ $102 = ((($5)) + 2|0);
+ $103 = HEAP8[$102>>0]|0;
+ $104 = (+($103&255));
+ $105 = $104 * 31.0;
+ $106 = $105 / 255.0;
+ $roundf10 = (+_roundf($106));
+ $107 = (~~(($roundf10))&255);
+ $108 = $95&255;
+ $109 = $108 << 11;
+ $110 = $101&255;
+ $111 = $110 << 5;
+ $112 = $111 | $109;
+ $113 = $107&255;
+ $114 = $112 | $113;
+ $115 = $114&65535;
+ $116 = HEAP32[$image>>2]|0;
+ $117 = HEAP32[$80>>2]|0;
+ $118 = HEAP32[$82>>2]|0;
+ $119 = Math_imul($118, $117)|0;
+ $i2$021 = 0;
+ while(1) {
+ $120 = (($116) + ($i2$021<<1)|0);
+ HEAP16[$120>>1] = $115;
+ $121 = (($i2$021) + 1)|0;
+ $122 = ($121|0)<($119|0);
+ if ($122) {
+ $i2$021 = $121;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 4: {
+ $123 = ((($image)) + 4|0);
+ $124 = HEAP32[$123>>2]|0;
+ $125 = ((($image)) + 8|0);
+ $126 = HEAP32[$125>>2]|0;
+ $127 = ($124*3)|0;
+ $128 = Math_imul($127, $126)|0;
+ $129 = (_malloc($128)|0);
+ HEAP32[$image>>2] = $129;
+ $130 = HEAP32[$123>>2]|0;
+ $131 = HEAP32[$125>>2]|0;
+ $132 = ($130*3)|0;
+ $133 = Math_imul($132, $131)|0;
+ $134 = ($133|0)>(0);
+ if ($134) {
+ $i3$024 = 0;$k$123 = 0;
+ while(1) {
+ $135 = (($5) + ($k$123<<2)|0);
+ $136 = HEAP8[$135>>0]|0;
+ $137 = HEAP32[$image>>2]|0;
+ $138 = (($137) + ($i3$024)|0);
+ HEAP8[$138>>0] = $136;
+ $139 = (((($5) + ($k$123<<2)|0)) + 1|0);
+ $140 = HEAP8[$139>>0]|0;
+ $141 = (($i3$024) + 1)|0;
+ $142 = HEAP32[$image>>2]|0;
+ $143 = (($142) + ($141)|0);
+ HEAP8[$143>>0] = $140;
+ $144 = (((($5) + ($k$123<<2)|0)) + 2|0);
+ $145 = HEAP8[$144>>0]|0;
+ $146 = (($i3$024) + 2)|0;
+ $147 = HEAP32[$image>>2]|0;
+ $148 = (($147) + ($146)|0);
+ HEAP8[$148>>0] = $145;
+ $149 = (($k$123) + 1)|0;
+ $150 = (($i3$024) + 3)|0;
+ $151 = HEAP32[$123>>2]|0;
+ $152 = HEAP32[$125>>2]|0;
+ $153 = ($151*3)|0;
+ $154 = Math_imul($153, $152)|0;
+ $155 = ($150|0)<($154|0);
+ if ($155) {
+ $i3$024 = $150;$k$123 = $149;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 5: {
+ $156 = ((($image)) + 4|0);
+ $157 = HEAP32[$156>>2]|0;
+ $158 = ((($image)) + 8|0);
+ $159 = HEAP32[$158>>2]|0;
+ $160 = $157 << 1;
+ $161 = Math_imul($160, $159)|0;
+ $162 = (_malloc($161)|0);
+ HEAP32[$image>>2] = $162;
+ $163 = HEAP32[$156>>2]|0;
+ $164 = HEAP32[$158>>2]|0;
+ $165 = Math_imul($164, $163)|0;
+ $166 = ($165|0)>(0);
+ if ($166) {
+ $167 = HEAP32[$image>>2]|0;
+ $168 = HEAP32[$156>>2]|0;
+ $169 = HEAP32[$158>>2]|0;
+ $170 = Math_imul($169, $168)|0;
+ $i7$026 = 0;
+ while(1) {
+ $171 = (($5) + ($i7$026<<2)|0);
+ $172 = HEAP8[$171>>0]|0;
+ $173 = (+($172&255));
+ $174 = $173 * 31.0;
+ $175 = $174 / 255.0;
+ $roundf5 = (+_roundf($175));
+ $176 = (~~(($roundf5))&255);
+ $177 = (((($5) + ($i7$026<<2)|0)) + 1|0);
+ $178 = HEAP8[$177>>0]|0;
+ $179 = (+($178&255));
+ $180 = $179 * 31.0;
+ $181 = $180 / 255.0;
+ $roundf6 = (+_roundf($181));
+ $182 = (~~(($roundf6))&255);
+ $183 = (((($5) + ($i7$026<<2)|0)) + 2|0);
+ $184 = HEAP8[$183>>0]|0;
+ $185 = (+($184&255));
+ $186 = $185 * 31.0;
+ $187 = $186 / 255.0;
+ $roundf7 = (+_roundf($187));
+ $188 = (~~(($roundf7))&255);
+ $189 = (((($5) + ($i7$026<<2)|0)) + 3|0);
+ $190 = HEAP8[$189>>0]|0;
+ $191 = ($190&255)>(50);
+ $192 = $176&255;
+ $193 = $192 << 11;
+ $194 = $182&255;
+ $195 = $194 << 6;
+ $196 = $195 | $193;
+ $197 = $188&255;
+ $198 = $197 << 1;
+ $199 = $196 | $198;
+ $200 = $191&1;
+ $201 = $199 | $200;
+ $202 = $201&65535;
+ $203 = (($167) + ($i7$026<<1)|0);
+ HEAP16[$203>>1] = $202;
+ $204 = (($i7$026) + 1)|0;
+ $205 = ($204|0)<($170|0);
+ if ($205) {
+ $i7$026 = $204;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 6: {
+ $206 = ((($image)) + 4|0);
+ $207 = HEAP32[$206>>2]|0;
+ $208 = ((($image)) + 8|0);
+ $209 = HEAP32[$208>>2]|0;
+ $210 = $207 << 1;
+ $211 = Math_imul($210, $209)|0;
+ $212 = (_malloc($211)|0);
+ HEAP32[$image>>2] = $212;
+ $213 = HEAP32[$206>>2]|0;
+ $214 = HEAP32[$208>>2]|0;
+ $215 = Math_imul($214, $213)|0;
+ $216 = ($215|0)>(0);
+ if ($216) {
+ $217 = HEAP32[$image>>2]|0;
+ $218 = HEAP32[$206>>2]|0;
+ $219 = HEAP32[$208>>2]|0;
+ $220 = Math_imul($219, $218)|0;
+ $i12$028 = 0;
+ while(1) {
+ $221 = (($5) + ($i12$028<<2)|0);
+ $222 = HEAP8[$221>>0]|0;
+ $223 = (+($222&255));
+ $224 = $223 * 15.0;
+ $225 = $224 / 255.0;
+ $roundf = (+_roundf($225));
+ $226 = (~~(($roundf))&255);
+ $227 = (((($5) + ($i12$028<<2)|0)) + 1|0);
+ $228 = HEAP8[$227>>0]|0;
+ $229 = (+($228&255));
+ $230 = $229 * 15.0;
+ $231 = $230 / 255.0;
+ $roundf2 = (+_roundf($231));
+ $232 = (~~(($roundf2))&255);
+ $233 = (((($5) + ($i12$028<<2)|0)) + 2|0);
+ $234 = HEAP8[$233>>0]|0;
+ $235 = (+($234&255));
+ $236 = $235 * 15.0;
+ $237 = $236 / 255.0;
+ $roundf3 = (+_roundf($237));
+ $238 = (~~(($roundf3))&255);
+ $239 = (((($5) + ($i12$028<<2)|0)) + 3|0);
+ $240 = HEAP8[$239>>0]|0;
+ $241 = (+($240&255));
+ $242 = $241 * 15.0;
+ $243 = $242 / 255.0;
+ $roundf4 = (+_roundf($243));
+ $244 = (~~(($roundf4))&255);
+ $245 = $226&255;
+ $246 = $245 << 12;
+ $247 = $232&255;
+ $248 = $247 << 8;
+ $249 = $248 | $246;
+ $250 = $238&255;
+ $251 = $250 << 4;
+ $252 = $249 | $251;
+ $253 = $244&255;
+ $254 = $252 | $253;
+ $255 = $254&65535;
+ $256 = (($217) + ($i12$028<<1)|0);
+ HEAP16[$256>>1] = $255;
+ $257 = (($i12$028) + 1)|0;
+ $258 = ($257|0)<($220|0);
+ if ($258) {
+ $i12$028 = $257;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 7: {
+ $259 = ((($image)) + 4|0);
+ $260 = HEAP32[$259>>2]|0;
+ $261 = ((($image)) + 8|0);
+ $262 = HEAP32[$261>>2]|0;
+ $263 = $260 << 2;
+ $264 = Math_imul($263, $262)|0;
+ $265 = (_malloc($264)|0);
+ HEAP32[$image>>2] = $265;
+ $266 = HEAP32[$259>>2]|0;
+ $267 = HEAP32[$261>>2]|0;
+ $268 = $266 << 2;
+ $269 = Math_imul($268, $267)|0;
+ $270 = ($269|0)>(0);
+ if ($270) {
+ $i13$031 = 0;$k$230 = 0;
+ while(1) {
+ $271 = (($5) + ($k$230<<2)|0);
+ $272 = HEAP8[$271>>0]|0;
+ $273 = HEAP32[$image>>2]|0;
+ $274 = (($273) + ($i13$031)|0);
+ HEAP8[$274>>0] = $272;
+ $275 = (((($5) + ($k$230<<2)|0)) + 1|0);
+ $276 = HEAP8[$275>>0]|0;
+ $277 = $i13$031 | 1;
+ $278 = HEAP32[$image>>2]|0;
+ $279 = (($278) + ($277)|0);
+ HEAP8[$279>>0] = $276;
+ $280 = (((($5) + ($k$230<<2)|0)) + 2|0);
+ $281 = HEAP8[$280>>0]|0;
+ $282 = $i13$031 | 2;
+ $283 = HEAP32[$image>>2]|0;
+ $284 = (($283) + ($282)|0);
+ HEAP8[$284>>0] = $281;
+ $285 = (((($5) + ($k$230<<2)|0)) + 3|0);
+ $286 = HEAP8[$285>>0]|0;
+ $287 = $i13$031 | 3;
+ $288 = HEAP32[$image>>2]|0;
+ $289 = (($288) + ($287)|0);
+ HEAP8[$289>>0] = $286;
+ $290 = (($k$230) + 1)|0;
+ $291 = (($i13$031) + 4)|0;
+ $292 = HEAP32[$259>>2]|0;
+ $293 = HEAP32[$261>>2]|0;
+ $294 = $292 << 2;
+ $295 = Math_imul($294, $293)|0;
+ $296 = ($291|0)<($295|0);
+ if ($296) {
+ $i13$031 = $291;$k$230 = $290;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ _free($5);
+ STACKTOP = sp;return;
+}
+function _DrawTexturePro($texture,$sourceRec,$destRec,$origin,$rotation,$tint) {
+ $texture = $texture|0;
+ $sourceRec = $sourceRec|0;
+ $destRec = $destRec|0;
+ $origin = $origin|0;
+ $rotation = +$rotation;
+ $tint = $tint|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0;
+ var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0;
+ var $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$texture>>2]|0;
+ $1 = ($0|0)==(0);
+ if ($1) {
+ return;
+ }
+ $2 = ((($sourceRec)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)<(0);
+ if ($4) {
+ $5 = HEAP32[$sourceRec>>2]|0;
+ $6 = (($5) - ($3))|0;
+ HEAP32[$sourceRec>>2] = $6;
+ }
+ $7 = ((($sourceRec)) + 12|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)<(0);
+ if ($9) {
+ $10 = ((($sourceRec)) + 4|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = (($11) - ($8))|0;
+ HEAP32[$10>>2] = $12;
+ }
+ $13 = HEAP32[$texture>>2]|0;
+ _rlEnableTexture($13);
+ _rlPushMatrix();
+ $14 = HEAP32[$destRec>>2]|0;
+ $15 = (+($14|0));
+ $16 = ((($destRec)) + 4|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (+($17|0));
+ _rlTranslatef($15,$18,0.0);
+ _rlRotatef($rotation,0.0,0.0,1.0);
+ $19 = +HEAPF32[$origin>>2];
+ $20 = -$19;
+ $21 = ((($origin)) + 4|0);
+ $22 = +HEAPF32[$21>>2];
+ $23 = -$22;
+ _rlTranslatef($20,$23,0.0);
+ _rlBegin(2);
+ $24 = HEAP8[$tint>>0]|0;
+ $25 = ((($tint)) + 1|0);
+ $26 = HEAP8[$25>>0]|0;
+ $27 = ((($tint)) + 2|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = ((($tint)) + 3|0);
+ $30 = HEAP8[$29>>0]|0;
+ _rlColor4ub($24,$26,$28,$30);
+ $31 = HEAP32[$sourceRec>>2]|0;
+ $32 = (+($31|0));
+ $33 = ((($texture)) + 4|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = (+($34|0));
+ $36 = $32 / $35;
+ $37 = ((($sourceRec)) + 4|0);
+ $38 = HEAP32[$37>>2]|0;
+ $39 = (+($38|0));
+ $40 = ((($texture)) + 8|0);
+ $41 = HEAP32[$40>>2]|0;
+ $42 = (+($41|0));
+ $43 = $39 / $42;
+ _rlTexCoord2f($36,$43);
+ _rlVertex2f(0.0,0.0);
+ $44 = HEAP32[$sourceRec>>2]|0;
+ $45 = (+($44|0));
+ $46 = HEAP32[$33>>2]|0;
+ $47 = (+($46|0));
+ $48 = $45 / $47;
+ $49 = HEAP32[$37>>2]|0;
+ $50 = HEAP32[$7>>2]|0;
+ $51 = (($50) + ($49))|0;
+ $52 = (+($51|0));
+ $53 = HEAP32[$40>>2]|0;
+ $54 = (+($53|0));
+ $55 = $52 / $54;
+ _rlTexCoord2f($48,$55);
+ $56 = ((($destRec)) + 12|0);
+ $57 = HEAP32[$56>>2]|0;
+ $58 = (+($57|0));
+ _rlVertex2f(0.0,$58);
+ $59 = HEAP32[$sourceRec>>2]|0;
+ $60 = HEAP32[$2>>2]|0;
+ $61 = (($60) + ($59))|0;
+ $62 = (+($61|0));
+ $63 = HEAP32[$33>>2]|0;
+ $64 = (+($63|0));
+ $65 = $62 / $64;
+ $66 = HEAP32[$37>>2]|0;
+ $67 = HEAP32[$7>>2]|0;
+ $68 = (($67) + ($66))|0;
+ $69 = (+($68|0));
+ $70 = HEAP32[$40>>2]|0;
+ $71 = (+($70|0));
+ $72 = $69 / $71;
+ _rlTexCoord2f($65,$72);
+ $73 = ((($destRec)) + 8|0);
+ $74 = HEAP32[$73>>2]|0;
+ $75 = (+($74|0));
+ $76 = HEAP32[$56>>2]|0;
+ $77 = (+($76|0));
+ _rlVertex2f($75,$77);
+ $78 = HEAP32[$sourceRec>>2]|0;
+ $79 = HEAP32[$2>>2]|0;
+ $80 = (($79) + ($78))|0;
+ $81 = (+($80|0));
+ $82 = HEAP32[$33>>2]|0;
+ $83 = (+($82|0));
+ $84 = $81 / $83;
+ $85 = HEAP32[$37>>2]|0;
+ $86 = (+($85|0));
+ $87 = HEAP32[$40>>2]|0;
+ $88 = (+($87|0));
+ $89 = $86 / $88;
+ _rlTexCoord2f($84,$89);
+ $90 = HEAP32[$73>>2]|0;
+ $91 = (+($90|0));
+ _rlVertex2f($91,0.0);
+ _rlEnd();
+ _rlPopMatrix();
+ return;
+}
+function _LoadDefaultFont() {
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $counter$013 = 0, $currentLine$08 = 0, $currentLine$1 = 0, $currentPosX$09 = 0, $currentPosX$1 = 0, $exitcond = 0;
+ var $i$014 = 0, $i1$012 = 0, $i2$010 = 0, $image = 0, $image$byval_copy1 = 0, $j$011 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $image$byval_copy1 = sp + 44|0;
+ $vararg_buffer = sp;
+ $image = sp + 24|0;
+ $0 = sp + 4|0;
+ HEAP32[(2648)>>2] = 224;
+ $1 = (_malloc(65536)|0);
+ $i$014 = 0;
+ while(1) {
+ $2 = (($1) + ($i$014<<2)|0);
+ $3 = (($i$014) + 1)|0;
+ $exitcond = ($3|0)==(16384);
+ HEAP8[$2>>0]=0&255;HEAP8[$2+1>>0]=(0>>8)&255;HEAP8[$2+2>>0]=(0>>16)&255;HEAP8[$2+3>>0]=0>>24;
+ if ($exitcond) {
+ $counter$013 = 0;$i1$012 = 0;
+ break;
+ } else {
+ $i$014 = $3;
+ }
+ }
+ while(1) {
+ $4 = (2668 + ($counter$013<<2)|0);
+ $5 = HEAP32[$4>>2]|0;
+ $j$011 = 31;
+ while(1) {
+ $6 = 1 << $j$011;
+ $7 = $5 & $6;
+ $8 = ($7|0)==(0);
+ if (!($8)) {
+ $9 = (($j$011) + ($i1$012))|0;
+ $10 = (($1) + ($9<<2)|0);
+ HEAP8[$10>>0]=-1&255;HEAP8[$10+1>>0]=(-1>>8)&255;HEAP8[$10+2>>0]=(-1>>16)&255;HEAP8[$10+3>>0]=-1>>24;
+ }
+ $11 = (($j$011) + -1)|0;
+ $12 = ($j$011|0)>(0);
+ if ($12) {
+ $j$011 = $11;
+ } else {
+ break;
+ }
+ }
+ $13 = (($counter$013) + 1)|0;
+ $14 = ($counter$013|0)>(511);
+ $$ = $14 ? 0 : $13;
+ $15 = (($i1$012) + 32)|0;
+ $16 = ($15|0)<(16384);
+ if ($16) {
+ $counter$013 = $$;$i1$012 = $15;
+ } else {
+ break;
+ }
+ }
+ _LoadImageEx($image,$1,128,128);
+ _ImageFormat($image,2);
+ _free($1);
+ ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
+ _LoadTextureFromImage($0,$image$byval_copy1);
+ ;HEAP32[2624>>2]=HEAP32[$0>>2]|0;HEAP32[2624+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[2624+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[2624+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[2624+16>>2]=HEAP32[$0+16>>2]|0;
+ ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0;
+ _UnloadImage($image$byval_copy1);
+ $17 = HEAP32[(2648)>>2]|0;
+ $18 = $17 << 2;
+ $19 = (_malloc($18)|0);
+ HEAP32[(2652)>>2] = $19;
+ $20 = HEAP32[(2648)>>2]|0;
+ $21 = $20 << 4;
+ $22 = (_malloc($21)|0);
+ HEAP32[(2656)>>2] = $22;
+ $23 = HEAP32[(2648)>>2]|0;
+ $24 = $23 << 3;
+ $25 = (_malloc($24)|0);
+ HEAP32[(2660)>>2] = $25;
+ $26 = HEAP32[(2648)>>2]|0;
+ $27 = $26 << 2;
+ $28 = (_malloc($27)|0);
+ HEAP32[(2664)>>2] = $28;
+ $29 = HEAP32[(2648)>>2]|0;
+ $30 = ($29|0)>(0);
+ if ($30) {
+ $currentLine$08 = 0;$currentPosX$09 = 1;$i2$010 = 0;
+ } else {
+ $69 = HEAP32[(2656)>>2]|0;
+ $70 = ((($69)) + 12|0);
+ $71 = HEAP32[$70>>2]|0;
+ HEAP32[(2644)>>2] = $71;
+ $72 = HEAP32[2624>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $72;
+ _TraceLog(0,11088,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+ while(1) {
+ $31 = (($i2$010) + 32)|0;
+ $32 = HEAP32[(2652)>>2]|0;
+ $33 = (($32) + ($i2$010<<2)|0);
+ HEAP32[$33>>2] = $31;
+ $34 = HEAP32[(2656)>>2]|0;
+ $35 = (($34) + ($i2$010<<4)|0);
+ HEAP32[$35>>2] = $currentPosX$09;
+ $36 = ($currentLine$08*11)|0;
+ $37 = (($36) + 1)|0;
+ $38 = HEAP32[(2656)>>2]|0;
+ $39 = (((($38) + ($i2$010<<4)|0)) + 4|0);
+ HEAP32[$39>>2] = $37;
+ $40 = (4716 + ($i2$010<<2)|0);
+ $41 = HEAP32[$40>>2]|0;
+ $42 = HEAP32[(2656)>>2]|0;
+ $43 = (((($42) + ($i2$010<<4)|0)) + 8|0);
+ HEAP32[$43>>2] = $41;
+ $44 = HEAP32[(2656)>>2]|0;
+ $45 = (((($44) + ($i2$010<<4)|0)) + 12|0);
+ HEAP32[$45>>2] = 10;
+ $46 = HEAP32[(2656)>>2]|0;
+ $47 = (((($46) + ($i2$010<<4)|0)) + 8|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = (($currentPosX$09) + 1)|0;
+ $50 = (($49) + ($48))|0;
+ $51 = HEAP32[(2628)>>2]|0;
+ $52 = ($50|0)<($51|0);
+ if ($52) {
+ $currentLine$1 = $currentLine$08;$currentPosX$1 = $50;
+ } else {
+ $53 = (($currentLine$08) + 1)|0;
+ $54 = HEAP32[$40>>2]|0;
+ $55 = (($54) + 2)|0;
+ $56 = (($46) + ($i2$010<<4)|0);
+ HEAP32[$56>>2] = 1;
+ $57 = ($53*11)|0;
+ $58 = (($57) + 1)|0;
+ $59 = HEAP32[(2656)>>2]|0;
+ $60 = (((($59) + ($i2$010<<4)|0)) + 4|0);
+ HEAP32[$60>>2] = $58;
+ $currentLine$1 = $53;$currentPosX$1 = $55;
+ }
+ $61 = HEAP32[(2660)>>2]|0;
+ $62 = (($61) + ($i2$010<<3)|0);
+ HEAPF32[$62>>2] = 0.0;
+ $63 = (((($61) + ($i2$010<<3)|0)) + 4|0);
+ HEAPF32[$63>>2] = 0.0;
+ $64 = HEAP32[(2664)>>2]|0;
+ $65 = (($64) + ($i2$010<<2)|0);
+ HEAP32[$65>>2] = 0;
+ $66 = (($i2$010) + 1)|0;
+ $67 = HEAP32[(2648)>>2]|0;
+ $68 = ($66|0)<($67|0);
+ if ($68) {
+ $currentLine$08 = $currentLine$1;$currentPosX$09 = $currentPosX$1;$i2$010 = $66;
+ } else {
+ break;
+ }
+ }
+ $69 = HEAP32[(2656)>>2]|0;
+ $70 = ((($69)) + 12|0);
+ $71 = HEAP32[$70>>2]|0;
+ HEAP32[(2644)>>2] = $71;
+ $72 = HEAP32[2624>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $72;
+ _TraceLog(0,11088,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _UnloadDefaultFont() {
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $$byval_copy = sp;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[2624>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[2624+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[2624+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[2624+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[2624+16>>2]|0;
+ _UnloadTexture($$byval_copy);
+ $0 = HEAP32[(2652)>>2]|0;
+ _free($0);
+ $1 = HEAP32[(2656)>>2]|0;
+ _free($1);
+ $2 = HEAP32[(2660)>>2]|0;
+ _free($2);
+ $3 = HEAP32[(2664)>>2]|0;
+ _free($3);
+ STACKTOP = sp;return;
+}
+function _DrawText($text,$posX,$posY,$fontSize,$color) {
+ $text = $text|0;
+ $posX = $posX|0;
+ $posY = $posY|0;
+ $fontSize = $fontSize|0;
+ $color = $color|0;
+ var $$fontSize = 0, $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0, $color$byval_copy = 0, $defaultFont$byval_copy = 0, $position = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0;
+ $color$byval_copy = sp + 64|0;
+ $position$byval_copy = sp + 56|0;
+ $defaultFont$byval_copy = sp + 8|0;
+ $position = sp;
+ $0 = (+($posX|0));
+ HEAPF32[$position>>2] = $0;
+ $1 = ((($position)) + 4|0);
+ $2 = (+($posY|0));
+ HEAPF32[$1>>2] = $2;
+ $3 = ($fontSize|0)<(10);
+ $$fontSize = $3 ? 10 : $fontSize;
+ $4 = (($$fontSize|0) / 10)&-1;
+ dest=$defaultFont$byval_copy; src=2624; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;
+ ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0;
+ _DrawTextEx($defaultFont$byval_copy,$text,$position$byval_copy,$$fontSize,$4,$color$byval_copy);
+ STACKTOP = sp;return;
+}
+function _DrawTextEx($spriteFont,$text,$position,$fontSize,$spacing,$tint) {
+ $spriteFont = $spriteFont|0;
+ $text = $text|0;
+ $position = $position|0;
+ $fontSize = $fontSize|0;
+ $spacing = $spacing|0;
+ $tint = $tint|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0;
+ var $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
+ var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0;
+ var $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0;
+ var $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0;
+ var $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0, $i$03 = 0, $i$1$ph = 0, $i$16 = 0, $rec = 0, $rec$byval_copy = 0, $textOffsetX$05 = 0, $textOffsetX$2 = 0, $textOffsetY$04 = 0, $textOffsetY$17 = 0, $tint$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0;
+ $tint$byval_copy = sp + 104|0;
+ $$byval_copy2 = sp + 96|0;
+ $$byval_copy1 = sp + 80|0;
+ $rec$byval_copy = sp + 64|0;
+ $$byval_copy = sp + 40|0;
+ $rec = sp + 24|0;
+ $0 = sp + 8|0;
+ $1 = sp;
+ $2 = (_strlen($text)|0);
+ $3 = (+($fontSize|0));
+ $4 = ((($spriteFont)) + 20|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = (+($5|0));
+ $7 = $3 / $6;
+ $8 = ($2|0)>(0);
+ if (!($8)) {
+ STACKTOP = sp;return;
+ }
+ $9 = ((($spriteFont)) + 32|0);
+ $10 = +HEAPF32[$position>>2];
+ $11 = ((($spriteFont)) + 36|0);
+ $12 = ((($position)) + 4|0);
+ $13 = +HEAPF32[$12>>2];
+ $14 = ((($rec)) + 8|0);
+ $15 = ((($rec)) + 12|0);
+ $16 = ((($0)) + 4|0);
+ $17 = ((($0)) + 8|0);
+ $18 = ((($0)) + 12|0);
+ $19 = ((($1)) + 4|0);
+ $20 = ((($spriteFont)) + 40|0);
+ $21 = (+($spacing|0));
+ $22 = (+($spacing|0));
+ $23 = ((($spriteFont)) + 32|0);
+ $24 = ((($spriteFont)) + 32|0);
+ $i$03 = 0;$textOffsetX$05 = 0;$textOffsetY$04 = 0;
+ while(1) {
+ $25 = (($text) + ($i$03)|0);
+ $26 = HEAP8[$25>>0]|0;
+ switch ($26<<24>>24) {
+ case -62: {
+ $27 = (($i$03) + 1)|0;
+ $28 = (($text) + ($27)|0);
+ $29 = HEAP8[$28>>0]|0;
+ $30 = $29&255;
+ $31 = (($30) + -32)|0;
+ $32 = HEAP32[$23>>2]|0;
+ $33 = (($32) + ($31<<4)|0);
+ ;HEAP32[$rec>>2]=HEAP32[$33>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$33+12>>2]|0;
+ $i$1$ph = $27;
+ label = 8;
+ break;
+ }
+ case -61: {
+ $34 = (($i$03) + 1)|0;
+ $35 = (($text) + ($34)|0);
+ $36 = HEAP8[$35>>0]|0;
+ $37 = $36&255;
+ $38 = (($37) + 32)|0;
+ $39 = HEAP32[$24>>2]|0;
+ $40 = (($39) + ($38<<4)|0);
+ ;HEAP32[$rec>>2]=HEAP32[$40>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$40+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$40+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$40+12>>2]|0;
+ $i$1$ph = $34;
+ label = 8;
+ break;
+ }
+ case 10: {
+ $41 = HEAP32[$4>>2]|0;
+ $42 = (($41|0) / 2)&-1;
+ $43 = (($42) + ($41))|0;
+ $44 = (+($43|0));
+ $45 = $7 * $44;
+ $46 = (+($textOffsetY$04|0));
+ $47 = $46 + $45;
+ $48 = (~~(($47)));
+ HEAP32[$rec>>2] = -1;
+ $i$16 = $i$03;$textOffsetX$2 = 0;$textOffsetY$17 = $48;
+ break;
+ }
+ default: {
+ $49 = $26 << 24 >> 24;
+ $50 = (($49) + -32)|0;
+ $51 = HEAP32[$9>>2]|0;
+ $52 = (($51) + ($50<<4)|0);
+ ;HEAP32[$rec>>2]=HEAP32[$52>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$52+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$52+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$52+12>>2]|0;
+ $i$1$ph = $i$03;
+ label = 8;
+ }
+ }
+ do {
+ if ((label|0) == 8) {
+ label = 0;
+ $$pr = HEAP32[$rec>>2]|0;
+ $53 = ($$pr|0)>(0);
+ if ($53) {
+ $54 = (+($textOffsetX$05|0));
+ $55 = $54 + $10;
+ $56 = (($text) + ($i$1$ph)|0);
+ $57 = HEAP8[$56>>0]|0;
+ $58 = $57 << 24 >> 24;
+ $59 = (($58) + -32)|0;
+ $60 = HEAP32[$11>>2]|0;
+ $61 = (($60) + ($59<<3)|0);
+ $62 = +HEAPF32[$61>>2];
+ $63 = $7 * $62;
+ $64 = $55 + $63;
+ $65 = (~~(($64)));
+ $66 = (+($textOffsetY$04|0));
+ $67 = $66 + $13;
+ $68 = (((($60) + ($59<<3)|0)) + 4|0);
+ $69 = +HEAPF32[$68>>2];
+ $70 = $7 * $69;
+ $71 = $67 + $70;
+ $72 = (~~(($71)));
+ $73 = HEAP32[$14>>2]|0;
+ $74 = (+($73|0));
+ $75 = $7 * $74;
+ $76 = (~~(($75)));
+ $77 = HEAP32[$15>>2]|0;
+ $78 = (+($77|0));
+ $79 = $7 * $78;
+ $80 = (~~(($79)));
+ HEAP32[$0>>2] = $65;
+ HEAP32[$16>>2] = $72;
+ HEAP32[$17>>2] = $76;
+ HEAP32[$18>>2] = $80;
+ HEAPF32[$1>>2] = 0.0;
+ HEAPF32[$19>>2] = 0.0;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$spriteFont>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$spriteFont+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$spriteFont+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$spriteFont+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$spriteFont+16>>2]|0;
+ ;HEAP32[$rec$byval_copy>>2]=HEAP32[$rec>>2]|0;HEAP32[$rec$byval_copy+4>>2]=HEAP32[$rec+4>>2]|0;HEAP32[$rec$byval_copy+8>>2]=HEAP32[$rec+8>>2]|0;HEAP32[$rec$byval_copy+12>>2]=HEAP32[$rec+12>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$1+4>>2]|0;
+ ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
+ _DrawTexturePro($$byval_copy,$rec$byval_copy,$$byval_copy1,$$byval_copy2,0.0,$tint$byval_copy);
+ $81 = HEAP8[$56>>0]|0;
+ $82 = $81 << 24 >> 24;
+ $83 = (($82) + -32)|0;
+ $84 = HEAP32[$20>>2]|0;
+ $85 = (($84) + ($83<<2)|0);
+ $86 = HEAP32[$85>>2]|0;
+ $87 = ($86|0)==(0);
+ if ($87) {
+ $88 = HEAP32[$14>>2]|0;
+ $89 = (+($88|0));
+ $90 = $7 * $89;
+ $91 = $21 + $90;
+ $92 = $54 + $91;
+ $93 = (~~(($92)));
+ $i$16 = $i$1$ph;$textOffsetX$2 = $93;$textOffsetY$17 = $textOffsetY$04;
+ break;
+ } else {
+ $94 = (+($86|0));
+ $95 = $7 * $94;
+ $96 = $22 + $95;
+ $97 = $54 + $96;
+ $98 = (~~(($97)));
+ $i$16 = $i$1$ph;$textOffsetX$2 = $98;$textOffsetY$17 = $textOffsetY$04;
+ break;
+ }
+ } else {
+ $i$16 = $i$1$ph;$textOffsetX$2 = $textOffsetX$05;$textOffsetY$17 = $textOffsetY$04;
+ }
+ }
+ } while(0);
+ $99 = (($i$16) + 1)|0;
+ $100 = ($99|0)<($2|0);
+ if ($100) {
+ $i$03 = $99;$textOffsetX$05 = $textOffsetX$2;$textOffsetY$04 = $textOffsetY$17;
+ } else {
+ break;
+ }
+ }
+ STACKTOP = sp;return;
+}
+function _DrawFPS($posX,$posY) {
+ $posX = $posX|0;
+ $posY = $posY|0;
+ var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, $buffer = 0, $storemerge = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $$byval_copy = sp;
+ $buffer = sp + 12|0;
+ $0 = sp + 8|0;
+ $1 = HEAP32[5612>>2]|0;
+ $2 = HEAP32[5616>>2]|0;
+ $3 = ($1|0)<($2|0);
+ if ($3) {
+ $4 = (($1) + 1)|0;
+ $storemerge = $4;
+ } else {
+ $5 = (+_GetFPS());
+ HEAPF32[5620>>2] = $5;
+ $6 = (~~(($5)));
+ HEAP32[5616>>2] = $6;
+ $storemerge = 0;
+ }
+ HEAP32[5612>>2] = $storemerge;
+ $7 = +HEAPF32[5620>>2];
+ $8 = $7;
+ HEAPF64[$$byval_copy>>3] = $8;
+ (_sprintf($buffer,11133,$$byval_copy)|0);
+ HEAP8[$0>>0] = 0;
+ $9 = ((($0)) + 1|0);
+ HEAP8[$9>>0] = -98;
+ $10 = ((($0)) + 2|0);
+ HEAP8[$10>>0] = 47;
+ $11 = ((($0)) + 3|0);
+ HEAP8[$11>>0] = -1;
+ ;HEAP8[$$byval_copy>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$0+3>>0]|0;
+ _DrawText($buffer,$posX,$posY,20,$$byval_copy);
+ STACKTOP = sp;return;
+}
+function _DrawGrid($slices,$spacing) {
+ $slices = $slices|0;
+ $spacing = +$spacing;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, $i$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (($slices|0) / 2)&-1;
+ _rlBegin(0);
+ $1 = (0 - ($0))|0;
+ $2 = ($0|0)<($1|0);
+ if ($2) {
+ _rlEnd();
+ return;
+ }
+ $3 = (+($1|0));
+ $4 = $3 * $spacing;
+ $5 = (+($0|0));
+ $6 = $5 * $spacing;
+ $i$01 = $1;
+ while(1) {
+ $7 = ($i$01|0)==(0);
+ if ($7) {
+ _rlColor3f(0.5,0.5,0.5);
+ _rlColor3f(0.5,0.5,0.5);
+ _rlColor3f(0.5,0.5,0.5);
+ _rlColor3f(0.5,0.5,0.5);
+ } else {
+ _rlColor3f(0.75,0.75,0.75);
+ _rlColor3f(0.75,0.75,0.75);
+ _rlColor3f(0.75,0.75,0.75);
+ _rlColor3f(0.75,0.75,0.75);
+ }
+ $8 = (+($i$01|0));
+ $9 = $8 * $spacing;
+ _rlVertex3f($9,0.0,$4);
+ _rlVertex3f($9,0.0,$6);
+ _rlVertex3f($4,0.0,$9);
+ _rlVertex3f($6,0.0,$9);
+ $10 = (($i$01) + 1)|0;
+ $11 = ($i$01|0)<($0|0);
+ if ($11) {
+ $i$01 = $10;
+ } else {
+ break;
+ }
+ }
+ _rlEnd();
+ return;
+}
+function _DrawGizmo($position) {
+ $position = $position|0;
+ var $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlPushMatrix();
+ $0 = +HEAPF32[$position>>2];
+ $1 = ((($position)) + 4|0);
+ $2 = +HEAPF32[$1>>2];
+ $3 = ((($position)) + 8|0);
+ $4 = +HEAPF32[$3>>2];
+ _rlTranslatef($0,$2,$4);
+ _rlScalef(1.0,1.0,1.0);
+ _rlBegin(0);
+ _rlColor3f(1.0,0.0,0.0);
+ _rlVertex3f(0.0,0.0,0.0);
+ _rlColor3f(1.0,0.0,0.0);
+ _rlVertex3f(1.0,0.0,0.0);
+ _rlColor3f(0.0,1.0,0.0);
+ _rlVertex3f(0.0,0.0,0.0);
+ _rlColor3f(0.0,1.0,0.0);
+ _rlVertex3f(0.0,1.0,0.0);
+ _rlColor3f(0.0,0.0,1.0);
+ _rlVertex3f(0.0,0.0,0.0);
+ _rlColor3f(0.0,0.0,1.0);
+ _rlVertex3f(0.0,0.0,1.0);
+ _rlEnd();
+ _rlPopMatrix();
+ return;
+}
+function _LoadModel($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $model = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 528|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $model = sp + 272|0;
+ $0 = sp + 200|0;
+ $1 = sp + 136|0;
+ $2 = sp + 12|0;
+ _memset(($model|0),0,256)|0;
+ $3 = (_GetExtension($fileName)|0);
+ $4 = (_strcmp($3,11143)|0);
+ $5 = ($4|0)==(0);
+ if ($5) {
+ _LoadOBJ($0,$fileName);
+ dest=$model; src=$0; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ } else {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,11147,$vararg_buffer);
+ }
+ $6 = HEAP32[$model>>2]|0;
+ $7 = ($6|0)==(0);
+ if ($7) {
+ _TraceLog(2,11203,$vararg_buffer1);
+ _memcpy(($agg$result|0),($model|0),256)|0;
+ STACKTOP = sp;return;
+ } else {
+ _rlglLoadMesh($model,0);
+ $8 = ((($model)) + 68|0);
+ _MatrixIdentity($1);
+ dest=$8; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $9 = ((($model)) + 132|0);
+ _LoadDefaultMaterial($2);
+ dest=$9; src=$2; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _memcpy(($agg$result|0),($model|0),256)|0;
+ STACKTOP = sp;return;
+ }
+}
+function _LoadDefaultMaterial($agg$result) {
+ $agg$result = $agg$result|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $material$sroa$0 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 176|0;
+ $material$sroa$0 = sp;
+ $0 = sp + 128|0;
+ $1 = sp + 108|0;
+ dest=$material$sroa$0; stop=dest+108|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ _GetDefaultShader($0);
+ dest=$material$sroa$0; src=$0; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _GetDefaultTexture($1);
+ $2 = ((($material$sroa$0)) + 48|0);
+ ;HEAP32[$2>>2]=HEAP32[$1>>2]|0;HEAP32[$2+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$1+16>>2]|0;
+ dest=$agg$result; src=$material$sroa$0; stop=dest+108|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $3 = ((($agg$result)) + 108|0);
+ $4 = ((($agg$result)) + 120|0);
+ ;HEAP32[$3>>2]=4294967295|0;HEAP32[$3+4>>2]=4294967295|0;HEAP32[$3+8>>2]=4294967295|0;
+ HEAPF32[$4>>2] = 100.0;
+ STACKTOP = sp;return;
+}
+function _UnloadModel($model) {
+ $model = $model|0;
+ var $$byval_copy = 0, $0 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0;
+ $$byval_copy = sp + 4|0;
+ $vararg_buffer = sp;
+ _rlglUnloadMesh($model);
+ $0 = ((($model)) + 132|0);
+ dest=$$byval_copy; src=$0; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadMaterial($$byval_copy);
+ _TraceLog(0,11229,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _UnloadMaterial($material) {
+ $material = $material|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($material)) + 48|0);
+ $1 = HEAP32[$0>>2]|0;
+ _rlDeleteTextures($1);
+ $2 = ((($material)) + 68|0);
+ $3 = HEAP32[$2>>2]|0;
+ _rlDeleteTextures($3);
+ $4 = ((($material)) + 88|0);
+ $5 = HEAP32[$4>>2]|0;
+ _rlDeleteTextures($5);
+ return;
+}
+function _DrawModel($model,$position,$scale,$tint) {
+ $model = $model|0;
+ $position = $position|0;
+ $scale = +$scale;
+ $tint = $tint|0;
+ var $0 = 0, $1 = 0, $model$byval_copy = 0, $position$byval_copy = 0, $rotationAxis = 0, $rotationAxis$byval_copy = 0, $tint$byval_copy = 0, $vScale = 0, $vScale$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 320|0;
+ $tint$byval_copy = sp + 316|0;
+ $vScale$byval_copy = sp + 304|0;
+ $rotationAxis$byval_copy = sp + 292|0;
+ $position$byval_copy = sp + 280|0;
+ $model$byval_copy = sp + 24|0;
+ $vScale = sp + 12|0;
+ $rotationAxis = sp;
+ HEAPF32[$vScale>>2] = $scale;
+ $0 = ((($vScale)) + 4|0);
+ HEAPF32[$0>>2] = $scale;
+ $1 = ((($vScale)) + 8|0);
+ HEAPF32[$1>>2] = $scale;
+ ;HEAP32[$rotationAxis>>2]=0|0;HEAP32[$rotationAxis+4>>2]=0|0;HEAP32[$rotationAxis+8>>2]=0|0;
+ _memcpy(($model$byval_copy|0),($model|0),256)|0;
+ ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[$position+8>>2]|0;
+ ;HEAP32[$rotationAxis$byval_copy>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$rotationAxis$byval_copy+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$rotationAxis$byval_copy+8>>2]=HEAP32[$rotationAxis+8>>2]|0;
+ ;HEAP32[$vScale$byval_copy>>2]=HEAP32[$vScale>>2]|0;HEAP32[$vScale$byval_copy+4>>2]=HEAP32[$vScale+4>>2]|0;HEAP32[$vScale$byval_copy+8>>2]=HEAP32[$vScale+8>>2]|0;
+ ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0;
+ _DrawModelEx($model$byval_copy,$position$byval_copy,$rotationAxis$byval_copy,0.0,$vScale$byval_copy,$tint$byval_copy);
+ STACKTOP = sp;return;
+}
+function _DrawModelEx($model,$position,$rotationAxis,$rotationAngle,$scale,$tint) {
+ $model = $model|0;
+ $position = $position|0;
+ $rotationAxis = $rotationAxis|0;
+ $rotationAngle = +$rotationAngle;
+ $scale = $scale|0;
+ $tint = $tint|0;
+ var $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0;
+ var $8 = 0, $9 = 0.0, $matRotation = 0, $matScale = 0, $matTranslation = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 576|0;
+ $$byval_copy3 = sp + 512|0;
+ $$byval_copy2 = sp + 388|0;
+ $$byval_copy1 = sp + 320|0;
+ $matRotation = sp + 128|0;
+ $matScale = sp + 64|0;
+ $matTranslation = sp;
+ $0 = sp + 256|0;
+ $1 = sp + 192|0;
+ $2 = $rotationAngle;
+ $3 = $2 * 0.017453292519943295;
+ $4 = $3;
+ ;HEAP32[$$byval_copy3>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$rotationAxis+8>>2]|0;
+ _MatrixRotate($matRotation,$$byval_copy3,$4);
+ $5 = +HEAPF32[$scale>>2];
+ $6 = ((($scale)) + 4|0);
+ $7 = +HEAPF32[$6>>2];
+ $8 = ((($scale)) + 8|0);
+ $9 = +HEAPF32[$8>>2];
+ _MatrixScale($matScale,$5,$7,$9);
+ $10 = +HEAPF32[$position>>2];
+ $11 = ((($position)) + 4|0);
+ $12 = +HEAPF32[$11>>2];
+ $13 = ((($position)) + 8|0);
+ $14 = +HEAPF32[$13>>2];
+ _MatrixTranslate($matTranslation,$10,$12,$14);
+ $15 = ((($model)) + 68|0);
+ dest=$$byval_copy2; src=$matScale; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy3; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$$byval_copy2,$$byval_copy3);
+ dest=$$byval_copy2; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy3; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($1,$$byval_copy2,$$byval_copy3);
+ dest=$15; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $16 = ((($model)) + 132|0);
+ $17 = ((($model)) + 240|0);
+ $18 = HEAPU8[$tint>>0]|(HEAPU8[$tint+1>>0]<<8)|(HEAPU8[$tint+2>>0]<<16)|(HEAPU8[$tint+3>>0]<<24);
+ HEAP32[$17>>2] = $18;
+ dest=$$byval_copy1; src=$model; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy2; src=$16; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _rlglDrawMesh($$byval_copy1,$$byval_copy2,$$byval_copy3);
+ STACKTOP = sp;return;
+}
+function _TraceLog($msgType,$text,$varargs) {
+ $msgType = $msgType|0;
+ $text = $text|0;
+ $varargs = $varargs|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $args = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $args = sp;
+ switch ($msgType|0) {
+ case 0: {
+ $0 = HEAP32[6676>>2]|0;
+ (_fwrite(11267,6,1,$0)|0);
+ break;
+ }
+ case 1: {
+ $1 = HEAP32[6676>>2]|0;
+ (_fwrite(11274,7,1,$1)|0);
+ break;
+ }
+ case 2: {
+ $2 = HEAP32[6676>>2]|0;
+ (_fwrite(11282,9,1,$2)|0);
+ break;
+ }
+ case 3: {
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ }
+ }
+ HEAP32[$args>>2] = $varargs;
+ $3 = HEAP32[6676>>2]|0;
+ (_vfprintf($3,$text,$args)|0);
+ $4 = HEAP32[6676>>2]|0;
+ (_fputc(10,$4)|0);
+ $5 = ($msgType|0)==(1);
+ if ($5) {
+ _exit(1);
+ // unreachable;
+ } else {
+ STACKTOP = sp;return;
+ }
+}
+function _GetExtension($fileName) {
+ $fileName = $fileName|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_strrchr($fileName,46)|0);
+ $1 = ($0|0)==(0|0);
+ $2 = ($0|0)==($fileName|0);
+ $or$cond = $1 | $2;
+ $3 = ((($0)) + 1|0);
+ $$0 = $or$cond ? 12661 : $3;
+ return ($$0|0);
+}
+function _ProcessGestureEvent($event) {
+ $event = $event|0;
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
+ var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
+ var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0.0, $183 = 0, $184 = 0.0, $185 = 0, $186 = 0.0, $187 = 0.0, $188 = 0.0;
+ var $189 = 0, $19 = 0, $190 = 0.0, $191 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0.0, $98 = 0, $99 = 0.0, $moveDownPosition$byval_copy11 = 0, $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $moveDownPosition2$byval_copy12 = sp + 8|0;
+ $moveDownPosition$byval_copy11 = sp;
+ $0 = ((($event)) + 4|0);
+ $1 = HEAP32[$0>>2]|0;
+ HEAP32[5628>>2] = $1;
+ $2 = ($1|0)<(2);
+ $3 = HEAP32[$event>>2]|0;
+ $4 = ($3|0)==(1);
+ if (!($2)) {
+ if ($4) {
+ $105 = ((($event)) + 16|0);
+ $106 = $105;
+ $107 = $106;
+ $108 = HEAP32[$107>>2]|0;
+ $109 = (($106) + 4)|0;
+ $110 = $109;
+ $111 = HEAP32[$110>>2]|0;
+ $112 = 80;
+ $113 = $112;
+ HEAP32[$113>>2] = $108;
+ $114 = (($112) + 4)|0;
+ $115 = $114;
+ HEAP32[$115>>2] = $111;
+ $116 = ((($event)) + 24|0);
+ $117 = $116;
+ $118 = $117;
+ $119 = HEAP32[$118>>2]|0;
+ $120 = (($117) + 4)|0;
+ $121 = $120;
+ $122 = HEAP32[$121>>2]|0;
+ $123 = 120;
+ $124 = $123;
+ HEAP32[$124>>2] = $119;
+ $125 = (($123) + 4)|0;
+ $126 = $125;
+ HEAP32[$126>>2] = $122;
+ $127 = +HEAPF32[120>>2];
+ $128 = +HEAPF32[80>>2];
+ $129 = $127 - $128;
+ HEAPF32[128>>2] = $129;
+ $130 = +HEAPF32[(124)>>2];
+ $131 = +HEAPF32[(84)>>2];
+ $132 = $130 - $131;
+ HEAPF32[(132)>>2] = $132;
+ HEAP32[5624>>2] = 4;
+ STACKTOP = sp;return;
+ }
+ switch ($3|0) {
+ case 2: {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
+ $133 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ HEAPF32[5656>>2] = $133;
+ $134 = 112;
+ $135 = $134;
+ $136 = HEAP32[$135>>2]|0;
+ $137 = (($134) + 4)|0;
+ $138 = $137;
+ $139 = HEAP32[$138>>2]|0;
+ $140 = 80;
+ $141 = $140;
+ HEAP32[$141>>2] = $136;
+ $142 = (($140) + 4)|0;
+ $143 = $142;
+ HEAP32[$143>>2] = $139;
+ $144 = 136;
+ $145 = $144;
+ $146 = HEAP32[$145>>2]|0;
+ $147 = (($144) + 4)|0;
+ $148 = $147;
+ $149 = HEAP32[$148>>2]|0;
+ $150 = 120;
+ $151 = $150;
+ HEAP32[$151>>2] = $146;
+ $152 = (($150) + 4)|0;
+ $153 = $152;
+ HEAP32[$153>>2] = $149;
+ $154 = ((($event)) + 16|0);
+ $155 = $154;
+ $156 = $155;
+ $157 = HEAP32[$156>>2]|0;
+ $158 = (($155) + 4)|0;
+ $159 = $158;
+ $160 = HEAP32[$159>>2]|0;
+ $161 = 112;
+ $162 = $161;
+ HEAP32[$162>>2] = $157;
+ $163 = (($161) + 4)|0;
+ $164 = $163;
+ HEAP32[$164>>2] = $160;
+ $165 = ((($event)) + 24|0);
+ $166 = $165;
+ $167 = $166;
+ $168 = HEAP32[$167>>2]|0;
+ $169 = (($166) + 4)|0;
+ $170 = $169;
+ $171 = HEAP32[$170>>2]|0;
+ $172 = 136;
+ $173 = $172;
+ HEAP32[$173>>2] = $168;
+ $174 = (($172) + 4)|0;
+ $175 = $174;
+ HEAP32[$175>>2] = $171;
+ $176 = +HEAPF32[136>>2];
+ $177 = +HEAPF32[112>>2];
+ $178 = $176 - $177;
+ HEAPF32[128>>2] = $178;
+ $179 = +HEAPF32[(140)>>2];
+ $180 = +HEAPF32[(116)>>2];
+ $181 = $179 - $180;
+ HEAPF32[(132)>>2] = $181;
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0;
+ $182 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $183 = !($182 >= 0.004999999888241291);
+ if ($183) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[120>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[120+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
+ $184 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $185 = !($184 >= 0.004999999888241291);
+ if ($185) {
+ HEAP32[5624>>2] = 4;
+ } else {
+ label = 37;
+ }
+ } else {
+ label = 37;
+ }
+ do {
+ if ((label|0) == 37) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
+ $186 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $187 = +HEAPF32[5656>>2];
+ $188 = $186 - $187;
+ $189 = $188 < 0.0;
+ if ($189) {
+ HEAP32[5624>>2] = 256;
+ break;
+ } else {
+ HEAP32[5624>>2] = 512;
+ break;
+ }
+ }
+ } while(0);
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0;
+ $190 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $191 = 360.0 - $190;
+ HEAPF32[5660>>2] = $191;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 0: {
+ HEAPF32[5656>>2] = 0.0;
+ HEAPF32[5660>>2] = 0.0;
+ HEAPF32[128>>2] = 0.0;
+ HEAPF32[(132)>>2] = 0.0;
+ HEAP32[5628>>2] = 0;
+ HEAP32[5624>>2] = 0;
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+ }
+ if ($4) {
+ $5 = HEAP32[5632>>2]|0;
+ $6 = (($5) + 1)|0;
+ HEAP32[5632>>2] = $6;
+ $7 = HEAP32[5624>>2]|0;
+ $8 = ($7|0)==(0);
+ $9 = ($5|0)>(0);
+ $or$cond = $9 & $8;
+ if ($or$cond) {
+ $10 = ((($event)) + 16|0);
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$10>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$10+4>>2]|0;
+ $11 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $12 = $11 < 0.029999999329447746;
+ if ($12) {
+ HEAP32[5624>>2] = 2;
+ HEAP32[5632>>2] = 0;
+ } else {
+ label = 6;
+ }
+ } else {
+ label = 6;
+ }
+ if ((label|0) == 6) {
+ HEAP32[5632>>2] = 1;
+ HEAP32[5624>>2] = 1;
+ }
+ $13 = ((($event)) + 16|0);
+ $14 = $13;
+ $15 = $14;
+ $16 = HEAP32[$15>>2]|0;
+ $17 = (($14) + 4)|0;
+ $18 = $17;
+ $19 = HEAP32[$18>>2]|0;
+ $20 = 80;
+ $21 = $20;
+ HEAP32[$21>>2] = $16;
+ $22 = (($20) + 4)|0;
+ $23 = $22;
+ HEAP32[$23>>2] = $19;
+ $24 = $13;
+ $25 = $24;
+ $26 = HEAP32[$25>>2]|0;
+ $27 = (($24) + 4)|0;
+ $28 = $27;
+ $29 = HEAP32[$28>>2]|0;
+ $30 = 88;
+ $31 = $30;
+ HEAP32[$31>>2] = $26;
+ $32 = (($30) + 4)|0;
+ $33 = $32;
+ HEAP32[$33>>2] = $29;
+ $34 = 96;
+ $35 = $34;
+ HEAP32[$35>>2] = $16;
+ $36 = (($34) + 4)|0;
+ $37 = $36;
+ HEAP32[$37>>2] = $19;
+ $38 = ((($event)) + 8|0);
+ $39 = HEAP32[$38>>2]|0;
+ HEAP32[5636>>2] = $39;
+ HEAPF32[104>>2] = 0.0;
+ HEAPF32[(108)>>2] = 0.0;
+ STACKTOP = sp;return;
+ }
+ switch ($3|0) {
+ case 0: {
+ $40 = HEAP32[5624>>2]|0;
+ $41 = ($40|0)==(8);
+ if ($41) {
+ $42 = ((($event)) + 16|0);
+ $43 = $42;
+ $44 = $43;
+ $45 = HEAP32[$44>>2]|0;
+ $46 = (($43) + 4)|0;
+ $47 = $46;
+ $48 = HEAP32[$47>>2]|0;
+ $49 = 96;
+ $50 = $49;
+ HEAP32[$50>>2] = $45;
+ $51 = (($49) + 4)|0;
+ $52 = $51;
+ HEAP32[$52>>2] = $48;
+ }
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0;
+ $53 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $54 = $53 / 0.0;
+ HEAPF32[5640>>2] = $54;
+ HEAP32[5644>>2] = 0;
+ $55 = $54 > 5.0000002374872565E-4;
+ do {
+ if ($55) {
+ $56 = HEAP32[5636>>2]|0;
+ $57 = ((($event)) + 8|0);
+ $58 = HEAP32[$57>>2]|0;
+ $59 = ($56|0)==($58|0);
+ if ($59) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0;
+ $60 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $61 = 360.0 - $60;
+ HEAPF32[5648>>2] = $61;
+ $62 = $61 < 30.0;
+ $63 = $61 > 330.0;
+ $or$cond3 = $62 | $63;
+ if ($or$cond3) {
+ HEAP32[5624>>2] = 16;
+ break;
+ }
+ $64 = $61 > 30.0;
+ $65 = $61 < 120.0;
+ $or$cond5 = $64 & $65;
+ if ($or$cond5) {
+ HEAP32[5624>>2] = 64;
+ break;
+ }
+ $66 = $61 > 120.0;
+ $67 = $61 < 210.0;
+ $or$cond7 = $66 & $67;
+ if ($or$cond7) {
+ HEAP32[5624>>2] = 32;
+ break;
+ }
+ $68 = $61 > 210.0;
+ $69 = $61 < 300.0;
+ $or$cond9 = $68 & $69;
+ if ($or$cond9) {
+ HEAP32[5624>>2] = 128;
+ break;
+ } else {
+ HEAP32[5624>>2] = 0;
+ break;
+ }
+ } else {
+ label = 22;
+ }
+ } else {
+ label = 22;
+ }
+ } while(0);
+ if ((label|0) == 22) {
+ HEAPF32[5640>>2] = 0.0;
+ HEAPF32[5648>>2] = 0.0;
+ HEAP32[5624>>2] = 0;
+ }
+ HEAPF32[88>>2] = 0.0;
+ HEAPF32[(92)>>2] = 0.0;
+ HEAP32[5628>>2] = 0;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 2: {
+ $70 = HEAP32[5644>>2]|0;
+ $71 = ($70|0)==(0);
+ if ($71) {
+ HEAP32[5644>>2] = 1;
+ }
+ $72 = ((($event)) + 16|0);
+ $73 = $72;
+ $74 = $73;
+ $75 = HEAP32[$74>>2]|0;
+ $76 = (($73) + 4)|0;
+ $77 = $76;
+ $78 = HEAP32[$77>>2]|0;
+ $79 = 112;
+ $80 = $79;
+ HEAP32[$80>>2] = $75;
+ $81 = (($79) + 4)|0;
+ $82 = $81;
+ HEAP32[$82>>2] = $78;
+ $83 = HEAP32[5624>>2]|0;
+ $84 = ($83|0)==(4);
+ if ($84) {
+ $85 = HEAP32[5652>>2]|0;
+ $86 = ($85|0)==(1);
+ if ($86) {
+ $87 = $72;
+ $88 = $87;
+ $89 = HEAP32[$88>>2]|0;
+ $90 = (($87) + 4)|0;
+ $91 = $90;
+ $92 = HEAP32[$91>>2]|0;
+ $93 = 80;
+ $94 = $93;
+ HEAP32[$94>>2] = $89;
+ $95 = (($93) + 4)|0;
+ $96 = $95;
+ HEAP32[$96>>2] = $92;
+ }
+ HEAP32[5652>>2] = 2;
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0;
+ $97 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $98 = !($97 >= 0.014999999664723873);
+ if (!($98)) {
+ HEAP32[5624>>2] = 8;
+ }
+ }
+ $99 = +HEAPF32[112>>2];
+ $100 = +HEAPF32[88>>2];
+ $101 = $99 - $100;
+ HEAPF32[104>>2] = $101;
+ $102 = +HEAPF32[(116)>>2];
+ $103 = +HEAPF32[(92)>>2];
+ $104 = $102 - $103;
+ HEAPF32[(108)>>2] = $104;
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+}
+function _UpdateGestures() {
+ var $$off = 0, $$pr = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5624>>2]|0;
+ $$off = (($0) + -1)|0;
+ $1 = ($$off>>>0)<(2);
+ $2 = HEAP32[5628>>2]|0;
+ $3 = ($2|0)<(2);
+ $or$cond3 = $1 & $3;
+ if ($or$cond3) {
+ HEAP32[5624>>2] = 4;
+ return;
+ }
+ $$pr = HEAP32[5624>>2]|0;
+ switch ($$pr|0) {
+ case 16: case 32: case 64: case 128: {
+ break;
+ }
+ default: {
+ return;
+ }
+ }
+ HEAP32[5624>>2] = 0;
+ return;
+}
+function _InitGraphicsDevice($width,$height) {
+ $width = $width|0;
+ $height = $height|0;
+ var $$byval_copy = 0, $$lcssa = 0, $$lcssa12 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
+ var $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $count = 0, $i$02 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer3 = 0, $vararg_buffer6 = 0;
+ var $vararg_buffer8 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0;
+ $$byval_copy = sp + 140|0;
+ $vararg_buffer22 = sp + 64|0;
+ $vararg_buffer18 = sp + 56|0;
+ $vararg_buffer14 = sp + 48|0;
+ $vararg_buffer10 = sp + 40|0;
+ $vararg_buffer8 = sp + 32|0;
+ $vararg_buffer6 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $0 = sp + 72|0;
+ $count = sp + 68|0;
+ $1 = sp + 136|0;
+ HEAP32[492>>2] = $width;
+ HEAP32[496>>2] = $height;
+ _MatrixIdentity($0);
+ dest=512; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ (_glfwSetErrorCallback((2|0))|0);
+ $2 = (_glfwInit()|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ _TraceLog(1,17116,$vararg_buffer);
+ }
+ $4 = HEAP32[492>>2]|0;
+ HEAP32[656>>2] = $4;
+ $5 = HEAP32[496>>2]|0;
+ HEAP32[660>>2] = $5;
+ _glfwDefaultWindowHints();
+ _glfwWindowHint(131075,0);
+ $6 = HEAP8[7695>>0]|0;
+ $7 = $6 & 16;
+ $8 = ($7<<24>>24)==(0);
+ if (!($8)) {
+ _glfwWindowHint(135181,4);
+ _TraceLog(0,17142,$vararg_buffer1);
+ }
+ $9 = (_rlGetVersion()|0);
+ $10 = ($9|0)==(2);
+ if ($10) {
+ _glfwWindowHint(139266,2);
+ _glfwWindowHint(139267,1);
+ } else {
+ $11 = (_rlGetVersion()|0);
+ $12 = ($11|0)==(3);
+ if ($12) {
+ _glfwWindowHint(139266,3);
+ _glfwWindowHint(139267,3);
+ _glfwWindowHint(139272,204801);
+ _glfwWindowHint(139270,0);
+ }
+ }
+ $13 = HEAP32[640>>2]|0;
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $40 = HEAP32[492>>2]|0;
+ $41 = HEAP32[496>>2]|0;
+ $42 = HEAP32[488>>2]|0;
+ $43 = (_glfwCreateWindow(($40|0),($41|0),($42|0),(0|0),(0|0))|0);
+ HEAP32[504>>2] = $43;
+ $44 = HEAP32[492>>2]|0;
+ HEAP32[672>>2] = $44;
+ $45 = HEAP32[496>>2]|0;
+ HEAP32[676>>2] = $45;
+ $46 = $43;
+ } else {
+ $15 = (_glfwGetPrimaryMonitor()|0);
+ $16 = (_glfwGetVideoModes(($15|0),($count|0))|0);
+ $17 = HEAP32[$count>>2]|0;
+ $18 = ($17|0)>(0);
+ L15: do {
+ if ($18) {
+ $19 = HEAP32[492>>2]|0;
+ $20 = HEAP32[$count>>2]|0;
+ $21 = HEAP32[496>>2]|0;
+ $i$02 = 0;
+ while(1) {
+ $22 = (($16) + (($i$02*24)|0)|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = ($23|0)<($19|0);
+ if (!($24)) {
+ $25 = (((($16) + (($i$02*24)|0)|0)) + 4|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($26|0)<($21|0);
+ if (!($27)) {
+ $$lcssa = $23;$$lcssa12 = $25;
+ break;
+ }
+ }
+ $29 = (($i$02) + 1)|0;
+ $30 = ($29|0)<($20|0);
+ if ($30) {
+ $i$02 = $29;
+ } else {
+ break L15;
+ }
+ }
+ HEAP32[656>>2] = $$lcssa;
+ $28 = HEAP32[$$lcssa12>>2]|0;
+ HEAP32[660>>2] = $28;
+ }
+ } while(0);
+ $31 = HEAP32[656>>2]|0;
+ $32 = HEAP32[660>>2]|0;
+ HEAP32[$vararg_buffer3>>2] = $31;
+ $vararg_ptr5 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr5>>2] = $32;
+ _TraceLog(2,17167,$vararg_buffer3);
+ $33 = HEAP32[656>>2]|0;
+ $34 = HEAP32[660>>2]|0;
+ _SetupFramebufferSize($33,$34);
+ $35 = HEAP32[656>>2]|0;
+ $36 = HEAP32[660>>2]|0;
+ $37 = HEAP32[488>>2]|0;
+ $38 = (_glfwGetPrimaryMonitor()|0);
+ $39 = (_glfwCreateWindow(($35|0),($36|0),($37|0),($38|0),(0|0))|0);
+ HEAP32[504>>2] = $39;
+ $46 = $39;
+ }
+ $47 = ($46|0)==(0|0);
+ if ($47) {
+ _glfwTerminate();
+ _TraceLog(1,17205,$vararg_buffer6);
+ } else {
+ _TraceLog(0,17238,$vararg_buffer8);
+ $48 = HEAP32[672>>2]|0;
+ $49 = HEAP32[676>>2]|0;
+ HEAP32[$vararg_buffer10>>2] = $48;
+ $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $49;
+ _TraceLog(0,17278,$vararg_buffer10);
+ $50 = HEAP32[492>>2]|0;
+ $51 = HEAP32[496>>2]|0;
+ HEAP32[$vararg_buffer14>>2] = $50;
+ $vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
+ HEAP32[$vararg_ptr17>>2] = $51;
+ _TraceLog(0,17299,$vararg_buffer14);
+ $52 = HEAP32[664>>2]|0;
+ $53 = HEAP32[668>>2]|0;
+ HEAP32[$vararg_buffer18>>2] = $52;
+ $vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
+ HEAP32[$vararg_ptr21>>2] = $53;
+ _TraceLog(0,17320,$vararg_buffer18);
+ }
+ $54 = HEAP32[504>>2]|0;
+ (_glfwSetWindowSizeCallback(($54|0),(1|0))|0);
+ $55 = HEAP32[504>>2]|0;
+ (_glfwSetCursorEnterCallback(($55|0),(3|0))|0);
+ $56 = HEAP32[504>>2]|0;
+ (_glfwSetKeyCallback(($56|0),(1|0))|0);
+ $57 = HEAP32[504>>2]|0;
+ (_glfwSetMouseButtonCallback(($57|0),(1|0))|0);
+ $58 = HEAP32[504>>2]|0;
+ (_glfwSetCursorPosCallback(($58|0),(1|0))|0);
+ $59 = HEAP32[504>>2]|0;
+ (_glfwSetCharCallback(($59|0),(4|0))|0);
+ $60 = HEAP32[504>>2]|0;
+ (_glfwSetScrollCallback(($60|0),(2|0))|0);
+ $61 = HEAP32[504>>2]|0;
+ (_glfwSetWindowIconifyCallback(($61|0),(5|0))|0);
+ $62 = HEAP32[504>>2]|0;
+ _glfwMakeContextCurrent(($62|0));
+ _glfwSwapInterval(0);
+ $63 = HEAP8[7695>>0]|0;
+ $64 = $63 & 32;
+ $65 = ($64<<24>>24)==(0);
+ if ($65) {
+ $66 = HEAP32[492>>2]|0;
+ $67 = HEAP32[496>>2]|0;
+ _rlglInit($66,$67);
+ $68 = HEAP32[664>>2]|0;
+ $69 = (($68|0) / 2)&-1;
+ $70 = HEAP32[668>>2]|0;
+ $71 = (($70|0) / 2)&-1;
+ $72 = HEAP32[672>>2]|0;
+ $73 = (($72) - ($68))|0;
+ $74 = HEAP32[676>>2]|0;
+ $75 = (($74) - ($70))|0;
+ _rlViewport($69,$71,$73,$75);
+ _rlMatrixMode(0);
+ _rlLoadIdentity();
+ $76 = HEAP32[672>>2]|0;
+ $77 = HEAP32[664>>2]|0;
+ $78 = (($76) - ($77))|0;
+ $79 = (+($78|0));
+ $80 = HEAP32[676>>2]|0;
+ $81 = HEAP32[668>>2]|0;
+ $82 = (($80) - ($81))|0;
+ $83 = (+($82|0));
+ _rlOrtho(0.0,$79,$83,0.0,0.0,1.0);
+ _rlMatrixMode(1);
+ _rlLoadIdentity();
+ HEAP8[$1>>0] = -11;
+ $84 = ((($1)) + 1|0);
+ HEAP8[$84>>0] = -11;
+ $85 = ((($1)) + 2|0);
+ HEAP8[$85>>0] = -11;
+ $86 = ((($1)) + 3|0);
+ HEAP8[$86>>0] = -1;
+ ;HEAP8[$$byval_copy>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$1+3>>0]|0;
+ _ClearBackground($$byval_copy);
+ STACKTOP = sp;return;
+ }
+ _glfwSwapInterval(1);
+ _TraceLog(0,17345,$vararg_buffer22);
+ $66 = HEAP32[492>>2]|0;
+ $67 = HEAP32[496>>2]|0;
+ _rlglInit($66,$67);
+ $68 = HEAP32[664>>2]|0;
+ $69 = (($68|0) / 2)&-1;
+ $70 = HEAP32[668>>2]|0;
+ $71 = (($70|0) / 2)&-1;
+ $72 = HEAP32[672>>2]|0;
+ $73 = (($72) - ($68))|0;
+ $74 = HEAP32[676>>2]|0;
+ $75 = (($74) - ($70))|0;
+ _rlViewport($69,$71,$73,$75);
+ _rlMatrixMode(0);
+ _rlLoadIdentity();
+ $76 = HEAP32[672>>2]|0;
+ $77 = HEAP32[664>>2]|0;
+ $78 = (($76) - ($77))|0;
+ $79 = (+($78|0));
+ $80 = HEAP32[676>>2]|0;
+ $81 = HEAP32[668>>2]|0;
+ $82 = (($80) - ($81))|0;
+ $83 = (+($82|0));
+ _rlOrtho(0.0,$79,$83,0.0,0.0,1.0);
+ _rlMatrixMode(1);
+ _rlLoadIdentity();
+ HEAP8[$1>>0] = -11;
+ $84 = ((($1)) + 1|0);
+ HEAP8[$84>>0] = -11;
+ $85 = ((($1)) + 2|0);
+ HEAP8[$85>>0] = -11;
+ $86 = ((($1)) + 3|0);
+ HEAP8[$86>>0] = -1;
+ ;HEAP8[$$byval_copy>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$1+3>>0]|0;
+ _ClearBackground($$byval_copy);
+ STACKTOP = sp;return;
+}
+function _InitTimer() {
+ var $0 = 0, $1 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_time((0|0))|0);
+ _srand($0);
+ $1 = (+_GetTime());
+ HEAPF64[32>>3] = $1;
+ return;
+}
+function _EmscriptenFullscreenChangeCallback($eventType,$e,$userData) {
+ $eventType = $eventType|0;
+ $e = $e|0;
+ $userData = $userData|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer = sp;
+ $0 = HEAP32[$e>>2]|0;
+ $1 = ($0|0)==(0);
+ $2 = ((($e)) + 264|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($e)) + 268|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ((($e)) + 272|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($e)) + 276|0);
+ $9 = HEAP32[$8>>2]|0;
+ if ($1) {
+ HEAP32[$vararg_buffer4>>2] = $3;
+ $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
+ HEAP32[$vararg_ptr7>>2] = $5;
+ $vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
+ HEAP32[$vararg_ptr8>>2] = $7;
+ $vararg_ptr9 = ((($vararg_buffer4)) + 12|0);
+ HEAP32[$vararg_ptr9>>2] = $9;
+ _TraceLog(0,17049,$vararg_buffer4);
+ STACKTOP = sp;return 0;
+ } else {
+ HEAP32[$vararg_buffer>>2] = $3;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $5;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $7;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $9;
+ _TraceLog(0,16980,$vararg_buffer);
+ STACKTOP = sp;return 0;
+ }
+ return (0)|0;
+}
+function _EmscriptenInputCallback($eventType,$touchEvent,$userData) {
+ $eventType = $eventType|0;
+ $touchEvent = $touchEvent|0;
+ $userData = $userData|0;
+ var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $7 = 0;
+ var $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $gestureEvent$byval_copy = sp + 32|0;
+ $gestureEvent = sp;
+ switch ($eventType|0) {
+ case 22: {
+ HEAP32[$gestureEvent>>2] = 1;
+ break;
+ }
+ case 23: {
+ HEAP32[$gestureEvent>>2] = 0;
+ break;
+ }
+ case 24: {
+ HEAP32[$gestureEvent>>2] = 2;
+ break;
+ }
+ default: {
+ }
+ }
+ $0 = HEAP32[$touchEvent>>2]|0;
+ $1 = ((($gestureEvent)) + 4|0);
+ HEAP32[$1>>2] = $0;
+ $2 = ((($touchEvent)) + 20|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($gestureEvent)) + 8|0);
+ HEAP32[$4>>2] = $3;
+ $5 = ((($touchEvent)) + 72|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($gestureEvent)) + 12|0);
+ HEAP32[$7>>2] = $6;
+ $8 = ((($touchEvent)) + 56|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = (+($9|0));
+ $11 = ((($touchEvent)) + 60|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = (+($12|0));
+ $14 = ((($gestureEvent)) + 16|0);
+ HEAPF32[$14>>2] = $10;
+ $15 = ((($gestureEvent)) + 20|0);
+ HEAPF32[$15>>2] = $13;
+ $16 = ((($touchEvent)) + 108|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (+($17|0));
+ $19 = ((($touchEvent)) + 112|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = (+($20|0));
+ $22 = ((($gestureEvent)) + 24|0);
+ HEAPF32[$22>>2] = $18;
+ $23 = ((($gestureEvent)) + 28|0);
+ HEAPF32[$23>>2] = $21;
+ $24 = ((($gestureEvent)) + 16|0);
+ $25 = $24;
+ $26 = $25;
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (($25) + 4)|0;
+ $29 = $28;
+ $30 = HEAP32[$29>>2]|0;
+ $31 = 64;
+ $32 = $31;
+ HEAP32[$32>>2] = $27;
+ $33 = (($31) + 4)|0;
+ $34 = $33;
+ HEAP32[$34>>2] = $30;
+ $35 = ((($gestureEvent)) + 24|0);
+ $36 = $35;
+ $37 = $36;
+ $38 = HEAP32[$37>>2]|0;
+ $39 = (($36) + 4)|0;
+ $40 = $39;
+ $41 = HEAP32[$40>>2]|0;
+ $42 = (72);
+ $43 = $42;
+ HEAP32[$43>>2] = $38;
+ $44 = (($42) + 4)|0;
+ $45 = $44;
+ HEAP32[$45>>2] = $41;
+ $46 = (_GetScreenWidth()|0);
+ $47 = (+($46|0));
+ $48 = +HEAPF32[$24>>2];
+ $49 = $48 / $47;
+ HEAPF32[$24>>2] = $49;
+ $50 = (_GetScreenHeight()|0);
+ $51 = (+($50|0));
+ $52 = +HEAPF32[$15>>2];
+ $53 = $52 / $51;
+ HEAPF32[$15>>2] = $53;
+ $54 = (_GetScreenWidth()|0);
+ $55 = (+($54|0));
+ $56 = +HEAPF32[$35>>2];
+ $57 = $56 / $55;
+ HEAPF32[$35>>2] = $57;
+ $58 = (_GetScreenHeight()|0);
+ $59 = (+($58|0));
+ $60 = +HEAPF32[$23>>2];
+ $61 = $60 / $59;
+ HEAPF32[$23>>2] = $61;
+ ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0;
+ _ProcessGestureEvent($gestureEvent$byval_copy);
+ STACKTOP = sp;return 1;
+}
+function _LogoAnimation() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[500>>2] = 0;
+ return;
+}
+function _GetTime() {
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_glfwGetTime());
+ return (+$0);
+}
+function _SwapBuffers() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[504>>2]|0;
+ _glfwSwapBuffers(($0|0));
+ return;
+}
+function _PollInputEvents() {
+ var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $mouseX = 0, $mouseY = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $mouseX = sp + 8|0;
+ $mouseY = sp;
+ _UpdateGestures();
+ $0 = HEAP32[504>>2]|0;
+ _glfwGetCursorPos(($0|0),($mouseX|0),($mouseY|0));
+ $1 = +HEAPF64[$mouseX>>3];
+ $2 = $1;
+ HEAPF32[8>>2] = $2;
+ $3 = +HEAPF64[$mouseY>>3];
+ $4 = $3;
+ HEAPF32[(12)>>2] = $4;
+ HEAP32[644>>2] = -1;
+ _memcpy((8208|0),(7696|0),512)|0;
+ ;HEAP8[8723>>0]=HEAP8[8720>>0]|0;HEAP8[8723+1>>0]=HEAP8[8720+1>>0]|0;HEAP8[8723+2>>0]=HEAP8[8720+2>>0]|0;
+ $5 = HEAP32[6424>>2]|0;
+ HEAP32[652>>2] = $5;
+ HEAP32[6424>>2] = 0;
+ _glfwPollEvents();
+ STACKTOP = sp;return;
+}
+function _LoadDefaultShader($agg$result) {
+ $agg$result = $agg$result|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $fDefaultShaderStr = 0, $shader = 0, $vDefaultShaderStr = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1008|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $shader = sp + 16|0;
+ $vDefaultShaderStr = sp + 505|0;
+ $fDefaultShaderStr = sp + 64|0;
+ _memcpy(($vDefaultShaderStr|0),(15954|0),489)|0;
+ _memcpy(($fDefaultShaderStr|0),(16443|0),441)|0;
+ $0 = (_LoadShaderProgram($vDefaultShaderStr,$fDefaultShaderStr)|0);
+ HEAP32[$shader>>2] = $0;
+ $1 = ($0|0)==(0);
+ if ($1) {
+ HEAP32[$vararg_buffer1>>2] = $0;
+ _TraceLog(2,16932,$vararg_buffer1);
+ } else {
+ HEAP32[$vararg_buffer>>2] = $0;
+ _TraceLog(0,16884,$vararg_buffer);
+ }
+ $2 = HEAP32[$shader>>2]|0;
+ $3 = ($2|0)==(0);
+ if (!($3)) {
+ _LoadDefaultShaderLocations($shader);
+ }
+ dest=$agg$result; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _LoadDefaultBuffers() {
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
+ var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
+ var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
+ var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
+ var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond14 = 0, $exitcond17 = 0, $exitcond19 = 0, $i1$012 = 0, $i3$010 = 0, $i6$07 = 0, $i7$06 = 0, $k$05 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0;
+ var $vararg_buffer14 = 0, $vararg_buffer17 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $vararg_buffer17 = sp + 48|0;
+ $vararg_buffer14 = sp + 40|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $0 = (_malloc(24576)|0);
+ HEAP32[(1872)>>2] = $0;
+ $1 = (_malloc(8192)|0);
+ HEAP32[(1880)>>2] = $1;
+ HEAP32[(1876)>>2] = 0;
+ HEAP32[(1884)>>2] = 0;
+ $2 = HEAP32[(1872)>>2]|0;
+ _memset(($2|0),0,24576)|0;
+ $i1$012 = 0;
+ while(1) {
+ $3 = HEAP32[(1880)>>2]|0;
+ $4 = (($3) + ($i1$012)|0);
+ HEAP8[$4>>0] = 0;
+ $5 = (($i1$012) + 1)|0;
+ $exitcond19 = ($5|0)==(8192);
+ if ($exitcond19) {
+ break;
+ } else {
+ $i1$012 = $5;
+ }
+ }
+ HEAP32[1860>>2] = 0;
+ HEAP32[(1868)>>2] = 0;
+ HEAP32[(1864)>>2] = 0;
+ $6 = (_malloc(73728)|0);
+ HEAP32[(1920)>>2] = $6;
+ $7 = (_malloc(24576)|0);
+ HEAP32[(1928)>>2] = $7;
+ HEAP32[(1924)>>2] = 0;
+ HEAP32[(1932)>>2] = 0;
+ $8 = HEAP32[(1920)>>2]|0;
+ _memset(($8|0),0,73728)|0;
+ $i3$010 = 0;
+ while(1) {
+ $9 = HEAP32[(1928)>>2]|0;
+ $10 = (($9) + ($i3$010)|0);
+ HEAP8[$10>>0] = 0;
+ $11 = (($i3$010) + 1)|0;
+ $exitcond17 = ($11|0)==(24576);
+ if ($exitcond17) {
+ break;
+ } else {
+ $i3$010 = $11;
+ }
+ }
+ HEAP32[1908>>2] = 0;
+ HEAP32[(1916)>>2] = 0;
+ HEAP32[(1912)>>2] = 0;
+ $12 = (_malloc(49152)|0);
+ HEAP32[(1968)>>2] = $12;
+ $13 = (_malloc(32768)|0);
+ HEAP32[(1972)>>2] = $13;
+ $14 = (_malloc(16384)|0);
+ HEAP32[(1976)>>2] = $14;
+ $15 = (_malloc(12288)|0);
+ HEAP32[(1980)>>2] = $15;
+ $16 = HEAP32[(1968)>>2]|0;
+ _memset(($16|0),0,49152)|0;
+ $17 = HEAP32[(1972)>>2]|0;
+ _memset(($17|0),0,32768)|0;
+ $i6$07 = 0;
+ while(1) {
+ $19 = HEAP32[(1976)>>2]|0;
+ $20 = (($19) + ($i6$07)|0);
+ HEAP8[$20>>0] = 0;
+ $21 = (($i6$07) + 1)|0;
+ $exitcond14 = ($21|0)==(16384);
+ if ($exitcond14) {
+ break;
+ } else {
+ $i6$07 = $21;
+ }
+ }
+ $18 = HEAP32[(1980)>>2]|0;
+ $i7$06 = 0;$k$05 = 0;
+ while(1) {
+ $22 = $k$05 << 2;
+ $23 = $22&65535;
+ $24 = (($18) + ($i7$06<<1)|0);
+ HEAP16[$24>>1] = $23;
+ $25 = $22 | 1;
+ $26 = $25&65535;
+ $27 = $i7$06 | 1;
+ $28 = (($18) + ($27<<1)|0);
+ HEAP16[$28>>1] = $26;
+ $29 = $22 | 2;
+ $30 = $29&65535;
+ $31 = (($i7$06) + 2)|0;
+ $32 = (($18) + ($31<<1)|0);
+ HEAP16[$32>>1] = $30;
+ $33 = (($i7$06) + 3)|0;
+ $34 = (($18) + ($33<<1)|0);
+ HEAP16[$34>>1] = $23;
+ $35 = (($i7$06) + 4)|0;
+ $36 = (($18) + ($35<<1)|0);
+ HEAP16[$36>>1] = $30;
+ $37 = $22 | 3;
+ $38 = $37&65535;
+ $39 = (($i7$06) + 5)|0;
+ $40 = (($18) + ($39<<1)|0);
+ HEAP16[$40>>1] = $38;
+ $41 = (($k$05) + 1)|0;
+ $42 = (($i7$06) + 6)|0;
+ $exitcond = ($41|0)==(1024);
+ if ($exitcond) {
+ break;
+ } else {
+ $i7$06 = $42;$k$05 = $41;
+ }
+ }
+ HEAP32[1956>>2] = 0;
+ HEAP32[(1960)>>2] = 0;
+ HEAP32[(1964)>>2] = 0;
+ _TraceLog(0,15425,$vararg_buffer);
+ $43 = HEAP32[2016>>2]|0;
+ $44 = ($43|0)==(0);
+ if (!($44)) {
+ $45 = HEAP32[2024>>2]|0;
+ FUNCTION_TABLE_vii[$45 & 63](1,(1888));
+ $46 = HEAP32[2028>>2]|0;
+ $47 = HEAP32[(1888)>>2]|0;
+ FUNCTION_TABLE_vi[$46 & 31]($47);
+ }
+ _glGenBuffers(2,((1892)|0));
+ $48 = HEAP32[(1892)>>2]|0;
+ _glBindBuffer(34962,($48|0));
+ $49 = HEAP32[(1872)>>2]|0;
+ _glBufferData(34962,24576,($49|0),35048);
+ $50 = HEAP32[(2112)>>2]|0;
+ _glEnableVertexAttribArray(($50|0));
+ $51 = HEAP32[(2112)>>2]|0;
+ _glVertexAttribPointer(($51|0),3,5126,0,0,(0|0));
+ _glGenBuffers(2,((1896)|0));
+ $52 = HEAP32[(1896)>>2]|0;
+ _glBindBuffer(34962,($52|0));
+ $53 = HEAP32[(1880)>>2]|0;
+ _glBufferData(34962,8192,($53|0),35048);
+ $54 = HEAP32[(2132)>>2]|0;
+ _glEnableVertexAttribArray(($54|0));
+ $55 = HEAP32[(2132)>>2]|0;
+ _glVertexAttribPointer(($55|0),4,5121,1,0,(0|0));
+ $56 = HEAP32[2016>>2]|0;
+ $57 = ($56|0)==(0);
+ if ($57) {
+ $59 = HEAP32[(1892)>>2]|0;
+ $60 = HEAP32[(1896)>>2]|0;
+ HEAP32[$vararg_buffer3>>2] = $59;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = $60;
+ _TraceLog(0,15563,$vararg_buffer3);
+ } else {
+ $58 = HEAP32[(1888)>>2]|0;
+ HEAP32[$vararg_buffer1>>2] = $58;
+ _TraceLog(0,15498,$vararg_buffer1);
+ }
+ $61 = HEAP32[2016>>2]|0;
+ $62 = ($61|0)==(0);
+ if (!($62)) {
+ $63 = HEAP32[2024>>2]|0;
+ FUNCTION_TABLE_vii[$63 & 63](1,(1936));
+ $64 = HEAP32[2028>>2]|0;
+ $65 = HEAP32[(1936)>>2]|0;
+ FUNCTION_TABLE_vi[$64 & 31]($65);
+ }
+ _glGenBuffers(1,((1940)|0));
+ $66 = HEAP32[(1940)>>2]|0;
+ _glBindBuffer(34962,($66|0));
+ $67 = HEAP32[(1920)>>2]|0;
+ _glBufferData(34962,73728,($67|0),35048);
+ $68 = HEAP32[(2112)>>2]|0;
+ _glEnableVertexAttribArray(($68|0));
+ $69 = HEAP32[(2112)>>2]|0;
+ _glVertexAttribPointer(($69|0),3,5126,0,0,(0|0));
+ _glGenBuffers(1,((1944)|0));
+ $70 = HEAP32[(1944)>>2]|0;
+ _glBindBuffer(34962,($70|0));
+ $71 = HEAP32[(1928)>>2]|0;
+ _glBufferData(34962,24576,($71|0),35048);
+ $72 = HEAP32[(2132)>>2]|0;
+ _glEnableVertexAttribArray(($72|0));
+ $73 = HEAP32[(2132)>>2]|0;
+ _glVertexAttribPointer(($73|0),4,5121,1,0,(0|0));
+ $74 = HEAP32[2016>>2]|0;
+ $75 = ($74|0)==(0);
+ if ($75) {
+ $77 = HEAP32[(1940)>>2]|0;
+ $78 = HEAP32[(1944)>>2]|0;
+ HEAP32[$vararg_buffer10>>2] = $77;
+ $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $78;
+ _TraceLog(0,15709,$vararg_buffer10);
+ } else {
+ $76 = HEAP32[(1936)>>2]|0;
+ HEAP32[$vararg_buffer7>>2] = $76;
+ _TraceLog(0,15640,$vararg_buffer7);
+ }
+ $79 = HEAP32[2016>>2]|0;
+ $80 = ($79|0)==(0);
+ if (!($80)) {
+ $81 = HEAP32[2024>>2]|0;
+ FUNCTION_TABLE_vii[$81 & 63](1,(1984));
+ $82 = HEAP32[2028>>2]|0;
+ $83 = HEAP32[(1984)>>2]|0;
+ FUNCTION_TABLE_vi[$82 & 31]($83);
+ }
+ _glGenBuffers(1,((1988)|0));
+ $84 = HEAP32[(1988)>>2]|0;
+ _glBindBuffer(34962,($84|0));
+ $85 = HEAP32[(1968)>>2]|0;
+ _glBufferData(34962,49152,($85|0),35048);
+ $86 = HEAP32[(2112)>>2]|0;
+ _glEnableVertexAttribArray(($86|0));
+ $87 = HEAP32[(2112)>>2]|0;
+ _glVertexAttribPointer(($87|0),3,5126,0,0,(0|0));
+ _glGenBuffers(1,((1992)|0));
+ $88 = HEAP32[(1992)>>2]|0;
+ _glBindBuffer(34962,($88|0));
+ $89 = HEAP32[(1972)>>2]|0;
+ _glBufferData(34962,32768,($89|0),35048);
+ $90 = HEAP32[(2116)>>2]|0;
+ _glEnableVertexAttribArray(($90|0));
+ $91 = HEAP32[(2116)>>2]|0;
+ _glVertexAttribPointer(($91|0),2,5126,0,0,(0|0));
+ _glGenBuffers(1,((1996)|0));
+ $92 = HEAP32[(1996)>>2]|0;
+ _glBindBuffer(34962,($92|0));
+ $93 = HEAP32[(1976)>>2]|0;
+ _glBufferData(34962,16384,($93|0),35048);
+ $94 = HEAP32[(2132)>>2]|0;
+ _glEnableVertexAttribArray(($94|0));
+ $95 = HEAP32[(2132)>>2]|0;
+ _glVertexAttribPointer(($95|0),4,5121,1,0,(0|0));
+ _glGenBuffers(1,((2000)|0));
+ $96 = HEAP32[(2000)>>2]|0;
+ _glBindBuffer(34963,($96|0));
+ $97 = HEAP32[(1980)>>2]|0;
+ _glBufferData(34963,12288,($97|0),35044);
+ $98 = HEAP32[2016>>2]|0;
+ $99 = ($98|0)==(0);
+ if ($99) {
+ $101 = HEAP32[(1988)>>2]|0;
+ $102 = HEAP32[(1992)>>2]|0;
+ $103 = HEAP32[(1996)>>2]|0;
+ $104 = HEAP32[(2000)>>2]|0;
+ HEAP32[$vararg_buffer17>>2] = $101;
+ $vararg_ptr20 = ((($vararg_buffer17)) + 4|0);
+ HEAP32[$vararg_ptr20>>2] = $102;
+ $vararg_ptr21 = ((($vararg_buffer17)) + 8|0);
+ HEAP32[$vararg_ptr21>>2] = $103;
+ $vararg_ptr22 = ((($vararg_buffer17)) + 12|0);
+ HEAP32[$vararg_ptr22>>2] = $104;
+ _TraceLog(0,15855,$vararg_buffer17);
+ } else {
+ $100 = HEAP32[(1984)>>2]|0;
+ HEAP32[$vararg_buffer14>>2] = $100;
+ _TraceLog(0,15790,$vararg_buffer14);
+ }
+ $105 = HEAP32[2016>>2]|0;
+ $106 = ($105|0)==(0);
+ if ($106) {
+ STACKTOP = sp;return;
+ }
+ $107 = HEAP32[2028>>2]|0;
+ FUNCTION_TABLE_vi[$107 & 31](0);
+ STACKTOP = sp;return;
+}
+function _LoadCompressedTexture($data,$width,$height,$mipmapCount,$compressedFormat) {
+ $data = $data|0;
+ $width = $width|0;
+ $height = $height|0;
+ $mipmapCount = $mipmapCount|0;
+ $compressedFormat = $compressedFormat|0;
+ var $$ = 0, $$013 = 0, $$0610 = 0, $$17 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $blockSize$0 = 0, $level$012 = 0, $offset$011 = 0, $or$cond = 0, $or$cond9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _glPixelStorei(3317,1);
+ switch ($compressedFormat|0) {
+ case 33776: case 33777: case 36196: case 37492: {
+ $blockSize$0 = 8;
+ break;
+ }
+ default: {
+ $blockSize$0 = 16;
+ }
+ }
+ $0 = ($mipmapCount|0)<(1);
+ $1 = $width | $height;
+ $2 = ($1|0)==(0);
+ $or$cond9 = $0 | $2;
+ if ($or$cond9) {
+ return;
+ } else {
+ $$013 = $width;$$0610 = $height;$level$012 = 0;$offset$011 = 0;
+ }
+ while(1) {
+ $3 = (($$013) + 3)|0;
+ $4 = (($3|0) / 4)&-1;
+ $5 = (($$0610) + 3)|0;
+ $6 = (($5|0) / 4)&-1;
+ $7 = Math_imul($4, $blockSize$0)|0;
+ $8 = Math_imul($7, $6)|0;
+ $9 = (($data) + ($offset$011)|0);
+ _glCompressedTexImage2D(3553,($level$012|0),($compressedFormat|0),($$013|0),($$0610|0),0,($8|0),($9|0));
+ $10 = (($8) + ($offset$011))|0;
+ $11 = (($$013|0) / 2)&-1;
+ $12 = (($$0610|0) / 2)&-1;
+ $13 = ($$013|0)<(2);
+ $$ = $13 ? 1 : $11;
+ $14 = ($$0610|0)<(2);
+ $$17 = $14 ? 1 : $12;
+ $15 = (($level$012) + 1)|0;
+ $16 = ($15|0)>=($mipmapCount|0);
+ $17 = $$ | $$17;
+ $18 = ($17|0)==(0);
+ $or$cond = $16 | $18;
+ if ($or$cond) {
+ break;
+ } else {
+ $$013 = $$;$$0610 = $$17;$level$012 = $15;$offset$011 = $10;
+ }
+ }
+ return;
+}
+function _UnloadDefaultShader() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _glUseProgram(0);
+ $0 = HEAP32[2060>>2]|0;
+ _glDeleteProgram(($0|0));
+ return;
+}
+function _UnloadStandardShader() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _glUseProgram(0);
+ $0 = HEAP32[2208>>2]|0;
+ _glDeleteProgram(($0|0));
+ return;
+}
+function _UnloadDefaultBuffers() {
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[2016>>2]|0;
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = HEAP32[2028>>2]|0;
+ FUNCTION_TABLE_vi[$2 & 31](0);
+ }
+ _glDisableVertexAttribArray(0);
+ _glDisableVertexAttribArray(1);
+ _glDisableVertexAttribArray(2);
+ _glDisableVertexAttribArray(3);
+ _glBindBuffer(34962,0);
+ _glBindBuffer(34963,0);
+ _glDeleteBuffers(1,((1892)|0));
+ _glDeleteBuffers(1,((1896)|0));
+ _glDeleteBuffers(1,((1940)|0));
+ _glDeleteBuffers(1,((1944)|0));
+ _glDeleteBuffers(1,((1988)|0));
+ _glDeleteBuffers(1,((1992)|0));
+ _glDeleteBuffers(1,((1996)|0));
+ _glDeleteBuffers(1,((2000)|0));
+ $3 = HEAP32[2016>>2]|0;
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ $5 = HEAP32[2020>>2]|0;
+ FUNCTION_TABLE_vii[$5 & 63](1,(1888));
+ $6 = HEAP32[2020>>2]|0;
+ FUNCTION_TABLE_vii[$6 & 63](1,(1936));
+ $7 = HEAP32[2020>>2]|0;
+ FUNCTION_TABLE_vii[$7 & 63](1,(1984));
+ }
+ $8 = HEAP32[(1872)>>2]|0;
+ _free($8);
+ $9 = HEAP32[(1880)>>2]|0;
+ _free($9);
+ $10 = HEAP32[(1920)>>2]|0;
+ _free($10);
+ $11 = HEAP32[(1928)>>2]|0;
+ _free($11);
+ $12 = HEAP32[(1968)>>2]|0;
+ _free($12);
+ $13 = HEAP32[(1972)>>2]|0;
+ _free($13);
+ $14 = HEAP32[(1976)>>2]|0;
+ _free($14);
+ $15 = HEAP32[(1980)>>2]|0;
+ _free($15);
+ return;
+}
+function _UpdateDefaultBuffers() {
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[1860>>2]|0;
+ $1 = ($0|0)>(0);
+ if ($1) {
+ $2 = HEAP32[2016>>2]|0;
+ $3 = ($2|0)==(0);
+ if (!($3)) {
+ $4 = HEAP32[2028>>2]|0;
+ $5 = HEAP32[(1888)>>2]|0;
+ FUNCTION_TABLE_vi[$4 & 31]($5);
+ }
+ $6 = HEAP32[(1892)>>2]|0;
+ _glBindBuffer(34962,($6|0));
+ $7 = HEAP32[1860>>2]|0;
+ $8 = ($7*12)|0;
+ $9 = HEAP32[(1872)>>2]|0;
+ _glBufferSubData(34962,0,($8|0),($9|0));
+ $10 = HEAP32[(1896)>>2]|0;
+ _glBindBuffer(34962,($10|0));
+ $11 = HEAP32[(1868)>>2]|0;
+ $12 = $11 << 2;
+ $13 = HEAP32[(1880)>>2]|0;
+ _glBufferSubData(34962,0,($12|0),($13|0));
+ }
+ $14 = HEAP32[1908>>2]|0;
+ $15 = ($14|0)>(0);
+ if ($15) {
+ $16 = HEAP32[2016>>2]|0;
+ $17 = ($16|0)==(0);
+ if (!($17)) {
+ $18 = HEAP32[2028>>2]|0;
+ $19 = HEAP32[(1936)>>2]|0;
+ FUNCTION_TABLE_vi[$18 & 31]($19);
+ }
+ $20 = HEAP32[(1940)>>2]|0;
+ _glBindBuffer(34962,($20|0));
+ $21 = HEAP32[1908>>2]|0;
+ $22 = ($21*12)|0;
+ $23 = HEAP32[(1920)>>2]|0;
+ _glBufferSubData(34962,0,($22|0),($23|0));
+ $24 = HEAP32[(1944)>>2]|0;
+ _glBindBuffer(34962,($24|0));
+ $25 = HEAP32[(1916)>>2]|0;
+ $26 = $25 << 2;
+ $27 = HEAP32[(1928)>>2]|0;
+ _glBufferSubData(34962,0,($26|0),($27|0));
+ }
+ $28 = HEAP32[1956>>2]|0;
+ $29 = ($28|0)>(0);
+ if ($29) {
+ $30 = HEAP32[2016>>2]|0;
+ $31 = ($30|0)==(0);
+ if (!($31)) {
+ $32 = HEAP32[2028>>2]|0;
+ $33 = HEAP32[(1984)>>2]|0;
+ FUNCTION_TABLE_vi[$32 & 31]($33);
+ }
+ $34 = HEAP32[(1988)>>2]|0;
+ _glBindBuffer(34962,($34|0));
+ $35 = HEAP32[1956>>2]|0;
+ $36 = ($35*12)|0;
+ $37 = HEAP32[(1968)>>2]|0;
+ _glBufferSubData(34962,0,($36|0),($37|0));
+ $38 = HEAP32[(1992)>>2]|0;
+ _glBindBuffer(34962,($38|0));
+ $39 = HEAP32[1956>>2]|0;
+ $40 = $39 << 3;
+ $41 = HEAP32[(1972)>>2]|0;
+ _glBufferSubData(34962,0,($40|0),($41|0));
+ $42 = HEAP32[(1996)>>2]|0;
+ _glBindBuffer(34962,($42|0));
+ $43 = HEAP32[1956>>2]|0;
+ $44 = $43 << 2;
+ $45 = HEAP32[(1976)>>2]|0;
+ _glBufferSubData(34962,0,($44|0),($45|0));
+ }
+ $46 = HEAP32[2016>>2]|0;
+ $47 = ($46|0)==(0);
+ if ($47) {
+ return;
+ }
+ $48 = HEAP32[2028>>2]|0;
+ FUNCTION_TABLE_vi[$48 & 31](0);
+ return;
+}
+function _DrawDefaultBuffers($eyesCount) {
+ $eyesCount = $eyesCount|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $exitcond = 0, $eye$06 = 0, $i$05 = 0, $indicesOffset$04 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $matModelView = 0, $matProjection = 0, $modelview$byval_copy = 0;
+ var $or$cond = 0, $or$cond3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 320|0;
+ $matMVP$byval_copy = sp + 256|0;
+ $modelview$byval_copy = sp + 192|0;
+ $matProjection = sp + 128|0;
+ $matModelView = sp + 64|0;
+ $matMVP = sp;
+ dest=$matProjection; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matModelView; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $0 = ($eyesCount|0)>(0);
+ if (!($0)) {
+ HEAP32[2008>>2] = 1;
+ $87 = HEAP32[2056>>2]|0;
+ $88 = HEAP32[2012>>2]|0;
+ $89 = ((($88)) + 8|0);
+ HEAP32[$89>>2] = $87;
+ $90 = HEAP32[2012>>2]|0;
+ HEAP32[$90>>2] = 0;
+ HEAP32[1860>>2] = 0;
+ HEAP32[(1868)>>2] = 0;
+ HEAP32[1908>>2] = 0;
+ HEAP32[(1916)>>2] = 0;
+ HEAP32[1956>>2] = 0;
+ HEAP32[(1960)>>2] = 0;
+ HEAP32[(1964)>>2] = 0;
+ HEAPF32[2004>>2] = -1.0;
+ dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=748; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ $1 = ($eyesCount|0)==(2);
+ $eye$06 = 0;
+ while(1) {
+ if ($1) {
+ dest=$modelview$byval_copy; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matMVP$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetStereoView($eye$06,$modelview$byval_copy,$matMVP$byval_copy);
+ }
+ $2 = HEAP32[1860>>2]|0;
+ $3 = ($2|0)>(0);
+ $4 = HEAP32[1908>>2]|0;
+ $5 = ($4|0)>(0);
+ $or$cond = $3 | $5;
+ $6 = HEAP32[1956>>2]|0;
+ $7 = ($6|0)>(0);
+ $or$cond3 = $or$cond | $7;
+ if ($or$cond3) {
+ $8 = HEAP32[2108>>2]|0;
+ _glUseProgram(($8|0));
+ dest=$modelview$byval_copy; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$matMVP$byval_copy; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($matMVP,$modelview$byval_copy,$matMVP$byval_copy);
+ $9 = HEAP32[(2136)>>2]|0;
+ dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $10 = (_MatrixToFloat($matMVP$byval_copy)|0);
+ _glUniformMatrix4fv(($9|0),1,0,($10|0));
+ $11 = HEAP32[(2140)>>2]|0;
+ _glUniform4f(($11|0),1.0,1.0,1.0,1.0);
+ $12 = HEAP32[(2144)>>2]|0;
+ _glUniform1i(($12|0),0);
+ }
+ $13 = HEAP32[1860>>2]|0;
+ $14 = ($13|0)>(0);
+ if ($14) {
+ $15 = HEAP32[2056>>2]|0;
+ _glBindTexture(3553,($15|0));
+ $16 = HEAP32[2016>>2]|0;
+ $17 = ($16|0)==(0);
+ if ($17) {
+ $20 = HEAP32[(1892)>>2]|0;
+ _glBindBuffer(34962,($20|0));
+ $21 = HEAP32[(2112)>>2]|0;
+ _glVertexAttribPointer(($21|0),3,5126,0,0,(0|0));
+ $22 = HEAP32[(2112)>>2]|0;
+ _glEnableVertexAttribArray(($22|0));
+ $23 = HEAP32[(1896)>>2]|0;
+ _glBindBuffer(34962,($23|0));
+ $24 = HEAP32[(2132)>>2]|0;
+ _glVertexAttribPointer(($24|0),4,5121,1,0,(0|0));
+ $25 = HEAP32[(2132)>>2]|0;
+ _glEnableVertexAttribArray(($25|0));
+ } else {
+ $18 = HEAP32[2028>>2]|0;
+ $19 = HEAP32[(1888)>>2]|0;
+ FUNCTION_TABLE_vi[$18 & 31]($19);
+ }
+ $26 = HEAP32[1860>>2]|0;
+ _glDrawArrays(1,0,($26|0));
+ $27 = HEAP32[2016>>2]|0;
+ $28 = ($27|0)==(0);
+ if ($28) {
+ _glBindBuffer(34962,0);
+ }
+ _glBindTexture(3553,0);
+ }
+ $29 = HEAP32[1908>>2]|0;
+ $30 = ($29|0)>(0);
+ if ($30) {
+ $31 = HEAP32[2056>>2]|0;
+ _glBindTexture(3553,($31|0));
+ $32 = HEAP32[2016>>2]|0;
+ $33 = ($32|0)==(0);
+ if ($33) {
+ $36 = HEAP32[(1940)>>2]|0;
+ _glBindBuffer(34962,($36|0));
+ $37 = HEAP32[(2112)>>2]|0;
+ _glVertexAttribPointer(($37|0),3,5126,0,0,(0|0));
+ $38 = HEAP32[(2112)>>2]|0;
+ _glEnableVertexAttribArray(($38|0));
+ $39 = HEAP32[(1944)>>2]|0;
+ _glBindBuffer(34962,($39|0));
+ $40 = HEAP32[(2132)>>2]|0;
+ _glVertexAttribPointer(($40|0),4,5121,1,0,(0|0));
+ $41 = HEAP32[(2132)>>2]|0;
+ _glEnableVertexAttribArray(($41|0));
+ } else {
+ $34 = HEAP32[2028>>2]|0;
+ $35 = HEAP32[(1936)>>2]|0;
+ FUNCTION_TABLE_vi[$34 & 31]($35);
+ }
+ $42 = HEAP32[1908>>2]|0;
+ _glDrawArrays(4,0,($42|0));
+ $43 = HEAP32[2016>>2]|0;
+ $44 = ($43|0)==(0);
+ if ($44) {
+ _glBindBuffer(34962,0);
+ }
+ _glBindTexture(3553,0);
+ }
+ $45 = HEAP32[1956>>2]|0;
+ $46 = ($45|0)>(0);
+ if ($46) {
+ $47 = HEAP32[2016>>2]|0;
+ $48 = ($47|0)==(0);
+ if ($48) {
+ $51 = HEAP32[(1988)>>2]|0;
+ _glBindBuffer(34962,($51|0));
+ $52 = HEAP32[(2112)>>2]|0;
+ _glVertexAttribPointer(($52|0),3,5126,0,0,(0|0));
+ $53 = HEAP32[(2112)>>2]|0;
+ _glEnableVertexAttribArray(($53|0));
+ $54 = HEAP32[(1992)>>2]|0;
+ _glBindBuffer(34962,($54|0));
+ $55 = HEAP32[(2116)>>2]|0;
+ _glVertexAttribPointer(($55|0),2,5126,0,0,(0|0));
+ $56 = HEAP32[(2116)>>2]|0;
+ _glEnableVertexAttribArray(($56|0));
+ $57 = HEAP32[(1996)>>2]|0;
+ _glBindBuffer(34962,($57|0));
+ $58 = HEAP32[(2132)>>2]|0;
+ _glVertexAttribPointer(($58|0),4,5121,1,0,(0|0));
+ $59 = HEAP32[(2132)>>2]|0;
+ _glEnableVertexAttribArray(($59|0));
+ $60 = HEAP32[(2000)>>2]|0;
+ _glBindBuffer(34963,($60|0));
+ } else {
+ $49 = HEAP32[2028>>2]|0;
+ $50 = HEAP32[(1984)>>2]|0;
+ FUNCTION_TABLE_vi[$49 & 31]($50);
+ }
+ $61 = HEAP32[2008>>2]|0;
+ $62 = ($61|0)>(0);
+ if ($62) {
+ $i$05 = 0;$indicesOffset$04 = 0;
+ while(1) {
+ $63 = HEAP32[2012>>2]|0;
+ $64 = (($63) + (($i$05*144)|0)|0);
+ $65 = HEAP32[$64>>2]|0;
+ $66 = (($65|0) / 4)&-1;
+ $67 = ($66*6)|0;
+ $68 = (((($63) + (($i$05*144)|0)|0)) + 8|0);
+ $69 = HEAP32[$68>>2]|0;
+ _glBindTexture(3553,($69|0));
+ $70 = $indicesOffset$04 << 1;
+ $71 = $70;
+ _glDrawElements(4,($67|0),5123,($71|0));
+ $72 = HEAP32[2012>>2]|0;
+ $73 = (($72) + (($i$05*144)|0)|0);
+ $74 = HEAP32[$73>>2]|0;
+ $75 = (($74|0) / 4)&-1;
+ $76 = ($75*6)|0;
+ $77 = (($76) + ($indicesOffset$04))|0;
+ $78 = (($i$05) + 1)|0;
+ $79 = HEAP32[2008>>2]|0;
+ $80 = ($78|0)<($79|0);
+ if ($80) {
+ $i$05 = $78;$indicesOffset$04 = $77;
+ } else {
+ break;
+ }
+ }
+ }
+ $81 = HEAP32[2016>>2]|0;
+ $82 = ($81|0)==(0);
+ if ($82) {
+ _glBindBuffer(34962,0);
+ _glBindBuffer(34963,0);
+ }
+ _glBindTexture(3553,0);
+ }
+ $83 = HEAP32[2016>>2]|0;
+ $84 = ($83|0)==(0);
+ if (!($84)) {
+ $85 = HEAP32[2028>>2]|0;
+ FUNCTION_TABLE_vi[$85 & 31](0);
+ }
+ _glUseProgram(0);
+ $86 = (($eye$06) + 1)|0;
+ $exitcond = ($86|0)==($eyesCount|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $eye$06 = $86;
+ }
+ }
+ HEAP32[2008>>2] = 1;
+ $87 = HEAP32[2056>>2]|0;
+ $88 = HEAP32[2012>>2]|0;
+ $89 = ((($88)) + 8|0);
+ HEAP32[$89>>2] = $87;
+ $90 = HEAP32[2012>>2]|0;
+ HEAP32[$90>>2] = 0;
+ HEAP32[1860>>2] = 0;
+ HEAP32[(1868)>>2] = 0;
+ HEAP32[1908>>2] = 0;
+ HEAP32[(1916)>>2] = 0;
+ HEAP32[1956>>2] = 0;
+ HEAP32[(1960)>>2] = 0;
+ HEAP32[(1964)>>2] = 0;
+ HEAPF32[2004>>2] = -1.0;
+ dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=748; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _SetShaderLights($shader) {
+ $shader = $shader|0;
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0.0;
+ var $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0, $95 = 0.0, $96 = 0;
+ var $97 = 0, $98 = 0, $99 = 0.0, $direction = 0, $direction1 = 0, $exitcond = 0, $i$01 = 0, $locName = 0, $shader$byval_copy7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0;
+ $shader$byval_copy7 = sp + 24|0;
+ $locName = sp + 72|0;
+ $direction = sp + 12|0;
+ $direction1 = sp;
+ dest=$locName; src=15335; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ $0 = ((($locName)) + 7|0);
+ $1 = ((($locName)) + 10|0);
+ $2 = ((($direction)) + 4|0);
+ $3 = ((($direction)) + 8|0);
+ $4 = ((($direction1)) + 4|0);
+ $5 = ((($direction1)) + 8|0);
+ $i$01 = 0;
+ while(1) {
+ $6 = (($i$01) + 48)|0;
+ $7 = $6&255;
+ HEAP8[$0>>0] = $7;
+ $8 = (2168 + ($i$01<<2)|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($9|0)==(0|0);
+ $11 = $1;
+ $12 = $11;
+ HEAP8[$12>>0]=1650552421&255;HEAP8[$12+1>>0]=(1650552421>>8)&255;HEAP8[$12+2>>0]=(1650552421>>16)&255;HEAP8[$12+3>>0]=1650552421>>24;
+ $13 = (($11) + 4)|0;
+ $14 = $13;
+ HEAP8[$14>>0]=6579564&255;HEAP8[$14+1>>0]=(6579564>>8)&255;HEAP8[$14+2>>0]=(6579564>>16)&255;HEAP8[$14+3>>0]=6579564>>24;
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $15 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ L3: do {
+ if ($10) {
+ _glUniform1i(($15|0),0);
+ } else {
+ $16 = HEAP32[$8>>2]|0;
+ $17 = ((($16)) + 4|0);
+ $18 = HEAP32[$17>>2]|0;
+ _glUniform1i(($15|0),($18|0));
+ ;HEAP8[$1>>0]=HEAP8[15367>>0]|0;HEAP8[$1+1>>0]=HEAP8[15367+1>>0]|0;HEAP8[$1+2>>0]=HEAP8[15367+2>>0]|0;HEAP8[$1+3>>0]=HEAP8[15367+3>>0]|0;HEAP8[$1+4>>0]=HEAP8[15367+4>>0]|0;
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $19 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $20 = HEAP32[$8>>2]|0;
+ $21 = ((($20)) + 8|0);
+ $22 = HEAP32[$21>>2]|0;
+ _glUniform1i(($19|0),($22|0));
+ dest=$1; src=15373; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ $23 = HEAP32[$shader>>2]|0;
+ $24 = (_glGetUniformLocation(($23|0),($locName|0))|0);
+ $25 = HEAP32[$8>>2]|0;
+ $26 = ((($25)) + 40|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = (+($27&255));
+ $29 = $28 / 255.0;
+ $30 = ((($25)) + 41|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = (+($31&255));
+ $33 = $32 / 255.0;
+ $34 = ((($25)) + 42|0);
+ $35 = HEAP8[$34>>0]|0;
+ $36 = (+($35&255));
+ $37 = $36 / 255.0;
+ $38 = ((($25)) + 43|0);
+ $39 = HEAP8[$38>>0]|0;
+ $40 = (+($39&255));
+ $41 = $40 / 255.0;
+ _glUniform4f(($24|0),(+$29),(+$33),(+$37),(+$41));
+ dest=$1; src=15382; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ $42 = HEAP32[$shader>>2]|0;
+ $43 = (_glGetUniformLocation(($42|0),($locName|0))|0);
+ $44 = HEAP32[$8>>2]|0;
+ $45 = ((($44)) + 44|0);
+ $46 = +HEAPF32[$45>>2];
+ _glUniform1f(($43|0),(+$46));
+ $47 = HEAP32[$8>>2]|0;
+ $48 = ((($47)) + 8|0);
+ $49 = HEAP32[$48>>2]|0;
+ switch ($49|0) {
+ case 0: {
+ dest=$1; src=15393; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $50 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $51 = HEAP32[$8>>2]|0;
+ $52 = ((($51)) + 12|0);
+ $53 = +HEAPF32[$52>>2];
+ $54 = ((($51)) + 16|0);
+ $55 = +HEAPF32[$54>>2];
+ $56 = ((($51)) + 20|0);
+ $57 = +HEAPF32[$56>>2];
+ _glUniform3f(($50|0),(+$53),(+$55),(+$57));
+ $58 = $1;
+ $59 = $58;
+ HEAP8[$59>>0]=1768186226&255;HEAP8[$59+1>>0]=(1768186226>>8)&255;HEAP8[$59+2>>0]=(1768186226>>16)&255;HEAP8[$59+3>>0]=1768186226>>24;
+ $60 = (($58) + 4)|0;
+ $61 = $60;
+ HEAP8[$61>>0]=29557&255;HEAP8[$61+1>>0]=(29557>>8)&255;HEAP8[$61+2>>0]=(29557>>16)&255;HEAP8[$61+3>>0]=29557>>24;
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $62 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $63 = HEAP32[$8>>2]|0;
+ $64 = ((($63)) + 36|0);
+ $65 = +HEAPF32[$64>>2];
+ _glUniform1f(($62|0),(+$65));
+ break L3;
+ break;
+ }
+ case 1: {
+ dest=$1; src=15403; stop=dest+11|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $66 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $67 = HEAP32[$8>>2]|0;
+ $68 = ((($67)) + 24|0);
+ $69 = +HEAPF32[$68>>2];
+ $70 = ((($67)) + 12|0);
+ $71 = +HEAPF32[$70>>2];
+ $72 = $69 - $71;
+ HEAPF32[$direction>>2] = $72;
+ $73 = HEAP32[$8>>2]|0;
+ $74 = ((($73)) + 28|0);
+ $75 = +HEAPF32[$74>>2];
+ $76 = ((($73)) + 16|0);
+ $77 = +HEAPF32[$76>>2];
+ $78 = $75 - $77;
+ HEAPF32[$2>>2] = $78;
+ $79 = HEAP32[$8>>2]|0;
+ $80 = ((($79)) + 32|0);
+ $81 = +HEAPF32[$80>>2];
+ $82 = ((($79)) + 20|0);
+ $83 = +HEAPF32[$82>>2];
+ $84 = $81 - $83;
+ HEAPF32[$3>>2] = $84;
+ _VectorNormalize($direction);
+ $85 = +HEAPF32[$direction>>2];
+ $86 = +HEAPF32[$2>>2];
+ $87 = +HEAPF32[$3>>2];
+ _glUniform3f(($66|0),(+$85),(+$86),(+$87));
+ break L3;
+ break;
+ }
+ case 2: {
+ dest=$1; src=15393; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $88 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $89 = HEAP32[$8>>2]|0;
+ $90 = ((($89)) + 12|0);
+ $91 = +HEAPF32[$90>>2];
+ $92 = ((($89)) + 16|0);
+ $93 = +HEAPF32[$92>>2];
+ $94 = ((($89)) + 20|0);
+ $95 = +HEAPF32[$94>>2];
+ _glUniform3f(($88|0),(+$91),(+$93),(+$95));
+ dest=$1; src=15403; stop=dest+11|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $96 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $97 = HEAP32[$8>>2]|0;
+ $98 = ((($97)) + 24|0);
+ $99 = +HEAPF32[$98>>2];
+ $100 = ((($97)) + 12|0);
+ $101 = +HEAPF32[$100>>2];
+ $102 = $99 - $101;
+ HEAPF32[$direction1>>2] = $102;
+ $103 = HEAP32[$8>>2]|0;
+ $104 = ((($103)) + 28|0);
+ $105 = +HEAPF32[$104>>2];
+ $106 = ((($103)) + 16|0);
+ $107 = +HEAPF32[$106>>2];
+ $108 = $105 - $107;
+ HEAPF32[$4>>2] = $108;
+ $109 = HEAP32[$8>>2]|0;
+ $110 = ((($109)) + 32|0);
+ $111 = +HEAPF32[$110>>2];
+ $112 = ((($109)) + 20|0);
+ $113 = +HEAPF32[$112>>2];
+ $114 = $111 - $113;
+ HEAPF32[$5>>2] = $114;
+ _VectorNormalize($direction1);
+ $115 = +HEAPF32[$direction1>>2];
+ $116 = +HEAPF32[$4>>2];
+ $117 = +HEAPF32[$5>>2];
+ _glUniform3f(($96|0),(+$115),(+$116),(+$117));
+ dest=$1; src=15414; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $118 = (_GetShaderLocation($shader$byval_copy7,$locName)|0);
+ $119 = HEAP32[$8>>2]|0;
+ $120 = ((($119)) + 48|0);
+ $121 = +HEAPF32[$120>>2];
+ _glUniform1f(($118|0),(+$121));
+ break L3;
+ break;
+ }
+ default: {
+ break L3;
+ }
+ }
+ }
+ } while(0);
+ $122 = (($i$01) + 1)|0;
+ $exitcond = ($122|0)==(8);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $122;
+ }
+ }
+ STACKTOP = sp;return;
+}
+function _SetStereoView($eye,$matProjection,$matModelView) {
+ $eye = $eye|0;
+ $matProjection = $matProjection|0;
+ $matModelView = $matModelView|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $eyeProjection = 0, $eyeProjection$byval_copy = 0, $matModelView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $eyeProjection$byval_copy = sp + 192|0;
+ $matModelView$byval_copy = sp + 64|0;
+ $eyeProjection = sp;
+ $0 = sp + 128|0;
+ $1 = HEAP32[2200>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ STACKTOP = sp;return;
+ }
+ dest=$eyeProjection; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $3 = HEAP32[2156>>2]|0;
+ $4 = Math_imul($3, $eye)|0;
+ $5 = (($4|0) / 2)&-1;
+ $6 = (($3|0) / 2)&-1;
+ $7 = HEAP32[2160>>2]|0;
+ _rlViewport($5,0,$6,$7);
+ $8 = (2476 + ($eye<<6)|0);
+ dest=$matModelView$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$eyeProjection$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($0,$matModelView$byval_copy,$eyeProjection$byval_copy);
+ $9 = (2348 + ($eye<<6)|0);
+ dest=$eyeProjection; src=$9; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$eyeProjection$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetMatrixModelview($eyeProjection$byval_copy);
+ dest=$eyeProjection$byval_copy; src=$eyeProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetMatrixProjection($eyeProjection$byval_copy);
+ STACKTOP = sp;return;
+}
+function _LoadShaderProgram($vShaderStr,$fShaderStr) {
+ $vShaderStr = $vShaderStr|0;
+ $fShaderStr = $fShaderStr|0;
+ var $$alloca_mul = 0, $$alloca_mul25 = 0, $$alloca_mul27 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $length = 0, $length2 = 0, $length4 = 0, $maxLength = 0, $maxLength1 = 0, $maxLength3 = 0, $pfs = 0, $program$0 = 0, $pvs = 0, $success = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0;
+ var $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0;
+ $vararg_buffer22 = sp + 64|0;
+ $vararg_buffer19 = sp + 56|0;
+ $vararg_buffer16 = sp + 48|0;
+ $vararg_buffer13 = sp + 40|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $pvs = sp + 100|0;
+ $pfs = sp + 96|0;
+ $success = sp + 92|0;
+ $maxLength = sp + 88|0;
+ $length = sp + 84|0;
+ $maxLength1 = sp + 80|0;
+ $length2 = sp + 76|0;
+ $maxLength3 = sp + 72|0;
+ $length4 = sp + 68|0;
+ $0 = (_glCreateShader(35633)|0);
+ $1 = (_glCreateShader(35632)|0);
+ HEAP32[$pvs>>2] = $vShaderStr;
+ HEAP32[$pfs>>2] = $fShaderStr;
+ _glShaderSource(($0|0),1,($pvs|0),(0|0));
+ _glShaderSource(($1|0),1,($pfs|0),(0|0));
+ HEAP32[$success>>2] = 0;
+ _glCompileShader(($0|0));
+ _glGetShaderiv(($0|0),35713,($success|0));
+ $2 = HEAP32[$success>>2]|0;
+ $3 = ($2|0)==(1);
+ if ($3) {
+ HEAP32[$vararg_buffer4>>2] = $0;
+ _TraceLog(0,15088,$vararg_buffer4);
+ } else {
+ HEAP32[$vararg_buffer>>2] = $0;
+ _TraceLog(2,15036,$vararg_buffer);
+ HEAP32[$maxLength>>2] = 0;
+ _glGetShaderiv(($0|0),35716,($maxLength|0));
+ $4 = HEAP32[$maxLength>>2]|0;
+ $5 = (_llvm_stacksave()|0);
+ $$alloca_mul = $4;
+ $6 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;;
+ $7 = HEAP32[$maxLength>>2]|0;
+ _glGetShaderInfoLog(($0|0),($7|0),($length|0),($6|0));
+ HEAP32[$vararg_buffer1>>2] = $6;
+ _TraceLog(0,15085,$vararg_buffer1);
+ _llvm_stackrestore(($5|0));
+ }
+ _glCompileShader(($1|0));
+ _glGetShaderiv(($1|0),35713,($success|0));
+ $8 = HEAP32[$success>>2]|0;
+ $9 = ($8|0)==(1);
+ if ($9) {
+ HEAP32[$vararg_buffer13>>2] = $1;
+ _TraceLog(0,15189,$vararg_buffer13);
+ } else {
+ HEAP32[$vararg_buffer7>>2] = $1;
+ _TraceLog(2,15138,$vararg_buffer7);
+ HEAP32[$maxLength1>>2] = 0;
+ _glGetShaderiv(($1|0),35716,($maxLength1|0));
+ $10 = HEAP32[$maxLength1>>2]|0;
+ $11 = (_llvm_stacksave()|0);
+ $$alloca_mul25 = $10;
+ $12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul25)|0)+15)&-16)|0;;
+ $13 = HEAP32[$maxLength1>>2]|0;
+ _glGetShaderInfoLog(($1|0),($13|0),($length2|0),($12|0));
+ HEAP32[$vararg_buffer10>>2] = $12;
+ _TraceLog(0,15085,$vararg_buffer10);
+ _llvm_stackrestore(($11|0));
+ }
+ $14 = (_glCreateProgram()|0);
+ _glAttachShader(($14|0),($0|0));
+ _glAttachShader(($14|0),($1|0));
+ _glBindAttribLocation(($14|0),0,(14903|0));
+ _glBindAttribLocation(($14|0),1,(14918|0));
+ _glBindAttribLocation(($14|0),2,(14949|0));
+ _glBindAttribLocation(($14|0),3,(14976|0));
+ _glBindAttribLocation(($14|0),4,(14962|0));
+ _glBindAttribLocation(($14|0),5,(14933|0));
+ _glLinkProgram(($14|0));
+ _glGetProgramiv(($14|0),35714,($success|0));
+ $15 = HEAP32[$success>>2]|0;
+ $16 = ($15|0)==(0);
+ if ($16) {
+ HEAP32[$vararg_buffer16>>2] = $14;
+ _TraceLog(2,15241,$vararg_buffer16);
+ HEAP32[$maxLength3>>2] = 0;
+ _glGetProgramiv(($14|0),35716,($maxLength3|0));
+ $17 = HEAP32[$maxLength3>>2]|0;
+ $18 = (_llvm_stacksave()|0);
+ $$alloca_mul27 = $17;
+ $19 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul27)|0)+15)&-16)|0;;
+ $20 = HEAP32[$maxLength3>>2]|0;
+ _glGetProgramInfoLog(($14|0),($20|0),($length4|0),($19|0));
+ HEAP32[$vararg_buffer19>>2] = $19;
+ _TraceLog(0,15085,$vararg_buffer19);
+ _glDeleteProgram(($14|0));
+ _llvm_stackrestore(($18|0));
+ $program$0 = 0;
+ _glDeleteShader(($0|0));
+ _glDeleteShader(($1|0));
+ STACKTOP = sp;return ($program$0|0);
+ } else {
+ HEAP32[$vararg_buffer22>>2] = $14;
+ _TraceLog(0,15287,$vararg_buffer22);
+ $program$0 = $14;
+ _glDeleteShader(($0|0));
+ _glDeleteShader(($1|0));
+ STACKTOP = sp;return ($program$0|0);
+ }
+ return (0)|0;
+}
+function _LoadDefaultShaderLocations($shader) {
+ $shader = $shader|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$shader>>2]|0;
+ $1 = (_glGetAttribLocation(($0|0),(14903|0))|0);
+ $2 = ((($shader)) + 4|0);
+ HEAP32[$2>>2] = $1;
+ $3 = HEAP32[$shader>>2]|0;
+ $4 = (_glGetAttribLocation(($3|0),(14918|0))|0);
+ $5 = ((($shader)) + 8|0);
+ HEAP32[$5>>2] = $4;
+ $6 = HEAP32[$shader>>2]|0;
+ $7 = (_glGetAttribLocation(($6|0),(14933|0))|0);
+ $8 = ((($shader)) + 12|0);
+ HEAP32[$8>>2] = $7;
+ $9 = HEAP32[$shader>>2]|0;
+ $10 = (_glGetAttribLocation(($9|0),(14949|0))|0);
+ $11 = ((($shader)) + 16|0);
+ HEAP32[$11>>2] = $10;
+ $12 = HEAP32[$shader>>2]|0;
+ $13 = (_glGetAttribLocation(($12|0),(14962|0))|0);
+ $14 = ((($shader)) + 20|0);
+ HEAP32[$14>>2] = $13;
+ $15 = HEAP32[$shader>>2]|0;
+ $16 = (_glGetAttribLocation(($15|0),(14976|0))|0);
+ $17 = ((($shader)) + 24|0);
+ HEAP32[$17>>2] = $16;
+ $18 = HEAP32[$shader>>2]|0;
+ $19 = (_glGetUniformLocation(($18|0),(14988|0))|0);
+ $20 = ((($shader)) + 28|0);
+ HEAP32[$20>>2] = $19;
+ $21 = HEAP32[$shader>>2]|0;
+ $22 = (_glGetUniformLocation(($21|0),(14998|0))|0);
+ $23 = ((($shader)) + 32|0);
+ HEAP32[$23>>2] = $22;
+ $24 = HEAP32[$shader>>2]|0;
+ $25 = (_glGetUniformLocation(($24|0),(15009|0))|0);
+ $26 = ((($shader)) + 36|0);
+ HEAP32[$26>>2] = $25;
+ $27 = HEAP32[$shader>>2]|0;
+ $28 = (_glGetUniformLocation(($27|0),(15018|0))|0);
+ $29 = ((($shader)) + 40|0);
+ HEAP32[$29>>2] = $28;
+ $30 = HEAP32[$shader>>2]|0;
+ $31 = (_glGetUniformLocation(($30|0),(15027|0))|0);
+ $32 = ((($shader)) + 44|0);
+ HEAP32[$32>>2] = $31;
+ return;
+}
+function _stbi__fopen($filename) {
+ $filename = $filename|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_fopen($filename,10906)|0);
+ return ($0|0);
+}
+function _stbi__err($str) {
+ $str = $str|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[2608>>2] = $str;
+ return;
+}
+function _stbi__start_file($s,$f) {
+ $s = $s|0;
+ $f = $f|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _stbi__start_callbacks($s,6412,$f);
+ return;
+}
+function _stbi__load_flip($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$04 = 0, $exitcond = 0, $exitcond7 = 0, $exitcond8 = 0, $or$cond = 0, $row$06 = 0, $z$03 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__load_main($s,$x,$y,$comp,$req_comp)|0);
+ $1 = HEAP32[2612>>2]|0;
+ $2 = ($1|0)!=(0);
+ $3 = ($0|0)!=(0|0);
+ $or$cond = $3 & $2;
+ if (!($or$cond)) {
+ return ($0|0);
+ }
+ $4 = HEAP32[$x>>2]|0;
+ $5 = HEAP32[$y>>2]|0;
+ $6 = ($req_comp|0)==(0);
+ if ($6) {
+ $7 = HEAP32[$comp>>2]|0;
+ $11 = $7;
+ } else {
+ $11 = $req_comp;
+ }
+ $8 = $5 >> 1;
+ $9 = ($8|0)>(0);
+ if (!($9)) {
+ return ($0|0);
+ }
+ $10 = ($4|0)>(0);
+ $12 = ($11|0)>(0);
+ $13 = (($5) + -1)|0;
+ $row$06 = 0;
+ while(1) {
+ if ($10) {
+ $14 = Math_imul($row$06, $4)|0;
+ $15 = (($13) - ($row$06))|0;
+ $16 = Math_imul($15, $4)|0;
+ $col$04 = 0;
+ while(1) {
+ if ($12) {
+ $17 = (($col$04) + ($14))|0;
+ $18 = Math_imul($17, $11)|0;
+ $19 = (($col$04) + ($16))|0;
+ $20 = Math_imul($19, $11)|0;
+ $z$03 = 0;
+ while(1) {
+ $21 = (($z$03) + ($18))|0;
+ $22 = (($0) + ($21)|0);
+ $23 = HEAP8[$22>>0]|0;
+ $24 = (($z$03) + ($20))|0;
+ $25 = (($0) + ($24)|0);
+ $26 = HEAP8[$25>>0]|0;
+ HEAP8[$22>>0] = $26;
+ HEAP8[$25>>0] = $23;
+ $27 = (($z$03) + 1)|0;
+ $exitcond = ($27|0)==($11|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $z$03 = $27;
+ }
+ }
+ }
+ $28 = (($col$04) + 1)|0;
+ $exitcond7 = ($28|0)==($4|0);
+ if ($exitcond7) {
+ break;
+ } else {
+ $col$04 = $28;
+ }
+ }
+ }
+ $29 = (($row$06) + 1)|0;
+ $exitcond8 = ($29|0)==($8|0);
+ if ($exitcond8) {
+ break;
+ } else {
+ $row$06 = $29;
+ }
+ }
+ return ($0|0);
+}
+function _stbi__start_callbacks($s,$c,$user) {
+ $s = $s|0;
+ $c = $c|0;
+ $user = $user|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 16|0);
+ ;HEAP32[$0>>2]=HEAP32[$c>>2]|0;HEAP32[$0+4>>2]=HEAP32[$c+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$c+8>>2]|0;
+ $1 = ((($s)) + 28|0);
+ HEAP32[$1>>2] = $user;
+ $2 = ((($s)) + 36|0);
+ HEAP32[$2>>2] = 128;
+ $3 = ((($s)) + 32|0);
+ HEAP32[$3>>2] = 1;
+ $4 = ((($s)) + 40|0);
+ $5 = ((($s)) + 176|0);
+ HEAP32[$5>>2] = $4;
+ _stbi__refill_buffer($s);
+ $6 = ((($s)) + 172|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($s)) + 180|0);
+ HEAP32[$8>>2] = $7;
+ return;
+}
+function _stbi__malloc($size) {
+ $size = $size|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_malloc($size)|0);
+ return ($0|0);
+}
+function _stbi__do_zlib($a,$obuf,$olen,$exp,$parse_header) {
+ $a = $a|0;
+ $obuf = $obuf|0;
+ $olen = $olen|0;
+ $exp = $exp|0;
+ $parse_header = $parse_header|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($a)) + 20|0);
+ HEAP32[$0>>2] = $obuf;
+ $1 = ((($a)) + 16|0);
+ HEAP32[$1>>2] = $obuf;
+ $2 = (($obuf) + ($olen)|0);
+ $3 = ((($a)) + 24|0);
+ HEAP32[$3>>2] = $2;
+ $4 = ((($a)) + 28|0);
+ HEAP32[$4>>2] = $exp;
+ $5 = (_stbi__parse_zlib($a,$parse_header)|0);
+ return ($5|0);
+}
+function _stbi__get16le($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = $0&255;
+ $2 = (_stbi__get8($s)|0);
+ $3 = $2&255;
+ $4 = $3 << 8;
+ $5 = $4 | $1;
+ return ($5|0);
+}
+function _LoadDDS($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $bufsize$0 = 0, $exitcond = 0, $exitcond13 = 0, $filecode = 0, $header = 0, $i$09 = 0, $i2$011 = 0, $i3$08 = 0, $image$sroa$0$0 = 0;
+ var $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$0$3 = 0, $image$sroa$26$0 = 0, $image$sroa$26$1 = 0, $image$sroa$41$0 = 0, $image$sroa$41$1 = 0, $image$sroa$56$0 = 0, $image$sroa$56$1 = 0, $image$sroa$56$2 = 0, $image$sroa$59$0 = 0, $image$sroa$59$1 = 0, $image$sroa$59$2 = 0, $image$sroa$59$3 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $switch = 0, $switch$split12D = 0, $switch$split2D = 0;
+ var $switch$split42D = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer12 = 0, $vararg_buffer16 = 0, $vararg_buffer20 = 0, $vararg_buffer24 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr19 = 0, $vararg_ptr23 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 192|0;
+ $vararg_buffer24 = sp + 56|0;
+ $vararg_buffer20 = sp + 48|0;
+ $vararg_buffer16 = sp + 40|0;
+ $vararg_buffer12 = sp + 32|0;
+ $vararg_buffer8 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $filecode = sp + 184|0;
+ $header = sp + 60|0;
+ $0 = (_fopen($fileName,10906)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,12292,$vararg_buffer);
+ $image$sroa$0$3 = 0;$image$sroa$26$1 = 0;$image$sroa$41$1 = 0;$image$sroa$56$2 = 0;$image$sroa$59$3 = 0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$3;
+ $86 = ((($agg$result)) + 4|0);
+ HEAP32[$86>>2] = $image$sroa$26$1;
+ $87 = ((($agg$result)) + 8|0);
+ HEAP32[$87>>2] = $image$sroa$41$1;
+ $88 = ((($agg$result)) + 12|0);
+ HEAP32[$88>>2] = $image$sroa$56$2;
+ $89 = ((($agg$result)) + 16|0);
+ HEAP32[$89>>2] = $image$sroa$59$3;
+ STACKTOP = sp;return;
+ }
+ (_fread($filecode,1,4,$0)|0);
+ $2 = (_strncmp($filecode,12326,4)|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ (_fread($header,124,1,$0)|0);
+ HEAP32[$vararg_buffer4>>2] = $fileName;
+ $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
+ HEAP32[$vararg_ptr7>>2] = 124;
+ _TraceLog(3,12379,$vararg_buffer4);
+ $4 = ((($header)) + 72|0);
+ $5 = HEAP32[$4>>2]|0;
+ HEAP32[$vararg_buffer8>>2] = $fileName;
+ $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
+ HEAP32[$vararg_ptr11>>2] = $5;
+ _TraceLog(3,12409,$vararg_buffer8);
+ $6 = ((($header)) + 76|0);
+ $7 = HEAP32[$6>>2]|0;
+ HEAP32[$vararg_buffer12>>2] = $fileName;
+ $vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
+ HEAP32[$vararg_ptr15>>2] = $7;
+ _TraceLog(3,12445,$vararg_buffer12);
+ $8 = ((($header)) + 80|0);
+ $9 = HEAP32[$8>>2]|0;
+ HEAP32[$vararg_buffer16>>2] = $fileName;
+ $vararg_ptr19 = ((($vararg_buffer16)) + 4|0);
+ HEAP32[$vararg_ptr19>>2] = $9;
+ _TraceLog(3,12484,$vararg_buffer16);
+ $10 = ((($header)) + 84|0);
+ $11 = HEAP32[$10>>2]|0;
+ HEAP32[$vararg_buffer20>>2] = $fileName;
+ $vararg_ptr23 = ((($vararg_buffer20)) + 4|0);
+ HEAP32[$vararg_ptr23>>2] = $11;
+ _TraceLog(3,12511,$vararg_buffer20);
+ $12 = ((($header)) + 12|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ((($header)) + 8|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = HEAP32[$10>>2]|0;
+ $17 = ($16|0)==(16);
+ L7: do {
+ if ($17) {
+ $18 = HEAP32[$6>>2]|0;
+ switch ($18|0) {
+ case 64: {
+ $19 = $13 << 1;
+ $20 = Math_imul($19, $15)|0;
+ $21 = (_malloc($20)|0);
+ (_fread($21,$20,1,$0)|0);
+ $image$sroa$0$0 = $21;$image$sroa$59$0 = 3;
+ break L7;
+ break;
+ }
+ case 65: {
+ break;
+ }
+ default: {
+ $image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
+ break L7;
+ }
+ }
+ $22 = ((($header)) + 100|0);
+ $23 = HEAP32[$22>>2]|0;
+ $switch$split2D = ($23|0)<(61440);
+ if ($switch$split2D) {
+ switch ($23|0) {
+ case 32768: {
+ break;
+ }
+ default: {
+ $image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
+ break L7;
+ }
+ }
+ $24 = Math_imul($15, $13)|0;
+ $25 = $24 << 1;
+ $26 = (_malloc($25)|0);
+ (_fread($26,$25,1,$0)|0);
+ $27 = ($24|0)>(0);
+ if (!($27)) {
+ $image$sroa$0$0 = $26;$image$sroa$59$0 = 5;
+ break;
+ }
+ $28 = Math_imul($15, $13)|0;
+ $i$09 = 0;
+ while(1) {
+ $29 = (($26) + ($i$09<<1)|0);
+ $30 = HEAP16[$29>>1]|0;
+ $31 = $30&65535;
+ $32 = ($30&65535) >>> 15;
+ $33 = $32&65535;
+ $34 = $31 << 1;
+ $35 = $34 | $33;
+ $36 = $35&65535;
+ HEAP16[$29>>1] = $36;
+ $37 = (($i$09) + 1)|0;
+ $exitcond = ($37|0)==($28|0);
+ if ($exitcond) {
+ $image$sroa$0$0 = $26;$image$sroa$59$0 = 5;
+ break;
+ } else {
+ $i$09 = $37;
+ }
+ }
+ } else {
+ switch ($23|0) {
+ case 61440: {
+ break;
+ }
+ default: {
+ $image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
+ break L7;
+ }
+ }
+ $38 = Math_imul($15, $13)|0;
+ $39 = $38 << 1;
+ $40 = (_malloc($39)|0);
+ (_fread($40,$39,1,$0)|0);
+ $41 = ($38|0)>(0);
+ if (!($41)) {
+ $image$sroa$0$0 = $40;$image$sroa$59$0 = 6;
+ break;
+ }
+ $42 = Math_imul($15, $13)|0;
+ $i2$011 = 0;
+ while(1) {
+ $43 = (($40) + ($i2$011<<1)|0);
+ $44 = HEAP16[$43>>1]|0;
+ $45 = $44&65535;
+ $46 = ($44&65535) >>> 12;
+ $47 = $46&65535;
+ $48 = $45 << 4;
+ $49 = $48 | $47;
+ $50 = $49&65535;
+ HEAP16[$43>>1] = $50;
+ $51 = (($i2$011) + 1)|0;
+ $exitcond13 = ($51|0)==($42|0);
+ if ($exitcond13) {
+ $image$sroa$0$0 = $40;$image$sroa$59$0 = 6;
+ break;
+ } else {
+ $i2$011 = $51;
+ }
+ }
+ }
+ } else {
+ $image$sroa$0$0 = 0;$image$sroa$59$0 = 0;
+ }
+ } while(0);
+ $52 = HEAP32[$6>>2]|0;
+ $53 = ($52|0)==(64);
+ $54 = HEAP32[$10>>2]|0;
+ $55 = ($54|0)==(24);
+ $or$cond = $53 & $55;
+ L24: do {
+ if ($or$cond) {
+ $56 = ($13*3)|0;
+ $57 = Math_imul($56, $15)|0;
+ $58 = (_malloc($57)|0);
+ (_fread($58,$57,1,$0)|0);
+ $image$sroa$0$1 = $58;$image$sroa$56$0 = 1;$image$sroa$59$1 = 4;
+ } else {
+ $59 = ($52|0)==(65);
+ $60 = ($54|0)==(32);
+ $or$cond3 = $59 & $60;
+ if ($or$cond3) {
+ $61 = $13 << 2;
+ $62 = Math_imul($61, $15)|0;
+ $63 = (_malloc($62)|0);
+ (_fread($63,$62,1,$0)|0);
+ $64 = ($62|0)>(0);
+ if ($64) {
+ $i3$08 = 0;
+ } else {
+ $image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7;
+ break;
+ }
+ while(1) {
+ $65 = (($63) + ($i3$08)|0);
+ $66 = HEAP8[$65>>0]|0;
+ $67 = $i3$08 | 2;
+ $68 = (($63) + ($67)|0);
+ $69 = HEAP8[$68>>0]|0;
+ HEAP8[$65>>0] = $69;
+ HEAP8[$68>>0] = $66;
+ $70 = (($i3$08) + 4)|0;
+ $71 = ($70|0)<($62|0);
+ if ($71) {
+ $i3$08 = $70;
+ } else {
+ $image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7;
+ break L24;
+ }
+ }
+ }
+ $72 = $52 & -2;
+ $switch = ($72|0)!=(4);
+ $73 = HEAP32[$8>>2]|0;
+ $74 = ($73|0)==(0);
+ $or$cond5 = $switch | $74;
+ if ($or$cond5) {
+ $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$56$0 = 1;$image$sroa$59$1 = $image$sroa$59$0;
+ } else {
+ $75 = ((($header)) + 24|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = ($76>>>0)>(1);
+ $78 = ((($header)) + 16|0);
+ $79 = HEAP32[$78>>2]|0;
+ $80 = $77&1;
+ $bufsize$0 = $79 << $80;
+ HEAP32[$vararg_buffer24>>2] = $79;
+ _TraceLog(3,12541,$vararg_buffer24);
+ $81 = (_malloc($bufsize$0)|0);
+ (_fread($81,1,$bufsize$0,$0)|0);
+ $82 = HEAP32[$75>>2]|0;
+ $83 = HEAP32[$8>>2]|0;
+ $switch$split12D = ($83|0)<(861165636);
+ if ($switch$split12D) {
+ switch ($83|0) {
+ case 827611204: {
+ break;
+ }
+ default: {
+ $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0;
+ break L24;
+ }
+ }
+ $84 = HEAP32[$6>>2]|0;
+ $85 = ($84|0)==(4);
+ $$ = $85 ? 8 : 9;
+ $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $$;
+ break;
+ }
+ $switch$split42D = ($83|0)<(894720068);
+ if ($switch$split42D) {
+ switch ($83|0) {
+ case 861165636: {
+ break;
+ }
+ default: {
+ $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0;
+ break L24;
+ }
+ }
+ $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 10;
+ break;
+ } else {
+ switch ($83|0) {
+ case 894720068: {
+ break;
+ }
+ default: {
+ $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0;
+ break L24;
+ }
+ }
+ $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 11;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $image$sroa$0$2 = $image$sroa$0$1;$image$sroa$26$0 = $13;$image$sroa$41$0 = $15;$image$sroa$56$1 = $image$sroa$56$0;$image$sroa$59$2 = $image$sroa$59$1;
+ } else {
+ HEAP32[$vararg_buffer1>>2] = $fileName;
+ _TraceLog(2,12331,$vararg_buffer1);
+ $image$sroa$0$2 = 0;$image$sroa$26$0 = 0;$image$sroa$41$0 = 0;$image$sroa$56$1 = 0;$image$sroa$59$2 = 0;
+ }
+ (_fclose($0)|0);
+ $image$sroa$0$3 = $image$sroa$0$2;$image$sroa$26$1 = $image$sroa$26$0;$image$sroa$41$1 = $image$sroa$41$0;$image$sroa$56$2 = $image$sroa$56$1;$image$sroa$59$3 = $image$sroa$59$2;
+ HEAP32[$agg$result>>2] = $image$sroa$0$3;
+ $86 = ((($agg$result)) + 4|0);
+ HEAP32[$86>>2] = $image$sroa$26$1;
+ $87 = ((($agg$result)) + 8|0);
+ HEAP32[$87>>2] = $image$sroa$41$1;
+ $88 = ((($agg$result)) + 12|0);
+ HEAP32[$88>>2] = $image$sroa$56$2;
+ $89 = ((($agg$result)) + 16|0);
+ HEAP32[$89>>2] = $image$sroa$59$3;
+ STACKTOP = sp;return;
+}
+function _LoadPKM($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$ = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0;
+ var $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $header = sp + 40|0;
+ $0 = (_fopen($fileName,10906)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,12125,$vararg_buffer);
+ $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$1 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$1;
+ $43 = ((($agg$result)) + 4|0);
+ HEAP32[$43>>2] = $image$sroa$4$1;
+ $44 = ((($agg$result)) + 8|0);
+ HEAP32[$44>>2] = $image$sroa$7$1;
+ $45 = ((($agg$result)) + 12|0);
+ HEAP32[$45>>2] = $image$sroa$10$1;
+ $46 = ((($agg$result)) + 16|0);
+ HEAP32[$46>>2] = $image$sroa$12$1;
+ STACKTOP = sp;return;
+ }
+ (_fread($header,16,1,$0)|0);
+ $2 = (_strncmp($header,12159,4)|0);
+ $3 = ($2|0)==(0);
+ L5: do {
+ if ($3) {
+ $4 = ((($header)) + 6|0);
+ $5 = HEAP16[$4>>1]|0;
+ $6 = $5&65535;
+ $7 = $6 << 8;
+ $8 = $6 >>> 8;
+ $9 = $7 | $8;
+ $10 = $9&65535;
+ HEAP16[$4>>1] = $10;
+ $11 = ((($header)) + 8|0);
+ $12 = HEAP16[$11>>1]|0;
+ $13 = $12&65535;
+ $14 = $13 << 8;
+ $15 = $13 >>> 8;
+ $16 = $14 | $15;
+ $17 = $16&65535;
+ HEAP16[$11>>1] = $17;
+ $18 = ((($header)) + 10|0);
+ $19 = HEAP16[$18>>1]|0;
+ $20 = $19&65535;
+ $21 = $20 << 8;
+ $22 = $20 >>> 8;
+ $23 = $21 | $22;
+ $24 = $23&65535;
+ HEAP16[$18>>1] = $24;
+ $25 = HEAP16[$11>>1]|0;
+ $26 = $25&65535;
+ HEAP32[$vararg_buffer4>>2] = $26;
+ _TraceLog(3,12212,$vararg_buffer4);
+ $27 = HEAP16[$18>>1]|0;
+ $28 = $27&65535;
+ HEAP32[$vararg_buffer7>>2] = $28;
+ _TraceLog(3,12238,$vararg_buffer7);
+ $29 = HEAP16[$4>>1]|0;
+ $30 = $29&65535;
+ HEAP32[$vararg_buffer10>>2] = $30;
+ _TraceLog(3,12265,$vararg_buffer10);
+ $31 = HEAP16[$11>>1]|0;
+ $32 = $31&65535;
+ $33 = HEAP16[$18>>1]|0;
+ $34 = $33&65535;
+ $35 = HEAP16[$4>>1]|0;
+ $36 = ($35<<16>>16)==(3);
+ $$ = $36 ? 8 : 4;
+ $37 = Math_imul($34, $32)|0;
+ $38 = Math_imul($37, $$)|0;
+ $39 = $38 >>> 3;
+ $40 = (_malloc($39)|0);
+ (_fread($40,1,$39,$0)|0);
+ $41 = HEAP16[$4>>1]|0;
+ switch ($41<<16>>16) {
+ case 0: {
+ $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 12;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34;
+ break L5;
+ break;
+ }
+ case 1: {
+ $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 13;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34;
+ break L5;
+ break;
+ }
+ default: {
+ $42 = ($41<<16>>16)==(3);
+ $$1 = $42 ? 14 : 0;
+ $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = $$1;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34;
+ break L5;
+ }
+ }
+ } else {
+ HEAP32[$vararg_buffer1>>2] = $fileName;
+ _TraceLog(2,12164,$vararg_buffer1);
+ $image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$0 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0;
+ }
+ } while(0);
+ (_fclose($0)|0);
+ $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$1;
+ $43 = ((($agg$result)) + 4|0);
+ HEAP32[$43>>2] = $image$sroa$4$1;
+ $44 = ((($agg$result)) + 8|0);
+ HEAP32[$44>>2] = $image$sroa$7$1;
+ $45 = ((($agg$result)) + 12|0);
+ HEAP32[$45>>2] = $image$sroa$10$1;
+ $46 = ((($agg$result)) + 16|0);
+ HEAP32[$46>>2] = $image$sroa$12$1;
+ STACKTOP = sp;return;
+}
+function _LoadKTX($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dataSize = 0, $header = 0, $i$01 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$3$0 = 0, $image$sroa$3$1 = 0, $image$sroa$5$0 = 0, $image$sroa$5$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$9$0 = 0, $image$sroa$9$1 = 0, $unused = 0, $vararg_buffer = 0;
+ var $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $header = sp + 40|0;
+ $unused = sp + 104|0;
+ $dataSize = sp + 36|0;
+ $0 = (_fopen($fileName,10906)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,11956,$vararg_buffer);
+ $image$sroa$0$1 = 0;$image$sroa$3$1 = 0;$image$sroa$5$1 = 0;$image$sroa$7$1 = 0;$image$sroa$9$1 = 0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$1;
+ $40 = ((($agg$result)) + 4|0);
+ HEAP32[$40>>2] = $image$sroa$3$1;
+ $41 = ((($agg$result)) + 8|0);
+ HEAP32[$41>>2] = $image$sroa$5$1;
+ $42 = ((($agg$result)) + 12|0);
+ HEAP32[$42>>2] = $image$sroa$7$1;
+ $43 = ((($agg$result)) + 16|0);
+ HEAP32[$43>>2] = $image$sroa$9$1;
+ STACKTOP = sp;return;
+ }
+ (_fread($header,64,1,$0)|0);
+ $2 = ((($header)) + 1|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ($3<<24>>24)==(75);
+ L5: do {
+ if ($4) {
+ $5 = ((($header)) + 2|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ($6<<24>>24)==(84);
+ if ($7) {
+ $8 = ((($header)) + 3|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)==(88);
+ if ($10) {
+ $11 = ((($header)) + 4|0);
+ $12 = HEAP8[$11>>0]|0;
+ $13 = ($12<<24>>24)==(32);
+ if ($13) {
+ $14 = ((($header)) + 5|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = ($15<<24>>24)==(49);
+ if ($16) {
+ $17 = ((($header)) + 6|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = ($18<<24>>24)==(49);
+ if ($19) {
+ $20 = ((($header)) + 36|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = ((($header)) + 40|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = ((($header)) + 56|0);
+ $25 = HEAP32[$24>>2]|0;
+ HEAP32[$vararg_buffer4>>2] = $21;
+ _TraceLog(3,12043,$vararg_buffer4);
+ $26 = HEAP32[$22>>2]|0;
+ HEAP32[$vararg_buffer7>>2] = $26;
+ _TraceLog(3,12069,$vararg_buffer7);
+ $27 = ((($header)) + 28|0);
+ $28 = HEAP32[$27>>2]|0;
+ HEAP32[$vararg_buffer10>>2] = $28;
+ _TraceLog(3,12096,$vararg_buffer10);
+ $29 = ((($header)) + 60|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = ($30|0)==(0);
+ if (!($31)) {
+ $32 = HEAP32[$29>>2]|0;
+ $i$01 = 0;
+ while(1) {
+ (_fread($unused,1,1,$0)|0);
+ $33 = (($i$01) + 1)|0;
+ $34 = ($33>>>0)<($32>>>0);
+ if ($34) {
+ $i$01 = $33;
+ } else {
+ break;
+ }
+ }
+ }
+ (_fread($dataSize,4,1,$0)|0);
+ $35 = HEAP32[$dataSize>>2]|0;
+ $36 = (_malloc($35)|0);
+ $37 = HEAP32[$dataSize>>2]|0;
+ (_fread($36,1,$37,$0)|0);
+ $38 = HEAP32[$27>>2]|0;
+ switch ($38|0) {
+ case 36196: {
+ $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 12;
+ break L5;
+ break;
+ }
+ case 37492: {
+ $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 13;
+ break L5;
+ break;
+ }
+ default: {
+ $39 = ($38|0)==(37496);
+ $$ = $39 ? 14 : 0;
+ $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = $$;
+ break L5;
+ }
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ } while(0);
+ if ((label|0) == 9) {
+ HEAP32[$vararg_buffer1>>2] = $fileName;
+ _TraceLog(2,11996,$vararg_buffer1);
+ $image$sroa$0$0 = 0;$image$sroa$3$0 = 0;$image$sroa$5$0 = 0;$image$sroa$7$0 = 0;$image$sroa$9$0 = 0;
+ }
+ (_fclose($0)|0);
+ $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$3$1 = $image$sroa$3$0;$image$sroa$5$1 = $image$sroa$5$0;$image$sroa$7$1 = $image$sroa$7$0;$image$sroa$9$1 = $image$sroa$9$0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$1;
+ $40 = ((($agg$result)) + 4|0);
+ HEAP32[$40>>2] = $image$sroa$3$1;
+ $41 = ((($agg$result)) + 8|0);
+ HEAP32[$41>>2] = $image$sroa$5$1;
+ $42 = ((($agg$result)) + 12|0);
+ HEAP32[$42>>2] = $image$sroa$7$1;
+ $43 = ((($agg$result)) + 16|0);
+ HEAP32[$43>>2] = $image$sroa$9$1;
+ STACKTOP = sp;return;
+}
+function _LoadPVR($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$ = 0, $$1 = 0, $$2 = 0, $$pr = 0, $$pr3 = 0, $$pr5 = 0, $$pr7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
+ var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
+ var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
+ var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
+ var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
+ var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $bpp$0 = 0, $header = 0, $i$08 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$10$2 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$12$2 = 0, $image$sroa$12$3 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$4$2 = 0;
+ var $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$7$2 = 0, $pvrVersion = 0, $unused = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $pvrVersion = sp + 73|0;
+ $header = sp + 20|0;
+ $unused = sp + 72|0;
+ $0 = (_fopen($fileName,10906)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,11824,$vararg_buffer);
+ $image$sroa$0$2 = 0;$image$sroa$10$2 = 0;$image$sroa$12$3 = 0;$image$sroa$4$2 = 0;$image$sroa$7$2 = 0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$2;
+ $113 = ((($agg$result)) + 4|0);
+ HEAP32[$113>>2] = $image$sroa$4$2;
+ $114 = ((($agg$result)) + 8|0);
+ HEAP32[$114>>2] = $image$sroa$7$2;
+ $115 = ((($agg$result)) + 12|0);
+ HEAP32[$115>>2] = $image$sroa$10$2;
+ $116 = ((($agg$result)) + 16|0);
+ HEAP32[$116>>2] = $image$sroa$12$3;
+ STACKTOP = sp;return;
+ }
+ HEAP8[$pvrVersion>>0] = 0;
+ (_fread($pvrVersion,1,1,$0)|0);
+ (_fseek($0,0,0)|0);
+ $2 = HEAP8[$pvrVersion>>0]|0;
+ switch ($2<<24>>24) {
+ case 80: {
+ (_fread($header,52,1,$0)|0);
+ $3 = HEAP8[$header>>0]|0;
+ $4 = ($3<<24>>24)==(80);
+ if ($4) {
+ $5 = ((($header)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ($6<<24>>24)==(86);
+ if ($7) {
+ $8 = ((($header)) + 2|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)==(82);
+ if ($10) {
+ $11 = ((($header)) + 3|0);
+ $12 = HEAP8[$11>>0]|0;
+ $13 = ($12<<24>>24)==(3);
+ if ($13) {
+ $14 = ((($header)) + 28|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = ((($header)) + 24|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ((($header)) + 44|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = ((($header)) + 8|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)==(108);
+ do {
+ if ($22) {
+ $23 = ((($header)) + 9|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = ($24<<24>>24)==(0);
+ if ($25) {
+ $26 = ((($header)) + 12|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = ($27<<24>>24)==(8);
+ if ($28) {
+ $image$sroa$12$0 = 1;
+ break;
+ }
+ }
+ $$pr = HEAP8[$20>>0]|0;
+ $29 = ($$pr<<24>>24)==(108);
+ if ($29) {
+ $30 = ((($header)) + 9|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = ($31<<24>>24)==(97);
+ if ($32) {
+ $33 = ((($header)) + 12|0);
+ $34 = HEAP8[$33>>0]|0;
+ $35 = ($34<<24>>24)==(8);
+ if ($35) {
+ $36 = ((($header)) + 13|0);
+ $37 = HEAP8[$36>>0]|0;
+ $38 = ($37<<24>>24)==(8);
+ if ($38) {
+ $image$sroa$12$0 = 2;
+ } else {
+ label = 16;
+ }
+ } else {
+ label = 16;
+ }
+ } else {
+ label = 16;
+ }
+ } else {
+ $39 = $$pr;
+ label = 17;
+ }
+ } else {
+ label = 16;
+ }
+ } while(0);
+ if ((label|0) == 16) {
+ $$pr3 = HEAP8[$20>>0]|0;
+ $39 = $$pr3;
+ label = 17;
+ }
+ L22: do {
+ if ((label|0) == 17) {
+ $40 = ($39<<24>>24)==(114);
+ if ($40) {
+ $41 = ((($header)) + 9|0);
+ $42 = HEAP8[$41>>0]|0;
+ $43 = ($42<<24>>24)==(103);
+ if ($43) {
+ $44 = ((($header)) + 10|0);
+ $45 = HEAP8[$44>>0]|0;
+ $46 = ($45<<24>>24)==(98);
+ if ($46) {
+ $47 = ((($header)) + 11|0);
+ $48 = HEAP8[$47>>0]|0;
+ switch ($48<<24>>24) {
+ case 97: {
+ break;
+ }
+ case 0: {
+ $83 = ((($header)) + 12|0);
+ $84 = HEAP8[$83>>0]|0;
+ $85 = ($84<<24>>24)==(5);
+ if ($85) {
+ $86 = ((($header)) + 13|0);
+ $87 = HEAP8[$86>>0]|0;
+ $88 = ($87<<24>>24)==(6);
+ if ($88) {
+ $89 = ((($header)) + 14|0);
+ $90 = HEAP8[$89>>0]|0;
+ $91 = ($90<<24>>24)==(5);
+ if ($91) {
+ $image$sroa$12$0 = 3;
+ break L22;
+ }
+ }
+ $$pr7 = HEAP8[$83>>0]|0;
+ $92 = $$pr7;
+ } else {
+ $92 = $84;
+ }
+ $93 = ($92<<24>>24)==(8);
+ if (!($93)) {
+ $image$sroa$12$0 = 0;
+ break L22;
+ }
+ $94 = ((($header)) + 13|0);
+ $95 = HEAP8[$94>>0]|0;
+ $96 = ($95<<24>>24)==(8);
+ if (!($96)) {
+ $image$sroa$12$0 = 0;
+ break L22;
+ }
+ $97 = ((($header)) + 14|0);
+ $98 = HEAP8[$97>>0]|0;
+ $99 = ($98<<24>>24)==(8);
+ $$1 = $99 ? 4 : 0;
+ $image$sroa$12$0 = $$1;
+ break L22;
+ break;
+ }
+ default: {
+ $image$sroa$12$0 = 0;
+ break L22;
+ }
+ }
+ $49 = ((($header)) + 12|0);
+ $50 = HEAP8[$49>>0]|0;
+ $51 = ($50<<24>>24)==(5);
+ if ($51) {
+ $52 = ((($header)) + 13|0);
+ $53 = HEAP8[$52>>0]|0;
+ $54 = ($53<<24>>24)==(5);
+ if ($54) {
+ $55 = ((($header)) + 14|0);
+ $56 = HEAP8[$55>>0]|0;
+ $57 = ($56<<24>>24)==(5);
+ if ($57) {
+ $58 = ((($header)) + 15|0);
+ $59 = HEAP8[$58>>0]|0;
+ $60 = ($59<<24>>24)==(1);
+ if ($60) {
+ $image$sroa$12$0 = 5;
+ break;
+ }
+ }
+ }
+ $$pr5 = HEAP8[$49>>0]|0;
+ $61 = $$pr5;
+ } else {
+ $61 = $50;
+ }
+ $62 = ($61<<24>>24)==(4);
+ if ($62) {
+ $63 = ((($header)) + 13|0);
+ $64 = HEAP8[$63>>0]|0;
+ $65 = ($64<<24>>24)==(4);
+ if ($65) {
+ $66 = ((($header)) + 14|0);
+ $67 = HEAP8[$66>>0]|0;
+ $68 = ($67<<24>>24)==(4);
+ if ($68) {
+ $69 = ((($header)) + 15|0);
+ $70 = HEAP8[$69>>0]|0;
+ $71 = ($70<<24>>24)==(4);
+ if ($71) {
+ $image$sroa$12$0 = 6;
+ break;
+ }
+ }
+ }
+ }
+ $72 = HEAP8[$49>>0]|0;
+ $73 = ($72<<24>>24)==(8);
+ if (!($73)) {
+ $image$sroa$12$0 = 0;
+ break;
+ }
+ $74 = ((($header)) + 13|0);
+ $75 = HEAP8[$74>>0]|0;
+ $76 = ($75<<24>>24)==(8);
+ if (!($76)) {
+ $image$sroa$12$0 = 0;
+ break;
+ }
+ $77 = ((($header)) + 14|0);
+ $78 = HEAP8[$77>>0]|0;
+ $79 = ($78<<24>>24)==(8);
+ if (!($79)) {
+ $image$sroa$12$0 = 0;
+ break;
+ }
+ $80 = ((($header)) + 15|0);
+ $81 = HEAP8[$80>>0]|0;
+ $82 = ($81<<24>>24)==(8);
+ $$ = $82 ? 7 : 0;
+ $image$sroa$12$0 = $$;
+ break;
+ }
+ }
+ }
+ $100 = HEAP8[$20>>0]|0;
+ $101 = ($100<<24>>24)==(2);
+ if ($101) {
+ $image$sroa$12$0 = 15;
+ } else {
+ $102 = ($100<<24>>24)==(3);
+ $$2 = $102 ? 16 : 0;
+ $image$sroa$12$0 = $$2;
+ }
+ }
+ } while(0);
+ HEAP8[$unused>>0] = 0;
+ $103 = ((($header)) + 48|0);
+ $104 = HEAP32[$103>>2]|0;
+ $105 = ($104|0)==(0);
+ if (!($105)) {
+ $i$08 = 0;
+ while(1) {
+ (_fread($unused,1,1,$0)|0);
+ $106 = (($i$08) + 1)|0;
+ $107 = HEAP32[$103>>2]|0;
+ $108 = ($106>>>0)<($107>>>0);
+ if ($108) {
+ $i$08 = $106;
+ } else {
+ break;
+ }
+ }
+ }
+ switch ($image$sroa$12$0|0) {
+ case 1: {
+ $bpp$0 = 8;
+ break;
+ }
+ case 6: case 3: case 5: case 2: {
+ $bpp$0 = 16;
+ break;
+ }
+ case 7: {
+ $bpp$0 = 32;
+ break;
+ }
+ case 4: {
+ $bpp$0 = 24;
+ break;
+ }
+ case 16: case 15: {
+ $bpp$0 = 4;
+ break;
+ }
+ default: {
+ $bpp$0 = 0;
+ }
+ }
+ $109 = Math_imul($17, $15)|0;
+ $110 = Math_imul($109, $bpp$0)|0;
+ $111 = (($110|0) / 8)&-1;
+ $112 = (_malloc($111)|0);
+ (_fread($112,$111,1,$0)|0);
+ $image$sroa$0$0 = $112;$image$sroa$10$0 = $19;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$0 = $15;$image$sroa$7$0 = $17;
+ } else {
+ label = 8;
+ }
+ } else {
+ label = 8;
+ }
+ } else {
+ label = 8;
+ }
+ } else {
+ label = 8;
+ }
+ if ((label|0) == 8) {
+ HEAP32[$vararg_buffer1>>2] = $fileName;
+ _TraceLog(2,11858,$vararg_buffer1);
+ $image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$1 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0;
+ }
+ $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$2 = $image$sroa$12$1;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0;
+ break;
+ }
+ case 52: {
+ _TraceLog(0,11906,$vararg_buffer4);
+ $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0;
+ break;
+ }
+ default: {
+ $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0;
+ }
+ }
+ (_fclose($0)|0);
+ $image$sroa$0$2 = $image$sroa$0$1;$image$sroa$10$2 = $image$sroa$10$1;$image$sroa$12$3 = $image$sroa$12$2;$image$sroa$4$2 = $image$sroa$4$1;$image$sroa$7$2 = $image$sroa$7$1;
+ HEAP32[$agg$result>>2] = $image$sroa$0$2;
+ $113 = ((($agg$result)) + 4|0);
+ HEAP32[$113>>2] = $image$sroa$4$2;
+ $114 = ((($agg$result)) + 8|0);
+ HEAP32[$114>>2] = $image$sroa$7$2;
+ $115 = ((($agg$result)) + 12|0);
+ HEAP32[$115>>2] = $image$sroa$10$2;
+ $116 = ((($agg$result)) + 16|0);
+ HEAP32[$116>>2] = $image$sroa$12$3;
+ STACKTOP = sp;return;
+}
+function _LoadASTC($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$14$0 = 0, $image$sroa$14$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$8$0 = 0, $image$sroa$8$1 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer4 = 0;
+ var $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $vararg_buffer14 = sp + 40|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $header = sp + 48|0;
+ $0 = (_fopen($fileName,10906)|0);
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,11623,$vararg_buffer);
+ $image$sroa$0$1 = 0;$image$sroa$12$1 = 0;$image$sroa$14$1 = 0;$image$sroa$4$1 = 0;$image$sroa$8$1 = 0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$1;
+ $58 = ((($agg$result)) + 4|0);
+ HEAP32[$58>>2] = $image$sroa$4$1;
+ $59 = ((($agg$result)) + 8|0);
+ HEAP32[$59>>2] = $image$sroa$8$1;
+ $60 = ((($agg$result)) + 12|0);
+ HEAP32[$60>>2] = $image$sroa$12$1;
+ $61 = ((($agg$result)) + 16|0);
+ HEAP32[$61>>2] = $image$sroa$14$1;
+ STACKTOP = sp;return;
+ }
+ (_fread($header,16,1,$0)|0);
+ $2 = ((($header)) + 3|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ($3<<24>>24)==(92);
+ L5: do {
+ if ($4) {
+ $5 = ((($header)) + 2|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ($6<<24>>24)==(-95);
+ if ($7) {
+ $8 = ((($header)) + 1|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)==(-85);
+ $11 = HEAP8[$header>>0]|0;
+ $12 = ($11<<24>>24)==(19);
+ $or$cond = $10 & $12;
+ if ($or$cond) {
+ $13 = ((($header)) + 9|0);
+ $14 = HEAP8[$13>>0]|0;
+ $15 = $14&255;
+ $16 = $15 << 16;
+ $17 = ((($header)) + 8|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = $18&255;
+ $20 = $19 << 8;
+ $21 = $20 | $16;
+ $22 = ((($header)) + 7|0);
+ $23 = HEAP8[$22>>0]|0;
+ $24 = $23&255;
+ $25 = $21 | $24;
+ $26 = ((($header)) + 12|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = $27&255;
+ $29 = $28 << 16;
+ $30 = ((($header)) + 11|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = $31&255;
+ $33 = $32 << 8;
+ $34 = $33 | $29;
+ $35 = ((($header)) + 10|0);
+ $36 = HEAP8[$35>>0]|0;
+ $37 = $36&255;
+ $38 = $34 | $37;
+ HEAP32[$vararg_buffer4>>2] = $25;
+ _TraceLog(3,11707,$vararg_buffer4);
+ HEAP32[$vararg_buffer7>>2] = $38;
+ _TraceLog(3,11728,$vararg_buffer7);
+ $39 = ((($header)) + 4|0);
+ $40 = HEAP8[$39>>0]|0;
+ $41 = $40&255;
+ $42 = ((($header)) + 5|0);
+ $43 = HEAP8[$42>>0]|0;
+ $44 = $43&255;
+ HEAP32[$vararg_buffer10>>2] = $41;
+ $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $44;
+ _TraceLog(3,11750,$vararg_buffer10);
+ $45 = HEAP8[$39>>0]|0;
+ $46 = $45&255;
+ $47 = HEAP8[$42>>0]|0;
+ $48 = $47&255;
+ $49 = Math_imul($48, $46)|0;
+ $50 = (128 / ($49>>>0))&-1;
+ $51 = ($50|0)==(8);
+ $52 = ($50|0)==(2);
+ switch ($50|0) {
+ case 2: case 8: {
+ $53 = Math_imul($38, $25)|0;
+ $54 = Math_imul($53, $50)|0;
+ $55 = $54 >>> 3;
+ $56 = (_malloc($55)|0);
+ (_fread($56,$55,1,$0)|0);
+ $57 = $51 | $52;
+ $$$ = $57 ? 17 : 0;
+ $image$sroa$0$0 = $56;$image$sroa$12$0 = 1;$image$sroa$14$0 = $$$;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38;
+ break L5;
+ break;
+ }
+ default: {
+ HEAP32[$vararg_buffer14>>2] = $fileName;
+ _TraceLog(2,11775,$vararg_buffer14);
+ $image$sroa$0$0 = 0;$image$sroa$12$0 = 1;$image$sroa$14$0 = 0;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38;
+ break L5;
+ }
+ }
+ } else {
+ label = 6;
+ }
+ } else {
+ label = 6;
+ }
+ } else {
+ label = 6;
+ }
+ } while(0);
+ if ((label|0) == 6) {
+ HEAP32[$vararg_buffer1>>2] = $fileName;
+ _TraceLog(2,11658,$vararg_buffer1);
+ $image$sroa$0$0 = 0;$image$sroa$12$0 = 0;$image$sroa$14$0 = 0;$image$sroa$4$0 = 0;$image$sroa$8$0 = 0;
+ }
+ (_fclose($0)|0);
+ $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$14$1 = $image$sroa$14$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$8$1 = $image$sroa$8$0;
+ HEAP32[$agg$result>>2] = $image$sroa$0$1;
+ $58 = ((($agg$result)) + 4|0);
+ HEAP32[$58>>2] = $image$sroa$4$1;
+ $59 = ((($agg$result)) + 8|0);
+ HEAP32[$59>>2] = $image$sroa$8$1;
+ $60 = ((($agg$result)) + 12|0);
+ HEAP32[$60>>2] = $image$sroa$12$1;
+ $61 = ((($agg$result)) + 16|0);
+ HEAP32[$61>>2] = $image$sroa$14$1;
+ STACKTOP = sp;return;
+}
+function _LoadOBJ($agg$result,$fileName) {
+ $agg$result = $agg$result|0;
+ $fileName = $fileName|0;
+ var $$byval_copy89 = 0, $$byval_copy90 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
+ var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
+ var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
+ var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0;
+ var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0;
+ var $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0;
+ var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0;
+ var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0;
+ var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0.0, $246 = 0.0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0;
+ var $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0.0, $272 = 0.0, $273 = 0, $274 = 0, $275 = 0;
+ var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
+ var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
+ var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
+ var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
+ var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $comments = 0, $countNormals$0$ph41 = 0, $countNormals$0$ph838 = 0, $countNormals$0$ph838$lcssa = 0, $countTexCoords$0$ph1137 = 0, $countTexCoords$0$ph1137$lcssa = 0, $countTexCoords$0$ph1137$lcssa218 = 0, $countTexCoords$0$ph42 = 0, $countTexCoords$0$ph939 = 0, $countVertex$0$ph40 = 0;
+ var $dataType = 0, $mesh$sroa$48 = 0, $midNormals$0 = 0, $midTexCoords$0 = 0, $nCounter$0$ph = 0, $nCounter$0$ph$ph = 0, $nCounter$1 = 0, $nCounter$1$lcssa = 0, $norm = 0, $numNormals$0$ph16$lcssa32 = 0, $numNormals$0$ph1671 = 0, $numNormals$0$ph1671$lcssa234 = 0, $numNormals$0$ph83 = 0, $numTexCoords$0$ph1772 = 0, $numTexCoords$0$ph20$lcssa31 = 0, $numTexCoords$0$ph2061 = 0, $numTexCoords$0$ph2061$lcssa229 = 0, $numTexCoords$0$ph2061$lcssa230 = 0, $numTexCoords$0$ph84 = 0, $numTriangles$0$ph1873 = 0;
+ var $numTriangles$0$ph2162 = 0, $numTriangles$0$ph23$lcssa28 = 0, $numTriangles$0$ph2352 = 0, $numTriangles$0$ph2352$lcssa = 0, $numTriangles$0$ph2352$lcssa$lcssa = 0, $numTriangles$0$ph2352$lcssa$lcssa226 = 0, $numTriangles$0$ph85 = 0, $numVertex$0$ph$lcssa = 0, $numVertex$0$ph82 = 0, $or$cond = 0, $tcCounter$0$ph$ph = 0, $useless = 0, $vCounter$0$ph = 0, $vCounter$0$ph$ph = 0, $vNum = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0;
+ var $vararg_buffer29 = 0, $vararg_buffer34 = 0, $vararg_buffer37 = 0, $vararg_buffer4 = 0, $vararg_buffer42 = 0, $vararg_buffer45 = 0, $vararg_buffer50 = 0, $vararg_buffer53 = 0, $vararg_buffer56 = 0, $vararg_buffer59 = 0, $vararg_buffer64 = 0, $vararg_buffer7 = 0, $vararg_buffer72 = 0, $vararg_buffer83 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0, $vararg_ptr18 = 0, $vararg_ptr22 = 0, $vararg_ptr32 = 0, $vararg_ptr33 = 0;
+ var $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr48 = 0, $vararg_ptr49 = 0, $vararg_ptr62 = 0, $vararg_ptr63 = 0, $vararg_ptr67 = 0, $vararg_ptr68 = 0, $vararg_ptr69 = 0, $vararg_ptr70 = 0, $vararg_ptr71 = 0, $vararg_ptr75 = 0, $vararg_ptr76 = 0, $vararg_ptr77 = 0, $vararg_ptr78 = 0, $vararg_ptr79 = 0, $vararg_ptr80 = 0, $vararg_ptr81 = 0, $vararg_ptr82 = 0, $vnNum = 0;
+ var $vtNum = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 592|0;
+ $$byval_copy90 = sp + 288|0;
+ $$byval_copy89 = sp + 272|0;
+ $vararg_buffer83 = sp + 264|0;
+ $vararg_buffer72 = sp + 224|0;
+ $vararg_buffer64 = sp + 200|0;
+ $vararg_buffer59 = sp + 184|0;
+ $vararg_buffer56 = sp + 176|0;
+ $vararg_buffer53 = sp + 168|0;
+ $vararg_buffer50 = sp + 160|0;
+ $vararg_buffer45 = sp + 144|0;
+ $vararg_buffer42 = sp + 136|0;
+ $vararg_buffer37 = sp + 120|0;
+ $vararg_buffer34 = sp + 112|0;
+ $vararg_buffer29 = sp + 96|0;
+ $vararg_buffer26 = sp + 88|0;
+ $vararg_buffer23 = sp + 80|0;
+ $vararg_buffer11 = sp + 72|0;
+ $vararg_buffer7 = sp + 64|0;
+ $vararg_buffer4 = sp + 56|0;
+ $vararg_buffer1 = sp + 48|0;
+ $vararg_buffer = sp + 40|0;
+ $mesh$sroa$48 = sp;
+ $dataType = sp + 576|0;
+ $comments = sp + 376|0;
+ $useless = sp + 372|0;
+ $vNum = sp + 360|0;
+ $vtNum = sp + 348|0;
+ $vnNum = sp + 336|0;
+ $norm = sp + 324|0;
+ $0 = sp + 312|0;
+ $1 = sp + 300|0;
+ dest=$mesh$sroa$48; stop=dest+36|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $2 = (_fopen($fileName,11292)|0);
+ $3 = ($2|0)==(0|0);
+ if ($3) {
+ HEAP32[$vararg_buffer>>2] = $fileName;
+ _TraceLog(2,11295,$vararg_buffer);
+ $6 = ((($agg$result)) + 32|0);
+ ;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0;HEAP32[$agg$result+12>>2]=0|0;HEAP32[$agg$result+16>>2]=0|0;HEAP32[$agg$result+20>>2]=0|0;HEAP32[$agg$result+24>>2]=0|0;HEAP32[$agg$result+28>>2]=0|0;
+ dest=$6; src=$mesh$sroa$48; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ $4 = (_feof($2)|0);
+ $5 = ($4|0)==(0);
+ L5: do {
+ if ($5) {
+ $numNormals$0$ph83 = 0;$numTexCoords$0$ph84 = 0;$numTriangles$0$ph85 = 0;$numVertex$0$ph82 = 0;
+ while(1) {
+ $numNormals$0$ph1671 = $numNormals$0$ph83;$numTexCoords$0$ph1772 = $numTexCoords$0$ph84;$numTriangles$0$ph1873 = $numTriangles$0$ph85;
+ L8: while(1) {
+ $numTexCoords$0$ph2061 = $numTexCoords$0$ph1772;$numTriangles$0$ph2162 = $numTriangles$0$ph1873;
+ L10: while(1) {
+ $numTriangles$0$ph2352 = $numTriangles$0$ph2162;
+ L12: while(1) {
+ L14: while(1) {
+ HEAP32[$vararg_buffer1>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer1)|0);
+ $7 = HEAP8[$dataType>>0]|0;
+ $8 = $7 << 24 >> 24;
+ switch ($8|0) {
+ case 118: {
+ $numTriangles$0$ph2352$lcssa = $numTriangles$0$ph2352;
+ break L12;
+ break;
+ }
+ case 102: {
+ break L14;
+ break;
+ }
+ case 117: case 109: case 115: case 103: case 111: case 35: {
+ (_fgets($comments,200,$2)|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $9 = (_feof($2)|0);
+ $10 = ($9|0)==(0);
+ if (!($10)) {
+ $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352;$numVertex$0$ph$lcssa = $numVertex$0$ph82;
+ break L5;
+ }
+ }
+ $21 = (($numTriangles$0$ph2352) + 1)|0;
+ (_fgets($comments,200,$2)|0);
+ $22 = (_feof($2)|0);
+ $23 = ($22|0)==(0);
+ if ($23) {
+ $numTriangles$0$ph2352 = $21;
+ } else {
+ $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061;$numTriangles$0$ph23$lcssa28 = $21;$numVertex$0$ph$lcssa = $numVertex$0$ph82;
+ break L5;
+ }
+ }
+ HEAP32[$vararg_buffer4>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer4)|0);
+ $11 = HEAP8[$dataType>>0]|0;
+ switch ($11<<24>>24) {
+ case 110: {
+ $numTexCoords$0$ph2061$lcssa230 = $numTexCoords$0$ph2061;$numTriangles$0$ph2352$lcssa$lcssa226 = $numTriangles$0$ph2352$lcssa;
+ break L10;
+ break;
+ }
+ case 116: {
+ break;
+ }
+ default: {
+ $numNormals$0$ph1671$lcssa234 = $numNormals$0$ph1671;$numTexCoords$0$ph2061$lcssa229 = $numTexCoords$0$ph2061;$numTriangles$0$ph2352$lcssa$lcssa = $numTriangles$0$ph2352$lcssa;
+ break L8;
+ }
+ }
+ $12 = (($numTexCoords$0$ph2061) + 1)|0;
+ (_fgets($comments,200,$2)|0);
+ $13 = (_feof($2)|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $numTexCoords$0$ph2061 = $12;$numTriangles$0$ph2162 = $numTriangles$0$ph2352$lcssa;
+ } else {
+ $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671;$numTexCoords$0$ph20$lcssa31 = $12;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352$lcssa;$numVertex$0$ph$lcssa = $numVertex$0$ph82;
+ break L5;
+ }
+ }
+ $15 = (($numNormals$0$ph1671) + 1)|0;
+ (_fgets($comments,200,$2)|0);
+ $16 = (_feof($2)|0);
+ $17 = ($16|0)==(0);
+ if ($17) {
+ $numNormals$0$ph1671 = $15;$numTexCoords$0$ph1772 = $numTexCoords$0$ph2061$lcssa230;$numTriangles$0$ph1873 = $numTriangles$0$ph2352$lcssa$lcssa226;
+ } else {
+ $numNormals$0$ph16$lcssa32 = $15;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061$lcssa230;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352$lcssa$lcssa226;$numVertex$0$ph$lcssa = $numVertex$0$ph82;
+ break L5;
+ }
+ }
+ $18 = (($numVertex$0$ph82) + 1)|0;
+ (_fgets($comments,200,$2)|0);
+ $19 = (_feof($2)|0);
+ $20 = ($19|0)==(0);
+ if ($20) {
+ $numNormals$0$ph83 = $numNormals$0$ph1671$lcssa234;$numTexCoords$0$ph84 = $numTexCoords$0$ph2061$lcssa229;$numTriangles$0$ph85 = $numTriangles$0$ph2352$lcssa$lcssa;$numVertex$0$ph82 = $18;
+ } else {
+ $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671$lcssa234;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061$lcssa229;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352$lcssa$lcssa;$numVertex$0$ph$lcssa = $18;
+ break;
+ }
+ }
+ } else {
+ $numNormals$0$ph16$lcssa32 = 0;$numTexCoords$0$ph20$lcssa31 = 0;$numTriangles$0$ph23$lcssa28 = 0;$numVertex$0$ph$lcssa = 0;
+ }
+ } while(0);
+ HEAP32[$vararg_buffer7>>2] = $fileName;
+ $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
+ HEAP32[$vararg_ptr10>>2] = $numVertex$0$ph$lcssa;
+ _TraceLog(3,11332,$vararg_buffer7);
+ HEAP32[$vararg_buffer11>>2] = $fileName;
+ $vararg_ptr14 = ((($vararg_buffer11)) + 4|0);
+ HEAP32[$vararg_ptr14>>2] = $numTexCoords$0$ph20$lcssa31;
+ _TraceLog(3,11360,$vararg_buffer11);
+ HEAP32[$$byval_copy89>>2] = $fileName;
+ $vararg_ptr18 = ((($$byval_copy89)) + 4|0);
+ HEAP32[$vararg_ptr18>>2] = $numNormals$0$ph16$lcssa32;
+ _TraceLog(3,11389,$$byval_copy89);
+ HEAP32[$$byval_copy90>>2] = $fileName;
+ $vararg_ptr22 = ((($$byval_copy90)) + 4|0);
+ HEAP32[$vararg_ptr22>>2] = $numTriangles$0$ph23$lcssa28;
+ _TraceLog(3,11416,$$byval_copy90);
+ $24 = ($numVertex$0$ph$lcssa*12)|0;
+ $25 = (_malloc($24)|0);
+ $26 = ($numNormals$0$ph16$lcssa32|0)>(0);
+ if ($26) {
+ $27 = ($numNormals$0$ph16$lcssa32*12)|0;
+ $28 = (_malloc($27)|0);
+ $midNormals$0 = $28;
+ } else {
+ $midNormals$0 = 0;
+ }
+ $29 = ($numTexCoords$0$ph20$lcssa31|0)>(0);
+ if ($29) {
+ $30 = $numTexCoords$0$ph20$lcssa31 << 3;
+ $31 = (_malloc($30)|0);
+ $midTexCoords$0 = $31;
+ } else {
+ $midTexCoords$0 = 0;
+ }
+ _rewind($2);
+ $32 = (_feof($2)|0);
+ $33 = ($32|0)==(0);
+ L31: do {
+ if ($33) {
+ $countNormals$0$ph41 = 0;$countTexCoords$0$ph42 = 0;$countVertex$0$ph40 = 0;
+ while(1) {
+ $countNormals$0$ph838 = $countNormals$0$ph41;$countTexCoords$0$ph939 = $countTexCoords$0$ph42;
+ L34: while(1) {
+ $countTexCoords$0$ph1137 = $countTexCoords$0$ph939;
+ L36: while(1) {
+ L38: while(1) {
+ HEAP32[$vararg_buffer23>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer23)|0);
+ $34 = HEAP8[$dataType>>0]|0;
+ $35 = $34 << 24 >> 24;
+ switch ($35|0) {
+ case 118: {
+ break L38;
+ break;
+ }
+ case 102: case 117: case 109: case 115: case 103: case 111: case 35: {
+ (_fgets($comments,200,$2)|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $36 = (_feof($2)|0);
+ $37 = ($36|0)==(0);
+ if (!($37)) {
+ break L31;
+ }
+ }
+ HEAP32[$vararg_buffer26>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer26)|0);
+ $38 = HEAP8[$dataType>>0]|0;
+ switch ($38<<24>>24) {
+ case 110: {
+ $countTexCoords$0$ph1137$lcssa218 = $countTexCoords$0$ph1137;
+ break L36;
+ break;
+ }
+ case 116: {
+ break;
+ }
+ default: {
+ $countNormals$0$ph838$lcssa = $countNormals$0$ph838;$countTexCoords$0$ph1137$lcssa = $countTexCoords$0$ph1137;
+ break L34;
+ }
+ }
+ HEAPF32[$useless>>2] = 0.0;
+ $39 = (($midTexCoords$0) + ($countTexCoords$0$ph1137<<3)|0);
+ $40 = (((($midTexCoords$0) + ($countTexCoords$0$ph1137<<3)|0)) + 4|0);
+ HEAP32[$vararg_buffer29>>2] = $39;
+ $vararg_ptr32 = ((($vararg_buffer29)) + 4|0);
+ HEAP32[$vararg_ptr32>>2] = $40;
+ $vararg_ptr33 = ((($vararg_buffer29)) + 8|0);
+ HEAP32[$vararg_ptr33>>2] = $useless;
+ (_fscanf($2,11445,$vararg_buffer29)|0);
+ $41 = (($countTexCoords$0$ph1137) + 1)|0;
+ HEAP32[$vararg_buffer34>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer34)|0);
+ $42 = (_feof($2)|0);
+ $43 = ($42|0)==(0);
+ if ($43) {
+ $countTexCoords$0$ph1137 = $41;
+ } else {
+ break L31;
+ }
+ }
+ $44 = (($midNormals$0) + (($countNormals$0$ph838*12)|0)|0);
+ $45 = (((($midNormals$0) + (($countNormals$0$ph838*12)|0)|0)) + 4|0);
+ $46 = (((($midNormals$0) + (($countNormals$0$ph838*12)|0)|0)) + 8|0);
+ HEAP32[$vararg_buffer37>>2] = $44;
+ $vararg_ptr40 = ((($vararg_buffer37)) + 4|0);
+ HEAP32[$vararg_ptr40>>2] = $45;
+ $vararg_ptr41 = ((($vararg_buffer37)) + 8|0);
+ HEAP32[$vararg_ptr41>>2] = $46;
+ (_fscanf($2,11445,$vararg_buffer37)|0);
+ $47 = (($countNormals$0$ph838) + 1)|0;
+ HEAP32[$vararg_buffer42>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer42)|0);
+ $48 = (_feof($2)|0);
+ $49 = ($48|0)==(0);
+ if ($49) {
+ $countNormals$0$ph838 = $47;$countTexCoords$0$ph939 = $countTexCoords$0$ph1137$lcssa218;
+ } else {
+ break L31;
+ }
+ }
+ $50 = (($25) + (($countVertex$0$ph40*12)|0)|0);
+ $51 = (((($25) + (($countVertex$0$ph40*12)|0)|0)) + 4|0);
+ $52 = (((($25) + (($countVertex$0$ph40*12)|0)|0)) + 8|0);
+ HEAP32[$vararg_buffer45>>2] = $50;
+ $vararg_ptr48 = ((($vararg_buffer45)) + 4|0);
+ HEAP32[$vararg_ptr48>>2] = $51;
+ $vararg_ptr49 = ((($vararg_buffer45)) + 8|0);
+ HEAP32[$vararg_ptr49>>2] = $52;
+ (_fscanf($2,11445,$vararg_buffer45)|0);
+ $53 = (($countVertex$0$ph40) + 1)|0;
+ HEAP32[$vararg_buffer50>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer50)|0);
+ $54 = (_feof($2)|0);
+ $55 = ($54|0)==(0);
+ if ($55) {
+ $countNormals$0$ph41 = $countNormals$0$ph838$lcssa;$countTexCoords$0$ph42 = $countTexCoords$0$ph1137$lcssa;$countVertex$0$ph40 = $53;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $56 = ($numTriangles$0$ph23$lcssa28*3)|0;
+ $57 = ($numTriangles$0$ph23$lcssa28*36)|0;
+ $58 = (_malloc($57)|0);
+ $59 = ($numTriangles$0$ph23$lcssa28*6)|0;
+ $60 = ($numTriangles$0$ph23$lcssa28*24)|0;
+ $61 = (_malloc($60)|0);
+ $62 = (_malloc($57)|0);
+ _rewind($2);
+ $63 = ($numNormals$0$ph16$lcssa32|0)==(0);
+ if ($63) {
+ HEAP32[$vararg_buffer53>>2] = $fileName;
+ _TraceLog(0,11454,$vararg_buffer53);
+ }
+ $64 = $numTexCoords$0$ph20$lcssa31 | $numNormals$0$ph16$lcssa32;
+ $65 = ($64|0)==(0);
+ $66 = ((($vNum)) + 4|0);
+ $67 = ((($vNum)) + 8|0);
+ $68 = ((($vNum)) + 4|0);
+ $69 = ((($vNum)) + 8|0);
+ $70 = ((($vnNum)) + 4|0);
+ $71 = ((($vnNum)) + 8|0);
+ $72 = ((($norm)) + 4|0);
+ $73 = ((($norm)) + 8|0);
+ $74 = ((($vNum)) + 4|0);
+ $75 = ((($vtNum)) + 4|0);
+ $76 = ((($vNum)) + 8|0);
+ $77 = ((($vtNum)) + 8|0);
+ $78 = ((($vNum)) + 4|0);
+ $79 = ((($vtNum)) + 4|0);
+ $80 = ((($vnNum)) + 4|0);
+ $81 = ((($vNum)) + 8|0);
+ $82 = ((($vtNum)) + 8|0);
+ $83 = ((($vnNum)) + 8|0);
+ $84 = ((($vtNum)) + 4|0);
+ $85 = ((($vtNum)) + 8|0);
+ $nCounter$0$ph$ph = 0;$tcCounter$0$ph$ph = 0;$vCounter$0$ph$ph = 0;
+ L51: while(1) {
+ $nCounter$0$ph = $nCounter$0$ph$ph;$vCounter$0$ph = $vCounter$0$ph$ph;
+ while(1) {
+ $86 = (_feof($2)|0);
+ $87 = ($86|0)==(0);
+ if (!($87)) {
+ break L51;
+ }
+ L55: while(1) {
+ HEAP32[$vararg_buffer56>>2] = $dataType;
+ (_fscanf($2,11329,$vararg_buffer56)|0);
+ $88 = HEAP8[$dataType>>0]|0;
+ $89 = $88 << 24 >> 24;
+ switch ($89|0) {
+ case 102: {
+ break L55;
+ break;
+ }
+ case 118: case 117: case 109: case 115: case 103: case 111: case 35: {
+ (_fgets($comments,200,$2)|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $90 = (_feof($2)|0);
+ $91 = ($90|0)==(0);
+ if (!($91)) {
+ break L51;
+ }
+ }
+ do {
+ if ($65) {
+ HEAP32[$vararg_buffer59>>2] = $vNum;
+ $vararg_ptr62 = ((($vararg_buffer59)) + 4|0);
+ HEAP32[$vararg_ptr62>>2] = $66;
+ $vararg_ptr63 = ((($vararg_buffer59)) + 8|0);
+ HEAP32[$vararg_ptr63>>2] = $67;
+ (_fscanf($2,11525,$vararg_buffer59)|0);
+ } else {
+ if ($63) {
+ HEAP32[$vararg_buffer64>>2] = $vNum;
+ $vararg_ptr67 = ((($vararg_buffer64)) + 4|0);
+ HEAP32[$vararg_ptr67>>2] = $vtNum;
+ $vararg_ptr68 = ((($vararg_buffer64)) + 8|0);
+ HEAP32[$vararg_ptr68>>2] = $74;
+ $vararg_ptr69 = ((($vararg_buffer64)) + 12|0);
+ HEAP32[$vararg_ptr69>>2] = $75;
+ $vararg_ptr70 = ((($vararg_buffer64)) + 16|0);
+ HEAP32[$vararg_ptr70>>2] = $76;
+ $vararg_ptr71 = ((($vararg_buffer64)) + 20|0);
+ HEAP32[$vararg_ptr71>>2] = $77;
+ (_fscanf($2,11534,$vararg_buffer64)|0);
+ break;
+ } else {
+ HEAP32[$vararg_buffer72>>2] = $vNum;
+ $vararg_ptr75 = ((($vararg_buffer72)) + 4|0);
+ HEAP32[$vararg_ptr75>>2] = $vtNum;
+ $vararg_ptr76 = ((($vararg_buffer72)) + 8|0);
+ HEAP32[$vararg_ptr76>>2] = $vnNum;
+ $vararg_ptr77 = ((($vararg_buffer72)) + 12|0);
+ HEAP32[$vararg_ptr77>>2] = $78;
+ $vararg_ptr78 = ((($vararg_buffer72)) + 16|0);
+ HEAP32[$vararg_ptr78>>2] = $79;
+ $vararg_ptr79 = ((($vararg_buffer72)) + 20|0);
+ HEAP32[$vararg_ptr79>>2] = $80;
+ $vararg_ptr80 = ((($vararg_buffer72)) + 24|0);
+ HEAP32[$vararg_ptr80>>2] = $81;
+ $vararg_ptr81 = ((($vararg_buffer72)) + 28|0);
+ HEAP32[$vararg_ptr81>>2] = $82;
+ $vararg_ptr82 = ((($vararg_buffer72)) + 32|0);
+ HEAP32[$vararg_ptr82>>2] = $83;
+ (_fscanf($2,11552,$vararg_buffer72)|0);
+ break;
+ }
+ }
+ } while(0);
+ $92 = HEAP32[$vNum>>2]|0;
+ $93 = (($92) + -1)|0;
+ $94 = (($25) + (($93*12)|0)|0);
+ $95 = HEAP32[$94>>2]|0;
+ $96 = (($58) + ($vCounter$0$ph<<2)|0);
+ HEAP32[$96>>2] = $95;
+ $97 = HEAP32[$vNum>>2]|0;
+ $98 = (($97) + -1)|0;
+ $99 = (((($25) + (($98*12)|0)|0)) + 4|0);
+ $100 = HEAP32[$99>>2]|0;
+ $101 = (($vCounter$0$ph) + 1)|0;
+ $102 = (($58) + ($101<<2)|0);
+ HEAP32[$102>>2] = $100;
+ $103 = HEAP32[$vNum>>2]|0;
+ $104 = (($103) + -1)|0;
+ $105 = (((($25) + (($104*12)|0)|0)) + 8|0);
+ $106 = HEAP32[$105>>2]|0;
+ $107 = (($vCounter$0$ph) + 2)|0;
+ $108 = (($58) + ($107<<2)|0);
+ HEAP32[$108>>2] = $106;
+ $109 = (($vCounter$0$ph) + 3)|0;
+ $110 = HEAP32[$68>>2]|0;
+ $111 = (($110) + -1)|0;
+ $112 = (($25) + (($111*12)|0)|0);
+ $113 = HEAP32[$112>>2]|0;
+ $114 = (($58) + ($109<<2)|0);
+ HEAP32[$114>>2] = $113;
+ $115 = HEAP32[$68>>2]|0;
+ $116 = (($115) + -1)|0;
+ $117 = (((($25) + (($116*12)|0)|0)) + 4|0);
+ $118 = HEAP32[$117>>2]|0;
+ $119 = (($vCounter$0$ph) + 4)|0;
+ $120 = (($58) + ($119<<2)|0);
+ HEAP32[$120>>2] = $118;
+ $121 = HEAP32[$68>>2]|0;
+ $122 = (($121) + -1)|0;
+ $123 = (((($25) + (($122*12)|0)|0)) + 8|0);
+ $124 = HEAP32[$123>>2]|0;
+ $125 = (($vCounter$0$ph) + 5)|0;
+ $126 = (($58) + ($125<<2)|0);
+ HEAP32[$126>>2] = $124;
+ $127 = (($vCounter$0$ph) + 6)|0;
+ $128 = HEAP32[$69>>2]|0;
+ $129 = (($128) + -1)|0;
+ $130 = (($25) + (($129*12)|0)|0);
+ $131 = HEAP32[$130>>2]|0;
+ $132 = (($58) + ($127<<2)|0);
+ HEAP32[$132>>2] = $131;
+ $133 = HEAP32[$69>>2]|0;
+ $134 = (($133) + -1)|0;
+ $135 = (((($25) + (($134*12)|0)|0)) + 4|0);
+ $136 = HEAP32[$135>>2]|0;
+ $137 = (($vCounter$0$ph) + 7)|0;
+ $138 = (($58) + ($137<<2)|0);
+ HEAP32[$138>>2] = $136;
+ $139 = HEAP32[$69>>2]|0;
+ $140 = (($139) + -1)|0;
+ $141 = (((($25) + (($140*12)|0)|0)) + 8|0);
+ $142 = HEAP32[$141>>2]|0;
+ $143 = (($vCounter$0$ph) + 8)|0;
+ $144 = (($58) + ($143<<2)|0);
+ HEAP32[$144>>2] = $142;
+ $145 = (($vCounter$0$ph) + 9)|0;
+ if ($26) {
+ $146 = HEAP32[$vnNum>>2]|0;
+ $147 = (($146) + -1)|0;
+ $148 = (($midNormals$0) + (($147*12)|0)|0);
+ $149 = HEAP32[$148>>2]|0;
+ $150 = (($62) + ($nCounter$0$ph<<2)|0);
+ HEAP32[$150>>2] = $149;
+ $151 = HEAP32[$vnNum>>2]|0;
+ $152 = (($151) + -1)|0;
+ $153 = (((($midNormals$0) + (($152*12)|0)|0)) + 4|0);
+ $154 = HEAP32[$153>>2]|0;
+ $155 = (($nCounter$0$ph) + 1)|0;
+ $156 = (($62) + ($155<<2)|0);
+ HEAP32[$156>>2] = $154;
+ $157 = HEAP32[$vnNum>>2]|0;
+ $158 = (($157) + -1)|0;
+ $159 = (((($midNormals$0) + (($158*12)|0)|0)) + 8|0);
+ $160 = HEAP32[$159>>2]|0;
+ $161 = (($nCounter$0$ph) + 2)|0;
+ $162 = (($62) + ($161<<2)|0);
+ HEAP32[$162>>2] = $160;
+ $163 = (($nCounter$0$ph) + 3)|0;
+ $164 = HEAP32[$70>>2]|0;
+ $165 = (($164) + -1)|0;
+ $166 = (($midNormals$0) + (($165*12)|0)|0);
+ $167 = HEAP32[$166>>2]|0;
+ $168 = (($62) + ($163<<2)|0);
+ HEAP32[$168>>2] = $167;
+ $169 = HEAP32[$70>>2]|0;
+ $170 = (($169) + -1)|0;
+ $171 = (((($midNormals$0) + (($170*12)|0)|0)) + 4|0);
+ $172 = HEAP32[$171>>2]|0;
+ $173 = (($nCounter$0$ph) + 4)|0;
+ $174 = (($62) + ($173<<2)|0);
+ HEAP32[$174>>2] = $172;
+ $175 = HEAP32[$70>>2]|0;
+ $176 = (($175) + -1)|0;
+ $177 = (((($midNormals$0) + (($176*12)|0)|0)) + 8|0);
+ $178 = HEAP32[$177>>2]|0;
+ $179 = (($nCounter$0$ph) + 5)|0;
+ $180 = (($62) + ($179<<2)|0);
+ HEAP32[$180>>2] = $178;
+ $181 = (($nCounter$0$ph) + 6)|0;
+ $182 = HEAP32[$71>>2]|0;
+ $183 = (($182) + -1)|0;
+ $184 = (($midNormals$0) + (($183*12)|0)|0);
+ $185 = HEAP32[$184>>2]|0;
+ $186 = (($62) + ($181<<2)|0);
+ HEAP32[$186>>2] = $185;
+ $187 = HEAP32[$71>>2]|0;
+ $188 = (($187) + -1)|0;
+ $189 = (((($midNormals$0) + (($188*12)|0)|0)) + 4|0);
+ $190 = HEAP32[$189>>2]|0;
+ $191 = (($nCounter$0$ph) + 7)|0;
+ $192 = (($62) + ($191<<2)|0);
+ HEAP32[$192>>2] = $190;
+ $193 = HEAP32[$71>>2]|0;
+ $194 = (($193) + -1)|0;
+ $195 = (((($midNormals$0) + (($194*12)|0)|0)) + 8|0);
+ $196 = HEAP32[$195>>2]|0;
+ $197 = (($nCounter$0$ph) + 8)|0;
+ $198 = (($62) + ($197<<2)|0);
+ HEAP32[$198>>2] = $196;
+ } else {
+ $199 = HEAP32[$68>>2]|0;
+ $200 = (($199) + -1)|0;
+ $201 = (($25) + (($200*12)|0)|0);
+ $202 = HEAP32[$vNum>>2]|0;
+ $203 = (($202) + -1)|0;
+ $204 = (($25) + (($203*12)|0)|0);
+ ;HEAP32[$$byval_copy89>>2]=HEAP32[$201>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$201+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$201+8>>2]|0;
+ ;HEAP32[$$byval_copy90>>2]=HEAP32[$204>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$204+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$204+8>>2]|0;
+ _VectorSubtract($0,$$byval_copy89,$$byval_copy90);
+ $205 = HEAP32[$69>>2]|0;
+ $206 = (($205) + -1)|0;
+ $207 = (($25) + (($206*12)|0)|0);
+ $208 = HEAP32[$vNum>>2]|0;
+ $209 = (($208) + -1)|0;
+ $210 = (($25) + (($209*12)|0)|0);
+ ;HEAP32[$$byval_copy89>>2]=HEAP32[$207>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$207+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$207+8>>2]|0;
+ ;HEAP32[$$byval_copy90>>2]=HEAP32[$210>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$210+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$210+8>>2]|0;
+ _VectorSubtract($1,$$byval_copy89,$$byval_copy90);
+ ;HEAP32[$$byval_copy89>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$0+8>>2]|0;
+ ;HEAP32[$$byval_copy90>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$1+8>>2]|0;
+ _VectorCrossProduct($norm,$$byval_copy89,$$byval_copy90);
+ _VectorNormalize($norm);
+ $211 = HEAP32[$norm>>2]|0;
+ $212 = (($62) + ($nCounter$0$ph<<2)|0);
+ HEAP32[$212>>2] = $211;
+ $213 = HEAP32[$72>>2]|0;
+ $214 = (($nCounter$0$ph) + 1)|0;
+ $215 = (($62) + ($214<<2)|0);
+ HEAP32[$215>>2] = $213;
+ $216 = HEAP32[$73>>2]|0;
+ $217 = (($nCounter$0$ph) + 2)|0;
+ $218 = (($62) + ($217<<2)|0);
+ HEAP32[$218>>2] = $216;
+ $219 = (($nCounter$0$ph) + 3)|0;
+ $220 = HEAP32[$norm>>2]|0;
+ $221 = (($62) + ($219<<2)|0);
+ HEAP32[$221>>2] = $220;
+ $222 = HEAP32[$72>>2]|0;
+ $223 = (($nCounter$0$ph) + 4)|0;
+ $224 = (($62) + ($223<<2)|0);
+ HEAP32[$224>>2] = $222;
+ $225 = HEAP32[$73>>2]|0;
+ $226 = (($nCounter$0$ph) + 5)|0;
+ $227 = (($62) + ($226<<2)|0);
+ HEAP32[$227>>2] = $225;
+ $228 = (($nCounter$0$ph) + 6)|0;
+ $229 = HEAP32[$norm>>2]|0;
+ $230 = (($62) + ($228<<2)|0);
+ HEAP32[$230>>2] = $229;
+ $231 = HEAP32[$72>>2]|0;
+ $232 = (($nCounter$0$ph) + 7)|0;
+ $233 = (($62) + ($232<<2)|0);
+ HEAP32[$233>>2] = $231;
+ $234 = HEAP32[$73>>2]|0;
+ $235 = (($nCounter$0$ph) + 8)|0;
+ $236 = (($62) + ($235<<2)|0);
+ HEAP32[$236>>2] = $234;
+ }
+ $nCounter$1 = (($nCounter$0$ph) + 9)|0;
+ if ($29) {
+ $$lcssa = $145;$nCounter$1$lcssa = $nCounter$1;
+ break;
+ } else {
+ $nCounter$0$ph = $nCounter$1;$vCounter$0$ph = $145;
+ }
+ }
+ $237 = HEAP32[$vtNum>>2]|0;
+ $238 = (($237) + -1)|0;
+ $239 = (($midTexCoords$0) + ($238<<3)|0);
+ $240 = HEAP32[$239>>2]|0;
+ $241 = (($61) + ($tcCounter$0$ph$ph<<2)|0);
+ HEAP32[$241>>2] = $240;
+ $242 = HEAP32[$vtNum>>2]|0;
+ $243 = (($242) + -1)|0;
+ $244 = (((($midTexCoords$0) + ($243<<3)|0)) + 4|0);
+ $245 = +HEAPF32[$244>>2];
+ $246 = 1.0 - $245;
+ $247 = $tcCounter$0$ph$ph | 1;
+ $248 = (($61) + ($247<<2)|0);
+ HEAPF32[$248>>2] = $246;
+ $249 = (($tcCounter$0$ph$ph) + 2)|0;
+ $250 = HEAP32[$84>>2]|0;
+ $251 = (($250) + -1)|0;
+ $252 = (($midTexCoords$0) + ($251<<3)|0);
+ $253 = HEAP32[$252>>2]|0;
+ $254 = (($61) + ($249<<2)|0);
+ HEAP32[$254>>2] = $253;
+ $255 = HEAP32[$84>>2]|0;
+ $256 = (($255) + -1)|0;
+ $257 = (((($midTexCoords$0) + ($256<<3)|0)) + 4|0);
+ $258 = +HEAPF32[$257>>2];
+ $259 = 1.0 - $258;
+ $260 = (($tcCounter$0$ph$ph) + 3)|0;
+ $261 = (($61) + ($260<<2)|0);
+ HEAPF32[$261>>2] = $259;
+ $262 = (($tcCounter$0$ph$ph) + 4)|0;
+ $263 = HEAP32[$85>>2]|0;
+ $264 = (($263) + -1)|0;
+ $265 = (($midTexCoords$0) + ($264<<3)|0);
+ $266 = HEAP32[$265>>2]|0;
+ $267 = (($61) + ($262<<2)|0);
+ HEAP32[$267>>2] = $266;
+ $268 = HEAP32[$85>>2]|0;
+ $269 = (($268) + -1)|0;
+ $270 = (((($midTexCoords$0) + ($269<<3)|0)) + 4|0);
+ $271 = +HEAPF32[$270>>2];
+ $272 = 1.0 - $271;
+ $273 = (($tcCounter$0$ph$ph) + 5)|0;
+ $274 = (($61) + ($273<<2)|0);
+ HEAPF32[$274>>2] = $272;
+ $275 = (($tcCounter$0$ph$ph) + 6)|0;
+ $nCounter$0$ph$ph = $nCounter$1$lcssa;$tcCounter$0$ph$ph = $275;$vCounter$0$ph$ph = $$lcssa;
+ }
+ (_fclose($2)|0);
+ $276 = ($numTexCoords$0$ph20$lcssa31|0)==(0);
+ $277 = ($59|0)>(0);
+ $or$cond = $276 & $277;
+ if ($or$cond) {
+ $278 = ($numTriangles$0$ph23$lcssa28*24)|0;
+ _memset(($61|0),0,($278|0))|0;
+ }
+ _free($25);
+ _free($midNormals$0);
+ _free($midTexCoords$0);
+ HEAP32[$vararg_buffer83>>2] = $fileName;
+ _TraceLog(0,11579,$vararg_buffer83);
+ HEAP32[$agg$result>>2] = $56;
+ $279 = ((($agg$result)) + 4|0);
+ HEAP32[$279>>2] = 0;
+ $280 = ((($agg$result)) + 8|0);
+ HEAP32[$280>>2] = $58;
+ $281 = ((($agg$result)) + 12|0);
+ HEAP32[$281>>2] = $61;
+ $282 = ((($agg$result)) + 16|0);
+ HEAP32[$282>>2] = 0;
+ $283 = ((($agg$result)) + 20|0);
+ HEAP32[$283>>2] = $62;
+ $284 = ((($agg$result)) + 24|0);
+ HEAP32[$284>>2] = 0;
+ $285 = ((($agg$result)) + 28|0);
+ HEAP32[$285>>2] = 0;
+ $286 = ((($agg$result)) + 32|0);
+ dest=$286; src=$mesh$sroa$48; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _Vector2Distance($v1,$v2) {
+ $v1 = $v1|0;
+ $v2 = $v2|0;
+ var $0 = 0.0, $1 = 0.0, $10 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF32[$v2>>2];
+ $1 = +HEAPF32[$v1>>2];
+ $2 = $0 - $1;
+ $3 = ((($v2)) + 4|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = ((($v1)) + 4|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = $4 - $6;
+ $8 = $2 * $2;
+ $9 = $7 * $7;
+ $10 = $8 + $9;
+ $sqrtf = (+Math_sqrt((+$10)));
+ return (+$sqrtf);
+}
+function _Vector2Angle($initialPosition,$finalPosition) {
+ $initialPosition = $initialPosition|0;
+ $finalPosition = $finalPosition|0;
+ var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $angle$0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($finalPosition)) + 4|0);
+ $1 = +HEAPF32[$0>>2];
+ $2 = ((($initialPosition)) + 4|0);
+ $3 = +HEAPF32[$2>>2];
+ $4 = $1 - $3;
+ $5 = $4;
+ $6 = +HEAPF32[$finalPosition>>2];
+ $7 = +HEAPF32[$initialPosition>>2];
+ $8 = $6 - $7;
+ $9 = $8;
+ $10 = (+Math_atan2((+$5),(+$9)));
+ $11 = $10;
+ $12 = $11;
+ $13 = $12 * 57.295779513082323;
+ $14 = $13;
+ $15 = $14 < 0.0;
+ $16 = $14 + 360.0;
+ $angle$0 = $15 ? $16 : $14;
+ return (+$angle$0);
+}
+function _stbi__pnm_info($s,$x,$y,$comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $c = sp;
+ _stbi__rewind($s);
+ $0 = (_stbi__get8($s)|0);
+ $1 = (_stbi__get8($s)|0);
+ $2 = ($0<<24>>24)==(80);
+ $$off = (($1) + -53)<<24>>24;
+ $switch = ($$off&255)<(2);
+ $or$cond = $2 & $switch;
+ if (!($or$cond)) {
+ _stbi__rewind($s);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $3 = ($1<<24>>24)==(54);
+ $4 = $3 ? 3 : 1;
+ HEAP32[$comp>>2] = $4;
+ $5 = (_stbi__get8($s)|0);
+ HEAP8[$c>>0] = $5;
+ _stbi__pnm_skip_whitespace($s,$c);
+ $6 = (_stbi__pnm_getinteger($s,$c)|0);
+ HEAP32[$x>>2] = $6;
+ _stbi__pnm_skip_whitespace($s,$c);
+ $7 = (_stbi__pnm_getinteger($s,$c)|0);
+ HEAP32[$y>>2] = $7;
+ _stbi__pnm_skip_whitespace($s,$c);
+ $8 = (_stbi__pnm_getinteger($s,$c)|0);
+ $9 = ($8|0)>(255);
+ if (!($9)) {
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ }
+ _stbi__err(12585);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__get8($s) {
+ $s = $s|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 168|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($s)) + 172|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($1>>>0)<($3>>>0);
+ if ($4) {
+ $5 = ((($1)) + 1|0);
+ HEAP32[$0>>2] = $5;
+ $6 = HEAP8[$1>>0]|0;
+ $$0 = $6;
+ return ($$0|0);
+ }
+ $7 = ((($s)) + 32|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)==(0);
+ if ($9) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ _stbi__refill_buffer($s);
+ $10 = HEAP32[$0>>2]|0;
+ $11 = ((($10)) + 1|0);
+ HEAP32[$0>>2] = $11;
+ $12 = HEAP8[$10>>0]|0;
+ $$0 = $12;
+ return ($$0|0);
+}
+function _stbi__rewind($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 176|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($s)) + 168|0);
+ HEAP32[$2>>2] = $1;
+ $3 = ((($s)) + 180|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($s)) + 172|0);
+ HEAP32[$5>>2] = $4;
+ return;
+}
+function _stbi__skip($s,$n) {
+ $s = $s|0;
+ $n = $n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($n|0)<(0);
+ if ($0) {
+ $1 = ((($s)) + 172|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($s)) + 168|0);
+ HEAP32[$3>>2] = $2;
+ return;
+ }
+ $4 = ((($s)) + 16|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)==(0|0);
+ if (!($6)) {
+ $7 = ((($s)) + 172|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($s)) + 168|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = $8;
+ $12 = $10;
+ $13 = (($11) - ($12))|0;
+ $14 = ($13|0)<($n|0);
+ if ($14) {
+ HEAP32[$9>>2] = $8;
+ $15 = ((($s)) + 20|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = ((($s)) + 28|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = (($n) - ($13))|0;
+ FUNCTION_TABLE_vii[$16 & 63]($18,$19);
+ return;
+ }
+ }
+ $20 = ((($s)) + 168|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = (($21) + ($n)|0);
+ HEAP32[$20>>2] = $22;
+ return;
+}
+function _stbi__tga_get_comp($bits_per_pixel,$is_grey,$is_rgb16) {
+ $bits_per_pixel = $bits_per_pixel|0;
+ $is_grey = $is_grey|0;
+ $is_rgb16 = $is_rgb16|0;
+ var $$0 = 0, $$mux = 0, $$not = 0, $$not1 = 0, $0 = 0, $1 = 0, $brmerge = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($is_rgb16|0)!=(0|0);
+ if ($0) {
+ HEAP32[$is_rgb16>>2] = 0;
+ }
+ switch ($bits_per_pixel|0) {
+ case 8: {
+ $$0 = 1;
+ break;
+ }
+ case 16: {
+ $$not = ($is_grey|0)!=(0);
+ $$not1 = $0 ^ 1;
+ $brmerge = $$not | $$not1;
+ $$mux = $$not ? 2 : 3;
+ if ($brmerge) {
+ $$0 = $$mux;
+ } else {
+ label = 6;
+ }
+ break;
+ }
+ case 15: {
+ if ($0) {
+ label = 6;
+ } else {
+ $$0 = 3;
+ }
+ break;
+ }
+ case 32: case 24: {
+ $1 = (($bits_per_pixel|0) / 8)&-1;
+ $$0 = $1;
+ break;
+ }
+ default: {
+ $$0 = 0;
+ }
+ }
+ if ((label|0) == 6) {
+ HEAP32[$is_rgb16>>2] = 1;
+ $$0 = 3;
+ }
+ return ($$0|0);
+}
+function _stbi__refill_buffer($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($s)) + 28|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($s)) + 40|0);
+ $5 = ((($s)) + 36|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = (FUNCTION_TABLE_iiii[$1 & 15]($3,$4,$6)|0);
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $9 = ((($s)) + 32|0);
+ HEAP32[$9>>2] = 0;
+ $10 = ((($s)) + 168|0);
+ HEAP32[$10>>2] = $4;
+ $11 = ((($s)) + 41|0);
+ $12 = ((($s)) + 172|0);
+ HEAP32[$12>>2] = $11;
+ $13 = HEAP32[$10>>2]|0;
+ HEAP8[$13>>0] = 0;
+ return;
+ } else {
+ $14 = ((($s)) + 168|0);
+ HEAP32[$14>>2] = $4;
+ $15 = (((($s)) + 40|0) + ($7)|0);
+ $16 = ((($s)) + 172|0);
+ HEAP32[$16>>2] = $15;
+ return;
+ }
+}
+function _stbi__pnm_skip_whitespace($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ L1: while(1) {
+ $0 = (_stbi__at_eof($s)|0);
+ $1 = ($0|0)==(0);
+ if ($1) {
+ $2 = HEAP8[$c>>0]|0;
+ $3 = (_stbi__pnm_isspace($2)|0);
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ $5 = (_stbi__get8($s)|0);
+ HEAP8[$c>>0] = $5;
+ continue;
+ }
+ }
+ $6 = (_stbi__at_eof($s)|0);
+ $7 = ($6|0)==(0);
+ if (!($7)) {
+ label = 10;
+ break;
+ }
+ $8 = HEAP8[$c>>0]|0;
+ $9 = ($8<<24>>24)==(35);
+ if (!($9)) {
+ label = 10;
+ break;
+ }
+ $10 = (_stbi__at_eof($s)|0);
+ $11 = ($10|0)==(0);
+ if (!($11)) {
+ continue;
+ }
+ while(1) {
+ $12 = HEAP8[$c>>0]|0;
+ switch ($12<<24>>24) {
+ case 13: case 10: {
+ continue L1;
+ break;
+ }
+ default: {
+ }
+ }
+ $13 = (_stbi__get8($s)|0);
+ HEAP8[$c>>0] = $13;
+ $14 = (_stbi__at_eof($s)|0);
+ $15 = ($14|0)==(0);
+ if (!($15)) {
+ continue L1;
+ }
+ }
+ }
+ if ((label|0) == 10) {
+ return;
+ }
+}
+function _stbi__pnm_getinteger($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $value$0$lcssa = 0, $value$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__at_eof($s)|0);
+ $1 = ($0|0)==(0);
+ if ($1) {
+ $value$01 = 0;
+ } else {
+ $value$0$lcssa = 0;
+ return ($value$0$lcssa|0);
+ }
+ while(1) {
+ $2 = HEAP8[$c>>0]|0;
+ $3 = (_stbi__pnm_isdigit($2)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $value$0$lcssa = $value$01;
+ label = 4;
+ break;
+ }
+ $5 = ($value$01*10)|0;
+ $6 = $2 << 24 >> 24;
+ $7 = (($5) + -48)|0;
+ $8 = (($7) + ($6))|0;
+ $9 = (_stbi__get8($s)|0);
+ HEAP8[$c>>0] = $9;
+ $10 = (_stbi__at_eof($s)|0);
+ $11 = ($10|0)==(0);
+ if ($11) {
+ $value$01 = $8;
+ } else {
+ $value$0$lcssa = $8;
+ label = 4;
+ break;
+ }
+ }
+ if ((label|0) == 4) {
+ return ($value$0$lcssa|0);
+ }
+ return (0)|0;
+}
+function _stbi__at_eof($s) {
+ $s = $s|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if (!($2)) {
+ $3 = ((($s)) + 24|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($s)) + 28|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = (FUNCTION_TABLE_ii[$4 & 15]($6)|0);
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $9 = ((($s)) + 32|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($10|0)==(0);
+ if ($11) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ }
+ $12 = ((($s)) + 168|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ((($s)) + 172|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = ($13>>>0)>=($15>>>0);
+ $17 = $16&1;
+ $$0 = $17;
+ return ($$0|0);
+}
+function _stbi__pnm_isdigit($c) {
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $c$off = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $c$off = (($c) + -48)<<24>>24;
+ $0 = ($c$off&255)<(10);
+ $1 = $0&1;
+ return ($1|0);
+}
+function _stbi__pnm_isspace($c) {
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $phitmp = 0, $switch$cast = 0, $switch$cast$clear = 0, $switch$downshift = 0, $switch$masked = 0, $switch$tableidx = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $switch$tableidx = (($c) + -9)<<24>>24;
+ $0 = ($switch$tableidx&255)<(24);
+ if (!($0)) {
+ $1 = 0;
+ return ($1|0);
+ }
+ $switch$cast = $switch$tableidx&255;
+ $switch$cast$clear = $switch$cast & 16777215;
+ $switch$downshift = 8388639 >>> $switch$cast$clear;
+ $switch$masked = $switch$downshift & 16777215;
+ $phitmp = $switch$masked & 1;
+ $1 = $phitmp;
+ return ($1|0);
+}
+function _stbi__pic_is4($s,$str) {
+ $s = $s|0;
+ $str = $str|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = HEAP8[$str>>0]|0;
+ $2 = ($0<<24>>24)==($1<<24>>24);
+ if (!($2)) {
+ return 0;
+ }
+ $3 = (_stbi__get8($s)|0);
+ $4 = ((($str)) + 1|0);
+ $5 = HEAP8[$4>>0]|0;
+ $6 = ($3<<24>>24)==($5<<24>>24);
+ if (!($6)) {
+ return 0;
+ }
+ $7 = (_stbi__get8($s)|0);
+ $8 = ((($str)) + 2|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($7<<24>>24)==($9<<24>>24);
+ if ($10) {
+ $11 = (_stbi__get8($s)|0);
+ $12 = ((($str)) + 3|0);
+ $13 = HEAP8[$12>>0]|0;
+ $14 = ($11<<24>>24)==($13<<24>>24);
+ $$ = $14&1;
+ return ($$|0);
+ } else {
+ return 0;
+ }
+ return (0)|0;
+}
+function _stbi__get16be($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = $0&255;
+ $2 = $1 << 8;
+ $3 = (_stbi__get8($s)|0);
+ $4 = $3&255;
+ $5 = $2 | $4;
+ return ($5|0);
+}
+function _stbi__get32be($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get16be($s)|0);
+ $1 = $0 << 16;
+ $2 = (_stbi__get16be($s)|0);
+ $3 = (($1) + ($2))|0;
+ return ($3|0);
+}
+function _stbi__bmp_parse_header($s,$info) {
+ $s = $s|0;
+ $info = $info|0;
+ var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = ($0<<24>>24)==(66);
+ if ($1) {
+ $2 = (_stbi__get8($s)|0);
+ $3 = ($2<<24>>24)==(77);
+ if ($3) {
+ (_stbi__get32le($s)|0);
+ (_stbi__get16le($s)|0);
+ (_stbi__get16le($s)|0);
+ $4 = (_stbi__get32le($s)|0);
+ $5 = ((($info)) + 4|0);
+ HEAP32[$5>>2] = $4;
+ $6 = (_stbi__get32le($s)|0);
+ $7 = ((($info)) + 8|0);
+ HEAP32[$7>>2] = $6;
+ $8 = ((($info)) + 24|0);
+ $9 = ((($info)) + 20|0);
+ $10 = ((($info)) + 16|0);
+ $11 = ((($info)) + 12|0);
+ $12 = ($6|0)==(12);
+ ;HEAP32[$11>>2]=0|0;HEAP32[$11+4>>2]=0|0;HEAP32[$11+8>>2]=0|0;HEAP32[$11+12>>2]=0|0;
+ switch ($6|0) {
+ case 12: {
+ $13 = (_stbi__get16le($s)|0);
+ HEAP32[$s>>2] = $13;
+ $14 = (_stbi__get16le($s)|0);
+ $15 = ((($s)) + 4|0);
+ HEAP32[$15>>2] = $14;
+ break;
+ }
+ case 124: case 108: case 56: case 40: {
+ $16 = (_stbi__get32le($s)|0);
+ HEAP32[$s>>2] = $16;
+ $17 = (_stbi__get32le($s)|0);
+ $18 = ((($s)) + 4|0);
+ HEAP32[$18>>2] = $17;
+ break;
+ }
+ default: {
+ _stbi__err(12614);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $19 = (_stbi__get16le($s)|0);
+ $20 = ($19|0)==(1);
+ if (!($20)) {
+ _stbi__err(12626);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $21 = (_stbi__get16le($s)|0);
+ HEAP32[$info>>2] = $21;
+ $22 = ($21|0)==(1);
+ if ($22) {
+ _stbi__err(12634);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ if ($12) {
+ $$0 = (1);
+ return ($$0|0);
+ }
+ $23 = (_stbi__get32le($s)|0);
+ $$off = (($23) + -1)|0;
+ $24 = ($$off>>>0)<(2);
+ if ($24) {
+ _stbi__err(12645);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ $25 = $6 & -17;
+ $26 = ($25|0)==(40);
+ if (!($26)) {
+ switch ($6|0) {
+ case 108: case 124: {
+ break;
+ }
+ default: {
+ _stbi__err(12626);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $39 = (_stbi__get32le($s)|0);
+ HEAP32[$11>>2] = $39;
+ $40 = (_stbi__get32le($s)|0);
+ HEAP32[$10>>2] = $40;
+ $41 = (_stbi__get32le($s)|0);
+ HEAP32[$9>>2] = $41;
+ $42 = (_stbi__get32le($s)|0);
+ HEAP32[$8>>2] = $42;
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ $43 = ($6|0)==(124);
+ if (!($43)) {
+ $$0 = (1);
+ return ($$0|0);
+ }
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ $$0 = (1);
+ return ($$0|0);
+ }
+ $27 = ($6|0)==(56);
+ if ($27) {
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ (_stbi__get32le($s)|0);
+ }
+ $28 = HEAP32[$info>>2]|0;
+ switch ($28|0) {
+ case 32: case 16: {
+ break;
+ }
+ default: {
+ $$0 = (1);
+ return ($$0|0);
+ }
+ }
+ switch ($23|0) {
+ case 0: {
+ $29 = HEAP32[$info>>2]|0;
+ $30 = ($29|0)==(32);
+ if ($30) {
+ HEAP32[$11>>2] = 16711680;
+ HEAP32[$10>>2] = 65280;
+ HEAP32[$9>>2] = 255;
+ HEAP32[$8>>2] = -16777216;
+ $31 = ((($info)) + 28|0);
+ HEAP32[$31>>2] = 0;
+ $$0 = (1);
+ return ($$0|0);
+ } else {
+ HEAP32[$11>>2] = 31744;
+ HEAP32[$10>>2] = 992;
+ HEAP32[$9>>2] = 31;
+ $$0 = (1);
+ return ($$0|0);
+ }
+ break;
+ }
+ case 3: {
+ $32 = (_stbi__get32le($s)|0);
+ HEAP32[$11>>2] = $32;
+ $33 = (_stbi__get32le($s)|0);
+ HEAP32[$10>>2] = $33;
+ $34 = (_stbi__get32le($s)|0);
+ HEAP32[$9>>2] = $34;
+ $35 = HEAP32[$11>>2]|0;
+ $36 = HEAP32[$10>>2]|0;
+ $37 = ($35|0)==($36|0);
+ $38 = ($36|0)==($34|0);
+ $or$cond = $37 & $38;
+ if (!($or$cond)) {
+ $$0 = (1);
+ return ($$0|0);
+ }
+ _stbi__err(12626);
+ $$0 = 0;
+ return ($$0|0);
+ break;
+ }
+ default: {
+ _stbi__err(12626);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ }
+ }
+ _stbi__err(12606);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__get32le($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get16le($s)|0);
+ $1 = (_stbi__get16le($s)|0);
+ $2 = $1 << 16;
+ $3 = (($2) + ($0))|0;
+ return ($3|0);
+}
+function _stbi__gif_header($s,$g,$comp,$is_info) {
+ $s = $s|0;
+ $g = $g|0;
+ $comp = $comp|0;
+ $is_info = $is_info|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = ($0<<24>>24)==(71);
+ if ($1) {
+ $2 = (_stbi__get8($s)|0);
+ $3 = ($2<<24>>24)==(73);
+ if ($3) {
+ $4 = (_stbi__get8($s)|0);
+ $5 = ($4<<24>>24)==(70);
+ if ($5) {
+ $6 = (_stbi__get8($s)|0);
+ $7 = ($6<<24>>24)==(56);
+ if ($7) {
+ $8 = (_stbi__get8($s)|0);
+ switch ($8<<24>>24) {
+ case 57: case 55: {
+ break;
+ }
+ default: {
+ _stbi__err(12653);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $9 = (_stbi__get8($s)|0);
+ $10 = ($9<<24>>24)==(97);
+ if (!($10)) {
+ _stbi__err(12653);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ HEAP32[2608>>2] = 12661;
+ $11 = (_stbi__get16le($s)|0);
+ HEAP32[$g>>2] = $11;
+ $12 = (_stbi__get16le($s)|0);
+ $13 = ((($g)) + 4|0);
+ HEAP32[$13>>2] = $12;
+ $14 = (_stbi__get8($s)|0);
+ $15 = $14&255;
+ $16 = ((($g)) + 16|0);
+ HEAP32[$16>>2] = $15;
+ $17 = (_stbi__get8($s)|0);
+ $18 = $17&255;
+ $19 = ((($g)) + 20|0);
+ HEAP32[$19>>2] = $18;
+ $20 = (_stbi__get8($s)|0);
+ $21 = $20&255;
+ $22 = ((($g)) + 24|0);
+ HEAP32[$22>>2] = $21;
+ $23 = ((($g)) + 28|0);
+ HEAP32[$23>>2] = -1;
+ $24 = ($comp|0)==(0|0);
+ if (!($24)) {
+ HEAP32[$comp>>2] = 4;
+ }
+ $25 = ($is_info|0)==(0);
+ if (!($25)) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $26 = HEAP32[$16>>2]|0;
+ $27 = $26 & 128;
+ $28 = ($27|0)==(0);
+ if ($28) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $29 = ((($g)) + 40|0);
+ $30 = $26 & 7;
+ $31 = 2 << $30;
+ _stbi__gif_parse_colortable($s,$29,$31,-1);
+ $$0 = 1;
+ return ($$0|0);
+ }
+ }
+ }
+ }
+ _stbi__err(12653);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__gif_parse_colortable($s,$pal,$num_entries,$transp) {
+ $s = $s|0;
+ $pal = $pal|0;
+ $num_entries = $num_entries|0;
+ $transp = $transp|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($num_entries|0)>(0);
+ if ($0) {
+ $i$01 = 0;
+ } else {
+ return;
+ }
+ while(1) {
+ $1 = (_stbi__get8($s)|0);
+ $2 = (((($pal) + ($i$01<<2)|0)) + 2|0);
+ HEAP8[$2>>0] = $1;
+ $3 = (_stbi__get8($s)|0);
+ $4 = (((($pal) + ($i$01<<2)|0)) + 1|0);
+ HEAP8[$4>>0] = $3;
+ $5 = (_stbi__get8($s)|0);
+ $6 = (($pal) + ($i$01<<2)|0);
+ HEAP8[$6>>0] = $5;
+ $not$ = ($i$01|0)!=($transp|0);
+ $7 = $not$ << 31 >> 31;
+ $8 = (((($pal) + ($i$01<<2)|0)) + 3|0);
+ HEAP8[$8>>0] = $7;
+ $9 = (($i$01) + 1)|0;
+ $exitcond = ($9|0)==($num_entries|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $9;
+ }
+ }
+ return;
+}
+function _stbi__parse_png_file($z,$scan,$req_comp) {
+ $z = $z|0;
+ $scan = $scan|0;
+ $req_comp = $req_comp|0;
+ var $$ = 0, $$0 = 0, $$lcssa1605 = 0, $$lobit = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
+ var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
+ var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
+ var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
+ var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
+ var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0;
+ var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
+ var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
+ var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
+ var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c = 0;
+ var $color$0 = 0, $color$0$lcssa = 0, $color$1 = 0, $first$0 = 0, $first$0$lcssa = 0, $first$1 = 0, $has_trans$0 = 0, $has_trans$0$lcssa = 0, $has_trans$1 = 0, $i$0314 = 0, $i$1309 = 0, $idata_limit$0 = 0, $idata_limit$1 = 0, $idata_limit$1$lcssa = 0, $idata_limit$1$ph = 0, $idata_limit$2 = 0, $idata_limit$3 = 0, $interlace$0 = 0, $interlace$0$lcssa = 0, $interlace$1 = 0;
+ var $ioff$0 = 0, $ioff$0$lcssa = 0, $ioff$1 = 0, $is_iphone$0 = 0, $is_iphone$0$lcssa = 0, $is_iphone$1 = 0, $k$0312 = 0, $k$1310 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond8 = 0, $pal_img_n$0 = 0, $pal_img_n$0$lcssa = 0, $pal_img_n$0$lcssa1544 = 0, $pal_img_n$1 = 0, $pal_img_n$2 = 0;
+ var $pal_len$0 = 0, $pal_len$1 = 0, $palette = 0, $raw_len = 0, $req_comp$ = 0, $switch$split102D = 0, $switch$split12D = 0, $switch$split2D = 0, $switch$split42D = 0, $switch$split72D = 0, $tc = 0, $tc16 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1056|0;
+ $palette = sp + 32|0;
+ $tc = sp + 22|0;
+ $tc16 = sp + 16|0;
+ $c = sp + 8|0;
+ $raw_len = sp;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = ((($z)) + 8|0);
+ HEAP32[$1>>2] = 0;
+ $2 = ((($z)) + 4|0);
+ HEAP32[$2>>2] = 0;
+ $3 = ((($z)) + 12|0);
+ HEAP32[$3>>2] = 0;
+ $4 = (_stbi__check_png_header($0)|0);
+ $5 = ($4|0)==(0);
+ if ($5) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $6 = ($scan|0)==(1);
+ if ($6) {
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $7 = ((($c)) + 4|0);
+ $8 = ((($0)) + 4|0);
+ $9 = ((($z)) + 16|0);
+ $10 = ((($0)) + 8|0);
+ $11 = ($scan|0)==(2);
+ $12 = ((($0)) + 8|0);
+ $13 = ((($0)) + 8|0);
+ $14 = ((($z)) + 16|0);
+ $15 = ($scan|0)==(2);
+ $16 = ($scan|0)==(2);
+ $color$0 = 0;$first$0 = 1;$has_trans$0 = 0;$idata_limit$0 = 0;$interlace$0 = 0;$ioff$0 = 0;$is_iphone$0 = 0;$pal_img_n$0 = 0;$pal_len$0 = 0;
+ L7: while(1) {
+ _stbi__get_chunk_header($c,$0);
+ $17 = HEAP32[$7>>2]|0;
+ $switch$split2D = ($17|0)<(1229472850);
+ L9: do {
+ if ($switch$split2D) {
+ $switch$split12D = ($17|0)<(1229209940);
+ if ($switch$split12D) {
+ switch ($17|0) {
+ case 1130840649: {
+ break;
+ }
+ default: {
+ label = 102;
+ break L9;
+ }
+ }
+ $18 = HEAP32[$c>>2]|0;
+ _stbi__skip($0,$18);
+ $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = 1;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ $switch$split72D = ($17|0)<(1229278788);
+ if (!($switch$split72D)) {
+ switch ($17|0) {
+ case 1229278788: {
+ $color$0$lcssa = $color$0;$first$0$lcssa = $first$0;$has_trans$0$lcssa = $has_trans$0;$interlace$0$lcssa = $interlace$0;$ioff$0$lcssa = $ioff$0;$is_iphone$0$lcssa = $is_iphone$0;$pal_img_n$0$lcssa = $pal_img_n$0;
+ label = 85;
+ break L7;
+ break;
+ }
+ default: {
+ label = 102;
+ break L9;
+ }
+ }
+ }
+ switch ($17|0) {
+ case 1229209940: {
+ break;
+ }
+ default: {
+ label = 102;
+ break L9;
+ }
+ }
+ $127 = ($first$0|0)==(0);
+ if (!($127)) {
+ label = 70;
+ break L7;
+ }
+ $128 = ($pal_img_n$0<<24>>24)==(0);
+ $129 = ($pal_len$0|0)!=(0);
+ $or$cond = $129 | $128;
+ if (!($or$cond)) {
+ label = 72;
+ break L7;
+ }
+ if ($16) {
+ $pal_img_n$0$lcssa1544 = $pal_img_n$0;
+ label = 74;
+ break L7;
+ }
+ $132 = HEAP32[$c>>2]|0;
+ $133 = (($132) + ($ioff$0))|0;
+ $134 = ($133|0)<($ioff$0|0);
+ if ($134) {
+ $$0 = 0;
+ label = 108;
+ break L7;
+ }
+ $135 = ($133>>>0)>($idata_limit$0>>>0);
+ if ($135) {
+ $136 = ($idata_limit$0|0)==(0);
+ $137 = ($132>>>0)>(4096);
+ $138 = $137 ? $132 : 4096;
+ $idata_limit$1$ph = $136 ? $138 : $idata_limit$0;
+ $139 = HEAP32[$c>>2]|0;
+ $140 = (($139) + ($ioff$0))|0;
+ $idata_limit$1 = $idata_limit$1$ph;
+ while(1) {
+ $141 = ($140>>>0)>($idata_limit$1>>>0);
+ $142 = $idata_limit$1 << 1;
+ if ($141) {
+ $idata_limit$1 = $142;
+ } else {
+ $idata_limit$1$lcssa = $idata_limit$1;
+ break;
+ }
+ }
+ $143 = HEAP32[$2>>2]|0;
+ $144 = (_realloc($143,$idata_limit$1$lcssa)|0);
+ $145 = ($144|0)==(0|0);
+ if ($145) {
+ label = 80;
+ break L7;
+ }
+ HEAP32[$2>>2] = $144;
+ $idata_limit$2 = $idata_limit$1$lcssa;
+ } else {
+ $idata_limit$2 = $idata_limit$0;
+ }
+ $146 = HEAP32[$2>>2]|0;
+ $147 = (($146) + ($ioff$0)|0);
+ $148 = HEAP32[$c>>2]|0;
+ $149 = (_stbi__getn($0,$147,$148)|0);
+ $150 = ($149|0)==(0);
+ if ($150) {
+ label = 83;
+ break L7;
+ }
+ $151 = HEAP32[$c>>2]|0;
+ $152 = (($151) + ($ioff$0))|0;
+ $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$2;$interlace$1 = $interlace$0;$ioff$1 = $152;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
+ } else {
+ $switch$split42D = ($17|0)<(1347179589);
+ if ($switch$split42D) {
+ switch ($17|0) {
+ case 1229472850: {
+ break;
+ }
+ default: {
+ label = 102;
+ break L9;
+ }
+ }
+ $19 = ($first$0|0)==(0);
+ if ($19) {
+ label = 7;
+ break L7;
+ }
+ $20 = HEAP32[$c>>2]|0;
+ $21 = ($20|0)==(13);
+ if (!($21)) {
+ label = 9;
+ break L7;
+ }
+ $22 = (_stbi__get32be($0)|0);
+ HEAP32[$0>>2] = $22;
+ $23 = ($22>>>0)>(16777216);
+ if ($23) {
+ label = 11;
+ break L7;
+ }
+ $24 = (_stbi__get32be($0)|0);
+ HEAP32[$8>>2] = $24;
+ $25 = ($24>>>0)>(16777216);
+ if ($25) {
+ label = 13;
+ break L7;
+ }
+ $26 = (_stbi__get8($0)|0);
+ $27 = $26&255;
+ HEAP32[$9>>2] = $27;
+ switch ($26<<24>>24) {
+ case 16: case 8: case 4: case 2: case 1: {
+ break;
+ }
+ default: {
+ label = 15;
+ break L7;
+ }
+ }
+ $28 = (_stbi__get8($0)|0);
+ $29 = $28&255;
+ $30 = ($28&255)>(6);
+ if ($30) {
+ label = 17;
+ break L7;
+ }
+ $31 = ($28<<24>>24)==(3);
+ if ($31) {
+ $32 = HEAP32[$9>>2]|0;
+ $33 = ($32|0)==(16);
+ if ($33) {
+ label = 20;
+ break L7;
+ } else {
+ $pal_img_n$1 = 3;
+ }
+ } else {
+ $34 = $29 & 1;
+ $35 = ($34|0)==(0);
+ if ($35) {
+ $pal_img_n$1 = $pal_img_n$0;
+ } else {
+ label = 22;
+ break L7;
+ }
+ }
+ $36 = (_stbi__get8($0)|0);
+ $37 = ($36<<24>>24)==(0);
+ if (!($37)) {
+ label = 24;
+ break L7;
+ }
+ $38 = (_stbi__get8($0)|0);
+ $39 = ($38<<24>>24)==(0);
+ if (!($39)) {
+ label = 26;
+ break L7;
+ }
+ $40 = (_stbi__get8($0)|0);
+ $41 = $40&255;
+ $42 = ($40&255)>(1);
+ if ($42) {
+ label = 28;
+ break L7;
+ }
+ $43 = HEAP32[$0>>2]|0;
+ $44 = ($43|0)==(0);
+ if ($44) {
+ label = 31;
+ break L7;
+ }
+ $45 = HEAP32[$8>>2]|0;
+ $46 = ($45|0)==(0);
+ if ($46) {
+ label = 31;
+ break L7;
+ }
+ $47 = ($pal_img_n$1<<24>>24)==(0);
+ if (!($47)) {
+ HEAP32[$12>>2] = 1;
+ $57 = HEAP32[$0>>2]|0;
+ $58 = (1073741824 / ($57>>>0))&-1;
+ $59 = $58 >>> 2;
+ $60 = HEAP32[$8>>2]|0;
+ $61 = ($59>>>0)<($60>>>0);
+ if ($61) {
+ label = 37;
+ break L7;
+ } else {
+ $color$1 = $29;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $41;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$1;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ }
+ $48 = $29 & 2;
+ $49 = $48 | 1;
+ $50 = $29 >>> 2;
+ $$lobit = $50 & 1;
+ $51 = (($49) + ($$lobit))|0;
+ HEAP32[$10>>2] = $51;
+ $52 = HEAP32[$0>>2]|0;
+ $53 = (1073741824 / ($52>>>0))&-1;
+ $54 = (($53>>>0) / ($51>>>0))&-1;
+ $55 = HEAP32[$8>>2]|0;
+ $56 = ($54>>>0)<($55>>>0);
+ if ($56) {
+ label = 34;
+ break L7;
+ }
+ if ($11) {
+ $$0 = 1;
+ label = 108;
+ break L7;
+ } else {
+ $color$1 = $29;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $41;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ }
+ $switch$split102D = ($17|0)<(1951551059);
+ if ($switch$split102D) {
+ switch ($17|0) {
+ case 1347179589: {
+ break;
+ }
+ default: {
+ label = 102;
+ break L9;
+ }
+ }
+ $62 = ($first$0|0)==(0);
+ if (!($62)) {
+ label = 39;
+ break L7;
+ }
+ $63 = HEAP32[$c>>2]|0;
+ $64 = ($63>>>0)>(768);
+ if ($64) {
+ label = 41;
+ break L7;
+ }
+ $65 = (($63>>>0) / 3)&-1;
+ $66 = ($65*3)|0;
+ $67 = ($66|0)==($63|0);
+ if (!($67)) {
+ label = 44;
+ break L7;
+ }
+ $68 = ($63>>>0)>(2);
+ if ($68) {
+ $i$0314 = 0;
+ } else {
+ $color$1 = $color$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $65;
+ break;
+ }
+ while(1) {
+ $69 = (_stbi__get8($0)|0);
+ $70 = $i$0314 << 2;
+ $71 = (($palette) + ($70)|0);
+ HEAP8[$71>>0] = $69;
+ $72 = (_stbi__get8($0)|0);
+ $73 = $70 | 1;
+ $74 = (($palette) + ($73)|0);
+ HEAP8[$74>>0] = $72;
+ $75 = (_stbi__get8($0)|0);
+ $76 = $70 | 2;
+ $77 = (($palette) + ($76)|0);
+ HEAP8[$77>>0] = $75;
+ $78 = $70 | 3;
+ $79 = (($palette) + ($78)|0);
+ HEAP8[$79>>0] = -1;
+ $80 = (($i$0314) + 1)|0;
+ $81 = ($80>>>0)<($65>>>0);
+ if ($81) {
+ $i$0314 = $80;
+ } else {
+ $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $65;
+ break L9;
+ }
+ }
+ }
+ switch ($17|0) {
+ case 1951551059: {
+ break;
+ }
+ default: {
+ label = 102;
+ break L9;
+ }
+ }
+ $82 = ($first$0|0)==(0);
+ if (!($82)) {
+ label = 47;
+ break L7;
+ }
+ $83 = HEAP32[$2>>2]|0;
+ $84 = ($83|0)==(0|0);
+ if (!($84)) {
+ label = 49;
+ break L7;
+ }
+ $85 = ($pal_img_n$0<<24>>24)==(0);
+ if (!($85)) {
+ if ($15) {
+ label = 52;
+ break L7;
+ }
+ $87 = ($pal_len$0|0)==(0);
+ if ($87) {
+ label = 54;
+ break L7;
+ }
+ $88 = HEAP32[$c>>2]|0;
+ $89 = ($88>>>0)>($pal_len$0>>>0);
+ if ($89) {
+ label = 58;
+ break L7;
+ }
+ $90 = HEAP32[$c>>2]|0;
+ $91 = ($90|0)==(0);
+ if ($91) {
+ $color$1 = $color$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ $92 = HEAP32[$c>>2]|0;
+ $i$1309 = 0;
+ while(1) {
+ $93 = (_stbi__get8($0)|0);
+ $94 = $i$1309 << 2;
+ $95 = $94 | 3;
+ $96 = (($palette) + ($95)|0);
+ HEAP8[$96>>0] = $93;
+ $97 = (($i$1309) + 1)|0;
+ $98 = ($97>>>0)<($92>>>0);
+ if ($98) {
+ $i$1309 = $97;
+ } else {
+ $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0;
+ break L9;
+ }
+ }
+ }
+ $99 = HEAP32[$13>>2]|0;
+ $100 = $99 & 1;
+ $101 = ($100|0)==(0);
+ if ($101) {
+ label = 61;
+ break L7;
+ }
+ $102 = HEAP32[$c>>2]|0;
+ $103 = $99 << 1;
+ $104 = ($102|0)==($103|0);
+ if (!($104)) {
+ label = 63;
+ break L7;
+ }
+ $105 = HEAP32[$14>>2]|0;
+ $106 = ($105|0)==(16);
+ $107 = HEAP32[$13>>2]|0;
+ $108 = ($107|0)>(0);
+ if ($106) {
+ if ($108) {
+ $k$0312 = 0;
+ } else {
+ $color$1 = $color$0;$first$1 = 0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ while(1) {
+ $109 = (_stbi__get16be($0)|0);
+ $110 = $109&65535;
+ $111 = (($tc16) + ($k$0312<<1)|0);
+ HEAP16[$111>>1] = $110;
+ $112 = (($k$0312) + 1)|0;
+ $113 = HEAP32[$13>>2]|0;
+ $114 = ($112|0)<($113|0);
+ if ($114) {
+ $k$0312 = $112;
+ } else {
+ $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ }
+ } else {
+ if ($108) {
+ $k$1310 = 0;
+ } else {
+ $color$1 = $color$0;$first$1 = 0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ while(1) {
+ $115 = (_stbi__get16be($0)|0);
+ $116 = $115 & 255;
+ $117 = HEAP32[$14>>2]|0;
+ $118 = (12888 + ($117)|0);
+ $119 = HEAP8[$118>>0]|0;
+ $120 = $119&255;
+ $121 = Math_imul($120, $116)|0;
+ $122 = $121&255;
+ $123 = (($tc) + ($k$1310)|0);
+ HEAP8[$123>>0] = $122;
+ $124 = (($k$1310) + 1)|0;
+ $125 = HEAP32[$13>>2]|0;
+ $126 = ($124|0)<($125|0);
+ if ($126) {
+ $k$1310 = $124;
+ } else {
+ $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 102) {
+ label = 0;
+ $201 = ($first$0|0)==(0);
+ if (!($201)) {
+ label = 103;
+ break;
+ }
+ $202 = $17 & 536870912;
+ $203 = ($202|0)==(0);
+ if ($203) {
+ $$lcssa1605 = $17;
+ label = 105;
+ break;
+ }
+ $214 = HEAP32[$c>>2]|0;
+ _stbi__skip($0,$214);
+ $color$1 = $color$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0;
+ }
+ (_stbi__get32be($0)|0);
+ $color$0 = $color$1;$first$0 = $first$1;$has_trans$0 = $has_trans$1;$idata_limit$0 = $idata_limit$3;$interlace$0 = $interlace$1;$ioff$0 = $ioff$1;$is_iphone$0 = $is_iphone$1;$pal_img_n$0 = $pal_img_n$2;$pal_len$0 = $pal_len$1;
+ }
+ switch (label|0) {
+ case 7: {
+ _stbi__err(12662);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 9: {
+ _stbi__err(12676);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 11: {
+ _stbi__err(12689);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 13: {
+ _stbi__err(12689);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 15: {
+ _stbi__err(12699);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 17: {
+ _stbi__err(12719);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 20: {
+ _stbi__err(12719);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 22: {
+ _stbi__err(12719);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 24: {
+ _stbi__err(12729);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 26: {
+ _stbi__err(12745);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 28: {
+ _stbi__err(12763);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 31: {
+ _stbi__err(12784);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 34: {
+ _stbi__err(12689);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 37: {
+ _stbi__err(12689);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 39: {
+ _stbi__err(12798);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 41: {
+ _stbi__err(12813);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 44: {
+ _stbi__err(12813);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 47: {
+ _stbi__err(12798);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 49: {
+ _stbi__err(12826);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 52: {
+ $86 = ((($0)) + 8|0);
+ HEAP32[$86>>2] = 4;
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 54: {
+ _stbi__err(12842);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 58: {
+ _stbi__err(12859);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 61: {
+ _stbi__err(12872);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 63: {
+ _stbi__err(12859);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 70: {
+ _stbi__err(12798);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 72: {
+ _stbi__err(12897);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 74: {
+ $130 = $pal_img_n$0$lcssa1544&255;
+ $131 = ((($0)) + 8|0);
+ HEAP32[$131>>2] = $130;
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 80: {
+ _stbi__err(12905);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 83: {
+ _stbi__err(12914);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 85: {
+ $153 = ($first$0$lcssa|0)==(0);
+ if (!($153)) {
+ _stbi__err(12798);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $154 = ($scan|0)==(0);
+ if (!($154)) {
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $155 = HEAP32[$2>>2]|0;
+ $156 = ($155|0)==(0|0);
+ if ($156) {
+ _stbi__err(12924);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $157 = HEAP32[$0>>2]|0;
+ $158 = ((($z)) + 16|0);
+ $159 = HEAP32[$158>>2]|0;
+ $160 = Math_imul($159, $157)|0;
+ $161 = (($160) + 7)|0;
+ $162 = $161 >>> 3;
+ $163 = ((($0)) + 4|0);
+ $164 = HEAP32[$163>>2]|0;
+ $165 = ((($0)) + 8|0);
+ $166 = HEAP32[$165>>2]|0;
+ $167 = Math_imul($166, $164)|0;
+ $168 = Math_imul($167, $162)|0;
+ $169 = (($168) + ($164))|0;
+ HEAP32[$raw_len>>2] = $169;
+ $170 = HEAP32[$2>>2]|0;
+ $171 = ($is_iphone$0$lcssa|0)!=(0);
+ $172 = $171&1;
+ $173 = $172 ^ 1;
+ $174 = (_stbi_zlib_decode_malloc_guesssize_headerflag($170,$ioff$0$lcssa,$169,$raw_len,$173)|0);
+ HEAP32[$1>>2] = $174;
+ $175 = ($174|0)==(0|0);
+ if ($175) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $176 = HEAP32[$2>>2]|0;
+ _free($176);
+ HEAP32[$2>>2] = 0;
+ $177 = HEAP32[$165>>2]|0;
+ $178 = (($177) + 1)|0;
+ $notlhs = ($178|0)!=($req_comp|0);
+ $notrhs = ($req_comp|0)==(3);
+ $or$cond3$not = $notrhs | $notlhs;
+ $179 = ($pal_img_n$0$lcssa<<24>>24)!=(0);
+ $or$cond5 = $179 | $or$cond3$not;
+ $180 = ($has_trans$0$lcssa<<24>>24)==(0);
+ $or$cond8 = $180 & $or$cond5;
+ $181 = ((($0)) + 12|0);
+ $$ = $or$cond8 ? $177 : $178;
+ HEAP32[$181>>2] = $$;
+ $182 = HEAP32[$1>>2]|0;
+ $183 = HEAP32[$raw_len>>2]|0;
+ $184 = ((($0)) + 12|0);
+ $185 = HEAP32[$158>>2]|0;
+ $186 = (_stbi__create_png_image($z,$182,$183,$$,$185,$color$0$lcssa,$interlace$0$lcssa)|0);
+ $187 = ($186|0)==(0);
+ if ($187) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ do {
+ if (!($180)) {
+ $188 = HEAP32[$158>>2]|0;
+ $189 = ($188|0)==(16);
+ if ($189) {
+ $190 = HEAP32[$184>>2]|0;
+ _stbi__compute_transparency16($z,$tc16,$190);
+ break;
+ } else {
+ $191 = HEAP32[$184>>2]|0;
+ _stbi__compute_transparency($z,$tc,$191);
+ break;
+ }
+ }
+ } while(0);
+ $192 = HEAP32[2620>>2]|0;
+ $193 = ($192|0)!=(0);
+ $or$cond7 = $171 & $193;
+ if ($or$cond7) {
+ $194 = HEAP32[$184>>2]|0;
+ $195 = ($194|0)>(2);
+ if ($195) {
+ _stbi__de_iphone($z);
+ }
+ }
+ if ($179) {
+ $196 = $pal_img_n$0$lcssa&255;
+ HEAP32[$165>>2] = $196;
+ $197 = ($req_comp|0)>(2);
+ $req_comp$ = $197 ? $req_comp : $196;
+ HEAP32[$184>>2] = $req_comp$;
+ $198 = (_stbi__expand_png_palette($z,$palette,$req_comp$)|0);
+ $199 = ($198|0)==(0);
+ if ($199) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ $200 = HEAP32[$1>>2]|0;
+ _free($200);
+ HEAP32[$1>>2] = 0;
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 103: {
+ _stbi__err(12798);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 105: {
+ $204 = $$lcssa1605 >>> 24;
+ $205 = $204&255;
+ HEAP8[12932>>0] = $205;
+ $206 = HEAP32[$7>>2]|0;
+ $207 = $206 >>> 16;
+ $208 = $207&255;
+ HEAP8[(12933)>>0] = $208;
+ $209 = HEAP32[$7>>2]|0;
+ $210 = $209 >>> 8;
+ $211 = $210&255;
+ HEAP8[(12934)>>0] = $211;
+ $212 = HEAP32[$7>>2]|0;
+ $213 = $212&255;
+ HEAP8[(12935)>>0] = $213;
+ _stbi__err(12932);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ case 108: {
+ STACKTOP = sp;return ($$0|0);
+ break;
+ }
+ }
+ return (0)|0;
+}
+function _stbi__check_png_header($s) {
+ $s = $s|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = ($0<<24>>24)==(-119);
+ if ($1) {
+ $2 = (_stbi__get8($s)|0);
+ $3 = ($2<<24>>24)==(80);
+ if ($3) {
+ $4 = (_stbi__get8($s)|0);
+ $5 = ($4<<24>>24)==(78);
+ if ($5) {
+ $6 = (_stbi__get8($s)|0);
+ $7 = ($6<<24>>24)==(71);
+ if ($7) {
+ $8 = (_stbi__get8($s)|0);
+ $9 = ($8<<24>>24)==(13);
+ if ($9) {
+ $10 = (_stbi__get8($s)|0);
+ $11 = ($10<<24>>24)==(10);
+ if ($11) {
+ $12 = (_stbi__get8($s)|0);
+ $13 = ($12<<24>>24)==(26);
+ if ($13) {
+ $14 = (_stbi__get8($s)|0);
+ $15 = ($14<<24>>24)==(10);
+ if ($15) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ _stbi__err(13250);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__get_chunk_header($agg$result,$s) {
+ $agg$result = $agg$result|0;
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get32be($s)|0);
+ $1 = (_stbi__get32be($s)|0);
+ HEAP32[$agg$result>>2] = $0;
+ $2 = ((($agg$result)) + 4|0);
+ HEAP32[$2>>2] = $1;
+ return;
+}
+function _stbi__getn($s,$buffer,$n) {
+ $s = $s|0;
+ $buffer = $buffer|0;
+ $n = $n|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if (!($2)) {
+ $3 = ((($s)) + 172|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($s)) + 168|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = $4;
+ $8 = $6;
+ $9 = (($7) - ($8))|0;
+ $10 = ($9|0)<($n|0);
+ if ($10) {
+ _memcpy(($buffer|0),($6|0),($9|0))|0;
+ $11 = HEAP32[$0>>2]|0;
+ $12 = ((($s)) + 28|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (($buffer) + ($9)|0);
+ $15 = (($n) - ($9))|0;
+ $16 = (FUNCTION_TABLE_iiii[$11 & 15]($13,$14,$15)|0);
+ $17 = ($16|0)==($15|0);
+ $18 = $17&1;
+ $19 = HEAP32[$3>>2]|0;
+ HEAP32[$5>>2] = $19;
+ $$0 = $18;
+ return ($$0|0);
+ }
+ }
+ $20 = ((($s)) + 168|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = (($21) + ($n)|0);
+ $23 = ((($s)) + 172|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = ($22>>>0)>($24>>>0);
+ if ($25) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ _memcpy(($buffer|0),($21|0),($n|0))|0;
+ $26 = HEAP32[$20>>2]|0;
+ $27 = (($26) + ($n)|0);
+ HEAP32[$20>>2] = $27;
+ $$0 = 1;
+ return ($$0|0);
+}
+function _stbi__create_png_image($a,$image_data,$image_data_len,$out_n,$depth,$color,$interlaced) {
+ $a = $a|0;
+ $image_data = $image_data|0;
+ $image_data_len = $image_data_len|0;
+ $out_n = $out_n|0;
+ $depth = $depth|0;
+ $color = $color|0;
+ $interlaced = $interlaced|0;
+ var $$0 = 0, $$0212 = 0, $$0311 = 0, $$1 = 0, $$14 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
+ var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $i$07 = 0;
+ var $j$08 = 0, $or$cond = 0, $p$010 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($interlaced|0)==(0);
+ $1 = HEAP32[$a>>2]|0;
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($1)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ if ($0) {
+ $5 = (_stbi__create_png_image_raw($a,$image_data,$image_data_len,$out_n,$2,$4,$depth,$color)|0);
+ $$0 = $5;
+ return ($$0|0);
+ }
+ $6 = Math_imul($2, $out_n)|0;
+ $7 = Math_imul($6, $4)|0;
+ $8 = (_stbi__malloc($7)|0);
+ $9 = ((($a)) + 12|0);
+ $10 = ((($a)) + 12|0);
+ $$0212 = $image_data;$$0311 = $image_data_len;$p$010 = 0;
+ while(1) {
+ $11 = HEAP32[$a>>2]|0;
+ $12 = HEAP32[$11>>2]|0;
+ $13 = (5664 + ($p$010<<2)|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = (5692 + ($p$010<<2)|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = (($12) + -1)|0;
+ $18 = (($17) - ($14))|0;
+ $19 = (($18) + ($16))|0;
+ $20 = (($19>>>0) / ($16>>>0))&-1;
+ $21 = ((($11)) + 4|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (5720 + ($p$010<<2)|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = (5748 + ($p$010<<2)|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = (($22) + -1)|0;
+ $28 = (($27) - ($24))|0;
+ $29 = (($28) + ($26))|0;
+ $30 = (($29>>>0) / ($26>>>0))&-1;
+ $31 = ($20|0)!=(0);
+ $32 = ($30|0)!=(0);
+ $or$cond = $31 & $32;
+ if ($or$cond) {
+ $33 = ((($11)) + 8|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = Math_imul($20, $depth)|0;
+ $36 = Math_imul($35, $34)|0;
+ $37 = (($36) + 7)|0;
+ $38 = $37 >> 3;
+ $39 = (($38) + 1)|0;
+ $40 = Math_imul($39, $30)|0;
+ $41 = (_stbi__create_png_image_raw($a,$$0212,$$0311,$out_n,$20,$30,$depth,$color)|0);
+ $42 = ($41|0)==(0);
+ if ($42) {
+ label = 8;
+ break;
+ }
+ $43 = ($30|0)>(0);
+ if ($43) {
+ $44 = ($20|0)>(0);
+ $j$08 = 0;
+ while(1) {
+ if ($44) {
+ $45 = HEAP32[$25>>2]|0;
+ $46 = Math_imul($45, $j$08)|0;
+ $47 = HEAP32[$23>>2]|0;
+ $48 = (($46) + ($47))|0;
+ $49 = HEAP32[$15>>2]|0;
+ $50 = HEAP32[$13>>2]|0;
+ $51 = Math_imul($j$08, $20)|0;
+ $i$07 = 0;
+ while(1) {
+ $52 = Math_imul($49, $i$07)|0;
+ $53 = (($52) + ($50))|0;
+ $54 = HEAP32[$a>>2]|0;
+ $55 = HEAP32[$54>>2]|0;
+ $56 = Math_imul($55, $48)|0;
+ $57 = (($53) + ($56))|0;
+ $$sum = Math_imul($57, $out_n)|0;
+ $58 = (($8) + ($$sum)|0);
+ $59 = HEAP32[$10>>2]|0;
+ $60 = (($i$07) + ($51))|0;
+ $61 = Math_imul($60, $out_n)|0;
+ $62 = (($59) + ($61)|0);
+ _memcpy(($58|0),($62|0),($out_n|0))|0;
+ $63 = (($i$07) + 1)|0;
+ $64 = ($63|0)<($20|0);
+ if ($64) {
+ $i$07 = $63;
+ } else {
+ break;
+ }
+ }
+ }
+ $65 = (($j$08) + 1)|0;
+ $66 = ($65|0)<($30|0);
+ if ($66) {
+ $j$08 = $65;
+ } else {
+ break;
+ }
+ }
+ }
+ $67 = HEAP32[$9>>2]|0;
+ _free($67);
+ $68 = (($$0212) + ($40)|0);
+ $69 = (($$0311) - ($40))|0;
+ $$1 = $68;$$14 = $69;
+ } else {
+ $$1 = $$0212;$$14 = $$0311;
+ }
+ $70 = (($p$010) + 1)|0;
+ $71 = ($70|0)<(7);
+ if ($71) {
+ $$0212 = $$1;$$0311 = $$14;$p$010 = $70;
+ } else {
+ label = 15;
+ break;
+ }
+ }
+ if ((label|0) == 8) {
+ _free($8);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 15) {
+ $72 = ((($a)) + 12|0);
+ HEAP32[$72>>2] = $8;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__compute_transparency16($z,$tc,$out_n) {
+ $z = $z|0;
+ $tc = $tc|0;
+ $out_n = $out_n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$03 = 0, $i$15 = 0, $not$ = 0, $p$04 = 0, $p$16 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = Math_imul($3, $1)|0;
+ $5 = ((($z)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ switch ($out_n|0) {
+ case 2: {
+ $11 = ($4|0)==(0);
+ if ($11) {
+ return;
+ }
+ $12 = Math_imul($3, $1)|0;
+ $i$03 = 0;$p$04 = $6;
+ while(1) {
+ $13 = HEAP16[$p$04>>1]|0;
+ $14 = HEAP16[$tc>>1]|0;
+ $not$ = ($13<<16>>16)!=($14<<16>>16);
+ $15 = $not$ << 31 >> 31;
+ $16 = ((($p$04)) + 2|0);
+ HEAP16[$16>>1] = $15;
+ $17 = ((($p$04)) + 4|0);
+ $18 = (($i$03) + 1)|0;
+ $exitcond = ($18|0)==($12|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$03 = $18;$p$04 = $17;
+ }
+ }
+ return;
+ break;
+ }
+ case 4: {
+ $7 = ($4|0)==(0);
+ if ($7) {
+ return;
+ }
+ $8 = ((($tc)) + 2|0);
+ $9 = ((($tc)) + 4|0);
+ $10 = Math_imul($3, $1)|0;
+ $i$15 = 0;$p$16 = $6;
+ while(1) {
+ $19 = HEAP16[$p$16>>1]|0;
+ $20 = HEAP16[$tc>>1]|0;
+ $21 = ($19<<16>>16)==($20<<16>>16);
+ if ($21) {
+ $22 = ((($p$16)) + 2|0);
+ $23 = HEAP16[$22>>1]|0;
+ $24 = HEAP16[$8>>1]|0;
+ $25 = ($23<<16>>16)==($24<<16>>16);
+ if ($25) {
+ $26 = ((($p$16)) + 4|0);
+ $27 = HEAP16[$26>>1]|0;
+ $28 = HEAP16[$9>>1]|0;
+ $29 = ($27<<16>>16)==($28<<16>>16);
+ if ($29) {
+ $30 = ((($p$16)) + 6|0);
+ HEAP16[$30>>1] = 0;
+ }
+ }
+ }
+ $31 = ((($p$16)) + 8|0);
+ $32 = (($i$15) + 1)|0;
+ $exitcond8 = ($32|0)==($10|0);
+ if ($exitcond8) {
+ break;
+ } else {
+ $i$15 = $32;$p$16 = $31;
+ }
+ }
+ return;
+ break;
+ }
+ default: {
+ ___assert_fail((13014|0),(12975|0),4298,(13066|0));
+ // unreachable;
+ }
+ }
+}
+function _stbi__compute_transparency($z,$tc,$out_n) {
+ $z = $z|0;
+ $tc = $tc|0;
+ $out_n = $out_n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$03 = 0, $i$15 = 0, $not$ = 0, $p$04 = 0, $p$16 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = Math_imul($3, $1)|0;
+ $5 = ((($z)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ switch ($out_n|0) {
+ case 2: {
+ $11 = ($4|0)==(0);
+ if ($11) {
+ return;
+ }
+ $12 = Math_imul($3, $1)|0;
+ $i$03 = 0;$p$04 = $6;
+ while(1) {
+ $13 = HEAP8[$p$04>>0]|0;
+ $14 = HEAP8[$tc>>0]|0;
+ $not$ = ($13<<24>>24)!=($14<<24>>24);
+ $15 = $not$ << 31 >> 31;
+ $16 = ((($p$04)) + 1|0);
+ HEAP8[$16>>0] = $15;
+ $17 = ((($p$04)) + 2|0);
+ $18 = (($i$03) + 1)|0;
+ $exitcond = ($18|0)==($12|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$03 = $18;$p$04 = $17;
+ }
+ }
+ return;
+ break;
+ }
+ case 4: {
+ $7 = ($4|0)==(0);
+ if ($7) {
+ return;
+ }
+ $8 = ((($tc)) + 1|0);
+ $9 = ((($tc)) + 2|0);
+ $10 = Math_imul($3, $1)|0;
+ $i$15 = 0;$p$16 = $6;
+ while(1) {
+ $19 = HEAP8[$p$16>>0]|0;
+ $20 = HEAP8[$tc>>0]|0;
+ $21 = ($19<<24>>24)==($20<<24>>24);
+ if ($21) {
+ $22 = ((($p$16)) + 1|0);
+ $23 = HEAP8[$22>>0]|0;
+ $24 = HEAP8[$8>>0]|0;
+ $25 = ($23<<24>>24)==($24<<24>>24);
+ if ($25) {
+ $26 = ((($p$16)) + 2|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = HEAP8[$9>>0]|0;
+ $29 = ($27<<24>>24)==($28<<24>>24);
+ if ($29) {
+ $30 = ((($p$16)) + 3|0);
+ HEAP8[$30>>0] = 0;
+ }
+ }
+ }
+ $31 = ((($p$16)) + 4|0);
+ $32 = (($i$15) + 1)|0;
+ $exitcond8 = ($32|0)==($10|0);
+ if ($exitcond8) {
+ break;
+ } else {
+ $i$15 = $32;$p$16 = $31;
+ }
+ }
+ return;
+ break;
+ }
+ default: {
+ ___assert_fail((13014|0),(12975|0),4273,(13039|0));
+ // unreachable;
+ }
+ }
+}
+function _stbi__de_iphone($z) {
+ $z = $z|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $exitcond14 = 0, $i$06 = 0, $i$111 = 0, $i$28 = 0, $p$05 = 0, $p$110 = 0, $p$27 = 0, $storemerge = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = Math_imul($3, $1)|0;
+ $5 = ((($z)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($0)) + 12|0);
+ $8 = HEAP32[$7>>2]|0;
+ switch ($8|0) {
+ case 3: {
+ $9 = ($4|0)==(0);
+ if ($9) {
+ return;
+ }
+ $10 = Math_imul($3, $1)|0;
+ $i$06 = 0;$p$05 = $6;
+ while(1) {
+ $11 = HEAP8[$p$05>>0]|0;
+ $12 = ((($p$05)) + 2|0);
+ $13 = HEAP8[$12>>0]|0;
+ HEAP8[$p$05>>0] = $13;
+ HEAP8[$12>>0] = $11;
+ $14 = ((($p$05)) + 3|0);
+ $15 = (($i$06) + 1)|0;
+ $exitcond = ($15|0)==($10|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$06 = $15;$p$05 = $14;
+ }
+ }
+ return;
+ break;
+ }
+ case 4: {
+ $16 = HEAP32[2616>>2]|0;
+ $17 = ($16|0)==(0);
+ $18 = ($4|0)==(0);
+ if ($17) {
+ if ($18) {
+ return;
+ }
+ $20 = Math_imul($3, $1)|0;
+ $i$28 = 0;$p$27 = $6;
+ while(1) {
+ $44 = HEAP8[$p$27>>0]|0;
+ $45 = ((($p$27)) + 2|0);
+ $46 = HEAP8[$45>>0]|0;
+ HEAP8[$p$27>>0] = $46;
+ HEAP8[$45>>0] = $44;
+ $47 = ((($p$27)) + 4|0);
+ $48 = (($i$28) + 1)|0;
+ $exitcond13 = ($48|0)==($20|0);
+ if ($exitcond13) {
+ break;
+ } else {
+ $i$28 = $48;$p$27 = $47;
+ }
+ }
+ return;
+ }
+ if ($18) {
+ return;
+ }
+ $19 = Math_imul($3, $1)|0;
+ $i$111 = 0;$p$110 = $6;
+ while(1) {
+ $21 = ((($p$110)) + 3|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = HEAP8[$p$110>>0]|0;
+ $24 = ($22<<24>>24)==(0);
+ $25 = ((($p$110)) + 2|0);
+ $26 = HEAP8[$25>>0]|0;
+ if ($24) {
+ HEAP8[$p$110>>0] = $26;
+ $storemerge = $23;
+ } else {
+ $27 = $26&255;
+ $28 = ($27*255)|0;
+ $29 = $22&255;
+ $30 = (($28>>>0) / ($29>>>0))&-1;
+ $31 = $30&255;
+ HEAP8[$p$110>>0] = $31;
+ $32 = ((($p$110)) + 1|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = $33&255;
+ $35 = ($34*255)|0;
+ $36 = (($35>>>0) / ($29>>>0))&-1;
+ $37 = $36&255;
+ HEAP8[$32>>0] = $37;
+ $38 = $23&255;
+ $39 = ($38*255)|0;
+ $40 = (($39>>>0) / ($29>>>0))&-1;
+ $41 = $40&255;
+ $storemerge = $41;
+ }
+ HEAP8[$25>>0] = $storemerge;
+ $42 = ((($p$110)) + 4|0);
+ $43 = (($i$111) + 1)|0;
+ $exitcond14 = ($43|0)==($19|0);
+ if ($exitcond14) {
+ break;
+ } else {
+ $i$111 = $43;$p$110 = $42;
+ }
+ }
+ return;
+ break;
+ }
+ default: {
+ ___assert_fail((12957|0),(12975|0),4399,(12998|0));
+ // unreachable;
+ }
+ }
+}
+function _stbi__expand_png_palette($a,$palette,$pal_img_n) {
+ $a = $a|0;
+ $palette = $palette|0;
+ $pal_img_n = $pal_img_n|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$04 = 0, $i$16 = 0, $p$03 = 0, $p$15 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$a>>2]|0;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = Math_imul($3, $1)|0;
+ $5 = ((($a)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = Math_imul($4, $pal_img_n)|0;
+ $8 = (_stbi__malloc($7)|0);
+ $9 = ($8|0)==(0|0);
+ if ($9) {
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $10 = ($pal_img_n|0)==(3);
+ $11 = ($4|0)==(0);
+ if ($10) {
+ if (!($11)) {
+ $13 = Math_imul($3, $1)|0;
+ $i$04 = 0;$p$03 = $8;
+ while(1) {
+ $14 = (($6) + ($i$04)|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = $15&255;
+ $17 = $16 << 2;
+ $18 = (($palette) + ($17)|0);
+ $19 = HEAP8[$18>>0]|0;
+ HEAP8[$p$03>>0] = $19;
+ $20 = $17 | 1;
+ $21 = (($palette) + ($20)|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = ((($p$03)) + 1|0);
+ HEAP8[$23>>0] = $22;
+ $24 = $17 | 2;
+ $25 = (($palette) + ($24)|0);
+ $26 = HEAP8[$25>>0]|0;
+ $27 = ((($p$03)) + 2|0);
+ HEAP8[$27>>0] = $26;
+ $28 = ((($p$03)) + 3|0);
+ $29 = (($i$04) + 1)|0;
+ $exitcond = ($29|0)==($13|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$04 = $29;$p$03 = $28;
+ }
+ }
+ }
+ } else {
+ if (!($11)) {
+ $12 = Math_imul($3, $1)|0;
+ $i$16 = 0;$p$15 = $8;
+ while(1) {
+ $30 = (($6) + ($i$16)|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = $31&255;
+ $33 = $32 << 2;
+ $34 = (($palette) + ($33)|0);
+ $35 = HEAP8[$34>>0]|0;
+ HEAP8[$p$15>>0] = $35;
+ $36 = $33 | 1;
+ $37 = (($palette) + ($36)|0);
+ $38 = HEAP8[$37>>0]|0;
+ $39 = ((($p$15)) + 1|0);
+ HEAP8[$39>>0] = $38;
+ $40 = $33 | 2;
+ $41 = (($palette) + ($40)|0);
+ $42 = HEAP8[$41>>0]|0;
+ $43 = ((($p$15)) + 2|0);
+ HEAP8[$43>>0] = $42;
+ $44 = $33 | 3;
+ $45 = (($palette) + ($44)|0);
+ $46 = HEAP8[$45>>0]|0;
+ $47 = ((($p$15)) + 3|0);
+ HEAP8[$47>>0] = $46;
+ $48 = ((($p$15)) + 4|0);
+ $49 = (($i$16) + 1)|0;
+ $exitcond8 = ($49|0)==($12|0);
+ if ($exitcond8) {
+ break;
+ } else {
+ $i$16 = $49;$p$15 = $48;
+ }
+ }
+ }
+ }
+ $50 = HEAP32[$5>>2]|0;
+ _free($50);
+ HEAP32[$5>>2] = $8;
+ $$0 = 1;
+ return ($$0|0);
+}
+function _stbi__create_png_image_raw($a,$raw,$raw_len,$out_n,$x,$y,$depth,$color) {
+ $a = $a|0;
+ $raw = $raw|0;
+ $raw_len = $raw_len|0;
+ $out_n = $out_n|0;
+ $x = $x|0;
+ $y = $y|0;
+ $depth = $depth|0;
+ $color = $color|0;
+ var $$0 = 0, $$01214 = 0, $$1 = 0, $$10 = 0, $$2192 = 0, $$3184 = 0, $$4176 = 0, $$5167 = 0, $$6158 = 0, $$7149 = 0, $$8141 = 0, $$9 = 0, $$not = 0, $$not288 = 0, $$sum = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0;
+ var $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum272 = 0, $$sum273 = 0, $$sum274 = 0, $$sum275 = 0, $$sum276 = 0, $$sum277 = 0;
+ var $$sum278 = 0, $$sum279 = 0, $$sum28 = 0, $$sum29 = 0, $$sum29$pn = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0;
+ var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0;
+ var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0;
+ var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0;
+ var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0;
+ var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0;
+ var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0;
+ var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0;
+ var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0;
+ var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0;
+ var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0;
+ var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
+ var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
+ var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
+ var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
+ var $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0;
+ var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0;
+ var $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0;
+ var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0;
+ var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0;
+ var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0;
+ var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0;
+ var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0;
+ var $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0;
+ var $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0;
+ var $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0;
+ var $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0;
+ var $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0;
+ var $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0;
+ var $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0;
+ var $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0;
+ var $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
+ var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
+ var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $brmerge287 = 0, $cur$0$sum = 0, $cur$0$sum30 = 0, $cur$0$sum31 = 0, $cur$0$sum32 = 0, $cur$0$sum33 = 0, $cur$0$sum34 = 0, $cur$0$sum35 = 0, $cur$0$sum36 = 0, $cur$0$sum37 = 0, $cur$0$sum38 = 0, $cur$0$sum39 = 0, $cur$0$sum40 = 0;
+ var $cur$0$sum41 = 0, $cur$1 = 0, $cur$2191 = 0, $cur$3183 = 0, $cur$4174 = 0, $cur$5165 = 0, $cur$6156 = 0, $cur$7148 = 0, $cur$8140 = 0, $cur$9196 = 0, $cur1$0$lcssa = 0, $cur1$0112 = 0, $cur1$1$lcssa = 0, $cur1$1104 = 0, $cur1$4$lcssa = 0, $cur1$499 = 0, $cur16$0129 = 0, $exitcond = 0, $exitcond249 = 0, $exitcond250 = 0;
+ var $exitcond252 = 0, $exitcond254 = 0, $exitcond256 = 0, $exitcond258 = 0, $exitcond260 = 0, $exitcond262 = 0, $exitcond265 = 0, $exitcond266 = 0, $exitcond267 = 0, $exitcond268 = 0, $exitcond269 = 0, $exitcond270 = 0, $exitcond271 = 0, $filter$0 = 0, $filter_bytes$0212 = 0, $filter_bytes$1 = 0, $i$0 = 0, $i$0190 = 0, $i$0193 = 0, $i$1 = 0;
+ var $i$1182 = 0, $i$1185 = 0, $i$2 = 0, $i$2173 = 0, $i$2177 = 0, $i$3 = 0, $i$3164 = 0, $i$3168 = 0, $i$4 = 0, $i$4155 = 0, $i$4159 = 0, $i$5 = 0, $i$5147 = 0, $i$5150 = 0, $i$6 = 0, $i$6139 = 0, $i$6142 = 0, $i$7195 = 0, $i$8127 = 0, $in$0$lcssa = 0;
+ var $in$0113 = 0, $in$1$lcssa = 0, $in$1105 = 0, $in$2$lcssa = 0, $in$2100 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next234 = 0, $indvars$iv$next237 = 0, $indvars$iv$next240 = 0, $indvars$iv$next243 = 0, $indvars$iv$next246 = 0, $indvars$iv233 = 0, $indvars$iv236 = 0, $indvars$iv239 = 0, $indvars$iv242 = 0, $indvars$iv245 = 0, $j$0211 = 0, $j$1125 = 0, $k$0132 = 0;
+ var $k$10161 = 0, $k$11152 = 0, $k$1209 = 0, $k$12144 = 0, $k$13136 = 0, $k$14$lcssa = 0, $k$14111 = 0, $k$15$lcssa = 0, $k$15103 = 0, $k$16$lcssa = 0, $k$1698 = 0, $k$2207 = 0, $k$3205 = 0, $k$4203 = 0, $k$5201 = 0, $k$6199 = 0, $k$7187 = 0, $k$8179 = 0, $k$9170 = 0, $or$cond = 0;
+ var $or$cond290 = 0, $prior$0 = 0, $prior$3175 = 0, $prior$4166 = 0, $prior$5157 = 0, $q$0 = 0, $q$0122 = 0, $q$0123 = 0, $q$1 = 0, $q$1119 = 0, $q$1120 = 0, $scevgep = 0, $scevgep235 = 0, $scevgep238 = 0, $scevgep241 = 0, $scevgep244 = 0, $scevgep247 = 0, $scevgep251 = 0, $scevgep253 = 0, $scevgep255 = 0;
+ var $scevgep257 = 0, $scevgep259 = 0, $scevgep261 = 0, $scevgep264 = 0, $width$0213 = 0, $width$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($depth|0)==(16);
+ $1 = $0 ? 2 : 1;
+ $2 = HEAP32[$a>>2]|0;
+ $3 = Math_imul($x, $out_n)|0;
+ $4 = Math_imul($1, $3)|0;
+ $5 = ((($2)) + 8|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = Math_imul($1, $out_n)|0;
+ $8 = Math_imul($6, $1)|0;
+ $9 = ($6|0)==($out_n|0);
+ $10 = (($6) + 1)|0;
+ $11 = ($10|0)==($out_n|0);
+ $or$cond = $9 | $11;
+ if (!($or$cond)) {
+ ___assert_fail((13095|0),(12975|0),4026,(13136|0));
+ // unreachable;
+ }
+ $12 = Math_imul($y, $x)|0;
+ $13 = Math_imul($7, $12)|0;
+ $14 = (_stbi__malloc($13)|0);
+ $15 = ((($a)) + 12|0);
+ HEAP32[$15>>2] = $14;
+ $16 = ($14|0)==(0|0);
+ if ($16) {
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $17 = Math_imul($6, $x)|0;
+ $18 = Math_imul($17, $depth)|0;
+ $19 = (($18) + 7)|0;
+ $20 = $19 >>> 3;
+ $21 = (($20) + 1)|0;
+ $22 = Math_imul($21, $y)|0;
+ $23 = HEAP32[$2>>2]|0;
+ $24 = ($23|0)==($x|0);
+ if ($24) {
+ $25 = ((($2)) + 4|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($26|0)==($y|0);
+ if ($27) {
+ $28 = ($22|0)==($raw_len|0);
+ if (!($28)) {
+ _stbi__err(13163);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ if ((label|0) == 9) {
+ $29 = ($22>>>0)>($raw_len>>>0);
+ if ($29) {
+ _stbi__err(13163);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $30 = ($y|0)==(0);
+ L18: do {
+ if (!($30)) {
+ $31 = ($depth|0)<(8);
+ $32 = ($20>>>0)>($x>>>0);
+ $33 = (($3) - ($20))|0;
+ $34 = ($depth|0)==(8);
+ $$sum17 = (($6) + 1)|0;
+ $brmerge = $31 | $9;
+ $35 = ($x|0)==(0);
+ $i$0190 = (($x) + -1)|0;
+ $36 = ($i$0190|0)==(0);
+ $i$1182 = (($x) + -1)|0;
+ $37 = ($i$1182|0)==(0);
+ $i$2173 = (($x) + -1)|0;
+ $38 = ($i$2173|0)==(0);
+ $i$3164 = (($x) + -1)|0;
+ $39 = ($i$3164|0)==(0);
+ $i$4155 = (($x) + -1)|0;
+ $40 = ($i$4155|0)==(0);
+ $i$5147 = (($x) + -1)|0;
+ $41 = ($i$5147|0)==(0);
+ $i$6139 = (($x) + -1)|0;
+ $42 = ($i$6139|0)==(0);
+ $$not = $0 ^ 1;
+ $brmerge287 = $35 | $$not;
+ $$01214 = $raw;$filter_bytes$0212 = $8;$j$0211 = 0;$width$0213 = $x;
+ while(1) {
+ $43 = HEAP32[$15>>2]|0;
+ $44 = Math_imul($j$0211, $4)|0;
+ $$sum13 = (($44) - ($4))|0;
+ $45 = HEAP8[$$01214>>0]|0;
+ $46 = $45&255;
+ $47 = ($45&255)>(4);
+ if ($47) {
+ label = 14;
+ break;
+ }
+ if ($31) {
+ if ($32) {
+ label = 17;
+ break;
+ }
+ $$sum29 = (($33) + ($44))|0;
+ $$sum29$pn = $$sum29;$filter_bytes$1 = 1;$width$1 = $20;
+ } else {
+ $$sum29$pn = $44;$filter_bytes$1 = $filter_bytes$0212;$width$1 = $width$0213;
+ }
+ $48 = ($j$0211|0)==(0);
+ if ($48) {
+ $49 = (13217 + ($46)|0);
+ $50 = HEAP8[$49>>0]|0;
+ $51 = $50&255;
+ $filter$0 = $51;
+ } else {
+ $filter$0 = $46;
+ }
+ $52 = ($filter_bytes$1|0)>(0);
+ L30: do {
+ if ($52) {
+ $k$0132 = 0;
+ while(1) {
+ switch ($filter$0|0) {
+ case 0: {
+ $$sum28 = (($k$0132) + 1)|0;
+ $53 = (($$01214) + ($$sum28)|0);
+ $54 = HEAP8[$53>>0]|0;
+ $cur$0$sum35 = (($k$0132) + ($$sum29$pn))|0;
+ $55 = (($43) + ($cur$0$sum35)|0);
+ HEAP8[$55>>0] = $54;
+ break;
+ }
+ case 1: {
+ $$sum27 = (($k$0132) + 1)|0;
+ $56 = (($$01214) + ($$sum27)|0);
+ $57 = HEAP8[$56>>0]|0;
+ $cur$0$sum36 = (($k$0132) + ($$sum29$pn))|0;
+ $58 = (($43) + ($cur$0$sum36)|0);
+ HEAP8[$58>>0] = $57;
+ break;
+ }
+ case 2: {
+ $$sum25 = (($k$0132) + 1)|0;
+ $59 = (($$01214) + ($$sum25)|0);
+ $60 = HEAP8[$59>>0]|0;
+ $61 = $60&255;
+ $$sum26 = (($k$0132) + ($$sum13))|0;
+ $62 = (($43) + ($$sum26)|0);
+ $63 = HEAP8[$62>>0]|0;
+ $64 = $63&255;
+ $65 = (($64) + ($61))|0;
+ $66 = $65&255;
+ $cur$0$sum37 = (($k$0132) + ($$sum29$pn))|0;
+ $67 = (($43) + ($cur$0$sum37)|0);
+ HEAP8[$67>>0] = $66;
+ break;
+ }
+ case 3: {
+ $$sum23 = (($k$0132) + 1)|0;
+ $68 = (($$01214) + ($$sum23)|0);
+ $69 = HEAP8[$68>>0]|0;
+ $70 = $69&255;
+ $$sum24 = (($k$0132) + ($$sum13))|0;
+ $71 = (($43) + ($$sum24)|0);
+ $72 = HEAP8[$71>>0]|0;
+ $73 = $72&255;
+ $74 = $73 >>> 1;
+ $75 = (($74) + ($70))|0;
+ $76 = $75&255;
+ $cur$0$sum38 = (($k$0132) + ($$sum29$pn))|0;
+ $77 = (($43) + ($cur$0$sum38)|0);
+ HEAP8[$77>>0] = $76;
+ break;
+ }
+ case 4: {
+ $$sum21 = (($k$0132) + 1)|0;
+ $78 = (($$01214) + ($$sum21)|0);
+ $79 = HEAP8[$78>>0]|0;
+ $80 = $79&255;
+ $$sum22 = (($k$0132) + ($$sum13))|0;
+ $81 = (($43) + ($$sum22)|0);
+ $82 = HEAP8[$81>>0]|0;
+ $83 = $82&255;
+ $84 = (_stbi__paeth(0,$83,0)|0);
+ $85 = (($84) + ($80))|0;
+ $86 = $85&255;
+ $cur$0$sum39 = (($k$0132) + ($$sum29$pn))|0;
+ $87 = (($43) + ($cur$0$sum39)|0);
+ HEAP8[$87>>0] = $86;
+ break;
+ }
+ case 5: {
+ $$sum20 = (($k$0132) + 1)|0;
+ $88 = (($$01214) + ($$sum20)|0);
+ $89 = HEAP8[$88>>0]|0;
+ $cur$0$sum40 = (($k$0132) + ($$sum29$pn))|0;
+ $90 = (($43) + ($cur$0$sum40)|0);
+ HEAP8[$90>>0] = $89;
+ break;
+ }
+ case 6: {
+ $$sum19 = (($k$0132) + 1)|0;
+ $91 = (($$01214) + ($$sum19)|0);
+ $92 = HEAP8[$91>>0]|0;
+ $cur$0$sum41 = (($k$0132) + ($$sum29$pn))|0;
+ $93 = (($43) + ($cur$0$sum41)|0);
+ HEAP8[$93>>0] = $92;
+ break;
+ }
+ default: {
+ }
+ }
+ $94 = (($k$0132) + 1)|0;
+ $exitcond249 = ($94|0)==($filter_bytes$1|0);
+ if ($exitcond249) {
+ break L30;
+ } else {
+ $k$0132 = $94;
+ }
+ }
+ }
+ } while(0);
+ do {
+ if ($34) {
+ if (!($9)) {
+ $cur$0$sum34 = (($$sum29$pn) + ($6))|0;
+ $95 = (($43) + ($cur$0$sum34)|0);
+ HEAP8[$95>>0] = -1;
+ }
+ $96 = (($$01214) + ($$sum17)|0);
+ $cur$0$sum33 = (($$sum29$pn) + ($out_n))|0;
+ $97 = (($43) + ($cur$0$sum33)|0);
+ $$sum18 = (($$sum13) + ($out_n))|0;
+ $98 = (($43) + ($$sum18)|0);
+ $$1 = $96;$cur$1 = $97;$prior$0 = $98;
+ } else {
+ if (!($0)) {
+ $105 = ((($$01214)) + 2|0);
+ $cur$0$sum = (($$sum29$pn) + 1)|0;
+ $106 = (($43) + ($cur$0$sum)|0);
+ $$sum14 = (($$sum13) + 1)|0;
+ $107 = (($43) + ($$sum14)|0);
+ $$1 = $105;$cur$1 = $106;$prior$0 = $107;
+ break;
+ }
+ if (!($9)) {
+ $cur$0$sum32 = (($$sum29$pn) + ($filter_bytes$1))|0;
+ $99 = (($43) + ($cur$0$sum32)|0);
+ HEAP8[$99>>0] = -1;
+ $100 = (($filter_bytes$1) + 1)|0;
+ $cur$0$sum31 = (($100) + ($$sum29$pn))|0;
+ $101 = (($43) + ($cur$0$sum31)|0);
+ HEAP8[$101>>0] = -1;
+ }
+ $$sum15 = (($filter_bytes$1) + 1)|0;
+ $102 = (($$01214) + ($$sum15)|0);
+ $cur$0$sum30 = (($$sum29$pn) + ($7))|0;
+ $103 = (($43) + ($cur$0$sum30)|0);
+ $$sum16 = (($$sum13) + ($7))|0;
+ $104 = (($43) + ($$sum16)|0);
+ $$1 = $102;$cur$1 = $103;$prior$0 = $104;
+ }
+ } while(0);
+ if ($brmerge) {
+ $108 = (($width$1) + -1)|0;
+ $109 = Math_imul($108, $filter_bytes$1)|0;
+ switch ($filter$0|0) {
+ case 0: {
+ _memcpy(($cur$1|0),($$1|0),($109|0))|0;
+ break;
+ }
+ case 1: {
+ $125 = ($109|0)>(0);
+ if ($125) {
+ $126 = (($width$1) + -1)|0;
+ $127 = Math_imul($filter_bytes$1, $126)|0;
+ $k$1209 = 0;
+ while(1) {
+ $128 = (($$1) + ($k$1209)|0);
+ $129 = HEAP8[$128>>0]|0;
+ $130 = $129&255;
+ $131 = (($k$1209) - ($filter_bytes$1))|0;
+ $132 = (($cur$1) + ($131)|0);
+ $133 = HEAP8[$132>>0]|0;
+ $134 = $133&255;
+ $135 = (($134) + ($130))|0;
+ $136 = $135&255;
+ $137 = (($cur$1) + ($k$1209)|0);
+ HEAP8[$137>>0] = $136;
+ $138 = (($k$1209) + 1)|0;
+ $exitcond271 = ($138|0)==($127|0);
+ if ($exitcond271) {
+ break;
+ } else {
+ $k$1209 = $138;
+ }
+ }
+ }
+ break;
+ }
+ case 2: {
+ $122 = ($109|0)>(0);
+ if ($122) {
+ $123 = (($width$1) + -1)|0;
+ $124 = Math_imul($filter_bytes$1, $123)|0;
+ $k$2207 = 0;
+ while(1) {
+ $139 = (($$1) + ($k$2207)|0);
+ $140 = HEAP8[$139>>0]|0;
+ $141 = $140&255;
+ $142 = (($prior$0) + ($k$2207)|0);
+ $143 = HEAP8[$142>>0]|0;
+ $144 = $143&255;
+ $145 = (($144) + ($141))|0;
+ $146 = $145&255;
+ $147 = (($cur$1) + ($k$2207)|0);
+ HEAP8[$147>>0] = $146;
+ $148 = (($k$2207) + 1)|0;
+ $exitcond270 = ($148|0)==($124|0);
+ if ($exitcond270) {
+ break;
+ } else {
+ $k$2207 = $148;
+ }
+ }
+ }
+ break;
+ }
+ case 3: {
+ $119 = ($109|0)>(0);
+ if ($119) {
+ $120 = (($width$1) + -1)|0;
+ $121 = Math_imul($filter_bytes$1, $120)|0;
+ $k$3205 = 0;
+ while(1) {
+ $149 = (($$1) + ($k$3205)|0);
+ $150 = HEAP8[$149>>0]|0;
+ $151 = $150&255;
+ $152 = (($prior$0) + ($k$3205)|0);
+ $153 = HEAP8[$152>>0]|0;
+ $154 = $153&255;
+ $155 = (($k$3205) - ($filter_bytes$1))|0;
+ $156 = (($cur$1) + ($155)|0);
+ $157 = HEAP8[$156>>0]|0;
+ $158 = $157&255;
+ $159 = (($158) + ($154))|0;
+ $160 = $159 >>> 1;
+ $161 = (($160) + ($151))|0;
+ $162 = $161&255;
+ $163 = (($cur$1) + ($k$3205)|0);
+ HEAP8[$163>>0] = $162;
+ $164 = (($k$3205) + 1)|0;
+ $exitcond269 = ($164|0)==($121|0);
+ if ($exitcond269) {
+ break;
+ } else {
+ $k$3205 = $164;
+ }
+ }
+ }
+ break;
+ }
+ case 4: {
+ $116 = ($109|0)>(0);
+ if ($116) {
+ $117 = (($width$1) + -1)|0;
+ $118 = Math_imul($filter_bytes$1, $117)|0;
+ $k$4203 = 0;
+ while(1) {
+ $165 = (($$1) + ($k$4203)|0);
+ $166 = HEAP8[$165>>0]|0;
+ $167 = $166&255;
+ $168 = (($k$4203) - ($filter_bytes$1))|0;
+ $169 = (($cur$1) + ($168)|0);
+ $170 = HEAP8[$169>>0]|0;
+ $171 = $170&255;
+ $172 = (($prior$0) + ($k$4203)|0);
+ $173 = HEAP8[$172>>0]|0;
+ $174 = $173&255;
+ $175 = (($prior$0) + ($168)|0);
+ $176 = HEAP8[$175>>0]|0;
+ $177 = $176&255;
+ $178 = (_stbi__paeth($171,$174,$177)|0);
+ $179 = (($178) + ($167))|0;
+ $180 = $179&255;
+ $181 = (($cur$1) + ($k$4203)|0);
+ HEAP8[$181>>0] = $180;
+ $182 = (($k$4203) + 1)|0;
+ $exitcond268 = ($182|0)==($118|0);
+ if ($exitcond268) {
+ break;
+ } else {
+ $k$4203 = $182;
+ }
+ }
+ }
+ break;
+ }
+ case 5: {
+ $113 = ($109|0)>(0);
+ if ($113) {
+ $114 = (($width$1) + -1)|0;
+ $115 = Math_imul($filter_bytes$1, $114)|0;
+ $k$5201 = 0;
+ while(1) {
+ $183 = (($$1) + ($k$5201)|0);
+ $184 = HEAP8[$183>>0]|0;
+ $185 = $184&255;
+ $186 = (($k$5201) - ($filter_bytes$1))|0;
+ $187 = (($cur$1) + ($186)|0);
+ $188 = HEAP8[$187>>0]|0;
+ $189 = $188&255;
+ $190 = $189 >>> 1;
+ $191 = (($190) + ($185))|0;
+ $192 = $191&255;
+ $193 = (($cur$1) + ($k$5201)|0);
+ HEAP8[$193>>0] = $192;
+ $194 = (($k$5201) + 1)|0;
+ $exitcond267 = ($194|0)==($115|0);
+ if ($exitcond267) {
+ break;
+ } else {
+ $k$5201 = $194;
+ }
+ }
+ }
+ break;
+ }
+ case 6: {
+ $110 = ($109|0)>(0);
+ if ($110) {
+ $111 = (($width$1) + -1)|0;
+ $112 = Math_imul($filter_bytes$1, $111)|0;
+ $k$6199 = 0;
+ while(1) {
+ $195 = (($$1) + ($k$6199)|0);
+ $196 = HEAP8[$195>>0]|0;
+ $197 = $196&255;
+ $198 = (($k$6199) - ($filter_bytes$1))|0;
+ $199 = (($cur$1) + ($198)|0);
+ $200 = HEAP8[$199>>0]|0;
+ $201 = $200&255;
+ $202 = (_stbi__paeth($201,0,0)|0);
+ $203 = (($202) + ($197))|0;
+ $204 = $203&255;
+ $205 = (($cur$1) + ($k$6199)|0);
+ HEAP8[$205>>0] = $204;
+ $206 = (($k$6199) + 1)|0;
+ $exitcond266 = ($206|0)==($112|0);
+ if ($exitcond266) {
+ break;
+ } else {
+ $k$6199 = $206;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ $207 = (($$1) + ($109)|0);
+ $$10 = $207;
+ } else {
+ if (!($11)) {
+ label = 63;
+ break;
+ }
+ switch ($filter$0|0) {
+ case 0: {
+ if ($36) {
+ $$9 = $$1;
+ } else {
+ $220 = ($filter_bytes$1|0)>(0);
+ $221 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$2192 = $$1;$cur$2191 = $cur$1;$i$0193 = $i$0190;
+ while(1) {
+ if ($220) {
+ $k$7187 = 0;
+ while(1) {
+ $222 = (($$2192) + ($k$7187)|0);
+ $223 = HEAP8[$222>>0]|0;
+ $224 = (($cur$2191) + ($k$7187)|0);
+ HEAP8[$224>>0] = $223;
+ $225 = (($k$7187) + 1)|0;
+ $exitcond262 = ($225|0)==($filter_bytes$1|0);
+ if ($exitcond262) {
+ break;
+ } else {
+ $k$7187 = $225;
+ }
+ }
+ }
+ $226 = (($cur$2191) + ($filter_bytes$1)|0);
+ HEAP8[$226>>0] = -1;
+ $227 = (($$2192) + ($filter_bytes$1)|0);
+ $228 = (($cur$2191) + ($7)|0);
+ $i$0 = (($i$0193) + -1)|0;
+ $229 = ($i$0|0)==(0);
+ if ($229) {
+ break;
+ } else {
+ $$2192 = $227;$cur$2191 = $228;$i$0193 = $i$0;
+ }
+ }
+ $scevgep264 = (($$1) + ($221)|0);
+ $$9 = $scevgep264;
+ }
+ break;
+ }
+ case 1: {
+ if ($37) {
+ $$9 = $$1;
+ } else {
+ $218 = ($filter_bytes$1|0)>(0);
+ $219 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$3184 = $$1;$cur$3183 = $cur$1;$i$1185 = $i$1182;
+ while(1) {
+ if ($218) {
+ $k$8179 = 0;
+ while(1) {
+ $230 = (($$3184) + ($k$8179)|0);
+ $231 = HEAP8[$230>>0]|0;
+ $232 = $231&255;
+ $233 = (($k$8179) - ($7))|0;
+ $234 = (($cur$3183) + ($233)|0);
+ $235 = HEAP8[$234>>0]|0;
+ $236 = $235&255;
+ $237 = (($236) + ($232))|0;
+ $238 = $237&255;
+ $239 = (($cur$3183) + ($k$8179)|0);
+ HEAP8[$239>>0] = $238;
+ $240 = (($k$8179) + 1)|0;
+ $exitcond260 = ($240|0)==($filter_bytes$1|0);
+ if ($exitcond260) {
+ break;
+ } else {
+ $k$8179 = $240;
+ }
+ }
+ }
+ $241 = (($cur$3183) + ($filter_bytes$1)|0);
+ HEAP8[$241>>0] = -1;
+ $242 = (($$3184) + ($filter_bytes$1)|0);
+ $243 = (($cur$3183) + ($7)|0);
+ $i$1 = (($i$1185) + -1)|0;
+ $244 = ($i$1|0)==(0);
+ if ($244) {
+ break;
+ } else {
+ $$3184 = $242;$cur$3183 = $243;$i$1185 = $i$1;
+ }
+ }
+ $scevgep261 = (($$1) + ($219)|0);
+ $$9 = $scevgep261;
+ }
+ break;
+ }
+ case 2: {
+ if ($38) {
+ $$9 = $$1;
+ } else {
+ $216 = ($filter_bytes$1|0)>(0);
+ $217 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$4176 = $$1;$cur$4174 = $cur$1;$i$2177 = $i$2173;$prior$3175 = $prior$0;
+ while(1) {
+ if ($216) {
+ $k$9170 = 0;
+ while(1) {
+ $245 = (($$4176) + ($k$9170)|0);
+ $246 = HEAP8[$245>>0]|0;
+ $247 = $246&255;
+ $248 = (($prior$3175) + ($k$9170)|0);
+ $249 = HEAP8[$248>>0]|0;
+ $250 = $249&255;
+ $251 = (($250) + ($247))|0;
+ $252 = $251&255;
+ $253 = (($cur$4174) + ($k$9170)|0);
+ HEAP8[$253>>0] = $252;
+ $254 = (($k$9170) + 1)|0;
+ $exitcond258 = ($254|0)==($filter_bytes$1|0);
+ if ($exitcond258) {
+ break;
+ } else {
+ $k$9170 = $254;
+ }
+ }
+ }
+ $255 = (($cur$4174) + ($filter_bytes$1)|0);
+ HEAP8[$255>>0] = -1;
+ $256 = (($$4176) + ($filter_bytes$1)|0);
+ $257 = (($cur$4174) + ($7)|0);
+ $258 = (($prior$3175) + ($7)|0);
+ $i$2 = (($i$2177) + -1)|0;
+ $259 = ($i$2|0)==(0);
+ if ($259) {
+ break;
+ } else {
+ $$4176 = $256;$cur$4174 = $257;$i$2177 = $i$2;$prior$3175 = $258;
+ }
+ }
+ $scevgep259 = (($$1) + ($217)|0);
+ $$9 = $scevgep259;
+ }
+ break;
+ }
+ case 3: {
+ if ($39) {
+ $$9 = $$1;
+ } else {
+ $214 = ($filter_bytes$1|0)>(0);
+ $215 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$5167 = $$1;$cur$5165 = $cur$1;$i$3168 = $i$3164;$prior$4166 = $prior$0;
+ while(1) {
+ if ($214) {
+ $k$10161 = 0;
+ while(1) {
+ $260 = (($$5167) + ($k$10161)|0);
+ $261 = HEAP8[$260>>0]|0;
+ $262 = $261&255;
+ $263 = (($prior$4166) + ($k$10161)|0);
+ $264 = HEAP8[$263>>0]|0;
+ $265 = $264&255;
+ $266 = (($k$10161) - ($7))|0;
+ $267 = (($cur$5165) + ($266)|0);
+ $268 = HEAP8[$267>>0]|0;
+ $269 = $268&255;
+ $270 = (($269) + ($265))|0;
+ $271 = $270 >>> 1;
+ $272 = (($271) + ($262))|0;
+ $273 = $272&255;
+ $274 = (($cur$5165) + ($k$10161)|0);
+ HEAP8[$274>>0] = $273;
+ $275 = (($k$10161) + 1)|0;
+ $exitcond256 = ($275|0)==($filter_bytes$1|0);
+ if ($exitcond256) {
+ break;
+ } else {
+ $k$10161 = $275;
+ }
+ }
+ }
+ $276 = (($cur$5165) + ($filter_bytes$1)|0);
+ HEAP8[$276>>0] = -1;
+ $277 = (($$5167) + ($filter_bytes$1)|0);
+ $278 = (($cur$5165) + ($7)|0);
+ $279 = (($prior$4166) + ($7)|0);
+ $i$3 = (($i$3168) + -1)|0;
+ $280 = ($i$3|0)==(0);
+ if ($280) {
+ break;
+ } else {
+ $$5167 = $277;$cur$5165 = $278;$i$3168 = $i$3;$prior$4166 = $279;
+ }
+ }
+ $scevgep257 = (($$1) + ($215)|0);
+ $$9 = $scevgep257;
+ }
+ break;
+ }
+ case 4: {
+ if ($40) {
+ $$9 = $$1;
+ } else {
+ $212 = ($filter_bytes$1|0)>(0);
+ $213 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$6158 = $$1;$cur$6156 = $cur$1;$i$4159 = $i$4155;$prior$5157 = $prior$0;
+ while(1) {
+ if ($212) {
+ $k$11152 = 0;
+ while(1) {
+ $281 = (($$6158) + ($k$11152)|0);
+ $282 = HEAP8[$281>>0]|0;
+ $283 = $282&255;
+ $284 = (($k$11152) - ($7))|0;
+ $285 = (($cur$6156) + ($284)|0);
+ $286 = HEAP8[$285>>0]|0;
+ $287 = $286&255;
+ $288 = (($prior$5157) + ($k$11152)|0);
+ $289 = HEAP8[$288>>0]|0;
+ $290 = $289&255;
+ $291 = (($prior$5157) + ($284)|0);
+ $292 = HEAP8[$291>>0]|0;
+ $293 = $292&255;
+ $294 = (_stbi__paeth($287,$290,$293)|0);
+ $295 = (($294) + ($283))|0;
+ $296 = $295&255;
+ $297 = (($cur$6156) + ($k$11152)|0);
+ HEAP8[$297>>0] = $296;
+ $298 = (($k$11152) + 1)|0;
+ $exitcond254 = ($298|0)==($filter_bytes$1|0);
+ if ($exitcond254) {
+ break;
+ } else {
+ $k$11152 = $298;
+ }
+ }
+ }
+ $299 = (($cur$6156) + ($filter_bytes$1)|0);
+ HEAP8[$299>>0] = -1;
+ $300 = (($$6158) + ($filter_bytes$1)|0);
+ $301 = (($cur$6156) + ($7)|0);
+ $302 = (($prior$5157) + ($7)|0);
+ $i$4 = (($i$4159) + -1)|0;
+ $303 = ($i$4|0)==(0);
+ if ($303) {
+ break;
+ } else {
+ $$6158 = $300;$cur$6156 = $301;$i$4159 = $i$4;$prior$5157 = $302;
+ }
+ }
+ $scevgep255 = (($$1) + ($213)|0);
+ $$9 = $scevgep255;
+ }
+ break;
+ }
+ case 5: {
+ if ($41) {
+ $$9 = $$1;
+ } else {
+ $210 = ($filter_bytes$1|0)>(0);
+ $211 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$7149 = $$1;$cur$7148 = $cur$1;$i$5150 = $i$5147;
+ while(1) {
+ if ($210) {
+ $k$12144 = 0;
+ while(1) {
+ $304 = (($$7149) + ($k$12144)|0);
+ $305 = HEAP8[$304>>0]|0;
+ $306 = $305&255;
+ $307 = (($k$12144) - ($7))|0;
+ $308 = (($cur$7148) + ($307)|0);
+ $309 = HEAP8[$308>>0]|0;
+ $310 = $309&255;
+ $311 = $310 >>> 1;
+ $312 = (($311) + ($306))|0;
+ $313 = $312&255;
+ $314 = (($cur$7148) + ($k$12144)|0);
+ HEAP8[$314>>0] = $313;
+ $315 = (($k$12144) + 1)|0;
+ $exitcond252 = ($315|0)==($filter_bytes$1|0);
+ if ($exitcond252) {
+ break;
+ } else {
+ $k$12144 = $315;
+ }
+ }
+ }
+ $316 = (($cur$7148) + ($filter_bytes$1)|0);
+ HEAP8[$316>>0] = -1;
+ $317 = (($$7149) + ($filter_bytes$1)|0);
+ $318 = (($cur$7148) + ($7)|0);
+ $i$5 = (($i$5150) + -1)|0;
+ $319 = ($i$5|0)==(0);
+ if ($319) {
+ break;
+ } else {
+ $$7149 = $317;$cur$7148 = $318;$i$5150 = $i$5;
+ }
+ }
+ $scevgep253 = (($$1) + ($211)|0);
+ $$9 = $scevgep253;
+ }
+ break;
+ }
+ case 6: {
+ if ($42) {
+ $$9 = $$1;
+ } else {
+ $208 = ($filter_bytes$1|0)>(0);
+ $209 = Math_imul($i$6139, $filter_bytes$1)|0;
+ $$8141 = $$1;$cur$8140 = $cur$1;$i$6142 = $i$6139;
+ while(1) {
+ if ($208) {
+ $k$13136 = 0;
+ while(1) {
+ $320 = (($$8141) + ($k$13136)|0);
+ $321 = HEAP8[$320>>0]|0;
+ $322 = $321&255;
+ $323 = (($k$13136) - ($7))|0;
+ $324 = (($cur$8140) + ($323)|0);
+ $325 = HEAP8[$324>>0]|0;
+ $326 = $325&255;
+ $327 = (_stbi__paeth($326,0,0)|0);
+ $328 = (($327) + ($322))|0;
+ $329 = $328&255;
+ $330 = (($cur$8140) + ($k$13136)|0);
+ HEAP8[$330>>0] = $329;
+ $331 = (($k$13136) + 1)|0;
+ $exitcond250 = ($331|0)==($filter_bytes$1|0);
+ if ($exitcond250) {
+ break;
+ } else {
+ $k$13136 = $331;
+ }
+ }
+ }
+ $332 = (($cur$8140) + ($filter_bytes$1)|0);
+ HEAP8[$332>>0] = -1;
+ $333 = (($$8141) + ($filter_bytes$1)|0);
+ $334 = (($cur$8140) + ($7)|0);
+ $i$6 = (($i$6142) + -1)|0;
+ $335 = ($i$6|0)==(0);
+ if ($335) {
+ break;
+ } else {
+ $$8141 = $333;$cur$8140 = $334;$i$6142 = $i$6;
+ }
+ }
+ $scevgep251 = (($$1) + ($209)|0);
+ $$9 = $scevgep251;
+ }
+ break;
+ }
+ default: {
+ $$9 = $$1;
+ }
+ }
+ if ($brmerge287) {
+ $$10 = $$9;
+ } else {
+ $336 = HEAP32[$15>>2]|0;
+ $337 = (($336) + ($44)|0);
+ $338 = (($filter_bytes$1) + 1)|0;
+ $cur$9196 = $337;$i$7195 = 0;
+ while(1) {
+ $339 = (($cur$9196) + ($338)|0);
+ HEAP8[$339>>0] = -1;
+ $340 = (($i$7195) + 1)|0;
+ $341 = (($cur$9196) + ($7)|0);
+ $exitcond265 = ($340|0)==($x|0);
+ if ($exitcond265) {
+ $$10 = $$9;
+ break;
+ } else {
+ $cur$9196 = $341;$i$7195 = $340;
+ }
+ }
+ }
+ }
+ $342 = (($j$0211) + 1)|0;
+ $343 = ($342>>>0)<($y>>>0);
+ if ($343) {
+ $$01214 = $$10;$filter_bytes$0212 = $filter_bytes$1;$j$0211 = $342;$width$0213 = $width$1;
+ } else {
+ break L18;
+ }
+ }
+ if ((label|0) == 14) {
+ _stbi__err(13181);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 17) {
+ ___assert_fail((13196|0),(12975|0),4047,(13136|0));
+ // unreachable;
+ }
+ else if ((label|0) == 63) {
+ ___assert_fail((13222|0),(12975|0),4108,(13136|0));
+ // unreachable;
+ }
+ }
+ } while(0);
+ $344 = ($depth|0)<(8);
+ if (!($344)) {
+ $$not288 = $0 ^ 1;
+ $639 = Math_imul($12, $out_n)|0;
+ $640 = ($639|0)==(0);
+ $or$cond290 = $640 | $$not288;
+ if ($or$cond290) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $641 = HEAP32[$15>>2]|0;
+ $642 = Math_imul($y, $x)|0;
+ $643 = Math_imul($642, $out_n)|0;
+ $cur16$0129 = $641;$i$8127 = 0;
+ while(1) {
+ $644 = HEAP8[$cur16$0129>>0]|0;
+ $645 = $644&255;
+ $646 = $645 << 8;
+ $647 = ((($cur16$0129)) + 1|0);
+ $648 = HEAP8[$647>>0]|0;
+ $649 = $648&255;
+ $650 = $646 | $649;
+ $651 = $650&65535;
+ HEAP16[$cur16$0129>>1] = $651;
+ $652 = (($i$8127) + 1)|0;
+ $653 = ((($cur16$0129)) + 2|0);
+ $exitcond = ($652|0)==($643|0);
+ if ($exitcond) {
+ $$0 = 1;
+ break;
+ } else {
+ $cur16$0129 = $653;$i$8127 = $652;
+ }
+ }
+ return ($$0|0);
+ }
+ $345 = ($y|0)==(0);
+ if ($345) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $$sum = (($3) - ($20))|0;
+ $346 = ($color|0)==(0);
+ $347 = (12888 + ($depth)|0);
+ $q$0122 = (($x) + -1)|0;
+ $348 = ($q$0122|0)>(-1);
+ $q$1119 = (($x) + -1)|0;
+ $349 = ($q$1119|0)>(-1);
+ $350 = ($17|0)>(1);
+ $351 = ($17|0)>(3);
+ $352 = ($17|0)>(7);
+ $353 = Math_imul($6, $x)|0;
+ $354 = (($353) + -8)|0;
+ $355 = $354 >>> 3;
+ $356 = Math_imul($x, $out_n)|0;
+ $357 = (($355) + ($356))|0;
+ $358 = (($357) + 1)|0;
+ $359 = Math_imul($6, $depth)|0;
+ $360 = Math_imul($359, $x)|0;
+ $361 = (($360) + 7)|0;
+ $362 = $361 >>> 3;
+ $363 = (($358) - ($362))|0;
+ $364 = Math_imul($1, $x)|0;
+ $365 = Math_imul($364, $out_n)|0;
+ $366 = (($353) + -8)|0;
+ $367 = $355 << 3;
+ $368 = (($366) - ($367))|0;
+ $369 = (($367) + 8)|0;
+ $370 = Math_imul($6, $x)|0;
+ $371 = (($370) + -4)|0;
+ $372 = $371 >>> 2;
+ $373 = Math_imul($x, $out_n)|0;
+ $374 = (($372) + ($373))|0;
+ $375 = (($374) + 1)|0;
+ $376 = Math_imul($6, $depth)|0;
+ $377 = Math_imul($376, $x)|0;
+ $378 = (($377) + 7)|0;
+ $379 = $378 >>> 3;
+ $380 = (($375) - ($379))|0;
+ $381 = Math_imul($1, $x)|0;
+ $382 = Math_imul($381, $out_n)|0;
+ $383 = (($370) + -4)|0;
+ $384 = $372 << 2;
+ $385 = (($383) - ($384))|0;
+ $386 = (($384) + 4)|0;
+ $387 = Math_imul($6, $x)|0;
+ $388 = (($387) + -2)|0;
+ $389 = $388 >>> 1;
+ $390 = Math_imul($x, $out_n)|0;
+ $391 = (($389) + ($390))|0;
+ $392 = (($391) + 1)|0;
+ $393 = Math_imul($6, $depth)|0;
+ $394 = Math_imul($393, $x)|0;
+ $395 = (($394) + 7)|0;
+ $396 = $395 >>> 3;
+ $397 = (($392) - ($396))|0;
+ $398 = Math_imul($1, $x)|0;
+ $399 = Math_imul($398, $out_n)|0;
+ $400 = (($387) + -2)|0;
+ $401 = $389 << 1;
+ $402 = (($400) - ($401))|0;
+ $403 = (($401) + 2)|0;
+ $indvars$iv = $363;$indvars$iv233 = $369;$indvars$iv236 = $380;$indvars$iv239 = $386;$indvars$iv242 = $397;$indvars$iv245 = $403;$j$1125 = 0;
+ L174: while(1) {
+ $404 = HEAP32[$15>>2]|0;
+ $405 = Math_imul($j$1125, $4)|0;
+ $406 = (($404) + ($405)|0);
+ $$sum2 = (($$sum) + ($405))|0;
+ $407 = (($404) + ($$sum2)|0);
+ if ($346) {
+ $408 = HEAP8[$347>>0]|0;
+ $409 = $408&255;
+ $414 = $409;
+ } else {
+ $414 = 1;
+ }
+ switch ($depth|0) {
+ case 4: {
+ if ($350) {
+ $scevgep244 = (($404) + ($indvars$iv242)|0);
+ $cur1$0112 = $406;$in$0113 = $407;$k$14111 = $17;
+ while(1) {
+ $410 = HEAP8[$in$0113>>0]|0;
+ $411 = $410&255;
+ $412 = $411 >>> 4;
+ $413 = Math_imul($412, $414)|0;
+ $415 = $413&255;
+ $416 = ((($cur1$0112)) + 1|0);
+ HEAP8[$cur1$0112>>0] = $415;
+ $417 = HEAP8[$in$0113>>0]|0;
+ $418 = $417&255;
+ $419 = $418 & 15;
+ $420 = Math_imul($419, $414)|0;
+ $421 = $420&255;
+ $422 = ((($cur1$0112)) + 2|0);
+ HEAP8[$416>>0] = $421;
+ $423 = (($k$14111) + -2)|0;
+ $424 = ((($in$0113)) + 1|0);
+ $425 = ($423|0)>(1);
+ if ($425) {
+ $cur1$0112 = $422;$in$0113 = $424;$k$14111 = $423;
+ } else {
+ break;
+ }
+ }
+ $scevgep247 = (($404) + ($indvars$iv245)|0);
+ $cur1$0$lcssa = $scevgep247;$in$0$lcssa = $scevgep244;$k$14$lcssa = $402;
+ } else {
+ $cur1$0$lcssa = $406;$in$0$lcssa = $407;$k$14$lcssa = $17;
+ }
+ $426 = ($k$14$lcssa|0)>(0);
+ if ($426) {
+ $427 = HEAP8[$in$0$lcssa>>0]|0;
+ $428 = $427&255;
+ $429 = $428 >>> 4;
+ $430 = Math_imul($429, $414)|0;
+ $431 = $430&255;
+ HEAP8[$cur1$0$lcssa>>0] = $431;
+ }
+ break;
+ }
+ case 2: {
+ if ($351) {
+ $scevgep238 = (($404) + ($indvars$iv236)|0);
+ $cur1$1104 = $406;$in$1105 = $407;$k$15103 = $17;
+ while(1) {
+ $432 = HEAP8[$in$1105>>0]|0;
+ $433 = $432&255;
+ $434 = $433 >>> 6;
+ $435 = Math_imul($434, $414)|0;
+ $436 = $435&255;
+ $437 = ((($cur1$1104)) + 1|0);
+ HEAP8[$cur1$1104>>0] = $436;
+ $438 = HEAP8[$in$1105>>0]|0;
+ $439 = $438&255;
+ $440 = $439 >>> 4;
+ $441 = $440 & 3;
+ $442 = Math_imul($441, $414)|0;
+ $443 = $442&255;
+ $444 = ((($cur1$1104)) + 2|0);
+ HEAP8[$437>>0] = $443;
+ $445 = HEAP8[$in$1105>>0]|0;
+ $446 = $445&255;
+ $447 = $446 >>> 2;
+ $448 = $447 & 3;
+ $449 = Math_imul($448, $414)|0;
+ $450 = $449&255;
+ $451 = ((($cur1$1104)) + 3|0);
+ HEAP8[$444>>0] = $450;
+ $452 = HEAP8[$in$1105>>0]|0;
+ $453 = $452&255;
+ $454 = $453 & 3;
+ $455 = Math_imul($454, $414)|0;
+ $456 = $455&255;
+ $457 = ((($cur1$1104)) + 4|0);
+ HEAP8[$451>>0] = $456;
+ $458 = (($k$15103) + -4)|0;
+ $459 = ((($in$1105)) + 1|0);
+ $460 = ($458|0)>(3);
+ if ($460) {
+ $cur1$1104 = $457;$in$1105 = $459;$k$15103 = $458;
+ } else {
+ break;
+ }
+ }
+ $scevgep241 = (($404) + ($indvars$iv239)|0);
+ $468 = $indvars$iv239;$cur1$1$lcssa = $scevgep241;$in$1$lcssa = $scevgep238;$k$15$lcssa = $385;
+ } else {
+ $468 = $405;$cur1$1$lcssa = $406;$in$1$lcssa = $407;$k$15$lcssa = $17;
+ }
+ $461 = ($k$15$lcssa|0)>(0);
+ if ($461) {
+ $462 = HEAP8[$in$1$lcssa>>0]|0;
+ $463 = $462&255;
+ $464 = $463 >>> 6;
+ $465 = Math_imul($464, $414)|0;
+ $466 = $465&255;
+ HEAP8[$cur1$1$lcssa>>0] = $466;
+ $467 = ($k$15$lcssa|0)>(1);
+ if ($467) {
+ $$sum278 = (($468) + 1)|0;
+ $469 = (($404) + ($$sum278)|0);
+ $470 = HEAP8[$in$1$lcssa>>0]|0;
+ $471 = $470&255;
+ $472 = $471 >>> 4;
+ $473 = $472 & 3;
+ $474 = Math_imul($473, $414)|0;
+ $475 = $474&255;
+ HEAP8[$469>>0] = $475;
+ $476 = ($k$15$lcssa|0)>(2);
+ if ($476) {
+ $$sum279 = (($468) + 2)|0;
+ $477 = (($404) + ($$sum279)|0);
+ $478 = HEAP8[$in$1$lcssa>>0]|0;
+ $479 = $478&255;
+ $480 = $479 >>> 2;
+ $481 = $480 & 3;
+ $482 = Math_imul($481, $414)|0;
+ $483 = $482&255;
+ HEAP8[$477>>0] = $483;
+ }
+ }
+ }
+ break;
+ }
+ case 1: {
+ if ($352) {
+ $scevgep = (($404) + ($indvars$iv)|0);
+ $cur1$499 = $406;$in$2100 = $407;$k$1698 = $17;
+ while(1) {
+ $484 = HEAP8[$in$2100>>0]|0;
+ $485 = $484&255;
+ $486 = $485 >>> 7;
+ $487 = (0 - ($486))|0;
+ $488 = $414 & $487;
+ $489 = $488&255;
+ $490 = ((($cur1$499)) + 1|0);
+ HEAP8[$cur1$499>>0] = $489;
+ $491 = HEAP8[$in$2100>>0]|0;
+ $492 = $491&255;
+ $493 = $492 >>> 6;
+ $494 = $493 & 1;
+ $495 = (0 - ($494))|0;
+ $496 = $414 & $495;
+ $497 = $496&255;
+ $498 = ((($cur1$499)) + 2|0);
+ HEAP8[$490>>0] = $497;
+ $499 = HEAP8[$in$2100>>0]|0;
+ $500 = $499&255;
+ $501 = $500 >>> 5;
+ $502 = $501 & 1;
+ $503 = (0 - ($502))|0;
+ $504 = $414 & $503;
+ $505 = $504&255;
+ $506 = ((($cur1$499)) + 3|0);
+ HEAP8[$498>>0] = $505;
+ $507 = HEAP8[$in$2100>>0]|0;
+ $508 = $507&255;
+ $509 = $508 >>> 4;
+ $510 = $509 & 1;
+ $511 = (0 - ($510))|0;
+ $512 = $414 & $511;
+ $513 = $512&255;
+ $514 = ((($cur1$499)) + 4|0);
+ HEAP8[$506>>0] = $513;
+ $515 = HEAP8[$in$2100>>0]|0;
+ $516 = $515&255;
+ $517 = $516 >>> 3;
+ $518 = $517 & 1;
+ $519 = (0 - ($518))|0;
+ $520 = $414 & $519;
+ $521 = $520&255;
+ $522 = ((($cur1$499)) + 5|0);
+ HEAP8[$514>>0] = $521;
+ $523 = HEAP8[$in$2100>>0]|0;
+ $524 = $523&255;
+ $525 = $524 >>> 2;
+ $526 = $525 & 1;
+ $527 = (0 - ($526))|0;
+ $528 = $414 & $527;
+ $529 = $528&255;
+ $530 = ((($cur1$499)) + 6|0);
+ HEAP8[$522>>0] = $529;
+ $531 = HEAP8[$in$2100>>0]|0;
+ $532 = $531&255;
+ $533 = $532 >>> 1;
+ $534 = $533 & 1;
+ $535 = (0 - ($534))|0;
+ $536 = $414 & $535;
+ $537 = $536&255;
+ $538 = ((($cur1$499)) + 7|0);
+ HEAP8[$530>>0] = $537;
+ $539 = HEAP8[$in$2100>>0]|0;
+ $540 = $539&255;
+ $541 = $540 & 1;
+ $542 = (0 - ($541))|0;
+ $543 = $414 & $542;
+ $544 = $543&255;
+ $545 = ((($cur1$499)) + 8|0);
+ HEAP8[$538>>0] = $544;
+ $546 = (($k$1698) + -8)|0;
+ $547 = ((($in$2100)) + 1|0);
+ $548 = ($546|0)>(7);
+ if ($548) {
+ $cur1$499 = $545;$in$2100 = $547;$k$1698 = $546;
+ } else {
+ break;
+ }
+ }
+ $scevgep235 = (($404) + ($indvars$iv233)|0);
+ $557 = $indvars$iv233;$cur1$4$lcssa = $scevgep235;$in$2$lcssa = $scevgep;$k$16$lcssa = $368;
+ } else {
+ $557 = $405;$cur1$4$lcssa = $406;$in$2$lcssa = $407;$k$16$lcssa = $17;
+ }
+ $549 = ($k$16$lcssa|0)>(0);
+ if ($549) {
+ $550 = HEAP8[$in$2$lcssa>>0]|0;
+ $551 = $550&255;
+ $552 = $551 >>> 7;
+ $553 = (0 - ($552))|0;
+ $554 = $414 & $553;
+ $555 = $554&255;
+ HEAP8[$cur1$4$lcssa>>0] = $555;
+ $556 = ($k$16$lcssa|0)>(1);
+ if ($556) {
+ $$sum272 = (($557) + 1)|0;
+ $558 = (($404) + ($$sum272)|0);
+ $559 = HEAP8[$in$2$lcssa>>0]|0;
+ $560 = $559&255;
+ $561 = $560 >>> 6;
+ $562 = $561 & 1;
+ $563 = (0 - ($562))|0;
+ $564 = $414 & $563;
+ $565 = $564&255;
+ HEAP8[$558>>0] = $565;
+ $566 = ($k$16$lcssa|0)>(2);
+ if ($566) {
+ $$sum273 = (($557) + 2)|0;
+ $567 = (($404) + ($$sum273)|0);
+ $568 = HEAP8[$in$2$lcssa>>0]|0;
+ $569 = $568&255;
+ $570 = $569 >>> 5;
+ $571 = $570 & 1;
+ $572 = (0 - ($571))|0;
+ $573 = $414 & $572;
+ $574 = $573&255;
+ HEAP8[$567>>0] = $574;
+ $575 = ($k$16$lcssa|0)>(3);
+ if ($575) {
+ $$sum274 = (($557) + 3)|0;
+ $576 = (($404) + ($$sum274)|0);
+ $577 = HEAP8[$in$2$lcssa>>0]|0;
+ $578 = $577&255;
+ $579 = $578 >>> 4;
+ $580 = $579 & 1;
+ $581 = (0 - ($580))|0;
+ $582 = $414 & $581;
+ $583 = $582&255;
+ HEAP8[$576>>0] = $583;
+ $584 = ($k$16$lcssa|0)>(4);
+ if ($584) {
+ $$sum275 = (($557) + 4)|0;
+ $585 = (($404) + ($$sum275)|0);
+ $586 = HEAP8[$in$2$lcssa>>0]|0;
+ $587 = $586&255;
+ $588 = $587 >>> 3;
+ $589 = $588 & 1;
+ $590 = (0 - ($589))|0;
+ $591 = $414 & $590;
+ $592 = $591&255;
+ HEAP8[$585>>0] = $592;
+ $593 = ($k$16$lcssa|0)>(5);
+ if ($593) {
+ $$sum276 = (($557) + 5)|0;
+ $594 = (($404) + ($$sum276)|0);
+ $595 = HEAP8[$in$2$lcssa>>0]|0;
+ $596 = $595&255;
+ $597 = $596 >>> 2;
+ $598 = $597 & 1;
+ $599 = (0 - ($598))|0;
+ $600 = $414 & $599;
+ $601 = $600&255;
+ HEAP8[$594>>0] = $601;
+ $602 = ($k$16$lcssa|0)>(6);
+ if ($602) {
+ $$sum277 = (($557) + 6)|0;
+ $603 = (($404) + ($$sum277)|0);
+ $604 = HEAP8[$in$2$lcssa>>0]|0;
+ $605 = $604&255;
+ $606 = $605 >>> 1;
+ $607 = $606 & 1;
+ $608 = (0 - ($607))|0;
+ $609 = $414 & $608;
+ $610 = $609&255;
+ HEAP8[$603>>0] = $610;
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ L213: do {
+ if (!($9)) {
+ $611 = HEAP32[$15>>2]|0;
+ switch ($6|0) {
+ case 1: {
+ if ($348) {
+ $q$0123 = $q$0122;
+ } else {
+ break L213;
+ }
+ while(1) {
+ $614 = $q$0123 << 1;
+ $615 = $614 | 1;
+ $$sum10 = (($615) + ($405))|0;
+ $616 = (($611) + ($$sum10)|0);
+ HEAP8[$616>>0] = -1;
+ $$sum11 = (($q$0123) + ($405))|0;
+ $617 = (($611) + ($$sum11)|0);
+ $618 = HEAP8[$617>>0]|0;
+ $$sum12 = (($614) + ($405))|0;
+ $619 = (($611) + ($$sum12)|0);
+ HEAP8[$619>>0] = $618;
+ $q$0 = (($q$0123) + -1)|0;
+ $620 = ($q$0|0)>(-1);
+ if ($620) {
+ $q$0123 = $q$0;
+ } else {
+ break L213;
+ }
+ }
+ break;
+ }
+ case 3: {
+ break;
+ }
+ default: {
+ label = 149;
+ break L174;
+ }
+ }
+ if ($349) {
+ $612 = (($405) + 2)|0;
+ $613 = (($405) + 1)|0;
+ $q$1120 = $q$1119;
+ while(1) {
+ $621 = $q$1120 << 2;
+ $622 = $621 | 3;
+ $$sum3 = (($622) + ($405))|0;
+ $623 = (($611) + ($$sum3)|0);
+ HEAP8[$623>>0] = -1;
+ $624 = ($q$1120*3)|0;
+ $$sum4 = (($612) + ($624))|0;
+ $625 = (($611) + ($$sum4)|0);
+ $626 = HEAP8[$625>>0]|0;
+ $627 = $621 | 2;
+ $$sum5 = (($627) + ($405))|0;
+ $628 = (($611) + ($$sum5)|0);
+ HEAP8[$628>>0] = $626;
+ $$sum6 = (($613) + ($624))|0;
+ $629 = (($611) + ($$sum6)|0);
+ $630 = HEAP8[$629>>0]|0;
+ $631 = $621 | 1;
+ $$sum7 = (($631) + ($405))|0;
+ $632 = (($611) + ($$sum7)|0);
+ HEAP8[$632>>0] = $630;
+ $$sum8 = (($624) + ($405))|0;
+ $633 = (($611) + ($$sum8)|0);
+ $634 = HEAP8[$633>>0]|0;
+ $$sum9 = (($621) + ($405))|0;
+ $635 = (($611) + ($$sum9)|0);
+ HEAP8[$635>>0] = $634;
+ $q$1 = (($q$1120) + -1)|0;
+ $636 = ($q$1|0)>(-1);
+ if ($636) {
+ $q$1120 = $q$1;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $637 = (($j$1125) + 1)|0;
+ $638 = ($637>>>0)<($y>>>0);
+ $indvars$iv$next = (($indvars$iv) + ($365))|0;
+ $indvars$iv$next234 = (($indvars$iv233) + ($365))|0;
+ $indvars$iv$next237 = (($indvars$iv236) + ($382))|0;
+ $indvars$iv$next240 = (($indvars$iv239) + ($382))|0;
+ $indvars$iv$next243 = (($indvars$iv242) + ($399))|0;
+ $indvars$iv$next246 = (($indvars$iv245) + ($399))|0;
+ if ($638) {
+ $indvars$iv = $indvars$iv$next;$indvars$iv233 = $indvars$iv$next234;$indvars$iv236 = $indvars$iv$next237;$indvars$iv239 = $indvars$iv$next240;$indvars$iv242 = $indvars$iv$next243;$indvars$iv245 = $indvars$iv$next246;$j$1125 = $637;
+ } else {
+ $$0 = 1;
+ label = 155;
+ break;
+ }
+ }
+ if ((label|0) == 149) {
+ ___assert_fail((13239|0),(12975|0),4197,(13136|0));
+ // unreachable;
+ }
+ else if ((label|0) == 155) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__paeth($a,$b,$c) {
+ $a = $a|0;
+ $b = $b|0;
+ $c = $c|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$b = 0, $ispos = 0, $ispos1 = 0, $ispos3 = 0, $neg = 0, $neg2 = 0, $neg4 = 0, $or$cond = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (($b) + ($a))|0;
+ $1 = (($0) - ($c))|0;
+ $2 = (($1) - ($a))|0;
+ $ispos = ($2|0)>(-1);
+ $neg = (0 - ($2))|0;
+ $3 = $ispos ? $2 : $neg;
+ $4 = (($1) - ($b))|0;
+ $ispos1 = ($4|0)>(-1);
+ $neg2 = (0 - ($4))|0;
+ $5 = $ispos1 ? $4 : $neg2;
+ $6 = (($1) - ($c))|0;
+ $ispos3 = ($6|0)>(-1);
+ $neg4 = (0 - ($6))|0;
+ $7 = $ispos3 ? $6 : $neg4;
+ $8 = ($3|0)>($5|0);
+ $9 = ($3|0)>($7|0);
+ $or$cond = $8 | $9;
+ $10 = ($5|0)>($7|0);
+ $c$b = $10 ? $c : $b;
+ $$0 = $or$cond ? $c$b : $a;
+ return ($$0|0);
+}
+function _stbi__decode_jpeg_header($z,$scan) {
+ $z = $z|0;
+ $scan = $scan|0;
+ var $$ = 0, $$0 = 0, $$2 = 0, $$9 = 0, $$lcssa = 0, $$lcssa20 = 0, $$lcssa5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $m$010 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($z)) + 18116|0);
+ HEAP8[$0>>0] = -1;
+ $1 = (_stbi__get_marker($z)|0);
+ $2 = ($1<<24>>24)==(-40);
+ if (!($2)) {
+ _stbi__err(13262);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $3 = ($scan|0)==(1);
+ if ($3) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $4 = (_stbi__get_marker($z)|0);
+ $5 = $4&255;
+ $6 = $5 & 254;
+ $7 = ($6|0)==(192);
+ $8 = ($4<<24>>24)==(-62);
+ $$9 = $8 | $7;
+ L8: do {
+ if ($$9) {
+ $$lcssa5 = $8;
+ } else {
+ $m$010 = $5;
+ L10: while(1) {
+ $13 = (_stbi__process_marker($z,$m$010)|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $$0 = 0;
+ label = 14;
+ break;
+ }
+ $15 = (_stbi__get_marker($z)|0);
+ $16 = $15&255;
+ $17 = ($15<<24>>24)==(-1);
+ if ($17) {
+ while(1) {
+ $18 = HEAP32[$z>>2]|0;
+ $19 = (_stbi__at_eof($18)|0);
+ $20 = ($19|0)==(0);
+ if (!($20)) {
+ break L10;
+ }
+ $21 = (_stbi__get_marker($z)|0);
+ $22 = ($21<<24>>24)==(-1);
+ if (!($22)) {
+ $$lcssa20 = $21;
+ break;
+ }
+ }
+ $9 = $$lcssa20&255;
+ $$lcssa = $9;
+ } else {
+ $$lcssa = $16;
+ }
+ $10 = $$lcssa & 254;
+ $11 = ($10|0)==(192);
+ $12 = ($$lcssa|0)==(194);
+ $$ = $12 | $11;
+ if ($$) {
+ $$lcssa5 = $12;
+ break L8;
+ } else {
+ $m$010 = $$lcssa;
+ }
+ }
+ if ((label|0) == 14) {
+ return ($$0|0);
+ }
+ _stbi__err(13269);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ } while(0);
+ $23 = $$lcssa5&1;
+ $24 = ((($z)) + 18124|0);
+ HEAP32[$24>>2] = $23;
+ $25 = (_stbi__process_frame_header($z,$scan)|0);
+ $not$ = ($25|0)!=(0);
+ $$2 = $not$&1;
+ $$0 = $$2;
+ return ($$0|0);
+}
+function _stbi__get_marker($j) {
+ $j = $j|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18116|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = ($1<<24>>24)==(-1);
+ if (!($2)) {
+ HEAP8[$0>>0] = -1;
+ $$0 = $1;
+ return ($$0|0);
+ }
+ $3 = HEAP32[$j>>2]|0;
+ $4 = (_stbi__get8($3)|0);
+ $5 = ($4<<24>>24)==(-1);
+ if (!($5)) {
+ $$0 = -1;
+ return ($$0|0);
+ }
+ while(1) {
+ $6 = HEAP32[$j>>2]|0;
+ $7 = (_stbi__get8($6)|0);
+ $8 = ($7<<24>>24)==(-1);
+ if (!($8)) {
+ $$0 = $7;
+ break;
+ }
+ }
+ return ($$0|0);
+}
+function _stbi__process_marker($z,$m) {
+ $z = $z|0;
+ $m = $m|0;
+ var $$2 = 0, $$mask = 0, $$mask7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
+ var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
+ var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
+ var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0;
+ var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
+ var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
+ var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
+ var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $L$0$lcssa = 0, $L$015 = 0, $L$1$lcssa = 0, $L$122 = 0;
+ var $exitcond = 0, $exitcond30 = 0, $i$014 = 0, $i1$118 = 0, $or$cond = 0, $or$cond5 = 0, $sizes = 0, $v$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $sizes = sp;
+ switch ($m|0) {
+ case 255: {
+ _stbi__err(13383);
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ break;
+ }
+ case 221: {
+ $0 = HEAP32[$z>>2]|0;
+ $1 = (_stbi__get16be($0)|0);
+ $2 = ($1|0)==(4);
+ if ($2) {
+ $3 = HEAP32[$z>>2]|0;
+ $4 = (_stbi__get16be($3)|0);
+ $5 = ((($z)) + 18172|0);
+ HEAP32[$5>>2] = $4;
+ $$2 = 1;
+ STACKTOP = sp;return ($$2|0);
+ } else {
+ _stbi__err(13399);
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ }
+ break;
+ }
+ case 219: {
+ $6 = HEAP32[$z>>2]|0;
+ $7 = (_stbi__get16be($6)|0);
+ $8 = (($7) + -2)|0;
+ $9 = ($7|0)>(2);
+ L16: do {
+ if ($9) {
+ $L$015 = $8;
+ while(1) {
+ $10 = HEAP32[$z>>2]|0;
+ $11 = (_stbi__get8($10)|0);
+ $12 = $11&255;
+ $13 = $12 & 15;
+ $$mask = $12 & 240;
+ $14 = ($$mask|0)==(0);
+ if (!($14)) {
+ label = 8;
+ break;
+ }
+ $15 = ($13>>>0)>(3);
+ if ($15) {
+ label = 10;
+ break;
+ } else {
+ $i$014 = 0;
+ }
+ while(1) {
+ $16 = HEAP32[$z>>2]|0;
+ $17 = (_stbi__get8($16)|0);
+ $18 = (13438 + ($i$014)|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = $19&255;
+ $21 = ((((($z)) + 13444|0) + ($13<<6)|0) + ($20)|0);
+ HEAP8[$21>>0] = $17;
+ $22 = (($i$014) + 1)|0;
+ $exitcond = ($22|0)==(64);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$014 = $22;
+ }
+ }
+ $23 = (($L$015) + -65)|0;
+ $24 = ($L$015|0)>(65);
+ if ($24) {
+ $L$015 = $23;
+ } else {
+ $L$0$lcssa = $23;
+ break L16;
+ }
+ }
+ if ((label|0) == 8) {
+ _stbi__err(13411);
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ }
+ else if ((label|0) == 10) {
+ _stbi__err(13424);
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ }
+ } else {
+ $L$0$lcssa = $8;
+ }
+ } while(0);
+ $25 = ($L$0$lcssa|0)==(0);
+ $26 = $25&1;
+ $$2 = $26;
+ STACKTOP = sp;return ($$2|0);
+ break;
+ }
+ case 196: {
+ $27 = HEAP32[$z>>2]|0;
+ $28 = (_stbi__get16be($27)|0);
+ $29 = (($28) + -2)|0;
+ $30 = ($28|0)>(2);
+ L31: do {
+ if ($30) {
+ $31 = ((($sizes)) + 4|0);
+ $32 = ((($sizes)) + 8|0);
+ $33 = ((($sizes)) + 12|0);
+ $34 = ((($sizes)) + 16|0);
+ $35 = ((($sizes)) + 20|0);
+ $36 = ((($sizes)) + 24|0);
+ $37 = ((($sizes)) + 28|0);
+ $38 = ((($sizes)) + 32|0);
+ $39 = ((($sizes)) + 36|0);
+ $40 = ((($sizes)) + 40|0);
+ $41 = ((($sizes)) + 44|0);
+ $42 = ((($sizes)) + 48|0);
+ $43 = ((($sizes)) + 52|0);
+ $44 = ((($sizes)) + 56|0);
+ $45 = ((($sizes)) + 60|0);
+ $L$122 = $29;
+ while(1) {
+ $46 = HEAP32[$z>>2]|0;
+ $47 = (_stbi__get8($46)|0);
+ $48 = $47&255;
+ $49 = $48 & 15;
+ $50 = ($47&255)>(31);
+ $51 = ($49>>>0)>(3);
+ $or$cond = $50 | $51;
+ if ($or$cond) {
+ label = 17;
+ break;
+ }
+ $52 = HEAP32[$z>>2]|0;
+ $53 = (_stbi__get8($52)|0);
+ $54 = $53&255;
+ HEAP32[$sizes>>2] = $54;
+ $55 = HEAP32[$z>>2]|0;
+ $56 = (_stbi__get8($55)|0);
+ $57 = $56&255;
+ HEAP32[$31>>2] = $57;
+ $58 = (($57) + ($54))|0;
+ $59 = HEAP32[$z>>2]|0;
+ $60 = (_stbi__get8($59)|0);
+ $61 = $60&255;
+ HEAP32[$32>>2] = $61;
+ $62 = (($61) + ($58))|0;
+ $63 = HEAP32[$z>>2]|0;
+ $64 = (_stbi__get8($63)|0);
+ $65 = $64&255;
+ HEAP32[$33>>2] = $65;
+ $66 = (($65) + ($62))|0;
+ $67 = HEAP32[$z>>2]|0;
+ $68 = (_stbi__get8($67)|0);
+ $69 = $68&255;
+ HEAP32[$34>>2] = $69;
+ $70 = (($69) + ($66))|0;
+ $71 = HEAP32[$z>>2]|0;
+ $72 = (_stbi__get8($71)|0);
+ $73 = $72&255;
+ HEAP32[$35>>2] = $73;
+ $74 = (($73) + ($70))|0;
+ $75 = HEAP32[$z>>2]|0;
+ $76 = (_stbi__get8($75)|0);
+ $77 = $76&255;
+ HEAP32[$36>>2] = $77;
+ $78 = (($77) + ($74))|0;
+ $79 = HEAP32[$z>>2]|0;
+ $80 = (_stbi__get8($79)|0);
+ $81 = $80&255;
+ HEAP32[$37>>2] = $81;
+ $82 = (($81) + ($78))|0;
+ $83 = HEAP32[$z>>2]|0;
+ $84 = (_stbi__get8($83)|0);
+ $85 = $84&255;
+ HEAP32[$38>>2] = $85;
+ $86 = (($85) + ($82))|0;
+ $87 = HEAP32[$z>>2]|0;
+ $88 = (_stbi__get8($87)|0);
+ $89 = $88&255;
+ HEAP32[$39>>2] = $89;
+ $90 = (($89) + ($86))|0;
+ $91 = HEAP32[$z>>2]|0;
+ $92 = (_stbi__get8($91)|0);
+ $93 = $92&255;
+ HEAP32[$40>>2] = $93;
+ $94 = (($93) + ($90))|0;
+ $95 = HEAP32[$z>>2]|0;
+ $96 = (_stbi__get8($95)|0);
+ $97 = $96&255;
+ HEAP32[$41>>2] = $97;
+ $98 = (($97) + ($94))|0;
+ $99 = HEAP32[$z>>2]|0;
+ $100 = (_stbi__get8($99)|0);
+ $101 = $100&255;
+ HEAP32[$42>>2] = $101;
+ $102 = (($101) + ($98))|0;
+ $103 = HEAP32[$z>>2]|0;
+ $104 = (_stbi__get8($103)|0);
+ $105 = $104&255;
+ HEAP32[$43>>2] = $105;
+ $106 = (($105) + ($102))|0;
+ $107 = HEAP32[$z>>2]|0;
+ $108 = (_stbi__get8($107)|0);
+ $109 = $108&255;
+ HEAP32[$44>>2] = $109;
+ $110 = (($109) + ($106))|0;
+ $111 = HEAP32[$z>>2]|0;
+ $112 = (_stbi__get8($111)|0);
+ $113 = $112&255;
+ HEAP32[$45>>2] = $113;
+ $114 = (($113) + ($110))|0;
+ $115 = (($L$122) + -17)|0;
+ $$mask7 = $48 & 240;
+ $116 = ($$mask7|0)==(0);
+ if ($116) {
+ $117 = (((($z)) + 4|0) + (($49*1680)|0)|0);
+ $118 = (_stbi__build_huffman($117,$sizes)|0);
+ $119 = ($118|0)==(0);
+ if ($119) {
+ break;
+ }
+ $120 = (((((($z)) + 4|0) + (($49*1680)|0)|0)) + 1024|0);
+ $v$0 = $120;
+ } else {
+ $121 = (((($z)) + 6724|0) + (($49*1680)|0)|0);
+ $122 = (_stbi__build_huffman($121,$sizes)|0);
+ $123 = ($122|0)==(0);
+ if ($123) {
+ break;
+ }
+ $124 = (((((($z)) + 6724|0) + (($49*1680)|0)|0)) + 1024|0);
+ $v$0 = $124;
+ }
+ $125 = ($114|0)>(0);
+ if ($125) {
+ $126 = $56&255;
+ $127 = $53&255;
+ $128 = (($126) + ($127))|0;
+ $129 = $60&255;
+ $130 = (($128) + ($129))|0;
+ $131 = $64&255;
+ $132 = (($130) + ($131))|0;
+ $133 = $68&255;
+ $134 = (($132) + ($133))|0;
+ $135 = $72&255;
+ $136 = (($134) + ($135))|0;
+ $137 = $76&255;
+ $138 = (($136) + ($137))|0;
+ $139 = $80&255;
+ $140 = (($138) + ($139))|0;
+ $141 = $84&255;
+ $142 = (($140) + ($141))|0;
+ $143 = $88&255;
+ $144 = (($142) + ($143))|0;
+ $145 = $92&255;
+ $146 = (($144) + ($145))|0;
+ $147 = $96&255;
+ $148 = (($146) + ($147))|0;
+ $149 = $100&255;
+ $150 = (($148) + ($149))|0;
+ $151 = $104&255;
+ $152 = (($150) + ($151))|0;
+ $153 = $108&255;
+ $154 = (($152) + ($153))|0;
+ $155 = $112&255;
+ $156 = (($154) + ($155))|0;
+ $i1$118 = 0;
+ while(1) {
+ $157 = HEAP32[$z>>2]|0;
+ $158 = (_stbi__get8($157)|0);
+ $159 = (($v$0) + ($i1$118)|0);
+ HEAP8[$159>>0] = $158;
+ $160 = (($i1$118) + 1)|0;
+ $exitcond30 = ($160|0)==($156|0);
+ if ($exitcond30) {
+ break;
+ } else {
+ $i1$118 = $160;
+ }
+ }
+ }
+ if (!($116)) {
+ $161 = (((($z)) + 13700|0) + ($49<<10)|0);
+ $162 = (((($z)) + 6724|0) + (($49*1680)|0)|0);
+ _stbi__build_fast_ac($161,$162);
+ }
+ $163 = (($115) - ($114))|0;
+ $164 = ($163|0)>(0);
+ if ($164) {
+ $L$122 = $163;
+ } else {
+ $L$1$lcssa = $163;
+ break L31;
+ }
+ }
+ if ((label|0) == 17) {
+ _stbi__err(13517);
+ }
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ } else {
+ $L$1$lcssa = $29;
+ }
+ } while(0);
+ $165 = ($L$1$lcssa|0)==(0);
+ $166 = $165&1;
+ $$2 = $166;
+ STACKTOP = sp;return ($$2|0);
+ break;
+ }
+ default: {
+ $167 = $m & -16;
+ $168 = ($167|0)==(224);
+ $169 = ($m|0)==(254);
+ $or$cond5 = $169 | $168;
+ if (!($or$cond5)) {
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ }
+ $170 = HEAP32[$z>>2]|0;
+ $171 = (_stbi__get16be($170)|0);
+ $172 = (($171) + -2)|0;
+ _stbi__skip($170,$172);
+ $$2 = 1;
+ STACKTOP = sp;return ($$2|0);
+ }
+ }
+ return (0)|0;
+}
+function _stbi__process_frame_header($z,$scan) {
+ $z = $z|0;
+ $scan = $scan|0;
+ var $$0 = 0, $$h_max$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
+ var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
+ var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
+ var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
+ var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
+ var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
+ var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
+ var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $h_max$0$lcssa = 0;
+ var $h_max$016 = 0, $i$021 = 0, $i$1 = 0, $i$215 = 0, $i$312 = 0, $i$312$lcssa = 0, $i$411 = 0, $i$411$in = 0, $or$cond = 0, $or$cond2 = 0, $v_max$0$lcssa = 0, $v_max$017 = 0, $v_max$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = (_stbi__get16be($0)|0);
+ $2 = ($1|0)<(11);
+ if ($2) {
+ _stbi__err(13276);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $3 = (_stbi__get8($0)|0);
+ $4 = ($3<<24>>24)==(8);
+ if (!($4)) {
+ _stbi__err(13288);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $5 = (_stbi__get16be($0)|0);
+ $6 = ((($0)) + 4|0);
+ HEAP32[$6>>2] = $5;
+ $7 = ($5|0)==(0);
+ if ($7) {
+ _stbi__err(13299);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $8 = (_stbi__get16be($0)|0);
+ HEAP32[$0>>2] = $8;
+ $9 = ($8|0)==(0);
+ if ($9) {
+ _stbi__err(13316);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $10 = (_stbi__get8($0)|0);
+ $11 = $10&255;
+ switch ($10<<24>>24) {
+ case 1: case 3: {
+ break;
+ }
+ default: {
+ _stbi__err(13324);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $12 = ((($0)) + 8|0);
+ HEAP32[$12>>2] = $11;
+ $13 = $10&255;
+ $i$021 = 0;
+ while(1) {
+ $14 = (((((($z)) + 17820|0) + (($i$021*72)|0)|0)) + 44|0);
+ HEAP32[$14>>2] = 0;
+ $15 = (((((($z)) + 17820|0) + (($i$021*72)|0)|0)) + 56|0);
+ HEAP32[$15>>2] = 0;
+ $16 = (($i$021) + 1)|0;
+ $exitcond = ($16|0)==($13|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$021 = $16;
+ }
+ }
+ $17 = HEAP32[$12>>2]|0;
+ $18 = ($17*3)|0;
+ $19 = (($18) + 8)|0;
+ $20 = ($1|0)==($19|0);
+ if (!($20)) {
+ _stbi__err(13276);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $21 = ((($z)) + 18148|0);
+ HEAP32[$21>>2] = 0;
+ $i$1 = 0;
+ while(1) {
+ $22 = HEAP32[$12>>2]|0;
+ $23 = ($i$1|0)<($22|0);
+ if (!($23)) {
+ $$lcssa = $22;
+ label = 27;
+ break;
+ }
+ $24 = (_stbi__get8($0)|0);
+ $25 = $24&255;
+ $26 = (((($z)) + 17820|0) + (($i$1*72)|0)|0);
+ HEAP32[$26>>2] = $25;
+ $27 = (($i$1) + 1)|0;
+ $28 = ($25|0)==($27|0);
+ $29 = ($25|0)==($i$1|0);
+ $or$cond = $28 | $29;
+ if (!($or$cond)) {
+ $30 = (13344 + ($i$1)|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = ($24<<24>>24)==($31<<24>>24);
+ if (!($32)) {
+ label = 19;
+ break;
+ }
+ $33 = HEAP32[$21>>2]|0;
+ $34 = (($33) + 1)|0;
+ HEAP32[$21>>2] = $34;
+ }
+ $35 = (_stbi__get8($0)|0);
+ $36 = $35&255;
+ $37 = $36 >>> 4;
+ $38 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 4|0);
+ HEAP32[$38>>2] = $37;
+ $39 = ($37|0)==(0);
+ $40 = ($35&255)>(79);
+ $or$cond2 = $40 | $39;
+ if ($or$cond2) {
+ label = 22;
+ break;
+ }
+ $41 = $36 & 15;
+ $42 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 8|0);
+ HEAP32[$42>>2] = $41;
+ $43 = (($41) + -1)|0;
+ $44 = ($43>>>0)>(3);
+ if ($44) {
+ label = 24;
+ break;
+ }
+ $45 = (_stbi__get8($0)|0);
+ $46 = $45&255;
+ $47 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 12|0);
+ HEAP32[$47>>2] = $46;
+ $48 = ($45&255)>(3);
+ if ($48) {
+ label = 26;
+ break;
+ } else {
+ $i$1 = $27;
+ }
+ }
+ if ((label|0) == 19) {
+ _stbi__err(13347);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 22) {
+ _stbi__err(13364);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 24) {
+ _stbi__err(13370);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 26) {
+ _stbi__err(13376);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 27) {
+ $49 = ($scan|0)==(0);
+ if (!($49)) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $50 = HEAP32[$0>>2]|0;
+ $51 = (1073741824 / ($50>>>0))&-1;
+ $52 = (($51>>>0) / ($$lcssa>>>0))&-1;
+ $53 = HEAP32[$6>>2]|0;
+ $54 = ($52>>>0)<($53>>>0);
+ if ($54) {
+ _stbi__err(12689);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $55 = HEAP32[$12>>2]|0;
+ $56 = ($55|0)>(0);
+ if ($56) {
+ $57 = HEAP32[$12>>2]|0;
+ $h_max$016 = 1;$i$215 = 0;$v_max$017 = 1;
+ while(1) {
+ $58 = (((((($z)) + 17820|0) + (($i$215*72)|0)|0)) + 4|0);
+ $59 = HEAP32[$58>>2]|0;
+ $60 = ($59|0)>($h_max$016|0);
+ $$h_max$0 = $60 ? $59 : $h_max$016;
+ $61 = (((((($z)) + 17820|0) + (($i$215*72)|0)|0)) + 8|0);
+ $62 = HEAP32[$61>>2]|0;
+ $63 = ($62|0)>($v_max$017|0);
+ $v_max$1 = $63 ? $62 : $v_max$017;
+ $64 = (($i$215) + 1)|0;
+ $65 = ($64|0)<($57|0);
+ if ($65) {
+ $h_max$016 = $$h_max$0;$i$215 = $64;$v_max$017 = $v_max$1;
+ } else {
+ $h_max$0$lcssa = $$h_max$0;$v_max$0$lcssa = $v_max$1;
+ break;
+ }
+ }
+ } else {
+ $h_max$0$lcssa = 1;$v_max$0$lcssa = 1;
+ }
+ $66 = ((($z)) + 17796|0);
+ HEAP32[$66>>2] = $h_max$0$lcssa;
+ $67 = ((($z)) + 17800|0);
+ HEAP32[$67>>2] = $v_max$0$lcssa;
+ $68 = $h_max$0$lcssa << 3;
+ $69 = ((($z)) + 17812|0);
+ HEAP32[$69>>2] = $68;
+ $70 = $v_max$0$lcssa << 3;
+ $71 = ((($z)) + 17816|0);
+ HEAP32[$71>>2] = $70;
+ $72 = HEAP32[$0>>2]|0;
+ $73 = HEAP32[$69>>2]|0;
+ $74 = (($72) + -1)|0;
+ $75 = (($74) + ($73))|0;
+ $76 = (($75>>>0) / ($73>>>0))&-1;
+ $77 = ((($z)) + 17804|0);
+ HEAP32[$77>>2] = $76;
+ $78 = HEAP32[$6>>2]|0;
+ $79 = HEAP32[$71>>2]|0;
+ $80 = (($78) + -1)|0;
+ $81 = (($80) + ($79))|0;
+ $82 = (($81>>>0) / ($79>>>0))&-1;
+ $83 = ((($z)) + 17808|0);
+ HEAP32[$83>>2] = $82;
+ $84 = HEAP32[$12>>2]|0;
+ $85 = ($84|0)>(0);
+ if (!($85)) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $86 = (($h_max$0$lcssa) + -1)|0;
+ $87 = (($v_max$0$lcssa) + -1)|0;
+ $88 = ((($z)) + 18124|0);
+ $i$312 = 0;
+ while(1) {
+ $89 = HEAP32[$0>>2]|0;
+ $90 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 4|0);
+ $91 = HEAP32[$90>>2]|0;
+ $92 = Math_imul($91, $89)|0;
+ $93 = (($86) + ($92))|0;
+ $94 = (($93>>>0) / ($h_max$0$lcssa>>>0))&-1;
+ $95 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 28|0);
+ HEAP32[$95>>2] = $94;
+ $96 = HEAP32[$6>>2]|0;
+ $97 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 8|0);
+ $98 = HEAP32[$97>>2]|0;
+ $99 = Math_imul($98, $96)|0;
+ $100 = (($87) + ($99))|0;
+ $101 = (($100>>>0) / ($v_max$0$lcssa>>>0))&-1;
+ $102 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 32|0);
+ HEAP32[$102>>2] = $101;
+ $103 = HEAP32[$77>>2]|0;
+ $104 = HEAP32[$90>>2]|0;
+ $105 = $103 << 3;
+ $106 = Math_imul($105, $104)|0;
+ $107 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 36|0);
+ HEAP32[$107>>2] = $106;
+ $108 = HEAP32[$83>>2]|0;
+ $109 = HEAP32[$97>>2]|0;
+ $110 = $108 << 3;
+ $111 = Math_imul($110, $109)|0;
+ $112 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 40|0);
+ HEAP32[$112>>2] = $111;
+ $113 = HEAP32[$107>>2]|0;
+ $114 = Math_imul($111, $113)|0;
+ $115 = (($114) + 15)|0;
+ $116 = (_stbi__malloc($115)|0);
+ $117 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 48|0);
+ HEAP32[$117>>2] = $116;
+ $118 = ($116|0)==(0|0);
+ if ($118) {
+ $i$312$lcssa = $i$312;
+ break;
+ }
+ $123 = $116;
+ $124 = (($123) + 15)|0;
+ $125 = $124 & -16;
+ $126 = $125;
+ $127 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 44|0);
+ HEAP32[$127>>2] = $126;
+ $128 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 56|0);
+ HEAP32[$128>>2] = 0;
+ $129 = HEAP32[$88>>2]|0;
+ $130 = ($129|0)==(0);
+ if ($130) {
+ $150 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 60|0);
+ HEAP32[$150>>2] = 0;
+ $151 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 52|0);
+ HEAP32[$151>>2] = 0;
+ } else {
+ $131 = HEAP32[$107>>2]|0;
+ $132 = (($131) + 7)|0;
+ $133 = $132 >> 3;
+ $134 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 64|0);
+ HEAP32[$134>>2] = $133;
+ $135 = HEAP32[$112>>2]|0;
+ $136 = (($135) + 7)|0;
+ $137 = $136 >> 3;
+ $138 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 68|0);
+ HEAP32[$138>>2] = $137;
+ $139 = HEAP32[$134>>2]|0;
+ $140 = $139 << 7;
+ $141 = Math_imul($140, $137)|0;
+ $142 = $141 | 15;
+ $143 = (_malloc($142)|0);
+ $144 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 52|0);
+ HEAP32[$144>>2] = $143;
+ $145 = $143;
+ $146 = (($145) + 15)|0;
+ $147 = $146 & -16;
+ $148 = $147;
+ $149 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 60|0);
+ HEAP32[$149>>2] = $148;
+ }
+ $152 = (($i$312) + 1)|0;
+ $153 = HEAP32[$12>>2]|0;
+ $154 = ($152|0)<($153|0);
+ if ($154) {
+ $i$312 = $152;
+ } else {
+ $$0 = 1;
+ label = 43;
+ break;
+ }
+ }
+ if ((label|0) == 43) {
+ return ($$0|0);
+ }
+ $119 = ($i$312$lcssa|0)>(0);
+ if ($119) {
+ $i$411$in = $i$312$lcssa;
+ while(1) {
+ $i$411 = (($i$411$in) + -1)|0;
+ $120 = (((((($z)) + 17820|0) + (($i$411*72)|0)|0)) + 48|0);
+ $121 = HEAP32[$120>>2]|0;
+ _free($121);
+ HEAP32[$120>>2] = 0;
+ $122 = ($i$411$in|0)>(1);
+ if ($122) {
+ $i$411$in = $i$411;
+ } else {
+ break;
+ }
+ }
+ }
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__build_huffman($h,$count) {
+ $h = $h|0;
+ $count = $count|0;
+ var $$0 = 0, $$lcssa37 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $code$014 = 0, $code$1$lcssa = 0, $code$110 = 0, $code$2 = 0, $exitcond = 0;
+ var $exitcond26 = 0, $i$022 = 0, $i$17 = 0, $j$017 = 0, $j$115 = 0, $k$021 = 0, $k$1$lcssa = 0, $k$1$lcssa$lcssa = 0, $k$116 = 0, $k$213 = 0, $k$3$lcssa = 0, $k$39 = 0, $k$4 = 0, $k$4$lcssa = 0, $scevgep = 0, $smax = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $i$022 = 0;$k$021 = 0;
+ while(1) {
+ $1 = (($count) + ($i$022<<2)|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(0);
+ $0 = (($i$022) + 1)|0;
+ if ($3) {
+ $4 = $0&255;
+ $j$017 = 0;$k$116 = $k$021;
+ while(1) {
+ $5 = (($k$116) + 1)|0;
+ $6 = (((($h)) + 1280|0) + ($k$116)|0);
+ HEAP8[$6>>0] = $4;
+ $7 = (($j$017) + 1)|0;
+ $8 = HEAP32[$1>>2]|0;
+ $9 = ($7|0)<($8|0);
+ if ($9) {
+ $j$017 = $7;$k$116 = $5;
+ } else {
+ $k$1$lcssa = $5;
+ break;
+ }
+ }
+ } else {
+ $k$1$lcssa = $k$021;
+ }
+ $exitcond26 = ($0|0)==(16);
+ if ($exitcond26) {
+ $k$1$lcssa$lcssa = $k$1$lcssa;
+ break;
+ } else {
+ $i$022 = $0;$k$021 = $k$1$lcssa;
+ }
+ }
+ $10 = (((($h)) + 1280|0) + ($k$1$lcssa$lcssa)|0);
+ HEAP8[$10>>0] = 0;
+ $code$014 = 0;$j$115 = 1;$k$213 = 0;
+ while(1) {
+ $11 = (($k$213) - ($code$014))|0;
+ $12 = (((($h)) + 1612|0) + ($j$115<<2)|0);
+ HEAP32[$12>>2] = $11;
+ $13 = (((($h)) + 1280|0) + ($k$213)|0);
+ $14 = HEAP8[$13>>0]|0;
+ $15 = $14&255;
+ $16 = ($15|0)==($j$115|0);
+ if ($16) {
+ $17 = (((($h)) + 1280|0) + ($k$213)|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = $18&255;
+ $20 = ($19|0)==($j$115|0);
+ if ($20) {
+ $code$110 = $code$014;$k$39 = $k$213;
+ while(1) {
+ $21 = (($code$110) + 1)|0;
+ $22 = $code$110&65535;
+ $23 = (($k$39) + 1)|0;
+ $24 = (((($h)) + 512|0) + ($k$39<<1)|0);
+ HEAP16[$24>>1] = $22;
+ $25 = (((($h)) + 1280|0) + ($23)|0);
+ $26 = HEAP8[$25>>0]|0;
+ $27 = $26&255;
+ $28 = ($27|0)==($j$115|0);
+ if ($28) {
+ $code$110 = $21;$k$39 = $23;
+ } else {
+ $code$1$lcssa = $21;$k$3$lcssa = $23;
+ break;
+ }
+ }
+ } else {
+ $code$1$lcssa = $code$014;$k$3$lcssa = $k$213;
+ }
+ $29 = 1 << $j$115;
+ $30 = ($code$1$lcssa|0)>($29|0);
+ if ($30) {
+ label = 11;
+ break;
+ } else {
+ $code$2 = $code$1$lcssa;$k$4 = $k$3$lcssa;
+ }
+ } else {
+ $code$2 = $code$014;$k$4 = $k$213;
+ }
+ $31 = (16 - ($j$115))|0;
+ $32 = $code$2 << $31;
+ $33 = (((($h)) + 1540|0) + ($j$115<<2)|0);
+ HEAP32[$33>>2] = $32;
+ $34 = $code$2 << 1;
+ $35 = (($j$115) + 1)|0;
+ $36 = ($35|0)<(17);
+ if ($36) {
+ $code$014 = $34;$j$115 = $35;$k$213 = $k$4;
+ } else {
+ $$lcssa37 = $35;$k$4$lcssa = $k$4;
+ break;
+ }
+ }
+ if ((label|0) == 11) {
+ _stbi__err(13532);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $37 = (((($h)) + 1540|0) + ($$lcssa37<<2)|0);
+ HEAP32[$37>>2] = -1;
+ _memset(($h|0),-1,512)|0;
+ $38 = ($k$4$lcssa|0)>(0);
+ if ($38) {
+ $i$17 = 0;
+ } else {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ while(1) {
+ $39 = (((($h)) + 1280|0) + ($i$17)|0);
+ $40 = HEAP8[$39>>0]|0;
+ $41 = ($40&255)<(10);
+ if ($41) {
+ $42 = $40&255;
+ $43 = (9 - ($42))|0;
+ $44 = 1 << $43;
+ $45 = ($43|0)==(31);
+ if (!($45)) {
+ $46 = (((($h)) + 512|0) + ($i$17<<1)|0);
+ $47 = HEAP16[$46>>1]|0;
+ $48 = $47&65535;
+ $49 = $48 << $43;
+ $50 = $i$17&255;
+ $scevgep = (($h) + ($49)|0);
+ $51 = ($44|0)>(1);
+ $smax = $51 ? $44 : 1;
+ _memset(($scevgep|0),($50|0),($smax|0))|0;
+ }
+ }
+ $52 = (($i$17) + 1)|0;
+ $exitcond = ($52|0)==($k$4$lcssa|0);
+ if ($exitcond) {
+ $$0 = 1;
+ break;
+ } else {
+ $i$17 = $52;
+ }
+ }
+ return ($$0|0);
+}
+function _stbi__build_fast_ac($fast_ac,$h) {
+ $fast_ac = $fast_ac|0;
+ $h = $h|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$0 = 0, $k$0$off = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $i$02 = 0;
+ while(1) {
+ $0 = (($h) + ($i$02)|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = (($fast_ac) + ($i$02<<1)|0);
+ HEAP16[$2>>1] = 0;
+ $3 = $1&255;
+ $4 = ($1<<24>>24)==(-1);
+ if (!($4)) {
+ $5 = (((($h)) + 1024|0) + ($3)|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6&255;
+ $8 = $7 & 240;
+ $9 = $7 & 15;
+ $10 = (((($h)) + 1280|0) + ($3)|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11&255;
+ $13 = ($9|0)==(0);
+ if (!($13)) {
+ $14 = (($12) + ($9))|0;
+ $15 = ($14|0)<(10);
+ if ($15) {
+ $16 = $i$02 << $12;
+ $17 = $16 & 511;
+ $18 = (9 - ($9))|0;
+ $19 = $17 >>> $18;
+ $20 = (($9) + -1)|0;
+ $21 = 1 << $20;
+ $22 = ($19|0)<($21|0);
+ if ($22) {
+ $23 = -1 << $9;
+ $24 = (($23) + 1)|0;
+ $25 = (($24) + ($19))|0;
+ $k$0 = $25;
+ } else {
+ $k$0 = $19;
+ }
+ $k$0$off = (($k$0) + 128)|0;
+ $26 = ($k$0$off>>>0)<(256);
+ if ($26) {
+ $27 = $k$0 << 8;
+ $28 = $27 | $8;
+ $29 = (($28) + ($14))|0;
+ $30 = $29&65535;
+ HEAP16[$2>>1] = $30;
+ }
+ }
+ }
+ }
+ $31 = (($i$02) + 1)|0;
+ $exitcond = ($31|0)==(512);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$02 = $31;
+ }
+ }
+ return;
+}
+function _stbi__parse_zlib($a,$parse_header) {
+ $a = $a|0;
+ $parse_header = $parse_header|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($parse_header|0)==(0);
+ if (!($0)) {
+ $1 = (_stbi__parse_zlib_header($a)|0);
+ $2 = ($1|0)==(0);
+ if ($2) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $3 = ((($a)) + 8|0);
+ HEAP32[$3>>2] = 0;
+ $4 = ((($a)) + 12|0);
+ HEAP32[$4>>2] = 0;
+ $5 = ((($a)) + 2052|0);
+ $6 = ((($a)) + 32|0);
+ L5: while(1) {
+ $7 = (_stbi__zreceive($a,1)|0);
+ $8 = (_stbi__zreceive($a,2)|0);
+ switch ($8|0) {
+ case 3: {
+ $$0 = 0;
+ label = 13;
+ break L5;
+ break;
+ }
+ case 0: {
+ $9 = (_stbi__parse_uncompressed_block($a)|0);
+ $10 = ($9|0)==(0);
+ if ($10) {
+ $$0 = 0;
+ label = 13;
+ break L5;
+ }
+ break;
+ }
+ case 1: {
+ $11 = HEAP8[(13580)>>0]|0;
+ $12 = ($11<<24>>24)==(0);
+ if ($12) {
+ _stbi__init_zdefaults();
+ }
+ $13 = (_stbi__zbuild_huffman($6,13581,288)|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $$0 = 0;
+ label = 13;
+ break L5;
+ }
+ $15 = (_stbi__zbuild_huffman($5,13549,32)|0);
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $$0 = 0;
+ label = 13;
+ break L5;
+ } else {
+ label = 11;
+ }
+ break;
+ }
+ default: {
+ $17 = (_stbi__compute_huffman_codes($a)|0);
+ $18 = ($17|0)==(0);
+ if ($18) {
+ $$0 = 0;
+ label = 13;
+ break L5;
+ } else {
+ label = 11;
+ }
+ }
+ }
+ if ((label|0) == 11) {
+ label = 0;
+ $19 = (_stbi__parse_huffman_block($a)|0);
+ $20 = ($19|0)==(0);
+ if ($20) {
+ $$0 = 0;
+ label = 13;
+ break;
+ }
+ }
+ $21 = ($7|0)==(0);
+ if (!($21)) {
+ $$0 = 1;
+ label = 13;
+ break;
+ }
+ }
+ if ((label|0) == 13) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__parse_zlib_header($a) {
+ $a = $a|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__zget8($a)|0);
+ $1 = $0&255;
+ $2 = $1 & 15;
+ $3 = (_stbi__zget8($a)|0);
+ $4 = $3&255;
+ $5 = $1 << 8;
+ $6 = $5 | $4;
+ $7 = (($6>>>0) % 31)&-1;
+ $8 = ($7|0)==(0);
+ if (!($8)) {
+ _stbi__err(14203);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $9 = $4 & 32;
+ $10 = ($9|0)==(0);
+ if (!($10)) {
+ _stbi__err(14219);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $11 = ($2|0)==(8);
+ if ($11) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ _stbi__err(14234);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__zreceive($z,$n) {
+ $z = $z|0;
+ $n = $n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($z)) + 8|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<($n|0);
+ if ($2) {
+ _stbi__fill_bits($z);
+ }
+ $3 = ((($z)) + 12|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = 1 << $n;
+ $6 = (($5) + -1)|0;
+ $7 = $4 & $6;
+ $8 = $4 >>> $n;
+ HEAP32[$3>>2] = $8;
+ $9 = HEAP32[$0>>2]|0;
+ $10 = (($9) - ($n))|0;
+ HEAP32[$0>>2] = $10;
+ return ($7|0);
+}
+function _stbi__parse_uncompressed_block($a) {
+ $a = $a|0;
+ var $$0 = 0, $$lcssa = 0, $$lcssa17 = 0, $$op = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $$promoted8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
+ var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
+ var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $header = 0, $k$0$lcssa = 0, $k$03 = 0, $k$12 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $header = sp;
+ $0 = ((($a)) + 8|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = $1 & 7;
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $$ph = $1;
+ } else {
+ (_stbi__zreceive($a,$2)|0);
+ $$pr = HEAP32[$0>>2]|0;
+ $$ph = $$pr;
+ }
+ $4 = ($$ph|0)>(0);
+ if ($4) {
+ $5 = ((($a)) + 12|0);
+ $$promoted = HEAP32[$5>>2]|0;
+ $$promoted8 = HEAP32[$0>>2]|0;
+ $6 = ($$promoted8|0)<(8);
+ $$op = $$promoted8 ^ -1;
+ $7 = $6 ? $$op : -9;
+ $8 = (($$promoted8) + ($7))|0;
+ $9 = (($8) + 8)|0;
+ $10 = $9 >>> 3;
+ $11 = $10 << 3;
+ $12 = (($10) + 1)|0;
+ $14 = $$promoted;$k$03 = 0;
+ while(1) {
+ $13 = $14&255;
+ $15 = (($k$03) + 1)|0;
+ $16 = (($header) + ($k$03)|0);
+ HEAP8[$16>>0] = $13;
+ $17 = $14 >>> 8;
+ $exitcond13 = ($15|0)==($12|0);
+ if ($exitcond13) {
+ $$lcssa17 = $17;
+ break;
+ } else {
+ $14 = $17;$k$03 = $15;
+ }
+ }
+ $18 = (($$promoted8) + -8)|0;
+ $19 = (($18) - ($11))|0;
+ HEAP32[$5>>2] = $$lcssa17;
+ HEAP32[$0>>2] = $19;
+ $$lcssa = $19;$k$0$lcssa = $12;
+ } else {
+ $$lcssa = $$ph;$k$0$lcssa = 0;
+ }
+ $20 = ($$lcssa|0)==(0);
+ if (!($20)) {
+ ___assert_fail((14125|0),(12975|0),3780,(14142|0));
+ // unreachable;
+ }
+ $21 = ($k$0$lcssa|0)<(4);
+ if ($21) {
+ $k$12 = $k$0$lcssa;
+ while(1) {
+ $22 = (_stbi__zget8($a)|0);
+ $23 = (($k$12) + 1)|0;
+ $24 = (($header) + ($k$12)|0);
+ HEAP8[$24>>0] = $22;
+ $exitcond = ($23|0)==(4);
+ if ($exitcond) {
+ break;
+ } else {
+ $k$12 = $23;
+ }
+ }
+ }
+ $25 = ((($header)) + 1|0);
+ $26 = HEAP8[$25>>0]|0;
+ $27 = $26&255;
+ $28 = $27 << 8;
+ $29 = HEAP8[$header>>0]|0;
+ $30 = $29&255;
+ $31 = $28 | $30;
+ $32 = ((($header)) + 3|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = $33&255;
+ $35 = $34 << 8;
+ $36 = ((($header)) + 2|0);
+ $37 = HEAP8[$36>>0]|0;
+ $38 = $37&255;
+ $39 = $35 | $38;
+ $40 = $31 ^ 65535;
+ $41 = ($39|0)==($40|0);
+ if (!($41)) {
+ _stbi__err(14173);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $42 = HEAP32[$a>>2]|0;
+ $43 = (($42) + ($31)|0);
+ $44 = ((($a)) + 4|0);
+ $45 = HEAP32[$44>>2]|0;
+ $46 = ($43>>>0)>($45>>>0);
+ if ($46) {
+ _stbi__err(14186);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $47 = ((($a)) + 16|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = (($48) + ($31)|0);
+ $50 = ((($a)) + 24|0);
+ $51 = HEAP32[$50>>2]|0;
+ $52 = ($49>>>0)>($51>>>0);
+ if ($52) {
+ $53 = (_stbi__zexpand($a,$48,$31)|0);
+ $54 = ($53|0)==(0);
+ if ($54) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ $55 = HEAP32[$47>>2]|0;
+ $56 = HEAP32[$a>>2]|0;
+ _memcpy(($55|0),($56|0),($31|0))|0;
+ $57 = HEAP32[$a>>2]|0;
+ $58 = (($57) + ($31)|0);
+ HEAP32[$a>>2] = $58;
+ $59 = HEAP32[$47>>2]|0;
+ $60 = (($59) + ($31)|0);
+ HEAP32[$47>>2] = $60;
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__init_zdefaults() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ _memset((13581|0),8,144)|0;
+ dest=(13725); stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ dest=(13837); stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ $0 = (13861);
+ $1 = $0;
+ HEAP8[$1>>0]=134744072&255;HEAP8[$1+1>>0]=(134744072>>8)&255;HEAP8[$1+2>>0]=(134744072>>16)&255;HEAP8[$1+3>>0]=134744072>>24;
+ $2 = (($0) + 4)|0;
+ $3 = $2;
+ HEAP8[$3>>0]=134744072&255;HEAP8[$3+1>>0]=(134744072>>8)&255;HEAP8[$3+2>>0]=(134744072>>16)&255;HEAP8[$3+3>>0]=134744072>>24;
+ dest=13549; stop=dest+32|0; do { HEAP8[dest>>0]=5|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _stbi__zbuild_huffman($z,$sizelist,$num) {
+ $z = $z|0;
+ $sizelist = $sizelist|0;
+ $num = $num|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
+ var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
+ var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
+ var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $code$06 = 0, $exitcond = 0, $exitcond13 = 0, $i$010 = 0, $i$28 = 0, $i$34 = 0, $j$03 = 0, $k$07 = 0, $next_code = 0, $or$cond = 0, $sizes = 0, dest = 0, label = 0, sp = 0;
+ var stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0;
+ $next_code = sp + 72|0;
+ $sizes = sp;
+ dest=$sizes; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ _memset(($z|0),0,1024)|0;
+ $0 = ($num|0)>(0);
+ if ($0) {
+ $i$010 = 0;
+ while(1) {
+ $1 = (($sizelist) + ($i$010)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = (($sizes) + ($3<<2)|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = (($5) + 1)|0;
+ HEAP32[$4>>2] = $6;
+ $7 = (($i$010) + 1)|0;
+ $exitcond13 = ($7|0)==($num|0);
+ if ($exitcond13) {
+ break;
+ } else {
+ $i$010 = $7;
+ }
+ }
+ }
+ HEAP32[$sizes>>2] = 0;
+ $11 = ((($sizes)) + 4|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ($12|0)>(2);
+ if (!($13)) {
+ $8 = ((($sizes)) + 8|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($9|0)>(4);
+ if (!($10)) {
+ $66 = ((($sizes)) + 12|0);
+ $67 = HEAP32[$66>>2]|0;
+ $68 = ($67|0)>(8);
+ if (!($68)) {
+ $69 = ((($sizes)) + 16|0);
+ $70 = HEAP32[$69>>2]|0;
+ $71 = ($70|0)>(16);
+ if (!($71)) {
+ $72 = ((($sizes)) + 20|0);
+ $73 = HEAP32[$72>>2]|0;
+ $74 = ($73|0)>(32);
+ if (!($74)) {
+ $75 = ((($sizes)) + 24|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = ($76|0)>(64);
+ if (!($77)) {
+ $78 = ((($sizes)) + 28|0);
+ $79 = HEAP32[$78>>2]|0;
+ $80 = ($79|0)>(128);
+ if (!($80)) {
+ $81 = ((($sizes)) + 32|0);
+ $82 = HEAP32[$81>>2]|0;
+ $83 = ($82|0)>(256);
+ if (!($83)) {
+ $84 = ((($sizes)) + 36|0);
+ $85 = HEAP32[$84>>2]|0;
+ $86 = ($85|0)>(512);
+ if (!($86)) {
+ $87 = ((($sizes)) + 40|0);
+ $88 = HEAP32[$87>>2]|0;
+ $89 = ($88|0)>(1024);
+ if (!($89)) {
+ $90 = ((($sizes)) + 44|0);
+ $91 = HEAP32[$90>>2]|0;
+ $92 = ($91|0)>(2048);
+ if (!($92)) {
+ $93 = ((($sizes)) + 48|0);
+ $94 = HEAP32[$93>>2]|0;
+ $95 = ($94|0)>(4096);
+ if (!($95)) {
+ $96 = ((($sizes)) + 52|0);
+ $97 = HEAP32[$96>>2]|0;
+ $98 = ($97|0)>(8192);
+ if (!($98)) {
+ $99 = ((($sizes)) + 56|0);
+ $100 = HEAP32[$99>>2]|0;
+ $101 = ($100|0)>(16384);
+ if (!($101)) {
+ $102 = ((($sizes)) + 60|0);
+ $103 = HEAP32[$102>>2]|0;
+ $104 = ($103|0)>(32768);
+ if (!($104)) {
+ $code$06 = 0;$i$28 = 1;$k$07 = 0;
+ while(1) {
+ $14 = (($next_code) + ($i$28<<2)|0);
+ HEAP32[$14>>2] = $code$06;
+ $15 = $code$06&65535;
+ $16 = (((($z)) + 1024|0) + ($i$28<<1)|0);
+ HEAP16[$16>>1] = $15;
+ $17 = $k$07&65535;
+ $18 = (((($z)) + 1124|0) + ($i$28<<1)|0);
+ HEAP16[$18>>1] = $17;
+ $19 = (($sizes) + ($i$28<<2)|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = (($20) + ($code$06))|0;
+ $22 = ($20|0)!=(0);
+ $23 = 1 << $i$28;
+ $24 = ($21|0)>($23|0);
+ $or$cond = $22 & $24;
+ if ($or$cond) {
+ label = 7;
+ break;
+ }
+ $25 = (16 - ($i$28))|0;
+ $26 = $21 << $25;
+ $27 = (((($z)) + 1056|0) + ($i$28<<2)|0);
+ HEAP32[$27>>2] = $26;
+ $28 = $21 << 1;
+ $29 = HEAP32[$19>>2]|0;
+ $30 = (($29) + ($k$07))|0;
+ $31 = (($i$28) + 1)|0;
+ $32 = ($31|0)<(16);
+ if ($32) {
+ $code$06 = $28;$i$28 = $31;$k$07 = $30;
+ } else {
+ break;
+ }
+ }
+ if ((label|0) == 7) {
+ _stbi__err(14063);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $33 = ((($z)) + 1120|0);
+ HEAP32[$33>>2] = 65536;
+ $34 = ($num|0)>(0);
+ if ($34) {
+ $i$34 = 0;
+ } else {
+ $$0 = 1;
+ STACKTOP = sp;return ($$0|0);
+ }
+ while(1) {
+ $35 = (($sizelist) + ($i$34)|0);
+ $36 = HEAP8[$35>>0]|0;
+ $37 = $36&255;
+ $38 = ($36<<24>>24)==(0);
+ if (!($38)) {
+ $39 = (($next_code) + ($37<<2)|0);
+ $40 = HEAP32[$39>>2]|0;
+ $41 = (((($z)) + 1024|0) + ($37<<1)|0);
+ $42 = HEAP16[$41>>1]|0;
+ $43 = $42&65535;
+ $44 = (($40) - ($43))|0;
+ $45 = (((($z)) + 1124|0) + ($37<<1)|0);
+ $46 = HEAP16[$45>>1]|0;
+ $47 = $46&65535;
+ $48 = (($44) + ($47))|0;
+ $49 = $37 << 9;
+ $50 = $49 | $i$34;
+ $51 = $50&65535;
+ $52 = (((($z)) + 1156|0) + ($48)|0);
+ HEAP8[$52>>0] = $36;
+ $53 = $i$34&65535;
+ $54 = (((($z)) + 1444|0) + ($48<<1)|0);
+ HEAP16[$54>>1] = $53;
+ $55 = ($36&255)<(10);
+ do {
+ if ($55) {
+ $56 = HEAP32[$39>>2]|0;
+ $57 = (_stbi__bit_reverse($56,$37)|0);
+ $58 = ($57|0)<(512);
+ if (!($58)) {
+ break;
+ }
+ $59 = 1 << $37;
+ $j$03 = $57;
+ while(1) {
+ $60 = (($z) + ($j$03<<1)|0);
+ HEAP16[$60>>1] = $51;
+ $61 = (($j$03) + ($59))|0;
+ $62 = ($61|0)<(512);
+ if ($62) {
+ $j$03 = $61;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $63 = HEAP32[$39>>2]|0;
+ $64 = (($63) + 1)|0;
+ HEAP32[$39>>2] = $64;
+ }
+ $65 = (($i$34) + 1)|0;
+ $exitcond = ($65|0)==($num|0);
+ if ($exitcond) {
+ $$0 = 1;
+ break;
+ } else {
+ $i$34 = $65;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ _stbi__err(14115);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__compute_huffman_codes($a) {
+ $a = $a|0;
+ var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $codelength_sizes = 0, $exitcond = 0, $i$08 = 0, $lencodes = 0, $n$0$be = 0, $n$0$lcssa = 0, $n$06 = 0, $not$ = 0, $z_codelength = 0, dest = 0;
+ var label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 2496|0;
+ $z_codelength = sp;
+ $lencodes = sp + 2039|0;
+ $codelength_sizes = sp + 2020|0;
+ $0 = (_stbi__zreceive($a,5)|0);
+ $1 = (($0) + 257)|0;
+ $2 = (_stbi__zreceive($a,5)|0);
+ $3 = (($2) + 1)|0;
+ $4 = (_stbi__zreceive($a,4)|0);
+ $5 = (($4) + 4)|0;
+ dest=$codelength_sizes; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ $6 = ($5|0)>(0);
+ if ($6) {
+ $7 = (($4) + 3)|0;
+ $i$08 = 0;
+ while(1) {
+ $8 = (_stbi__zreceive($a,3)|0);
+ $9 = $8&255;
+ $10 = (14044 + ($i$08)|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11&255;
+ $13 = (($codelength_sizes) + ($12)|0);
+ HEAP8[$13>>0] = $9;
+ $14 = (($i$08) + 1)|0;
+ $exitcond = ($i$08|0)==($7|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$08 = $14;
+ }
+ }
+ }
+ $15 = (_stbi__zbuild_huffman($z_codelength,$codelength_sizes,19)|0);
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $17 = (($3) + ($1))|0;
+ $18 = ($17|0)>(0);
+ L9: do {
+ if ($18) {
+ $n$06 = 0;
+ L10: while(1) {
+ $19 = (_stbi__zhuffman_decode($a,$z_codelength)|0);
+ $20 = ($19>>>0)>(18);
+ if ($20) {
+ break;
+ }
+ $21 = ($19|0)<(16);
+ L13: do {
+ if ($21) {
+ $22 = $19&255;
+ $23 = (($n$06) + 1)|0;
+ $24 = (($lencodes) + ($n$06)|0);
+ HEAP8[$24>>0] = $22;
+ $n$0$be = $23;
+ } else {
+ switch ($19|0) {
+ case 16: {
+ $25 = (_stbi__zreceive($a,2)|0);
+ $26 = (($25) + 3)|0;
+ $27 = (($lencodes) + ($n$06)|0);
+ $28 = (($n$06) + -1)|0;
+ $29 = (($lencodes) + ($28)|0);
+ $30 = HEAP8[$29>>0]|0;
+ _memset(($27|0),($30|0),($26|0))|0;
+ $31 = (($26) + ($n$06))|0;
+ $n$0$be = $31;
+ break L13;
+ break;
+ }
+ case 17: {
+ $33 = (_stbi__zreceive($a,3)|0);
+ $34 = (($33) + 3)|0;
+ $35 = (($lencodes) + ($n$06)|0);
+ _memset(($35|0),0,($34|0))|0;
+ $36 = (($34) + ($n$06))|0;
+ $n$0$be = $36;
+ break L13;
+ break;
+ }
+ case 18: {
+ $37 = (_stbi__zreceive($a,7)|0);
+ $38 = (($37) + 11)|0;
+ $39 = (($lencodes) + ($n$06)|0);
+ _memset(($39|0),0,($38|0))|0;
+ $40 = (($38) + ($n$06))|0;
+ $n$0$be = $40;
+ break L13;
+ break;
+ }
+ default: {
+ label = 14;
+ break L10;
+ }
+ }
+ }
+ } while(0);
+ $32 = ($n$0$be|0)<($17|0);
+ if ($32) {
+ $n$06 = $n$0$be;
+ } else {
+ $n$0$lcssa = $n$0$be;
+ break L9;
+ }
+ }
+ if ((label|0) == 14) {
+ ___assert_fail((14079|0),(12975|0),3755,(14087|0));
+ // unreachable;
+ }
+ _stbi__err(14063);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ } else {
+ $n$0$lcssa = 0;
+ }
+ } while(0);
+ $41 = ($n$0$lcssa|0)==($17|0);
+ if (!($41)) {
+ _stbi__err(14063);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $42 = ((($a)) + 32|0);
+ $43 = (_stbi__zbuild_huffman($42,$lencodes,$1)|0);
+ $44 = ($43|0)==(0);
+ if ($44) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $45 = ((($a)) + 2052|0);
+ $46 = (($lencodes) + ($1)|0);
+ $47 = (_stbi__zbuild_huffman($45,$46,$3)|0);
+ $not$ = ($47|0)!=(0);
+ $$ = $not$&1;
+ $$0 = $$;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__parse_huffman_block($a) {
+ $a = $a|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dist$0 = 0;
+ var $len$0 = 0, $len$2 = 0, $p$0 = 0, $scevgep = 0, $scevgep14 = 0, $zout$0 = 0, $zout$0$lcssa = 0, $zout$1 = 0, $zout$2 = 0, $zout$4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($a)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($a)) + 32|0);
+ $3 = ((($a)) + 24|0);
+ $4 = ((($a)) + 2052|0);
+ $5 = ((($a)) + 20|0);
+ $6 = ((($a)) + 24|0);
+ $zout$0 = $1;
+ while(1) {
+ $9 = (_stbi__zhuffman_decode($a,$2)|0);
+ $10 = ($9|0)<(256);
+ if ($10) {
+ $11 = ($9|0)<(0);
+ if ($11) {
+ label = 6;
+ break;
+ }
+ $12 = HEAP32[$3>>2]|0;
+ $13 = ($zout$0>>>0)<($12>>>0);
+ if ($13) {
+ $zout$1 = $zout$0;
+ } else {
+ $14 = (_stbi__zexpand($a,$zout$0,1)|0);
+ $15 = ($14|0)==(0);
+ if ($15) {
+ $$0 = 0;
+ label = 28;
+ break;
+ }
+ $16 = HEAP32[$0>>2]|0;
+ $zout$1 = $16;
+ }
+ $17 = $9&255;
+ $18 = ((($zout$1)) + 1|0);
+ HEAP8[$zout$1>>0] = $17;
+ $zout$0 = $18;
+ continue;
+ }
+ $19 = ($9|0)==(256);
+ if ($19) {
+ $zout$0$lcssa = $zout$0;
+ label = 12;
+ break;
+ }
+ $20 = (($9) + -257)|0;
+ $21 = (5776 + ($20<<2)|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (($9) + -265)|0;
+ $24 = ($23>>>0)<(20);
+ if ($24) {
+ $25 = (5900 + ($20<<2)|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = (_stbi__zreceive($a,$26)|0);
+ $28 = (($27) + ($22))|0;
+ $len$0 = $28;
+ } else {
+ $len$0 = $22;
+ }
+ $29 = (_stbi__zhuffman_decode($a,$4)|0);
+ $30 = ($29|0)<(0);
+ if ($30) {
+ label = 16;
+ break;
+ }
+ $31 = (6024 + ($29<<2)|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = (($29) + -4)|0;
+ $34 = ($33>>>0)<(26);
+ if ($34) {
+ $35 = (6152 + ($29<<2)|0);
+ $36 = HEAP32[$35>>2]|0;
+ $37 = (_stbi__zreceive($a,$36)|0);
+ $38 = (($37) + ($32))|0;
+ $dist$0 = $38;
+ } else {
+ $dist$0 = $32;
+ }
+ $39 = HEAP32[$5>>2]|0;
+ $40 = $zout$0;
+ $41 = $39;
+ $42 = (($40) - ($41))|0;
+ $43 = ($42|0)<($dist$0|0);
+ if ($43) {
+ label = 20;
+ break;
+ }
+ $44 = (($zout$0) + ($len$0)|0);
+ $45 = HEAP32[$6>>2]|0;
+ $46 = ($44>>>0)>($45>>>0);
+ if ($46) {
+ $47 = (_stbi__zexpand($a,$zout$0,$len$0)|0);
+ $48 = ($47|0)==(0);
+ if ($48) {
+ $$0 = 0;
+ label = 28;
+ break;
+ }
+ $49 = HEAP32[$0>>2]|0;
+ $zout$2 = $49;
+ } else {
+ $zout$2 = $zout$0;
+ }
+ $50 = (0 - ($dist$0))|0;
+ $8 = (($zout$2) + ($50)|0);
+ $51 = ($dist$0|0)==(1);
+ $52 = ($len$0|0)==(0);
+ if ($51) {
+ if ($52) {
+ $zout$0 = $zout$2;
+ continue;
+ }
+ $7 = HEAP8[$8>>0]|0;
+ _memset(($zout$2|0),($7|0),($len$0|0))|0;
+ $scevgep14 = (($zout$2) + ($len$0)|0);
+ $zout$0 = $scevgep14;
+ continue;
+ }
+ if ($52) {
+ $zout$0 = $zout$2;
+ continue;
+ } else {
+ $len$2 = $len$0;$p$0 = $8;$zout$4 = $zout$2;
+ }
+ while(1) {
+ $53 = ((($p$0)) + 1|0);
+ $54 = HEAP8[$p$0>>0]|0;
+ $55 = ((($zout$4)) + 1|0);
+ HEAP8[$zout$4>>0] = $54;
+ $56 = (($len$2) + -1)|0;
+ $57 = ($56|0)==(0);
+ if ($57) {
+ break;
+ } else {
+ $len$2 = $56;$p$0 = $53;$zout$4 = $55;
+ }
+ }
+ $scevgep = (($zout$2) + ($len$0)|0);
+ $zout$0 = $scevgep;
+ }
+ if ((label|0) == 6) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 12) {
+ HEAP32[$0>>2] = $zout$0$lcssa;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ else if ((label|0) == 16) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 20) {
+ _stbi__err(13886);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 28) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__zhuffman_decode($a,$z) {
+ $a = $a|0;
+ $z = $z|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($a)) + 8|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<(16);
+ if ($2) {
+ _stbi__fill_bits($a);
+ }
+ $3 = ((($a)) + 12|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4 & 511;
+ $6 = (($z) + ($5<<1)|0);
+ $7 = HEAP16[$6>>1]|0;
+ $8 = $7&65535;
+ $9 = ($7<<16>>16)==(0);
+ if ($9) {
+ $15 = (_stbi__zhuffman_decode_slowpath($a,$z)|0);
+ $$0 = $15;
+ return ($$0|0);
+ } else {
+ $10 = $8 >>> 9;
+ $11 = $4 >>> $10;
+ HEAP32[$3>>2] = $11;
+ $12 = HEAP32[$0>>2]|0;
+ $13 = (($12) - ($10))|0;
+ HEAP32[$0>>2] = $13;
+ $14 = $8 & 511;
+ $$0 = $14;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__zexpand($z,$zout,$n) {
+ $z = $z|0;
+ $zout = $zout|0;
+ $n = $n|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, $limit$0 = 0, $limit$0$lcssa = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($z)) + 16|0);
+ HEAP32[$0>>2] = $zout;
+ $1 = ((($z)) + 28|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0);
+ if ($3) {
+ _stbi__err(13895);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $4 = ((($z)) + 20|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = $zout;
+ $7 = $5;
+ $8 = (($6) - ($7))|0;
+ $9 = ((($z)) + 24|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = $10;
+ $12 = (($11) - ($7))|0;
+ $13 = (($8) + ($n))|0;
+ $limit$0 = $12;
+ while(1) {
+ $14 = ($13|0)>($limit$0|0);
+ $15 = $limit$0 << 1;
+ if ($14) {
+ $limit$0 = $15;
+ } else {
+ $limit$0$lcssa = $limit$0;
+ break;
+ }
+ }
+ $16 = HEAP32[$4>>2]|0;
+ $17 = (_realloc($16,$limit$0$lcssa)|0);
+ $18 = ($17|0)==(0|0);
+ if ($18) {
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ HEAP32[$4>>2] = $17;
+ $19 = (($17) + ($8)|0);
+ HEAP32[$0>>2] = $19;
+ $20 = (($17) + ($limit$0$lcssa)|0);
+ HEAP32[$9>>2] = $20;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__fill_bits($z) {
+ $z = $z|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($z)) + 12|0);
+ $1 = ((($z)) + 8|0);
+ while(1) {
+ $2 = HEAP32[$0>>2]|0;
+ $3 = HEAP32[$1>>2]|0;
+ $4 = 1 << $3;
+ $5 = ($2>>>0)<($4>>>0);
+ if (!($5)) {
+ label = 3;
+ break;
+ }
+ $6 = (_stbi__zget8($z)|0);
+ $7 = $6&255;
+ $8 = HEAP32[$1>>2]|0;
+ $9 = $7 << $8;
+ $10 = HEAP32[$0>>2]|0;
+ $11 = $10 | $9;
+ HEAP32[$0>>2] = $11;
+ $12 = HEAP32[$1>>2]|0;
+ $13 = (($12) + 8)|0;
+ HEAP32[$1>>2] = $13;
+ $14 = ($13|0)<(25);
+ if (!($14)) {
+ label = 5;
+ break;
+ }
+ }
+ if ((label|0) == 3) {
+ ___assert_fail((13991|0),(12975|0),3598,(14028|0));
+ // unreachable;
+ }
+ else if ((label|0) == 5) {
+ return;
+ }
+}
+function _stbi__zhuffman_decode_slowpath($a,$z) {
+ $a = $a|0;
+ $z = $z|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $s$0 = 0, $s$0$lcssa = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($a)) + 12|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = (_stbi__bit_reverse($1,16)|0);
+ $s$0 = 10;
+ while(1) {
+ $3 = (((($z)) + 1056|0) + ($s$0<<2)|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($2|0)<($4|0);
+ $6 = (($s$0) + 1)|0;
+ if ($5) {
+ $s$0$lcssa = $s$0;
+ break;
+ } else {
+ $s$0 = $6;
+ }
+ }
+ $7 = ($s$0$lcssa|0)==(16);
+ if ($7) {
+ $$0 = -1;
+ return ($$0|0);
+ }
+ $8 = (16 - ($s$0$lcssa))|0;
+ $9 = $2 >> $8;
+ $10 = (((($z)) + 1024|0) + ($s$0$lcssa<<1)|0);
+ $11 = HEAP16[$10>>1]|0;
+ $12 = $11&65535;
+ $13 = (($9) - ($12))|0;
+ $14 = (((($z)) + 1124|0) + ($s$0$lcssa<<1)|0);
+ $15 = HEAP16[$14>>1]|0;
+ $16 = $15&65535;
+ $17 = (($13) + ($16))|0;
+ $18 = (((($z)) + 1156|0) + ($17)|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = $19&255;
+ $21 = ($20|0)==($s$0$lcssa|0);
+ if (!($21)) {
+ ___assert_fail((13915|0),(12975|0),3626,(13931|0));
+ // unreachable;
+ }
+ $22 = HEAP32[$0>>2]|0;
+ $23 = $22 >>> $s$0$lcssa;
+ HEAP32[$0>>2] = $23;
+ $24 = ((($a)) + 8|0);
+ $25 = HEAP32[$24>>2]|0;
+ $26 = (($25) - ($s$0$lcssa))|0;
+ HEAP32[$24>>2] = $26;
+ $27 = (((($z)) + 1444|0) + ($17<<1)|0);
+ $28 = HEAP16[$27>>1]|0;
+ $29 = $28&65535;
+ $$0 = $29;
+ return ($$0|0);
+}
+function _stbi__bit_reverse($v,$bits) {
+ $v = $v|0;
+ $bits = $bits|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($bits|0)<(17);
+ if ($0) {
+ $1 = (_stbi__bitreverse16($v)|0);
+ $2 = (16 - ($bits))|0;
+ $3 = $1 >> $2;
+ return ($3|0);
+ } else {
+ ___assert_fail((13962|0),(12975|0),3516,(13973|0));
+ // unreachable;
+ }
+ return (0)|0;
+}
+function _stbi__bitreverse16($n) {
+ $n = $n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $0 = $n >>> 1;
+ $1 = $0 & 21845;
+ $2 = $n << 1;
+ $3 = $2 & 43690;
+ $4 = $1 | $3;
+ $5 = $4 >>> 2;
+ $6 = $5 & 13107;
+ $7 = $4 << 2;
+ $8 = $7 & 52428;
+ $9 = $6 | $8;
+ $10 = $9 >>> 4;
+ $11 = $10 & 3855;
+ $12 = $9 << 4;
+ $13 = $12 & 61680;
+ $14 = $11 | $13;
+ $15 = $14 >>> 8;
+ $16 = $14 << 8;
+ $17 = $16 & 65280;
+ $18 = $17 | $15;
+ return ($18|0);
+}
+function _stbi__zget8($z) {
+ $z = $z|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = ((($z)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($0>>>0)<($2>>>0);
+ if (!($3)) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $4 = ((($0)) + 1|0);
+ HEAP32[$z>>2] = $4;
+ $5 = HEAP8[$0>>0]|0;
+ $$0 = $5;
+ return ($$0|0);
+}
+function _stbi__load_main($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__jpeg_test($s)|0);
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = (_stbi__jpeg_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $2;
+ return ($$0|0);
+ }
+ $3 = (_stbi__png_test($s)|0);
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ $5 = (_stbi__png_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $5;
+ return ($$0|0);
+ }
+ $6 = (_stbi__bmp_test($s)|0);
+ $7 = ($6|0)==(0);
+ if (!($7)) {
+ $8 = (_stbi__bmp_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $8;
+ return ($$0|0);
+ }
+ $9 = (_stbi__gif_test($s)|0);
+ $10 = ($9|0)==(0);
+ if (!($10)) {
+ $11 = (_stbi__gif_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $11;
+ return ($$0|0);
+ }
+ $12 = (_stbi__psd_test($s)|0);
+ $13 = ($12|0)==(0);
+ if (!($13)) {
+ $14 = (_stbi__psd_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $14;
+ return ($$0|0);
+ }
+ $15 = (_stbi__pic_test($s)|0);
+ $16 = ($15|0)==(0);
+ if (!($16)) {
+ $17 = (_stbi__pic_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $17;
+ return ($$0|0);
+ }
+ $18 = (_stbi__pnm_test($s)|0);
+ $19 = ($18|0)==(0);
+ if (!($19)) {
+ $20 = (_stbi__pnm_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $20;
+ return ($$0|0);
+ }
+ $21 = (_stbi__tga_test($s)|0);
+ $22 = ($21|0)==(0);
+ if ($22) {
+ _stbi__err(12566);
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ $23 = (_stbi__tga_load($s,$x,$y,$comp,$req_comp)|0);
+ $$0 = $23;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__jpeg_test($s) {
+ $s = $s|0;
+ var $0 = 0, $j = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 18192|0;
+ $j = sp;
+ HEAP32[$j>>2] = $s;
+ _stbi__setup_jpeg($j);
+ $0 = (_stbi__decode_jpeg_header($j,1)|0);
+ _stbi__rewind($s);
+ STACKTOP = sp;return ($0|0);
+}
+function _stbi__jpeg_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__malloc(18192)|0);
+ HEAP32[$0>>2] = $s;
+ _stbi__setup_jpeg($0);
+ $1 = (_load_jpeg_image($0,$x,$y,$comp,$req_comp)|0);
+ _free($0);
+ return ($1|0);
+}
+function _stbi__png_test($s) {
+ $s = $s|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__check_png_header($s)|0);
+ _stbi__rewind($s);
+ return ($0|0);
+}
+function _stbi__png_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $0 = 0, $p = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $p = sp;
+ HEAP32[$p>>2] = $s;
+ $0 = (_stbi__do_png($p,$x,$y,$comp,$req_comp)|0);
+ STACKTOP = sp;return ($0|0);
+}
+function _stbi__bmp_test($s) {
+ $s = $s|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__bmp_test_raw($s)|0);
+ _stbi__rewind($s);
+ return ($0|0);
+}
+function _stbi__bmp_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $$pr = 0, $$sum = 0, $$sum16 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
+ var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
+ var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
+ var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
+ var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
+ var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0;
+ var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0;
+ var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0;
+ var $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0;
+ var $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
+ var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
+ var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
+ var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $acount$0 = 0, $all_a$064 = 0, $all_a$158 = 0, $all_a$251 = 0, $all_a$3 = 0, $all_a$4 = 0, $ashift$0 = 0, $bcount$0 = 0, $bshift$0 = 0, $easy$017 = 0, $exitcond = 0, $gcount$0 = 0, $gshift$0 = 0, $i$046 = 0;
+ var $i$138 = 0, $i$256 = 0, $i$349 = 0, $i$435 = 0, $i$532 = 0, $info = 0, $ispos = 0, $j$044 = 0, $j$162 = 0, $j$233 = 0, $neg = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $out$0 = 0;
+ var $pal = 0, $psize$0 = 0, $rcount$0 = 0, $req_comp$ = 0, $rshift$0 = 0, $v$0 = 0, $v2$0 = 0, $width$0 = 0, $width$1 = 0, $width$1$ph = 0, $z$045 = 0, $z$139 = 0, $z$2 = 0, $z$3 = 0, $z$4 = 0, $z1$063 = 0, $z1$157 = 0, $z1$2 = 0, $z1$350 = 0, $z1$4 = 0;
+ var $z1$5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1056|0;
+ $pal = sp + 32|0;
+ $info = sp;
+ $0 = ((($info)) + 28|0);
+ HEAP32[$0>>2] = 255;
+ $1 = (_stbi__bmp_parse_header($s,$info)|0);
+ $2 = ($1|0)==(0|0);
+ if ($2) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $3 = ((($s)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)>(0);
+ $ispos = ($4|0)>(-1);
+ $neg = (0 - ($4))|0;
+ $6 = $ispos ? $4 : $neg;
+ HEAP32[$3>>2] = $6;
+ $7 = ((($info)) + 12|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($info)) + 16|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($info)) + 20|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ((($info)) + 24|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = HEAP32[$0>>2]|0;
+ $16 = ((($info)) + 8|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ($17|0)==(12);
+ $19 = HEAP32[$info>>2]|0;
+ if ($18) {
+ $20 = ($19|0)<(24);
+ if ($20) {
+ $21 = ((($info)) + 4|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (($22) + -38)|0;
+ $24 = (($23|0) / 3)&-1;
+ $psize$0 = $24;
+ } else {
+ $psize$0 = 0;
+ }
+ } else {
+ $25 = ($19|0)<(16);
+ if ($25) {
+ $26 = ((($info)) + 4|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (-14 - ($17))|0;
+ $29 = (($28) + ($27))|0;
+ $30 = $29 >> 2;
+ $psize$0 = $30;
+ } else {
+ $psize$0 = 0;
+ }
+ }
+ $31 = ($14|0)!=(0);
+ $32 = $31 ? 4 : 3;
+ $33 = ((($s)) + 8|0);
+ HEAP32[$33>>2] = $32;
+ $34 = ($req_comp|0)==(0);
+ $35 = ($req_comp|0)>(2);
+ $req_comp$ = $35 ? $req_comp : $32;
+ $36 = HEAP32[$s>>2]|0;
+ $37 = Math_imul($36, $req_comp$)|0;
+ $38 = HEAP32[$3>>2]|0;
+ $39 = Math_imul($37, $38)|0;
+ $40 = (_stbi__malloc($39)|0);
+ $41 = ($40|0)==(0|0);
+ if ($41) {
+ _stbi__err(12905);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $42 = HEAP32[$info>>2]|0;
+ $43 = ($42|0)<(16);
+ if ($43) {
+ $44 = ($psize$0|0)==(0);
+ $45 = ($psize$0|0)>(256);
+ $or$cond3 = $44 | $45;
+ if ($or$cond3) {
+ _free($40);
+ _stbi__err(14566);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $46 = ($psize$0|0)>(0);
+ if ($46) {
+ $47 = HEAP32[$16>>2]|0;
+ $48 = ($47|0)==(12);
+ $i$046 = 0;
+ while(1) {
+ $49 = (_stbi__get8($s)|0);
+ $50 = (((($pal) + ($i$046<<2)|0)) + 2|0);
+ HEAP8[$50>>0] = $49;
+ $51 = (_stbi__get8($s)|0);
+ $52 = (((($pal) + ($i$046<<2)|0)) + 1|0);
+ HEAP8[$52>>0] = $51;
+ $53 = (_stbi__get8($s)|0);
+ $54 = (($pal) + ($i$046<<2)|0);
+ HEAP8[$54>>0] = $53;
+ if (!($48)) {
+ (_stbi__get8($s)|0);
+ }
+ $55 = (((($pal) + ($i$046<<2)|0)) + 3|0);
+ HEAP8[$55>>0] = -1;
+ $56 = (($i$046) + 1)|0;
+ $exitcond = ($56|0)==($psize$0|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$046 = $56;
+ }
+ }
+ }
+ $57 = ((($info)) + 4|0);
+ $58 = HEAP32[$57>>2]|0;
+ $59 = (($58) + -14)|0;
+ $60 = HEAP32[$16>>2]|0;
+ $61 = (($59) - ($60))|0;
+ $62 = ($60|0)==(12);
+ $63 = $62 ? 3 : 4;
+ $64 = Math_imul($63, $psize$0)|0;
+ $65 = (($61) - ($64))|0;
+ _stbi__skip($s,$65);
+ $66 = HEAP32[$info>>2]|0;
+ switch ($66|0) {
+ case 4: {
+ $67 = HEAP32[$s>>2]|0;
+ $68 = (($67) + 1)|0;
+ $69 = $68 >>> 1;
+ $width$0 = $69;
+ break;
+ }
+ case 8: {
+ $70 = HEAP32[$s>>2]|0;
+ $width$0 = $70;
+ break;
+ }
+ default: {
+ _free($40);
+ _stbi__err(14574);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ $71 = (0 - ($width$0))|0;
+ $72 = $71 & 3;
+ $73 = HEAP32[$3>>2]|0;
+ $74 = ($73|0)>(0);
+ if ($74) {
+ $75 = HEAP32[$info>>2]|0;
+ $76 = ($75|0)==(4);
+ $77 = ($req_comp$|0)==(4);
+ $78 = ($75|0)==(8);
+ $j$044 = 0;$z$045 = 0;
+ while(1) {
+ $79 = HEAP32[$s>>2]|0;
+ $80 = ($79|0)>(0);
+ L37: do {
+ if ($80) {
+ $i$138 = 0;$z$139 = $z$045;
+ while(1) {
+ $81 = (_stbi__get8($s)|0);
+ $82 = $81&255;
+ $83 = $82 & 15;
+ $84 = $82 >>> 4;
+ $v$0 = $76 ? $84 : $82;
+ $v2$0 = $76 ? $83 : 0;
+ $85 = (($pal) + ($v$0<<2)|0);
+ $86 = HEAP8[$85>>0]|0;
+ $87 = (($z$139) + 1)|0;
+ $88 = (($40) + ($z$139)|0);
+ HEAP8[$88>>0] = $86;
+ $89 = (((($pal) + ($v$0<<2)|0)) + 1|0);
+ $90 = HEAP8[$89>>0]|0;
+ $91 = (($z$139) + 2)|0;
+ $92 = (($40) + ($87)|0);
+ HEAP8[$92>>0] = $90;
+ $93 = (((($pal) + ($v$0<<2)|0)) + 2|0);
+ $94 = HEAP8[$93>>0]|0;
+ $95 = (($z$139) + 3)|0;
+ $96 = (($40) + ($91)|0);
+ HEAP8[$96>>0] = $94;
+ if ($77) {
+ $97 = (($z$139) + 4)|0;
+ $98 = (($40) + ($95)|0);
+ HEAP8[$98>>0] = -1;
+ $z$2 = $97;
+ } else {
+ $z$2 = $95;
+ }
+ $99 = $i$138 | 1;
+ $100 = HEAP32[$s>>2]|0;
+ $101 = ($99|0)==($100|0);
+ if ($101) {
+ $z$4 = $z$2;
+ break L37;
+ }
+ if ($78) {
+ $102 = (_stbi__get8($s)|0);
+ $103 = $102&255;
+ $105 = $103;
+ } else {
+ $105 = $v2$0;
+ }
+ $104 = (($pal) + ($105<<2)|0);
+ $106 = HEAP8[$104>>0]|0;
+ $107 = (($z$2) + 1)|0;
+ $108 = (($40) + ($z$2)|0);
+ HEAP8[$108>>0] = $106;
+ $109 = (((($pal) + ($105<<2)|0)) + 1|0);
+ $110 = HEAP8[$109>>0]|0;
+ $111 = (($z$2) + 2)|0;
+ $112 = (($40) + ($107)|0);
+ HEAP8[$112>>0] = $110;
+ $113 = (((($pal) + ($105<<2)|0)) + 2|0);
+ $114 = HEAP8[$113>>0]|0;
+ $115 = (($z$2) + 3)|0;
+ $116 = (($40) + ($111)|0);
+ HEAP8[$116>>0] = $114;
+ if ($77) {
+ $117 = (($z$2) + 4)|0;
+ $118 = (($40) + ($115)|0);
+ HEAP8[$118>>0] = -1;
+ $z$3 = $117;
+ } else {
+ $z$3 = $115;
+ }
+ $119 = (($i$138) + 2)|0;
+ $120 = HEAP32[$s>>2]|0;
+ $121 = ($119|0)<($120|0);
+ if ($121) {
+ $i$138 = $119;$z$139 = $z$3;
+ } else {
+ $z$4 = $z$3;
+ break;
+ }
+ }
+ } else {
+ $z$4 = $z$045;
+ }
+ } while(0);
+ _stbi__skip($s,$72);
+ $122 = (($j$044) + 1)|0;
+ $123 = HEAP32[$3>>2]|0;
+ $124 = ($122|0)<($123|0);
+ if ($124) {
+ $j$044 = $122;$z$045 = $z$4;
+ } else {
+ $all_a$4 = $15;
+ break;
+ }
+ }
+ } else {
+ $all_a$4 = $15;
+ }
+ } else {
+ $125 = ((($info)) + 4|0);
+ $126 = HEAP32[$125>>2]|0;
+ $127 = (($126) + -14)|0;
+ $128 = HEAP32[$16>>2]|0;
+ $129 = (($127) - ($128))|0;
+ _stbi__skip($s,$129);
+ $130 = HEAP32[$info>>2]|0;
+ switch ($130|0) {
+ case 24: {
+ $131 = HEAP32[$s>>2]|0;
+ $132 = ($131*3)|0;
+ $width$1$ph = $132;
+ label = 36;
+ break;
+ }
+ case 16: {
+ $133 = HEAP32[$s>>2]|0;
+ $134 = $133 << 1;
+ $width$1$ph = $134;
+ label = 36;
+ break;
+ }
+ default: {
+ $137 = $130;$width$1 = 0;
+ }
+ }
+ if ((label|0) == 36) {
+ $$pr = HEAP32[$info>>2]|0;
+ $137 = $$pr;$width$1 = $width$1$ph;
+ }
+ $135 = (0 - ($width$1))|0;
+ $136 = $135 & 3;
+ switch ($137|0) {
+ case 24: {
+ $261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 1;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0;
+ break;
+ }
+ case 32: {
+ $138 = ($12|0)==(255);
+ $139 = ($10|0)==(65280);
+ $or$cond5 = $139 & $138;
+ $140 = ($8|0)==(16711680);
+ $or$cond7 = $140 & $or$cond5;
+ $141 = ($14|0)==(-16777216);
+ $or$cond9 = $141 & $or$cond7;
+ if ($or$cond9) {
+ $261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 2;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0;
+ } else {
+ label = 39;
+ }
+ break;
+ }
+ default: {
+ label = 39;
+ }
+ }
+ do {
+ if ((label|0) == 39) {
+ $142 = ($8|0)!=(0);
+ $143 = ($10|0)!=(0);
+ $or$cond11 = $142 & $143;
+ $144 = ($12|0)!=(0);
+ $or$cond13 = $or$cond11 & $144;
+ if ($or$cond13) {
+ $145 = (_stbi__high_bit($8)|0);
+ $146 = (($145) + -7)|0;
+ $147 = (_stbi__bitcount($8)|0);
+ $148 = (_stbi__high_bit($10)|0);
+ $149 = (($148) + -7)|0;
+ $150 = (_stbi__bitcount($10)|0);
+ $151 = (_stbi__high_bit($12)|0);
+ $152 = (($151) + -7)|0;
+ $153 = (_stbi__bitcount($12)|0);
+ $154 = (_stbi__high_bit($14)|0);
+ $155 = (($154) + -7)|0;
+ $156 = (_stbi__bitcount($14)|0);
+ $261 = 0;$acount$0 = $156;$ashift$0 = $155;$bcount$0 = $153;$bshift$0 = $152;$easy$017 = 0;$gcount$0 = $150;$gshift$0 = $149;$rcount$0 = $147;$rshift$0 = $146;
+ break;
+ }
+ _free($40);
+ _stbi__err(14582);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ } while(0);
+ $157 = HEAP32[$3>>2]|0;
+ $158 = ($157|0)>(0);
+ if ($158) {
+ $159 = HEAP32[$info>>2]|0;
+ $160 = ($159|0)==(16);
+ $161 = ($req_comp$|0)==(4);
+ $162 = ($easy$017|0)==(2);
+ $163 = ($req_comp$|0)==(4);
+ $all_a$064 = $15;$j$162 = 0;$z1$063 = 0;
+ while(1) {
+ $164 = HEAP32[$s>>2]|0;
+ $165 = ($164|0)>(0);
+ if ($261) {
+ if ($165) {
+ $all_a$158 = $all_a$064;$i$256 = 0;$z1$157 = $z1$063;
+ while(1) {
+ $166 = (_stbi__get8($s)|0);
+ $167 = (($z1$157) + 2)|0;
+ $168 = (($40) + ($167)|0);
+ HEAP8[$168>>0] = $166;
+ $169 = (_stbi__get8($s)|0);
+ $170 = (($z1$157) + 1)|0;
+ $171 = (($40) + ($170)|0);
+ HEAP8[$171>>0] = $169;
+ $172 = (_stbi__get8($s)|0);
+ $173 = (($40) + ($z1$157)|0);
+ HEAP8[$173>>0] = $172;
+ $174 = (($z1$157) + 3)|0;
+ if ($162) {
+ $175 = (_stbi__get8($s)|0);
+ $176 = $175&255;
+ $178 = $176;
+ } else {
+ $178 = 255;
+ }
+ $177 = $178 | $all_a$158;
+ if ($163) {
+ $179 = $178&255;
+ $180 = (($z1$157) + 4)|0;
+ $181 = (($40) + ($174)|0);
+ HEAP8[$181>>0] = $179;
+ $z1$2 = $180;
+ } else {
+ $z1$2 = $174;
+ }
+ $182 = (($i$256) + 1)|0;
+ $183 = HEAP32[$s>>2]|0;
+ $184 = ($182|0)<($183|0);
+ if ($184) {
+ $all_a$158 = $177;$i$256 = $182;$z1$157 = $z1$2;
+ } else {
+ $all_a$3 = $177;$z1$5 = $z1$2;
+ break;
+ }
+ }
+ } else {
+ $all_a$3 = $all_a$064;$z1$5 = $z1$063;
+ }
+ } else {
+ if ($165) {
+ $all_a$251 = $all_a$064;$i$349 = 0;$z1$350 = $z1$063;
+ while(1) {
+ if ($160) {
+ $185 = (_stbi__get16le($s)|0);
+ $188 = $185;
+ } else {
+ $186 = (_stbi__get32le($s)|0);
+ $188 = $186;
+ }
+ $187 = $188 & $8;
+ $189 = (_stbi__shiftsigned($187,$rshift$0,$rcount$0)|0);
+ $190 = $189&255;
+ $191 = (($z1$350) + 1)|0;
+ $192 = (($40) + ($z1$350)|0);
+ HEAP8[$192>>0] = $190;
+ $193 = $188 & $10;
+ $194 = (_stbi__shiftsigned($193,$gshift$0,$gcount$0)|0);
+ $195 = $194&255;
+ $196 = (($z1$350) + 2)|0;
+ $197 = (($40) + ($191)|0);
+ HEAP8[$197>>0] = $195;
+ $198 = $188 & $12;
+ $199 = (_stbi__shiftsigned($198,$bshift$0,$bcount$0)|0);
+ $200 = $199&255;
+ $201 = (($z1$350) + 3)|0;
+ $202 = (($40) + ($196)|0);
+ HEAP8[$202>>0] = $200;
+ if ($31) {
+ $203 = $188 & $14;
+ $204 = (_stbi__shiftsigned($203,$ashift$0,$acount$0)|0);
+ $206 = $204;
+ } else {
+ $206 = 255;
+ }
+ $205 = $206 | $all_a$251;
+ if ($161) {
+ $207 = $206&255;
+ $208 = (($z1$350) + 4)|0;
+ $209 = (($40) + ($201)|0);
+ HEAP8[$209>>0] = $207;
+ $z1$4 = $208;
+ } else {
+ $z1$4 = $201;
+ }
+ $210 = (($i$349) + 1)|0;
+ $211 = HEAP32[$s>>2]|0;
+ $212 = ($210|0)<($211|0);
+ if ($212) {
+ $all_a$251 = $205;$i$349 = $210;$z1$350 = $z1$4;
+ } else {
+ $all_a$3 = $205;$z1$5 = $z1$4;
+ break;
+ }
+ }
+ } else {
+ $all_a$3 = $all_a$064;$z1$5 = $z1$063;
+ }
+ }
+ _stbi__skip($s,$136);
+ $213 = (($j$162) + 1)|0;
+ $214 = HEAP32[$3>>2]|0;
+ $215 = ($213|0)<($214|0);
+ if ($215) {
+ $all_a$064 = $all_a$3;$j$162 = $213;$z1$063 = $z1$5;
+ } else {
+ $all_a$4 = $all_a$3;
+ break;
+ }
+ }
+ } else {
+ $all_a$4 = $15;
+ }
+ }
+ $216 = ($req_comp$|0)==(4);
+ $217 = ($all_a$4|0)==(0);
+ $or$cond15 = $216 & $217;
+ if ($or$cond15) {
+ $218 = HEAP32[$s>>2]|0;
+ $219 = $218 << 2;
+ $220 = HEAP32[$3>>2]|0;
+ $221 = Math_imul($219, $220)|0;
+ $222 = (($221) + -1)|0;
+ $223 = ($222|0)>(-1);
+ if ($223) {
+ $i$435 = $222;
+ while(1) {
+ $224 = (($40) + ($i$435)|0);
+ HEAP8[$224>>0] = -1;
+ $225 = (($i$435) + -4)|0;
+ $226 = ($225|0)>(-1);
+ if ($226) {
+ $i$435 = $225;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ if ($5) {
+ $227 = HEAP32[$3>>2]|0;
+ $228 = $227 >> 1;
+ $229 = ($228|0)>(0);
+ if ($229) {
+ $230 = HEAP32[$s>>2]|0;
+ $231 = Math_imul($230, $req_comp$)|0;
+ $232 = ($231|0)>(0);
+ $233 = HEAP32[$3>>2]|0;
+ $234 = $233 >> 1;
+ $239 = $227;$j$233 = 0;
+ while(1) {
+ $235 = Math_imul($j$233, $req_comp$)|0;
+ $236 = Math_imul($235, $230)|0;
+ $237 = $j$233 ^ -1;
+ $238 = (($239) + ($237))|0;
+ $240 = Math_imul($238, $req_comp$)|0;
+ $241 = Math_imul($240, $230)|0;
+ if ($232) {
+ $242 = HEAP32[$s>>2]|0;
+ $243 = Math_imul($242, $req_comp$)|0;
+ $i$532 = 0;
+ while(1) {
+ $$sum = (($i$532) + ($236))|0;
+ $244 = (($40) + ($$sum)|0);
+ $245 = HEAP8[$244>>0]|0;
+ $$sum16 = (($i$532) + ($241))|0;
+ $246 = (($40) + ($$sum16)|0);
+ $247 = HEAP8[$246>>0]|0;
+ HEAP8[$244>>0] = $247;
+ HEAP8[$246>>0] = $245;
+ $248 = (($i$532) + 1)|0;
+ $249 = ($248|0)<($243|0);
+ if ($249) {
+ $i$532 = $248;
+ } else {
+ break;
+ }
+ }
+ }
+ $250 = (($j$233) + 1)|0;
+ $251 = ($250|0)<($234|0);
+ if ($251) {
+ $239 = $233;$j$233 = $250;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ $252 = ($req_comp$|0)==($req_comp|0);
+ $or$cond = $34 | $252;
+ if ($or$cond) {
+ $out$0 = $40;
+ } else {
+ $253 = HEAP32[$s>>2]|0;
+ $254 = HEAP32[$3>>2]|0;
+ $255 = (_stbi__convert_format($40,$req_comp$,$req_comp,$253,$254)|0);
+ $256 = ($255|0)==(0|0);
+ if ($256) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ } else {
+ $out$0 = $255;
+ }
+ }
+ $257 = HEAP32[$s>>2]|0;
+ HEAP32[$x>>2] = $257;
+ $258 = HEAP32[$3>>2]|0;
+ HEAP32[$y>>2] = $258;
+ $259 = ($comp|0)==(0|0);
+ if ($259) {
+ $$0 = $out$0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $260 = HEAP32[$33>>2]|0;
+ HEAP32[$comp>>2] = $260;
+ $$0 = $out$0;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__gif_test($s) {
+ $s = $s|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__gif_test_raw($s)|0);
+ _stbi__rewind($s);
+ return ($0|0);
+}
+function _stbi__gif_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $u$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__malloc(18516)|0);
+ _memset(($0|0),0,18516)|0;
+ $1 = (_stbi__gif_load_next($s,$0,$comp)|0);
+ $2 = ($1|0)==($s|0);
+ $$ = $2 ? 0 : $1;
+ $3 = ($$|0)==(0|0);
+ if ($3) {
+ $10 = ((($0)) + 8|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ($11|0)==(0|0);
+ if ($12) {
+ $u$0 = 0;
+ _free($0);
+ return ($u$0|0);
+ }
+ _free($11);
+ $u$0 = 0;
+ _free($0);
+ return ($u$0|0);
+ } else {
+ $4 = HEAP32[$0>>2]|0;
+ HEAP32[$x>>2] = $4;
+ $5 = ((($0)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ HEAP32[$y>>2] = $6;
+ switch ($req_comp|0) {
+ case 0: case 4: {
+ $u$0 = $$;
+ _free($0);
+ return ($u$0|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $7 = HEAP32[$0>>2]|0;
+ $8 = HEAP32[$5>>2]|0;
+ $9 = (_stbi__convert_format($$,4,$req_comp,$7,$8)|0);
+ $u$0 = $9;
+ _free($0);
+ return ($u$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__psd_test($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get32be($s)|0);
+ $1 = ($0|0)==(943870035);
+ $2 = $1&1;
+ _stbi__rewind($s);
+ return ($2|0);
+}
+function _stbi__psd_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $$lcssa = 0, $$pn = 0, $$sum6 = 0, $$sum7 = 0, $$sum8 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0;
+ var $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0;
+ var $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
+ var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
+ var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0;
+ var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0;
+ var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0;
+ var $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $channel$046 = 0, $count$0$ph$be = 0, $count$0$ph45 = 0, $exitcond = 0, $exitcond49 = 0, $exitcond49$1 = 0, $exitcond49$2 = 0, $exitcond49$3 = 0, $exitcond50 = 0, $exitcond50$1 = 0, $exitcond50$2 = 0;
+ var $exitcond50$3 = 0, $exitcond51 = 0, $exitcond51$1 = 0, $exitcond51$2 = 0, $exitcond51$3 = 0, $exitcond54 = 0, $exitcond58 = 0, $i$036 = 0, $i$126 = 0, $i$126$1 = 0, $i$126$2 = 0, $i$126$3 = 0, $i$232 = 0, $i$232$1 = 0, $i$232$2 = 0, $i$232$3 = 0, $i$329 = 0, $i$329$1 = 0, $i$329$2 = 0, $i$329$3 = 0;
+ var $i$424 = 0, $len$043 = 0, $len$140 = 0, $or$cond = 0, $out$0 = 0, $p$035 = 0, $p$1$ph$be = 0, $p$1$ph44 = 0, $p$242 = 0, $p$339 = 0, $p1$025 = 0, $p1$025$1 = 0, $p1$025$2 = 0, $p1$025$3 = 0, $p1$131 = 0, $p1$131$1 = 0, $p1$131$2 = 0, $p1$131$3 = 0, $p1$228 = 0, $p1$228$1 = 0;
+ var $p1$228$2 = 0, $p1$228$3 = 0, $scevgep$sum = 0, $scevgep55 = 0, $scevgep56$sum = 0, $scevgep57 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get32be($s)|0);
+ $1 = ($0|0)==(943870035);
+ if (!($1)) {
+ _stbi__err(14377);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $2 = (_stbi__get16be($s)|0);
+ $3 = ($2|0)==(1);
+ if (!($3)) {
+ _stbi__err(14385);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ _stbi__skip($s,6);
+ $4 = (_stbi__get16be($s)|0);
+ $5 = ($4>>>0)>(16);
+ if ($5) {
+ _stbi__err(14399);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $6 = (_stbi__get32be($s)|0);
+ $7 = (_stbi__get32be($s)|0);
+ $8 = (_stbi__get16be($s)|0);
+ switch ($8|0) {
+ case 8: case 16: {
+ break;
+ }
+ default: {
+ _stbi__err(14419);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $9 = (_stbi__get16be($s)|0);
+ $10 = ($9|0)==(3);
+ if (!($10)) {
+ _stbi__err(14441);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $11 = (_stbi__get32be($s)|0);
+ _stbi__skip($s,$11);
+ $12 = (_stbi__get32be($s)|0);
+ _stbi__skip($s,$12);
+ $13 = (_stbi__get32be($s)|0);
+ _stbi__skip($s,$13);
+ $14 = (_stbi__get16be($s)|0);
+ $15 = ($14|0)>(1);
+ if ($15) {
+ _stbi__err(14234);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $16 = $6 << 2;
+ $17 = Math_imul($16, $7)|0;
+ $18 = (_stbi__malloc($17)|0);
+ $19 = ($18|0)==(0|0);
+ if ($19) {
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $20 = Math_imul($7, $6)|0;
+ $21 = ($14|0)==(0);
+ L29: do {
+ if ($21) {
+ $54 = ($8|0)==(16);
+ $55 = ($20|0)>(0);
+ $56 = ($20|0)>(0);
+ $57 = ($20|0)>(0);
+ $58 = Math_imul($7, $6)|0;
+ $59 = ($4|0)>(0);
+ do {
+ if ($59) {
+ if ($54) {
+ if ($55) {
+ $i$232 = 0;$p1$131 = $18;
+ } else {
+ break;
+ }
+ while(1) {
+ $62 = (_stbi__get16be($s)|0);
+ $63 = $62 >>> 8;
+ $64 = $63&255;
+ HEAP8[$p1$131>>0] = $64;
+ $65 = (($i$232) + 1)|0;
+ $66 = ((($p1$131)) + 4|0);
+ $exitcond51 = ($65|0)==($58|0);
+ if ($exitcond51) {
+ break;
+ } else {
+ $i$232 = $65;$p1$131 = $66;
+ }
+ }
+ } else {
+ if ($56) {
+ $i$329 = 0;$p1$228 = $18;
+ } else {
+ break;
+ }
+ while(1) {
+ $67 = (_stbi__get8($s)|0);
+ HEAP8[$p1$228>>0] = $67;
+ $68 = (($i$329) + 1)|0;
+ $69 = ((($p1$228)) + 4|0);
+ $exitcond50 = ($68|0)==($58|0);
+ if ($exitcond50) {
+ break;
+ } else {
+ $i$329 = $68;$p1$228 = $69;
+ }
+ }
+ }
+ } else {
+ if ($57) {
+ $i$126 = 0;$p1$025 = $18;
+ } else {
+ break L29;
+ }
+ while(1) {
+ HEAP8[$p1$025>>0] = 0;
+ $60 = (($i$126) + 1)|0;
+ $61 = ((($p1$025)) + 4|0);
+ $exitcond49 = ($60|0)==($58|0);
+ if ($exitcond49) {
+ break;
+ } else {
+ $i$126 = $60;$p1$025 = $61;
+ }
+ }
+ }
+ } while(0);
+ $70 = ((($18)) + 1|0);
+ $71 = ($4|0)>(1);
+ do {
+ if ($71) {
+ if ($54) {
+ if ($55) {
+ $i$232$1 = 0;$p1$131$1 = $70;
+ } else {
+ break;
+ }
+ while(1) {
+ $114 = (_stbi__get16be($s)|0);
+ $115 = $114 >>> 8;
+ $116 = $115&255;
+ HEAP8[$p1$131$1>>0] = $116;
+ $117 = (($i$232$1) + 1)|0;
+ $118 = ((($p1$131$1)) + 4|0);
+ $exitcond51$1 = ($117|0)==($58|0);
+ if ($exitcond51$1) {
+ break;
+ } else {
+ $i$232$1 = $117;$p1$131$1 = $118;
+ }
+ }
+ } else {
+ if ($56) {
+ $i$329$1 = 0;$p1$228$1 = $70;
+ } else {
+ break;
+ }
+ while(1) {
+ $111 = (_stbi__get8($s)|0);
+ HEAP8[$p1$228$1>>0] = $111;
+ $112 = (($i$329$1) + 1)|0;
+ $113 = ((($p1$228$1)) + 4|0);
+ $exitcond50$1 = ($112|0)==($58|0);
+ if ($exitcond50$1) {
+ break;
+ } else {
+ $i$329$1 = $112;$p1$228$1 = $113;
+ }
+ }
+ }
+ } else {
+ if ($57) {
+ $i$126$1 = 0;$p1$025$1 = $70;
+ } else {
+ break L29;
+ }
+ while(1) {
+ HEAP8[$p1$025$1>>0] = 0;
+ $109 = (($i$126$1) + 1)|0;
+ $110 = ((($p1$025$1)) + 4|0);
+ $exitcond49$1 = ($109|0)==($58|0);
+ if ($exitcond49$1) {
+ break;
+ } else {
+ $i$126$1 = $109;$p1$025$1 = $110;
+ }
+ }
+ }
+ } while(0);
+ $119 = ((($18)) + 2|0);
+ $120 = ($4|0)>(2);
+ do {
+ if ($120) {
+ if ($54) {
+ if ($55) {
+ $i$232$2 = 0;$p1$131$2 = $119;
+ } else {
+ break;
+ }
+ while(1) {
+ $126 = (_stbi__get16be($s)|0);
+ $127 = $126 >>> 8;
+ $128 = $127&255;
+ HEAP8[$p1$131$2>>0] = $128;
+ $129 = (($i$232$2) + 1)|0;
+ $130 = ((($p1$131$2)) + 4|0);
+ $exitcond51$2 = ($129|0)==($58|0);
+ if ($exitcond51$2) {
+ break;
+ } else {
+ $i$232$2 = $129;$p1$131$2 = $130;
+ }
+ }
+ } else {
+ if ($56) {
+ $i$329$2 = 0;$p1$228$2 = $119;
+ } else {
+ break;
+ }
+ while(1) {
+ $123 = (_stbi__get8($s)|0);
+ HEAP8[$p1$228$2>>0] = $123;
+ $124 = (($i$329$2) + 1)|0;
+ $125 = ((($p1$228$2)) + 4|0);
+ $exitcond50$2 = ($124|0)==($58|0);
+ if ($exitcond50$2) {
+ break;
+ } else {
+ $i$329$2 = $124;$p1$228$2 = $125;
+ }
+ }
+ }
+ } else {
+ if ($57) {
+ $i$126$2 = 0;$p1$025$2 = $119;
+ } else {
+ break L29;
+ }
+ while(1) {
+ HEAP8[$p1$025$2>>0] = 0;
+ $121 = (($i$126$2) + 1)|0;
+ $122 = ((($p1$025$2)) + 4|0);
+ $exitcond49$2 = ($121|0)==($58|0);
+ if ($exitcond49$2) {
+ break;
+ } else {
+ $i$126$2 = $121;$p1$025$2 = $122;
+ }
+ }
+ }
+ } while(0);
+ $131 = ((($18)) + 3|0);
+ $132 = ($4|0)>(3);
+ if (!($132)) {
+ if ($57) {
+ $i$126$3 = 0;$p1$025$3 = $131;
+ } else {
+ break;
+ }
+ while(1) {
+ HEAP8[$p1$025$3>>0] = -1;
+ $133 = (($i$126$3) + 1)|0;
+ $134 = ((($p1$025$3)) + 4|0);
+ $exitcond49$3 = ($133|0)==($58|0);
+ if ($exitcond49$3) {
+ label = 43;
+ break L29;
+ } else {
+ $i$126$3 = $133;$p1$025$3 = $134;
+ }
+ }
+ }
+ if ($54) {
+ if ($55) {
+ $i$232$3 = 0;$p1$131$3 = $131;
+ } else {
+ break;
+ }
+ while(1) {
+ $138 = (_stbi__get16be($s)|0);
+ $139 = $138 >>> 8;
+ $140 = $139&255;
+ HEAP8[$p1$131$3>>0] = $140;
+ $141 = (($i$232$3) + 1)|0;
+ $142 = ((($p1$131$3)) + 4|0);
+ $exitcond51$3 = ($141|0)==($58|0);
+ if ($exitcond51$3) {
+ label = 43;
+ break;
+ } else {
+ $i$232$3 = $141;$p1$131$3 = $142;
+ }
+ }
+ } else {
+ if ($56) {
+ $i$329$3 = 0;$p1$228$3 = $131;
+ } else {
+ break;
+ }
+ while(1) {
+ $135 = (_stbi__get8($s)|0);
+ HEAP8[$p1$228$3>>0] = $135;
+ $136 = (($i$329$3) + 1)|0;
+ $137 = ((($p1$228$3)) + 4|0);
+ $exitcond50$3 = ($136|0)==($58|0);
+ if ($exitcond50$3) {
+ label = 43;
+ break;
+ } else {
+ $i$329$3 = $136;$p1$228$3 = $137;
+ }
+ }
+ }
+ } else {
+ $22 = $4 << 1;
+ $23 = Math_imul($22, $6)|0;
+ _stbi__skip($s,$23);
+ $24 = ($20|0)>(0);
+ $25 = ($20|0)>(0);
+ $26 = Math_imul($7, $6)|0;
+ $channel$046 = 0;
+ while(1) {
+ $27 = (($18) + ($channel$046)|0);
+ $28 = ($channel$046|0)<($4|0);
+ if ($28) {
+ if ($24) {
+ $count$0$ph45 = 0;$p$1$ph44 = $27;
+ while(1) {
+ while(1) {
+ $36 = (_stbi__get8($s)|0);
+ $37 = ($36<<24>>24)==(-128);
+ if (!($37)) {
+ $$lcssa = $36;
+ break;
+ }
+ }
+ $38 = $$lcssa&255;
+ $39 = ($$lcssa<<24>>24)>(-1);
+ if ($39) {
+ $40 = (($38) + 1)|0;
+ $41 = $$lcssa&255;
+ $33 = $41 << 2;
+ $len$043 = $40;$p$242 = $p$1$ph44;
+ while(1) {
+ $42 = (_stbi__get8($s)|0);
+ HEAP8[$p$242>>0] = $42;
+ $43 = ((($p$242)) + 4|0);
+ $44 = (($len$043) + -1)|0;
+ $45 = ($44|0)==(0);
+ if ($45) {
+ break;
+ } else {
+ $len$043 = $44;$p$242 = $43;
+ }
+ }
+ $scevgep56$sum = (($33) + 4)|0;
+ $scevgep57 = (($p$1$ph44) + ($scevgep56$sum)|0);
+ $$pn = $40;$p$1$ph$be = $scevgep57;
+ } else {
+ $46 = (257 - ($38))|0;
+ $47 = (_stbi__get8($s)|0);
+ $48 = ($46|0)==(0);
+ if ($48) {
+ $$pn = 0;$p$1$ph$be = $p$1$ph44;
+ } else {
+ $49 = $$lcssa&255;
+ $35 = Math_imul($49, -4)|0;
+ $len$140 = $46;$p$339 = $p$1$ph44;
+ while(1) {
+ HEAP8[$p$339>>0] = $47;
+ $50 = ((($p$339)) + 4|0);
+ $51 = (($len$140) + -1)|0;
+ $52 = ($51|0)==(0);
+ if ($52) {
+ break;
+ } else {
+ $len$140 = $51;$p$339 = $50;
+ }
+ }
+ $scevgep$sum = (($35) + 1028)|0;
+ $scevgep55 = (($p$1$ph44) + ($scevgep$sum)|0);
+ $$pn = $46;$p$1$ph$be = $scevgep55;
+ }
+ }
+ $count$0$ph$be = (($$pn) + ($count$0$ph45))|0;
+ $34 = ($count$0$ph$be|0)<($20|0);
+ if ($34) {
+ $count$0$ph45 = $count$0$ph$be;$p$1$ph44 = $p$1$ph$be;
+ } else {
+ break;
+ }
+ }
+ }
+ } else {
+ if ($25) {
+ $29 = ($channel$046|0)==(3);
+ $30 = $29 << 31 >> 31;
+ $i$036 = 0;$p$035 = $27;
+ while(1) {
+ HEAP8[$p$035>>0] = $30;
+ $31 = (($i$036) + 1)|0;
+ $32 = ((($p$035)) + 4|0);
+ $exitcond54 = ($31|0)==($26|0);
+ if ($exitcond54) {
+ break;
+ } else {
+ $i$036 = $31;$p$035 = $32;
+ }
+ }
+ }
+ }
+ $53 = (($channel$046) + 1)|0;
+ $exitcond58 = ($53|0)==(4);
+ if ($exitcond58) {
+ label = 43;
+ break;
+ } else {
+ $channel$046 = $53;
+ }
+ }
+ }
+ } while(0);
+ L108: do {
+ if ((label|0) == 43) {
+ $72 = ($4|0)>(3);
+ $73 = ($20|0)>(0);
+ $or$cond = $72 & $73;
+ if ($or$cond) {
+ $74 = Math_imul($7, $6)|0;
+ $i$424 = 0;
+ while(1) {
+ $75 = $i$424 << 2;
+ $76 = (($18) + ($75)|0);
+ $$sum6 = $75 | 3;
+ $77 = (($18) + ($$sum6)|0);
+ $78 = HEAP8[$77>>0]|0;
+ switch ($78<<24>>24) {
+ case -1: case 0: {
+ break;
+ }
+ default: {
+ $79 = $78&255;
+ $80 = (+($79|0));
+ $81 = $80 / 255.0;
+ $82 = 1.0 / $81;
+ $83 = 1.0 - $82;
+ $84 = $83 * 255.0;
+ $85 = HEAP8[$76>>0]|0;
+ $86 = $85&255;
+ $87 = (+($86|0));
+ $88 = $82 * $87;
+ $89 = $84 + $88;
+ $90 = (~~(($89))&255);
+ HEAP8[$76>>0] = $90;
+ $$sum7 = $75 | 1;
+ $91 = (($18) + ($$sum7)|0);
+ $92 = HEAP8[$91>>0]|0;
+ $93 = $92&255;
+ $94 = (+($93|0));
+ $95 = $82 * $94;
+ $96 = $84 + $95;
+ $97 = (~~(($96))&255);
+ HEAP8[$91>>0] = $97;
+ $$sum8 = $75 | 2;
+ $98 = (($18) + ($$sum8)|0);
+ $99 = HEAP8[$98>>0]|0;
+ $100 = $99&255;
+ $101 = (+($100|0));
+ $102 = $82 * $101;
+ $103 = $84 + $102;
+ $104 = (~~(($103))&255);
+ HEAP8[$98>>0] = $104;
+ }
+ }
+ $105 = (($i$424) + 1)|0;
+ $exitcond = ($105|0)==($74|0);
+ if ($exitcond) {
+ break L108;
+ } else {
+ $i$424 = $105;
+ }
+ }
+ }
+ }
+ } while(0);
+ switch ($req_comp|0) {
+ case 0: case 4: {
+ $out$0 = $18;
+ break;
+ }
+ default: {
+ $106 = (_stbi__convert_format($18,4,$req_comp,$7,$6)|0);
+ $107 = ($106|0)==(0|0);
+ if ($107) {
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ $out$0 = $106;
+ }
+ }
+ }
+ $108 = ($comp|0)==(0|0);
+ if (!($108)) {
+ HEAP32[$comp>>2] = 4;
+ }
+ HEAP32[$y>>2] = $6;
+ HEAP32[$x>>2] = $7;
+ $$0 = $out$0;
+ return ($$0|0);
+}
+function _stbi__pic_test($s) {
+ $s = $s|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__pic_test_core($s)|0);
+ _stbi__rewind($s);
+ return ($0|0);
+}
+function _stbi__pic_load($s,$px,$py,$comp,$req_comp) {
+ $s = $s|0;
+ $px = $px|0;
+ $py = $py|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $result$0 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $i$02 = 0;
+ while(1) {
+ (_stbi__get8($s)|0);
+ $0 = (($i$02) + 1)|0;
+ $exitcond = ($0|0)==(92);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$02 = $0;
+ }
+ }
+ $1 = (_stbi__get16be($s)|0);
+ $2 = (_stbi__get16be($s)|0);
+ $3 = (_stbi__at_eof($s)|0);
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ _stbi__err(14363);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $5 = (268435456 / ($1|0))&-1;
+ $6 = ($5|0)<($2|0);
+ if ($6) {
+ _stbi__err(12689);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ (_stbi__get32be($s)|0);
+ (_stbi__get16be($s)|0);
+ (_stbi__get16be($s)|0);
+ $7 = $1 << 2;
+ $8 = Math_imul($7, $2)|0;
+ $9 = (_stbi__malloc($8)|0);
+ _memset(($9|0),-1,($8|0))|0;
+ $10 = (_stbi__pic_load_core($s,$1,$2,$comp,$9)|0);
+ $11 = ($10|0)==(0|0);
+ if ($11) {
+ _free($9);
+ $result$0 = 0;
+ } else {
+ $result$0 = $9;
+ }
+ HEAP32[$px>>2] = $1;
+ HEAP32[$py>>2] = $2;
+ $12 = ($req_comp|0)==(0);
+ if ($12) {
+ $13 = HEAP32[$comp>>2]|0;
+ $$01 = $13;
+ } else {
+ $$01 = $req_comp;
+ }
+ $14 = (_stbi__convert_format($result$0,4,$$01,$1,$2)|0);
+ $$0 = $14;
+ return ($$0|0);
+}
+function _stbi__pnm_test($s) {
+ $s = $s|0;
+ var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = (_stbi__get8($s)|0);
+ $2 = ($0<<24>>24)==(80);
+ $$off = (($1) + -53)<<24>>24;
+ $switch = ($$off&255)<(2);
+ $or$cond = $2 & $switch;
+ if ($or$cond) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ _stbi__rewind($s);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__pnm_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0;
+ var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($s)) + 4|0);
+ $1 = ((($s)) + 8|0);
+ $2 = (_stbi__pnm_info($s,$s,$0,$1)|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $4 = HEAP32[$s>>2]|0;
+ HEAP32[$x>>2] = $4;
+ $5 = HEAP32[$0>>2]|0;
+ HEAP32[$y>>2] = $5;
+ $6 = HEAP32[$1>>2]|0;
+ HEAP32[$comp>>2] = $6;
+ $7 = HEAP32[$1>>2]|0;
+ $8 = HEAP32[$s>>2]|0;
+ $9 = Math_imul($8, $7)|0;
+ $10 = HEAP32[$0>>2]|0;
+ $11 = Math_imul($9, $10)|0;
+ $12 = (_stbi__malloc($11)|0);
+ $13 = ($12|0)==(0|0);
+ if ($13) {
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $14 = HEAP32[$1>>2]|0;
+ $15 = HEAP32[$s>>2]|0;
+ $16 = Math_imul($15, $14)|0;
+ $17 = HEAP32[$0>>2]|0;
+ $18 = Math_imul($16, $17)|0;
+ (_stbi__getn($s,$12,$18)|0);
+ $19 = ($req_comp|0)==(0);
+ if ($19) {
+ $$0 = $12;
+ return ($$0|0);
+ }
+ $20 = HEAP32[$1>>2]|0;
+ $21 = ($20|0)==($req_comp|0);
+ if ($21) {
+ $$0 = $12;
+ return ($$0|0);
+ } else {
+ $22 = HEAP32[$s>>2]|0;
+ $23 = HEAP32[$0>>2]|0;
+ $24 = (_stbi__convert_format($12,$20,$req_comp,$22,$23)|0);
+ return ($24|0);
+ }
+ return (0)|0;
+}
+function _stbi__tga_test($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $res$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ (_stbi__get8($s)|0);
+ $0 = (_stbi__get8($s)|0);
+ $1 = ($0&255)>(1);
+ L1: do {
+ if ($1) {
+ $res$0 = 0;
+ } else {
+ $2 = (_stbi__get8($s)|0);
+ $3 = ($0<<24>>24)==(1);
+ if ($3) {
+ switch ($2<<24>>24) {
+ case 1: case 9: {
+ break;
+ }
+ default: {
+ $res$0 = 0;
+ break L1;
+ }
+ }
+ _stbi__skip($s,4);
+ $4 = (_stbi__get8($s)|0);
+ switch ($4<<24>>24) {
+ case 8: case 15: case 16: case 24: case 32: {
+ break;
+ }
+ default: {
+ $res$0 = 0;
+ break L1;
+ }
+ }
+ _stbi__skip($s,4);
+ } else {
+ switch ($2<<24>>24) {
+ case 2: case 3: case 10: case 11: {
+ break;
+ }
+ default: {
+ $res$0 = 0;
+ break L1;
+ }
+ }
+ _stbi__skip($s,9);
+ }
+ $5 = (_stbi__get16le($s)|0);
+ $6 = ($5|0)<(1);
+ if ($6) {
+ $res$0 = 0;
+ } else {
+ $7 = (_stbi__get16le($s)|0);
+ $8 = ($7|0)<(1);
+ if ($8) {
+ $res$0 = 0;
+ } else {
+ $9 = (_stbi__get8($s)|0);
+ if ($3) {
+ switch ($9<<24>>24) {
+ case 8: case 16: {
+ break;
+ }
+ default: {
+ $res$0 = 0;
+ break L1;
+ }
+ }
+ } else {
+ switch ($9<<24>>24) {
+ case 8: case 15: case 16: case 24: case 32: {
+ break;
+ }
+ default: {
+ $res$0 = 0;
+ break L1;
+ }
+ }
+ }
+ $res$0 = 1;
+ }
+ }
+ }
+ } while(0);
+ _stbi__rewind($s);
+ return ($res$0|0);
+}
+function _stbi__tga_load($s,$x,$y,$comp,$req_comp) {
+ $s = $s|0;
+ $x = $x|0;
+ $y = $y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$ = 0, $$0 = 0, $$6 = 0, $$7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
+ var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
+ var $97 = 0, $98 = 0, $99 = 0, $RLE_count$039 = 0, $RLE_count$18 = 0, $RLE_count$19 = 0, $RLE_repeating$040 = 0, $RLE_repeating$110 = 0, $RLE_repeating$111 = 0, $exitcond = 0, $exitcond50 = 0, $exitcond55 = 0, $exitcond56 = 0, $i$048 = 0, $i$145 = 0, $i$238 = 0, $i$323 = 0, $i$421 = 0, $index1$024 = 0, $index2$025 = 0;
+ var $j$129 = 0, $j$327 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond5$not = 0, $or$cond57 = 0, $or$cond59 = 0, $pal_entry$046 = 0, $raw_data = 0, $read_next_pixel$041 = 0, $scevgep = 0, $scevgep54 = 0, $tga_comp$0 = 0, $tga_palette$0 = 0, $tga_pixel$022 = 0, $tga_rgb16 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $tga_rgb16 = sp;
+ $raw_data = sp + 4|0;
+ $0 = (_stbi__get8($s)|0);
+ $1 = $0&255;
+ $2 = (_stbi__get8($s)|0);
+ $3 = (_stbi__get8($s)|0);
+ $4 = $3&255;
+ $5 = (_stbi__get16le($s)|0);
+ $6 = (_stbi__get16le($s)|0);
+ $7 = (_stbi__get8($s)|0);
+ (_stbi__get16le($s)|0);
+ (_stbi__get16le($s)|0);
+ $8 = (_stbi__get16le($s)|0);
+ $9 = (_stbi__get16le($s)|0);
+ $10 = (_stbi__get8($s)|0);
+ HEAP32[$tga_rgb16>>2] = 0;
+ $11 = (_stbi__get8($s)|0);
+ $12 = $11&255;
+ $13 = ($3&255)>(7);
+ $$6 = $13&1;
+ $14 = $12 >>> 5;
+ $15 = $14 & 1;
+ $16 = ($2<<24>>24)!=(0);
+ if ($16) {
+ $17 = $7&255;
+ $18 = (_stbi__tga_get_comp($17,0,$tga_rgb16)|0);
+ $tga_comp$0 = $18;
+ } else {
+ $19 = (($4) + -8)|0;
+ $$7 = $13 ? $19 : $4;
+ $20 = $10&255;
+ $21 = ($$7|0)==(3);
+ $22 = $21&1;
+ $23 = (_stbi__tga_get_comp($20,$22,$tga_rgb16)|0);
+ $tga_comp$0 = $23;
+ }
+ $24 = ($tga_comp$0|0)==(0);
+ if ($24) {
+ _stbi__err(14250);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ HEAP32[$x>>2] = $8;
+ HEAP32[$y>>2] = $9;
+ $25 = ($comp|0)==(0|0);
+ if (!($25)) {
+ HEAP32[$comp>>2] = $tga_comp$0;
+ }
+ $26 = Math_imul($9, $8)|0;
+ $27 = Math_imul($26, $tga_comp$0)|0;
+ $28 = (_stbi__malloc($27)|0);
+ $29 = ($28|0)==(0|0);
+ if ($29) {
+ _stbi__err(12905);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ _stbi__skip($s,$1);
+ $30 = HEAP32[$tga_rgb16>>2]|0;
+ $31 = $30 | $$6;
+ $32 = ($31|0)!=(0);
+ $33 = $16 | $32;
+ if ($33) {
+ do {
+ if ($16) {
+ _stbi__skip($s,$5);
+ $44 = Math_imul($tga_comp$0, $6)|0;
+ $45 = (_stbi__malloc($44)|0);
+ $46 = ($45|0)==(0|0);
+ if ($46) {
+ _free($28);
+ _stbi__err(12905);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $47 = HEAP32[$tga_rgb16>>2]|0;
+ $48 = ($47|0)==(0);
+ if ($48) {
+ $53 = (_stbi__getn($s,$45,$44)|0);
+ $54 = ($53|0)==(0);
+ if (!($54)) {
+ $tga_palette$0 = $45;
+ break;
+ }
+ _free($28);
+ _free($45);
+ _stbi__err(14297);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $49 = ($tga_comp$0|0)==(3);
+ if (!($49)) {
+ ___assert_fail((14261|0),(12975|0),5180,(14282|0));
+ // unreachable;
+ }
+ $50 = ($6|0)>(0);
+ if ($50) {
+ $i$145 = 0;$pal_entry$046 = $45;
+ while(1) {
+ _stbi__tga_read_rgb16($s,$pal_entry$046);
+ $51 = (($pal_entry$046) + ($tga_comp$0)|0);
+ $52 = (($i$145) + 1)|0;
+ $exitcond55 = ($52|0)==($6|0);
+ if ($exitcond55) {
+ $tga_palette$0 = $45;
+ break;
+ } else {
+ $i$145 = $52;$pal_entry$046 = $51;
+ }
+ }
+ } else {
+ $tga_palette$0 = $45;
+ }
+ } else {
+ $tga_palette$0 = 0;
+ }
+ } while(0);
+ $55 = Math_imul($9, $8)|0;
+ $56 = ($55|0)>(0);
+ L35: do {
+ if ($56) {
+ $57 = ($10<<24>>24)==(8);
+ $58 = ($tga_comp$0|0)>(0);
+ $59 = ($tga_comp$0|0)==(3);
+ $60 = ($tga_comp$0|0)>(0);
+ $61 = ($tga_comp$0|0)>(0);
+ $RLE_count$039 = 0;$RLE_repeating$040 = 0;$i$238 = 0;$read_next_pixel$041 = 1;
+ L37: while(1) {
+ $62 = Math_imul($tga_comp$0, $i$238)|0;
+ $scevgep54 = (($28) + ($62)|0);
+ do {
+ if ($13) {
+ $63 = ($RLE_count$039|0)==(0);
+ if ($63) {
+ $64 = (_stbi__get8($s)|0);
+ $65 = $64&255;
+ $66 = $65 & 127;
+ $67 = (($66) + 1)|0;
+ $68 = $65 >>> 7;
+ $RLE_count$18 = $67;$RLE_repeating$110 = $68;
+ label = 31;
+ break;
+ }
+ $69 = ($RLE_repeating$040|0)==(0);
+ if ($69) {
+ $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = 0;
+ label = 31;
+ } else {
+ $70 = ($read_next_pixel$041|0)==(0);
+ if ($70) {
+ $RLE_count$19 = $RLE_count$039;$RLE_repeating$111 = $RLE_repeating$040;
+ } else {
+ $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040;
+ label = 31;
+ }
+ }
+ } else {
+ $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040;
+ label = 31;
+ }
+ } while(0);
+ do {
+ if ((label|0) == 31) {
+ label = 0;
+ if ($16) {
+ if ($57) {
+ $71 = (_stbi__get8($s)|0);
+ $72 = $71&255;
+ $79 = $72;
+ } else {
+ $73 = (_stbi__get16le($s)|0);
+ $79 = $73;
+ }
+ if (!($58)) {
+ $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
+ break;
+ }
+ $80 = ($79|0)>=($6|0);
+ $$ = $80 ? 0 : $79;
+ $81 = Math_imul($tga_comp$0, $$)|0;
+ $scevgep = (($tga_palette$0) + ($81)|0);
+ _memcpy(($raw_data|0),($scevgep|0),($tga_comp$0|0))|0;
+ $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
+ break;
+ } else {
+ $74 = HEAP32[$tga_rgb16>>2]|0;
+ $75 = ($74|0)==(0);
+ if ($75) {
+ if ($60) {
+ $j$129 = 0;
+ } else {
+ $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
+ break;
+ }
+ while(1) {
+ $76 = (_stbi__get8($s)|0);
+ $77 = (($raw_data) + ($j$129)|0);
+ HEAP8[$77>>0] = $76;
+ $78 = (($j$129) + 1)|0;
+ $exitcond50 = ($78|0)==($tga_comp$0|0);
+ if ($exitcond50) {
+ $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
+ break;
+ } else {
+ $j$129 = $78;
+ }
+ }
+ } else {
+ if (!($59)) {
+ break L37;
+ }
+ _stbi__tga_read_rgb16($s,$raw_data);
+ $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110;
+ break;
+ }
+ }
+ }
+ } while(0);
+ if ($61) {
+ _memcpy(($scevgep54|0),($raw_data|0),($tga_comp$0|0))|0;
+ }
+ $82 = (($RLE_count$19) + -1)|0;
+ $83 = (($i$238) + 1)|0;
+ $84 = ($83|0)<($55|0);
+ if ($84) {
+ $RLE_count$039 = $82;$RLE_repeating$040 = $RLE_repeating$111;$i$238 = $83;$read_next_pixel$041 = 0;
+ } else {
+ break L35;
+ }
+ }
+ ___assert_fail((14261|0),(12975|0),5229,(14282|0));
+ // unreachable;
+ }
+ } while(0);
+ $85 = ($15|0)==(0);
+ $86 = ($9|0)>(0);
+ $or$cond57 = $85 & $86;
+ if ($or$cond57) {
+ $87 = Math_imul($tga_comp$0, $8)|0;
+ $88 = (($9) + -1)|0;
+ $89 = Math_imul($tga_comp$0, $8)|0;
+ $90 = Math_imul($tga_comp$0, $8)|0;
+ $91 = ($90|0)>(0);
+ $j$327 = 0;
+ while(1) {
+ if ($91) {
+ $92 = (($88) - ($j$327))|0;
+ $93 = Math_imul($89, $92)|0;
+ $94 = Math_imul($87, $j$327)|0;
+ $i$323 = $90;$index1$024 = $94;$index2$025 = $93;
+ while(1) {
+ $95 = (($28) + ($index1$024)|0);
+ $96 = HEAP8[$95>>0]|0;
+ $97 = (($28) + ($index2$025)|0);
+ $98 = HEAP8[$97>>0]|0;
+ HEAP8[$95>>0] = $98;
+ HEAP8[$97>>0] = $96;
+ $99 = (($index1$024) + 1)|0;
+ $100 = (($index2$025) + 1)|0;
+ $101 = (($i$323) + -1)|0;
+ $102 = ($i$323|0)>(1);
+ if ($102) {
+ $i$323 = $101;$index1$024 = $99;$index2$025 = $100;
+ } else {
+ break;
+ }
+ }
+ }
+ $103 = (($j$327) + 1)|0;
+ $104 = $103 << 1;
+ $105 = ($104|0)<($9|0);
+ if ($105) {
+ $j$327 = $103;
+ } else {
+ break;
+ }
+ }
+ }
+ $106 = ($tga_palette$0|0)==(0|0);
+ if (!($106)) {
+ _free($tga_palette$0);
+ }
+ } else {
+ $34 = ($9|0)>(0);
+ if ($34) {
+ $35 = ($15|0)==(0);
+ $36 = (($9) + -1)|0;
+ $37 = Math_imul($tga_comp$0, $8)|0;
+ $38 = Math_imul($tga_comp$0, $8)|0;
+ $i$048 = 0;
+ while(1) {
+ $39 = (($36) - ($i$048))|0;
+ $40 = $35 ? $39 : $i$048;
+ $41 = Math_imul($37, $40)|0;
+ $42 = (($28) + ($41)|0);
+ (_stbi__getn($s,$42,$38)|0);
+ $43 = (($i$048) + 1)|0;
+ $exitcond56 = ($43|0)==($9|0);
+ if ($exitcond56) {
+ break;
+ } else {
+ $i$048 = $43;
+ }
+ }
+ }
+ }
+ $107 = HEAP32[$tga_rgb16>>2]|0;
+ $notlhs = ($tga_comp$0|0)>(2);
+ $notrhs = ($107|0)==(0);
+ $or$cond5$not = $notrhs & $notlhs;
+ $108 = Math_imul($9, $8)|0;
+ $109 = ($108|0)>(0);
+ $or$cond59 = $or$cond5$not & $109;
+ if ($or$cond59) {
+ $110 = Math_imul($9, $8)|0;
+ $i$421 = 0;$tga_pixel$022 = $28;
+ while(1) {
+ $111 = HEAP8[$tga_pixel$022>>0]|0;
+ $112 = ((($tga_pixel$022)) + 2|0);
+ $113 = HEAP8[$112>>0]|0;
+ HEAP8[$tga_pixel$022>>0] = $113;
+ HEAP8[$112>>0] = $111;
+ $114 = (($tga_pixel$022) + ($tga_comp$0)|0);
+ $115 = (($i$421) + 1)|0;
+ $exitcond = ($115|0)==($110|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$421 = $115;$tga_pixel$022 = $114;
+ }
+ }
+ }
+ $116 = ($req_comp|0)==(0);
+ $117 = ($tga_comp$0|0)==($req_comp|0);
+ $or$cond = $116 | $117;
+ if ($or$cond) {
+ $$0 = $28;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $118 = (_stbi__convert_format($28,$tga_comp$0,$req_comp,$8,$9)|0);
+ $$0 = $118;
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__convert_format($data,$img_n,$req_comp,$x,$y) {
+ $data = $data|0;
+ $img_n = $img_n|0;
+ $req_comp = $req_comp|0;
+ $x = $x|0;
+ $y = $y|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
+ var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
+ var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
+ var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dest$081 = 0;
+ var $dest$1031 = 0, $dest$1127 = 0, $dest$176 = 0, $dest$271 = 0, $dest$366 = 0, $dest$461 = 0, $dest$556 = 0, $dest$651 = 0, $dest$746 = 0, $dest$841 = 0, $dest$936 = 0, $i$0 = 0, $i$079 = 0, $i$082 = 0, $i$1 = 0, $i$10 = 0, $i$1029 = 0, $i$1032 = 0, $i$11 = 0, $i$1125 = 0;
+ var $i$1128 = 0, $i$174 = 0, $i$177 = 0, $i$2 = 0, $i$269 = 0, $i$272 = 0, $i$3 = 0, $i$364 = 0, $i$367 = 0, $i$4 = 0, $i$459 = 0, $i$462 = 0, $i$5 = 0, $i$554 = 0, $i$557 = 0, $i$6 = 0, $i$649 = 0, $i$652 = 0, $i$7 = 0, $i$744 = 0;
+ var $i$747 = 0, $i$8 = 0, $i$839 = 0, $i$842 = 0, $i$9 = 0, $i$934 = 0, $i$937 = 0, $j$084 = 0, $req_comp$off = 0, $src$080 = 0, $src$1030 = 0, $src$1126 = 0, $src$175 = 0, $src$270 = 0, $src$365 = 0, $src$460 = 0, $src$555 = 0, $src$650 = 0, $src$745 = 0, $src$840 = 0;
+ var $src$935 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($req_comp|0)==($img_n|0);
+ if ($0) {
+ $$0 = $data;
+ return ($$0|0);
+ }
+ $req_comp$off = (($req_comp) + -1)|0;
+ $1 = ($req_comp$off>>>0)<(4);
+ if (!($1)) {
+ ___assert_fail((14309|0),(12975|0),1355,(14340|0));
+ // unreachable;
+ }
+ $2 = Math_imul($x, $req_comp)|0;
+ $3 = Math_imul($2, $y)|0;
+ $4 = (_stbi__malloc($3)|0);
+ $5 = ($4|0)==(0|0);
+ if ($5) {
+ _free($data);
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $6 = ($y|0)>(0);
+ L11: do {
+ if ($6) {
+ $7 = $img_n << 3;
+ $8 = (($7) + ($req_comp))|0;
+ $i$079 = (($x) + -1)|0;
+ $9 = ($i$079|0)>(-1);
+ $i$174 = (($x) + -1)|0;
+ $10 = ($i$174|0)>(-1);
+ $i$269 = (($x) + -1)|0;
+ $11 = ($i$269|0)>(-1);
+ $i$364 = (($x) + -1)|0;
+ $12 = ($i$364|0)>(-1);
+ $i$459 = (($x) + -1)|0;
+ $13 = ($i$459|0)>(-1);
+ $i$554 = (($x) + -1)|0;
+ $14 = ($i$554|0)>(-1);
+ $i$649 = (($x) + -1)|0;
+ $15 = ($i$649|0)>(-1);
+ $i$744 = (($x) + -1)|0;
+ $16 = ($i$744|0)>(-1);
+ $i$839 = (($x) + -1)|0;
+ $17 = ($i$839|0)>(-1);
+ $i$934 = (($x) + -1)|0;
+ $18 = ($i$934|0)>(-1);
+ $i$1029 = (($x) + -1)|0;
+ $19 = ($i$1029|0)>(-1);
+ $i$1125 = (($x) + -1)|0;
+ $20 = ($i$1125|0)>(-1);
+ $j$084 = 0;
+ L13: while(1) {
+ $21 = Math_imul($j$084, $x)|0;
+ $22 = Math_imul($21, $img_n)|0;
+ $23 = (($data) + ($22)|0);
+ $24 = Math_imul($21, $req_comp)|0;
+ $25 = (($4) + ($24)|0);
+ do {
+ switch ($8|0) {
+ case 10: {
+ if ($9) {
+ $dest$081 = $25;$i$082 = $i$079;$src$080 = $23;
+ while(1) {
+ $26 = HEAP8[$src$080>>0]|0;
+ HEAP8[$dest$081>>0] = $26;
+ $27 = ((($dest$081)) + 1|0);
+ HEAP8[$27>>0] = -1;
+ $28 = ((($src$080)) + 1|0);
+ $29 = ((($dest$081)) + 2|0);
+ $i$0 = (($i$082) + -1)|0;
+ $30 = ($i$0|0)>(-1);
+ if ($30) {
+ $dest$081 = $29;$i$082 = $i$0;$src$080 = $28;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 11: {
+ if ($10) {
+ $dest$176 = $25;$i$177 = $i$174;$src$175 = $23;
+ while(1) {
+ $31 = HEAP8[$src$175>>0]|0;
+ $32 = ((($dest$176)) + 2|0);
+ HEAP8[$32>>0] = $31;
+ $33 = ((($dest$176)) + 1|0);
+ HEAP8[$33>>0] = $31;
+ HEAP8[$dest$176>>0] = $31;
+ $34 = ((($src$175)) + 1|0);
+ $35 = ((($dest$176)) + 3|0);
+ $i$1 = (($i$177) + -1)|0;
+ $36 = ($i$1|0)>(-1);
+ if ($36) {
+ $dest$176 = $35;$i$177 = $i$1;$src$175 = $34;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 12: {
+ if ($11) {
+ $dest$271 = $25;$i$272 = $i$269;$src$270 = $23;
+ while(1) {
+ $37 = HEAP8[$src$270>>0]|0;
+ $38 = ((($dest$271)) + 2|0);
+ HEAP8[$38>>0] = $37;
+ $39 = ((($dest$271)) + 1|0);
+ HEAP8[$39>>0] = $37;
+ HEAP8[$dest$271>>0] = $37;
+ $40 = ((($dest$271)) + 3|0);
+ HEAP8[$40>>0] = -1;
+ $41 = ((($src$270)) + 1|0);
+ $42 = ((($dest$271)) + 4|0);
+ $i$2 = (($i$272) + -1)|0;
+ $43 = ($i$2|0)>(-1);
+ if ($43) {
+ $dest$271 = $42;$i$272 = $i$2;$src$270 = $41;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 17: {
+ if ($12) {
+ $dest$366 = $25;$i$367 = $i$364;$src$365 = $23;
+ while(1) {
+ $44 = HEAP8[$src$365>>0]|0;
+ HEAP8[$dest$366>>0] = $44;
+ $45 = ((($src$365)) + 2|0);
+ $46 = ((($dest$366)) + 1|0);
+ $i$3 = (($i$367) + -1)|0;
+ $47 = ($i$3|0)>(-1);
+ if ($47) {
+ $dest$366 = $46;$i$367 = $i$3;$src$365 = $45;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 19: {
+ if ($13) {
+ $dest$461 = $25;$i$462 = $i$459;$src$460 = $23;
+ while(1) {
+ $48 = HEAP8[$src$460>>0]|0;
+ $49 = ((($dest$461)) + 2|0);
+ HEAP8[$49>>0] = $48;
+ $50 = ((($dest$461)) + 1|0);
+ HEAP8[$50>>0] = $48;
+ HEAP8[$dest$461>>0] = $48;
+ $51 = ((($src$460)) + 2|0);
+ $52 = ((($dest$461)) + 3|0);
+ $i$4 = (($i$462) + -1)|0;
+ $53 = ($i$4|0)>(-1);
+ if ($53) {
+ $dest$461 = $52;$i$462 = $i$4;$src$460 = $51;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 20: {
+ if ($14) {
+ $dest$556 = $25;$i$557 = $i$554;$src$555 = $23;
+ while(1) {
+ $54 = HEAP8[$src$555>>0]|0;
+ $55 = ((($dest$556)) + 2|0);
+ HEAP8[$55>>0] = $54;
+ $56 = ((($dest$556)) + 1|0);
+ HEAP8[$56>>0] = $54;
+ HEAP8[$dest$556>>0] = $54;
+ $57 = ((($src$555)) + 1|0);
+ $58 = HEAP8[$57>>0]|0;
+ $59 = ((($dest$556)) + 3|0);
+ HEAP8[$59>>0] = $58;
+ $60 = ((($src$555)) + 2|0);
+ $61 = ((($dest$556)) + 4|0);
+ $i$5 = (($i$557) + -1)|0;
+ $62 = ($i$5|0)>(-1);
+ if ($62) {
+ $dest$556 = $61;$i$557 = $i$5;$src$555 = $60;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 28: {
+ if ($15) {
+ $dest$651 = $25;$i$652 = $i$649;$src$650 = $23;
+ while(1) {
+ $63 = HEAP8[$src$650>>0]|0;
+ HEAP8[$dest$651>>0] = $63;
+ $64 = ((($src$650)) + 1|0);
+ $65 = HEAP8[$64>>0]|0;
+ $66 = ((($dest$651)) + 1|0);
+ HEAP8[$66>>0] = $65;
+ $67 = ((($src$650)) + 2|0);
+ $68 = HEAP8[$67>>0]|0;
+ $69 = ((($dest$651)) + 2|0);
+ HEAP8[$69>>0] = $68;
+ $70 = ((($dest$651)) + 3|0);
+ HEAP8[$70>>0] = -1;
+ $71 = ((($src$650)) + 3|0);
+ $72 = ((($dest$651)) + 4|0);
+ $i$6 = (($i$652) + -1)|0;
+ $73 = ($i$6|0)>(-1);
+ if ($73) {
+ $dest$651 = $72;$i$652 = $i$6;$src$650 = $71;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 25: {
+ if ($16) {
+ $dest$746 = $25;$i$747 = $i$744;$src$745 = $23;
+ while(1) {
+ $74 = HEAP8[$src$745>>0]|0;
+ $75 = $74&255;
+ $76 = ((($src$745)) + 1|0);
+ $77 = HEAP8[$76>>0]|0;
+ $78 = $77&255;
+ $79 = ((($src$745)) + 2|0);
+ $80 = HEAP8[$79>>0]|0;
+ $81 = $80&255;
+ $82 = (_stbi__compute_y($75,$78,$81)|0);
+ HEAP8[$dest$746>>0] = $82;
+ $83 = ((($src$745)) + 3|0);
+ $84 = ((($dest$746)) + 1|0);
+ $i$7 = (($i$747) + -1)|0;
+ $85 = ($i$7|0)>(-1);
+ if ($85) {
+ $dest$746 = $84;$i$747 = $i$7;$src$745 = $83;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 26: {
+ if ($17) {
+ $dest$841 = $25;$i$842 = $i$839;$src$840 = $23;
+ while(1) {
+ $86 = HEAP8[$src$840>>0]|0;
+ $87 = $86&255;
+ $88 = ((($src$840)) + 1|0);
+ $89 = HEAP8[$88>>0]|0;
+ $90 = $89&255;
+ $91 = ((($src$840)) + 2|0);
+ $92 = HEAP8[$91>>0]|0;
+ $93 = $92&255;
+ $94 = (_stbi__compute_y($87,$90,$93)|0);
+ HEAP8[$dest$841>>0] = $94;
+ $95 = ((($dest$841)) + 1|0);
+ HEAP8[$95>>0] = -1;
+ $96 = ((($src$840)) + 3|0);
+ $97 = ((($dest$841)) + 2|0);
+ $i$8 = (($i$842) + -1)|0;
+ $98 = ($i$8|0)>(-1);
+ if ($98) {
+ $dest$841 = $97;$i$842 = $i$8;$src$840 = $96;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 33: {
+ if ($18) {
+ $dest$936 = $25;$i$937 = $i$934;$src$935 = $23;
+ while(1) {
+ $99 = HEAP8[$src$935>>0]|0;
+ $100 = $99&255;
+ $101 = ((($src$935)) + 1|0);
+ $102 = HEAP8[$101>>0]|0;
+ $103 = $102&255;
+ $104 = ((($src$935)) + 2|0);
+ $105 = HEAP8[$104>>0]|0;
+ $106 = $105&255;
+ $107 = (_stbi__compute_y($100,$103,$106)|0);
+ HEAP8[$dest$936>>0] = $107;
+ $108 = ((($src$935)) + 4|0);
+ $109 = ((($dest$936)) + 1|0);
+ $i$9 = (($i$937) + -1)|0;
+ $110 = ($i$9|0)>(-1);
+ if ($110) {
+ $dest$936 = $109;$i$937 = $i$9;$src$935 = $108;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 34: {
+ if ($19) {
+ $dest$1031 = $25;$i$1032 = $i$1029;$src$1030 = $23;
+ while(1) {
+ $111 = HEAP8[$src$1030>>0]|0;
+ $112 = $111&255;
+ $113 = ((($src$1030)) + 1|0);
+ $114 = HEAP8[$113>>0]|0;
+ $115 = $114&255;
+ $116 = ((($src$1030)) + 2|0);
+ $117 = HEAP8[$116>>0]|0;
+ $118 = $117&255;
+ $119 = (_stbi__compute_y($112,$115,$118)|0);
+ HEAP8[$dest$1031>>0] = $119;
+ $120 = ((($src$1030)) + 3|0);
+ $121 = HEAP8[$120>>0]|0;
+ $122 = ((($dest$1031)) + 1|0);
+ HEAP8[$122>>0] = $121;
+ $123 = ((($src$1030)) + 4|0);
+ $124 = ((($dest$1031)) + 2|0);
+ $i$10 = (($i$1032) + -1)|0;
+ $125 = ($i$10|0)>(-1);
+ if ($125) {
+ $dest$1031 = $124;$i$1032 = $i$10;$src$1030 = $123;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 35: {
+ if ($20) {
+ $dest$1127 = $25;$i$1128 = $i$1125;$src$1126 = $23;
+ while(1) {
+ $126 = HEAP8[$src$1126>>0]|0;
+ HEAP8[$dest$1127>>0] = $126;
+ $127 = ((($src$1126)) + 1|0);
+ $128 = HEAP8[$127>>0]|0;
+ $129 = ((($dest$1127)) + 1|0);
+ HEAP8[$129>>0] = $128;
+ $130 = ((($src$1126)) + 2|0);
+ $131 = HEAP8[$130>>0]|0;
+ $132 = ((($dest$1127)) + 2|0);
+ HEAP8[$132>>0] = $131;
+ $133 = ((($src$1126)) + 4|0);
+ $134 = ((($dest$1127)) + 3|0);
+ $i$11 = (($i$1128) + -1)|0;
+ $135 = ($i$11|0)>(-1);
+ if ($135) {
+ $dest$1127 = $134;$i$1128 = $i$11;$src$1126 = $133;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ break L13;
+ }
+ }
+ } while(0);
+ $136 = (($j$084) + 1)|0;
+ $137 = ($136|0)<($y|0);
+ if ($137) {
+ $j$084 = $136;
+ } else {
+ break L11;
+ }
+ }
+ ___assert_fail((14361|0),(12975|0),1384,(14340|0));
+ // unreachable;
+ }
+ } while(0);
+ _free($data);
+ $$0 = $4;
+ return ($$0|0);
+}
+function _stbi__compute_y($r,$g,$b) {
+ $r = $r|0;
+ $g = $g|0;
+ $b = $b|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($r*77)|0;
+ $1 = ($g*150)|0;
+ $2 = (($1) + ($0))|0;
+ $3 = ($b*29)|0;
+ $4 = (($2) + ($3))|0;
+ $5 = $4 >>> 8;
+ $6 = $5&255;
+ return ($6|0);
+}
+function _stbi__pic_load_core($s,$width,$height,$comp,$result) {
+ $s = $s|0;
+ $width = $width|0;
+ $height = $height|0;
+ $comp = $comp|0;
+ $result = $result|0;
+ var $$ = 0, $$0 = 0, $$lcssa108 = 0, $$lcssa111 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
+ var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0;
+ var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
+ var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $act_comp$0 = 0;
+ var $count3$0 = 0, $count3$1 = 0, $dest$038 = 0, $dest$135 = 0, $dest$2$lcssa = 0, $dest$230 = 0, $dest$327 = 0, $dest$425 = 0, $dest$523 = 0, $dest$6 = 0, $exitcond = 0, $exitcond57 = 0, $i$031 = 0, $i4$026 = 0, $i4$124 = 0, $left$036 = 0, $left2$028 = 0, $num_packets$0 = 0, $num_packets$0$lcssa105 = 0, $packet_idx$041 = 0;
+ var $packets = 0, $scevgep = 0, $scevgep56 = 0, $value = 0, $value5 = 0, $x$039 = 0, $y$044 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0;
+ $packets = sp + 8|0;
+ $value = sp + 4|0;
+ $value5 = sp;
+ $act_comp$0 = 0;$num_packets$0 = 0;
+ while(1) {
+ $0 = ($num_packets$0|0)==(10);
+ if ($0) {
+ label = 3;
+ break;
+ }
+ $1 = (($num_packets$0) + 1)|0;
+ $2 = (_stbi__get8($s)|0);
+ $3 = (_stbi__get8($s)|0);
+ $4 = (($packets) + (($num_packets$0*3)|0)|0);
+ HEAP8[$4>>0] = $3;
+ $5 = (_stbi__get8($s)|0);
+ $6 = (((($packets) + (($num_packets$0*3)|0)|0)) + 1|0);
+ HEAP8[$6>>0] = $5;
+ $7 = (_stbi__get8($s)|0);
+ $8 = (((($packets) + (($num_packets$0*3)|0)|0)) + 2|0);
+ HEAP8[$8>>0] = $7;
+ $9 = $7&255;
+ $10 = $9 | $act_comp$0;
+ $11 = (_stbi__at_eof($s)|0);
+ $12 = ($11|0)==(0);
+ if (!($12)) {
+ label = 5;
+ break;
+ }
+ $13 = HEAP8[$4>>0]|0;
+ $14 = ($13<<24>>24)==(8);
+ if (!($14)) {
+ label = 7;
+ break;
+ }
+ $15 = ($2<<24>>24)==(0);
+ if ($15) {
+ $$lcssa108 = $1;$$lcssa111 = $10;$num_packets$0$lcssa105 = $num_packets$0;
+ label = 9;
+ break;
+ } else {
+ $act_comp$0 = $10;$num_packets$0 = $1;
+ }
+ }
+ if ((label|0) == 3) {
+ _stbi__err(14250);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 5) {
+ _stbi__err(14363);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 7) {
+ _stbi__err(14250);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 9) {
+ $16 = $$lcssa111 >>> 4;
+ $17 = $16 & 1;
+ $18 = (($17) + 3)|0;
+ HEAP32[$comp>>2] = $18;
+ $19 = ($height|0)>(0);
+ if (!($19)) {
+ $$0 = $result;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $20 = ($num_packets$0$lcssa105|0)>(-1);
+ $21 = $width << 2;
+ $22 = ($width|0)>(0);
+ $23 = ($width|0)>(0);
+ $24 = ($width|0)>(0);
+ $y$044 = 0;
+ L13: while(1) {
+ L15: do {
+ if ($20) {
+ $25 = Math_imul($21, $y$044)|0;
+ $26 = (($result) + ($25)|0);
+ $packet_idx$041 = 0;
+ while(1) {
+ $27 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 1|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = $28&255;
+ switch ($29|0) {
+ case 0: {
+ if ($22) {
+ $33 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
+ $34 = HEAP8[$33>>0]|0;
+ $35 = $34&255;
+ $dest$038 = $26;$x$039 = 0;
+ while(1) {
+ $36 = (_stbi__readval($s,$35,$dest$038)|0);
+ $37 = ($36|0)==(0|0);
+ if ($37) {
+ $$0 = 0;
+ label = 52;
+ break L13;
+ }
+ $38 = (($x$039) + 1)|0;
+ $39 = ((($dest$038)) + 4|0);
+ $40 = ($38|0)<($width|0);
+ if ($40) {
+ $dest$038 = $39;$x$039 = $38;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 1: {
+ if ($23) {
+ $32 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
+ $dest$135 = $26;$left$036 = $width;
+ while(1) {
+ $41 = (_stbi__get8($s)|0);
+ $42 = (_stbi__at_eof($s)|0);
+ $43 = ($42|0)==(0);
+ if (!($43)) {
+ label = 24;
+ break L13;
+ }
+ $44 = HEAP8[$32>>0]|0;
+ $45 = $44&255;
+ $46 = (_stbi__readval($s,$45,$value)|0);
+ $47 = ($46|0)==(0|0);
+ if ($47) {
+ $$0 = 0;
+ label = 52;
+ break L13;
+ }
+ $48 = $41&255;
+ $49 = ($48|0)>($left$036|0);
+ $50 = $left$036&255;
+ $$ = $49 ? $50 : $41;
+ $51 = $$&255;
+ $52 = ($$<<24>>24)==(0);
+ if ($52) {
+ $dest$2$lcssa = $dest$135;
+ } else {
+ $53 = $$&255;
+ $54 = $53 << 2;
+ $dest$230 = $dest$135;$i$031 = 0;
+ while(1) {
+ $55 = HEAP8[$32>>0]|0;
+ $56 = $55&255;
+ _stbi__copyval($56,$dest$230,$value);
+ $57 = (($i$031) + 1)|0;
+ $58 = ((($dest$230)) + 4|0);
+ $exitcond57 = ($57|0)==($53|0);
+ if ($exitcond57) {
+ break;
+ } else {
+ $dest$230 = $58;$i$031 = $57;
+ }
+ }
+ $scevgep56 = (($dest$135) + ($54)|0);
+ $dest$2$lcssa = $scevgep56;
+ }
+ $59 = (($left$036) - ($51))|0;
+ $60 = ($59|0)>(0);
+ if ($60) {
+ $dest$135 = $dest$2$lcssa;$left$036 = $59;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 2: {
+ if ($24) {
+ $30 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
+ $31 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0);
+ $dest$327 = $26;$left2$028 = $width;
+ while(1) {
+ $61 = (_stbi__get8($s)|0);
+ $62 = $61&255;
+ $63 = (_stbi__at_eof($s)|0);
+ $64 = ($63|0)==(0);
+ if (!($64)) {
+ label = 32;
+ break L13;
+ }
+ $65 = ($61<<24>>24)<(0);
+ if ($65) {
+ $66 = ($61<<24>>24)==(-128);
+ if ($66) {
+ $67 = (_stbi__get16be($s)|0);
+ $count3$0 = $67;
+ } else {
+ $68 = (($62) + -127)|0;
+ $count3$0 = $68;
+ }
+ $69 = ($count3$0|0)>($left2$028|0);
+ if ($69) {
+ label = 38;
+ break L13;
+ }
+ $70 = HEAP8[$30>>0]|0;
+ $71 = $70&255;
+ $72 = (_stbi__readval($s,$71,$value5)|0);
+ $73 = ($72|0)==(0|0);
+ if ($73) {
+ $$0 = 0;
+ label = 52;
+ break L13;
+ }
+ $74 = ($count3$0|0)>(0);
+ if ($74) {
+ $75 = $count3$0 << 2;
+ $dest$425 = $dest$327;$i4$026 = 0;
+ while(1) {
+ $76 = HEAP8[$30>>0]|0;
+ $77 = $76&255;
+ _stbi__copyval($77,$dest$425,$value5);
+ $78 = (($i4$026) + 1)|0;
+ $79 = ((($dest$425)) + 4|0);
+ $exitcond = ($78|0)==($count3$0|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $dest$425 = $79;$i4$026 = $78;
+ }
+ }
+ $scevgep = (($dest$327) + ($75)|0);
+ $count3$1 = $count3$0;$dest$6 = $scevgep;
+ } else {
+ $count3$1 = $count3$0;$dest$6 = $dest$327;
+ }
+ } else {
+ $80 = (($62) + 1)|0;
+ $81 = ($62|0)<($left2$028|0);
+ if (!($81)) {
+ label = 45;
+ break L13;
+ }
+ $82 = HEAP8[$31>>0]|0;
+ $83 = $82&255;
+ $dest$523 = $dest$327;$i4$124 = 0;
+ while(1) {
+ $84 = (_stbi__readval($s,$83,$dest$523)|0);
+ $85 = ($84|0)==(0|0);
+ if ($85) {
+ $$0 = 0;
+ label = 52;
+ break L13;
+ }
+ $86 = (($i4$124) + 1)|0;
+ $87 = ((($dest$523)) + 4|0);
+ $88 = ($86|0)<($80|0);
+ if ($88) {
+ $dest$523 = $87;$i4$124 = $86;
+ } else {
+ $count3$1 = $80;$dest$6 = $87;
+ break;
+ }
+ }
+ }
+ $89 = (($left2$028) - ($count3$1))|0;
+ $90 = ($89|0)>(0);
+ if ($90) {
+ $dest$327 = $dest$6;$left2$028 = $89;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ label = 20;
+ break L13;
+ }
+ }
+ $91 = (($packet_idx$041) + 1)|0;
+ $92 = ($91|0)<($$lcssa108|0);
+ if ($92) {
+ $packet_idx$041 = $91;
+ } else {
+ break L15;
+ }
+ }
+ }
+ } while(0);
+ $93 = (($y$044) + 1)|0;
+ $94 = ($93|0)<($height|0);
+ if ($94) {
+ $y$044 = $93;
+ } else {
+ $$0 = $result;
+ label = 52;
+ break;
+ }
+ }
+ if ((label|0) == 20) {
+ _stbi__err(14250);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 24) {
+ _stbi__err(14363);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 32) {
+ _stbi__err(14363);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 38) {
+ _stbi__err(14363);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 45) {
+ _stbi__err(14363);
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ else if ((label|0) == 52) {
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ return (0)|0;
+}
+function _stbi__readval($s,$channel,$dest) {
+ $s = $s|0;
+ $channel = $channel|0;
+ $dest = $dest|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $channel & 128;
+ $1 = ($0|0)==(0);
+ if ($1) {
+ label = 5;
+ } else {
+ $2 = (_stbi__at_eof($s)|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $4 = (_stbi__get8($s)|0);
+ HEAP8[$dest>>0] = $4;
+ label = 5;
+ }
+ }
+ do {
+ if ((label|0) == 5) {
+ $5 = $channel & 64;
+ $6 = ($5|0)==(0);
+ if (!($6)) {
+ $7 = (_stbi__at_eof($s)|0);
+ $8 = ($7|0)==(0);
+ if (!($8)) {
+ break;
+ }
+ $9 = (_stbi__get8($s)|0);
+ $10 = ((($dest)) + 1|0);
+ HEAP8[$10>>0] = $9;
+ }
+ $11 = $channel & 32;
+ $12 = ($11|0)==(0);
+ if (!($12)) {
+ $13 = (_stbi__at_eof($s)|0);
+ $14 = ($13|0)==(0);
+ if (!($14)) {
+ break;
+ }
+ $15 = (_stbi__get8($s)|0);
+ $16 = ((($dest)) + 2|0);
+ HEAP8[$16>>0] = $15;
+ }
+ $17 = $channel & 16;
+ $18 = ($17|0)==(0);
+ if ($18) {
+ $$0 = $dest;
+ return ($$0|0);
+ }
+ $19 = (_stbi__at_eof($s)|0);
+ $20 = ($19|0)==(0);
+ if ($20) {
+ $21 = (_stbi__get8($s)|0);
+ $22 = ((($dest)) + 3|0);
+ HEAP8[$22>>0] = $21;
+ $$0 = $dest;
+ return ($$0|0);
+ }
+ }
+ } while(0);
+ _stbi__err(14363);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__copyval($channel,$dest,$src) {
+ $channel = $channel|0;
+ $dest = $dest|0;
+ $src = $src|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $channel & 128;
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = HEAP8[$src>>0]|0;
+ HEAP8[$dest>>0] = $2;
+ }
+ $3 = $channel & 64;
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ $5 = ((($src)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ((($dest)) + 1|0);
+ HEAP8[$7>>0] = $6;
+ }
+ $8 = $channel & 32;
+ $9 = ($8|0)==(0);
+ if (!($9)) {
+ $10 = ((($src)) + 2|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = ((($dest)) + 2|0);
+ HEAP8[$12>>0] = $11;
+ }
+ $13 = $channel & 16;
+ $14 = ($13|0)==(0);
+ if ($14) {
+ return;
+ }
+ $15 = ((($src)) + 3|0);
+ $16 = HEAP8[$15>>0]|0;
+ $17 = ((($dest)) + 3|0);
+ HEAP8[$17>>0] = $16;
+ return;
+}
+function _stbi__pic_test_core($s) {
+ $s = $s|0;
+ var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__pic_is4($s,12601)|0);
+ $1 = ($0|0)==(0);
+ if ($1) {
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ $i$01 = 0;
+ }
+ while(1) {
+ (_stbi__get8($s)|0);
+ $2 = (($i$01) + 1)|0;
+ $exitcond = ($2|0)==(84);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $2;
+ }
+ }
+ $3 = (_stbi__pic_is4($s,14372)|0);
+ $not$ = ($3|0)!=(0);
+ $$ = $not$&1;
+ $$0 = $$;
+ return ($$0|0);
+}
+function _stbi__gif_load_next($s,$g,$comp) {
+ $s = $s|0;
+ $g = $g|0;
+ $comp = $comp|0;
+ var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
+ var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
+ var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
+ var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
+ var $99 = 0, $i$02 = 0, $prev_trans$0 = 0, $prev_trans$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($g)) + 8|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0|0);
+ do {
+ if ($2) {
+ $3 = (_stbi__gif_header($s,$g,$comp,0)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ $$pr = HEAP32[$0>>2]|0;
+ $20 = $$pr;
+ break;
+ }
+ } else {
+ $20 = $1;
+ }
+ } while(0);
+ $5 = HEAP32[$g>>2]|0;
+ $6 = $5 << 2;
+ $7 = ((($g)) + 4|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = Math_imul($6, $8)|0;
+ $10 = (_stbi__malloc($9)|0);
+ HEAP32[$0>>2] = $10;
+ $11 = ($10|0)==(0|0);
+ if ($11) {
+ _stbi__err(12905);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $12 = ((($g)) + 32|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = $13 >>> 2;
+ $15 = $14 & 7;
+ switch ($15|0) {
+ case 0: {
+ $16 = HEAP32[$g>>2]|0;
+ $17 = $16 << 2;
+ $18 = HEAP32[$7>>2]|0;
+ $19 = Math_imul($17, $18)|0;
+ _stbi__fill_gif_background($g,0,0,$17,$19);
+ break;
+ }
+ case 1: {
+ $21 = ($20|0)==(0|0);
+ if (!($21)) {
+ $22 = HEAP32[$g>>2]|0;
+ $23 = $22 << 2;
+ $24 = HEAP32[$7>>2]|0;
+ $25 = Math_imul($23, $24)|0;
+ _memcpy(($10|0),($20|0),($25|0))|0;
+ }
+ $26 = ((($g)) + 12|0);
+ HEAP32[$26>>2] = $20;
+ break;
+ }
+ case 2: {
+ $27 = ($20|0)==(0|0);
+ if (!($27)) {
+ $28 = HEAP32[$g>>2]|0;
+ $29 = $28 << 2;
+ $30 = HEAP32[$7>>2]|0;
+ $31 = Math_imul($29, $30)|0;
+ _memcpy(($10|0),($20|0),($31|0))|0;
+ }
+ $32 = ((($g)) + 18488|0);
+ $33 = HEAP32[$32>>2]|0;
+ $34 = ((($g)) + 18492|0);
+ $35 = HEAP32[$34>>2]|0;
+ $36 = ((($g)) + 18496|0);
+ $37 = HEAP32[$36>>2]|0;
+ $38 = ((($g)) + 18500|0);
+ $39 = HEAP32[$38>>2]|0;
+ _stbi__fill_gif_background($g,$33,$35,$37,$39);
+ break;
+ }
+ case 3: {
+ $40 = ((($g)) + 12|0);
+ $41 = HEAP32[$40>>2]|0;
+ $42 = ($41|0)==(0|0);
+ if (!($42)) {
+ $45 = ((($g)) + 18492|0);
+ $46 = HEAP32[$45>>2]|0;
+ $47 = ((($g)) + 18500|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = ($46|0)<($48|0);
+ if ($49) {
+ $50 = ((($g)) + 18488|0);
+ $51 = ((($g)) + 18496|0);
+ $i$02 = $46;
+ while(1) {
+ $52 = HEAP32[$50>>2]|0;
+ $53 = (($52) + ($i$02))|0;
+ $54 = HEAP32[$0>>2]|0;
+ $55 = (($54) + ($53)|0);
+ $56 = HEAP32[$40>>2]|0;
+ $57 = (($56) + ($53)|0);
+ $58 = HEAP32[$51>>2]|0;
+ $59 = (($58) - ($52))|0;
+ _memcpy(($55|0),($57|0),($59|0))|0;
+ $60 = HEAP32[$g>>2]|0;
+ $61 = $60 << 2;
+ $62 = (($61) + ($i$02))|0;
+ $63 = HEAP32[$47>>2]|0;
+ $64 = ($62|0)<($63|0);
+ if ($64) {
+ $i$02 = $62;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ $43 = ((($g)) + 36|0);
+ $44 = ((($g)) + 28|0);
+ L27: while(1) {
+ $65 = (_stbi__get8($s)|0);
+ $66 = $65&255;
+ switch ($66|0) {
+ case 44: {
+ label = 20;
+ break L27;
+ break;
+ }
+ case 59: {
+ label = 45;
+ break L27;
+ break;
+ }
+ case 33: {
+ break;
+ }
+ default: {
+ label = 46;
+ break L27;
+ }
+ }
+ $143 = (_stbi__get8($s)|0);
+ $144 = ($143<<24>>24)==(-7);
+ do {
+ if ($144) {
+ $147 = (_stbi__get8($s)|0);
+ $148 = ($147<<24>>24)==(4);
+ if ($148) {
+ $149 = (_stbi__get8($s)|0);
+ $150 = $149&255;
+ HEAP32[$12>>2] = $150;
+ $151 = (_stbi__get16le($s)|0);
+ HEAP32[$43>>2] = $151;
+ $152 = (_stbi__get8($s)|0);
+ $153 = $152&255;
+ HEAP32[$44>>2] = $153;
+ break;
+ } else {
+ $154 = $147&255;
+ _stbi__skip($s,$154);
+ continue L27;
+ }
+ }
+ } while(0);
+ $145 = (_stbi__get8($s)|0);
+ $146 = ($145<<24>>24)==(0);
+ if ($146) {
+ continue;
+ } else {
+ $156 = $145;
+ }
+ while(1) {
+ $155 = $156&255;
+ _stbi__skip($s,$155);
+ $157 = (_stbi__get8($s)|0);
+ $158 = ($157<<24>>24)==(0);
+ if ($158) {
+ continue L27;
+ } else {
+ $156 = $157;
+ }
+ }
+ }
+ if ((label|0) == 20) {
+ $67 = (_stbi__get16le($s)|0);
+ $68 = (_stbi__get16le($s)|0);
+ $69 = (_stbi__get16le($s)|0);
+ $70 = (_stbi__get16le($s)|0);
+ $71 = (($69) + ($67))|0;
+ $72 = HEAP32[$g>>2]|0;
+ $73 = ($71|0)>($72|0);
+ if (!($73)) {
+ $74 = (($70) + ($68))|0;
+ $75 = HEAP32[$7>>2]|0;
+ $76 = ($74|0)>($75|0);
+ if (!($76)) {
+ $77 = $72 << 2;
+ $78 = ((($g)) + 18512|0);
+ HEAP32[$78>>2] = $77;
+ $79 = $67 << 2;
+ $80 = ((($g)) + 18488|0);
+ HEAP32[$80>>2] = $79;
+ $81 = HEAP32[$78>>2]|0;
+ $82 = Math_imul($81, $68)|0;
+ $83 = ((($g)) + 18492|0);
+ HEAP32[$83>>2] = $82;
+ $84 = HEAP32[$80>>2]|0;
+ $85 = $69 << 2;
+ $86 = (($84) + ($85))|0;
+ $87 = ((($g)) + 18496|0);
+ HEAP32[$87>>2] = $86;
+ $88 = HEAP32[$83>>2]|0;
+ $89 = HEAP32[$78>>2]|0;
+ $90 = Math_imul($89, $70)|0;
+ $91 = (($90) + ($88))|0;
+ $92 = ((($g)) + 18500|0);
+ HEAP32[$92>>2] = $91;
+ $93 = HEAP32[$80>>2]|0;
+ $94 = ((($g)) + 18504|0);
+ HEAP32[$94>>2] = $93;
+ $95 = HEAP32[$83>>2]|0;
+ $96 = ((($g)) + 18508|0);
+ HEAP32[$96>>2] = $95;
+ $97 = (_stbi__get8($s)|0);
+ $98 = $97&255;
+ $99 = ((($g)) + 18484|0);
+ HEAP32[$99>>2] = $98;
+ $100 = $98 & 64;
+ $101 = ($100|0)==(0);
+ $102 = HEAP32[$78>>2]|0;
+ if ($101) {
+ $106 = ((($g)) + 18480|0);
+ HEAP32[$106>>2] = $102;
+ $107 = ((($g)) + 18476|0);
+ HEAP32[$107>>2] = 0;
+ } else {
+ $103 = $102 << 3;
+ $104 = ((($g)) + 18480|0);
+ HEAP32[$104>>2] = $103;
+ $105 = ((($g)) + 18476|0);
+ HEAP32[$105>>2] = 3;
+ }
+ $108 = HEAP32[$99>>2]|0;
+ $109 = $108 & 128;
+ $110 = ($109|0)==(0);
+ if ($110) {
+ $121 = ((($g)) + 16|0);
+ $122 = HEAP32[$121>>2]|0;
+ $123 = $122 & 128;
+ $124 = ($123|0)==(0);
+ if ($124) {
+ _stbi__err(14481);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $125 = ((($g)) + 28|0);
+ $126 = HEAP32[$125>>2]|0;
+ $127 = ($126|0)>(-1);
+ if ($127) {
+ $128 = HEAP32[$12>>2]|0;
+ $129 = $128 & 1;
+ $130 = ($129|0)==(0);
+ if ($130) {
+ $prev_trans$0 = -1;
+ } else {
+ $131 = (((((($g)) + 40|0) + ($126<<2)|0)) + 3|0);
+ $132 = HEAP8[$131>>0]|0;
+ $133 = $132&255;
+ HEAP8[$131>>0] = 0;
+ $prev_trans$0 = $133;
+ }
+ } else {
+ $prev_trans$0 = -1;
+ }
+ $134 = ((($g)) + 40|0);
+ $135 = ((($g)) + 18472|0);
+ HEAP32[$135>>2] = $134;
+ $prev_trans$1 = $prev_trans$0;
+ } else {
+ $111 = ((($g)) + 1064|0);
+ $112 = $108 & 7;
+ $113 = 2 << $112;
+ $114 = HEAP32[$12>>2]|0;
+ $115 = $114 & 1;
+ $116 = ($115|0)==(0);
+ if ($116) {
+ $119 = -1;
+ } else {
+ $117 = ((($g)) + 28|0);
+ $118 = HEAP32[$117>>2]|0;
+ $119 = $118;
+ }
+ _stbi__gif_parse_colortable($s,$111,$113,$119);
+ $120 = ((($g)) + 18472|0);
+ HEAP32[$120>>2] = $111;
+ $prev_trans$1 = -1;
+ }
+ $136 = (_stbi__process_gif_raster($s,$g)|0);
+ $137 = ($136|0)==(0|0);
+ if ($137) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $138 = ($prev_trans$1|0)==(-1);
+ if ($138) {
+ $$0 = $136;
+ return ($$0|0);
+ }
+ $139 = $prev_trans$1&255;
+ $140 = ((($g)) + 28|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = (((((($g)) + 40|0) + ($141<<2)|0)) + 3|0);
+ HEAP8[$142>>0] = $139;
+ $$0 = $136;
+ return ($$0|0);
+ }
+ }
+ _stbi__err(14460);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 45) {
+ $$0 = $s;
+ return ($$0|0);
+ }
+ else if ((label|0) == 46) {
+ _stbi__err(14501);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__fill_gif_background($g,$x0,$y0,$x1,$y1) {
+ $g = $g|0;
+ $x0 = $x0|0;
+ $y0 = $y0|0;
+ $x1 = $x1|0;
+ $y1 = $y1|0;
+ var $$sum = 0, $$sum1 = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0;
+ var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $x$03 = 0, $y$04 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($g)) + 20|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = (((($g)) + 40|0) + ($1<<2)|0);
+ $3 = ($y0|0)<($y1|0);
+ if (!($3)) {
+ return;
+ }
+ $4 = ($x0|0)<($x1|0);
+ $5 = ((($g)) + 8|0);
+ $6 = (((((($g)) + 40|0) + ($1<<2)|0)) + 2|0);
+ $7 = (((((($g)) + 40|0) + ($1<<2)|0)) + 1|0);
+ $y$04 = $y0;
+ while(1) {
+ if ($4) {
+ $x$03 = $x0;
+ while(1) {
+ $8 = (($x$03) + ($y$04))|0;
+ $9 = HEAP32[$5>>2]|0;
+ $10 = (($9) + ($8)|0);
+ $11 = HEAP8[$6>>0]|0;
+ HEAP8[$10>>0] = $11;
+ $12 = HEAP8[$7>>0]|0;
+ $$sum = (($8) + 1)|0;
+ $13 = (($9) + ($$sum)|0);
+ HEAP8[$13>>0] = $12;
+ $14 = HEAP8[$2>>0]|0;
+ $$sum1 = (($8) + 2)|0;
+ $15 = (($9) + ($$sum1)|0);
+ HEAP8[$15>>0] = $14;
+ $$sum2 = (($8) + 3)|0;
+ $16 = (($9) + ($$sum2)|0);
+ HEAP8[$16>>0] = 0;
+ $17 = (($x$03) + 4)|0;
+ $18 = ($17|0)<($x1|0);
+ if ($18) {
+ $x$03 = $17;
+ } else {
+ break;
+ }
+ }
+ }
+ $19 = HEAP32[$g>>2]|0;
+ $20 = $19 << 2;
+ $21 = (($20) + ($y$04))|0;
+ $22 = ($21|0)<($y1|0);
+ if ($22) {
+ $y$04 = $21;
+ } else {
+ break;
+ }
+ }
+ return;
+}
+function _stbi__process_gif_raster($s,$g) {
+ $s = $s|0;
+ $g = $g|0;
+ var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $avail$0$ph = 0;
+ var $avail$0$ph7 = 0, $avail$1 = 0, $bits$0$lcssa = 0, $bits$0$ph = 0, $bits$0$ph3 = 0, $bits$0$ph9 = 0, $bits$040 = 0, $codemask$0$ph = 0, $codemask$0$ph$in = 0, $codesize$0$ph = 0, $codesize$0$ph$in = 0, $first$0$ph = 0, $init_code$047 = 0, $len$0$lcssa = 0, $len$0$lcssa$lcssa169 = 0, $len$0$ph = 0, $len$0$ph11 = 0, $len$0$ph5 = 0, $len$042 = 0, $len$1 = 0;
+ var $oldcode$0$ph = 0, $oldcode$0$ph8 = 0, $or$cond = 0, $valid_bits$0$lcssa = 0, $valid_bits$0$ph = 0, $valid_bits$0$ph10 = 0, $valid_bits$0$ph4 = 0, $valid_bits$041 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = $0&255;
+ $2 = ($0&255)>(12);
+ if ($2) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $3 = 1 << $1;
+ $init_code$047 = 0;
+ while(1) {
+ $4 = (((($g)) + 2088|0) + ($init_code$047<<2)|0);
+ HEAP16[$4>>1] = -1;
+ $5 = $init_code$047&255;
+ $6 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 2|0);
+ HEAP8[$6>>0] = $5;
+ $7 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 3|0);
+ HEAP8[$7>>0] = $5;
+ $8 = (($init_code$047) + 1)|0;
+ $9 = ($8|0)<($3|0);
+ if ($9) {
+ $init_code$047 = $8;
+ } else {
+ break;
+ }
+ }
+ $10 = (($3) + 2)|0;
+ $11 = (($3) + 1)|0;
+ $bits$0$ph = 0;$first$0$ph = 0;$len$0$ph = 0;$valid_bits$0$ph = 0;
+ L7: while(1) {
+ $avail$0$ph = $10;$bits$0$ph3 = $bits$0$ph;$codesize$0$ph$in = $1;$len$0$ph5 = $len$0$ph;$oldcode$0$ph = -1;$valid_bits$0$ph4 = $valid_bits$0$ph;
+ L9: while(1) {
+ $codesize$0$ph = (($codesize$0$ph$in) + 1)|0;
+ $codemask$0$ph$in = 1 << $codesize$0$ph;
+ $codemask$0$ph = (($codemask$0$ph$in) + -1)|0;
+ $avail$0$ph7 = $avail$0$ph;$bits$0$ph9 = $bits$0$ph3;$len$0$ph11 = $len$0$ph5;$oldcode$0$ph8 = $oldcode$0$ph;$valid_bits$0$ph10 = $valid_bits$0$ph4;
+ while(1) {
+ $12 = ($valid_bits$0$ph10|0)<($codesize$0$ph|0);
+ if ($12) {
+ $bits$040 = $bits$0$ph9;$len$042 = $len$0$ph11;$valid_bits$041 = $valid_bits$0$ph10;
+ while(1) {
+ $13 = ($len$042|0)==(0);
+ if ($13) {
+ $14 = (_stbi__get8($s)|0);
+ $15 = $14&255;
+ $16 = ($14<<24>>24)==(0);
+ if ($16) {
+ label = 10;
+ break L7;
+ } else {
+ $len$1 = $15;
+ }
+ } else {
+ $len$1 = $len$042;
+ }
+ $19 = (($len$1) + -1)|0;
+ $20 = (_stbi__get8($s)|0);
+ $21 = $20&255;
+ $22 = $21 << $valid_bits$041;
+ $23 = $22 | $bits$040;
+ $24 = (($valid_bits$041) + 8)|0;
+ $25 = ($24|0)<($codesize$0$ph|0);
+ if ($25) {
+ $bits$040 = $23;$len$042 = $19;$valid_bits$041 = $24;
+ } else {
+ $bits$0$lcssa = $23;$len$0$lcssa = $19;$valid_bits$0$lcssa = $24;
+ break;
+ }
+ }
+ } else {
+ $bits$0$lcssa = $bits$0$ph9;$len$0$lcssa = $len$0$ph11;$valid_bits$0$lcssa = $valid_bits$0$ph10;
+ }
+ $26 = $bits$0$lcssa & $codemask$0$ph;
+ $27 = $bits$0$lcssa >> $codesize$0$ph;
+ $28 = (($valid_bits$0$lcssa) - ($codesize$0$ph))|0;
+ $29 = ($26|0)==($3|0);
+ if ($29) {
+ $bits$0$ph = $27;$first$0$ph = 1;$len$0$ph = $len$0$lcssa;$valid_bits$0$ph = $28;
+ continue L7;
+ }
+ $30 = ($26|0)==($11|0);
+ if ($30) {
+ $len$0$lcssa$lcssa169 = $len$0$lcssa;
+ label = 14;
+ break L7;
+ }
+ $39 = ($26|0)>($avail$0$ph7|0);
+ if ($39) {
+ label = 29;
+ break L7;
+ }
+ if (!($first$0$ph)) {
+ label = 19;
+ break L7;
+ }
+ $40 = ($oldcode$0$ph8|0)>(-1);
+ if ($40) {
+ $41 = (($avail$0$ph7) + 1)|0;
+ $42 = ($avail$0$ph7|0)>(4095);
+ if ($42) {
+ label = 22;
+ break L7;
+ }
+ $43 = $oldcode$0$ph8&65535;
+ $44 = (((($g)) + 2088|0) + ($avail$0$ph7<<2)|0);
+ HEAP16[$44>>1] = $43;
+ $45 = (((((($g)) + 2088|0) + ($oldcode$0$ph8<<2)|0)) + 2|0);
+ $46 = HEAP8[$45>>0]|0;
+ $47 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 2|0);
+ HEAP8[$47>>0] = $46;
+ $48 = ($26|0)==($41|0);
+ if ($48) {
+ $$sink = $46;
+ } else {
+ $49 = (((((($g)) + 2088|0) + ($26<<2)|0)) + 2|0);
+ $50 = HEAP8[$49>>0]|0;
+ $$sink = $50;
+ }
+ $51 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 3|0);
+ HEAP8[$51>>0] = $$sink;
+ $avail$1 = $41;
+ } else {
+ $52 = ($26|0)==($avail$0$ph7|0);
+ if ($52) {
+ label = 27;
+ break L7;
+ } else {
+ $avail$1 = $avail$0$ph7;
+ }
+ }
+ $53 = $26&65535;
+ _stbi__out_gif_code($g,$53);
+ $54 = $avail$1 & $codemask$0$ph;
+ $55 = ($54|0)==(0);
+ $56 = ($avail$1|0)<(4096);
+ $or$cond = $56 & $55;
+ if ($or$cond) {
+ $avail$0$ph = $avail$1;$bits$0$ph3 = $27;$codesize$0$ph$in = $codesize$0$ph;$len$0$ph5 = $len$0$lcssa;$oldcode$0$ph = $26;$valid_bits$0$ph4 = $28;
+ continue L9;
+ } else {
+ $avail$0$ph7 = $avail$1;$bits$0$ph9 = $27;$len$0$ph11 = $len$0$lcssa;$oldcode$0$ph8 = $26;$valid_bits$0$ph10 = $28;
+ }
+ }
+ }
+ }
+ if ((label|0) == 10) {
+ $17 = ((($g)) + 8|0);
+ $18 = HEAP32[$17>>2]|0;
+ $$0 = $18;
+ return ($$0|0);
+ }
+ else if ((label|0) == 14) {
+ _stbi__skip($s,$len$0$lcssa$lcssa169);
+ $31 = (_stbi__get8($s)|0);
+ $32 = ($31<<24>>24)==(0);
+ if (!($32)) {
+ $34 = $31;
+ while(1) {
+ $33 = $34&255;
+ _stbi__skip($s,$33);
+ $35 = (_stbi__get8($s)|0);
+ $36 = ($35<<24>>24)==(0);
+ if ($36) {
+ break;
+ } else {
+ $34 = $35;
+ }
+ }
+ }
+ $37 = ((($g)) + 8|0);
+ $38 = HEAP32[$37>>2]|0;
+ $$0 = $38;
+ return ($$0|0);
+ }
+ else if ((label|0) == 19) {
+ _stbi__err(14514);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 22) {
+ _stbi__err(14528);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 27) {
+ _stbi__err(14543);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 29) {
+ _stbi__err(14543);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__out_gif_code($g,$code) {
+ $g = $g|0;
+ $code = $code|0;
+ var $$pr = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
+ var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0;
+ var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $code&65535;
+ $1 = (((($g)) + 2088|0) + ($0<<2)|0);
+ $2 = HEAP16[$1>>1]|0;
+ $3 = ($2<<16>>16)>(-1);
+ if ($3) {
+ _stbi__out_gif_code($g,$2);
+ }
+ $4 = ((($g)) + 18508|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ((($g)) + 18500|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($5|0)<($7|0);
+ if (!($8)) {
+ return;
+ }
+ $9 = ((($g)) + 18504|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = (($10) + ($5))|0;
+ $12 = ((($g)) + 8|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (((((($g)) + 2088|0) + ($0<<2)|0)) + 3|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = $15&255;
+ $17 = $16 << 2;
+ $18 = ((($g)) + 18472|0);
+ $19 = HEAP32[$18>>2]|0;
+ $$sum1 = $17 | 3;
+ $20 = (($19) + ($$sum1)|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)<(0);
+ if ($22) {
+ $23 = (($19) + ($17)|0);
+ $24 = (($13) + ($11)|0);
+ $$sum2 = $17 | 2;
+ $25 = (($19) + ($$sum2)|0);
+ $26 = HEAP8[$25>>0]|0;
+ HEAP8[$24>>0] = $26;
+ $$sum3 = $17 | 1;
+ $27 = (($19) + ($$sum3)|0);
+ $28 = HEAP8[$27>>0]|0;
+ $$sum = (($11) + 1)|0;
+ $29 = (($13) + ($$sum)|0);
+ HEAP8[$29>>0] = $28;
+ $30 = HEAP8[$23>>0]|0;
+ $$sum4 = (($11) + 2)|0;
+ $31 = (($13) + ($$sum4)|0);
+ HEAP8[$31>>0] = $30;
+ $32 = HEAP8[$20>>0]|0;
+ $$sum5 = (($11) + 3)|0;
+ $33 = (($13) + ($$sum5)|0);
+ HEAP8[$33>>0] = $32;
+ }
+ $34 = HEAP32[$9>>2]|0;
+ $35 = (($34) + 4)|0;
+ HEAP32[$9>>2] = $35;
+ $36 = ((($g)) + 18496|0);
+ $37 = HEAP32[$36>>2]|0;
+ $38 = ($35|0)<($37|0);
+ if ($38) {
+ return;
+ }
+ $39 = ((($g)) + 18488|0);
+ $40 = HEAP32[$39>>2]|0;
+ HEAP32[$9>>2] = $40;
+ $41 = ((($g)) + 18480|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = HEAP32[$4>>2]|0;
+ $44 = (($43) + ($42))|0;
+ HEAP32[$4>>2] = $44;
+ $45 = ((($g)) + 18476|0);
+ $46 = HEAP32[$6>>2]|0;
+ $47 = ($44|0)<($46|0);
+ if ($47) {
+ return;
+ }
+ $48 = ((($g)) + 18512|0);
+ $49 = ((($g)) + 18492|0);
+ $$pr = HEAP32[$45>>2]|0;
+ $50 = $$pr;
+ while(1) {
+ $51 = ($50|0)>(0);
+ if (!($51)) {
+ label = 11;
+ break;
+ }
+ $52 = HEAP32[$48>>2]|0;
+ $53 = $52 << $50;
+ HEAP32[$41>>2] = $53;
+ $54 = HEAP32[$49>>2]|0;
+ $55 = $53 >> 1;
+ $56 = (($55) + ($54))|0;
+ HEAP32[$4>>2] = $56;
+ $57 = HEAP32[$45>>2]|0;
+ $58 = (($57) + -1)|0;
+ HEAP32[$45>>2] = $58;
+ $59 = HEAP32[$4>>2]|0;
+ $60 = HEAP32[$6>>2]|0;
+ $61 = ($59|0)<($60|0);
+ if ($61) {
+ label = 11;
+ break;
+ } else {
+ $50 = $58;
+ }
+ }
+ if ((label|0) == 11) {
+ return;
+ }
+}
+function _stbi__gif_test_raw($s) {
+ $s = $s|0;
+ var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = ($0<<24>>24)==(71);
+ L1: do {
+ if ($1) {
+ $2 = (_stbi__get8($s)|0);
+ $3 = ($2<<24>>24)==(73);
+ if ($3) {
+ $4 = (_stbi__get8($s)|0);
+ $5 = ($4<<24>>24)==(70);
+ if ($5) {
+ $6 = (_stbi__get8($s)|0);
+ $7 = ($6<<24>>24)==(56);
+ if ($7) {
+ $8 = (_stbi__get8($s)|0);
+ switch ($8<<24>>24) {
+ case 55: case 57: {
+ break;
+ }
+ default: {
+ $$0 = 0;
+ break L1;
+ }
+ }
+ $9 = (_stbi__get8($s)|0);
+ $10 = ($9<<24>>24)==(97);
+ $$ = $10&1;
+ $$0 = $$;
+ } else {
+ $$0 = 0;
+ }
+ } else {
+ $$0 = 0;
+ }
+ } else {
+ $$0 = 0;
+ }
+ } else {
+ $$0 = 0;
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _stbi__high_bit($z) {
+ $z = $z|0;
+ var $$ = 0, $$01 = 0, $$1 = 0, $$2 = 0, $$3 = 0, $$n$3 = 0, $$z = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, $n$1 = 0, $n$2 = 0, $n$3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($z|0)==(0);
+ if ($0) {
+ $$01 = -1;
+ return ($$01|0);
+ }
+ $1 = ($z>>>0)>(65535);
+ $2 = $z >>> 16;
+ $$z = $1 ? $2 : $z;
+ $$ = $1 ? 16 : 0;
+ $3 = ($$z>>>0)>(255);
+ $4 = $$ | 8;
+ $5 = $$z >>> 8;
+ $$1 = $3 ? $5 : $$z;
+ $n$1 = $3 ? $4 : $$;
+ $6 = ($$1>>>0)>(15);
+ $7 = $n$1 | 4;
+ $8 = $$1 >>> 4;
+ $$2 = $6 ? $8 : $$1;
+ $n$2 = $6 ? $7 : $n$1;
+ $9 = ($$2>>>0)>(3);
+ $10 = $n$2 | 2;
+ $11 = $$2 >>> 2;
+ $$3 = $9 ? $11 : $$2;
+ $n$3 = $9 ? $10 : $n$2;
+ $12 = ($$3>>>0)>(1);
+ $13 = $12&1;
+ $$n$3 = (($13) + ($n$3))|0;
+ $$01 = $$n$3;
+ return ($$01|0);
+}
+function _stbi__bitcount($a) {
+ $a = $a|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $a & 1431655765;
+ $1 = $a >>> 1;
+ $2 = $1 & 1431655765;
+ $3 = (($2) + ($0))|0;
+ $4 = $3 & 858993459;
+ $5 = $3 >>> 2;
+ $6 = $5 & 858993459;
+ $7 = (($6) + ($4))|0;
+ $8 = $7 >>> 4;
+ $9 = (($8) + ($7))|0;
+ $10 = $9 & 252645135;
+ $11 = $10 >>> 8;
+ $12 = (($11) + ($10))|0;
+ $13 = $12 >>> 16;
+ $14 = (($13) + ($12))|0;
+ $15 = $14 & 255;
+ return ($15|0);
+}
+function _stbi__shiftsigned($v,$shift,$bits) {
+ $v = $v|0;
+ $shift = $shift|0;
+ $bits = $bits|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $result$0$lcssa = 0, $result$01 = 0, $z$02 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($shift|0)<(0);
+ $1 = (0 - ($shift))|0;
+ $2 = $v << $1;
+ $3 = $v >> $shift;
+ $$0 = $0 ? $2 : $3;
+ $4 = ($bits|0)<(8);
+ if ($4) {
+ $result$01 = $$0;$z$02 = $bits;
+ } else {
+ $result$0$lcssa = $$0;
+ return ($result$0$lcssa|0);
+ }
+ while(1) {
+ $5 = $$0 >> $z$02;
+ $6 = (($5) + ($result$01))|0;
+ $7 = (($z$02) + ($bits))|0;
+ $8 = ($7|0)<(8);
+ if ($8) {
+ $result$01 = $6;$z$02 = $7;
+ } else {
+ $result$0$lcssa = $6;
+ break;
+ }
+ }
+ return ($result$0$lcssa|0);
+}
+function _stbi__bmp_test_raw($s) {
+ $s = $s|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_stbi__get8($s)|0);
+ $1 = ($0<<24>>24)==(66);
+ if (!($1)) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $2 = (_stbi__get8($s)|0);
+ $3 = ($2<<24>>24)==(77);
+ if (!($3)) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ (_stbi__get32le($s)|0);
+ (_stbi__get16le($s)|0);
+ (_stbi__get16le($s)|0);
+ (_stbi__get32le($s)|0);
+ $4 = (_stbi__get32le($s)|0);
+ switch ($4|0) {
+ case 124: case 12: case 40: case 56: case 108: {
+ $$0 = 1;
+ return ($$0|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__do_png($p,$x,$y,$n,$req_comp) {
+ $p = $p|0;
+ $x = $x|0;
+ $y = $y|0;
+ $n = $n|0;
+ $req_comp = $req_comp|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $result$0 = 0, $result$1 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($req_comp>>>0)>(4);
+ if ($0) {
+ _stbi__err(14592);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $1 = (_stbi__parse_png_file($p,0,$req_comp)|0);
+ $2 = ($1|0)==(0);
+ if ($2) {
+ $result$1 = 0;
+ } else {
+ $3 = ((($p)) + 16|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(16);
+ if ($5) {
+ $6 = (_stbi__reduce_png($p)|0);
+ $7 = ($6|0)==(0);
+ if ($7) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $8 = ((($p)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ HEAP32[$8>>2] = 0;
+ $10 = ($req_comp|0)==(0);
+ if ($10) {
+ $result$0 = $9;
+ } else {
+ $11 = HEAP32[$p>>2]|0;
+ $12 = ((($11)) + 12|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($13|0)==($req_comp|0);
+ if ($14) {
+ $result$0 = $9;
+ } else {
+ $15 = HEAP32[$11>>2]|0;
+ $16 = ((($11)) + 4|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (_stbi__convert_format($9,$13,$req_comp,$15,$17)|0);
+ $19 = HEAP32[$p>>2]|0;
+ $20 = ((($19)) + 12|0);
+ HEAP32[$20>>2] = $req_comp;
+ $21 = ($18|0)==(0|0);
+ if ($21) {
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ $result$0 = $18;
+ }
+ }
+ }
+ $22 = HEAP32[$p>>2]|0;
+ $23 = HEAP32[$22>>2]|0;
+ HEAP32[$x>>2] = $23;
+ $24 = HEAP32[$p>>2]|0;
+ $25 = ((($24)) + 4|0);
+ $26 = HEAP32[$25>>2]|0;
+ HEAP32[$y>>2] = $26;
+ $27 = ($n|0)==(0|0);
+ if ($27) {
+ $result$1 = $result$0;
+ } else {
+ $28 = HEAP32[$p>>2]|0;
+ $29 = ((($28)) + 8|0);
+ $30 = HEAP32[$29>>2]|0;
+ HEAP32[$n>>2] = $30;
+ $result$1 = $result$0;
+ }
+ }
+ $31 = ((($p)) + 12|0);
+ $32 = HEAP32[$31>>2]|0;
+ _free($32);
+ HEAP32[$31>>2] = 0;
+ $33 = ((($p)) + 8|0);
+ $34 = HEAP32[$33>>2]|0;
+ _free($34);
+ HEAP32[$33>>2] = 0;
+ $35 = ((($p)) + 4|0);
+ $36 = HEAP32[$35>>2]|0;
+ _free($36);
+ HEAP32[$35>>2] = 0;
+ $$0 = $result$1;
+ return ($$0|0);
+}
+function _stbi__reduce_png($p) {
+ $p = $p|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$p>>2]|0;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = Math_imul($3, $1)|0;
+ $5 = ((($0)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = Math_imul($4, $6)|0;
+ $8 = ((($p)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ((($p)) + 16|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ($11|0)==(16);
+ if (!($12)) {
+ return 1;
+ }
+ $13 = (_stbi__malloc($7)|0);
+ $14 = ($7|0)>(0);
+ if ($14) {
+ $15 = Math_imul($3, $1)|0;
+ $16 = Math_imul($15, $6)|0;
+ $i$01 = 0;
+ while(1) {
+ $17 = (($9) + ($i$01<<1)|0);
+ $18 = HEAP16[$17>>1]|0;
+ $19 = ($18&65535) >>> 8;
+ $20 = $19&255;
+ $21 = (($13) + ($i$01)|0);
+ HEAP8[$21>>0] = $20;
+ $22 = (($i$01) + 1)|0;
+ $exitcond = ($22|0)==($16|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $22;
+ }
+ }
+ }
+ HEAP32[$8>>2] = $13;
+ _free($9);
+ return 1;
+}
+function _stbi__setup_jpeg($j) {
+ $j = $j|0;
+ var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18180|0);
+ HEAP32[$0>>2] = 2;
+ $1 = ((($j)) + 18184|0);
+ HEAP32[$1>>2] = 1;
+ $2 = ((($j)) + 18188|0);
+ HEAP32[$2>>2] = 1;
+ return;
+}
+function _load_jpeg_image($z,$out_x,$out_y,$comp,$req_comp) {
+ $z = $z|0;
+ $out_x = $out_x|0;
+ $out_y = $out_y|0;
+ $comp = $comp|0;
+ $req_comp = $req_comp|0;
+ var $$ = 0, $$0 = 0, $$1 = 0, $$in = 0, $$in4 = 0, $$pr = 0, $$pr5 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
+ var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
+ var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
+ var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
+ var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
+ var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0;
+ var $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0;
+ var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0;
+ var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
+ var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
+ var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $coutput = 0, $exitcond = 0, $i$023 = 0, $i$120 = 0, $i$217 = 0, $i$315 = 0, $j$025 = 0;
+ var $k$028 = 0, $k$113 = 0, $or$cond3 = 0, $out$022 = 0, $out$119 = 0, $out$214 = 0, $res_comp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0;
+ $coutput = sp + 128|0;
+ $res_comp = sp;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = ((($0)) + 8|0);
+ HEAP32[$1>>2] = 0;
+ $2 = ($req_comp>>>0)>(4);
+ if ($2) {
+ _stbi__err(14592);
+ $$1 = 0;
+ STACKTOP = sp;return ($$1|0);
+ }
+ $3 = (_stbi__decode_jpeg_image($z)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ _stbi__cleanup_jpeg($z);
+ $$1 = 0;
+ STACKTOP = sp;return ($$1|0);
+ }
+ $5 = ($req_comp|0)==(0);
+ if ($5) {
+ $6 = HEAP32[$z>>2]|0;
+ $7 = ((($6)) + 8|0);
+ $8 = HEAP32[$7>>2]|0;
+ $13 = $8;
+ } else {
+ $13 = $req_comp;
+ }
+ $9 = HEAP32[$z>>2]|0;
+ $10 = ((($9)) + 8|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ($11|0)==(3);
+ $14 = ($13|0)<(3);
+ $or$cond3 = $14 & $12;
+ $$ = $or$cond3 ? 1 : $11;
+ $15 = ($$|0)>(0);
+ L12: do {
+ if ($15) {
+ $16 = ((($z)) + 17796|0);
+ $17 = ((($z)) + 17800|0);
+ $18 = ((($z)) + 18188|0);
+ $k$028 = 0;
+ while(1) {
+ $19 = (($res_comp) + ($k$028<<5)|0);
+ $20 = HEAP32[$z>>2]|0;
+ $21 = HEAP32[$20>>2]|0;
+ $22 = (($21) + 3)|0;
+ $23 = (_stbi__malloc($22)|0);
+ $24 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 56|0);
+ HEAP32[$24>>2] = $23;
+ $25 = ($23|0)==(0|0);
+ if ($25) {
+ break;
+ }
+ $26 = HEAP32[$16>>2]|0;
+ $27 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 4|0);
+ $28 = HEAP32[$27>>2]|0;
+ $29 = (($26|0) / ($28|0))&-1;
+ $30 = (((($res_comp) + ($k$028<<5)|0)) + 12|0);
+ HEAP32[$30>>2] = $29;
+ $31 = HEAP32[$17>>2]|0;
+ $32 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 8|0);
+ $33 = HEAP32[$32>>2]|0;
+ $34 = (($31|0) / ($33|0))&-1;
+ $35 = (((($res_comp) + ($k$028<<5)|0)) + 16|0);
+ HEAP32[$35>>2] = $34;
+ $36 = $34 >> 1;
+ $37 = (((($res_comp) + ($k$028<<5)|0)) + 24|0);
+ HEAP32[$37>>2] = $36;
+ $38 = HEAP32[$z>>2]|0;
+ $39 = HEAP32[$38>>2]|0;
+ $40 = HEAP32[$30>>2]|0;
+ $41 = (($39) + -1)|0;
+ $42 = (($41) + ($40))|0;
+ $43 = (($42>>>0) / ($40>>>0))&-1;
+ $44 = (((($res_comp) + ($k$028<<5)|0)) + 20|0);
+ HEAP32[$44>>2] = $43;
+ $45 = (((($res_comp) + ($k$028<<5)|0)) + 28|0);
+ HEAP32[$45>>2] = 0;
+ $46 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 44|0);
+ $47 = HEAP32[$46>>2]|0;
+ $48 = (((($res_comp) + ($k$028<<5)|0)) + 8|0);
+ HEAP32[$48>>2] = $47;
+ $49 = (((($res_comp) + ($k$028<<5)|0)) + 4|0);
+ HEAP32[$49>>2] = $47;
+ $50 = HEAP32[$30>>2]|0;
+ $51 = ($50|0)==(1);
+ do {
+ if ($51) {
+ $52 = HEAP32[$35>>2]|0;
+ $53 = ($52|0)==(1);
+ if ($53) {
+ HEAP32[$19>>2] = 2;
+ break;
+ }
+ $$pr = HEAP32[$30>>2]|0;
+ $54 = ($$pr|0)==(1);
+ if ($54) {
+ $55 = HEAP32[$35>>2]|0;
+ $56 = ($55|0)==(2);
+ if ($56) {
+ HEAP32[$19>>2] = 3;
+ } else {
+ label = 17;
+ }
+ } else {
+ $57 = $$pr;
+ label = 18;
+ }
+ } else {
+ label = 17;
+ }
+ } while(0);
+ if ((label|0) == 17) {
+ label = 0;
+ $$pr5 = HEAP32[$30>>2]|0;
+ $57 = $$pr5;
+ label = 18;
+ }
+ do {
+ if ((label|0) == 18) {
+ label = 0;
+ $58 = ($57|0)==(2);
+ if ($58) {
+ $59 = HEAP32[$35>>2]|0;
+ $60 = ($59|0)==(1);
+ if ($60) {
+ HEAP32[$19>>2] = 4;
+ break;
+ }
+ }
+ $61 = HEAP32[$30>>2]|0;
+ $62 = ($61|0)==(2);
+ if ($62) {
+ $63 = HEAP32[$35>>2]|0;
+ $64 = ($63|0)==(2);
+ if ($64) {
+ $65 = HEAP32[$18>>2]|0;
+ HEAP32[$19>>2] = $65;
+ break;
+ }
+ }
+ HEAP32[$19>>2] = 5;
+ }
+ } while(0);
+ $66 = (($k$028) + 1)|0;
+ $67 = ($66|0)<($$|0);
+ if ($67) {
+ $k$028 = $66;
+ } else {
+ label = 26;
+ break L12;
+ }
+ }
+ _stbi__cleanup_jpeg($z);
+ _stbi__err(12905);
+ $$0 = 0;
+ } else {
+ label = 26;
+ }
+ } while(0);
+ do {
+ if ((label|0) == 26) {
+ $68 = HEAP32[$z>>2]|0;
+ $69 = HEAP32[$68>>2]|0;
+ $70 = Math_imul($69, $13)|0;
+ $71 = ((($68)) + 4|0);
+ $72 = HEAP32[$71>>2]|0;
+ $73 = Math_imul($70, $72)|0;
+ $74 = (($73) + 1)|0;
+ $75 = (_stbi__malloc($74)|0);
+ $76 = ($75|0)==(0|0);
+ if ($76) {
+ _stbi__cleanup_jpeg($z);
+ _stbi__err(12905);
+ $$0 = 0;
+ break;
+ }
+ $77 = HEAP32[$z>>2]|0;
+ $78 = ((($77)) + 4|0);
+ $79 = HEAP32[$78>>2]|0;
+ $80 = ($79|0)==(0);
+ if (!($80)) {
+ $81 = ($$|0)>(0);
+ $82 = ($13|0)>(2);
+ $83 = ((($z)) + 18148|0);
+ $84 = ((($z)) + 18184|0);
+ $85 = ((($coutput)) + 4|0);
+ $86 = ((($coutput)) + 8|0);
+ $87 = ((($coutput)) + 4|0);
+ $88 = ((($coutput)) + 8|0);
+ $89 = ($13|0)==(1);
+ $91 = $77;$j$025 = 0;
+ while(1) {
+ $90 = HEAP32[$91>>2]|0;
+ $92 = Math_imul($j$025, $13)|0;
+ $93 = Math_imul($92, $90)|0;
+ $94 = (($75) + ($93)|0);
+ if ($81) {
+ $k$113 = 0;
+ while(1) {
+ $95 = (((($res_comp) + ($k$113<<5)|0)) + 24|0);
+ $96 = HEAP32[$95>>2]|0;
+ $97 = (((($res_comp) + ($k$113<<5)|0)) + 16|0);
+ $98 = HEAP32[$97>>2]|0;
+ $99 = $98 >> 1;
+ $100 = ($96|0)>=($99|0);
+ $101 = (($res_comp) + ($k$113<<5)|0);
+ $102 = HEAP32[$101>>2]|0;
+ $103 = (((((($z)) + 17820|0) + (($k$113*72)|0)|0)) + 56|0);
+ $104 = HEAP32[$103>>2]|0;
+ $105 = (((($res_comp) + ($k$113<<5)|0)) + 8|0);
+ $106 = (((($res_comp) + ($k$113<<5)|0)) + 4|0);
+ $$in = $100 ? $105 : $106;
+ $107 = HEAP32[$$in>>2]|0;
+ $$in4 = $100 ? $106 : $105;
+ $108 = HEAP32[$$in4>>2]|0;
+ $109 = (((($res_comp) + ($k$113<<5)|0)) + 20|0);
+ $110 = HEAP32[$109>>2]|0;
+ $111 = (((($res_comp) + ($k$113<<5)|0)) + 12|0);
+ $112 = HEAP32[$111>>2]|0;
+ $113 = (FUNCTION_TABLE_iiiiii[$102 & 7]($104,$107,$108,$110,$112)|0);
+ $114 = (($coutput) + ($k$113<<2)|0);
+ HEAP32[$114>>2] = $113;
+ $115 = HEAP32[$95>>2]|0;
+ $116 = (($115) + 1)|0;
+ HEAP32[$95>>2] = $116;
+ $117 = HEAP32[$97>>2]|0;
+ $118 = ($116|0)<($117|0);
+ if (!($118)) {
+ HEAP32[$95>>2] = 0;
+ $119 = HEAP32[$105>>2]|0;
+ HEAP32[$106>>2] = $119;
+ $120 = (((($res_comp) + ($k$113<<5)|0)) + 28|0);
+ $121 = HEAP32[$120>>2]|0;
+ $122 = (($121) + 1)|0;
+ HEAP32[$120>>2] = $122;
+ $123 = (((((($z)) + 17820|0) + (($k$113*72)|0)|0)) + 32|0);
+ $124 = HEAP32[$123>>2]|0;
+ $125 = ($122|0)<($124|0);
+ if ($125) {
+ $126 = (((((($z)) + 17820|0) + (($k$113*72)|0)|0)) + 36|0);
+ $127 = HEAP32[$126>>2]|0;
+ $128 = HEAP32[$105>>2]|0;
+ $129 = (($128) + ($127)|0);
+ HEAP32[$105>>2] = $129;
+ }
+ }
+ $130 = (($k$113) + 1)|0;
+ $exitcond = ($130|0)==($$|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $k$113 = $130;
+ }
+ }
+ }
+ $131 = HEAP32[$coutput>>2]|0;
+ $132 = HEAP32[$z>>2]|0;
+ L55: do {
+ if ($82) {
+ $133 = ((($132)) + 8|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = ($134|0)==(3);
+ if (!($135)) {
+ $136 = HEAP32[$z>>2]|0;
+ $137 = HEAP32[$136>>2]|0;
+ $138 = ($137|0)==(0);
+ if ($138) {
+ break;
+ } else {
+ $i$120 = 0;$out$119 = $94;
+ }
+ while(1) {
+ $164 = (($131) + ($i$120)|0);
+ $165 = HEAP8[$164>>0]|0;
+ $166 = ((($out$119)) + 2|0);
+ HEAP8[$166>>0] = $165;
+ $167 = ((($out$119)) + 1|0);
+ HEAP8[$167>>0] = $165;
+ HEAP8[$out$119>>0] = $165;
+ $168 = ((($out$119)) + 3|0);
+ HEAP8[$168>>0] = -1;
+ $169 = (($out$119) + ($13)|0);
+ $170 = (($i$120) + 1)|0;
+ $171 = HEAP32[$z>>2]|0;
+ $172 = HEAP32[$171>>2]|0;
+ $173 = ($170>>>0)<($172>>>0);
+ if ($173) {
+ $i$120 = $170;$out$119 = $169;
+ } else {
+ break L55;
+ }
+ }
+ }
+ $139 = HEAP32[$83>>2]|0;
+ $140 = ($139|0)==(3);
+ if (!($140)) {
+ $160 = HEAP32[$84>>2]|0;
+ $161 = HEAP32[$85>>2]|0;
+ $162 = HEAP32[$86>>2]|0;
+ $163 = HEAP32[$132>>2]|0;
+ FUNCTION_TABLE_viiiiii[$160 & 3]($94,$131,$161,$162,$163,$13);
+ break;
+ }
+ $141 = HEAP32[$z>>2]|0;
+ $142 = HEAP32[$141>>2]|0;
+ $143 = ($142|0)==(0);
+ if (!($143)) {
+ $i$023 = 0;$out$022 = $94;
+ while(1) {
+ $144 = (($131) + ($i$023)|0);
+ $145 = HEAP8[$144>>0]|0;
+ HEAP8[$out$022>>0] = $145;
+ $146 = HEAP32[$87>>2]|0;
+ $147 = (($146) + ($i$023)|0);
+ $148 = HEAP8[$147>>0]|0;
+ $149 = ((($out$022)) + 1|0);
+ HEAP8[$149>>0] = $148;
+ $150 = HEAP32[$88>>2]|0;
+ $151 = (($150) + ($i$023)|0);
+ $152 = HEAP8[$151>>0]|0;
+ $153 = ((($out$022)) + 2|0);
+ HEAP8[$153>>0] = $152;
+ $154 = ((($out$022)) + 3|0);
+ HEAP8[$154>>0] = -1;
+ $155 = (($out$022) + ($13)|0);
+ $156 = (($i$023) + 1)|0;
+ $157 = HEAP32[$z>>2]|0;
+ $158 = HEAP32[$157>>2]|0;
+ $159 = ($156>>>0)<($158>>>0);
+ if ($159) {
+ $i$023 = $156;$out$022 = $155;
+ } else {
+ break;
+ }
+ }
+ }
+ } else {
+ $174 = HEAP32[$132>>2]|0;
+ $175 = ($174|0)==(0);
+ if ($89) {
+ if ($175) {
+ break;
+ } else {
+ $i$217 = 0;
+ }
+ while(1) {
+ $176 = (($131) + ($i$217)|0);
+ $177 = HEAP8[$176>>0]|0;
+ $$sum = (($i$217) + ($93))|0;
+ $178 = (($75) + ($$sum)|0);
+ HEAP8[$178>>0] = $177;
+ $179 = (($i$217) + 1)|0;
+ $180 = HEAP32[$z>>2]|0;
+ $181 = HEAP32[$180>>2]|0;
+ $182 = ($179>>>0)<($181>>>0);
+ if ($182) {
+ $i$217 = $179;
+ } else {
+ break;
+ }
+ }
+ } else {
+ if ($175) {
+ break;
+ } else {
+ $i$315 = 0;$out$214 = $94;
+ }
+ while(1) {
+ $183 = (($131) + ($i$315)|0);
+ $184 = HEAP8[$183>>0]|0;
+ $185 = ((($out$214)) + 1|0);
+ HEAP8[$out$214>>0] = $184;
+ $186 = ((($out$214)) + 2|0);
+ HEAP8[$185>>0] = -1;
+ $187 = (($i$315) + 1)|0;
+ $188 = HEAP32[$z>>2]|0;
+ $189 = HEAP32[$188>>2]|0;
+ $190 = ($187>>>0)<($189>>>0);
+ if ($190) {
+ $i$315 = $187;$out$214 = $186;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $191 = (($j$025) + 1)|0;
+ $192 = HEAP32[$z>>2]|0;
+ $193 = ((($192)) + 4|0);
+ $194 = HEAP32[$193>>2]|0;
+ $195 = ($191>>>0)<($194>>>0);
+ if ($195) {
+ $91 = $192;$j$025 = $191;
+ } else {
+ break;
+ }
+ }
+ }
+ _stbi__cleanup_jpeg($z);
+ $196 = HEAP32[$z>>2]|0;
+ $197 = HEAP32[$196>>2]|0;
+ HEAP32[$out_x>>2] = $197;
+ $198 = HEAP32[$z>>2]|0;
+ $199 = ((($198)) + 4|0);
+ $200 = HEAP32[$199>>2]|0;
+ HEAP32[$out_y>>2] = $200;
+ $201 = ($comp|0)==(0|0);
+ if ($201) {
+ $$0 = $75;
+ } else {
+ $202 = HEAP32[$z>>2]|0;
+ $203 = ((($202)) + 8|0);
+ $204 = HEAP32[$203>>2]|0;
+ HEAP32[$comp>>2] = $204;
+ $$0 = $75;
+ }
+ }
+ } while(0);
+ $$1 = $$0;
+ STACKTOP = sp;return ($$1|0);
+}
+function _stbi__decode_jpeg_image($j) {
+ $j = $j|0;
+ var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 17868|0);
+ HEAP32[$0>>2] = 0;
+ $1 = ((($j)) + 17872|0);
+ HEAP32[$1>>2] = 0;
+ $2 = ((($j)) + 17940|0);
+ HEAP32[$2>>2] = 0;
+ $3 = ((($j)) + 17944|0);
+ HEAP32[$3>>2] = 0;
+ $4 = ((($j)) + 18012|0);
+ HEAP32[$4>>2] = 0;
+ $5 = ((($j)) + 18016|0);
+ HEAP32[$5>>2] = 0;
+ $6 = ((($j)) + 18084|0);
+ HEAP32[$6>>2] = 0;
+ $7 = ((($j)) + 18088|0);
+ HEAP32[$7>>2] = 0;
+ $8 = ((($j)) + 18172|0);
+ HEAP32[$8>>2] = 0;
+ $9 = (_stbi__decode_jpeg_header($j,0)|0);
+ $10 = ($9|0)==(0);
+ if ($10) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $11 = (_stbi__get_marker($j)|0);
+ $12 = ((($j)) + 18116|0);
+ $$sink = $11;
+ L4: while(1) {
+ $13 = $$sink&255;
+ L6: do {
+ switch ($13|0) {
+ case 217: {
+ label = 13;
+ break L4;
+ break;
+ }
+ case 218: {
+ $14 = (_stbi__process_scan_header($j)|0);
+ $15 = ($14|0)==(0);
+ if ($15) {
+ $$0 = 0;
+ label = 15;
+ break L4;
+ }
+ $16 = (_stbi__parse_entropy_coded_data($j)|0);
+ $17 = ($16|0)==(0);
+ if ($17) {
+ $$0 = 0;
+ label = 15;
+ break L4;
+ }
+ $18 = HEAP8[$12>>0]|0;
+ $19 = ($18<<24>>24)==(-1);
+ if ($19) {
+ L11: while(1) {
+ $20 = HEAP32[$j>>2]|0;
+ $21 = (_stbi__at_eof($20)|0);
+ $22 = ($21|0)==(0);
+ if (!($22)) {
+ break L6;
+ }
+ $23 = HEAP32[$j>>2]|0;
+ $24 = (_stbi__get8($23)|0);
+ switch ($24<<24>>24) {
+ case 0: {
+ break;
+ }
+ case -1: {
+ break L11;
+ break;
+ }
+ default: {
+ label = 10;
+ break L4;
+ }
+ }
+ }
+ $25 = HEAP32[$j>>2]|0;
+ $26 = (_stbi__get8($25)|0);
+ HEAP8[$12>>0] = $26;
+ }
+ break;
+ }
+ default: {
+ $27 = (_stbi__process_marker($j,$13)|0);
+ $28 = ($27|0)==(0);
+ if ($28) {
+ $$0 = 0;
+ label = 15;
+ break L4;
+ }
+ }
+ }
+ } while(0);
+ $29 = (_stbi__get_marker($j)|0);
+ $$sink = $29;
+ }
+ if ((label|0) == 10) {
+ _stbi__err(14605);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 13) {
+ $30 = ((($j)) + 18124|0);
+ $31 = HEAP32[$30>>2]|0;
+ $32 = ($31|0)==(0);
+ if ($32) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ _stbi__jpeg_finish($j);
+ $$0 = 1;
+ return ($$0|0);
+ }
+ else if ((label|0) == 15) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__cleanup_jpeg($j) {
+ $j = $j|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var $i$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$j>>2]|0;
+ $1 = ((($0)) + 8|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(0);
+ if ($3) {
+ $i$01 = 0;
+ } else {
+ return;
+ }
+ while(1) {
+ $4 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 48|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)==(0|0);
+ if (!($6)) {
+ _free($5);
+ HEAP32[$4>>2] = 0;
+ $7 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 44|0);
+ HEAP32[$7>>2] = 0;
+ }
+ $8 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 52|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($9|0)==(0|0);
+ if (!($10)) {
+ _free($9);
+ HEAP32[$8>>2] = 0;
+ $11 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 60|0);
+ HEAP32[$11>>2] = 0;
+ }
+ $12 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 56|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($13|0)==(0|0);
+ if (!($14)) {
+ _free($13);
+ HEAP32[$12>>2] = 0;
+ }
+ $15 = (($i$01) + 1)|0;
+ $16 = HEAP32[$j>>2]|0;
+ $17 = ((($16)) + 8|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = ($15|0)<($18|0);
+ if ($19) {
+ $i$01 = $15;
+ } else {
+ break;
+ }
+ }
+ return;
+}
+function _resample_row_1($out,$in_near,$in_far,$w,$hs) {
+ $out = $out|0;
+ $in_near = $in_near|0;
+ $in_far = $in_far|0;
+ $w = $w|0;
+ $hs = $hs|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return ($in_near|0);
+}
+function _stbi__resample_row_v_2($out,$in_near,$in_far,$w,$hs) {
+ $out = $out|0;
+ $in_near = $in_near|0;
+ $in_far = $in_far|0;
+ $w = $w|0;
+ $hs = $hs|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($w|0)>(0);
+ if ($0) {
+ $i$01 = 0;
+ } else {
+ return ($out|0);
+ }
+ while(1) {
+ $1 = (($in_near) + ($i$01)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = ($3*3)|0;
+ $5 = (($in_far) + ($i$01)|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6&255;
+ $8 = (($7) + 2)|0;
+ $9 = (($8) + ($4))|0;
+ $10 = $9 >>> 2;
+ $11 = $10&255;
+ $12 = (($out) + ($i$01)|0);
+ HEAP8[$12>>0] = $11;
+ $13 = (($i$01) + 1)|0;
+ $exitcond = ($13|0)==($w|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $13;
+ }
+ }
+ return ($out|0);
+}
+function _stbi__resample_row_h_2($out,$in_near,$in_far,$w,$hs) {
+ $out = $out|0;
+ $in_near = $in_near|0;
+ $in_far = $in_far|0;
+ $w = $w|0;
+ $hs = $hs|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$0$lcssa = 0, $i$01 = 0, $phitmp = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($w|0)==(1);
+ $1 = HEAP8[$in_near>>0]|0;
+ if ($0) {
+ $2 = ((($out)) + 1|0);
+ HEAP8[$2>>0] = $1;
+ HEAP8[$out>>0] = $1;
+ return ($out|0);
+ }
+ HEAP8[$out>>0] = $1;
+ $3 = HEAP8[$in_near>>0]|0;
+ $4 = $3&255;
+ $5 = ($4*3)|0;
+ $6 = ((($in_near)) + 1|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = $7&255;
+ $9 = (($8) + 2)|0;
+ $10 = (($9) + ($5))|0;
+ $11 = $10 >>> 2;
+ $12 = $11&255;
+ $13 = ((($out)) + 1|0);
+ HEAP8[$13>>0] = $12;
+ $14 = (($w) + -1)|0;
+ $15 = ($14|0)>(1);
+ if ($15) {
+ $16 = (($w) + -1)|0;
+ $i$01 = 1;
+ while(1) {
+ $17 = (($in_near) + ($i$01)|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = $18&255;
+ $20 = ($19*3)|0;
+ $21 = (($20) + 2)|0;
+ $22 = (($i$01) + -1)|0;
+ $23 = (($in_near) + ($22)|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = $24&255;
+ $26 = (($21) + ($25))|0;
+ $27 = $26 >>> 2;
+ $28 = $27&255;
+ $29 = $i$01 << 1;
+ $30 = (($out) + ($29)|0);
+ HEAP8[$30>>0] = $28;
+ $31 = (($i$01) + 1)|0;
+ $32 = (($in_near) + ($31)|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = $33&255;
+ $35 = (($21) + ($34))|0;
+ $36 = $35 >>> 2;
+ $37 = $36&255;
+ $38 = $29 | 1;
+ $39 = (($out) + ($38)|0);
+ HEAP8[$39>>0] = $37;
+ $exitcond = ($31|0)==($16|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $31;
+ }
+ }
+ $phitmp = $16 << 1;
+ $i$0$lcssa = $phitmp;
+ } else {
+ $i$0$lcssa = 2;
+ }
+ $40 = (($w) + -2)|0;
+ $41 = (($in_near) + ($40)|0);
+ $42 = HEAP8[$41>>0]|0;
+ $43 = $42&255;
+ $44 = ($43*3)|0;
+ $45 = (($in_near) + ($14)|0);
+ $46 = HEAP8[$45>>0]|0;
+ $47 = $46&255;
+ $48 = (($47) + 2)|0;
+ $49 = (($48) + ($44))|0;
+ $50 = $49 >>> 2;
+ $51 = $50&255;
+ $52 = (($out) + ($i$0$lcssa)|0);
+ HEAP8[$52>>0] = $51;
+ $53 = HEAP8[$45>>0]|0;
+ $54 = $i$0$lcssa | 1;
+ $55 = (($out) + ($54)|0);
+ HEAP8[$55>>0] = $53;
+ return ($out|0);
+}
+function _stbi__resample_row_generic($out,$in_near,$in_far,$w,$hs) {
+ $out = $out|0;
+ $in_near = $in_near|0;
+ $in_far = $in_far|0;
+ $w = $w|0;
+ $hs = $hs|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $exitcond4 = 0, $i$02 = 0, $j$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($w|0)>(0);
+ if (!($0)) {
+ return ($out|0);
+ }
+ $1 = ($hs|0)>(0);
+ $i$02 = 0;
+ while(1) {
+ if ($1) {
+ $2 = (($in_near) + ($i$02)|0);
+ $3 = Math_imul($i$02, $hs)|0;
+ $j$01 = 0;
+ while(1) {
+ $4 = HEAP8[$2>>0]|0;
+ $5 = (($j$01) + ($3))|0;
+ $6 = (($out) + ($5)|0);
+ HEAP8[$6>>0] = $4;
+ $7 = (($j$01) + 1)|0;
+ $exitcond = ($7|0)==($hs|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $j$01 = $7;
+ }
+ }
+ }
+ $8 = (($i$02) + 1)|0;
+ $exitcond4 = ($8|0)==($w|0);
+ if ($exitcond4) {
+ break;
+ } else {
+ $i$02 = $8;
+ }
+ }
+ return ($out|0);
+}
+function _stbi__process_scan_header($z) {
+ $z = $z|0;
+ var $$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
+ var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
+ var $8 = 0, $9 = 0, $i$010 = 0, $or$cond1 = 0, $or$cond2 = 0, $which$0$lcssa = 0, $which$07 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[$z>>2]|0;
+ $1 = (_stbi__get16be($0)|0);
+ $2 = HEAP32[$z>>2]|0;
+ $3 = (_stbi__get8($2)|0);
+ $4 = $3&255;
+ $5 = ((($z)) + 18152|0);
+ HEAP32[$5>>2] = $4;
+ $6 = (($3) + -1)<<24>>24;
+ $7 = ($6&255)>(3);
+ if (!($7)) {
+ $8 = HEAP32[$z>>2]|0;
+ $9 = ((($8)) + 8|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($4|0)>($10|0);
+ if (!($11)) {
+ $12 = $4 << 1;
+ $13 = (($12) + 6)|0;
+ $14 = ($1|0)==($13|0);
+ if (!($14)) {
+ _stbi__err(14859);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $15 = HEAP32[$5>>2]|0;
+ $16 = ($15|0)>(0);
+ $17 = HEAP32[$z>>2]|0;
+ $18 = (_stbi__get8($17)|0);
+ $19 = $18&255;
+ L8: do {
+ if ($16) {
+ $30 = $19;$i$010 = 0;
+ while(1) {
+ $20 = HEAP32[$z>>2]|0;
+ $21 = (_stbi__get8($20)|0);
+ $22 = $21&255;
+ $23 = HEAP32[$z>>2]|0;
+ $24 = ((($23)) + 8|0);
+ $25 = HEAP32[$24>>2]|0;
+ $26 = ($25|0)>(0);
+ L11: do {
+ if ($26) {
+ $which$07 = 0;
+ while(1) {
+ $27 = (((($z)) + 17820|0) + (($which$07*72)|0)|0);
+ $28 = HEAP32[$27>>2]|0;
+ $29 = ($28|0)==($30|0);
+ if ($29) {
+ $which$0$lcssa = $which$07;
+ break L11;
+ }
+ $31 = (($which$07) + 1)|0;
+ $32 = HEAP32[$z>>2]|0;
+ $33 = ((($32)) + 8|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = ($31|0)<($34|0);
+ if ($35) {
+ $which$07 = $31;
+ } else {
+ $which$0$lcssa = $31;
+ break;
+ }
+ }
+ } else {
+ $which$0$lcssa = 0;
+ }
+ } while(0);
+ $36 = HEAP32[$z>>2]|0;
+ $37 = ((($36)) + 8|0);
+ $38 = HEAP32[$37>>2]|0;
+ $39 = ($which$0$lcssa|0)==($38|0);
+ if ($39) {
+ $$0 = 0;
+ label = 26;
+ break;
+ }
+ $40 = $22 >>> 4;
+ $41 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 16|0);
+ HEAP32[$41>>2] = $40;
+ $42 = ($21&255)>(63);
+ if ($42) {
+ label = 12;
+ break;
+ }
+ $43 = $22 & 15;
+ $44 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 20|0);
+ HEAP32[$44>>2] = $43;
+ $45 = ($43>>>0)>(3);
+ if ($45) {
+ label = 14;
+ break;
+ }
+ $46 = (((($z)) + 18156|0) + ($i$010<<2)|0);
+ HEAP32[$46>>2] = $which$0$lcssa;
+ $47 = (($i$010) + 1)|0;
+ $48 = HEAP32[$5>>2]|0;
+ $49 = ($47|0)<($48|0);
+ $50 = HEAP32[$z>>2]|0;
+ $51 = (_stbi__get8($50)|0);
+ $52 = $51&255;
+ if ($49) {
+ $30 = $52;$i$010 = $47;
+ } else {
+ $$lcssa = $52;
+ break L8;
+ }
+ }
+ if ((label|0) == 12) {
+ _stbi__err(14871);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 14) {
+ _stbi__err(14883);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 26) {
+ return ($$0|0);
+ }
+ } else {
+ $$lcssa = $19;
+ }
+ } while(0);
+ $53 = ((($z)) + 18128|0);
+ HEAP32[$53>>2] = $$lcssa;
+ $54 = HEAP32[$z>>2]|0;
+ $55 = (_stbi__get8($54)|0);
+ $56 = $55&255;
+ $57 = ((($z)) + 18132|0);
+ HEAP32[$57>>2] = $56;
+ $58 = HEAP32[$z>>2]|0;
+ $59 = (_stbi__get8($58)|0);
+ $60 = $59&255;
+ $61 = $60 >>> 4;
+ $62 = ((($z)) + 18136|0);
+ HEAP32[$62>>2] = $61;
+ $63 = $60 & 15;
+ $64 = ((($z)) + 18140|0);
+ HEAP32[$64>>2] = $63;
+ $65 = ((($z)) + 18124|0);
+ $66 = HEAP32[$65>>2]|0;
+ $67 = ($66|0)==(0);
+ $68 = HEAP32[$53>>2]|0;
+ if (!($67)) {
+ $69 = ($68|0)>(63);
+ if (!($69)) {
+ $70 = HEAP32[$57>>2]|0;
+ $71 = ($70|0)>(63);
+ $72 = ($68|0)>($70|0);
+ $or$cond1 = $71 | $72;
+ if (!($or$cond1)) {
+ $73 = HEAP32[$62>>2]|0;
+ $74 = ($73|0)>(13);
+ $75 = ($63>>>0)>(13);
+ $or$cond2 = $75 | $74;
+ if (!($or$cond2)) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ }
+ }
+ _stbi__err(14895);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $76 = ($68|0)==(0);
+ if (!($76)) {
+ _stbi__err(14895);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $77 = HEAP32[$62>>2]|0;
+ $78 = $77 | $63;
+ $79 = ($78|0)==(0);
+ if ($79) {
+ HEAP32[$57>>2] = 63;
+ $$0 = 1;
+ return ($$0|0);
+ } else {
+ _stbi__err(14895);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ }
+ _stbi__err(14835);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__parse_entropy_coded_data($z) {
+ $z = $z|0;
+ var $$0 = 0, $$1 = 0, $$2 = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
+ var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
+ var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
+ var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
+ var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
+ var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0;
+ var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0;
+ var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
+ var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
+ var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
+ var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $data = 0, $i$023 = 0, $i1$035 = 0, $i13$054 = 0;
+ var $i6$040 = 0, $j$024 = 0, $j14$057 = 0, $j2$038 = 0, $j7$043 = 0, $k$032 = 0, $k15$051 = 0, $tmp = 0, $tmp5 = 0, $x$026 = 0, $x16$045 = 0, $y$029 = 0, $y17$048 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0;
+ $data = sp;
+ _stbi__jpeg_reset($z);
+ $0 = ((($z)) + 18124|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ $3 = ((($z)) + 18152|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(1);
+ if ($2) {
+ if ($5) {
+ $6 = ((($z)) + 18156|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 28|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = (($9) + 7)|0;
+ $11 = $10 >> 3;
+ $12 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 32|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (($13) + 7)|0;
+ $15 = $14 >> 3;
+ $16 = ($15|0)>(0);
+ L5: do {
+ if ($16) {
+ $17 = ($11|0)>(0);
+ $18 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 20|0);
+ $19 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 16|0);
+ $20 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 12|0);
+ $21 = ((($z)) + 18180|0);
+ $22 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 44|0);
+ $23 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 36|0);
+ $24 = ((($z)) + 18176|0);
+ $25 = ((($z)) + 18112|0);
+ $26 = ((($z)) + 18116|0);
+ $j$024 = 0;
+ while(1) {
+ if ($17) {
+ $i$023 = 0;
+ while(1) {
+ $27 = HEAP32[$18>>2]|0;
+ $28 = HEAP32[$19>>2]|0;
+ $29 = (((($z)) + 4|0) + (($28*1680)|0)|0);
+ $30 = (((($z)) + 6724|0) + (($27*1680)|0)|0);
+ $31 = (((($z)) + 13700|0) + ($27<<10)|0);
+ $32 = HEAP32[$20>>2]|0;
+ $33 = (((($z)) + 13444|0) + ($32<<6)|0);
+ $34 = (_stbi__jpeg_decode_block($z,$data,$29,$30,$31,$7,$33)|0);
+ $35 = ($34|0)==(0);
+ if ($35) {
+ $$0 = 0;
+ break L5;
+ }
+ $36 = HEAP32[$21>>2]|0;
+ $37 = HEAP32[$22>>2]|0;
+ $38 = HEAP32[$23>>2]|0;
+ $39 = Math_imul($38, $j$024)|0;
+ $40 = (($39) + ($i$023))|0;
+ $$sum1 = $40 << 3;
+ $41 = (($37) + ($$sum1)|0);
+ FUNCTION_TABLE_viii[$36 & 31]($41,$38,$data);
+ $42 = HEAP32[$24>>2]|0;
+ $43 = (($42) + -1)|0;
+ HEAP32[$24>>2] = $43;
+ $44 = ($42|0)<(2);
+ if ($44) {
+ $45 = HEAP32[$25>>2]|0;
+ $46 = ($45|0)<(24);
+ if ($46) {
+ _stbi__grow_buffer_unsafe($z);
+ }
+ $47 = HEAP8[$26>>0]|0;
+ $48 = $47 & -8;
+ $49 = ($48<<24>>24)==(-48);
+ if (!($49)) {
+ $$0 = 1;
+ break L5;
+ }
+ _stbi__jpeg_reset($z);
+ }
+ $50 = (($i$023) + 1)|0;
+ $51 = ($50|0)<($11|0);
+ if ($51) {
+ $i$023 = $50;
+ } else {
+ break;
+ }
+ }
+ }
+ $52 = (($j$024) + 1)|0;
+ $53 = ($52|0)<($15|0);
+ if ($53) {
+ $j$024 = $52;
+ } else {
+ $$0 = 1;
+ break;
+ }
+ }
+ } else {
+ $$0 = 1;
+ }
+ } while(0);
+ $$2 = $$0;
+ STACKTOP = sp;return ($$2|0);
+ }
+ $54 = ((($z)) + 17808|0);
+ $55 = HEAP32[$54>>2]|0;
+ $56 = ($55|0)>(0);
+ L24: do {
+ if ($56) {
+ $57 = ((($z)) + 17804|0);
+ $58 = ((($z)) + 18176|0);
+ $59 = ((($z)) + 18112|0);
+ $60 = ((($z)) + 18116|0);
+ $61 = ((($z)) + 18180|0);
+ $j2$038 = 0;
+ while(1) {
+ $62 = HEAP32[$57>>2]|0;
+ $63 = ($62|0)>(0);
+ if ($63) {
+ $i1$035 = 0;
+ while(1) {
+ $64 = HEAP32[$3>>2]|0;
+ $65 = ($64|0)>(0);
+ if ($65) {
+ $k$032 = 0;
+ while(1) {
+ $66 = (((($z)) + 18156|0) + ($k$032<<2)|0);
+ $67 = HEAP32[$66>>2]|0;
+ $68 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 8|0);
+ $69 = HEAP32[$68>>2]|0;
+ $70 = ($69|0)>(0);
+ if ($70) {
+ $71 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 4|0);
+ $72 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 20|0);
+ $73 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 16|0);
+ $74 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 12|0);
+ $75 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 44|0);
+ $76 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 36|0);
+ $y$029 = 0;
+ while(1) {
+ $77 = HEAP32[$71>>2]|0;
+ $78 = ($77|0)>(0);
+ if ($78) {
+ $92 = $77;$x$026 = 0;
+ while(1) {
+ $79 = HEAP32[$68>>2]|0;
+ $80 = HEAP32[$72>>2]|0;
+ $81 = HEAP32[$73>>2]|0;
+ $82 = (((($z)) + 4|0) + (($81*1680)|0)|0);
+ $83 = (((($z)) + 6724|0) + (($80*1680)|0)|0);
+ $84 = (((($z)) + 13700|0) + ($80<<10)|0);
+ $85 = HEAP32[$74>>2]|0;
+ $86 = (((($z)) + 13444|0) + ($85<<6)|0);
+ $87 = (_stbi__jpeg_decode_block($z,$data,$82,$83,$84,$67,$86)|0);
+ $88 = ($87|0)==(0);
+ if ($88) {
+ $$1 = 0;
+ break L24;
+ }
+ $89 = Math_imul($79, $j2$038)|0;
+ $90 = (($89) + ($y$029))|0;
+ $91 = Math_imul($92, $i1$035)|0;
+ $93 = (($91) + ($x$026))|0;
+ $94 = HEAP32[$61>>2]|0;
+ $95 = HEAP32[$75>>2]|0;
+ $96 = HEAP32[$76>>2]|0;
+ $97 = Math_imul($96, $90)|0;
+ $tmp = (($93) + ($97))|0;
+ $tmp5 = $tmp << 3;
+ $98 = (($95) + ($tmp5)|0);
+ FUNCTION_TABLE_viii[$94 & 31]($98,$96,$data);
+ $99 = (($x$026) + 1)|0;
+ $100 = HEAP32[$71>>2]|0;
+ $101 = ($99|0)<($100|0);
+ if ($101) {
+ $92 = $100;$x$026 = $99;
+ } else {
+ break;
+ }
+ }
+ }
+ $102 = (($y$029) + 1)|0;
+ $103 = HEAP32[$68>>2]|0;
+ $104 = ($102|0)<($103|0);
+ if ($104) {
+ $y$029 = $102;
+ } else {
+ break;
+ }
+ }
+ }
+ $105 = (($k$032) + 1)|0;
+ $106 = HEAP32[$3>>2]|0;
+ $107 = ($105|0)<($106|0);
+ if ($107) {
+ $k$032 = $105;
+ } else {
+ break;
+ }
+ }
+ }
+ $108 = HEAP32[$58>>2]|0;
+ $109 = (($108) + -1)|0;
+ HEAP32[$58>>2] = $109;
+ $110 = ($108|0)<(2);
+ if ($110) {
+ $111 = HEAP32[$59>>2]|0;
+ $112 = ($111|0)<(24);
+ if ($112) {
+ _stbi__grow_buffer_unsafe($z);
+ }
+ $113 = HEAP8[$60>>0]|0;
+ $114 = $113 & -8;
+ $115 = ($114<<24>>24)==(-48);
+ if (!($115)) {
+ $$1 = 1;
+ break L24;
+ }
+ _stbi__jpeg_reset($z);
+ }
+ $116 = (($i1$035) + 1)|0;
+ $117 = HEAP32[$57>>2]|0;
+ $118 = ($116|0)<($117|0);
+ if ($118) {
+ $i1$035 = $116;
+ } else {
+ break;
+ }
+ }
+ }
+ $119 = (($j2$038) + 1)|0;
+ $120 = HEAP32[$54>>2]|0;
+ $121 = ($119|0)<($120|0);
+ if ($121) {
+ $j2$038 = $119;
+ } else {
+ $$1 = 1;
+ break;
+ }
+ }
+ } else {
+ $$1 = 1;
+ }
+ } while(0);
+ $$2 = $$1;
+ STACKTOP = sp;return ($$2|0);
+ }
+ if ($5) {
+ $129 = ((($z)) + 18156|0);
+ $130 = HEAP32[$129>>2]|0;
+ $131 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 28|0);
+ $132 = HEAP32[$131>>2]|0;
+ $133 = (($132) + 7)|0;
+ $134 = $133 >> 3;
+ $135 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 32|0);
+ $136 = HEAP32[$135>>2]|0;
+ $137 = (($136) + 7)|0;
+ $138 = $137 >> 3;
+ $139 = ($138|0)>(0);
+ if (!($139)) {
+ $$2 = 1;
+ STACKTOP = sp;return ($$2|0);
+ }
+ $140 = ($134|0)>(0);
+ $141 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 60|0);
+ $142 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 64|0);
+ $143 = ((($z)) + 18128|0);
+ $144 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 16|0);
+ $145 = ((($z)) + 18176|0);
+ $146 = ((($z)) + 18112|0);
+ $147 = ((($z)) + 18116|0);
+ $148 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 20|0);
+ $j7$043 = 0;
+ L61: while(1) {
+ if ($140) {
+ $i6$040 = 0;
+ while(1) {
+ $149 = HEAP32[$141>>2]|0;
+ $150 = HEAP32[$142>>2]|0;
+ $151 = Math_imul($150, $j7$043)|0;
+ $152 = (($151) + ($i6$040))|0;
+ $153 = $152 << 6;
+ $154 = (($149) + ($153<<1)|0);
+ $155 = HEAP32[$143>>2]|0;
+ $156 = ($155|0)==(0);
+ if ($156) {
+ $157 = HEAP32[$144>>2]|0;
+ $158 = (((($z)) + 4|0) + (($157*1680)|0)|0);
+ $159 = (_stbi__jpeg_decode_block_prog_dc($z,$154,$158,$130)|0);
+ $160 = ($159|0)==(0);
+ if ($160) {
+ $$2 = 0;
+ label = 66;
+ break L61;
+ }
+ } else {
+ $161 = HEAP32[$148>>2]|0;
+ $162 = (((($z)) + 6724|0) + (($161*1680)|0)|0);
+ $163 = (((($z)) + 13700|0) + ($161<<10)|0);
+ $164 = (_stbi__jpeg_decode_block_prog_ac($z,$154,$162,$163)|0);
+ $165 = ($164|0)==(0);
+ if ($165) {
+ $$2 = 0;
+ label = 66;
+ break L61;
+ }
+ }
+ $166 = HEAP32[$145>>2]|0;
+ $167 = (($166) + -1)|0;
+ HEAP32[$145>>2] = $167;
+ $168 = ($166|0)<(2);
+ if ($168) {
+ $169 = HEAP32[$146>>2]|0;
+ $170 = ($169|0)<(24);
+ if ($170) {
+ _stbi__grow_buffer_unsafe($z);
+ }
+ $171 = HEAP8[$147>>0]|0;
+ $172 = $171 & -8;
+ $173 = ($172<<24>>24)==(-48);
+ if (!($173)) {
+ $$2 = 1;
+ label = 66;
+ break L61;
+ }
+ _stbi__jpeg_reset($z);
+ }
+ $174 = (($i6$040) + 1)|0;
+ $175 = ($174|0)<($134|0);
+ if ($175) {
+ $i6$040 = $174;
+ } else {
+ break;
+ }
+ }
+ }
+ $176 = (($j7$043) + 1)|0;
+ $177 = ($176|0)<($138|0);
+ if ($177) {
+ $j7$043 = $176;
+ } else {
+ $$2 = 1;
+ label = 66;
+ break;
+ }
+ }
+ if ((label|0) == 66) {
+ STACKTOP = sp;return ($$2|0);
+ }
+ }
+ $122 = ((($z)) + 17808|0);
+ $123 = HEAP32[$122>>2]|0;
+ $124 = ($123|0)>(0);
+ if (!($124)) {
+ $$2 = 1;
+ STACKTOP = sp;return ($$2|0);
+ }
+ $125 = ((($z)) + 17804|0);
+ $126 = ((($z)) + 18176|0);
+ $127 = ((($z)) + 18112|0);
+ $128 = ((($z)) + 18116|0);
+ $j14$057 = 0;
+ L87: while(1) {
+ $178 = HEAP32[$125>>2]|0;
+ $179 = ($178|0)>(0);
+ if ($179) {
+ $i13$054 = 0;
+ while(1) {
+ $180 = HEAP32[$3>>2]|0;
+ $181 = ($180|0)>(0);
+ if ($181) {
+ $k15$051 = 0;
+ while(1) {
+ $182 = (((($z)) + 18156|0) + ($k15$051<<2)|0);
+ $183 = HEAP32[$182>>2]|0;
+ $184 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 8|0);
+ $185 = HEAP32[$184>>2]|0;
+ $186 = ($185|0)>(0);
+ if ($186) {
+ $187 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 4|0);
+ $188 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 60|0);
+ $189 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 64|0);
+ $190 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 16|0);
+ $y17$048 = 0;
+ while(1) {
+ $191 = HEAP32[$187>>2]|0;
+ $192 = ($191|0)>(0);
+ if ($192) {
+ $197 = $191;$x16$045 = 0;
+ while(1) {
+ $196 = Math_imul($197, $i13$054)|0;
+ $198 = (($196) + ($x16$045))|0;
+ $199 = HEAP32[$184>>2]|0;
+ $200 = Math_imul($199, $j14$057)|0;
+ $201 = (($200) + ($y17$048))|0;
+ $202 = HEAP32[$188>>2]|0;
+ $203 = HEAP32[$189>>2]|0;
+ $204 = Math_imul($201, $203)|0;
+ $205 = (($198) + ($204))|0;
+ $206 = $205 << 6;
+ $207 = (($202) + ($206<<1)|0);
+ $208 = HEAP32[$190>>2]|0;
+ $209 = (((($z)) + 4|0) + (($208*1680)|0)|0);
+ $210 = (_stbi__jpeg_decode_block_prog_dc($z,$207,$209,$183)|0);
+ $211 = ($210|0)==(0);
+ $194 = (($x16$045) + 1)|0;
+ if ($211) {
+ $$2 = 0;
+ label = 66;
+ break L87;
+ }
+ $193 = HEAP32[$187>>2]|0;
+ $195 = ($194|0)<($193|0);
+ if ($195) {
+ $197 = $193;$x16$045 = $194;
+ } else {
+ break;
+ }
+ }
+ }
+ $212 = (($y17$048) + 1)|0;
+ $213 = HEAP32[$184>>2]|0;
+ $214 = ($212|0)<($213|0);
+ if ($214) {
+ $y17$048 = $212;
+ } else {
+ break;
+ }
+ }
+ }
+ $215 = (($k15$051) + 1)|0;
+ $216 = HEAP32[$3>>2]|0;
+ $217 = ($215|0)<($216|0);
+ if ($217) {
+ $k15$051 = $215;
+ } else {
+ break;
+ }
+ }
+ }
+ $218 = HEAP32[$126>>2]|0;
+ $219 = (($218) + -1)|0;
+ HEAP32[$126>>2] = $219;
+ $220 = ($218|0)<(2);
+ if ($220) {
+ $221 = HEAP32[$127>>2]|0;
+ $222 = ($221|0)<(24);
+ if ($222) {
+ _stbi__grow_buffer_unsafe($z);
+ }
+ $223 = HEAP8[$128>>0]|0;
+ $224 = $223 & -8;
+ $225 = ($224<<24>>24)==(-48);
+ if (!($225)) {
+ $$2 = 1;
+ label = 66;
+ break L87;
+ }
+ _stbi__jpeg_reset($z);
+ }
+ $226 = (($i13$054) + 1)|0;
+ $227 = HEAP32[$125>>2]|0;
+ $228 = ($226|0)<($227|0);
+ if ($228) {
+ $i13$054 = $226;
+ } else {
+ break;
+ }
+ }
+ }
+ $229 = (($j14$057) + 1)|0;
+ $230 = HEAP32[$122>>2]|0;
+ $231 = ($229|0)<($230|0);
+ if ($231) {
+ $j14$057 = $229;
+ } else {
+ $$2 = 1;
+ label = 66;
+ break;
+ }
+ }
+ if ((label|0) == 66) {
+ STACKTOP = sp;return ($$2|0);
+ }
+ return (0)|0;
+}
+function _stbi__jpeg_finish($z) {
+ $z = $z|0;
+ var $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$02 = 0, $j$03 = 0, $n$06 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($z)) + 18124|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ return;
+ }
+ $3 = HEAP32[$z>>2]|0;
+ $4 = ((($3)) + 8|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)>(0);
+ if (!($6)) {
+ return;
+ }
+ $7 = ((($z)) + 18180|0);
+ $n$06 = 0;
+ while(1) {
+ $8 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 28|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = (($9) + 7)|0;
+ $11 = $10 >> 3;
+ $12 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 32|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (($13) + 7)|0;
+ $15 = $14 >> 3;
+ $16 = ($15|0)>(0);
+ if ($16) {
+ $17 = ($11|0)>(0);
+ $18 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 60|0);
+ $19 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 64|0);
+ $20 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 12|0);
+ $21 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 44|0);
+ $22 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 36|0);
+ $j$03 = 0;
+ while(1) {
+ if ($17) {
+ $i$02 = 0;
+ while(1) {
+ $23 = HEAP32[$18>>2]|0;
+ $24 = HEAP32[$19>>2]|0;
+ $25 = Math_imul($24, $j$03)|0;
+ $26 = (($25) + ($i$02))|0;
+ $27 = $26 << 6;
+ $28 = (($23) + ($27<<1)|0);
+ $29 = HEAP32[$20>>2]|0;
+ $30 = (((($z)) + 13444|0) + ($29<<6)|0);
+ _stbi__jpeg_dequantize($28,$30);
+ $31 = HEAP32[$7>>2]|0;
+ $32 = HEAP32[$21>>2]|0;
+ $33 = HEAP32[$22>>2]|0;
+ $34 = Math_imul($33, $j$03)|0;
+ $35 = (($34) + ($i$02))|0;
+ $$sum = $35 << 3;
+ $36 = (($32) + ($$sum)|0);
+ FUNCTION_TABLE_viii[$31 & 31]($36,$33,$28);
+ $37 = (($i$02) + 1)|0;
+ $exitcond = ($37|0)==($11|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$02 = $37;
+ }
+ }
+ }
+ $38 = (($j$03) + 1)|0;
+ $exitcond8 = ($38|0)==($15|0);
+ if ($exitcond8) {
+ break;
+ } else {
+ $j$03 = $38;
+ }
+ }
+ }
+ $39 = (($n$06) + 1)|0;
+ $40 = HEAP32[$z>>2]|0;
+ $41 = ((($40)) + 8|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = ($39|0)<($42|0);
+ if ($43) {
+ $n$06 = $39;
+ } else {
+ break;
+ }
+ }
+ return;
+}
+function _stbi__jpeg_dequantize($data,$dequant) {
+ $data = $data|0;
+ $dequant = $dequant|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $i$01 = 0;
+ while(1) {
+ $0 = (($dequant) + ($i$01)|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = $1&255;
+ $3 = (($data) + ($i$01<<1)|0);
+ $4 = HEAP16[$3>>1]|0;
+ $5 = $4 << 16 >> 16;
+ $6 = Math_imul($5, $2)|0;
+ $7 = $6&65535;
+ HEAP16[$3>>1] = $7;
+ $8 = (($i$01) + 1)|0;
+ $exitcond = ($8|0)==(64);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$01 = $8;
+ }
+ }
+ return;
+}
+function _stbi__jpeg_reset($j) {
+ $j = $j|0;
+ var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18112|0);
+ HEAP32[$0>>2] = 0;
+ $1 = ((($j)) + 18108|0);
+ HEAP32[$1>>2] = 0;
+ $2 = ((($j)) + 18120|0);
+ HEAP32[$2>>2] = 0;
+ $3 = ((($j)) + 17988|0);
+ HEAP32[$3>>2] = 0;
+ $4 = ((($j)) + 17916|0);
+ HEAP32[$4>>2] = 0;
+ $5 = ((($j)) + 17844|0);
+ HEAP32[$5>>2] = 0;
+ $6 = ((($j)) + 18116|0);
+ HEAP8[$6>>0] = -1;
+ $7 = ((($j)) + 18172|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)==(0);
+ $$ = $9 ? 2147483647 : $8;
+ $10 = ((($j)) + 18176|0);
+ HEAP32[$10>>2] = $$;
+ $11 = ((($j)) + 18144|0);
+ HEAP32[$11>>2] = 0;
+ return;
+}
+function _stbi__jpeg_decode_block($j,$data,$hdc,$hac,$fac,$b,$dequant) {
+ $j = $j|0;
+ $data = $data|0;
+ $hdc = $hdc|0;
+ $hac = $hac|0;
+ $fac = $fac|0;
+ $b = $b|0;
+ $dequant = $dequant|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$1 = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18112|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<(16);
+ if ($2) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $3 = (_stbi__jpeg_huff_decode($j,$hdc)|0);
+ $4 = ($3|0)<(0);
+ if ($4) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0));
+ $5 = ($3|0)==(0);
+ if ($5) {
+ $10 = 0;
+ } else {
+ $6 = (_stbi__extend_receive($j,$3)|0);
+ $10 = $6;
+ }
+ $7 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = (($8) + ($10))|0;
+ HEAP32[$7>>2] = $9;
+ $11 = HEAP8[$dequant>>0]|0;
+ $12 = $11&255;
+ $13 = Math_imul($12, $9)|0;
+ $14 = $13&65535;
+ HEAP16[$data>>1] = $14;
+ $15 = ((($j)) + 18108|0);
+ $k$0 = 1;
+ L11: while(1) {
+ $16 = HEAP32[$0>>2]|0;
+ $17 = ($16|0)<(16);
+ if ($17) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $18 = HEAP32[$15>>2]|0;
+ $19 = $18 >>> 23;
+ $20 = (($fac) + ($19<<1)|0);
+ $21 = HEAP16[$20>>1]|0;
+ $22 = $21 << 16 >> 16;
+ $23 = ($21<<16>>16)==(0);
+ do {
+ if ($23) {
+ $42 = (_stbi__jpeg_huff_decode($j,$hac)|0);
+ $43 = ($42|0)<(0);
+ if ($43) {
+ label = 13;
+ break L11;
+ }
+ $44 = $42 & 15;
+ $45 = ($44|0)==(0);
+ if (!($45)) {
+ $48 = $42 >> 4;
+ $49 = (($48) + ($k$0))|0;
+ $50 = (($49) + 1)|0;
+ $51 = (13438 + ($49)|0);
+ $52 = HEAP8[$51>>0]|0;
+ $53 = $52&255;
+ $54 = (_stbi__extend_receive($j,$44)|0);
+ $55 = (($dequant) + ($53)|0);
+ $56 = HEAP8[$55>>0]|0;
+ $57 = $56&255;
+ $58 = Math_imul($57, $54)|0;
+ $59 = $58&65535;
+ $60 = (($data) + ($53<<1)|0);
+ HEAP16[$60>>1] = $59;
+ $k$1 = $50;
+ break;
+ }
+ $46 = ($42|0)==(240);
+ if (!($46)) {
+ $$0 = 1;
+ label = 19;
+ break L11;
+ }
+ $47 = (($k$0) + 16)|0;
+ $k$1 = $47;
+ } else {
+ $24 = $22 >>> 4;
+ $25 = $24 & 15;
+ $26 = (($25) + ($k$0))|0;
+ $27 = $22 & 15;
+ $28 = $18 << $27;
+ HEAP32[$15>>2] = $28;
+ $29 = HEAP32[$0>>2]|0;
+ $30 = (($29) - ($27))|0;
+ HEAP32[$0>>2] = $30;
+ $31 = (($26) + 1)|0;
+ $32 = (13438 + ($26)|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = $33&255;
+ $35 = $22 >> 8;
+ $36 = (($dequant) + ($34)|0);
+ $37 = HEAP8[$36>>0]|0;
+ $38 = $37&255;
+ $39 = Math_imul($38, $35)|0;
+ $40 = $39&65535;
+ $41 = (($data) + ($34<<1)|0);
+ HEAP16[$41>>1] = $40;
+ $k$1 = $31;
+ }
+ } while(0);
+ $61 = ($k$1|0)<(64);
+ if ($61) {
+ $k$0 = $k$1;
+ } else {
+ $$0 = 1;
+ label = 19;
+ break;
+ }
+ }
+ if ((label|0) == 13) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 19) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__grow_buffer_unsafe($j) {
+ $j = $j|0;
+ var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18120|0);
+ $1 = ((($j)) + 18112|0);
+ $2 = ((($j)) + 18108|0);
+ while(1) {
+ $3 = HEAP32[$0>>2]|0;
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $5 = HEAP32[$j>>2]|0;
+ $6 = (_stbi__get8($5)|0);
+ $7 = $6&255;
+ $8 = ($6<<24>>24)==(-1);
+ if ($8) {
+ $9 = HEAP32[$j>>2]|0;
+ $10 = (_stbi__get8($9)|0);
+ $11 = ($10<<24>>24)==(0);
+ if ($11) {
+ $16 = 255;
+ } else {
+ $$lcssa = $10;
+ break;
+ }
+ } else {
+ $16 = $7;
+ }
+ } else {
+ $16 = 0;
+ }
+ $13 = HEAP32[$1>>2]|0;
+ $14 = (24 - ($13))|0;
+ $15 = $16 << $14;
+ $17 = HEAP32[$2>>2]|0;
+ $18 = $15 | $17;
+ HEAP32[$2>>2] = $18;
+ $19 = HEAP32[$1>>2]|0;
+ $20 = (($19) + 8)|0;
+ HEAP32[$1>>2] = $20;
+ $21 = ($20|0)<(25);
+ if (!($21)) {
+ label = 7;
+ break;
+ }
+ }
+ if ((label|0) == 7) {
+ return;
+ }
+ $12 = ((($j)) + 18116|0);
+ HEAP8[$12>>0] = $$lcssa;
+ HEAP32[$0>>2] = 1;
+ return;
+}
+function _stbi__jpeg_decode_block_prog_dc($j,$data,$hdc,$b) {
+ $j = $j|0;
+ $data = $data|0;
+ $hdc = $hdc|0;
+ $b = $b|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18132|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if (!($2)) {
+ _stbi__err(14624);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $3 = ((($j)) + 18112|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)<(16);
+ if ($5) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $6 = ((($j)) + 18136|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)==(0);
+ if ($8) {
+ dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0));
+ $9 = (_stbi__jpeg_huff_decode($j,$hdc)|0);
+ $10 = ($9|0)==(0);
+ if ($10) {
+ $15 = 0;
+ } else {
+ $11 = (_stbi__extend_receive($j,$9)|0);
+ $15 = $11;
+ }
+ $12 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (($13) + ($15))|0;
+ HEAP32[$12>>2] = $14;
+ $16 = ((($j)) + 18140|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = $14 << $17;
+ $19 = $18&65535;
+ HEAP16[$data>>1] = $19;
+ $$0 = 1;
+ return ($$0|0);
+ } else {
+ $20 = (_stbi__jpeg_get_bit($j)|0);
+ $21 = ($20|0)==(0);
+ if ($21) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $22 = ((($j)) + 18140|0);
+ $23 = HEAP32[$22>>2]|0;
+ $sext = 65536 << $23;
+ $24 = $sext >>> 16;
+ $25 = HEAP16[$data>>1]|0;
+ $26 = $25&65535;
+ $27 = (($26) + ($24))|0;
+ $28 = $27&65535;
+ HEAP16[$data>>1] = $28;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__jpeg_decode_block_prog_ac($j,$data,$hac,$fac) {
+ $j = $j|0;
+ $data = $data|0;
+ $hac = $hac|0;
+ $fac = $fac|0;
+ var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa63 = 0, $$lcssa63$lcssa = 0, $$lcssa66 = 0, $$lcssa66$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
+ var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0;
+ var $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
+ var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
+ var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
+ var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $k$0 = 0, $k$1 = 0, $k$223 = 0, $k$3 = 0, $k$4$ph20 = 0, $k$415 = 0, $k$415$lcssa = 0, $k$5 = 0, $r1$0$ph = 0, $r1$0$ph519 = 0, $s2$0$ph = 0, $sext = 0, $sext1 = 0, $sext2 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18128|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ _stbi__err(14624);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $3 = ((($j)) + 18136|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(0);
+ $6 = ((($j)) + 18140|0);
+ $7 = HEAP32[$6>>2]|0;
+ if ($5) {
+ $8 = ((($j)) + 18144|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($9|0)==(0);
+ if (!($10)) {
+ $14 = (($9) + -1)|0;
+ HEAP32[$8>>2] = $14;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $11 = ((($j)) + 18112|0);
+ $12 = ((($j)) + 18108|0);
+ $13 = ((($j)) + 18132|0);
+ $k$0 = $1;
+ L11: while(1) {
+ $15 = HEAP32[$11>>2]|0;
+ $16 = ($15|0)<(16);
+ if ($16) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $17 = HEAP32[$12>>2]|0;
+ $18 = $17 >>> 23;
+ $19 = (($fac) + ($18<<1)|0);
+ $20 = HEAP16[$19>>1]|0;
+ $21 = $20 << 16 >> 16;
+ $22 = ($20<<16>>16)==(0);
+ do {
+ if ($22) {
+ $38 = (_stbi__jpeg_huff_decode($j,$hac)|0);
+ $39 = ($38|0)<(0);
+ if ($39) {
+ label = 12;
+ break L11;
+ }
+ $40 = $38 & 15;
+ $41 = $38 >> 4;
+ $42 = ($40|0)==(0);
+ if (!($42)) {
+ $52 = (($41) + ($k$0))|0;
+ $53 = (($52) + 1)|0;
+ $54 = (13438 + ($52)|0);
+ $55 = HEAP8[$54>>0]|0;
+ $56 = $55&255;
+ $57 = (_stbi__extend_receive($j,$40)|0);
+ $58 = $57 << $7;
+ $59 = $58&65535;
+ $60 = (($data) + ($56<<1)|0);
+ HEAP16[$60>>1] = $59;
+ $k$1 = $53;
+ break;
+ }
+ $43 = ($41|0)<(15);
+ if ($43) {
+ $$lcssa = $41;
+ label = 15;
+ break L11;
+ }
+ $51 = (($k$0) + 16)|0;
+ $k$1 = $51;
+ } else {
+ $23 = $21 >>> 4;
+ $24 = $23 & 15;
+ $25 = (($24) + ($k$0))|0;
+ $26 = $21 & 15;
+ $27 = $17 << $26;
+ HEAP32[$12>>2] = $27;
+ $28 = HEAP32[$11>>2]|0;
+ $29 = (($28) - ($26))|0;
+ HEAP32[$11>>2] = $29;
+ $30 = (($25) + 1)|0;
+ $31 = (13438 + ($25)|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = $32&255;
+ $34 = $21 >> 8;
+ $35 = $34 << $7;
+ $36 = $35&65535;
+ $37 = (($data) + ($33<<1)|0);
+ HEAP16[$37>>1] = $36;
+ $k$1 = $30;
+ }
+ } while(0);
+ $61 = HEAP32[$13>>2]|0;
+ $62 = ($k$1|0)>($61|0);
+ if ($62) {
+ $$0 = 1;
+ label = 53;
+ break;
+ } else {
+ $k$0 = $k$1;
+ }
+ }
+ if ((label|0) == 12) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 15) {
+ $44 = 1 << $$lcssa;
+ HEAP32[$8>>2] = $44;
+ $45 = ($$lcssa|0)==(0);
+ if (!($45)) {
+ $46 = (_stbi__jpeg_get_bits($j,$$lcssa)|0);
+ $47 = HEAP32[$8>>2]|0;
+ $48 = (($47) + ($46))|0;
+ HEAP32[$8>>2] = $48;
+ }
+ $49 = HEAP32[$8>>2]|0;
+ $50 = (($49) + -1)|0;
+ HEAP32[$8>>2] = $50;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ else if ((label|0) == 53) {
+ return ($$0|0);
+ }
+ }
+ $63 = 1 << $7;
+ $64 = ((($j)) + 18144|0);
+ $65 = HEAP32[$64>>2]|0;
+ $66 = ($65|0)==(0);
+ if (!($66)) {
+ $71 = (($65) + -1)|0;
+ HEAP32[$64>>2] = $71;
+ $72 = HEAP32[$0>>2]|0;
+ $73 = ((($j)) + 18132|0);
+ $74 = HEAP32[$73>>2]|0;
+ $75 = ($72|0)>($74|0);
+ if ($75) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ $sext2 = $63 << 16;
+ $76 = $sext2 >> 16;
+ $k$223 = $72;
+ while(1) {
+ $77 = (13438 + ($k$223)|0);
+ $78 = HEAP8[$77>>0]|0;
+ $79 = $78&255;
+ $80 = (($data) + ($79<<1)|0);
+ $81 = HEAP16[$80>>1]|0;
+ $82 = ($81<<16>>16)==(0);
+ do {
+ if (!($82)) {
+ $83 = (_stbi__jpeg_get_bit($j)|0);
+ $84 = ($83|0)==(0);
+ if (!($84)) {
+ $85 = HEAP16[$80>>1]|0;
+ $86 = $85 << 16 >> 16;
+ $87 = $86 & $76;
+ $88 = ($87|0)==(0);
+ if ($88) {
+ $89 = ($85<<16>>16)>(0);
+ if ($89) {
+ $90 = (($86) + ($76))|0;
+ $91 = $90&65535;
+ HEAP16[$80>>1] = $91;
+ break;
+ } else {
+ $92 = (($86) - ($76))|0;
+ $93 = $92&65535;
+ HEAP16[$80>>1] = $93;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $94 = (($k$223) + 1)|0;
+ $95 = HEAP32[$73>>2]|0;
+ $96 = ($k$223|0)<($95|0);
+ if ($96) {
+ $k$223 = $94;
+ } else {
+ $$0 = 1;
+ break;
+ }
+ }
+ return ($$0|0);
+ }
+ $sext = $63 << 16;
+ $67 = $sext >> 16;
+ $68 = (0 - ($67))|0;
+ $69 = ((($j)) + 18132|0);
+ $sext1 = $63 << 16;
+ $70 = $sext1 >> 16;
+ $k$3 = $1;
+ L52: while(1) {
+ $97 = (_stbi__jpeg_huff_decode($j,$hac)|0);
+ $98 = ($97|0)<(0);
+ if ($98) {
+ label = 33;
+ break;
+ }
+ $99 = $97 & 15;
+ $100 = $97 >> 4;
+ switch ($99|0) {
+ case 0: {
+ $101 = ($100|0)<(15);
+ if ($101) {
+ $102 = 1 << $100;
+ $103 = (($102) + -1)|0;
+ HEAP32[$64>>2] = $103;
+ $104 = ($100|0)==(0);
+ if ($104) {
+ $r1$0$ph = 64;$s2$0$ph = 0;
+ } else {
+ $105 = (_stbi__jpeg_get_bits($j,$100)|0);
+ $106 = HEAP32[$64>>2]|0;
+ $107 = (($106) + ($105))|0;
+ HEAP32[$64>>2] = $107;
+ $r1$0$ph = 64;$s2$0$ph = 0;
+ }
+ } else {
+ $r1$0$ph = $100;$s2$0$ph = 0;
+ }
+ break;
+ }
+ case 1: {
+ $108 = (_stbi__jpeg_get_bit($j)|0);
+ $109 = ($108|0)==(0);
+ $$ = $109 ? $68 : $67;
+ $r1$0$ph = $100;$s2$0$ph = $$;
+ break;
+ }
+ default: {
+ label = 38;
+ break L52;
+ }
+ }
+ $110 = HEAP32[$69>>2]|0;
+ $111 = ($k$3|0)>($110|0);
+ L61: do {
+ if ($111) {
+ $k$5 = $k$3;
+ } else {
+ $k$4$ph20 = $k$3;$r1$0$ph519 = $r1$0$ph;
+ while(1) {
+ $k$415 = $k$4$ph20;
+ while(1) {
+ $115 = (($k$415) + 1)|0;
+ $116 = (13438 + ($k$415)|0);
+ $117 = HEAP8[$116>>0]|0;
+ $118 = $117&255;
+ $119 = (($data) + ($118<<1)|0);
+ $120 = HEAP16[$119>>1]|0;
+ $121 = ($120<<16>>16)==(0);
+ if ($121) {
+ $$lcssa63 = $115;$$lcssa66 = $119;$k$415$lcssa = $k$415;
+ break;
+ }
+ $122 = (_stbi__jpeg_get_bit($j)|0);
+ $123 = ($122|0)==(0);
+ do {
+ if (!($123)) {
+ $124 = HEAP16[$119>>1]|0;
+ $125 = $124 << 16 >> 16;
+ $126 = $125 & $70;
+ $127 = ($126|0)==(0);
+ if ($127) {
+ $128 = ($124<<16>>16)>(0);
+ if ($128) {
+ $129 = (($125) + ($70))|0;
+ $130 = $129&65535;
+ HEAP16[$119>>1] = $130;
+ break;
+ } else {
+ $133 = (($125) - ($70))|0;
+ $134 = $133&65535;
+ HEAP16[$119>>1] = $134;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $131 = HEAP32[$69>>2]|0;
+ $132 = ($k$415|0)<($131|0);
+ if ($132) {
+ $k$415 = $115;
+ } else {
+ $k$5 = $115;
+ break L61;
+ }
+ }
+ $135 = ($r1$0$ph519|0)==(0);
+ if ($135) {
+ $$lcssa63$lcssa = $$lcssa63;$$lcssa66$lcssa = $$lcssa66;
+ break;
+ }
+ $112 = (($r1$0$ph519) + -1)|0;
+ $113 = HEAP32[$69>>2]|0;
+ $114 = ($k$415$lcssa|0)<($113|0);
+ if ($114) {
+ $k$4$ph20 = $$lcssa63;$r1$0$ph519 = $112;
+ } else {
+ $k$5 = $$lcssa63;
+ break L61;
+ }
+ }
+ $136 = $s2$0$ph&65535;
+ HEAP16[$$lcssa66$lcssa>>1] = $136;
+ $k$5 = $$lcssa63$lcssa;
+ }
+ } while(0);
+ $137 = HEAP32[$69>>2]|0;
+ $138 = ($k$5|0)>($137|0);
+ if ($138) {
+ $$0 = 1;
+ label = 53;
+ break;
+ } else {
+ $k$3 = $k$5;
+ }
+ }
+ if ((label|0) == 33) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 38) {
+ _stbi__err(13869);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ else if ((label|0) == 53) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__jpeg_huff_decode($j,$h) {
+ $j = $j|0;
+ $h = $h|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$0$lcssa = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18112|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<(16);
+ if ($2) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $3 = ((($j)) + 18108|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4 >>> 23;
+ $6 = (($h) + ($5)|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = $7&255;
+ $9 = ($7<<24>>24)==(-1);
+ if (!($9)) {
+ $10 = (((($h)) + 1280|0) + ($8)|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11&255;
+ $13 = HEAP32[$0>>2]|0;
+ $14 = ($12|0)>($13|0);
+ if ($14) {
+ $$0 = -1;
+ return ($$0|0);
+ }
+ $15 = $4 << $12;
+ HEAP32[$3>>2] = $15;
+ $16 = HEAP32[$0>>2]|0;
+ $17 = (($16) - ($12))|0;
+ HEAP32[$0>>2] = $17;
+ $18 = (((($h)) + 1024|0) + ($8)|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = $19&255;
+ $$0 = $20;
+ return ($$0|0);
+ }
+ $21 = $4 >>> 16;
+ $k$0 = 10;
+ while(1) {
+ $22 = (((($h)) + 1540|0) + ($k$0<<2)|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = ($21>>>0)<($23>>>0);
+ $25 = (($k$0) + 1)|0;
+ if ($24) {
+ $k$0$lcssa = $k$0;
+ break;
+ } else {
+ $k$0 = $25;
+ }
+ }
+ $26 = ($k$0$lcssa|0)==(17);
+ $27 = HEAP32[$0>>2]|0;
+ if ($26) {
+ $28 = (($27) + -16)|0;
+ HEAP32[$0>>2] = $28;
+ $$0 = -1;
+ return ($$0|0);
+ }
+ $29 = ($27|0)<($k$0$lcssa|0);
+ if ($29) {
+ $$0 = -1;
+ return ($$0|0);
+ }
+ $30 = HEAP32[$3>>2]|0;
+ $31 = (32 - ($k$0$lcssa))|0;
+ $32 = $30 >>> $31;
+ $33 = (6280 + ($k$0$lcssa<<2)|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = $32 & $34;
+ $36 = (((($h)) + 1612|0) + ($k$0$lcssa<<2)|0);
+ $37 = HEAP32[$36>>2]|0;
+ $38 = (($35) + ($37))|0;
+ $39 = (((($h)) + 1280|0) + ($38)|0);
+ $40 = HEAP8[$39>>0]|0;
+ $41 = $40&255;
+ $42 = (32 - ($41))|0;
+ $43 = $30 >>> $42;
+ $44 = (6280 + ($41<<2)|0);
+ $45 = HEAP32[$44>>2]|0;
+ $46 = $43 & $45;
+ $47 = (((($h)) + 512|0) + ($38<<1)|0);
+ $48 = HEAP16[$47>>1]|0;
+ $49 = $48&65535;
+ $50 = ($46|0)==($49|0);
+ if (!($50)) {
+ ___assert_fail((14730|0),(12975|0),1659,(14812|0));
+ // unreachable;
+ }
+ $51 = (($27) - ($k$0$lcssa))|0;
+ HEAP32[$0>>2] = $51;
+ $52 = HEAP32[$3>>2]|0;
+ $53 = $52 << $k$0$lcssa;
+ HEAP32[$3>>2] = $53;
+ $54 = (((($h)) + 1024|0) + ($38)|0);
+ $55 = HEAP8[$54>>0]|0;
+ $56 = $55&255;
+ $$0 = $56;
+ return ($$0|0);
+}
+function _stbi__jpeg_get_bits($j,$n) {
+ $j = $j|0;
+ $n = $n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18112|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<($n|0);
+ if ($2) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $3 = ((($j)) + 18108|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4 << $n;
+ $6 = (32 - ($n))|0;
+ $7 = $4 >>> $6;
+ $8 = $5 | $7;
+ $9 = (6280 + ($n<<2)|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = $10 ^ -1;
+ $12 = $8 & $11;
+ HEAP32[$3>>2] = $12;
+ $13 = HEAP32[$9>>2]|0;
+ $14 = $8 & $13;
+ $15 = HEAP32[$0>>2]|0;
+ $16 = (($15) - ($n))|0;
+ HEAP32[$0>>2] = $16;
+ return ($14|0);
+}
+function _stbi__extend_receive($j,$n) {
+ $j = $j|0;
+ $n = $n|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18112|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<($n|0);
+ if ($2) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $3 = ((($j)) + 18108|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4 << $n;
+ $6 = (32 - ($n))|0;
+ $7 = $4 >>> $6;
+ $8 = $5 | $7;
+ $9 = ($n>>>0)<(17);
+ if ($9) {
+ $10 = $4 >> 31;
+ $11 = (6280 + ($n<<2)|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = $12 ^ -1;
+ $14 = $8 & $13;
+ HEAP32[$3>>2] = $14;
+ $15 = HEAP32[$11>>2]|0;
+ $16 = $15 & $8;
+ $17 = HEAP32[$0>>2]|0;
+ $18 = (($17) - ($n))|0;
+ HEAP32[$0>>2] = $18;
+ $19 = (6348 + ($n<<2)|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = $10 ^ -1;
+ $22 = $20 & $21;
+ $23 = (($22) + ($16))|0;
+ return ($23|0);
+ } else {
+ ___assert_fail((14646|0),(12975|0),1680,(14709|0));
+ // unreachable;
+ }
+ return (0)|0;
+}
+function _stbi__jpeg_get_bit($j) {
+ $j = $j|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($j)) + 18112|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<(1);
+ if ($2) {
+ _stbi__grow_buffer_unsafe($j);
+ }
+ $3 = ((($j)) + 18108|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4 << 1;
+ HEAP32[$3>>2] = $5;
+ $6 = HEAP32[$0>>2]|0;
+ $7 = (($6) + -1)|0;
+ HEAP32[$0>>2] = $7;
+ $8 = $4 & -2147483648;
+ return ($8|0);
+}
+function _stbi__idct_block($out,$out_stride,$data) {
+ $out = $out|0;
+ $out_stride = $out_stride|0;
+ $data = $data|0;
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
+ var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
+ var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
+ var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
+ var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $d$04 = 0, $exitcond = 0, $exitcond9 = 0, $i$08 = 0, $i$13 = 0, $o$01 = 0, $v$06 = 0, $v$12 = 0;
+ var $val = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $val = sp;
+ $d$04 = $data;$i$08 = 0;$v$06 = $val;
+ while(1) {
+ $0 = ((($d$04)) + 16|0);
+ $1 = HEAP16[$0>>1]|0;
+ $2 = ($1<<16>>16)==(0);
+ if ($2) {
+ $3 = ((($d$04)) + 32|0);
+ $4 = HEAP16[$3>>1]|0;
+ $5 = ($4<<16>>16)==(0);
+ if ($5) {
+ $6 = ((($d$04)) + 48|0);
+ $7 = HEAP16[$6>>1]|0;
+ $8 = ($7<<16>>16)==(0);
+ if ($8) {
+ $9 = ((($d$04)) + 64|0);
+ $10 = HEAP16[$9>>1]|0;
+ $11 = ($10<<16>>16)==(0);
+ if ($11) {
+ $12 = ((($d$04)) + 80|0);
+ $13 = HEAP16[$12>>1]|0;
+ $14 = ($13<<16>>16)==(0);
+ if ($14) {
+ $15 = ((($d$04)) + 96|0);
+ $16 = HEAP16[$15>>1]|0;
+ $17 = ($16<<16>>16)==(0);
+ if ($17) {
+ $18 = ((($d$04)) + 112|0);
+ $19 = HEAP16[$18>>1]|0;
+ $20 = ($19<<16>>16)==(0);
+ if ($20) {
+ $21 = HEAP16[$d$04>>1]|0;
+ $22 = $21 << 16 >> 16;
+ $23 = $22 << 2;
+ $24 = ((($v$06)) + 224|0);
+ HEAP32[$24>>2] = $23;
+ $25 = ((($v$06)) + 192|0);
+ HEAP32[$25>>2] = $23;
+ $26 = ((($v$06)) + 160|0);
+ HEAP32[$26>>2] = $23;
+ $27 = ((($v$06)) + 128|0);
+ HEAP32[$27>>2] = $23;
+ $28 = ((($v$06)) + 96|0);
+ HEAP32[$28>>2] = $23;
+ $29 = ((($v$06)) + 64|0);
+ HEAP32[$29>>2] = $23;
+ $30 = ((($v$06)) + 32|0);
+ HEAP32[$30>>2] = $23;
+ HEAP32[$v$06>>2] = $23;
+ } else {
+ label = 10;
+ }
+ } else {
+ label = 10;
+ }
+ } else {
+ label = 10;
+ }
+ } else {
+ label = 10;
+ }
+ } else {
+ label = 10;
+ }
+ } else {
+ label = 10;
+ }
+ } else {
+ label = 10;
+ }
+ if ((label|0) == 10) {
+ label = 0;
+ $31 = ((($d$04)) + 32|0);
+ $32 = HEAP16[$31>>1]|0;
+ $33 = $32 << 16 >> 16;
+ $34 = ((($d$04)) + 96|0);
+ $35 = HEAP16[$34>>1]|0;
+ $36 = $35 << 16 >> 16;
+ $37 = (($36) + ($33))|0;
+ $38 = ($37*2217)|0;
+ $39 = Math_imul($36, -7567)|0;
+ $40 = (($38) + ($39))|0;
+ $41 = ($33*3135)|0;
+ $42 = (($38) + ($41))|0;
+ $43 = HEAP16[$d$04>>1]|0;
+ $44 = $43 << 16 >> 16;
+ $45 = ((($d$04)) + 64|0);
+ $46 = HEAP16[$45>>1]|0;
+ $47 = $46 << 16 >> 16;
+ $48 = (($47) + ($44))|0;
+ $49 = $48 << 12;
+ $50 = (($44) - ($47))|0;
+ $51 = $50 << 12;
+ $52 = (($49) - ($42))|0;
+ $53 = (($51) - ($40))|0;
+ $54 = ((($d$04)) + 112|0);
+ $55 = HEAP16[$54>>1]|0;
+ $56 = $55 << 16 >> 16;
+ $57 = ((($d$04)) + 80|0);
+ $58 = HEAP16[$57>>1]|0;
+ $59 = $58 << 16 >> 16;
+ $60 = ((($d$04)) + 48|0);
+ $61 = HEAP16[$60>>1]|0;
+ $62 = $61 << 16 >> 16;
+ $63 = HEAP16[$0>>1]|0;
+ $64 = $63 << 16 >> 16;
+ $65 = (($62) + ($56))|0;
+ $66 = (($64) + ($59))|0;
+ $67 = (($64) + ($56))|0;
+ $68 = (($62) + ($59))|0;
+ $69 = (($66) + ($65))|0;
+ $70 = ($69*4816)|0;
+ $71 = ($56*1223)|0;
+ $72 = ($59*8410)|0;
+ $73 = ($62*12586)|0;
+ $74 = ($64*6149)|0;
+ $75 = Math_imul($67, -3685)|0;
+ $76 = (($70) + ($75))|0;
+ $77 = Math_imul($68, -10497)|0;
+ $78 = (($70) + ($77))|0;
+ $79 = Math_imul($65, -8034)|0;
+ $80 = Math_imul($66, -1597)|0;
+ $81 = (($80) + ($74))|0;
+ $82 = (($81) + ($76))|0;
+ $83 = (($79) + ($73))|0;
+ $84 = (($83) + ($78))|0;
+ $85 = (($80) + ($72))|0;
+ $86 = (($85) + ($78))|0;
+ $87 = (($79) + ($71))|0;
+ $88 = (($87) + ($76))|0;
+ $89 = (($42) + 512)|0;
+ $90 = (($89) + ($49))|0;
+ $91 = (($40) + 512)|0;
+ $92 = (($91) + ($51))|0;
+ $93 = (($53) + 512)|0;
+ $94 = (($52) + 512)|0;
+ $95 = (($82) + ($90))|0;
+ $96 = $95 >> 10;
+ HEAP32[$v$06>>2] = $96;
+ $97 = (($90) - ($82))|0;
+ $98 = $97 >> 10;
+ $99 = ((($v$06)) + 224|0);
+ HEAP32[$99>>2] = $98;
+ $100 = (($84) + ($92))|0;
+ $101 = $100 >> 10;
+ $102 = ((($v$06)) + 32|0);
+ HEAP32[$102>>2] = $101;
+ $103 = (($92) - ($84))|0;
+ $104 = $103 >> 10;
+ $105 = ((($v$06)) + 192|0);
+ HEAP32[$105>>2] = $104;
+ $106 = (($86) + ($93))|0;
+ $107 = $106 >> 10;
+ $108 = ((($v$06)) + 64|0);
+ HEAP32[$108>>2] = $107;
+ $109 = (($93) - ($86))|0;
+ $110 = $109 >> 10;
+ $111 = ((($v$06)) + 160|0);
+ HEAP32[$111>>2] = $110;
+ $112 = (($88) + ($94))|0;
+ $113 = $112 >> 10;
+ $114 = ((($v$06)) + 96|0);
+ HEAP32[$114>>2] = $113;
+ $115 = (($94) - ($88))|0;
+ $116 = $115 >> 10;
+ $117 = ((($v$06)) + 128|0);
+ HEAP32[$117>>2] = $116;
+ }
+ $118 = (($i$08) + 1)|0;
+ $119 = ((($d$04)) + 2|0);
+ $120 = ((($v$06)) + 4|0);
+ $exitcond9 = ($118|0)==(8);
+ if ($exitcond9) {
+ $i$13 = 0;$o$01 = $out;$v$12 = $val;
+ break;
+ } else {
+ $d$04 = $119;$i$08 = $118;$v$06 = $120;
+ }
+ }
+ while(1) {
+ $121 = ((($v$12)) + 8|0);
+ $122 = HEAP32[$121>>2]|0;
+ $123 = ((($v$12)) + 24|0);
+ $124 = HEAP32[$123>>2]|0;
+ $125 = (($124) + ($122))|0;
+ $126 = ($125*2217)|0;
+ $127 = Math_imul($124, -7567)|0;
+ $128 = (($126) + ($127))|0;
+ $129 = ($122*3135)|0;
+ $130 = (($126) + ($129))|0;
+ $131 = HEAP32[$v$12>>2]|0;
+ $132 = ((($v$12)) + 16|0);
+ $133 = HEAP32[$132>>2]|0;
+ $134 = (($133) + ($131))|0;
+ $135 = $134 << 12;
+ $136 = (($131) - ($133))|0;
+ $137 = $136 << 12;
+ $138 = (($135) - ($130))|0;
+ $139 = (($137) - ($128))|0;
+ $140 = ((($v$12)) + 28|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = ((($v$12)) + 20|0);
+ $143 = HEAP32[$142>>2]|0;
+ $144 = ((($v$12)) + 12|0);
+ $145 = HEAP32[$144>>2]|0;
+ $146 = ((($v$12)) + 4|0);
+ $147 = HEAP32[$146>>2]|0;
+ $148 = (($145) + ($141))|0;
+ $149 = (($147) + ($143))|0;
+ $150 = (($147) + ($141))|0;
+ $151 = (($145) + ($143))|0;
+ $152 = (($149) + ($148))|0;
+ $153 = ($152*4816)|0;
+ $154 = ($141*1223)|0;
+ $155 = ($143*8410)|0;
+ $156 = ($145*12586)|0;
+ $157 = ($147*6149)|0;
+ $158 = Math_imul($150, -3685)|0;
+ $159 = (($153) + ($158))|0;
+ $160 = Math_imul($151, -10497)|0;
+ $161 = (($153) + ($160))|0;
+ $162 = Math_imul($148, -8034)|0;
+ $163 = Math_imul($149, -1597)|0;
+ $164 = (($163) + ($157))|0;
+ $165 = (($164) + ($159))|0;
+ $166 = (($162) + ($156))|0;
+ $167 = (($166) + ($161))|0;
+ $168 = (($163) + ($155))|0;
+ $169 = (($168) + ($161))|0;
+ $170 = (($162) + ($154))|0;
+ $171 = (($170) + ($159))|0;
+ $172 = (($130) + 16842752)|0;
+ $173 = (($172) + ($135))|0;
+ $174 = (($128) + 16842752)|0;
+ $175 = (($174) + ($137))|0;
+ $176 = (($139) + 16842752)|0;
+ $177 = (($138) + 16842752)|0;
+ $178 = (($165) + ($173))|0;
+ $179 = $178 >> 17;
+ $180 = (_stbi__clamp($179)|0);
+ HEAP8[$o$01>>0] = $180;
+ $181 = (($173) - ($165))|0;
+ $182 = $181 >> 17;
+ $183 = (_stbi__clamp($182)|0);
+ $184 = ((($o$01)) + 7|0);
+ HEAP8[$184>>0] = $183;
+ $185 = (($167) + ($175))|0;
+ $186 = $185 >> 17;
+ $187 = (_stbi__clamp($186)|0);
+ $188 = ((($o$01)) + 1|0);
+ HEAP8[$188>>0] = $187;
+ $189 = (($175) - ($167))|0;
+ $190 = $189 >> 17;
+ $191 = (_stbi__clamp($190)|0);
+ $192 = ((($o$01)) + 6|0);
+ HEAP8[$192>>0] = $191;
+ $193 = (($169) + ($176))|0;
+ $194 = $193 >> 17;
+ $195 = (_stbi__clamp($194)|0);
+ $196 = ((($o$01)) + 2|0);
+ HEAP8[$196>>0] = $195;
+ $197 = (($176) - ($169))|0;
+ $198 = $197 >> 17;
+ $199 = (_stbi__clamp($198)|0);
+ $200 = ((($o$01)) + 5|0);
+ HEAP8[$200>>0] = $199;
+ $201 = (($171) + ($177))|0;
+ $202 = $201 >> 17;
+ $203 = (_stbi__clamp($202)|0);
+ $204 = ((($o$01)) + 3|0);
+ HEAP8[$204>>0] = $203;
+ $205 = (($177) - ($171))|0;
+ $206 = $205 >> 17;
+ $207 = (_stbi__clamp($206)|0);
+ $208 = ((($o$01)) + 4|0);
+ HEAP8[$208>>0] = $207;
+ $209 = (($i$13) + 1)|0;
+ $210 = ((($v$12)) + 32|0);
+ $211 = (($o$01) + ($out_stride)|0);
+ $exitcond = ($209|0)==(8);
+ if ($exitcond) {
+ break;
+ } else {
+ $i$13 = $209;$o$01 = $211;$v$12 = $210;
+ }
+ }
+ STACKTOP = sp;return;
+}
+function _stbi__YCbCr_to_RGB_row($out,$y,$pcb,$pcr,$count,$step) {
+ $out = $out|0;
+ $y = $y|0;
+ $pcb = $pcb|0;
+ $pcr = $pcr|0;
+ $count = $count|0;
+ $step = $step|0;
+ var $$04 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b$0 = 0, $exitcond = 0, $g$0 = 0, $i$03 = 0, $r$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($count|0)>(0);
+ if ($0) {
+ $$04 = $out;$i$03 = 0;
+ } else {
+ return;
+ }
+ while(1) {
+ $1 = (($y) + ($i$03)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = $3 << 20;
+ $5 = $4 | 524288;
+ $6 = (($pcr) + ($i$03)|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = $7&255;
+ $9 = (($8) + -128)|0;
+ $10 = (($pcb) + ($i$03)|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11&255;
+ $13 = (($12) + -128)|0;
+ $14 = Math_imul($9, 1470208)|0;
+ $15 = (($14) + ($5))|0;
+ $16 = Math_imul($9, -748800)|0;
+ $17 = (($5) + ($16))|0;
+ $18 = Math_imul($13, -360960)|0;
+ $19 = $18 & -65536;
+ $20 = (($19) + ($17))|0;
+ $21 = Math_imul($13, 1858048)|0;
+ $22 = (($21) + ($5))|0;
+ $23 = $15 >> 20;
+ $24 = $20 >> 20;
+ $25 = $22 >> 20;
+ $26 = ($23>>>0)>(255);
+ $27 = $15 >>> 31;
+ $28 = (($27) + 255)|0;
+ $r$0 = $26 ? $28 : $23;
+ $29 = ($24>>>0)>(255);
+ $30 = $20 >>> 31;
+ $31 = (($30) + 255)|0;
+ $g$0 = $29 ? $31 : $24;
+ $32 = ($25>>>0)>(255);
+ $33 = $22 >>> 31;
+ $34 = (($33) + 255)|0;
+ $b$0 = $32 ? $34 : $25;
+ $35 = $r$0&255;
+ HEAP8[$$04>>0] = $35;
+ $36 = $g$0&255;
+ $37 = ((($$04)) + 1|0);
+ HEAP8[$37>>0] = $36;
+ $38 = $b$0&255;
+ $39 = ((($$04)) + 2|0);
+ HEAP8[$39>>0] = $38;
+ $40 = ((($$04)) + 3|0);
+ HEAP8[$40>>0] = -1;
+ $41 = (($$04) + ($step)|0);
+ $42 = (($i$03) + 1)|0;
+ $exitcond = ($42|0)==($count|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$04 = $41;$i$03 = $42;
+ }
+ }
+ return;
+}
+function _stbi__resample_row_hv_2($out,$in_near,$in_far,$w,$hs) {
+ $out = $out|0;
+ $in_near = $in_near|0;
+ $in_far = $in_far|0;
+ $w = $w|0;
+ $hs = $hs|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, $exitcond = 0, $i$01 = 0, $t1$0$lcssa = 0, $t1$02 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($w|0)==(1);
+ $1 = HEAP8[$in_near>>0]|0;
+ $2 = $1&255;
+ $3 = ($2*3)|0;
+ $4 = HEAP8[$in_far>>0]|0;
+ $5 = $4&255;
+ $6 = (($3) + ($5))|0;
+ $7 = (($6) + 2)|0;
+ $8 = $7 >>> 2;
+ $9 = $8&255;
+ if ($0) {
+ $10 = ((($out)) + 1|0);
+ HEAP8[$10>>0] = $9;
+ HEAP8[$out>>0] = $9;
+ return ($out|0);
+ }
+ HEAP8[$out>>0] = $9;
+ $11 = ($w|0)>(1);
+ if ($11) {
+ $i$01 = 1;$t1$02 = $6;
+ while(1) {
+ $12 = (($in_near) + ($i$01)|0);
+ $13 = HEAP8[$12>>0]|0;
+ $14 = $13&255;
+ $15 = ($14*3)|0;
+ $16 = (($in_far) + ($i$01)|0);
+ $17 = HEAP8[$16>>0]|0;
+ $18 = $17&255;
+ $19 = (($15) + ($18))|0;
+ $20 = ($t1$02*3)|0;
+ $21 = (($20) + 8)|0;
+ $22 = (($21) + ($19))|0;
+ $23 = $22 >>> 4;
+ $24 = $23&255;
+ $25 = $i$01 << 1;
+ $26 = (($25) + -1)|0;
+ $27 = (($out) + ($26)|0);
+ HEAP8[$27>>0] = $24;
+ $28 = ($19*3)|0;
+ $29 = (($t1$02) + 8)|0;
+ $30 = (($29) + ($28))|0;
+ $31 = $30 >>> 4;
+ $32 = $31&255;
+ $33 = (($out) + ($25)|0);
+ HEAP8[$33>>0] = $32;
+ $34 = (($i$01) + 1)|0;
+ $exitcond = ($34|0)==($w|0);
+ if ($exitcond) {
+ $t1$0$lcssa = $19;
+ break;
+ } else {
+ $i$01 = $34;$t1$02 = $19;
+ }
+ }
+ } else {
+ $t1$0$lcssa = $6;
+ }
+ $35 = (($t1$0$lcssa) + 2)|0;
+ $36 = $35 >>> 2;
+ $37 = $36&255;
+ $38 = $w << 1;
+ $39 = (($38) + -1)|0;
+ $40 = (($out) + ($39)|0);
+ HEAP8[$40>>0] = $37;
+ return ($out|0);
+}
+function _stbi__clamp($x) {
+ $x = $x|0;
+ var $$not = 0, $0 = 0, $1 = 0, $2 = 0, $x$lobit = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($x>>>0)>(255);
+ if ($0) {
+ $x$lobit = $x >> 31;
+ $1 = $x$lobit&255;
+ $$not = $1 ^ -1;
+ return ($$not|0);
+ } else {
+ $2 = $x&255;
+ return ($2|0);
+ }
+ return (0)|0;
+}
+function _stbi__stdio_read($user,$data,$size) {
+ $user = $user|0;
+ $data = $data|0;
+ $size = $size|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_fread($data,1,$size,$user)|0);
+ return ($0|0);
+}
+function _stbi__stdio_skip($user,$n) {
+ $user = $user|0;
+ $n = $n|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ (_fseek($user,$n,1)|0);
+ return;
+}
+function _stbi__stdio_eof($user) {
+ $user = $user|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_feof($user)|0);
+ return ($0|0);
+}
+function _ErrorCallback($error,$description) {
+ $error = $error|0;
+ $description = $description|0;
+ var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ HEAP32[$vararg_buffer>>2] = $error;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $description;
+ _TraceLog(2,17577,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _SetupFramebufferSize($displayWidth,$displayHeight) {
+ $displayWidth = $displayWidth|0;
+ $displayHeight = $displayHeight|0;
+ var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0;
+ var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, $or$cond = 0, $roundf = 0.0, $roundf1 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $storemerge = 0, $vararg_buffer = 0, $vararg_buffer4 = 0;
+ var $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0;
+ $vararg_buffer8 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer = sp;
+ $0 = sp + 40|0;
+ $1 = HEAP32[492>>2]|0;
+ $2 = ($1|0)>($displayWidth|0);
+ if (!($2)) {
+ $3 = HEAP32[496>>2]|0;
+ $4 = ($3|0)>($displayHeight|0);
+ if (!($4)) {
+ $29 = ($1|0)<($displayWidth|0);
+ $30 = ($3|0)<($displayHeight|0);
+ $or$cond = $29 | $30;
+ if (!($or$cond)) {
+ HEAP32[672>>2] = $1;
+ $51 = HEAP32[496>>2]|0;
+ HEAP32[676>>2] = $51;
+ HEAP32[664>>2] = 0;
+ HEAP32[668>>2] = 0;
+ STACKTOP = sp;return;
+ }
+ HEAP32[$vararg_buffer8>>2] = $1;
+ $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
+ HEAP32[$vararg_ptr11>>2] = $3;
+ $vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
+ HEAP32[$vararg_ptr12>>2] = $displayWidth;
+ $vararg_ptr13 = ((($vararg_buffer8)) + 12|0);
+ HEAP32[$vararg_ptr13>>2] = $displayHeight;
+ _TraceLog(0,17511,$vararg_buffer8);
+ $31 = (+($displayWidth|0));
+ $32 = (+($displayHeight|0));
+ $33 = $31 / $32;
+ $34 = HEAP32[492>>2]|0;
+ $35 = (+($34|0));
+ $36 = HEAP32[496>>2]|0;
+ $37 = (+($36|0));
+ $38 = $35 / $37;
+ $39 = !($33 <= $38);
+ if ($39) {
+ $46 = $33 * $37;
+ $roundf = (+_roundf($46));
+ $47 = (~~(($roundf)));
+ HEAP32[672>>2] = $47;
+ $48 = HEAP32[496>>2]|0;
+ HEAP32[676>>2] = $48;
+ $49 = HEAP32[492>>2]|0;
+ $50 = (($47) - ($49))|0;
+ HEAP32[664>>2] = $50;
+ HEAP32[668>>2] = 0;
+ STACKTOP = sp;return;
+ } else {
+ HEAP32[672>>2] = $34;
+ $40 = HEAP32[492>>2]|0;
+ $41 = (+($40|0));
+ $42 = $41 / $33;
+ $roundf1 = (+_roundf($42));
+ $43 = (~~(($roundf1)));
+ HEAP32[676>>2] = $43;
+ HEAP32[664>>2] = 0;
+ $44 = HEAP32[496>>2]|0;
+ $45 = (($43) - ($44))|0;
+ HEAP32[668>>2] = $45;
+ STACKTOP = sp;return;
+ }
+ }
+ }
+ $5 = HEAP32[492>>2]|0;
+ $6 = HEAP32[496>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $5;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $6;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $displayWidth;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $displayHeight;
+ _TraceLog(2,17368,$vararg_buffer);
+ $7 = (+($displayWidth|0));
+ $8 = HEAP32[492>>2]|0;
+ $9 = (+($8|0));
+ $10 = $7 / $9;
+ $11 = (+($displayHeight|0));
+ $12 = HEAP32[496>>2]|0;
+ $13 = (+($12|0));
+ $14 = $11 / $13;
+ $15 = !($10 <= $14);
+ if ($15) {
+ $21 = $9 * $14;
+ $roundf2 = (+_roundf($21));
+ $22 = (~~(($roundf2)));
+ HEAP32[672>>2] = $22;
+ HEAP32[676>>2] = $displayHeight;
+ $23 = (($displayWidth) - ($22))|0;
+ HEAP32[664>>2] = $23;
+ $storemerge = 0;
+ } else {
+ HEAP32[672>>2] = $displayWidth;
+ $16 = HEAP32[496>>2]|0;
+ $17 = (+($16|0));
+ $18 = $10 * $17;
+ $roundf3 = (+_roundf($18));
+ $19 = (~~(($roundf3)));
+ HEAP32[676>>2] = $19;
+ HEAP32[664>>2] = 0;
+ $20 = (($displayHeight) - ($19))|0;
+ $storemerge = $20;
+ }
+ HEAP32[668>>2] = $storemerge;
+ $24 = HEAP32[672>>2]|0;
+ $25 = (+($24|0));
+ $26 = HEAP32[492>>2]|0;
+ $27 = (+($26|0));
+ $28 = $25 / $27;
+ _MatrixScale($0,$28,$28,$28);
+ dest=512; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[672>>2] = $displayWidth;
+ HEAP32[676>>2] = $displayHeight;
+ HEAP32[$vararg_buffer4>>2] = $displayWidth;
+ $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
+ HEAP32[$vararg_ptr7>>2] = $displayHeight;
+ _TraceLog(2,17446,$vararg_buffer4);
+ STACKTOP = sp;return;
+}
+function _WindowSizeCallback($window,$width,$height) {
+ $window = $window|0;
+ $width = $width|0;
+ $height = $height|0;
+ var $0 = 0.0, $1 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlViewport(0,0,$width,$height);
+ _rlMatrixMode(0);
+ _rlLoadIdentity();
+ $0 = (+($width|0));
+ $1 = (+($height|0));
+ _rlOrtho(0.0,$0,$1,0.0,0.0,1.0);
+ _rlMatrixMode(1);
+ _rlLoadIdentity();
+ _rlClearScreenBuffers();
+ HEAP32[492>>2] = $width;
+ HEAP32[496>>2] = $height;
+ HEAP32[672>>2] = $width;
+ HEAP32[676>>2] = $height;
+ return;
+}
+function _CursorEnterCallback($window,$enter) {
+ $window = $window|0;
+ $enter = $enter|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function _KeyCallback($window,$key,$scancode,$action,$mods) {
+ $window = $window|0;
+ $key = $key|0;
+ $scancode = $scancode|0;
+ $action = $action|0;
+ $mods = $mods|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[648>>2]|0;
+ $1 = ($0|0)==($key|0);
+ $2 = ($action|0)==(1);
+ $or$cond = $2 & $1;
+ if ($or$cond) {
+ _glfwSetWindowShouldClose(($window|0),1);
+ return;
+ }
+ $3 = $action&255;
+ $4 = (7696 + ($key)|0);
+ HEAP8[$4>>0] = $3;
+ if (!($2)) {
+ return;
+ }
+ HEAP32[644>>2] = $key;
+ return;
+}
+function _MouseButtonCallback($window,$button,$action,$mods) {
+ $window = $window|0;
+ $button = $button|0;
+ $action = $action|0;
+ $mods = $mods|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0;
+ var $27 = 0.0, $28 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0;
+ $gestureEvent$byval_copy = sp + 40|0;
+ $gestureEvent = sp + 8|0;
+ $0 = sp;
+ $1 = $action&255;
+ $2 = (8720 + ($button)|0);
+ HEAP8[$2>>0] = $1;
+ $3 = (_IsMouseButtonPressed(0)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $5 = (_IsMouseButtonReleased(0)|0);
+ $6 = ($5|0)==(0);
+ if (!($6)) {
+ HEAP32[$gestureEvent>>2] = 0;
+ }
+ } else {
+ HEAP32[$gestureEvent>>2] = 1;
+ }
+ $7 = ((($gestureEvent)) + 8|0);
+ HEAP32[$7>>2] = 0;
+ $8 = ((($gestureEvent)) + 4|0);
+ HEAP32[$8>>2] = 1;
+ $9 = ((($gestureEvent)) + 16|0);
+ _GetMousePosition($0);
+ $10 = $0;
+ $11 = $10;
+ $12 = HEAP32[$11>>2]|0;
+ $13 = (($10) + 4)|0;
+ $14 = $13;
+ $15 = HEAP32[$14>>2]|0;
+ $16 = $9;
+ $17 = $16;
+ HEAP32[$17>>2] = $12;
+ $18 = (($16) + 4)|0;
+ $19 = $18;
+ HEAP32[$19>>2] = $15;
+ $20 = (_GetScreenWidth()|0);
+ $21 = (+($20|0));
+ $22 = +HEAPF32[$9>>2];
+ $23 = $22 / $21;
+ HEAPF32[$9>>2] = $23;
+ $24 = (_GetScreenHeight()|0);
+ $25 = (+($24|0));
+ $26 = ((($gestureEvent)) + 20|0);
+ $27 = +HEAPF32[$26>>2];
+ $28 = $27 / $25;
+ HEAPF32[$26>>2] = $28;
+ ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0;
+ _ProcessGestureEvent($gestureEvent$byval_copy);
+ STACKTOP = sp;return;
+}
+function _MouseCursorPosCallback($window,$x,$y) {
+ $window = $window|0;
+ $x = +$x;
+ $y = +$y;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $3 = 0.0, $4 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0;
+ $gestureEvent$byval_copy = sp + 32|0;
+ $gestureEvent = sp;
+ HEAP32[$gestureEvent>>2] = 2;
+ $0 = ((($gestureEvent)) + 8|0);
+ HEAP32[$0>>2] = 0;
+ $1 = ((($gestureEvent)) + 4|0);
+ HEAP32[$1>>2] = 1;
+ $2 = $x;
+ $3 = $y;
+ $4 = ((($gestureEvent)) + 16|0);
+ HEAPF32[$4>>2] = $2;
+ $5 = ((($gestureEvent)) + 20|0);
+ HEAPF32[$5>>2] = $3;
+ $6 = ((($gestureEvent)) + 16|0);
+ $7 = $6;
+ $8 = $7;
+ $9 = HEAP32[$8>>2]|0;
+ $10 = (($7) + 4)|0;
+ $11 = $10;
+ $12 = HEAP32[$11>>2]|0;
+ $13 = 64;
+ $14 = $13;
+ HEAP32[$14>>2] = $9;
+ $15 = (($13) + 4)|0;
+ $16 = $15;
+ HEAP32[$16>>2] = $12;
+ $17 = (_GetScreenWidth()|0);
+ $18 = (+($17|0));
+ $19 = +HEAPF32[$6>>2];
+ $20 = $19 / $18;
+ HEAPF32[$6>>2] = $20;
+ $21 = (_GetScreenHeight()|0);
+ $22 = (+($21|0));
+ $23 = +HEAPF32[$5>>2];
+ $24 = $23 / $22;
+ HEAPF32[$5>>2] = $24;
+ ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0;
+ _ProcessGestureEvent($gestureEvent$byval_copy);
+ STACKTOP = sp;return;
+}
+function _CharCallback($window,$key) {
+ $window = $window|0;
+ $key = $key|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[644>>2] = $key;
+ return;
+}
+function _ScrollCallback($window,$xoffset,$yoffset) {
+ $window = $window|0;
+ $xoffset = +$xoffset;
+ $yoffset = +$yoffset;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (~~(($yoffset)));
+ HEAP32[6424>>2] = $0;
+ return;
+}
+function _WindowIconifyCallback($window,$iconified) {
+ $window = $window|0;
+ $iconified = $iconified|0;
+ var $$ = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $not$ = ($iconified|0)!=(0);
+ $$ = $not$&1;
+ HEAP32[508>>2] = $$;
+ return;
+}
+function _emscripten_GetProcAddress($name_) {
+ $name_ = $name_|0;
+ var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
+ var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0;
+ var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
+ var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0;
+ var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0;
+ var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0;
+ var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0;
+ var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0;
+ var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0;
+ var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0;
+ var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0;
+ var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0;
+ var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0;
+ var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0;
+ var $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0;
+ var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0;
+ var $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0;
+ var $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0;
+ var $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0;
+ var $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0;
+ var $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0;
+ var $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0;
+ var $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0;
+ var $549 = 0, $55 = 0, $550 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
+ var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
+ var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $end = 0, $name = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $0 = sp + 12|0;
+ $1 = sp + 8|0;
+ $name = sp + 4|0;
+ $end = sp;
+ HEAP32[$1>>2] = $name_;
+ $2 = HEAP32[$1>>2]|0;
+ $3 = (_strlen($2)|0);
+ $4 = (($3) + 1)|0;
+ $5 = (_malloc($4)|0);
+ HEAP32[$name>>2] = $5;
+ $6 = HEAP32[$name>>2]|0;
+ $7 = HEAP32[$1>>2]|0;
+ (_strcpy($6,$7)|0);
+ $8 = HEAP32[$name>>2]|0;
+ $9 = (_strstr($8,17615)|0);
+ HEAP32[$end>>2] = $9;
+ $10 = HEAP32[$end>>2]|0;
+ $11 = ($10|0)!=(0|0);
+ if ($11) {
+ $12 = HEAP32[$end>>2]|0;
+ HEAP8[$12>>0] = 0;
+ }
+ $13 = HEAP32[$name>>2]|0;
+ $14 = (_strstr($13,17619)|0);
+ HEAP32[$end>>2] = $14;
+ $15 = HEAP32[$end>>2]|0;
+ $16 = ($15|0)!=(0|0);
+ if ($16) {
+ $17 = HEAP32[$end>>2]|0;
+ HEAP8[$17>>0] = 0;
+ }
+ $18 = HEAP32[$name>>2]|0;
+ $19 = (_strstr($18,17623)|0);
+ HEAP32[$end>>2] = $19;
+ $20 = HEAP32[$end>>2]|0;
+ $21 = ($20|0)!=(0|0);
+ if ($21) {
+ $22 = HEAP32[$end>>2]|0;
+ HEAP8[$22>>0] = 0;
+ }
+ $23 = HEAP32[$name>>2]|0;
+ $24 = (_strstr($23,17627)|0);
+ HEAP32[$end>>2] = $24;
+ $25 = HEAP32[$end>>2]|0;
+ $26 = ($25|0)!=(0|0);
+ if ($26) {
+ $27 = HEAP32[$end>>2]|0;
+ HEAP8[$27>>0] = 0;
+ }
+ $28 = HEAP32[$name>>2]|0;
+ $29 = (_strcmp($28,17633)|0);
+ $30 = ($29|0)!=(0);
+ do {
+ if ($30) {
+ $31 = HEAP32[$name>>2]|0;
+ $32 = (_strcmp($31,17671)|0);
+ $33 = ($32|0)!=(0);
+ if (!($33)) {
+ HEAP32[$name>>2] = 17690;
+ break;
+ }
+ $34 = HEAP32[$name>>2]|0;
+ $35 = (_strcmp($34,17703)|0);
+ $36 = ($35|0)!=(0);
+ if (!($36)) {
+ HEAP32[$name>>2] = 17724;
+ break;
+ }
+ $37 = HEAP32[$name>>2]|0;
+ $38 = (_strcmp($37,17739)|0);
+ $39 = ($38|0)!=(0);
+ if (!($39)) {
+ HEAP32[$name>>2] = 17754;
+ break;
+ }
+ $40 = HEAP32[$name>>2]|0;
+ $41 = (_strcmp($40,17769)|0);
+ $42 = ($41|0)!=(0);
+ if (!($42)) {
+ HEAP32[$name>>2] = 17784;
+ }
+ } else {
+ HEAP32[$name>>2] = 17655;
+ }
+ } while(0);
+ $43 = HEAP32[$name>>2]|0;
+ $44 = (_strcmp($43,17799)|0);
+ $45 = ($44|0)!=(0);
+ do {
+ if ($45) {
+ $46 = HEAP32[$name>>2]|0;
+ $47 = (_strcmp($46,17813)|0);
+ $48 = ($47|0)!=(0);
+ if (!($48)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $49 = HEAP32[$name>>2]|0;
+ $50 = (_strcmp($49,17825)|0);
+ $51 = ($50|0)!=(0);
+ if (!($51)) {
+ HEAP32[$0>>2] = 7;
+ break;
+ }
+ $52 = HEAP32[$name>>2]|0;
+ $53 = (_strcmp($52,17839)|0);
+ $54 = ($53|0)!=(0);
+ if (!($54)) {
+ HEAP32[$0>>2] = 8;
+ break;
+ }
+ $55 = HEAP32[$name>>2]|0;
+ $56 = (_strcmp($55,17851)|0);
+ $57 = ($56|0)!=(0);
+ if (!($57)) {
+ HEAP32[$0>>2] = 9;
+ break;
+ }
+ $58 = HEAP32[$name>>2]|0;
+ $59 = (_strcmp($58,17865)|0);
+ $60 = ($59|0)!=(0);
+ if (!($60)) {
+ HEAP32[$0>>2] = 10;
+ break;
+ }
+ $61 = HEAP32[$name>>2]|0;
+ $62 = (_strcmp($61,17879)|0);
+ $63 = ($62|0)!=(0);
+ if (!($63)) {
+ HEAP32[$0>>2] = 11;
+ break;
+ }
+ $64 = HEAP32[$name>>2]|0;
+ $65 = (_strcmp($64,17896)|0);
+ $66 = ($65|0)!=(0);
+ if (!($66)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $67 = HEAP32[$name>>2]|0;
+ $68 = (_strcmp($67,17919)|0);
+ $69 = ($68|0)!=(0);
+ if (!($69)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $70 = HEAP32[$name>>2]|0;
+ $71 = (_strcmp($70,17945)|0);
+ $72 = ($71|0)!=(0);
+ if (!($72)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $73 = HEAP32[$name>>2]|0;
+ $74 = (_strcmp($73,17958)|0);
+ $75 = ($74|0)!=(0);
+ if (!($75)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $76 = HEAP32[$name>>2]|0;
+ $77 = (_strcmp($76,17974)|0);
+ $78 = ($77|0)!=(0);
+ if (!($78)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $79 = HEAP32[$name>>2]|0;
+ $80 = (_strcmp($79,17987)|0);
+ $81 = ($80|0)!=(0);
+ if (!($81)) {
+ HEAP32[$0>>2] = 12;
+ break;
+ }
+ $82 = HEAP32[$name>>2]|0;
+ $83 = (_strcmp($82,18001)|0);
+ $84 = ($83|0)!=(0);
+ if (!($84)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $85 = HEAP32[$name>>2]|0;
+ $86 = (_strcmp($85,18021)|0);
+ $87 = ($86|0)!=(0);
+ if (!($87)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $88 = HEAP32[$name>>2]|0;
+ $89 = (_strcmp($88,18041)|0);
+ $90 = ($89|0)!=(0);
+ if (!($90)) {
+ HEAP32[$0>>2] = 5;
+ break;
+ }
+ $91 = HEAP32[$name>>2]|0;
+ $92 = (_strcmp($91,18058)|0);
+ $93 = ($92|0)!=(0);
+ if (!($93)) {
+ HEAP32[$0>>2] = 6;
+ break;
+ }
+ $94 = HEAP32[$name>>2]|0;
+ $95 = (_strcmp($94,18075)|0);
+ $96 = ($95|0)!=(0);
+ if (!($96)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $97 = HEAP32[$name>>2]|0;
+ $98 = (_strcmp($97,18087)|0);
+ $99 = ($98|0)!=(0);
+ if (!($99)) {
+ HEAP32[$0>>2] = 13;
+ break;
+ }
+ $100 = HEAP32[$name>>2]|0;
+ $101 = (_strcmp($100,18100)|0);
+ $102 = ($101|0)!=(0);
+ if (!($102)) {
+ HEAP32[$0>>2] = 14;
+ break;
+ }
+ $103 = HEAP32[$name>>2]|0;
+ $104 = (_strcmp($103,18116)|0);
+ $105 = ($104|0)!=(0);
+ if (!($105)) {
+ HEAP32[$0>>2] = 7;
+ break;
+ }
+ $106 = HEAP32[$name>>2]|0;
+ $107 = (_strcmp($106,18139)|0);
+ $108 = ($107|0)!=(0);
+ if (!($108)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $109 = HEAP32[$name>>2]|0;
+ $110 = (_strcmp($109,18152)|0);
+ $111 = ($110|0)!=(0);
+ if (!($111)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $112 = HEAP32[$name>>2]|0;
+ $113 = (_strcmp($112,18168)|0);
+ $114 = ($113|0)!=(0);
+ if (!($114)) {
+ HEAP32[$0>>2] = 5;
+ break;
+ }
+ $115 = HEAP32[$name>>2]|0;
+ $116 = (_strcmp($115,18179)|0);
+ $117 = ($116|0)!=(0);
+ if (!($117)) {
+ HEAP32[$0>>2] = 15;
+ break;
+ }
+ $118 = HEAP32[$name>>2]|0;
+ $119 = (_strcmp($118,18198)|0);
+ $120 = ($119|0)!=(0);
+ if (!($120)) {
+ HEAP32[$0>>2] = 16;
+ break;
+ }
+ $121 = HEAP32[$name>>2]|0;
+ $122 = (_strcmp($121,18220)|0);
+ $123 = ($122|0)!=(0);
+ if (!($123)) {
+ HEAP32[$0>>2] = 17;
+ break;
+ }
+ $124 = HEAP32[$name>>2]|0;
+ $125 = (_strcmp($124,18239)|0);
+ $126 = ($125|0)!=(0);
+ if (!($126)) {
+ HEAP32[$0>>2] = 8;
+ break;
+ }
+ $127 = HEAP32[$name>>2]|0;
+ $128 = (_strcmp($127,18268)|0);
+ $129 = ($128|0)!=(0);
+ if (!($129)) {
+ HEAP32[$0>>2] = 6;
+ break;
+ }
+ $130 = HEAP32[$name>>2]|0;
+ $131 = (_strcmp($130,18285)|0);
+ $132 = ($131|0)!=(0);
+ if (!($132)) {
+ HEAP32[$0>>2] = 9;
+ break;
+ }
+ $133 = HEAP32[$name>>2]|0;
+ $134 = (_strcmp($133,18300)|0);
+ $135 = ($134|0)!=(0);
+ if (!($135)) {
+ HEAP32[$0>>2] = 10;
+ break;
+ }
+ $136 = HEAP32[$name>>2]|0;
+ $137 = (_strcmp($136,18315)|0);
+ $138 = ($137|0)!=(0);
+ if (!($138)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $139 = HEAP32[$name>>2]|0;
+ $140 = (_strcmp($139,18336)|0);
+ $141 = ($140|0)!=(0);
+ if (!($141)) {
+ HEAP32[$0>>2] = 11;
+ break;
+ }
+ $142 = HEAP32[$name>>2]|0;
+ $143 = (_strcmp($142,18356)|0);
+ $144 = ($143|0)!=(0);
+ if (!($144)) {
+ HEAP32[$0>>2] = 12;
+ break;
+ }
+ $145 = HEAP32[$name>>2]|0;
+ $146 = (_strcmp($145,18376)|0);
+ $147 = ($146|0)!=(0);
+ if (!($147)) {
+ HEAP32[$0>>2] = 13;
+ break;
+ }
+ $148 = HEAP32[$name>>2]|0;
+ $149 = (_strcmp($148,18402)|0);
+ $150 = ($149|0)!=(0);
+ if (!($150)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $151 = HEAP32[$name>>2]|0;
+ $152 = (_strcmp($151,18421)|0);
+ $153 = ($152|0)!=(0);
+ if (!($153)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $154 = HEAP32[$name>>2]|0;
+ $155 = (_strcmp($154,18433)|0);
+ $156 = ($155|0)!=(0);
+ if (!($156)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $157 = HEAP32[$name>>2]|0;
+ $158 = (_strcmp($157,18445)|0);
+ $159 = ($158|0)!=(0);
+ if (!($159)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $160 = HEAP32[$name>>2]|0;
+ $161 = (_strcmp($160,18457)|0);
+ $162 = ($161|0)!=(0);
+ if (!($162)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $163 = HEAP32[$name>>2]|0;
+ $164 = (_strcmp($163,18469)|0);
+ $165 = ($164|0)!=(0);
+ if (!($165)) {
+ HEAP32[$0>>2] = 18;
+ break;
+ }
+ $166 = HEAP32[$name>>2]|0;
+ $167 = (_strcmp($166,18481)|0);
+ $168 = ($167|0)!=(0);
+ if (!($168)) {
+ HEAP32[$0>>2] = 14;
+ break;
+ }
+ $169 = HEAP32[$name>>2]|0;
+ $170 = (_strcmp($169,18493)|0);
+ $171 = ($170|0)!=(0);
+ if (!($171)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $172 = HEAP32[$name>>2]|0;
+ $173 = (_strcmp($172,18505)|0);
+ $174 = ($173|0)!=(0);
+ if (!($174)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $175 = HEAP32[$name>>2]|0;
+ $176 = (_strcmp($175,18517)|0);
+ $177 = ($176|0)!=(0);
+ if (!($177)) {
+ HEAP32[$0>>2] = 15;
+ break;
+ }
+ $178 = HEAP32[$name>>2]|0;
+ $179 = (_strcmp($178,18530)|0);
+ $180 = ($179|0)!=(0);
+ if (!($180)) {
+ HEAP32[$0>>2] = 16;
+ break;
+ }
+ $181 = HEAP32[$name>>2]|0;
+ $182 = (_strcmp($181,18543)|0);
+ $183 = ($182|0)!=(0);
+ if (!($183)) {
+ HEAP32[$0>>2] = 17;
+ break;
+ }
+ $184 = HEAP32[$name>>2]|0;
+ $185 = (_strcmp($184,18556)|0);
+ $186 = ($185|0)!=(0);
+ if (!($186)) {
+ HEAP32[$0>>2] = 18;
+ break;
+ }
+ $187 = HEAP32[$name>>2]|0;
+ $188 = (_strcmp($187,18569)|0);
+ $189 = ($188|0)!=(0);
+ if (!($189)) {
+ HEAP32[$0>>2] = 19;
+ break;
+ }
+ $190 = HEAP32[$name>>2]|0;
+ $191 = (_strcmp($190,18582)|0);
+ $192 = ($191|0)!=(0);
+ if (!($192)) {
+ HEAP32[$0>>2] = 20;
+ break;
+ }
+ $193 = HEAP32[$name>>2]|0;
+ $194 = (_strcmp($193,18595)|0);
+ $195 = ($194|0)!=(0);
+ if (!($195)) {
+ HEAP32[$0>>2] = 21;
+ break;
+ }
+ $196 = HEAP32[$name>>2]|0;
+ $197 = (_strcmp($196,18608)|0);
+ $198 = ($197|0)!=(0);
+ if (!($198)) {
+ HEAP32[$0>>2] = 22;
+ break;
+ }
+ $199 = HEAP32[$name>>2]|0;
+ $200 = (_strcmp($199,18621)|0);
+ $201 = ($200|0)!=(0);
+ if (!($201)) {
+ HEAP32[$0>>2] = 5;
+ break;
+ }
+ $202 = HEAP32[$name>>2]|0;
+ $203 = (_strcmp($202,18640)|0);
+ $204 = ($203|0)!=(0);
+ if (!($204)) {
+ HEAP32[$0>>2] = 6;
+ break;
+ }
+ $205 = HEAP32[$name>>2]|0;
+ $206 = (_strcmp($205,18659)|0);
+ $207 = ($206|0)!=(0);
+ if (!($207)) {
+ HEAP32[$0>>2] = 7;
+ break;
+ }
+ $208 = HEAP32[$name>>2]|0;
+ $209 = (_strcmp($208,18678)|0);
+ $210 = ($209|0)!=(0);
+ if (!($210)) {
+ HEAP32[$0>>2] = 19;
+ break;
+ }
+ $211 = HEAP32[$name>>2]|0;
+ $212 = (_strcmp($211,18691)|0);
+ $213 = ($212|0)!=(0);
+ if (!($213)) {
+ HEAP32[$0>>2] = 20;
+ break;
+ }
+ $214 = HEAP32[$name>>2]|0;
+ $215 = (_strcmp($214,18709)|0);
+ $216 = ($215|0)!=(0);
+ if (!($216)) {
+ HEAP32[$0>>2] = 21;
+ break;
+ }
+ $217 = HEAP32[$name>>2]|0;
+ $218 = (_strcmp($217,18727)|0);
+ $219 = ($218|0)!=(0);
+ if (!($219)) {
+ HEAP32[$0>>2] = 22;
+ break;
+ }
+ $220 = HEAP32[$name>>2]|0;
+ $221 = (_strcmp($220,18745)|0);
+ $222 = ($221|0)!=(0);
+ if (!($222)) {
+ HEAP32[$0>>2] = 23;
+ break;
+ }
+ $223 = HEAP32[$name>>2]|0;
+ $224 = (_strcmp($223,18763)|0);
+ $225 = ($224|0)!=(0);
+ if (!($225)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $226 = HEAP32[$name>>2]|0;
+ $227 = (_strcmp($226,18783)|0);
+ $228 = ($227|0)!=(0);
+ if (!($228)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $229 = HEAP32[$name>>2]|0;
+ $230 = (_strcmp($229,17724)|0);
+ $231 = ($230|0)!=(0);
+ if (!($231)) {
+ HEAP32[$0>>2] = 7;
+ break;
+ }
+ $232 = HEAP32[$name>>2]|0;
+ $233 = (_strcmp($232,18801)|0);
+ $234 = ($233|0)!=(0);
+ if (!($234)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $235 = HEAP32[$name>>2]|0;
+ $236 = (_strcmp($235,18816)|0);
+ $237 = ($236|0)!=(0);
+ if (!($237)) {
+ HEAP32[$0>>2] = 8;
+ break;
+ }
+ $238 = HEAP32[$name>>2]|0;
+ $239 = (_strcmp($238,18837)|0);
+ $240 = ($239|0)!=(0);
+ if (!($240)) {
+ HEAP32[$0>>2] = 9;
+ break;
+ }
+ $241 = HEAP32[$name>>2]|0;
+ $242 = (_strcmp($241,18852)|0);
+ $243 = ($242|0)!=(0);
+ if (!($243)) {
+ HEAP32[$0>>2] = 10;
+ break;
+ }
+ $244 = HEAP32[$name>>2]|0;
+ $245 = (_strcmp($244,18870)|0);
+ $246 = ($245|0)!=(0);
+ if (!($246)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $247 = HEAP32[$name>>2]|0;
+ $248 = (_strcmp($247,18886)|0);
+ $249 = ($248|0)!=(0);
+ if (!($249)) {
+ HEAP32[$0>>2] = 11;
+ break;
+ }
+ $250 = HEAP32[$name>>2]|0;
+ $251 = (_strcmp($250,18905)|0);
+ $252 = ($251|0)!=(0);
+ if (!($252)) {
+ HEAP32[$0>>2] = 23;
+ break;
+ }
+ $253 = HEAP32[$name>>2]|0;
+ $254 = (_strcmp($253,18919)|0);
+ $255 = ($254|0)!=(0);
+ if (!($255)) {
+ HEAP32[$0>>2] = 24;
+ break;
+ }
+ $256 = HEAP32[$name>>2]|0;
+ $257 = (_strcmp($256,18934)|0);
+ $258 = ($257|0)!=(0);
+ if (!($258)) {
+ HEAP32[$0>>2] = 8;
+ break;
+ }
+ $259 = HEAP32[$name>>2]|0;
+ $260 = (_strcmp($259,17655)|0);
+ $261 = ($260|0)!=(0);
+ if (!($261)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $262 = HEAP32[$name>>2]|0;
+ $263 = (_strcmp($262,18945)|0);
+ $264 = ($263|0)!=(0);
+ if (!($264)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $265 = HEAP32[$name>>2]|0;
+ $266 = (_strcmp($265,17754)|0);
+ $267 = ($266|0)!=(0);
+ if (!($267)) {
+ HEAP32[$0>>2] = 24;
+ break;
+ }
+ $268 = HEAP32[$name>>2]|0;
+ $269 = (_strcmp($268,17784)|0);
+ $270 = ($269|0)!=(0);
+ if (!($270)) {
+ HEAP32[$0>>2] = 25;
+ break;
+ }
+ $271 = HEAP32[$name>>2]|0;
+ $272 = (_strcmp($271,18961)|0);
+ $273 = ($272|0)!=(0);
+ if (!($273)) {
+ HEAP32[$0>>2] = 12;
+ break;
+ }
+ $274 = HEAP32[$name>>2]|0;
+ $275 = (_strcmp($274,18988)|0);
+ $276 = ($275|0)!=(0);
+ if (!($276)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $277 = HEAP32[$name>>2]|0;
+ $278 = (_strcmp($277,19002)|0);
+ $279 = ($278|0)!=(0);
+ if (!($279)) {
+ HEAP32[$0>>2] = 13;
+ break;
+ }
+ $280 = HEAP32[$name>>2]|0;
+ $281 = (_strcmp($280,17690)|0);
+ $282 = ($281|0)!=(0);
+ if (!($282)) {
+ HEAP32[$0>>2] = 5;
+ break;
+ }
+ $283 = HEAP32[$name>>2]|0;
+ $284 = (_strcmp($283,19022)|0);
+ $285 = ($284|0)!=(0);
+ if (!($285)) {
+ HEAP32[$0>>2] = 6;
+ break;
+ }
+ $286 = HEAP32[$name>>2]|0;
+ $287 = (_strcmp($286,19040)|0);
+ $288 = ($287|0)!=(0);
+ if (!($288)) {
+ HEAP32[$0>>2] = 9;
+ break;
+ }
+ $289 = HEAP32[$name>>2]|0;
+ $290 = (_strcmp($289,19052)|0);
+ $291 = ($290|0)!=(0);
+ if (!($291)) {
+ HEAP32[$0>>2] = 25;
+ break;
+ }
+ $292 = HEAP32[$name>>2]|0;
+ $293 = (_strcmp($292,19073)|0);
+ $294 = ($293|0)!=(0);
+ if (!($294)) {
+ HEAP32[$0>>2] = 26;
+ break;
+ }
+ $295 = HEAP32[$name>>2]|0;
+ $296 = (_strcmp($295,19091)|0);
+ $297 = ($296|0)!=(0);
+ if (!($297)) {
+ HEAP32[$0>>2] = 27;
+ break;
+ }
+ $298 = HEAP32[$name>>2]|0;
+ $299 = (_strcmp($298,19109)|0);
+ $300 = ($299|0)!=(0);
+ if (!($300)) {
+ HEAP32[$0>>2] = 28;
+ break;
+ }
+ $301 = HEAP32[$name>>2]|0;
+ $302 = (_strcmp($301,19130)|0);
+ $303 = ($302|0)!=(0);
+ if (!($303)) {
+ HEAP32[$0>>2] = 14;
+ break;
+ }
+ $304 = HEAP32[$name>>2]|0;
+ $305 = (_strcmp($304,19156)|0);
+ $306 = ($305|0)!=(0);
+ if (!($306)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $307 = HEAP32[$name>>2]|0;
+ $308 = (_strcmp($307,19179)|0);
+ $309 = ($308|0)!=(0);
+ if (!($309)) {
+ HEAP32[$0>>2] = 15;
+ break;
+ }
+ $310 = HEAP32[$name>>2]|0;
+ $311 = (_strcmp($310,19217)|0);
+ $312 = ($311|0)!=(0);
+ if (!($312)) {
+ HEAP32[$0>>2] = 10;
+ break;
+ }
+ $313 = HEAP32[$name>>2]|0;
+ $314 = (_strcmp($313,19233)|0);
+ $315 = ($314|0)!=(0);
+ if (!($315)) {
+ HEAP32[$0>>2] = 7;
+ break;
+ }
+ $316 = HEAP32[$name>>2]|0;
+ $317 = (_strcmp($316,19248)|0);
+ $318 = ($317|0)!=(0);
+ if (!($318)) {
+ HEAP32[$0>>2] = 26;
+ break;
+ }
+ $319 = HEAP32[$name>>2]|0;
+ $320 = (_strcmp($319,19271)|0);
+ $321 = ($320|0)!=(0);
+ if (!($321)) {
+ HEAP32[$0>>2] = 16;
+ break;
+ }
+ $322 = HEAP32[$name>>2]|0;
+ $323 = (_strcmp($322,19284)|0);
+ $324 = ($323|0)!=(0);
+ if (!($324)) {
+ HEAP32[$0>>2] = 29;
+ break;
+ }
+ $325 = HEAP32[$name>>2]|0;
+ $326 = (_strcmp($325,19298)|0);
+ $327 = ($326|0)!=(0);
+ if (!($327)) {
+ HEAP32[$0>>2] = 30;
+ break;
+ }
+ $328 = HEAP32[$name>>2]|0;
+ $329 = (_strcmp($328,19312)|0);
+ $330 = ($329|0)!=(0);
+ if (!($330)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $331 = HEAP32[$name>>2]|0;
+ $332 = (_strcmp($331,19332)|0);
+ $333 = ($332|0)!=(0);
+ if (!($333)) {
+ HEAP32[$0>>2] = 8;
+ break;
+ }
+ $334 = HEAP32[$name>>2]|0;
+ $335 = (_strcmp($334,19352)|0);
+ $336 = ($335|0)!=(0);
+ if (!($336)) {
+ HEAP32[$0>>2] = 17;
+ break;
+ }
+ $337 = HEAP32[$name>>2]|0;
+ $338 = (_strcmp($337,19368)|0);
+ $339 = ($338|0)!=(0);
+ if (!($339)) {
+ HEAP32[$0>>2] = 18;
+ break;
+ }
+ $340 = HEAP32[$name>>2]|0;
+ $341 = (_strcmp($340,19386)|0);
+ $342 = ($341|0)!=(0);
+ if (!($342)) {
+ HEAP32[$0>>2] = 27;
+ break;
+ }
+ $343 = HEAP32[$name>>2]|0;
+ $344 = (_strcmp($343,19402)|0);
+ $345 = ($344|0)!=(0);
+ if (!($345)) {
+ HEAP32[$0>>2] = 19;
+ break;
+ }
+ $346 = HEAP32[$name>>2]|0;
+ $347 = (_strcmp($346,19417)|0);
+ $348 = ($347|0)!=(0);
+ if (!($348)) {
+ HEAP32[$0>>2] = 9;
+ break;
+ }
+ $349 = HEAP32[$name>>2]|0;
+ $350 = (_strcmp($349,19439)|0);
+ $351 = ($350|0)!=(0);
+ if (!($351)) {
+ HEAP32[$0>>2] = 31;
+ break;
+ }
+ $352 = HEAP32[$name>>2]|0;
+ $353 = (_strcmp($352,19457)|0);
+ $354 = ($353|0)!=(0);
+ if (!($354)) {
+ HEAP32[$0>>2] = 32;
+ break;
+ }
+ $355 = HEAP32[$name>>2]|0;
+ $356 = (_strcmp($355,19478)|0);
+ $357 = ($356|0)!=(0);
+ if (!($357)) {
+ HEAP32[$0>>2] = 10;
+ break;
+ }
+ $358 = HEAP32[$name>>2]|0;
+ $359 = (_strcmp($358,19496)|0);
+ $360 = ($359|0)!=(0);
+ if (!($360)) {
+ HEAP32[$0>>2] = 11;
+ break;
+ }
+ $361 = HEAP32[$name>>2]|0;
+ $362 = (_strcmp($361,19509)|0);
+ $363 = ($362|0)!=(0);
+ if (!($363)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $364 = HEAP32[$name>>2]|0;
+ $365 = (_strcmp($364,19524)|0);
+ $366 = ($365|0)!=(0);
+ if (!($366)) {
+ HEAP32[$0>>2] = 12;
+ break;
+ }
+ $367 = HEAP32[$name>>2]|0;
+ $368 = (_strcmp($367,19538)|0);
+ $369 = ($368|0)!=(0);
+ if (!($369)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $370 = HEAP32[$name>>2]|0;
+ $371 = (_strcmp($370,19548)|0);
+ $372 = ($371|0)!=(0);
+ if (!($372)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $373 = HEAP32[$name>>2]|0;
+ $374 = (_strcmp($373,19558)|0);
+ $375 = ($374|0)!=(0);
+ if (!($375)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $376 = HEAP32[$name>>2]|0;
+ $377 = (_strcmp($376,19580)|0);
+ $378 = ($377|0)!=(0);
+ if (!($378)) {
+ HEAP32[$0>>2] = 13;
+ break;
+ }
+ $379 = HEAP32[$name>>2]|0;
+ $380 = (_strcmp($379,19606)|0);
+ $381 = ($380|0)!=(0);
+ if (!($381)) {
+ HEAP32[$0>>2] = 14;
+ break;
+ }
+ $382 = HEAP32[$name>>2]|0;
+ $383 = (_strcmp($382,19633)|0);
+ $384 = ($383|0)!=(0);
+ if (!($384)) {
+ HEAP32[$0>>2] = 28;
+ break;
+ }
+ $385 = HEAP32[$name>>2]|0;
+ $386 = (_strcmp($385,19646)|0);
+ $387 = ($386|0)!=(0);
+ if (!($387)) {
+ HEAP32[$0>>2] = 20;
+ break;
+ }
+ $388 = HEAP32[$name>>2]|0;
+ $389 = (_strcmp($388,19661)|0);
+ $390 = ($389|0)!=(0);
+ if (!($390)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $391 = HEAP32[$name>>2]|0;
+ $392 = (_strcmp($391,19676)|0);
+ $393 = ($392|0)!=(0);
+ if (!($393)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $394 = HEAP32[$name>>2]|0;
+ $395 = (_strcmp($394,19700)|0);
+ $396 = ($395|0)!=(0);
+ if (!($396)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $397 = HEAP32[$name>>2]|0;
+ $398 = (_strcmp($397,19711)|0);
+ $399 = ($398|0)!=(0);
+ if (!($399)) {
+ HEAP32[$0>>2] = 33;
+ break;
+ }
+ $400 = HEAP32[$name>>2]|0;
+ $401 = (_strcmp($400,19733)|0);
+ $402 = ($401|0)!=(0);
+ if (!($402)) {
+ HEAP32[$0>>2] = 21;
+ break;
+ }
+ $403 = HEAP32[$name>>2]|0;
+ $404 = (_strcmp($403,19755)|0);
+ $405 = ($404|0)!=(0);
+ if (!($405)) {
+ HEAP32[$0>>2] = 5;
+ break;
+ }
+ $406 = HEAP32[$name>>2]|0;
+ $407 = (_strcmp($406,19779)|0);
+ $408 = ($407|0)!=(0);
+ if (!($408)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $409 = HEAP32[$name>>2]|0;
+ $410 = (_strcmp($409,19788)|0);
+ $411 = ($410|0)!=(0);
+ if (!($411)) {
+ HEAP32[$0>>2] = 5;
+ break;
+ }
+ $412 = HEAP32[$name>>2]|0;
+ $413 = (_strcmp($412,19796)|0);
+ $414 = ($413|0)!=(0);
+ if (!($414)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $415 = HEAP32[$name>>2]|0;
+ $416 = (_strcmp($415,19809)|0);
+ $417 = ($416|0)!=(0);
+ if (!($417)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $418 = HEAP32[$name>>2]|0;
+ $419 = (_strcmp($418,19823)|0);
+ $420 = ($419|0)!=(0);
+ if (!($420)) {
+ HEAP32[$0>>2] = 15;
+ break;
+ }
+ $421 = HEAP32[$name>>2]|0;
+ $422 = (_strcmp($421,19835)|0);
+ $423 = ($422|0)!=(0);
+ if (!($423)) {
+ HEAP32[$0>>2] = 16;
+ break;
+ }
+ $424 = HEAP32[$name>>2]|0;
+ $425 = (_strcmp($424,19844)|0);
+ $426 = ($425|0)!=(0);
+ if (!($426)) {
+ HEAP32[$0>>2] = 17;
+ break;
+ }
+ $427 = HEAP32[$name>>2]|0;
+ $428 = (_strcmp($427,19854)|0);
+ $429 = ($428|0)!=(0);
+ if (!($429)) {
+ HEAP32[$0>>2] = 18;
+ break;
+ }
+ $430 = HEAP32[$name>>2]|0;
+ $431 = (_strcmp($430,19866)|0);
+ $432 = ($431|0)!=(0);
+ if (!($432)) {
+ HEAP32[$0>>2] = 19;
+ break;
+ }
+ $433 = HEAP32[$name>>2]|0;
+ $434 = (_strcmp($433,19877)|0);
+ $435 = ($434|0)!=(0);
+ if (!($435)) {
+ HEAP32[$0>>2] = 20;
+ break;
+ }
+ $436 = HEAP32[$name>>2]|0;
+ $437 = (_strcmp($436,19885)|0);
+ $438 = ($437|0)!=(0);
+ if (!($438)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $439 = HEAP32[$name>>2]|0;
+ $440 = (_strcmp($439,19897)|0);
+ $441 = ($440|0)!=(0);
+ if (!($441)) {
+ HEAP32[$0>>2] = 21;
+ break;
+ }
+ $442 = HEAP32[$name>>2]|0;
+ $443 = (_strcmp($442,19912)|0);
+ $444 = ($443|0)!=(0);
+ if (!($444)) {
+ HEAP32[$0>>2] = 22;
+ break;
+ }
+ $445 = HEAP32[$name>>2]|0;
+ $446 = (_strcmp($445,19924)|0);
+ $447 = ($446|0)!=(0);
+ if (!($447)) {
+ HEAP32[$0>>2] = 23;
+ break;
+ }
+ $448 = HEAP32[$name>>2]|0;
+ $449 = (_strcmp($448,19938)|0);
+ $450 = ($449|0)!=(0);
+ if (!($450)) {
+ HEAP32[$0>>2] = 11;
+ break;
+ }
+ $451 = HEAP32[$name>>2]|0;
+ $452 = (_strcmp($451,19963)|0);
+ $453 = ($452|0)!=(0);
+ if (!($453)) {
+ HEAP32[$0>>2] = 24;
+ break;
+ }
+ $454 = HEAP32[$name>>2]|0;
+ $455 = (_strcmp($454,19980)|0);
+ $456 = ($455|0)!=(0);
+ if (!($456)) {
+ HEAP32[$0>>2] = 25;
+ break;
+ }
+ $457 = HEAP32[$name>>2]|0;
+ $458 = (_strcmp($457,19996)|0);
+ $459 = ($458|0)!=(0);
+ if (!($459)) {
+ HEAP32[$0>>2] = 26;
+ break;
+ }
+ $460 = HEAP32[$name>>2]|0;
+ $461 = (_strcmp($460,20012)|0);
+ $462 = ($461|0)!=(0);
+ if (!($462)) {
+ HEAP32[$0>>2] = 12;
+ break;
+ }
+ $463 = HEAP32[$name>>2]|0;
+ $464 = (_strcmp($463,20024)|0);
+ $465 = ($464|0)!=(0);
+ if (!($465)) {
+ HEAP32[$0>>2] = 34;
+ break;
+ }
+ $466 = HEAP32[$name>>2]|0;
+ $467 = (_strcmp($466,20036)|0);
+ $468 = ($467|0)!=(0);
+ if (!($468)) {
+ HEAP32[$0>>2] = 35;
+ break;
+ }
+ $469 = HEAP32[$name>>2]|0;
+ $470 = (_strcmp($469,20060)|0);
+ $471 = ($470|0)!=(0);
+ if (!($471)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $472 = HEAP32[$name>>2]|0;
+ $473 = (_strcmp($472,20073)|0);
+ $474 = ($473|0)!=(0);
+ if (!($474)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $475 = HEAP32[$name>>2]|0;
+ $476 = (_strcmp($475,20087)|0);
+ $477 = ($476|0)!=(0);
+ if (!($477)) {
+ HEAP32[$0>>2] = 36;
+ break;
+ }
+ $478 = HEAP32[$name>>2]|0;
+ $479 = (_strcmp($478,20109)|0);
+ $480 = ($479|0)!=(0);
+ if (!($480)) {
+ HEAP32[$0>>2] = 37;
+ break;
+ }
+ $481 = HEAP32[$name>>2]|0;
+ $482 = (_strcmp($481,20116)|0);
+ $483 = ($482|0)!=(0);
+ if (!($483)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $484 = HEAP32[$name>>2]|0;
+ $485 = (_strcmp($484,20132)|0);
+ $486 = ($485|0)!=(0);
+ if (!($486)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $487 = HEAP32[$name>>2]|0;
+ $488 = (_strcmp($487,20149)|0);
+ $489 = ($488|0)!=(0);
+ if (!($489)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $490 = HEAP32[$name>>2]|0;
+ $491 = (_strcmp($490,20166)|0);
+ $492 = ($491|0)!=(0);
+ if (!($492)) {
+ HEAP32[$0>>2] = 29;
+ break;
+ }
+ $493 = HEAP32[$name>>2]|0;
+ $494 = (_strcmp($493,20182)|0);
+ $495 = ($494|0)!=(0);
+ if (!($495)) {
+ HEAP32[$0>>2] = 1;
+ break;
+ }
+ $496 = HEAP32[$name>>2]|0;
+ $497 = (_strcmp($496,20198)|0);
+ $498 = ($497|0)!=(0);
+ if (!($498)) {
+ HEAP32[$0>>2] = 4;
+ break;
+ }
+ $499 = HEAP32[$name>>2]|0;
+ $500 = (_strcmp($499,20215)|0);
+ $501 = ($500|0)!=(0);
+ if (!($501)) {
+ HEAP32[$0>>2] = 30;
+ break;
+ }
+ $502 = HEAP32[$name>>2]|0;
+ $503 = (_strcmp($502,20229)|0);
+ $504 = ($503|0)!=(0);
+ if (!($504)) {
+ HEAP32[$0>>2] = 31;
+ break;
+ }
+ $505 = HEAP32[$name>>2]|0;
+ $506 = (_strcmp($505,20241)|0);
+ $507 = ($506|0)!=(0);
+ if (!($507)) {
+ HEAP32[$0>>2] = 22;
+ break;
+ }
+ $508 = HEAP32[$name>>2]|0;
+ $509 = (_strcmp($508,20252)|0);
+ $510 = ($509|0)!=(0);
+ if (!($510)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $511 = HEAP32[$name>>2]|0;
+ $512 = (_strcmp($511,20265)|0);
+ $513 = ($512|0)!=(0);
+ if (!($513)) {
+ HEAP32[$0>>2] = 23;
+ break;
+ }
+ $514 = HEAP32[$name>>2]|0;
+ $515 = (_strcmp($514,20275)|0);
+ $516 = ($515|0)!=(0);
+ if (!($516)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $517 = HEAP32[$name>>2]|0;
+ $518 = (_strcmp($517,20292)|0);
+ $519 = ($518|0)!=(0);
+ if (!($519)) {
+ HEAP32[$0>>2] = 24;
+ break;
+ }
+ $520 = HEAP32[$name>>2]|0;
+ $521 = (_strcmp($520,20304)|0);
+ $522 = ($521|0)!=(0);
+ if (!($522)) {
+ HEAP32[$0>>2] = 25;
+ break;
+ }
+ $523 = HEAP32[$name>>2]|0;
+ $524 = (_strcmp($523,20326)|0);
+ $525 = ($524|0)!=(0);
+ if (!($525)) {
+ HEAP32[$0>>2] = 26;
+ break;
+ }
+ $526 = HEAP32[$name>>2]|0;
+ $527 = (_strcmp($526,20346)|0);
+ $528 = ($527|0)!=(0);
+ if (!($528)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $529 = HEAP32[$name>>2]|0;
+ $530 = (_strcmp($529,20359)|0);
+ $531 = ($530|0)!=(0);
+ if (!($531)) {
+ HEAP32[$0>>2] = 27;
+ break;
+ }
+ $532 = HEAP32[$name>>2]|0;
+ $533 = (_strcmp($532,20381)|0);
+ $534 = ($533|0)!=(0);
+ if (!($534)) {
+ HEAP32[$0>>2] = 28;
+ break;
+ }
+ $535 = HEAP32[$name>>2]|0;
+ $536 = (_strcmp($535,20401)|0);
+ $537 = ($536|0)!=(0);
+ if (!($537)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $538 = HEAP32[$name>>2]|0;
+ $539 = (_strcmp($538,20418)|0);
+ $540 = ($539|0)!=(0);
+ if (!($540)) {
+ HEAP32[$0>>2] = 2;
+ break;
+ }
+ $541 = HEAP32[$name>>2]|0;
+ $542 = (_strcmp($541,20435)|0);
+ $543 = ($542|0)!=(0);
+ if (!($543)) {
+ HEAP32[$0>>2] = 3;
+ break;
+ }
+ $544 = HEAP32[$name>>2]|0;
+ $545 = (_strcmp($544,20455)|0);
+ $546 = ($545|0)!=(0);
+ if ($546) {
+ $547 = HEAP32[$1>>2]|0;
+ $548 = HEAP32[$name>>2]|0;
+ $549 = _emscripten_asm_const_2(0, ($547|0), ($548|0))|0;
+ HEAP32[$0>>2] = 0;
+ break;
+ } else {
+ HEAP32[$0>>2] = 38;
+ break;
+ }
+ } else {
+ HEAP32[$0>>2] = 6;
+ }
+ } while(0);
+ $550 = HEAP32[$0>>2]|0;
+ STACKTOP = sp;return ($550|0);
+}
+function _isspace($c) {
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($c|0)==(32);
+ $1 = (($c) + -9)|0;
+ $2 = ($1>>>0)<(5);
+ $3 = $0 | $2;
+ $4 = $3&1;
+ return ($4|0);
+}
+function _strerror($e) {
+ $e = $e|0;
+ var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$03 = 0, $i$03$lcssa = 0, $i$12 = 0, $s$0$lcssa = 0, $s$01 = 0, $s$1 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $i$03 = 0;
+ while(1) {
+ $1 = (20571 + ($i$03)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = ($3|0)==($e|0);
+ if ($4) {
+ $i$03$lcssa = $i$03;
+ label = 2;
+ break;
+ }
+ $5 = (($i$03) + 1)|0;
+ $6 = ($5|0)==(87);
+ if ($6) {
+ $i$12 = 87;$s$01 = 20659;
+ label = 5;
+ break;
+ } else {
+ $i$03 = $5;
+ }
+ }
+ if ((label|0) == 2) {
+ $0 = ($i$03$lcssa|0)==(0);
+ if ($0) {
+ $s$0$lcssa = 20659;
+ } else {
+ $i$12 = $i$03$lcssa;$s$01 = 20659;
+ label = 5;
+ }
+ }
+ if ((label|0) == 5) {
+ while(1) {
+ label = 0;
+ $s$1 = $s$01;
+ while(1) {
+ $7 = HEAP8[$s$1>>0]|0;
+ $8 = ($7<<24>>24)==(0);
+ $9 = ((($s$1)) + 1|0);
+ if ($8) {
+ $$lcssa = $9;
+ break;
+ } else {
+ $s$1 = $9;
+ }
+ }
+ $10 = (($i$12) + -1)|0;
+ $11 = ($10|0)==(0);
+ if ($11) {
+ $s$0$lcssa = $$lcssa;
+ break;
+ } else {
+ $i$12 = $10;$s$01 = $$lcssa;
+ label = 5;
+ }
+ }
+ }
+ return ($s$0$lcssa|0);
+}
+function ___errno_location() {
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[6428>>2]|0;
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ $$0 = 6684;
+ } else {
+ $2 = (_pthread_self()|0);
+ $3 = ((($2)) + 60|0);
+ $4 = HEAP32[$3>>2]|0;
+ $$0 = $4;
+ }
+ return ($$0|0);
+}
+function ___floatscan($f,$prec,$pok) {
+ $f = $f|0;
+ $prec = $prec|0;
+ $pok = $pok|0;
+ var $$$i = 0, $$0 = 0.0, $$0$i27 = 0.0, $$010$i = 0, $$07$i = 0, $$0710$i = 0, $$0711$i = 0, $$09$i = 0, $$1$be$i = 0, $$1$ph$i = 0, $$11$i = 0, $$18$i = 0, $$2$i = 0, $$3$be$i = 0, $$3$lcssa$i = 0, $$3105$i = 0, $$in = 0, $$k$0$i = 0, $$lcssa = 0, $$lcssa256 = 0;
+ var $$lcssa256$lcssa = 0, $$lcssa257 = 0, $$lcssa257$lcssa = 0, $$lcssa263 = 0, $$lcssa264 = 0, $$lcssa265 = 0, $$lcssa275 = 0, $$lnz$0$i = 0, $$neg32$i = 0, $$not$i = 0, $$old8 = 0, $$pn$i = 0.0, $$pre$i = 0, $$pre$i17 = 0, $$pre$phi42$iZ2D = 0.0, $$pre41$i = 0.0, $$promoted$i = 0, $$sink$off0$i = 0, $0 = 0, $1 = 0;
+ var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
+ var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
+ var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
+ var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
+ var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0, $187 = 0, $188 = 0.0, $189 = 0.0, $19 = 0;
+ var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0;
+ var $208 = 0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0;
+ var $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0;
+ var $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0;
+ var $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0.0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0;
+ var $280 = 0.0, $281 = 0.0, $282 = 0.0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0;
+ var $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0.0, $312 = 0, $313 = 0, $314 = 0, $315 = 0;
+ var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0.0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0, $324 = 0, $325 = 0.0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0;
+ var $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0;
+ var $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0;
+ var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0;
+ var $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0;
+ var $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0;
+ var $424 = 0.0, $425 = 0.0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0.0;
+ var $442 = 0.0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0.0, $454 = 0.0, $455 = 0.0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0;
+ var $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0.0, $466 = 0.0, $467 = 0.0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0;
+ var $479 = 0.0, $48 = 0, $480 = 0, $481 = 0.0, $482 = 0.0, $483 = 0, $484 = 0.0, $485 = 0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0.0, $492 = 0.0, $493 = 0, $494 = 0, $495 = 0, $496 = 0;
+ var $497 = 0, $498 = 0.0, $499 = 0.0, $5 = 0, $50 = 0.0, $500 = 0.0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0.0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0.0, $510 = 0, $511 = 0, $512 = 0, $513 = 0;
+ var $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0.0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0;
+ var $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0;
+ var $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0;
+ var $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0;
+ var $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0;
+ var $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0.0, $62 = 0, $620 = 0, $621 = 0;
+ var $622 = 0, $623 = 0, $624 = 0.0, $625 = 0.0, $626 = 0.0, $627 = 0, $628 = 0.0, $629 = 0.0, $63 = 0, $630 = 0.0, $631 = 0.0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0;
+ var $640 = 0, $641 = 0, $642 = 0.0, $643 = 0.0, $644 = 0.0, $645 = 0, $646 = 0.0, $647 = 0.0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0.0, $652 = 0.0, $653 = 0.0, $654 = 0.0, $655 = 0, $656 = 0, $657 = 0.0, $658 = 0;
+ var $659 = 0.0, $66 = 0, $660 = 0.0, $661 = 0.0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0.0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0.0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0;
+ var $677 = 0, $678 = 0.0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0.0, $684 = 0, $685 = 0, $686 = 0.0, $687 = 0.0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0;
+ var $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0;
+ var $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
+ var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
+ var $98 = 0, $99 = 0, $a$0$lcssa151$i = 0, $a$085$i = 0, $a$1$i = 0, $a$1$i$lcssa = 0, $a$2$ph38$i = 0, $a$3$i = 0, $a$3$i$lcssa248 = 0, $a$3$i249 = 0, $a$3$ph$i = 0, $a$3$ph157$i = 0, $a$478$i = 0, $a$5$i = 0, $a$5$i$lcssa = 0, $a$5$i$lcssa$lcssa = 0, $bias$0$i = 0.0, $bias$0$i25 = 0.0, $bits$0$ph = 0, $brmerge$i28 = 0;
+ var $c$0 = 0, $c$0$i = 0, $c$1$lcssa = 0, $c$1$ph$i = 0, $c$179 = 0, $c$2 = 0, $c$2$i = 0, $c$2$lcssa$i = 0, $c$377 = 0, $c$4 = 0, $c$5 = 0, $c$6 = 0, $carry$087$i = 0, $carry1$0$i = 0, $carry1$1$i = 0, $carry1$1$i$lcssa = 0, $carry1$1$i$lcssa$lcssa = 0, $carry3$081$i = 0, $cond$i = 0, $d$0$i = 0;
+ var $denormal$0$i = 0, $denormal$1$i = 0, $denormal$2$i = 0, $e2$0$i19 = 0, $e2$0$ph$i = 0, $e2$1$i = 0, $e2$1$i246 = 0, $e2$1$ph$i = 0, $e2$1$ph156$i = 0, $e2$2$i = 0, $e2$3$i = 0, $emin$0$ph = 0, $exitcond$i = 0, $frac$0$i = 0.0, $frac$1$i = 0.0, $frac$2$i = 0.0, $gotdig$0$i = 0, $gotdig$0$i$lcssa242 = 0, $gotdig$0$i12 = 0, $gotdig$0$i12$lcssa273 = 0;
+ var $gotdig$2$i = 0, $gotdig$2$i$lcssa = 0, $gotdig$2$i13 = 0, $gotdig$3$i = 0, $gotdig$3$lcssa$i = 0, $gotdig$3101$i = 0, $gotdig$3101$i$lcssa = 0, $gotdig$4$i = 0, $gotrad$0$i = 0, $gotrad$0$i$lcssa = 0, $gotrad$0$i14 = 0, $gotrad$1$i = 0, $gotrad$1$lcssa$i = 0, $gotrad$1102$i = 0, $gotrad$2$i = 0, $gottail$0$i = 0, $gottail$1$i = 0, $gottail$2$i = 0, $i$0$lcssa = 0, $i$078 = 0;
+ var $i$1 = 0, $i$276 = 0, $i$3 = 0, $i$4 = 0, $i$4$lcssa = 0, $j$0$lcssa$i = 0, $j$0104$i = 0, $j$0104$i$lcssa = 0, $j$067$i = 0, $j$068$i = 0, $j$069$i = 0, $j$2$i = 0, $j$394$i = 0, $k$0$lcssa$i = 0, $k$0103$i = 0, $k$0103$i$lcssa = 0, $k$063$i = 0, $k$064$i = 0, $k$065$i = 0, $k$2$i = 0;
+ var $k$3$i = 0, $k$486$i = 0, $k$5$i = 0, $k$5$in$i = 0, $k$5$z$2$i = 0, $k$679$i = 0, $lnz$0$lcssa$i = 0, $lnz$0100$i = 0, $lnz$0100$i$lcssa = 0, $lnz$057$i = 0, $lnz$058$i = 0, $lnz$059$i = 0, $lnz$2$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond$i16 = 0, $or$cond13$i = 0, $or$cond15$i = 0, $or$cond16$i = 0, $or$cond17$i = 0;
+ var $or$cond182$i = 0, $or$cond19$i = 0, $or$cond20$i = 0, $or$cond3$i = 0, $or$cond4$i = 0, $or$cond5 = 0, $or$cond6$i = 0, $or$cond7 = 0, $or$cond8$i = 0, $or$cond9 = 0, $or$cond9$i = 0, $rp$0$lcssa152$i = 0, $rp$084$i = 0, $rp$1$i18 = 0, $rp$1$i18$lcssa = 0, $rp$2$ph36$i = 0, $rp$3$ph$i = 0, $rp$3$ph34$i = 0, $rp$477$i = 0, $rp$5$i = 0;
+ var $rp$5$i$lcssa = 0, $rp$5$i$lcssa$lcssa = 0, $scale$0$i = 0.0, $scale$1$i = 0.0, $scale$2$i = 0.0, $sign$0 = 0, $storemerge$i = 0, $sum$i = 0, $x$0$i = 0, $x$0$i$lcssa = 0, $x$1$i = 0, $x$2$i = 0, $x$3$lcssa$i = 0, $x$324$i = 0, $x$4$lcssa$i = 0, $x$419$i = 0, $x$5$i = 0, $x$6$i = 0, $x$i = 0, $y$0$i = 0.0;
+ var $y$0$i$lcssa = 0.0, $y$1$i = 0.0, $y$1$i24 = 0.0, $y$2$i = 0.0, $y$2$i26 = 0.0, $y$3$i = 0.0, $y$3$lcssa$i = 0.0, $y$320$i = 0.0, $y$4$i = 0.0, $y$5$i = 0.0, $z$0$i = 0, $z$1$i = 0, $z$1$ph37$i = 0, $z$2$i = 0, $z$3$i = 0, $z$3$i$lcssa = 0, $z$3$i$lcssa$lcssa = 0, $z$4$i = 0, $z$5$ph$i = 0, $z$7$1$i = 0;
+ var $z$7$i = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 512|0;
+ $x$i = sp;
+ switch ($prec|0) {
+ case 0: {
+ $bits$0$ph = 24;$emin$0$ph = -149;
+ label = 4;
+ break;
+ }
+ case 1: {
+ $bits$0$ph = 53;$emin$0$ph = -1074;
+ label = 4;
+ break;
+ }
+ case 2: {
+ $bits$0$ph = 53;$emin$0$ph = -1074;
+ label = 4;
+ break;
+ }
+ default: {
+ $$0 = 0.0;
+ }
+ }
+ L4: do {
+ if ((label|0) == 4) {
+ $0 = ((($f)) + 4|0);
+ $1 = ((($f)) + 100|0);
+ while(1) {
+ $2 = HEAP32[$0>>2]|0;
+ $3 = HEAP32[$1>>2]|0;
+ $4 = ($2>>>0)<($3>>>0);
+ if ($4) {
+ $5 = ((($2)) + 1|0);
+ HEAP32[$0>>2] = $5;
+ $6 = HEAP8[$2>>0]|0;
+ $7 = $6&255;
+ $9 = $7;
+ } else {
+ $8 = (___shgetc($f)|0);
+ $9 = $8;
+ }
+ $10 = (_isspace($9)|0);
+ $11 = ($10|0)==(0);
+ if ($11) {
+ $$lcssa275 = $9;
+ break;
+ }
+ }
+ $12 = ($$lcssa275|0)==(45);
+ L13: do {
+ switch ($$lcssa275|0) {
+ case 43: case 45: {
+ $13 = $12&1;
+ $14 = $13 << 1;
+ $15 = (1 - ($14))|0;
+ $16 = HEAP32[$0>>2]|0;
+ $17 = HEAP32[$1>>2]|0;
+ $18 = ($16>>>0)<($17>>>0);
+ if ($18) {
+ $19 = ((($16)) + 1|0);
+ HEAP32[$0>>2] = $19;
+ $20 = HEAP8[$16>>0]|0;
+ $21 = $20&255;
+ $c$0 = $21;$sign$0 = $15;
+ break L13;
+ } else {
+ $22 = (___shgetc($f)|0);
+ $c$0 = $22;$sign$0 = $15;
+ break L13;
+ }
+ break;
+ }
+ default: {
+ $c$0 = $$lcssa275;$sign$0 = 1;
+ }
+ }
+ } while(0);
+ $c$179 = $c$0;$i$078 = 0;
+ while(1) {
+ $23 = $c$179 | 32;
+ $24 = (22463 + ($i$078)|0);
+ $25 = HEAP8[$24>>0]|0;
+ $26 = $25 << 24 >> 24;
+ $27 = ($23|0)==($26|0);
+ if (!($27)) {
+ $c$1$lcssa = $c$179;$i$0$lcssa = $i$078;
+ break;
+ }
+ $28 = ($i$078>>>0)<(7);
+ do {
+ if ($28) {
+ $29 = HEAP32[$0>>2]|0;
+ $30 = HEAP32[$1>>2]|0;
+ $31 = ($29>>>0)<($30>>>0);
+ if ($31) {
+ $32 = ((($29)) + 1|0);
+ HEAP32[$0>>2] = $32;
+ $33 = HEAP8[$29>>0]|0;
+ $34 = $33&255;
+ $c$2 = $34;
+ break;
+ } else {
+ $35 = (___shgetc($f)|0);
+ $c$2 = $35;
+ break;
+ }
+ } else {
+ $c$2 = $c$179;
+ }
+ } while(0);
+ $36 = (($i$078) + 1)|0;
+ $37 = ($36>>>0)<(8);
+ if ($37) {
+ $c$179 = $c$2;$i$078 = $36;
+ } else {
+ $c$1$lcssa = $c$2;$i$0$lcssa = $36;
+ break;
+ }
+ }
+ L29: do {
+ switch ($i$0$lcssa|0) {
+ case 8: {
+ break;
+ }
+ case 3: {
+ label = 23;
+ break;
+ }
+ default: {
+ $38 = ($i$0$lcssa>>>0)>(3);
+ $39 = ($pok|0)!=(0);
+ $or$cond5 = $39 & $38;
+ if ($or$cond5) {
+ $40 = ($i$0$lcssa|0)==(8);
+ if ($40) {
+ break L29;
+ } else {
+ label = 23;
+ break L29;
+ }
+ }
+ $53 = ($i$0$lcssa|0)==(0);
+ L34: do {
+ if ($53) {
+ $c$377 = $c$1$lcssa;$i$276 = 0;
+ while(1) {
+ $54 = $c$377 | 32;
+ $55 = (24298 + ($i$276)|0);
+ $56 = HEAP8[$55>>0]|0;
+ $57 = $56 << 24 >> 24;
+ $58 = ($54|0)==($57|0);
+ if (!($58)) {
+ $c$5 = $c$377;$i$3 = $i$276;
+ break L34;
+ }
+ $59 = ($i$276>>>0)<(2);
+ do {
+ if ($59) {
+ $60 = HEAP32[$0>>2]|0;
+ $61 = HEAP32[$1>>2]|0;
+ $62 = ($60>>>0)<($61>>>0);
+ if ($62) {
+ $63 = ((($60)) + 1|0);
+ HEAP32[$0>>2] = $63;
+ $64 = HEAP8[$60>>0]|0;
+ $65 = $64&255;
+ $c$4 = $65;
+ break;
+ } else {
+ $66 = (___shgetc($f)|0);
+ $c$4 = $66;
+ break;
+ }
+ } else {
+ $c$4 = $c$377;
+ }
+ } while(0);
+ $67 = (($i$276) + 1)|0;
+ $68 = ($67>>>0)<(3);
+ if ($68) {
+ $c$377 = $c$4;$i$276 = $67;
+ } else {
+ $c$5 = $c$4;$i$3 = $67;
+ break;
+ }
+ }
+ } else {
+ $c$5 = $c$1$lcssa;$i$3 = $i$0$lcssa;
+ }
+ } while(0);
+ switch ($i$3|0) {
+ case 3: {
+ $69 = HEAP32[$0>>2]|0;
+ $70 = HEAP32[$1>>2]|0;
+ $71 = ($69>>>0)<($70>>>0);
+ if ($71) {
+ $72 = ((($69)) + 1|0);
+ HEAP32[$0>>2] = $72;
+ $73 = HEAP8[$69>>0]|0;
+ $74 = $73&255;
+ $76 = $74;
+ } else {
+ $75 = (___shgetc($f)|0);
+ $76 = $75;
+ }
+ $77 = ($76|0)==(40);
+ if ($77) {
+ $i$4 = 1;
+ } else {
+ $78 = HEAP32[$1>>2]|0;
+ $79 = ($78|0)==(0|0);
+ if ($79) {
+ $$0 = nan;
+ break L4;
+ }
+ $80 = HEAP32[$0>>2]|0;
+ $81 = ((($80)) + -1|0);
+ HEAP32[$0>>2] = $81;
+ $$0 = nan;
+ break L4;
+ }
+ while(1) {
+ $82 = HEAP32[$0>>2]|0;
+ $83 = HEAP32[$1>>2]|0;
+ $84 = ($82>>>0)<($83>>>0);
+ if ($84) {
+ $85 = ((($82)) + 1|0);
+ HEAP32[$0>>2] = $85;
+ $86 = HEAP8[$82>>0]|0;
+ $87 = $86&255;
+ $90 = $87;
+ } else {
+ $88 = (___shgetc($f)|0);
+ $90 = $88;
+ }
+ $89 = (($90) + -48)|0;
+ $91 = ($89>>>0)<(10);
+ $92 = (($90) + -65)|0;
+ $93 = ($92>>>0)<(26);
+ $or$cond = $91 | $93;
+ if (!($or$cond)) {
+ $94 = (($90) + -97)|0;
+ $95 = ($94>>>0)<(26);
+ $96 = ($90|0)==(95);
+ $or$cond7 = $96 | $95;
+ if (!($or$cond7)) {
+ $$lcssa = $90;$i$4$lcssa = $i$4;
+ break;
+ }
+ }
+ $108 = (($i$4) + 1)|0;
+ $i$4 = $108;
+ }
+ $97 = ($$lcssa|0)==(41);
+ if ($97) {
+ $$0 = nan;
+ break L4;
+ }
+ $98 = HEAP32[$1>>2]|0;
+ $99 = ($98|0)==(0|0);
+ if (!($99)) {
+ $100 = HEAP32[$0>>2]|0;
+ $101 = ((($100)) + -1|0);
+ HEAP32[$0>>2] = $101;
+ }
+ if (!($39)) {
+ $103 = (___errno_location()|0);
+ HEAP32[$103>>2] = 22;
+ ___shlim($f,0);
+ $$0 = 0.0;
+ break L4;
+ }
+ $102 = ($i$4$lcssa|0)==(0);
+ if ($102) {
+ $$0 = nan;
+ break L4;
+ } else {
+ $$in = $i$4$lcssa;
+ }
+ while(1) {
+ $104 = (($$in) + -1)|0;
+ if (!($99)) {
+ $105 = HEAP32[$0>>2]|0;
+ $106 = ((($105)) + -1|0);
+ HEAP32[$0>>2] = $106;
+ }
+ $107 = ($104|0)==(0);
+ if ($107) {
+ $$0 = nan;
+ break L4;
+ } else {
+ $$in = $104;
+ }
+ }
+ break;
+ }
+ case 0: {
+ $114 = ($c$5|0)==(48);
+ do {
+ if ($114) {
+ $115 = HEAP32[$0>>2]|0;
+ $116 = HEAP32[$1>>2]|0;
+ $117 = ($115>>>0)<($116>>>0);
+ if ($117) {
+ $118 = ((($115)) + 1|0);
+ HEAP32[$0>>2] = $118;
+ $119 = HEAP8[$115>>0]|0;
+ $120 = $119&255;
+ $123 = $120;
+ } else {
+ $121 = (___shgetc($f)|0);
+ $123 = $121;
+ }
+ $122 = $123 | 32;
+ $124 = ($122|0)==(120);
+ if (!($124)) {
+ $326 = HEAP32[$1>>2]|0;
+ $327 = ($326|0)==(0|0);
+ if ($327) {
+ $c$6 = 48;
+ break;
+ }
+ $328 = HEAP32[$0>>2]|0;
+ $329 = ((($328)) + -1|0);
+ HEAP32[$0>>2] = $329;
+ $c$6 = 48;
+ break;
+ }
+ $125 = HEAP32[$0>>2]|0;
+ $126 = HEAP32[$1>>2]|0;
+ $127 = ($125>>>0)<($126>>>0);
+ if ($127) {
+ $128 = ((($125)) + 1|0);
+ HEAP32[$0>>2] = $128;
+ $129 = HEAP8[$125>>0]|0;
+ $130 = $129&255;
+ $c$0$i = $130;$gotdig$0$i = 0;
+ } else {
+ $131 = (___shgetc($f)|0);
+ $c$0$i = $131;$gotdig$0$i = 0;
+ }
+ L94: while(1) {
+ switch ($c$0$i|0) {
+ case 46: {
+ $gotdig$0$i$lcssa242 = $gotdig$0$i;
+ label = 74;
+ break L94;
+ break;
+ }
+ case 48: {
+ break;
+ }
+ default: {
+ $168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$0$i;$gotdig$2$i = $gotdig$0$i;$gotrad$0$i = 0;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0;
+ break L94;
+ }
+ }
+ $132 = HEAP32[$0>>2]|0;
+ $133 = HEAP32[$1>>2]|0;
+ $134 = ($132>>>0)<($133>>>0);
+ if ($134) {
+ $135 = ((($132)) + 1|0);
+ HEAP32[$0>>2] = $135;
+ $136 = HEAP8[$132>>0]|0;
+ $137 = $136&255;
+ $c$0$i = $137;$gotdig$0$i = 1;
+ continue;
+ } else {
+ $138 = (___shgetc($f)|0);
+ $c$0$i = $138;$gotdig$0$i = 1;
+ continue;
+ }
+ }
+ if ((label|0) == 74) {
+ $139 = HEAP32[$0>>2]|0;
+ $140 = HEAP32[$1>>2]|0;
+ $141 = ($139>>>0)<($140>>>0);
+ if ($141) {
+ $142 = ((($139)) + 1|0);
+ HEAP32[$0>>2] = $142;
+ $143 = HEAP8[$139>>0]|0;
+ $144 = $143&255;
+ $c$1$ph$i = $144;
+ } else {
+ $145 = (___shgetc($f)|0);
+ $c$1$ph$i = $145;
+ }
+ $146 = ($c$1$ph$i|0)==(48);
+ if ($146) {
+ $154 = 0;$155 = 0;
+ while(1) {
+ $147 = HEAP32[$0>>2]|0;
+ $148 = HEAP32[$1>>2]|0;
+ $149 = ($147>>>0)<($148>>>0);
+ if ($149) {
+ $150 = ((($147)) + 1|0);
+ HEAP32[$0>>2] = $150;
+ $151 = HEAP8[$147>>0]|0;
+ $152 = $151&255;
+ $158 = $152;
+ } else {
+ $153 = (___shgetc($f)|0);
+ $158 = $153;
+ }
+ $156 = (_i64Add(($154|0),($155|0),-1,-1)|0);
+ $157 = tempRet0;
+ $159 = ($158|0)==(48);
+ if ($159) {
+ $154 = $156;$155 = $157;
+ } else {
+ $168 = 0;$170 = 0;$694 = $156;$695 = $157;$c$2$i = $158;$gotdig$2$i = 1;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0;
+ break;
+ }
+ }
+ } else {
+ $168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$1$ph$i;$gotdig$2$i = $gotdig$0$i$lcssa242;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0;
+ }
+ }
+ while(1) {
+ $160 = (($c$2$i) + -48)|0;
+ $161 = ($160>>>0)<(10);
+ $$pre$i = $c$2$i | 32;
+ if ($161) {
+ label = 86;
+ } else {
+ $162 = (($$pre$i) + -97)|0;
+ $163 = ($162>>>0)<(6);
+ $164 = ($c$2$i|0)==(46);
+ $or$cond6$i = $164 | $163;
+ if (!($or$cond6$i)) {
+ $212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = $c$2$i;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i;
+ break;
+ }
+ if ($164) {
+ $165 = ($gotrad$0$i|0)==(0);
+ if ($165) {
+ $696 = $170;$697 = $168;$698 = $170;$699 = $168;$gotdig$3$i = $gotdig$2$i;$gotrad$1$i = 1;$gottail$2$i = $gottail$0$i;$scale$2$i = $scale$0$i;$x$2$i = $x$0$i;$y$2$i = $y$0$i;
+ } else {
+ $212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = 46;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i;
+ break;
+ }
+ } else {
+ label = 86;
+ }
+ }
+ if ((label|0) == 86) {
+ label = 0;
+ $166 = ($c$2$i|0)>(57);
+ $167 = (($$pre$i) + -87)|0;
+ $d$0$i = $166 ? $167 : $160;
+ $169 = ($168|0)<(0);
+ $171 = ($170>>>0)<(8);
+ $172 = ($168|0)==(0);
+ $173 = $172 & $171;
+ $174 = $169 | $173;
+ do {
+ if ($174) {
+ $175 = $x$0$i << 4;
+ $176 = (($d$0$i) + ($175))|0;
+ $gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $176;$y$1$i = $y$0$i;
+ } else {
+ $177 = ($168|0)<(0);
+ $178 = ($170>>>0)<(14);
+ $179 = ($168|0)==(0);
+ $180 = $179 & $178;
+ $181 = $177 | $180;
+ if ($181) {
+ $182 = (+($d$0$i|0));
+ $183 = $scale$0$i * 0.0625;
+ $184 = $183 * $182;
+ $185 = $y$0$i + $184;
+ $gottail$1$i = $gottail$0$i;$scale$1$i = $183;$x$1$i = $x$0$i;$y$1$i = $185;
+ break;
+ }
+ $186 = ($d$0$i|0)==(0);
+ $187 = ($gottail$0$i|0)!=(0);
+ $or$cond$i = $187 | $186;
+ if ($or$cond$i) {
+ $gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $y$0$i;
+ } else {
+ $188 = $scale$0$i * 0.5;
+ $189 = $y$0$i + $188;
+ $gottail$1$i = 1;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $189;
+ }
+ }
+ } while(0);
+ $190 = (_i64Add(($170|0),($168|0),1,0)|0);
+ $191 = tempRet0;
+ $696 = $694;$697 = $695;$698 = $190;$699 = $191;$gotdig$3$i = 1;$gotrad$1$i = $gotrad$0$i;$gottail$2$i = $gottail$1$i;$scale$2$i = $scale$1$i;$x$2$i = $x$1$i;$y$2$i = $y$1$i;
+ }
+ $192 = HEAP32[$0>>2]|0;
+ $193 = HEAP32[$1>>2]|0;
+ $194 = ($192>>>0)<($193>>>0);
+ if ($194) {
+ $195 = ((($192)) + 1|0);
+ HEAP32[$0>>2] = $195;
+ $196 = HEAP8[$192>>0]|0;
+ $197 = $196&255;
+ $168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $197;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i;
+ continue;
+ } else {
+ $198 = (___shgetc($f)|0);
+ $168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $198;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i;
+ continue;
+ }
+ }
+ $199 = ($gotdig$2$i$lcssa|0)==(0);
+ if ($199) {
+ $200 = HEAP32[$1>>2]|0;
+ $201 = ($200|0)==(0|0);
+ if (!($201)) {
+ $202 = HEAP32[$0>>2]|0;
+ $203 = ((($202)) + -1|0);
+ HEAP32[$0>>2] = $203;
+ }
+ $204 = ($pok|0)==(0);
+ if ($204) {
+ ___shlim($f,0);
+ } else {
+ if (!($201)) {
+ $205 = HEAP32[$0>>2]|0;
+ $206 = ((($205)) + -1|0);
+ HEAP32[$0>>2] = $206;
+ $207 = ($gotrad$0$i$lcssa|0)==(0);
+ if (!($207)) {
+ $208 = ((($205)) + -2|0);
+ HEAP32[$0>>2] = $208;
+ }
+ }
+ }
+ $209 = (+($sign$0|0));
+ $210 = $209 * 0.0;
+ $$0 = $210;
+ break L4;
+ }
+ $211 = ($gotrad$0$i$lcssa|0)==(0);
+ $214 = $211 ? $213 : $212;
+ $217 = $211 ? $216 : $215;
+ $218 = ($216|0)<(0);
+ $219 = ($213>>>0)<(8);
+ $220 = ($216|0)==(0);
+ $221 = $220 & $219;
+ $222 = $218 | $221;
+ if ($222) {
+ $224 = $213;$225 = $216;$x$324$i = $x$0$i$lcssa;
+ while(1) {
+ $223 = $x$324$i << 4;
+ $226 = (_i64Add(($224|0),($225|0),1,0)|0);
+ $227 = tempRet0;
+ $228 = ($227|0)<(0);
+ $229 = ($226>>>0)<(8);
+ $230 = ($227|0)==(0);
+ $231 = $230 & $229;
+ $232 = $228 | $231;
+ if ($232) {
+ $224 = $226;$225 = $227;$x$324$i = $223;
+ } else {
+ $x$3$lcssa$i = $223;
+ break;
+ }
+ }
+ } else {
+ $x$3$lcssa$i = $x$0$i$lcssa;
+ }
+ $233 = $c$2$lcssa$i | 32;
+ $234 = ($233|0)==(112);
+ if ($234) {
+ $235 = (_scanexp($f,$pok)|0);
+ $236 = tempRet0;
+ $237 = ($235|0)==(0);
+ $238 = ($236|0)==(-2147483648);
+ $239 = $237 & $238;
+ if ($239) {
+ $240 = ($pok|0)==(0);
+ if ($240) {
+ ___shlim($f,0);
+ $$0 = 0.0;
+ break L4;
+ }
+ $241 = HEAP32[$1>>2]|0;
+ $242 = ($241|0)==(0|0);
+ if ($242) {
+ $253 = 0;$254 = 0;
+ } else {
+ $243 = HEAP32[$0>>2]|0;
+ $244 = ((($243)) + -1|0);
+ HEAP32[$0>>2] = $244;
+ $253 = 0;$254 = 0;
+ }
+ } else {
+ $253 = $235;$254 = $236;
+ }
+ } else {
+ $245 = HEAP32[$1>>2]|0;
+ $246 = ($245|0)==(0|0);
+ if ($246) {
+ $253 = 0;$254 = 0;
+ } else {
+ $247 = HEAP32[$0>>2]|0;
+ $248 = ((($247)) + -1|0);
+ HEAP32[$0>>2] = $248;
+ $253 = 0;$254 = 0;
+ }
+ }
+ $249 = (_bitshift64Shl(($214|0),($217|0),2)|0);
+ $250 = tempRet0;
+ $251 = (_i64Add(($249|0),($250|0),-32,-1)|0);
+ $252 = tempRet0;
+ $255 = (_i64Add(($251|0),($252|0),($253|0),($254|0))|0);
+ $256 = tempRet0;
+ $257 = ($x$3$lcssa$i|0)==(0);
+ if ($257) {
+ $258 = (+($sign$0|0));
+ $259 = $258 * 0.0;
+ $$0 = $259;
+ break L4;
+ }
+ $260 = (0 - ($emin$0$ph))|0;
+ $261 = ($256|0)>(0);
+ $262 = ($255>>>0)>($260>>>0);
+ $263 = ($256|0)==(0);
+ $264 = $263 & $262;
+ $265 = $261 | $264;
+ if ($265) {
+ $266 = (___errno_location()|0);
+ HEAP32[$266>>2] = 34;
+ $267 = (+($sign$0|0));
+ $268 = $267 * 1.7976931348623157E+308;
+ $269 = $268 * 1.7976931348623157E+308;
+ $$0 = $269;
+ break L4;
+ }
+ $270 = (($emin$0$ph) + -106)|0;
+ $271 = ($270|0)<(0);
+ $272 = $271 << 31 >> 31;
+ $273 = ($256|0)<($272|0);
+ $274 = ($255>>>0)<($270>>>0);
+ $275 = ($256|0)==($272|0);
+ $276 = $275 & $274;
+ $277 = $273 | $276;
+ if ($277) {
+ $279 = (___errno_location()|0);
+ HEAP32[$279>>2] = 34;
+ $280 = (+($sign$0|0));
+ $281 = $280 * 2.2250738585072014E-308;
+ $282 = $281 * 2.2250738585072014E-308;
+ $$0 = $282;
+ break L4;
+ }
+ $278 = ($x$3$lcssa$i|0)>(-1);
+ if ($278) {
+ $288 = $255;$289 = $256;$x$419$i = $x$3$lcssa$i;$y$320$i = $y$0$i$lcssa;
+ while(1) {
+ $283 = !($y$320$i >= 0.5);
+ $284 = $x$419$i << 1;
+ $285 = $y$320$i + -1.0;
+ $286 = $283&1;
+ $287 = $286 | $284;
+ $x$5$i = $287 ^ 1;
+ $$pn$i = $283 ? $y$320$i : $285;
+ $y$4$i = $y$320$i + $$pn$i;
+ $290 = (_i64Add(($288|0),($289|0),-1,-1)|0);
+ $291 = tempRet0;
+ $292 = ($287|0)>(-1);
+ if ($292) {
+ $288 = $290;$289 = $291;$x$419$i = $x$5$i;$y$320$i = $y$4$i;
+ } else {
+ $297 = $290;$298 = $291;$x$4$lcssa$i = $x$5$i;$y$3$lcssa$i = $y$4$i;
+ break;
+ }
+ }
+ } else {
+ $297 = $255;$298 = $256;$x$4$lcssa$i = $x$3$lcssa$i;$y$3$lcssa$i = $y$0$i$lcssa;
+ }
+ $293 = ($emin$0$ph|0)<(0);
+ $294 = $293 << 31 >> 31;
+ $295 = (_i64Subtract(32,0,($emin$0$ph|0),($294|0))|0);
+ $296 = tempRet0;
+ $299 = (_i64Add(($297|0),($298|0),($295|0),($296|0))|0);
+ $300 = tempRet0;
+ $301 = (0)>($300|0);
+ $302 = ($bits$0$ph>>>0)>($299>>>0);
+ $303 = (0)==($300|0);
+ $304 = $303 & $302;
+ $305 = $301 | $304;
+ if ($305) {
+ $306 = ($299|0)<(0);
+ if ($306) {
+ $$0710$i = 0;
+ label = 127;
+ } else {
+ $$07$i = $299;
+ label = 125;
+ }
+ } else {
+ $$07$i = $bits$0$ph;
+ label = 125;
+ }
+ if ((label|0) == 125) {
+ $307 = ($$07$i|0)<(53);
+ if ($307) {
+ $$0710$i = $$07$i;
+ label = 127;
+ } else {
+ $$pre41$i = (+($sign$0|0));
+ $$0711$i = $$07$i;$$pre$phi42$iZ2D = $$pre41$i;$bias$0$i = 0.0;
+ }
+ }
+ if ((label|0) == 127) {
+ $308 = (84 - ($$0710$i))|0;
+ $309 = (+_scalbn(1.0,$308));
+ $310 = (+($sign$0|0));
+ $311 = (+_copysignl($309,$310));
+ $$0711$i = $$0710$i;$$pre$phi42$iZ2D = $310;$bias$0$i = $311;
+ }
+ $312 = ($$0711$i|0)<(32);
+ $313 = $y$3$lcssa$i != 0.0;
+ $or$cond4$i = $313 & $312;
+ $314 = $x$4$lcssa$i & 1;
+ $315 = ($314|0)==(0);
+ $or$cond9$i = $315 & $or$cond4$i;
+ $316 = $or$cond9$i&1;
+ $x$6$i = (($316) + ($x$4$lcssa$i))|0;
+ $y$5$i = $or$cond9$i ? 0.0 : $y$3$lcssa$i;
+ $317 = (+($x$6$i>>>0));
+ $318 = $$pre$phi42$iZ2D * $317;
+ $319 = $bias$0$i + $318;
+ $320 = $$pre$phi42$iZ2D * $y$5$i;
+ $321 = $320 + $319;
+ $322 = $321 - $bias$0$i;
+ $323 = $322 != 0.0;
+ if (!($323)) {
+ $324 = (___errno_location()|0);
+ HEAP32[$324>>2] = 34;
+ }
+ $325 = (+_scalbnl($322,$297));
+ $$0 = $325;
+ break L4;
+ } else {
+ $c$6 = $c$5;
+ }
+ } while(0);
+ $sum$i = (($emin$0$ph) + ($bits$0$ph))|0;
+ $330 = (0 - ($sum$i))|0;
+ $$09$i = $c$6;$gotdig$0$i12 = 0;
+ L184: while(1) {
+ switch ($$09$i|0) {
+ case 46: {
+ $gotdig$0$i12$lcssa273 = $gotdig$0$i12;
+ label = 138;
+ break L184;
+ break;
+ }
+ case 48: {
+ break;
+ }
+ default: {
+ $$2$i = $$09$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12;$gotrad$0$i14 = 0;
+ break L184;
+ }
+ }
+ $331 = HEAP32[$0>>2]|0;
+ $332 = HEAP32[$1>>2]|0;
+ $333 = ($331>>>0)<($332>>>0);
+ if ($333) {
+ $334 = ((($331)) + 1|0);
+ HEAP32[$0>>2] = $334;
+ $335 = HEAP8[$331>>0]|0;
+ $336 = $335&255;
+ $$09$i = $336;$gotdig$0$i12 = 1;
+ continue;
+ } else {
+ $337 = (___shgetc($f)|0);
+ $$09$i = $337;$gotdig$0$i12 = 1;
+ continue;
+ }
+ }
+ if ((label|0) == 138) {
+ $338 = HEAP32[$0>>2]|0;
+ $339 = HEAP32[$1>>2]|0;
+ $340 = ($338>>>0)<($339>>>0);
+ if ($340) {
+ $341 = ((($338)) + 1|0);
+ HEAP32[$0>>2] = $341;
+ $342 = HEAP8[$338>>0]|0;
+ $343 = $342&255;
+ $$1$ph$i = $343;
+ } else {
+ $344 = (___shgetc($f)|0);
+ $$1$ph$i = $344;
+ }
+ $345 = ($$1$ph$i|0)==(48);
+ if ($345) {
+ $346 = 0;$347 = 0;
+ while(1) {
+ $348 = (_i64Add(($346|0),($347|0),-1,-1)|0);
+ $349 = tempRet0;
+ $350 = HEAP32[$0>>2]|0;
+ $351 = HEAP32[$1>>2]|0;
+ $352 = ($350>>>0)<($351>>>0);
+ if ($352) {
+ $353 = ((($350)) + 1|0);
+ HEAP32[$0>>2] = $353;
+ $354 = HEAP8[$350>>0]|0;
+ $355 = $354&255;
+ $$1$be$i = $355;
+ } else {
+ $356 = (___shgetc($f)|0);
+ $$1$be$i = $356;
+ }
+ $357 = ($$1$be$i|0)==(48);
+ if ($357) {
+ $346 = $348;$347 = $349;
+ } else {
+ $$2$i = $$1$be$i;$700 = $348;$701 = $349;$gotdig$2$i13 = 1;$gotrad$0$i14 = 1;
+ break;
+ }
+ }
+ } else {
+ $$2$i = $$1$ph$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12$lcssa273;$gotrad$0$i14 = 1;
+ }
+ }
+ HEAP32[$x$i>>2] = 0;
+ $358 = (($$2$i) + -48)|0;
+ $359 = ($358>>>0)<(10);
+ $360 = ($$2$i|0)==(46);
+ $361 = $360 | $359;
+ L203: do {
+ if ($361) {
+ $362 = ((($x$i)) + 496|0);
+ $$3105$i = $$2$i;$365 = 0;$366 = 0;$702 = $360;$703 = $358;$704 = $700;$705 = $701;$gotdig$3101$i = $gotdig$2$i13;$gotrad$1102$i = $gotrad$0$i14;$j$0104$i = 0;$k$0103$i = 0;$lnz$0100$i = 0;
+ L205: while(1) {
+ do {
+ if ($702) {
+ $cond$i = ($gotrad$1102$i|0)==(0);
+ if ($cond$i) {
+ $706 = $365;$707 = $366;$708 = $365;$709 = $366;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = 1;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i;
+ } else {
+ $710 = $704;$711 = $705;$712 = $365;$713 = $366;$gotdig$3101$i$lcssa = $gotdig$3101$i;$j$0104$i$lcssa = $j$0104$i;$k$0103$i$lcssa = $k$0103$i;$lnz$0100$i$lcssa = $lnz$0100$i;
+ break L205;
+ }
+ } else {
+ $364 = ($k$0103$i|0)<(125);
+ $367 = (_i64Add(($365|0),($366|0),1,0)|0);
+ $368 = tempRet0;
+ $369 = ($$3105$i|0)!=(48);
+ if (!($364)) {
+ if (!($369)) {
+ $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i;
+ break;
+ }
+ $379 = HEAP32[$362>>2]|0;
+ $380 = $379 | 1;
+ HEAP32[$362>>2] = $380;
+ $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i;
+ break;
+ }
+ $$lnz$0$i = $369 ? $367 : $lnz$0100$i;
+ $370 = ($j$0104$i|0)==(0);
+ $371 = (($x$i) + ($k$0103$i<<2)|0);
+ if ($370) {
+ $storemerge$i = $703;
+ } else {
+ $372 = HEAP32[$371>>2]|0;
+ $373 = ($372*10)|0;
+ $374 = (($$3105$i) + -48)|0;
+ $375 = (($374) + ($373))|0;
+ $storemerge$i = $375;
+ }
+ HEAP32[$371>>2] = $storemerge$i;
+ $376 = (($j$0104$i) + 1)|0;
+ $377 = ($376|0)==(9);
+ $378 = $377&1;
+ $$k$0$i = (($378) + ($k$0103$i))|0;
+ $$11$i = $377 ? 0 : $376;
+ $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = 1;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $$11$i;$k$2$i = $$k$0$i;$lnz$2$i = $$lnz$0$i;
+ }
+ } while(0);
+ $381 = HEAP32[$0>>2]|0;
+ $382 = HEAP32[$1>>2]|0;
+ $383 = ($381>>>0)<($382>>>0);
+ if ($383) {
+ $384 = ((($381)) + 1|0);
+ HEAP32[$0>>2] = $384;
+ $385 = HEAP8[$381>>0]|0;
+ $386 = $385&255;
+ $$3$be$i = $386;
+ } else {
+ $387 = (___shgetc($f)|0);
+ $$3$be$i = $387;
+ }
+ $388 = (($$3$be$i) + -48)|0;
+ $389 = ($388>>>0)<(10);
+ $390 = ($$3$be$i|0)==(46);
+ $391 = $390 | $389;
+ if ($391) {
+ $$3105$i = $$3$be$i;$365 = $708;$366 = $709;$702 = $390;$703 = $388;$704 = $706;$705 = $707;$gotdig$3101$i = $gotdig$4$i;$gotrad$1102$i = $gotrad$2$i;$j$0104$i = $j$2$i;$k$0103$i = $k$2$i;$lnz$0100$i = $lnz$2$i;
+ } else {
+ $$3$lcssa$i = $$3$be$i;$393 = $706;$394 = $708;$396 = $707;$397 = $709;$gotdig$3$lcssa$i = $gotdig$4$i;$gotrad$1$lcssa$i = $gotrad$2$i;$j$0$lcssa$i = $j$2$i;$k$0$lcssa$i = $k$2$i;$lnz$0$lcssa$i = $lnz$2$i;
+ label = 161;
+ break L203;
+ }
+ }
+ $363 = ($gotdig$3101$i$lcssa|0)!=(0);
+ $714 = $712;$715 = $713;$716 = $710;$717 = $711;$718 = $363;$j$069$i = $j$0104$i$lcssa;$k$065$i = $k$0103$i$lcssa;$lnz$059$i = $lnz$0100$i$lcssa;
+ label = 169;
+ } else {
+ $$3$lcssa$i = $$2$i;$393 = $700;$394 = 0;$396 = $701;$397 = 0;$gotdig$3$lcssa$i = $gotdig$2$i13;$gotrad$1$lcssa$i = $gotrad$0$i14;$j$0$lcssa$i = 0;$k$0$lcssa$i = 0;$lnz$0$lcssa$i = 0;
+ label = 161;
+ }
+ } while(0);
+ do {
+ if ((label|0) == 161) {
+ $392 = ($gotrad$1$lcssa$i|0)==(0);
+ $395 = $392 ? $394 : $393;
+ $398 = $392 ? $397 : $396;
+ $399 = ($gotdig$3$lcssa$i|0)!=(0);
+ $400 = $$3$lcssa$i | 32;
+ $401 = ($400|0)==(101);
+ $or$cond13$i = $401 & $399;
+ if (!($or$cond13$i)) {
+ $416 = ($$3$lcssa$i|0)>(-1);
+ if ($416) {
+ $714 = $394;$715 = $397;$716 = $395;$717 = $398;$718 = $399;$j$069$i = $j$0$lcssa$i;$k$065$i = $k$0$lcssa$i;$lnz$059$i = $lnz$0$lcssa$i;
+ label = 169;
+ break;
+ } else {
+ $719 = $394;$720 = $397;$721 = $399;$722 = $395;$723 = $398;$j$068$i = $j$0$lcssa$i;$k$064$i = $k$0$lcssa$i;$lnz$058$i = $lnz$0$lcssa$i;
+ label = 171;
+ break;
+ }
+ }
+ $402 = (_scanexp($f,$pok)|0);
+ $403 = tempRet0;
+ $404 = ($402|0)==(0);
+ $405 = ($403|0)==(-2147483648);
+ $406 = $404 & $405;
+ if ($406) {
+ $407 = ($pok|0)==(0);
+ if ($407) {
+ ___shlim($f,0);
+ $$0$i27 = 0.0;
+ break;
+ }
+ $408 = HEAP32[$1>>2]|0;
+ $409 = ($408|0)==(0|0);
+ if ($409) {
+ $412 = 0;$413 = 0;
+ } else {
+ $410 = HEAP32[$0>>2]|0;
+ $411 = ((($410)) + -1|0);
+ HEAP32[$0>>2] = $411;
+ $412 = 0;$413 = 0;
+ }
+ } else {
+ $412 = $402;$413 = $403;
+ }
+ $414 = (_i64Add(($412|0),($413|0),($395|0),($398|0))|0);
+ $415 = tempRet0;
+ $426 = $414;$428 = $394;$429 = $415;$431 = $397;$j$067$i = $j$0$lcssa$i;$k$063$i = $k$0$lcssa$i;$lnz$057$i = $lnz$0$lcssa$i;
+ label = 173;
+ }
+ } while(0);
+ if ((label|0) == 169) {
+ $417 = HEAP32[$1>>2]|0;
+ $418 = ($417|0)==(0|0);
+ if ($418) {
+ $719 = $714;$720 = $715;$721 = $718;$722 = $716;$723 = $717;$j$068$i = $j$069$i;$k$064$i = $k$065$i;$lnz$058$i = $lnz$059$i;
+ label = 171;
+ } else {
+ $419 = HEAP32[$0>>2]|0;
+ $420 = ((($419)) + -1|0);
+ HEAP32[$0>>2] = $420;
+ if ($718) {
+ $426 = $716;$428 = $714;$429 = $717;$431 = $715;$j$067$i = $j$069$i;$k$063$i = $k$065$i;$lnz$057$i = $lnz$059$i;
+ label = 173;
+ } else {
+ label = 172;
+ }
+ }
+ }
+ if ((label|0) == 171) {
+ if ($721) {
+ $426 = $722;$428 = $719;$429 = $723;$431 = $720;$j$067$i = $j$068$i;$k$063$i = $k$064$i;$lnz$057$i = $lnz$058$i;
+ label = 173;
+ } else {
+ label = 172;
+ }
+ }
+ do {
+ if ((label|0) == 172) {
+ $421 = (___errno_location()|0);
+ HEAP32[$421>>2] = 22;
+ ___shlim($f,0);
+ $$0$i27 = 0.0;
+ }
+ else if ((label|0) == 173) {
+ $422 = HEAP32[$x$i>>2]|0;
+ $423 = ($422|0)==(0);
+ if ($423) {
+ $424 = (+($sign$0|0));
+ $425 = $424 * 0.0;
+ $$0$i27 = $425;
+ break;
+ }
+ $427 = ($426|0)==($428|0);
+ $430 = ($429|0)==($431|0);
+ $432 = $427 & $430;
+ $433 = ($431|0)<(0);
+ $434 = ($428>>>0)<(10);
+ $435 = ($431|0)==(0);
+ $436 = $435 & $434;
+ $437 = $433 | $436;
+ $or$cond$i16 = $437 & $432;
+ if ($or$cond$i16) {
+ $438 = ($bits$0$ph>>>0)>(30);
+ $439 = $422 >>> $bits$0$ph;
+ $440 = ($439|0)==(0);
+ $or$cond15$i = $438 | $440;
+ if ($or$cond15$i) {
+ $441 = (+($sign$0|0));
+ $442 = (+($422>>>0));
+ $443 = $441 * $442;
+ $$0$i27 = $443;
+ break;
+ }
+ }
+ $444 = (($emin$0$ph|0) / -2)&-1;
+ $445 = ($444|0)<(0);
+ $446 = $445 << 31 >> 31;
+ $447 = ($429|0)>($446|0);
+ $448 = ($426>>>0)>($444>>>0);
+ $449 = ($429|0)==($446|0);
+ $450 = $449 & $448;
+ $451 = $447 | $450;
+ if ($451) {
+ $452 = (___errno_location()|0);
+ HEAP32[$452>>2] = 34;
+ $453 = (+($sign$0|0));
+ $454 = $453 * 1.7976931348623157E+308;
+ $455 = $454 * 1.7976931348623157E+308;
+ $$0$i27 = $455;
+ break;
+ }
+ $456 = (($emin$0$ph) + -106)|0;
+ $457 = ($456|0)<(0);
+ $458 = $457 << 31 >> 31;
+ $459 = ($429|0)<($458|0);
+ $460 = ($426>>>0)<($456>>>0);
+ $461 = ($429|0)==($458|0);
+ $462 = $461 & $460;
+ $463 = $459 | $462;
+ if ($463) {
+ $464 = (___errno_location()|0);
+ HEAP32[$464>>2] = 34;
+ $465 = (+($sign$0|0));
+ $466 = $465 * 2.2250738585072014E-308;
+ $467 = $466 * 2.2250738585072014E-308;
+ $$0$i27 = $467;
+ break;
+ }
+ $468 = ($j$067$i|0)==(0);
+ if ($468) {
+ $k$3$i = $k$063$i;
+ } else {
+ $469 = ($j$067$i|0)<(9);
+ if ($469) {
+ $470 = (($x$i) + ($k$063$i<<2)|0);
+ $$promoted$i = HEAP32[$470>>2]|0;
+ $472 = $$promoted$i;$j$394$i = $j$067$i;
+ while(1) {
+ $471 = ($472*10)|0;
+ $473 = (($j$394$i) + 1)|0;
+ $exitcond$i = ($473|0)==(9);
+ if ($exitcond$i) {
+ $$lcssa265 = $471;
+ break;
+ } else {
+ $472 = $471;$j$394$i = $473;
+ }
+ }
+ HEAP32[$470>>2] = $$lcssa265;
+ }
+ $474 = (($k$063$i) + 1)|0;
+ $k$3$i = $474;
+ }
+ $475 = ($lnz$057$i|0)<(9);
+ if ($475) {
+ $476 = ($lnz$057$i|0)<=($426|0);
+ $477 = ($426|0)<(18);
+ $or$cond3$i = $476 & $477;
+ if ($or$cond3$i) {
+ $478 = ($426|0)==(9);
+ if ($478) {
+ $479 = (+($sign$0|0));
+ $480 = HEAP32[$x$i>>2]|0;
+ $481 = (+($480>>>0));
+ $482 = $479 * $481;
+ $$0$i27 = $482;
+ break;
+ }
+ $483 = ($426|0)<(9);
+ if ($483) {
+ $484 = (+($sign$0|0));
+ $485 = HEAP32[$x$i>>2]|0;
+ $486 = (+($485>>>0));
+ $487 = $484 * $486;
+ $488 = (8 - ($426))|0;
+ $489 = (6688 + ($488<<2)|0);
+ $490 = HEAP32[$489>>2]|0;
+ $491 = (+($490|0));
+ $492 = $487 / $491;
+ $$0$i27 = $492;
+ break;
+ }
+ $$neg32$i = (($bits$0$ph) + 27)|0;
+ $493 = Math_imul($426, -3)|0;
+ $494 = (($$neg32$i) + ($493))|0;
+ $495 = ($494|0)>(30);
+ $$pre$i17 = HEAP32[$x$i>>2]|0;
+ $496 = $$pre$i17 >>> $494;
+ $497 = ($496|0)==(0);
+ $or$cond182$i = $495 | $497;
+ if ($or$cond182$i) {
+ $498 = (+($sign$0|0));
+ $499 = (+($$pre$i17>>>0));
+ $500 = $498 * $499;
+ $501 = (($426) + -10)|0;
+ $502 = (6688 + ($501<<2)|0);
+ $503 = HEAP32[$502>>2]|0;
+ $504 = (+($503|0));
+ $505 = $500 * $504;
+ $$0$i27 = $505;
+ break;
+ }
+ }
+ }
+ $506 = (($426|0) % 9)&-1;
+ $507 = ($506|0)==(0);
+ if ($507) {
+ $a$2$ph38$i = 0;$e2$0$ph$i = 0;$rp$2$ph36$i = $426;$z$1$ph37$i = $k$3$i;
+ } else {
+ $508 = ($426|0)>(-1);
+ $509 = (($506) + 9)|0;
+ $510 = $508 ? $506 : $509;
+ $511 = (8 - ($510))|0;
+ $512 = (6688 + ($511<<2)|0);
+ $513 = HEAP32[$512>>2]|0;
+ $514 = ($k$3$i|0)==(0);
+ if ($514) {
+ $a$0$lcssa151$i = 0;$rp$0$lcssa152$i = $426;$z$0$i = 0;
+ } else {
+ $515 = (1000000000 / ($513|0))&-1;
+ $a$085$i = 0;$carry$087$i = 0;$k$486$i = 0;$rp$084$i = $426;
+ while(1) {
+ $516 = (($x$i) + ($k$486$i<<2)|0);
+ $517 = HEAP32[$516>>2]|0;
+ $518 = (($517>>>0) % ($513>>>0))&-1;
+ $519 = (($517>>>0) / ($513>>>0))&-1;
+ $520 = (($519) + ($carry$087$i))|0;
+ HEAP32[$516>>2] = $520;
+ $521 = Math_imul($518, $515)|0;
+ $522 = ($k$486$i|0)==($a$085$i|0);
+ $523 = ($520|0)==(0);
+ $or$cond16$i = $522 & $523;
+ $524 = (($k$486$i) + 1)|0;
+ $525 = $524 & 127;
+ $526 = (($rp$084$i) + -9)|0;
+ $rp$1$i18 = $or$cond16$i ? $526 : $rp$084$i;
+ $a$1$i = $or$cond16$i ? $525 : $a$085$i;
+ $527 = ($524|0)==($k$3$i|0);
+ if ($527) {
+ $$lcssa264 = $521;$a$1$i$lcssa = $a$1$i;$rp$1$i18$lcssa = $rp$1$i18;
+ break;
+ } else {
+ $a$085$i = $a$1$i;$carry$087$i = $521;$k$486$i = $524;$rp$084$i = $rp$1$i18;
+ }
+ }
+ $528 = ($$lcssa264|0)==(0);
+ if ($528) {
+ $a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $k$3$i;
+ } else {
+ $529 = (($k$3$i) + 1)|0;
+ $530 = (($x$i) + ($k$3$i<<2)|0);
+ HEAP32[$530>>2] = $$lcssa264;
+ $a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $529;
+ }
+ }
+ $531 = (9 - ($510))|0;
+ $532 = (($531) + ($rp$0$lcssa152$i))|0;
+ $a$2$ph38$i = $a$0$lcssa151$i;$e2$0$ph$i = 0;$rp$2$ph36$i = $532;$z$1$ph37$i = $z$0$i;
+ }
+ L284: while(1) {
+ $533 = ($rp$2$ph36$i|0)<(18);
+ $534 = ($rp$2$ph36$i|0)==(18);
+ $535 = (($x$i) + ($a$2$ph38$i<<2)|0);
+ $e2$0$i19 = $e2$0$ph$i;$z$1$i = $z$1$ph37$i;
+ while(1) {
+ if (!($533)) {
+ if (!($534)) {
+ $a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = $rp$2$ph36$i;$z$5$ph$i = $z$1$i;
+ break L284;
+ }
+ $536 = HEAP32[$535>>2]|0;
+ $537 = ($536>>>0)<(9007199);
+ if (!($537)) {
+ $a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = 18;$z$5$ph$i = $z$1$i;
+ break L284;
+ }
+ }
+ $538 = (($z$1$i) + 127)|0;
+ $carry1$0$i = 0;$k$5$in$i = $538;$z$2$i = $z$1$i;
+ while(1) {
+ $k$5$i = $k$5$in$i & 127;
+ $539 = (($x$i) + ($k$5$i<<2)|0);
+ $540 = HEAP32[$539>>2]|0;
+ $541 = (_bitshift64Shl(($540|0),0,29)|0);
+ $542 = tempRet0;
+ $543 = (_i64Add(($541|0),($542|0),($carry1$0$i|0),0)|0);
+ $544 = tempRet0;
+ $545 = ($544>>>0)>(0);
+ $546 = ($543>>>0)>(1000000000);
+ $547 = ($544|0)==(0);
+ $548 = $547 & $546;
+ $549 = $545 | $548;
+ if ($549) {
+ $550 = (___udivdi3(($543|0),($544|0),1000000000,0)|0);
+ $551 = tempRet0;
+ $552 = (___uremdi3(($543|0),($544|0),1000000000,0)|0);
+ $553 = tempRet0;
+ $$sink$off0$i = $552;$carry1$1$i = $550;
+ } else {
+ $$sink$off0$i = $543;$carry1$1$i = 0;
+ }
+ HEAP32[$539>>2] = $$sink$off0$i;
+ $554 = (($z$2$i) + 127)|0;
+ $555 = $554 & 127;
+ $556 = ($k$5$i|0)!=($555|0);
+ $557 = ($k$5$i|0)==($a$2$ph38$i|0);
+ $or$cond17$i = $556 | $557;
+ $558 = ($$sink$off0$i|0)==(0);
+ $k$5$z$2$i = $558 ? $k$5$i : $z$2$i;
+ $z$3$i = $or$cond17$i ? $z$2$i : $k$5$z$2$i;
+ $559 = (($k$5$i) + -1)|0;
+ if ($557) {
+ $carry1$1$i$lcssa = $carry1$1$i;$z$3$i$lcssa = $z$3$i;
+ break;
+ } else {
+ $carry1$0$i = $carry1$1$i;$k$5$in$i = $559;$z$2$i = $z$3$i;
+ }
+ }
+ $560 = (($e2$0$i19) + -29)|0;
+ $561 = ($carry1$1$i$lcssa|0)==(0);
+ if ($561) {
+ $e2$0$i19 = $560;$z$1$i = $z$3$i$lcssa;
+ } else {
+ $$lcssa263 = $560;$carry1$1$i$lcssa$lcssa = $carry1$1$i$lcssa;$z$3$i$lcssa$lcssa = $z$3$i$lcssa;
+ break;
+ }
+ }
+ $562 = (($rp$2$ph36$i) + 9)|0;
+ $563 = (($a$2$ph38$i) + 127)|0;
+ $564 = $563 & 127;
+ $565 = ($564|0)==($z$3$i$lcssa$lcssa|0);
+ if ($565) {
+ $566 = (($z$3$i$lcssa$lcssa) + 127)|0;
+ $567 = $566 & 127;
+ $568 = (($x$i) + ($567<<2)|0);
+ $569 = HEAP32[$568>>2]|0;
+ $570 = (($z$3$i$lcssa$lcssa) + 126)|0;
+ $571 = $570 & 127;
+ $572 = (($x$i) + ($571<<2)|0);
+ $573 = HEAP32[$572>>2]|0;
+ $574 = $573 | $569;
+ HEAP32[$572>>2] = $574;
+ $z$4$i = $567;
+ } else {
+ $z$4$i = $z$3$i$lcssa$lcssa;
+ }
+ $575 = (($x$i) + ($564<<2)|0);
+ HEAP32[$575>>2] = $carry1$1$i$lcssa$lcssa;
+ $a$2$ph38$i = $564;$e2$0$ph$i = $$lcssa263;$rp$2$ph36$i = $562;$z$1$ph37$i = $z$4$i;
+ }
+ L302: while(1) {
+ $606 = (($z$5$ph$i) + 1)|0;
+ $603 = $606 & 127;
+ $607 = (($z$5$ph$i) + 127)|0;
+ $608 = $607 & 127;
+ $609 = (($x$i) + ($608<<2)|0);
+ $a$3$ph157$i = $a$3$ph$i;$e2$1$ph156$i = $e2$1$ph$i;$rp$3$ph$i = $rp$3$ph34$i;
+ while(1) {
+ $610 = ($rp$3$ph$i|0)==(18);
+ $611 = ($rp$3$ph$i|0)>(27);
+ $$18$i = $611 ? 9 : 1;
+ $$not$i = $610 ^ 1;
+ $a$3$i = $a$3$ph157$i;$e2$1$i = $e2$1$ph156$i;
+ while(1) {
+ $576 = $a$3$i & 127;
+ $577 = ($576|0)==($z$5$ph$i|0);
+ do {
+ if ($577) {
+ label = 219;
+ } else {
+ $578 = (($x$i) + ($576<<2)|0);
+ $579 = HEAP32[$578>>2]|0;
+ $580 = ($579>>>0)<(9007199);
+ if ($580) {
+ label = 219;
+ break;
+ }
+ $581 = ($579>>>0)>(9007199);
+ if ($581) {
+ break;
+ }
+ $582 = (($a$3$i) + 1)|0;
+ $583 = $582 & 127;
+ $584 = ($583|0)==($z$5$ph$i|0);
+ if ($584) {
+ label = 219;
+ break;
+ }
+ $690 = (($x$i) + ($583<<2)|0);
+ $691 = HEAP32[$690>>2]|0;
+ $692 = ($691>>>0)<(254740991);
+ if ($692) {
+ label = 219;
+ break;
+ }
+ $693 = ($691>>>0)>(254740991);
+ $brmerge$i28 = $693 | $$not$i;
+ if (!($brmerge$i28)) {
+ $617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i;
+ break L302;
+ }
+ }
+ } while(0);
+ if ((label|0) == 219) {
+ label = 0;
+ if ($610) {
+ label = 220;
+ break L302;
+ }
+ }
+ $585 = (($e2$1$i) + ($$18$i))|0;
+ $586 = ($a$3$i|0)==($z$5$ph$i|0);
+ if ($586) {
+ $a$3$i = $z$5$ph$i;$e2$1$i = $585;
+ } else {
+ $$lcssa256 = $585;$a$3$i$lcssa248 = $a$3$i;
+ break;
+ }
+ }
+ $587 = 1 << $$18$i;
+ $588 = (($587) + -1)|0;
+ $589 = 1000000000 >>> $$18$i;
+ $a$478$i = $a$3$i$lcssa248;$carry3$081$i = 0;$k$679$i = $a$3$i$lcssa248;$rp$477$i = $rp$3$ph$i;
+ while(1) {
+ $590 = (($x$i) + ($k$679$i<<2)|0);
+ $591 = HEAP32[$590>>2]|0;
+ $592 = $591 & $588;
+ $593 = $591 >>> $$18$i;
+ $594 = (($593) + ($carry3$081$i))|0;
+ HEAP32[$590>>2] = $594;
+ $595 = Math_imul($592, $589)|0;
+ $596 = ($k$679$i|0)==($a$478$i|0);
+ $597 = ($594|0)==(0);
+ $or$cond19$i = $596 & $597;
+ $598 = (($k$679$i) + 1)|0;
+ $599 = $598 & 127;
+ $600 = (($rp$477$i) + -9)|0;
+ $rp$5$i = $or$cond19$i ? $600 : $rp$477$i;
+ $a$5$i = $or$cond19$i ? $599 : $a$478$i;
+ $601 = ($599|0)==($z$5$ph$i|0);
+ if ($601) {
+ $$lcssa257 = $595;$a$5$i$lcssa = $a$5$i;$rp$5$i$lcssa = $rp$5$i;
+ break;
+ } else {
+ $a$478$i = $a$5$i;$carry3$081$i = $595;$k$679$i = $599;$rp$477$i = $rp$5$i;
+ }
+ }
+ $602 = ($$lcssa257|0)==(0);
+ if ($602) {
+ $a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa;
+ continue;
+ }
+ $604 = ($603|0)==($a$5$i$lcssa|0);
+ if (!($604)) {
+ $$lcssa256$lcssa = $$lcssa256;$$lcssa257$lcssa = $$lcssa257;$a$5$i$lcssa$lcssa = $a$5$i$lcssa;$rp$5$i$lcssa$lcssa = $rp$5$i$lcssa;
+ break;
+ }
+ $612 = HEAP32[$609>>2]|0;
+ $613 = $612 | 1;
+ HEAP32[$609>>2] = $613;
+ $a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa;
+ }
+ $605 = (($x$i) + ($z$5$ph$i<<2)|0);
+ HEAP32[$605>>2] = $$lcssa257$lcssa;
+ $a$3$ph$i = $a$5$i$lcssa$lcssa;$e2$1$ph$i = $$lcssa256$lcssa;$rp$3$ph34$i = $rp$5$i$lcssa$lcssa;$z$5$ph$i = $603;
+ }
+ if ((label|0) == 220) {
+ if ($577) {
+ $614 = (($603) + -1)|0;
+ $615 = (($x$i) + ($614<<2)|0);
+ HEAP32[$615>>2] = 0;
+ $617 = $z$5$ph$i;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $603;
+ } else {
+ $617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i;
+ }
+ }
+ $616 = (($x$i) + ($617<<2)|0);
+ $618 = HEAP32[$616>>2]|0;
+ $619 = (+($618>>>0));
+ $620 = (($a$3$i249) + 1)|0;
+ $621 = $620 & 127;
+ $622 = ($621|0)==($z$7$i|0);
+ if ($622) {
+ $679 = (($a$3$i249) + 2)|0;
+ $680 = $679 & 127;
+ $681 = (($680) + -1)|0;
+ $682 = (($x$i) + ($681<<2)|0);
+ HEAP32[$682>>2] = 0;
+ $z$7$1$i = $680;
+ } else {
+ $z$7$1$i = $z$7$i;
+ }
+ $683 = $619 * 1.0E+9;
+ $684 = (($x$i) + ($621<<2)|0);
+ $685 = HEAP32[$684>>2]|0;
+ $686 = (+($685>>>0));
+ $687 = $683 + $686;
+ $643 = (+($sign$0|0));
+ $625 = $643 * $687;
+ $663 = (($e2$1$i246) + 53)|0;
+ $669 = (($663) - ($emin$0$ph))|0;
+ $670 = ($669|0)<($bits$0$ph|0);
+ $688 = ($669|0)<(0);
+ $$$i = $688 ? 0 : $669;
+ $denormal$0$i = $670&1;
+ $$010$i = $670 ? $$$i : $bits$0$ph;
+ $689 = ($$010$i|0)<(53);
+ if ($689) {
+ $623 = (105 - ($$010$i))|0;
+ $624 = (+_scalbn(1.0,$623));
+ $626 = (+_copysignl($624,$625));
+ $627 = (53 - ($$010$i))|0;
+ $628 = (+_scalbn(1.0,$627));
+ $629 = (+_fmodl($625,$628));
+ $630 = $625 - $629;
+ $631 = $626 + $630;
+ $bias$0$i25 = $626;$frac$0$i = $629;$y$1$i24 = $631;
+ } else {
+ $bias$0$i25 = 0.0;$frac$0$i = 0.0;$y$1$i24 = $625;
+ }
+ $632 = (($a$3$i249) + 2)|0;
+ $633 = $632 & 127;
+ $634 = ($633|0)==($z$7$1$i|0);
+ do {
+ if ($634) {
+ $frac$2$i = $frac$0$i;
+ } else {
+ $635 = (($x$i) + ($633<<2)|0);
+ $636 = HEAP32[$635>>2]|0;
+ $637 = ($636>>>0)<(500000000);
+ do {
+ if ($637) {
+ $638 = ($636|0)==(0);
+ if ($638) {
+ $639 = (($a$3$i249) + 3)|0;
+ $640 = $639 & 127;
+ $641 = ($640|0)==($z$7$1$i|0);
+ if ($641) {
+ $frac$1$i = $frac$0$i;
+ break;
+ }
+ }
+ $642 = $643 * 0.25;
+ $644 = $642 + $frac$0$i;
+ $frac$1$i = $644;
+ } else {
+ $645 = ($636>>>0)>(500000000);
+ if ($645) {
+ $646 = $643 * 0.75;
+ $647 = $646 + $frac$0$i;
+ $frac$1$i = $647;
+ break;
+ }
+ $648 = (($a$3$i249) + 3)|0;
+ $649 = $648 & 127;
+ $650 = ($649|0)==($z$7$1$i|0);
+ if ($650) {
+ $651 = $643 * 0.5;
+ $652 = $651 + $frac$0$i;
+ $frac$1$i = $652;
+ break;
+ } else {
+ $653 = $643 * 0.75;
+ $654 = $653 + $frac$0$i;
+ $frac$1$i = $654;
+ break;
+ }
+ }
+ } while(0);
+ $655 = (53 - ($$010$i))|0;
+ $656 = ($655|0)>(1);
+ if (!($656)) {
+ $frac$2$i = $frac$1$i;
+ break;
+ }
+ $657 = (+_fmodl($frac$1$i,1.0));
+ $658 = $657 != 0.0;
+ if ($658) {
+ $frac$2$i = $frac$1$i;
+ break;
+ }
+ $659 = $frac$1$i + 1.0;
+ $frac$2$i = $659;
+ }
+ } while(0);
+ $660 = $y$1$i24 + $frac$2$i;
+ $661 = $660 - $bias$0$i25;
+ $662 = $663 & 2147483647;
+ $664 = (-2 - ($sum$i))|0;
+ $665 = ($662|0)>($664|0);
+ do {
+ if ($665) {
+ $666 = (+Math_abs((+$661)));
+ $667 = !($666 >= 9007199254740992.0);
+ if ($667) {
+ $denormal$2$i = $denormal$0$i;$e2$2$i = $e2$1$i246;$y$2$i26 = $661;
+ } else {
+ $668 = ($$010$i|0)==($669|0);
+ $or$cond20$i = $670 & $668;
+ $denormal$1$i = $or$cond20$i ? 0 : $denormal$0$i;
+ $671 = $661 * 0.5;
+ $672 = (($e2$1$i246) + 1)|0;
+ $denormal$2$i = $denormal$1$i;$e2$2$i = $672;$y$2$i26 = $671;
+ }
+ $673 = (($e2$2$i) + 50)|0;
+ $674 = ($673|0)>($330|0);
+ if (!($674)) {
+ $675 = ($denormal$2$i|0)!=(0);
+ $676 = $frac$2$i != 0.0;
+ $or$cond8$i = $676 & $675;
+ if (!($or$cond8$i)) {
+ $e2$3$i = $e2$2$i;$y$3$i = $y$2$i26;
+ break;
+ }
+ }
+ $677 = (___errno_location()|0);
+ HEAP32[$677>>2] = 34;
+ $e2$3$i = $e2$2$i;$y$3$i = $y$2$i26;
+ } else {
+ $e2$3$i = $e2$1$i246;$y$3$i = $661;
+ }
+ } while(0);
+ $678 = (+_scalbnl($y$3$i,$e2$3$i));
+ $$0$i27 = $678;
+ }
+ } while(0);
+ $$0 = $$0$i27;
+ break L4;
+ break;
+ }
+ default: {
+ $109 = HEAP32[$1>>2]|0;
+ $110 = ($109|0)==(0|0);
+ if (!($110)) {
+ $111 = HEAP32[$0>>2]|0;
+ $112 = ((($111)) + -1|0);
+ HEAP32[$0>>2] = $112;
+ }
+ $113 = (___errno_location()|0);
+ HEAP32[$113>>2] = 22;
+ ___shlim($f,0);
+ $$0 = 0.0;
+ break L4;
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 23) {
+ $41 = HEAP32[$1>>2]|0;
+ $42 = ($41|0)==(0|0);
+ if (!($42)) {
+ $43 = HEAP32[$0>>2]|0;
+ $44 = ((($43)) + -1|0);
+ HEAP32[$0>>2] = $44;
+ }
+ $45 = ($pok|0)!=(0);
+ $46 = ($i$0$lcssa>>>0)>(3);
+ $or$cond9 = $45 & $46;
+ if ($or$cond9) {
+ $i$1 = $i$0$lcssa;
+ while(1) {
+ if (!($42)) {
+ $47 = HEAP32[$0>>2]|0;
+ $48 = ((($47)) + -1|0);
+ HEAP32[$0>>2] = $48;
+ }
+ $49 = (($i$1) + -1)|0;
+ $$old8 = ($49>>>0)>(3);
+ if ($$old8) {
+ $i$1 = $49;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ $50 = (+($sign$0|0));
+ $51 = $50 * inf;
+ $52 = $51;
+ $$0 = $52;
+ }
+ } while(0);
+ STACKTOP = sp;return (+$$0);
+}
+function ___intscan($f,$base,$pok,$0,$1) {
+ $f = $f|0;
+ $base = $base|0;
+ $pok = $pok|0;
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$1 = 0, $$122 = 0, $$123 = 0, $$base21 = 0, $$lcssa = 0, $$lcssa130 = 0, $$lcssa131 = 0, $$lcssa132 = 0, $$lcssa133 = 0, $$lcssa134 = 0, $$lcssa135 = 0, $$sum = 0, $$sum14 = 0, $$sum1445 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0, $$sum1865 = 0, $$sum19 = 0;
+ var $$sum20 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
+ var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
+ var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
+ var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
+ var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
+ var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
+ var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
+ var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
+ var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
+ var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
+ var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $3 = 0, $30 = 0;
+ var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
+ var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0;
+ var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
+ var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c$0 = 0, $c$1 = 0, $c$124 = 0, $c$2$be = 0, $c$2$be$lcssa = 0;
+ var $c$2$lcssa = 0, $c$3$be = 0, $c$3$lcssa = 0, $c$371 = 0, $c$4$be = 0, $c$4$be$lcssa = 0, $c$4$lcssa = 0, $c$5$be = 0, $c$6$be = 0, $c$6$be$lcssa = 0, $c$6$lcssa = 0, $c$7$be = 0, $c$753 = 0, $c$8 = 0, $c$9$be = 0, $neg$0 = 0, $neg$0$ = 0, $neg$1 = 0, $or$cond = 0, $or$cond12 = 0;
+ var $or$cond40 = 0, $or$cond5 = 0, $or$cond7 = 0, $x$082 = 0, $x$146 = 0, $x$266 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($base>>>0)>(36);
+ L1: do {
+ if ($2) {
+ $5 = (___errno_location()|0);
+ HEAP32[$5>>2] = 22;
+ $286 = 0;$287 = 0;
+ } else {
+ $3 = ((($f)) + 4|0);
+ $4 = ((($f)) + 100|0);
+ while(1) {
+ $6 = HEAP32[$3>>2]|0;
+ $7 = HEAP32[$4>>2]|0;
+ $8 = ($6>>>0)<($7>>>0);
+ if ($8) {
+ $9 = ((($6)) + 1|0);
+ HEAP32[$3>>2] = $9;
+ $10 = HEAP8[$6>>0]|0;
+ $11 = $10&255;
+ $13 = $11;
+ } else {
+ $12 = (___shgetc($f)|0);
+ $13 = $12;
+ }
+ $14 = (_isspace($13)|0);
+ $15 = ($14|0)==(0);
+ if ($15) {
+ $$lcssa135 = $13;
+ break;
+ }
+ }
+ $16 = ($$lcssa135|0)==(45);
+ L11: do {
+ switch ($$lcssa135|0) {
+ case 43: case 45: {
+ $17 = $16 << 31 >> 31;
+ $18 = HEAP32[$3>>2]|0;
+ $19 = HEAP32[$4>>2]|0;
+ $20 = ($18>>>0)<($19>>>0);
+ if ($20) {
+ $21 = ((($18)) + 1|0);
+ HEAP32[$3>>2] = $21;
+ $22 = HEAP8[$18>>0]|0;
+ $23 = $22&255;
+ $c$0 = $23;$neg$0 = $17;
+ break L11;
+ } else {
+ $24 = (___shgetc($f)|0);
+ $c$0 = $24;$neg$0 = $17;
+ break L11;
+ }
+ break;
+ }
+ default: {
+ $c$0 = $$lcssa135;$neg$0 = 0;
+ }
+ }
+ } while(0);
+ $25 = ($base|0)==(0);
+ $26 = $base & -17;
+ $27 = ($26|0)==(0);
+ $28 = ($c$0|0)==(48);
+ $or$cond5 = $27 & $28;
+ do {
+ if ($or$cond5) {
+ $29 = HEAP32[$3>>2]|0;
+ $30 = HEAP32[$4>>2]|0;
+ $31 = ($29>>>0)<($30>>>0);
+ if ($31) {
+ $32 = ((($29)) + 1|0);
+ HEAP32[$3>>2] = $32;
+ $33 = HEAP8[$29>>0]|0;
+ $34 = $33&255;
+ $37 = $34;
+ } else {
+ $35 = (___shgetc($f)|0);
+ $37 = $35;
+ }
+ $36 = $37 | 32;
+ $38 = ($36|0)==(120);
+ if (!($38)) {
+ if ($25) {
+ $$123 = 8;$c$124 = $37;
+ label = 46;
+ break;
+ } else {
+ $$1 = $base;$c$1 = $37;
+ label = 32;
+ break;
+ }
+ }
+ $39 = HEAP32[$3>>2]|0;
+ $40 = HEAP32[$4>>2]|0;
+ $41 = ($39>>>0)<($40>>>0);
+ if ($41) {
+ $42 = ((($39)) + 1|0);
+ HEAP32[$3>>2] = $42;
+ $43 = HEAP8[$39>>0]|0;
+ $44 = $43&255;
+ $46 = $44;
+ } else {
+ $45 = (___shgetc($f)|0);
+ $46 = $45;
+ }
+ $$sum20 = (($46) + 1)|0;
+ $47 = (22472 + ($$sum20)|0);
+ $48 = HEAP8[$47>>0]|0;
+ $49 = ($48&255)>(15);
+ if ($49) {
+ $50 = HEAP32[$4>>2]|0;
+ $51 = ($50|0)==(0|0);
+ if (!($51)) {
+ $52 = HEAP32[$3>>2]|0;
+ $53 = ((($52)) + -1|0);
+ HEAP32[$3>>2] = $53;
+ }
+ $54 = ($pok|0)==(0);
+ if ($54) {
+ ___shlim($f,0);
+ $286 = 0;$287 = 0;
+ break L1;
+ }
+ if ($51) {
+ $286 = 0;$287 = 0;
+ break L1;
+ }
+ $55 = HEAP32[$3>>2]|0;
+ $56 = ((($55)) + -1|0);
+ HEAP32[$3>>2] = $56;
+ $286 = 0;$287 = 0;
+ break L1;
+ } else {
+ $$123 = 16;$c$124 = $46;
+ label = 46;
+ }
+ } else {
+ $$base21 = $25 ? 10 : $base;
+ $$sum = (($c$0) + 1)|0;
+ $57 = (22472 + ($$sum)|0);
+ $58 = HEAP8[$57>>0]|0;
+ $59 = $58&255;
+ $60 = ($59>>>0)<($$base21>>>0);
+ if ($60) {
+ $$1 = $$base21;$c$1 = $c$0;
+ label = 32;
+ } else {
+ $61 = HEAP32[$4>>2]|0;
+ $62 = ($61|0)==(0|0);
+ if (!($62)) {
+ $63 = HEAP32[$3>>2]|0;
+ $64 = ((($63)) + -1|0);
+ HEAP32[$3>>2] = $64;
+ }
+ ___shlim($f,0);
+ $65 = (___errno_location()|0);
+ HEAP32[$65>>2] = 22;
+ $286 = 0;$287 = 0;
+ break L1;
+ }
+ }
+ } while(0);
+ if ((label|0) == 32) {
+ $66 = ($$1|0)==(10);
+ if ($66) {
+ $67 = (($c$1) + -48)|0;
+ $68 = ($67>>>0)<(10);
+ if ($68) {
+ $71 = $67;$x$082 = 0;
+ while(1) {
+ $69 = ($x$082*10)|0;
+ $70 = (($69) + ($71))|0;
+ $72 = HEAP32[$3>>2]|0;
+ $73 = HEAP32[$4>>2]|0;
+ $74 = ($72>>>0)<($73>>>0);
+ if ($74) {
+ $75 = ((($72)) + 1|0);
+ HEAP32[$3>>2] = $75;
+ $76 = HEAP8[$72>>0]|0;
+ $77 = $76&255;
+ $c$2$be = $77;
+ } else {
+ $78 = (___shgetc($f)|0);
+ $c$2$be = $78;
+ }
+ $79 = (($c$2$be) + -48)|0;
+ $80 = ($79>>>0)<(10);
+ $81 = ($70>>>0)<(429496729);
+ $82 = $80 & $81;
+ if ($82) {
+ $71 = $79;$x$082 = $70;
+ } else {
+ $$lcssa134 = $70;$c$2$be$lcssa = $c$2$be;
+ break;
+ }
+ }
+ $288 = $$lcssa134;$289 = 0;$c$2$lcssa = $c$2$be$lcssa;
+ } else {
+ $288 = 0;$289 = 0;$c$2$lcssa = $c$1;
+ }
+ $83 = (($c$2$lcssa) + -48)|0;
+ $84 = ($83>>>0)<(10);
+ if ($84) {
+ $85 = $288;$86 = $289;$89 = $83;$c$371 = $c$2$lcssa;
+ while(1) {
+ $87 = (___muldi3(($85|0),($86|0),10,0)|0);
+ $88 = tempRet0;
+ $90 = ($89|0)<(0);
+ $91 = $90 << 31 >> 31;
+ $92 = $89 ^ -1;
+ $93 = $91 ^ -1;
+ $94 = ($88>>>0)>($93>>>0);
+ $95 = ($87>>>0)>($92>>>0);
+ $96 = ($88|0)==($93|0);
+ $97 = $96 & $95;
+ $98 = $94 | $97;
+ if ($98) {
+ $$lcssa = $89;$290 = $85;$291 = $86;$c$3$lcssa = $c$371;
+ break;
+ }
+ $99 = (_i64Add(($87|0),($88|0),($89|0),($91|0))|0);
+ $100 = tempRet0;
+ $101 = HEAP32[$3>>2]|0;
+ $102 = HEAP32[$4>>2]|0;
+ $103 = ($101>>>0)<($102>>>0);
+ if ($103) {
+ $104 = ((($101)) + 1|0);
+ HEAP32[$3>>2] = $104;
+ $105 = HEAP8[$101>>0]|0;
+ $106 = $105&255;
+ $c$3$be = $106;
+ } else {
+ $107 = (___shgetc($f)|0);
+ $c$3$be = $107;
+ }
+ $108 = (($c$3$be) + -48)|0;
+ $109 = ($108>>>0)<(10);
+ $110 = ($100>>>0)<(429496729);
+ $111 = ($99>>>0)<(2576980378);
+ $112 = ($100|0)==(429496729);
+ $113 = $112 & $111;
+ $114 = $110 | $113;
+ $or$cond7 = $109 & $114;
+ if ($or$cond7) {
+ $85 = $99;$86 = $100;$89 = $108;$c$371 = $c$3$be;
+ } else {
+ $$lcssa = $108;$290 = $99;$291 = $100;$c$3$lcssa = $c$3$be;
+ break;
+ }
+ }
+ $115 = ($$lcssa>>>0)>(9);
+ if ($115) {
+ $259 = $291;$261 = $290;$neg$1 = $neg$0;
+ } else {
+ $$122 = 10;$292 = $290;$293 = $291;$c$8 = $c$3$lcssa;
+ label = 72;
+ }
+ } else {
+ $259 = $289;$261 = $288;$neg$1 = $neg$0;
+ }
+ } else {
+ $$123 = $$1;$c$124 = $c$1;
+ label = 46;
+ }
+ }
+ L63: do {
+ if ((label|0) == 46) {
+ $116 = (($$123) + -1)|0;
+ $117 = $116 & $$123;
+ $118 = ($117|0)==(0);
+ if ($118) {
+ $123 = ($$123*23)|0;
+ $124 = $123 >>> 5;
+ $125 = $124 & 7;
+ $126 = (22729 + ($125)|0);
+ $127 = HEAP8[$126>>0]|0;
+ $128 = $127 << 24 >> 24;
+ $$sum1445 = (($c$124) + 1)|0;
+ $129 = (22472 + ($$sum1445)|0);
+ $130 = HEAP8[$129>>0]|0;
+ $131 = $130&255;
+ $132 = ($131>>>0)<($$123>>>0);
+ if ($132) {
+ $135 = $131;$x$146 = 0;
+ while(1) {
+ $133 = $x$146 << $128;
+ $134 = $135 | $133;
+ $136 = HEAP32[$3>>2]|0;
+ $137 = HEAP32[$4>>2]|0;
+ $138 = ($136>>>0)<($137>>>0);
+ if ($138) {
+ $139 = ((($136)) + 1|0);
+ HEAP32[$3>>2] = $139;
+ $140 = HEAP8[$136>>0]|0;
+ $141 = $140&255;
+ $c$4$be = $141;
+ } else {
+ $142 = (___shgetc($f)|0);
+ $c$4$be = $142;
+ }
+ $$sum14 = (($c$4$be) + 1)|0;
+ $143 = (22472 + ($$sum14)|0);
+ $144 = HEAP8[$143>>0]|0;
+ $145 = $144&255;
+ $146 = ($145>>>0)<($$123>>>0);
+ $147 = ($134>>>0)<(134217728);
+ $148 = $147 & $146;
+ if ($148) {
+ $135 = $145;$x$146 = $134;
+ } else {
+ $$lcssa130 = $134;$$lcssa131 = $144;$c$4$be$lcssa = $c$4$be;
+ break;
+ }
+ }
+ $152 = $$lcssa131;$154 = 0;$156 = $$lcssa130;$c$4$lcssa = $c$4$be$lcssa;
+ } else {
+ $152 = $130;$154 = 0;$156 = 0;$c$4$lcssa = $c$124;
+ }
+ $149 = (_bitshift64Lshr(-1,-1,($128|0))|0);
+ $150 = tempRet0;
+ $151 = $152&255;
+ $153 = ($151>>>0)>=($$123>>>0);
+ $155 = ($154>>>0)>($150>>>0);
+ $157 = ($156>>>0)>($149>>>0);
+ $158 = ($154|0)==($150|0);
+ $159 = $158 & $157;
+ $160 = $155 | $159;
+ $or$cond40 = $153 | $160;
+ if ($or$cond40) {
+ $$122 = $$123;$292 = $156;$293 = $154;$c$8 = $c$4$lcssa;
+ label = 72;
+ break;
+ } else {
+ $161 = $156;$162 = $154;$166 = $152;
+ }
+ while(1) {
+ $163 = (_bitshift64Shl(($161|0),($162|0),($128|0))|0);
+ $164 = tempRet0;
+ $165 = $166&255;
+ $167 = $165 | $163;
+ $168 = HEAP32[$3>>2]|0;
+ $169 = HEAP32[$4>>2]|0;
+ $170 = ($168>>>0)<($169>>>0);
+ if ($170) {
+ $171 = ((($168)) + 1|0);
+ HEAP32[$3>>2] = $171;
+ $172 = HEAP8[$168>>0]|0;
+ $173 = $172&255;
+ $c$5$be = $173;
+ } else {
+ $174 = (___shgetc($f)|0);
+ $c$5$be = $174;
+ }
+ $$sum15 = (($c$5$be) + 1)|0;
+ $175 = (22472 + ($$sum15)|0);
+ $176 = HEAP8[$175>>0]|0;
+ $177 = $176&255;
+ $178 = ($177>>>0)>=($$123>>>0);
+ $179 = ($164>>>0)>($150>>>0);
+ $180 = ($167>>>0)>($149>>>0);
+ $181 = ($164|0)==($150|0);
+ $182 = $181 & $180;
+ $183 = $179 | $182;
+ $or$cond = $178 | $183;
+ if ($or$cond) {
+ $$122 = $$123;$292 = $167;$293 = $164;$c$8 = $c$5$be;
+ label = 72;
+ break L63;
+ } else {
+ $161 = $167;$162 = $164;$166 = $176;
+ }
+ }
+ }
+ $$sum1865 = (($c$124) + 1)|0;
+ $119 = (22472 + ($$sum1865)|0);
+ $120 = HEAP8[$119>>0]|0;
+ $121 = $120&255;
+ $122 = ($121>>>0)<($$123>>>0);
+ if ($122) {
+ $186 = $121;$x$266 = 0;
+ while(1) {
+ $184 = Math_imul($x$266, $$123)|0;
+ $185 = (($186) + ($184))|0;
+ $187 = HEAP32[$3>>2]|0;
+ $188 = HEAP32[$4>>2]|0;
+ $189 = ($187>>>0)<($188>>>0);
+ if ($189) {
+ $190 = ((($187)) + 1|0);
+ HEAP32[$3>>2] = $190;
+ $191 = HEAP8[$187>>0]|0;
+ $192 = $191&255;
+ $c$6$be = $192;
+ } else {
+ $193 = (___shgetc($f)|0);
+ $c$6$be = $193;
+ }
+ $$sum18 = (($c$6$be) + 1)|0;
+ $194 = (22472 + ($$sum18)|0);
+ $195 = HEAP8[$194>>0]|0;
+ $196 = $195&255;
+ $197 = ($196>>>0)<($$123>>>0);
+ $198 = ($185>>>0)<(119304647);
+ $199 = $198 & $197;
+ if ($199) {
+ $186 = $196;$x$266 = $185;
+ } else {
+ $$lcssa132 = $185;$$lcssa133 = $195;$c$6$be$lcssa = $c$6$be;
+ break;
+ }
+ }
+ $201 = $$lcssa133;$294 = $$lcssa132;$295 = 0;$c$6$lcssa = $c$6$be$lcssa;
+ } else {
+ $201 = $120;$294 = 0;$295 = 0;$c$6$lcssa = $c$124;
+ }
+ $200 = $201&255;
+ $202 = ($200>>>0)<($$123>>>0);
+ if ($202) {
+ $203 = (___udivdi3(-1,-1,($$123|0),0)|0);
+ $204 = tempRet0;
+ $205 = $295;$207 = $294;$215 = $201;$c$753 = $c$6$lcssa;
+ while(1) {
+ $206 = ($205>>>0)>($204>>>0);
+ $208 = ($207>>>0)>($203>>>0);
+ $209 = ($205|0)==($204|0);
+ $210 = $209 & $208;
+ $211 = $206 | $210;
+ if ($211) {
+ $$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753;
+ label = 72;
+ break L63;
+ }
+ $212 = (___muldi3(($207|0),($205|0),($$123|0),0)|0);
+ $213 = tempRet0;
+ $214 = $215&255;
+ $216 = $214 ^ -1;
+ $217 = ($213>>>0)>(4294967295);
+ $218 = ($212>>>0)>($216>>>0);
+ $219 = ($213|0)==(-1);
+ $220 = $219 & $218;
+ $221 = $217 | $220;
+ if ($221) {
+ $$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753;
+ label = 72;
+ break L63;
+ }
+ $222 = (_i64Add(($214|0),0,($212|0),($213|0))|0);
+ $223 = tempRet0;
+ $224 = HEAP32[$3>>2]|0;
+ $225 = HEAP32[$4>>2]|0;
+ $226 = ($224>>>0)<($225>>>0);
+ if ($226) {
+ $227 = ((($224)) + 1|0);
+ HEAP32[$3>>2] = $227;
+ $228 = HEAP8[$224>>0]|0;
+ $229 = $228&255;
+ $c$7$be = $229;
+ } else {
+ $230 = (___shgetc($f)|0);
+ $c$7$be = $230;
+ }
+ $$sum19 = (($c$7$be) + 1)|0;
+ $231 = (22472 + ($$sum19)|0);
+ $232 = HEAP8[$231>>0]|0;
+ $233 = $232&255;
+ $234 = ($233>>>0)<($$123>>>0);
+ if ($234) {
+ $205 = $223;$207 = $222;$215 = $232;$c$753 = $c$7$be;
+ } else {
+ $$122 = $$123;$292 = $222;$293 = $223;$c$8 = $c$7$be;
+ label = 72;
+ break;
+ }
+ }
+ } else {
+ $$122 = $$123;$292 = $294;$293 = $295;$c$8 = $c$6$lcssa;
+ label = 72;
+ }
+ }
+ } while(0);
+ if ((label|0) == 72) {
+ $$sum16 = (($c$8) + 1)|0;
+ $235 = (22472 + ($$sum16)|0);
+ $236 = HEAP8[$235>>0]|0;
+ $237 = $236&255;
+ $238 = ($237>>>0)<($$122>>>0);
+ if ($238) {
+ while(1) {
+ $239 = HEAP32[$3>>2]|0;
+ $240 = HEAP32[$4>>2]|0;
+ $241 = ($239>>>0)<($240>>>0);
+ if ($241) {
+ $242 = ((($239)) + 1|0);
+ HEAP32[$3>>2] = $242;
+ $243 = HEAP8[$239>>0]|0;
+ $244 = $243&255;
+ $c$9$be = $244;
+ } else {
+ $245 = (___shgetc($f)|0);
+ $c$9$be = $245;
+ }
+ $$sum17 = (($c$9$be) + 1)|0;
+ $246 = (22472 + ($$sum17)|0);
+ $247 = HEAP8[$246>>0]|0;
+ $248 = $247&255;
+ $249 = ($248>>>0)<($$122>>>0);
+ if (!($249)) {
+ break;
+ }
+ }
+ $250 = (___errno_location()|0);
+ HEAP32[$250>>2] = 34;
+ $251 = $0 & 1;
+ $252 = ($251|0)==(0);
+ $253 = (0)==(0);
+ $254 = $252 & $253;
+ $neg$0$ = $254 ? $neg$0 : 0;
+ $259 = $1;$261 = $0;$neg$1 = $neg$0$;
+ } else {
+ $259 = $293;$261 = $292;$neg$1 = $neg$0;
+ }
+ }
+ $255 = HEAP32[$4>>2]|0;
+ $256 = ($255|0)==(0|0);
+ if (!($256)) {
+ $257 = HEAP32[$3>>2]|0;
+ $258 = ((($257)) + -1|0);
+ HEAP32[$3>>2] = $258;
+ }
+ $260 = ($259>>>0)<($1>>>0);
+ $262 = ($261>>>0)<($0>>>0);
+ $263 = ($259|0)==($1|0);
+ $264 = $263 & $262;
+ $265 = $260 | $264;
+ if (!($265)) {
+ $266 = $0 & 1;
+ $267 = ($266|0)!=(0);
+ $268 = (0)!=(0);
+ $269 = $267 | $268;
+ $270 = ($neg$1|0)!=(0);
+ $or$cond12 = $269 | $270;
+ if (!($or$cond12)) {
+ $271 = (___errno_location()|0);
+ HEAP32[$271>>2] = 34;
+ $272 = (_i64Add(($0|0),($1|0),-1,-1)|0);
+ $273 = tempRet0;
+ $286 = $273;$287 = $272;
+ break;
+ }
+ $274 = ($259>>>0)>($1>>>0);
+ $275 = ($261>>>0)>($0>>>0);
+ $276 = ($259|0)==($1|0);
+ $277 = $276 & $275;
+ $278 = $274 | $277;
+ if ($278) {
+ $279 = (___errno_location()|0);
+ HEAP32[$279>>2] = 34;
+ $286 = $1;$287 = $0;
+ break;
+ }
+ }
+ $280 = ($neg$1|0)<(0);
+ $281 = $280 << 31 >> 31;
+ $282 = $261 ^ $neg$1;
+ $283 = $259 ^ $281;
+ $284 = (_i64Subtract(($282|0),($283|0),($neg$1|0),($281|0))|0);
+ $285 = tempRet0;
+ $286 = $285;$287 = $284;
+ }
+ } while(0);
+ tempRet0 = ($286);
+ return ($287|0);
+}
+function ___shlim($f,$lim) {
+ $f = $f|0;
+ $lim = $lim|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 104|0);
+ HEAP32[$0>>2] = $lim;
+ $1 = ((($f)) + 8|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($f)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $2;
+ $6 = $4;
+ $7 = (($5) - ($6))|0;
+ $8 = ((($f)) + 108|0);
+ HEAP32[$8>>2] = $7;
+ $9 = ($lim|0)!=(0);
+ $10 = ($7|0)>($lim|0);
+ $or$cond = $9 & $10;
+ if ($or$cond) {
+ $11 = (($4) + ($lim)|0);
+ $12 = ((($f)) + 100|0);
+ HEAP32[$12>>2] = $11;
+ } else {
+ $13 = ((($f)) + 100|0);
+ HEAP32[$13>>2] = $5;
+ }
+ return;
+}
+function ___shgetc($f) {
+ $f = $f|0;
+ var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert3 = 0, $$pre = 0, $$pre4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
+ var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
+ var $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 104|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ label = 3;
+ } else {
+ $3 = ((($f)) + 108|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)<($1|0);
+ if ($5) {
+ label = 3;
+ } else {
+ label = 4;
+ }
+ }
+ if ((label|0) == 3) {
+ $6 = (___uflow($f)|0);
+ $7 = ($6|0)<(0);
+ if ($7) {
+ label = 4;
+ } else {
+ $9 = HEAP32[$0>>2]|0;
+ $10 = ($9|0)==(0);
+ $$phi$trans$insert = ((($f)) + 8|0);
+ if ($10) {
+ $$pre = HEAP32[$$phi$trans$insert>>2]|0;
+ $11 = $$pre;
+ $26 = $$pre;$41 = $11;
+ label = 9;
+ } else {
+ $12 = HEAP32[$$phi$trans$insert>>2]|0;
+ $13 = ((($f)) + 4|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = $12;
+ $16 = $14;
+ $17 = (($15) - ($16))|0;
+ $18 = ((($f)) + 108|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = (($9) - ($19))|0;
+ $21 = (($20) + -1)|0;
+ $22 = ($17|0)>($21|0);
+ if ($22) {
+ $23 = (($14) + ($21)|0);
+ $24 = ((($f)) + 100|0);
+ HEAP32[$24>>2] = $23;
+ $27 = $12;
+ } else {
+ $26 = $15;$41 = $12;
+ label = 9;
+ }
+ }
+ if ((label|0) == 9) {
+ $25 = ((($f)) + 100|0);
+ HEAP32[$25>>2] = $26;
+ $27 = $41;
+ }
+ $28 = ($27|0)==(0|0);
+ $$phi$trans$insert3 = ((($f)) + 4|0);
+ $$pre4 = HEAP32[$$phi$trans$insert3>>2]|0;
+ if (!($28)) {
+ $29 = $27;
+ $30 = $$pre4;
+ $31 = ((($f)) + 108|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = (($29) + 1)|0;
+ $34 = (($33) - ($30))|0;
+ $35 = (($34) + ($32))|0;
+ HEAP32[$31>>2] = $35;
+ }
+ $36 = ((($$pre4)) + -1|0);
+ $37 = HEAP8[$36>>0]|0;
+ $38 = $37&255;
+ $39 = ($38|0)==($6|0);
+ if ($39) {
+ $$0 = $6;
+ } else {
+ $40 = $6&255;
+ HEAP8[$36>>0] = $40;
+ $$0 = $6;
+ }
+ }
+ }
+ if ((label|0) == 4) {
+ $8 = ((($f)) + 100|0);
+ HEAP32[$8>>2] = 0;
+ $$0 = -1;
+ }
+ return ($$0|0);
+}
+function ___syscall_ret($r) {
+ $r = $r|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($r>>>0)>(4294963200);
+ if ($0) {
+ $1 = (0 - ($r))|0;
+ $2 = (___errno_location()|0);
+ HEAP32[$2>>2] = $1;
+ $$0 = -1;
+ } else {
+ $$0 = $r;
+ }
+ return ($$0|0);
+}
+function _copysign($x,$y) {
+ $x = +$x;
+ $y = +$y;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0;
+ $1 = HEAP32[tempDoublePtr+4>>2]|0;
+ HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0;
+ $3 = HEAP32[tempDoublePtr+4>>2]|0;
+ $4 = $1 & 2147483647;
+ $5 = $3 & -2147483648;
+ $6 = $5 | $4;
+ HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $6;$7 = +HEAPF64[tempDoublePtr>>3];
+ return (+$7);
+}
+function _copysignl($x,$y) {
+ $x = +$x;
+ $y = +$y;
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_copysign($x,$y));
+ return (+$0);
+}
+function _fmod($x,$y) {
+ $x = +$x;
+ $y = +$y;
+ var $$0 = 0.0, $$lcssa7 = 0, $$x = 0.0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0;
+ var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0;
+ var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0;
+ var $15 = 0, $150 = 0.0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0;
+ var $ex$0$lcssa = 0, $ex$026 = 0, $ex$1 = 0, $ex$2$lcssa = 0, $ex$212 = 0, $ex$3$lcssa = 0, $ex$39 = 0, $ey$0$lcssa = 0, $ey$020 = 0, $ey$1$ph = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0;
+ $1 = HEAP32[tempDoublePtr+4>>2]|0;
+ HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0;
+ $3 = HEAP32[tempDoublePtr+4>>2]|0;
+ $4 = (_bitshift64Lshr(($0|0),($1|0),52)|0);
+ $5 = tempRet0;
+ $6 = $4 & 2047;
+ $7 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
+ $8 = tempRet0;
+ $9 = $7 & 2047;
+ $10 = $1 & -2147483648;
+ $11 = (_bitshift64Shl(($2|0),($3|0),1)|0);
+ $12 = tempRet0;
+ $13 = ($11|0)==(0);
+ $14 = ($12|0)==(0);
+ $15 = $13 & $14;
+ L1: do {
+ if ($15) {
+ label = 3;
+ } else {
+ $16 = $3 & 2147483647;
+ $17 = ($16>>>0)>(2146435072);
+ $18 = ($2>>>0)>(0);
+ $19 = ($16|0)==(2146435072);
+ $20 = $19 & $18;
+ $21 = $17 | $20;
+ $22 = ($6|0)==(2047);
+ $or$cond = $21 | $22;
+ if ($or$cond) {
+ label = 3;
+ } else {
+ $25 = (_bitshift64Shl(($0|0),($1|0),1)|0);
+ $26 = tempRet0;
+ $27 = ($26>>>0)>($12>>>0);
+ $28 = ($25>>>0)>($11>>>0);
+ $29 = ($26|0)==($12|0);
+ $30 = $29 & $28;
+ $31 = $27 | $30;
+ if (!($31)) {
+ $32 = ($25|0)==($11|0);
+ $33 = ($26|0)==($12|0);
+ $34 = $32 & $33;
+ $35 = $x * 0.0;
+ $$x = $34 ? $35 : $x;
+ return (+$$x);
+ }
+ $36 = ($6|0)==(0);
+ if ($36) {
+ $37 = (_bitshift64Shl(($0|0),($1|0),12)|0);
+ $38 = tempRet0;
+ $39 = ($38|0)>(-1);
+ $40 = ($37>>>0)>(4294967295);
+ $41 = ($38|0)==(-1);
+ $42 = $41 & $40;
+ $43 = $39 | $42;
+ if ($43) {
+ $45 = $37;$46 = $38;$ex$026 = 0;
+ while(1) {
+ $44 = (($ex$026) + -1)|0;
+ $47 = (_bitshift64Shl(($45|0),($46|0),1)|0);
+ $48 = tempRet0;
+ $49 = ($48|0)>(-1);
+ $50 = ($47>>>0)>(4294967295);
+ $51 = ($48|0)==(-1);
+ $52 = $51 & $50;
+ $53 = $49 | $52;
+ if ($53) {
+ $45 = $47;$46 = $48;$ex$026 = $44;
+ } else {
+ $ex$0$lcssa = $44;
+ break;
+ }
+ }
+ } else {
+ $ex$0$lcssa = 0;
+ }
+ $54 = (1 - ($ex$0$lcssa))|0;
+ $55 = (_bitshift64Shl(($0|0),($1|0),($54|0))|0);
+ $56 = tempRet0;
+ $83 = $55;$84 = $56;$ex$1 = $ex$0$lcssa;
+ } else {
+ $57 = $1 & 1048575;
+ $58 = $57 | 1048576;
+ $83 = $0;$84 = $58;$ex$1 = $6;
+ }
+ $59 = ($9|0)==(0);
+ if ($59) {
+ $60 = (_bitshift64Shl(($2|0),($3|0),12)|0);
+ $61 = tempRet0;
+ $62 = ($61|0)>(-1);
+ $63 = ($60>>>0)>(4294967295);
+ $64 = ($61|0)==(-1);
+ $65 = $64 & $63;
+ $66 = $62 | $65;
+ if ($66) {
+ $68 = $60;$69 = $61;$ey$020 = 0;
+ while(1) {
+ $67 = (($ey$020) + -1)|0;
+ $70 = (_bitshift64Shl(($68|0),($69|0),1)|0);
+ $71 = tempRet0;
+ $72 = ($71|0)>(-1);
+ $73 = ($70>>>0)>(4294967295);
+ $74 = ($71|0)==(-1);
+ $75 = $74 & $73;
+ $76 = $72 | $75;
+ if ($76) {
+ $68 = $70;$69 = $71;$ey$020 = $67;
+ } else {
+ $ey$0$lcssa = $67;
+ break;
+ }
+ }
+ } else {
+ $ey$0$lcssa = 0;
+ }
+ $77 = (1 - ($ey$0$lcssa))|0;
+ $78 = (_bitshift64Shl(($2|0),($3|0),($77|0))|0);
+ $79 = tempRet0;
+ $85 = $78;$86 = $79;$ey$1$ph = $ey$0$lcssa;
+ } else {
+ $80 = $3 & 1048575;
+ $81 = $80 | 1048576;
+ $85 = $2;$86 = $81;$ey$1$ph = $9;
+ }
+ $82 = ($ex$1|0)>($ey$1$ph|0);
+ $87 = (_i64Subtract(($83|0),($84|0),($85|0),($86|0))|0);
+ $88 = tempRet0;
+ $89 = ($88|0)>(-1);
+ $90 = ($87>>>0)>(4294967295);
+ $91 = ($88|0)==(-1);
+ $92 = $91 & $90;
+ $93 = $89 | $92;
+ L23: do {
+ if ($82) {
+ $152 = $93;$153 = $87;$154 = $88;$94 = $83;$96 = $84;$ex$212 = $ex$1;
+ while(1) {
+ if ($152) {
+ $95 = ($94|0)==($85|0);
+ $97 = ($96|0)==($86|0);
+ $98 = $95 & $97;
+ if ($98) {
+ break;
+ } else {
+ $100 = $153;$101 = $154;
+ }
+ } else {
+ $100 = $94;$101 = $96;
+ }
+ $102 = (_bitshift64Shl(($100|0),($101|0),1)|0);
+ $103 = tempRet0;
+ $104 = (($ex$212) + -1)|0;
+ $105 = ($104|0)>($ey$1$ph|0);
+ $106 = (_i64Subtract(($102|0),($103|0),($85|0),($86|0))|0);
+ $107 = tempRet0;
+ $108 = ($107|0)>(-1);
+ $109 = ($106>>>0)>(4294967295);
+ $110 = ($107|0)==(-1);
+ $111 = $110 & $109;
+ $112 = $108 | $111;
+ if ($105) {
+ $152 = $112;$153 = $106;$154 = $107;$94 = $102;$96 = $103;$ex$212 = $104;
+ } else {
+ $$lcssa7 = $112;$113 = $102;$115 = $103;$155 = $106;$156 = $107;$ex$2$lcssa = $104;
+ break L23;
+ }
+ }
+ $99 = $x * 0.0;
+ $$0 = $99;
+ break L1;
+ } else {
+ $$lcssa7 = $93;$113 = $83;$115 = $84;$155 = $87;$156 = $88;$ex$2$lcssa = $ex$1;
+ }
+ } while(0);
+ if ($$lcssa7) {
+ $114 = ($113|0)==($85|0);
+ $116 = ($115|0)==($86|0);
+ $117 = $114 & $116;
+ if ($117) {
+ $125 = $x * 0.0;
+ $$0 = $125;
+ break;
+ } else {
+ $118 = $156;$120 = $155;
+ }
+ } else {
+ $118 = $115;$120 = $113;
+ }
+ $119 = ($118>>>0)<(1048576);
+ $121 = ($120>>>0)<(0);
+ $122 = ($118|0)==(1048576);
+ $123 = $122 & $121;
+ $124 = $119 | $123;
+ if ($124) {
+ $126 = $120;$127 = $118;$ex$39 = $ex$2$lcssa;
+ while(1) {
+ $128 = (_bitshift64Shl(($126|0),($127|0),1)|0);
+ $129 = tempRet0;
+ $130 = (($ex$39) + -1)|0;
+ $131 = ($129>>>0)<(1048576);
+ $132 = ($128>>>0)<(0);
+ $133 = ($129|0)==(1048576);
+ $134 = $133 & $132;
+ $135 = $131 | $134;
+ if ($135) {
+ $126 = $128;$127 = $129;$ex$39 = $130;
+ } else {
+ $137 = $128;$138 = $129;$ex$3$lcssa = $130;
+ break;
+ }
+ }
+ } else {
+ $137 = $120;$138 = $118;$ex$3$lcssa = $ex$2$lcssa;
+ }
+ $136 = ($ex$3$lcssa|0)>(0);
+ if ($136) {
+ $139 = (_i64Add(($137|0),($138|0),0,-1048576)|0);
+ $140 = tempRet0;
+ $141 = (_bitshift64Shl(($ex$3$lcssa|0),0,52)|0);
+ $142 = tempRet0;
+ $143 = $139 | $141;
+ $144 = $140 | $142;
+ $149 = $144;$151 = $143;
+ } else {
+ $145 = (1 - ($ex$3$lcssa))|0;
+ $146 = (_bitshift64Lshr(($137|0),($138|0),($145|0))|0);
+ $147 = tempRet0;
+ $149 = $147;$151 = $146;
+ }
+ $148 = $149 | $10;
+ HEAP32[tempDoublePtr>>2] = $151;HEAP32[tempDoublePtr+4>>2] = $148;$150 = +HEAPF64[tempDoublePtr>>3];
+ $$0 = $150;
+ }
+ }
+ } while(0);
+ if ((label|0) == 3) {
+ $23 = $x * $y;
+ $24 = $23 / $23;
+ $$0 = $24;
+ }
+ return (+$$0);
+}
+function _fmodl($x,$y) {
+ $x = +$x;
+ $y = +$y;
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_fmod($x,$y));
+ return (+$0);
+}
+function _frexp($x,$e) {
+ $x = +$x;
+ $e = $e|0;
+ var $$0 = 0.0, $$01 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $storemerge = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0;
+ $1 = HEAP32[tempDoublePtr+4>>2]|0;
+ $2 = (_bitshift64Lshr(($0|0),($1|0),52)|0);
+ $3 = tempRet0;
+ $4 = $2 & 2047;
+ switch ($4|0) {
+ case 0: {
+ $5 = $x != 0.0;
+ if ($5) {
+ $6 = $x * 1.8446744073709552E+19;
+ $7 = (+_frexp($6,$e));
+ $8 = HEAP32[$e>>2]|0;
+ $9 = (($8) + -64)|0;
+ $$01 = $7;$storemerge = $9;
+ } else {
+ $$01 = $x;$storemerge = 0;
+ }
+ HEAP32[$e>>2] = $storemerge;
+ $$0 = $$01;
+ break;
+ }
+ case 2047: {
+ $$0 = $x;
+ break;
+ }
+ default: {
+ $10 = (($4) + -1022)|0;
+ HEAP32[$e>>2] = $10;
+ $11 = $1 & -2146435073;
+ $12 = $11 | 1071644672;
+ HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $12;$13 = +HEAPF64[tempDoublePtr>>3];
+ $$0 = $13;
+ }
+ }
+ return (+$$0);
+}
+function _frexpl($x,$e) {
+ $x = +$x;
+ $e = $e|0;
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_frexp($x,$e));
+ return (+$0);
+}
+function _roundf($x) {
+ $x = +$x;
+ var $$0 = 0.0, $$x = 0.0, $$y$0 = 0.0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0;
+ var $9 = 0.0, $y$0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (HEAPF32[tempDoublePtr>>2]=$x,HEAP32[tempDoublePtr>>2]|0);
+ $1 = $0 >>> 23;
+ $2 = $1 & 255;
+ $3 = ($2>>>0)>(149);
+ do {
+ if ($3) {
+ $$0 = $x;
+ } else {
+ $4 = ($0|0)<(0);
+ $5 = -$x;
+ $$x = $4 ? $5 : $x;
+ $6 = ($2>>>0)<(126);
+ if ($6) {
+ $7 = $x * 0.0;
+ $$0 = $7;
+ break;
+ }
+ $8 = $$x + 8388608.0;
+ $9 = $8 + -8388608.0;
+ $10 = $9 - $$x;
+ $11 = $10 > 0.5;
+ if ($11) {
+ $12 = $$x + $10;
+ $13 = $12 + -1.0;
+ $y$0 = $13;
+ } else {
+ $14 = !($10 <= -0.5);
+ $15 = $$x + $10;
+ if ($14) {
+ $y$0 = $15;
+ } else {
+ $16 = $15 + 1.0;
+ $y$0 = $16;
+ }
+ }
+ $17 = -$y$0;
+ $$y$0 = $4 ? $17 : $y$0;
+ $$0 = $$y$0;
+ }
+ } while(0);
+ return (+$$0);
+}
+function _scalbn($x,$n) {
+ $x = +$x;
+ $n = $n|0;
+ var $$ = 0, $$0 = 0, $$1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0.0, $9 = 0, $y$0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($n|0)>(1023);
+ if ($0) {
+ $1 = $x * 8.9884656743115795E+307;
+ $2 = (($n) + -1023)|0;
+ $3 = ($2|0)>(1023);
+ if ($3) {
+ $4 = $1 * 8.9884656743115795E+307;
+ $5 = (($n) + -2046)|0;
+ $6 = ($5|0)>(1023);
+ $$ = $6 ? 1023 : $5;
+ $$0 = $$;$y$0 = $4;
+ } else {
+ $$0 = $2;$y$0 = $1;
+ }
+ } else {
+ $7 = ($n|0)<(-1022);
+ if ($7) {
+ $8 = $x * 2.2250738585072014E-308;
+ $9 = (($n) + 1022)|0;
+ $10 = ($9|0)<(-1022);
+ if ($10) {
+ $11 = $8 * 2.2250738585072014E-308;
+ $12 = (($n) + 2044)|0;
+ $13 = ($12|0)<(-1022);
+ $$1 = $13 ? -1022 : $12;
+ $$0 = $$1;$y$0 = $11;
+ } else {
+ $$0 = $9;$y$0 = $8;
+ }
+ } else {
+ $$0 = $n;$y$0 = $x;
+ }
+ }
+ $14 = (($$0) + 1023)|0;
+ $15 = (_bitshift64Shl(($14|0),0,52)|0);
+ $16 = tempRet0;
+ HEAP32[tempDoublePtr>>2] = $15;HEAP32[tempDoublePtr+4>>2] = $16;$17 = +HEAPF64[tempDoublePtr>>3];
+ $18 = $y$0 * $17;
+ return (+$18);
+}
+function _scalbnl($x,$n) {
+ $x = +$x;
+ $n = $n|0;
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_scalbn($x,$n));
+ return (+$0);
+}
+function _mbrtowc($wc,$src,$n,$st) {
+ $wc = $wc|0;
+ $src = $src|0;
+ $n = $n|0;
+ $st = $st|0;
+ var $$0 = 0, $$024 = 0, $$1 = 0, $$lcssa = 0, $$lcssa35 = 0, $$st = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$05 = 0, $c$1 = 0, $c$2 = 0, $dummy = 0, $dummy$wc = 0, $s$06 = 0, $s$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $dummy = sp;
+ $0 = ($st|0)==(0|0);
+ $$st = $0 ? 6720 : $st;
+ $1 = HEAP32[$$st>>2]|0;
+ $2 = ($src|0)==(0|0);
+ L1: do {
+ if ($2) {
+ $3 = ($1|0)==(0);
+ if ($3) {
+ $$0 = 0;
+ } else {
+ label = 15;
+ }
+ } else {
+ $4 = ($wc|0)==(0|0);
+ $dummy$wc = $4 ? $dummy : $wc;
+ $5 = ($n|0)==(0);
+ if ($5) {
+ $$0 = -2;
+ } else {
+ $6 = ($1|0)==(0);
+ if ($6) {
+ $7 = HEAP8[$src>>0]|0;
+ $8 = $7&255;
+ $9 = ($7<<24>>24)>(-1);
+ if ($9) {
+ HEAP32[$dummy$wc>>2] = $8;
+ $10 = ($7<<24>>24)!=(0);
+ $11 = $10&1;
+ $$0 = $11;
+ break;
+ }
+ $12 = (($8) + -194)|0;
+ $13 = ($12>>>0)>(50);
+ if ($13) {
+ label = 15;
+ break;
+ }
+ $14 = ((($src)) + 1|0);
+ $15 = (6472 + ($12<<2)|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = (($n) + -1)|0;
+ $18 = ($17|0)==(0);
+ if ($18) {
+ $c$2 = $16;
+ } else {
+ $$024 = $17;$c$05 = $16;$s$06 = $14;
+ label = 9;
+ }
+ } else {
+ $$024 = $n;$c$05 = $1;$s$06 = $src;
+ label = 9;
+ }
+ L11: do {
+ if ((label|0) == 9) {
+ $19 = HEAP8[$s$06>>0]|0;
+ $20 = $19&255;
+ $21 = $20 >>> 3;
+ $22 = (($21) + -16)|0;
+ $23 = $c$05 >> 26;
+ $24 = (($21) + ($23))|0;
+ $25 = $22 | $24;
+ $26 = ($25>>>0)>(7);
+ if ($26) {
+ label = 15;
+ break L1;
+ } else {
+ $$1 = $$024;$30 = $19;$c$1 = $c$05;$s$1 = $s$06;
+ }
+ while(1) {
+ $27 = $c$1 << 6;
+ $28 = ((($s$1)) + 1|0);
+ $29 = $30&255;
+ $31 = (($29) + -128)|0;
+ $32 = $31 | $27;
+ $33 = (($$1) + -1)|0;
+ $34 = ($32|0)<(0);
+ if (!($34)) {
+ $$lcssa = $32;$$lcssa35 = $33;
+ break;
+ }
+ $36 = ($33|0)==(0);
+ if ($36) {
+ $c$2 = $32;
+ break L11;
+ }
+ $37 = HEAP8[$28>>0]|0;
+ $38 = $37 & -64;
+ $39 = ($38<<24>>24)==(-128);
+ if ($39) {
+ $$1 = $33;$30 = $37;$c$1 = $32;$s$1 = $28;
+ } else {
+ label = 15;
+ break L1;
+ }
+ }
+ HEAP32[$$st>>2] = 0;
+ HEAP32[$dummy$wc>>2] = $$lcssa;
+ $35 = (($n) - ($$lcssa35))|0;
+ $$0 = $35;
+ break L1;
+ }
+ } while(0);
+ HEAP32[$$st>>2] = $c$2;
+ $$0 = -2;
+ }
+ }
+ } while(0);
+ if ((label|0) == 15) {
+ HEAP32[$$st>>2] = 0;
+ $40 = (___errno_location()|0);
+ HEAP32[$40>>2] = 84;
+ $$0 = -1;
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _mbsinit($st) {
+ $st = $st|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($st|0)==(0|0);
+ if ($0) {
+ $4 = 1;
+ } else {
+ $1 = HEAP32[$st>>2]|0;
+ $2 = ($1|0)==(0);
+ $4 = $2;
+ }
+ $3 = $4&1;
+ return ($3|0);
+}
+function _wcrtomb($s,$wc,$st) {
+ $s = $s|0;
+ $wc = $wc|0;
+ $st = $st|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($s|0)==(0|0);
+ do {
+ if ($0) {
+ $$0 = 1;
+ } else {
+ $1 = ($wc>>>0)<(128);
+ if ($1) {
+ $2 = $wc&255;
+ HEAP8[$s>>0] = $2;
+ $$0 = 1;
+ break;
+ }
+ $3 = ($wc>>>0)<(2048);
+ if ($3) {
+ $4 = $wc >>> 6;
+ $5 = $4 | 192;
+ $6 = $5&255;
+ $7 = ((($s)) + 1|0);
+ HEAP8[$s>>0] = $6;
+ $8 = $wc & 63;
+ $9 = $8 | 128;
+ $10 = $9&255;
+ HEAP8[$7>>0] = $10;
+ $$0 = 2;
+ break;
+ }
+ $11 = ($wc>>>0)<(55296);
+ $12 = $wc & -8192;
+ $13 = ($12|0)==(57344);
+ $or$cond = $11 | $13;
+ if ($or$cond) {
+ $14 = $wc >>> 12;
+ $15 = $14 | 224;
+ $16 = $15&255;
+ $17 = ((($s)) + 1|0);
+ HEAP8[$s>>0] = $16;
+ $18 = $wc >>> 6;
+ $19 = $18 & 63;
+ $20 = $19 | 128;
+ $21 = $20&255;
+ $22 = ((($s)) + 2|0);
+ HEAP8[$17>>0] = $21;
+ $23 = $wc & 63;
+ $24 = $23 | 128;
+ $25 = $24&255;
+ HEAP8[$22>>0] = $25;
+ $$0 = 3;
+ break;
+ }
+ $26 = (($wc) + -65536)|0;
+ $27 = ($26>>>0)<(1048576);
+ if ($27) {
+ $28 = $wc >>> 18;
+ $29 = $28 | 240;
+ $30 = $29&255;
+ $31 = ((($s)) + 1|0);
+ HEAP8[$s>>0] = $30;
+ $32 = $wc >>> 12;
+ $33 = $32 & 63;
+ $34 = $33 | 128;
+ $35 = $34&255;
+ $36 = ((($s)) + 2|0);
+ HEAP8[$31>>0] = $35;
+ $37 = $wc >>> 6;
+ $38 = $37 & 63;
+ $39 = $38 | 128;
+ $40 = $39&255;
+ $41 = ((($s)) + 3|0);
+ HEAP8[$36>>0] = $40;
+ $42 = $wc & 63;
+ $43 = $42 | 128;
+ $44 = $43&255;
+ HEAP8[$41>>0] = $44;
+ $$0 = 4;
+ break;
+ } else {
+ $45 = (___errno_location()|0);
+ HEAP32[$45>>2] = 84;
+ $$0 = -1;
+ break;
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _wctomb($s,$wc) {
+ $s = $s|0;
+ $wc = $wc|0;
+ var $$0 = 0, $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($s|0)==(0|0);
+ if ($0) {
+ $$0 = 0;
+ } else {
+ $1 = (_wcrtomb($s,$wc,0)|0);
+ $$0 = $1;
+ }
+ return ($$0|0);
+}
+function _srand($s) {
+ $s = $s|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (($s) + -1)|0;
+ $1 = 144;
+ $2 = $1;
+ HEAP32[$2>>2] = $0;
+ $3 = (($1) + 4)|0;
+ $4 = $3;
+ HEAP32[$4>>2] = 0;
+ return;
+}
+function _fclose($f) {
+ $f = $f|0;
+ var $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 76|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)>(-1);
+ if ($2) {
+ (___lockfile($f)|0);
+ }
+ $3 = HEAP32[$f>>2]|0;
+ $4 = $3 & 1;
+ $5 = ($4|0)!=(0);
+ if (!($5)) {
+ ___lock(((6456)|0));
+ $6 = ((($f)) + 52|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)==(0|0);
+ $9 = $7;
+ $$pre = ((($f)) + 56|0);
+ if (!($8)) {
+ $10 = HEAP32[$$pre>>2]|0;
+ $11 = ((($7)) + 56|0);
+ HEAP32[$11>>2] = $10;
+ }
+ $12 = HEAP32[$$pre>>2]|0;
+ $13 = ($12|0)==(0|0);
+ $14 = $12;
+ if (!($13)) {
+ $15 = ((($12)) + 52|0);
+ HEAP32[$15>>2] = $9;
+ }
+ $16 = HEAP32[(6452)>>2]|0;
+ $17 = ($16|0)==($f|0);
+ if ($17) {
+ HEAP32[(6452)>>2] = $14;
+ }
+ ___unlock(((6456)|0));
+ }
+ $18 = (_fflush($f)|0);
+ $19 = ((($f)) + 12|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = (FUNCTION_TABLE_ii[$20 & 15]($f)|0);
+ $22 = $21 | $18;
+ $23 = ((($f)) + 92|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = ($24|0)==(0|0);
+ if (!($25)) {
+ _free($24);
+ }
+ if (!($5)) {
+ _free($f);
+ }
+ return ($22|0);
+}
+function _feof($f) {
+ $f = $f|0;
+ var $$lobit = 0, $$lobit1 = 0, $$lobit2 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 76|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)>(-1);
+ if ($2) {
+ $5 = (___lockfile($f)|0);
+ $phitmp = ($5|0)==(0);
+ $6 = HEAP32[$f>>2]|0;
+ $7 = $6 >>> 4;
+ $$lobit = $7 & 1;
+ if ($phitmp) {
+ $$lobit2 = $$lobit;
+ } else {
+ ___unlockfile($f);
+ $$lobit2 = $$lobit;
+ }
+ } else {
+ $3 = HEAP32[$f>>2]|0;
+ $4 = $3 >>> 4;
+ $$lobit1 = $4 & 1;
+ $$lobit2 = $$lobit1;
+ }
+ return ($$lobit2|0);
+}
+function _fflush($f) {
+ $f = $f|0;
+ var $$0 = 0, $$01 = 0, $$012 = 0, $$014 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, $r$0$lcssa = 0, $r$03 = 0, $r$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($f|0)==(0|0);
+ do {
+ if ($0) {
+ $7 = HEAP32[6680>>2]|0;
+ $8 = ($7|0)==(0|0);
+ if ($8) {
+ $27 = 0;
+ } else {
+ $9 = HEAP32[6680>>2]|0;
+ $10 = (_fflush($9)|0);
+ $27 = $10;
+ }
+ ___lock(((6456)|0));
+ $$012 = HEAP32[(6452)>>2]|0;
+ $11 = ($$012|0)==(0|0);
+ if ($11) {
+ $r$0$lcssa = $27;
+ } else {
+ $$014 = $$012;$r$03 = $27;
+ while(1) {
+ $12 = ((($$014)) + 76|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($13|0)>(-1);
+ if ($14) {
+ $15 = (___lockfile($$014)|0);
+ $23 = $15;
+ } else {
+ $23 = 0;
+ }
+ $16 = ((($$014)) + 20|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ((($$014)) + 28|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = ($17>>>0)>($19>>>0);
+ if ($20) {
+ $21 = (___fflush_unlocked($$014)|0);
+ $22 = $21 | $r$03;
+ $r$1 = $22;
+ } else {
+ $r$1 = $r$03;
+ }
+ $24 = ($23|0)==(0);
+ if (!($24)) {
+ ___unlockfile($$014);
+ }
+ $25 = ((($$014)) + 56|0);
+ $$01 = HEAP32[$25>>2]|0;
+ $26 = ($$01|0)==(0|0);
+ if ($26) {
+ $r$0$lcssa = $r$1;
+ break;
+ } else {
+ $$014 = $$01;$r$03 = $r$1;
+ }
+ }
+ }
+ ___unlock(((6456)|0));
+ $$0 = $r$0$lcssa;
+ } else {
+ $1 = ((($f)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if (!($3)) {
+ $4 = (___fflush_unlocked($f)|0);
+ $$0 = $4;
+ break;
+ }
+ $5 = (___lockfile($f)|0);
+ $phitmp = ($5|0)==(0);
+ $6 = (___fflush_unlocked($f)|0);
+ if ($phitmp) {
+ $$0 = $6;
+ } else {
+ ___unlockfile($f);
+ $$0 = $6;
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _fgets($s,$n,$f) {
+ $s = $s|0;
+ $n = $n|0;
+ $f = $f|0;
+ var $$0 = 0, $$048 = 0, $$05 = 0, $$lcssa14 = 0, $$old2 = 0, $$pre = 0, $$sum$pre$phiZZ2D = 0, $$sum6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
+ var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, $or$cond = 0, $or$cond3 = 0, $p$0 = 0, $p$1 = 0, $sext$mask = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 76|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)>(-1);
+ if ($2) {
+ $3 = (___lockfile($f)|0);
+ $12 = $3;
+ } else {
+ $12 = 0;
+ }
+ $4 = (($n) + -1)|0;
+ $5 = ($n|0)<(2);
+ if ($5) {
+ $6 = ((($f)) + 74|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = $7 << 24 >> 24;
+ $9 = (($8) + 255)|0;
+ $10 = $9 | $8;
+ $11 = $10&255;
+ HEAP8[$6>>0] = $11;
+ $13 = ($12|0)==(0);
+ if (!($13)) {
+ ___unlockfile($f);
+ }
+ $14 = ($4|0)==(0);
+ if ($14) {
+ HEAP8[$s>>0] = 0;
+ $$0 = $s;
+ } else {
+ $$0 = 0;
+ }
+ } else {
+ $$old2 = ($4|0)==(0);
+ L11: do {
+ if ($$old2) {
+ $p$1 = $s;
+ label = 18;
+ } else {
+ $15 = ((($f)) + 4|0);
+ $16 = ((($f)) + 8|0);
+ $$05 = $4;$p$0 = $s;
+ while(1) {
+ $17 = HEAP32[$15>>2]|0;
+ $18 = HEAP32[$16>>2]|0;
+ $19 = $18;
+ $20 = $17;
+ $21 = (($19) - ($20))|0;
+ $22 = (_memchr($17,10,$21)|0);
+ $23 = ($22|0)==(0|0);
+ $24 = $22;
+ $25 = (1 - ($20))|0;
+ $26 = (($25) + ($24))|0;
+ $27 = $23 ? $21 : $26;
+ $28 = ($27>>>0)<($$05>>>0);
+ $29 = $28 ? $27 : $$05;
+ _memcpy(($p$0|0),($17|0),($29|0))|0;
+ $30 = HEAP32[$15>>2]|0;
+ $31 = (($30) + ($29)|0);
+ HEAP32[$15>>2] = $31;
+ $32 = (($p$0) + ($29)|0);
+ $33 = (($$05) - ($29))|0;
+ $or$cond = $23 & $28;
+ if (!($or$cond)) {
+ $p$1 = $32;
+ label = 18;
+ break L11;
+ }
+ $34 = HEAP32[$16>>2]|0;
+ $35 = ($31>>>0)<($34>>>0);
+ if ($35) {
+ $$sum6 = (($29) + 1)|0;
+ $36 = (($30) + ($$sum6)|0);
+ HEAP32[$15>>2] = $36;
+ $37 = HEAP8[$31>>0]|0;
+ $38 = $37&255;
+ $$sum$pre$phiZZ2D = $$sum6;$47 = $38;
+ } else {
+ $39 = (___uflow($f)|0);
+ $40 = ($39|0)<(0);
+ if ($40) {
+ $$lcssa14 = $32;
+ break;
+ }
+ $$pre = (($29) + 1)|0;
+ $$sum$pre$phiZZ2D = $$pre;$47 = $39;
+ }
+ $45 = (($33) + -1)|0;
+ $46 = $47&255;
+ $48 = (($p$0) + ($$sum$pre$phiZZ2D)|0);
+ HEAP8[$32>>0] = $46;
+ $sext$mask = $47 & 255;
+ $49 = ($sext$mask|0)!=(10);
+ $50 = ($45|0)!=(0);
+ $or$cond3 = $50 & $49;
+ if ($or$cond3) {
+ $$05 = $45;$p$0 = $48;
+ } else {
+ $p$1 = $48;
+ label = 18;
+ break L11;
+ }
+ }
+ $41 = ($$lcssa14|0)==($s|0);
+ if ($41) {
+ $$048 = 0;
+ } else {
+ $42 = HEAP32[$f>>2]|0;
+ $43 = $42 & 16;
+ $44 = ($43|0)==(0);
+ if ($44) {
+ $$048 = 0;
+ } else {
+ $p$1 = $$lcssa14;
+ label = 18;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 18) {
+ $51 = ($s|0)==(0|0);
+ if ($51) {
+ $$048 = 0;
+ } else {
+ HEAP8[$p$1>>0] = 0;
+ $$048 = $s;
+ }
+ }
+ $52 = ($12|0)==(0);
+ if ($52) {
+ $$0 = $$048;
+ } else {
+ ___unlockfile($f);
+ $$0 = $$048;
+ }
+ }
+ return ($$0|0);
+}
+function _fopen($filename,$mode) {
+ $filename = $filename|0;
+ $mode = $mode|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $0 = HEAP8[$mode>>0]|0;
+ $1 = $0 << 24 >> 24;
+ $memchr = (_memchr(22738,$1,4)|0);
+ $2 = ($memchr|0)==(0|0);
+ if ($2) {
+ $3 = (___errno_location()|0);
+ HEAP32[$3>>2] = 22;
+ $$0 = 0;
+ } else {
+ $4 = (___fmodeflags($mode)|0);
+ $5 = $4 | 32768;
+ HEAP32[$vararg_buffer>>2] = $filename;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $5;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 438;
+ $6 = (___syscall5(5,($vararg_buffer|0))|0);
+ $7 = (___syscall_ret($6)|0);
+ $8 = ($7|0)<(0);
+ if ($8) {
+ $$0 = 0;
+ } else {
+ $9 = (___fdopen($7,$mode)|0);
+ $10 = ($9|0)==(0|0);
+ if ($10) {
+ HEAP32[$vararg_buffer3>>2] = $7;
+ (___syscall6(6,($vararg_buffer3|0))|0);
+ $$0 = 0;
+ } else {
+ $$0 = $9;
+ }
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _fputc($c,$f) {
+ $c = $c|0;
+ $f = $f|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 76|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)<(0);
+ if ($2) {
+ label = 3;
+ } else {
+ $3 = (___lockfile($f)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ label = 3;
+ } else {
+ $18 = ((($f)) + 75|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = $19 << 24 >> 24;
+ $21 = ($20|0)==($c|0);
+ if ($21) {
+ label = 10;
+ } else {
+ $22 = ((($f)) + 20|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = ((($f)) + 16|0);
+ $25 = HEAP32[$24>>2]|0;
+ $26 = ($23>>>0)<($25>>>0);
+ if ($26) {
+ $27 = $c&255;
+ $28 = ((($23)) + 1|0);
+ HEAP32[$22>>2] = $28;
+ HEAP8[$23>>0] = $27;
+ $29 = $c & 255;
+ $31 = $29;
+ } else {
+ label = 10;
+ }
+ }
+ if ((label|0) == 10) {
+ $30 = (___overflow($f,$c)|0);
+ $31 = $30;
+ }
+ ___unlockfile($f);
+ $$0 = $31;
+ }
+ }
+ do {
+ if ((label|0) == 3) {
+ $5 = ((($f)) + 75|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6 << 24 >> 24;
+ $8 = ($7|0)==($c|0);
+ if (!($8)) {
+ $9 = ((($f)) + 20|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($f)) + 16|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ($10>>>0)<($12>>>0);
+ if ($13) {
+ $14 = $c&255;
+ $15 = ((($10)) + 1|0);
+ HEAP32[$9>>2] = $15;
+ HEAP8[$10>>0] = $14;
+ $16 = $c & 255;
+ $$0 = $16;
+ break;
+ }
+ }
+ $17 = (___overflow($f,$c)|0);
+ $$0 = $17;
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _fread($destv,$size,$nmemb,$f) {
+ $destv = $destv|0;
+ $size = $size|0;
+ $nmemb = $nmemb|0;
+ $f = $f|0;
+ var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, $dest$0$ph = 0, $dest$02 = 0, $l$0$ph = 0, $l$03 = 0, $l$03$lcssa = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = Math_imul($nmemb, $size)|0;
+ $1 = ((($f)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $4 = (___lockfile($f)|0);
+ $31 = $4;
+ } else {
+ $31 = 0;
+ }
+ $5 = ((($f)) + 74|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6 << 24 >> 24;
+ $8 = (($7) + 255)|0;
+ $9 = $8 | $7;
+ $10 = $9&255;
+ HEAP8[$5>>0] = $10;
+ $11 = ((($f)) + 8|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ((($f)) + 4|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = $12;
+ $16 = $14;
+ $17 = (($15) - ($16))|0;
+ $18 = ($17|0)>(0);
+ if ($18) {
+ $19 = ($17>>>0)<($0>>>0);
+ $$ = $19 ? $17 : $0;
+ _memcpy(($destv|0),($14|0),($$|0))|0;
+ $20 = (($14) + ($$)|0);
+ HEAP32[$13>>2] = $20;
+ $21 = (($destv) + ($$)|0);
+ $22 = (($0) - ($$))|0;
+ $dest$0$ph = $21;$l$0$ph = $22;
+ } else {
+ $dest$0$ph = $destv;$l$0$ph = $0;
+ }
+ $23 = ($l$0$ph|0)==(0);
+ L7: do {
+ if ($23) {
+ label = 13;
+ } else {
+ $24 = ((($f)) + 32|0);
+ $dest$02 = $dest$0$ph;$l$03 = $l$0$ph;
+ while(1) {
+ $25 = (___toread($f)|0);
+ $26 = ($25|0)==(0);
+ if (!($26)) {
+ $l$03$lcssa = $l$03;
+ break;
+ }
+ $27 = HEAP32[$24>>2]|0;
+ $28 = (FUNCTION_TABLE_iiii[$27 & 15]($f,$dest$02,$l$03)|0);
+ $29 = (($28) + 1)|0;
+ $30 = ($29>>>0)<(2);
+ if ($30) {
+ $l$03$lcssa = $l$03;
+ break;
+ }
+ $35 = (($l$03) - ($28))|0;
+ $36 = (($dest$02) + ($28)|0);
+ $37 = ($l$03|0)==($28|0);
+ if ($37) {
+ label = 13;
+ break L7;
+ } else {
+ $dest$02 = $36;$l$03 = $35;
+ }
+ }
+ $32 = ($31|0)==(0);
+ if (!($32)) {
+ ___unlockfile($f);
+ }
+ $33 = (($0) - ($l$03$lcssa))|0;
+ $34 = (($33>>>0) / ($size>>>0))&-1;
+ $$0 = $34;
+ }
+ } while(0);
+ if ((label|0) == 13) {
+ $38 = ($31|0)==(0);
+ if ($38) {
+ $$0 = $nmemb;
+ } else {
+ ___unlockfile($f);
+ $$0 = $nmemb;
+ }
+ }
+ return ($$0|0);
+}
+function _fscanf($f,$fmt,$varargs) {
+ $f = $f|0;
+ $fmt = $fmt|0;
+ $varargs = $varargs|0;
+ var $0 = 0, $ap = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $ap = sp;
+ HEAP32[$ap>>2] = $varargs;
+ $0 = (_vfscanf($f,$fmt,$ap)|0);
+ STACKTOP = sp;return ($0|0);
+}
+function ___fseeko_unlocked($f,$off,$whence) {
+ $f = $f|0;
+ $off = $off|0;
+ $whence = $whence|0;
+ var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($whence|0)==(1);
+ if ($0) {
+ $1 = ((($f)) + 8|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($f)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $2;
+ $6 = $4;
+ $7 = (($off) - ($5))|0;
+ $8 = (($7) + ($6))|0;
+ $$01 = $8;
+ } else {
+ $$01 = $off;
+ }
+ $9 = ((($f)) + 20|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($f)) + 28|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ($10>>>0)>($12>>>0);
+ if ($13) {
+ $14 = ((($f)) + 36|0);
+ $15 = HEAP32[$14>>2]|0;
+ (FUNCTION_TABLE_iiii[$15 & 15]($f,0,0)|0);
+ $16 = HEAP32[$9>>2]|0;
+ $17 = ($16|0)==(0|0);
+ if ($17) {
+ $$0 = -1;
+ } else {
+ label = 5;
+ }
+ } else {
+ label = 5;
+ }
+ if ((label|0) == 5) {
+ $18 = ((($f)) + 16|0);
+ HEAP32[$18>>2] = 0;
+ HEAP32[$11>>2] = 0;
+ HEAP32[$9>>2] = 0;
+ $19 = ((($f)) + 40|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = (FUNCTION_TABLE_iiii[$20 & 15]($f,$$01,$whence)|0);
+ $22 = ($21|0)<(0);
+ if ($22) {
+ $$0 = -1;
+ } else {
+ $23 = ((($f)) + 8|0);
+ HEAP32[$23>>2] = 0;
+ $24 = ((($f)) + 4|0);
+ HEAP32[$24>>2] = 0;
+ $25 = HEAP32[$f>>2]|0;
+ $26 = $25 & -17;
+ HEAP32[$f>>2] = $26;
+ $$0 = 0;
+ }
+ }
+ return ($$0|0);
+}
+function ___fseeko($f,$off,$whence) {
+ $f = $f|0;
+ $off = $off|0;
+ $whence = $whence|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 76|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)>(-1);
+ if ($2) {
+ $4 = (___lockfile($f)|0);
+ $phitmp = ($4|0)==(0);
+ $5 = (___fseeko_unlocked($f,$off,$whence)|0);
+ if ($phitmp) {
+ $6 = $5;
+ } else {
+ ___unlockfile($f);
+ $6 = $5;
+ }
+ } else {
+ $3 = (___fseeko_unlocked($f,$off,$whence)|0);
+ $6 = $3;
+ }
+ return ($6|0);
+}
+function _fseek($f,$off,$whence) {
+ $f = $f|0;
+ $off = $off|0;
+ $whence = $whence|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (___fseeko($f,$off,$whence)|0);
+ return ($0|0);
+}
+function ___fwritex($s,$l,$f) {
+ $s = $s|0;
+ $l = $l|0;
+ $f = $f|0;
+ var $$0 = 0, $$01 = 0, $$02 = 0, $$pre = 0, $$pre6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
+ var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$lcssa10 = 0;
+ var $i$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if ($2) {
+ $3 = (___towrite($f)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $$pre = HEAP32[$0>>2]|0;
+ $7 = $$pre;
+ label = 4;
+ } else {
+ $$0 = 0;
+ }
+ } else {
+ $7 = $1;
+ label = 4;
+ }
+ L4: do {
+ if ((label|0) == 4) {
+ $5 = ((($f)) + 20|0);
+ $6 = HEAP32[$5>>2]|0;
+ $8 = $7;
+ $9 = $6;
+ $10 = (($8) - ($9))|0;
+ $11 = ($10>>>0)<($l>>>0);
+ if ($11) {
+ $12 = ((($f)) + 36|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (FUNCTION_TABLE_iiii[$13 & 15]($f,$s,$l)|0);
+ $$0 = $14;
+ break;
+ }
+ $15 = ((($f)) + 75|0);
+ $16 = HEAP8[$15>>0]|0;
+ $17 = ($16<<24>>24)>(-1);
+ L9: do {
+ if ($17) {
+ $i$0 = $l;
+ while(1) {
+ $18 = ($i$0|0)==(0);
+ if ($18) {
+ $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0;
+ break L9;
+ }
+ $19 = (($i$0) + -1)|0;
+ $20 = (($s) + ($19)|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)==(10);
+ if ($22) {
+ $i$0$lcssa10 = $i$0;
+ break;
+ } else {
+ $i$0 = $19;
+ }
+ }
+ $23 = ((($f)) + 36|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = (FUNCTION_TABLE_iiii[$24 & 15]($f,$s,$i$0$lcssa10)|0);
+ $26 = ($25>>>0)<($i$0$lcssa10>>>0);
+ if ($26) {
+ $$0 = $i$0$lcssa10;
+ break L4;
+ }
+ $27 = (($s) + ($i$0$lcssa10)|0);
+ $28 = (($l) - ($i$0$lcssa10))|0;
+ $$pre6 = HEAP32[$5>>2]|0;
+ $$01 = $28;$$02 = $27;$29 = $$pre6;$i$1 = $i$0$lcssa10;
+ } else {
+ $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0;
+ }
+ } while(0);
+ _memcpy(($29|0),($$02|0),($$01|0))|0;
+ $30 = HEAP32[$5>>2]|0;
+ $31 = (($30) + ($$01)|0);
+ HEAP32[$5>>2] = $31;
+ $32 = (($i$1) + ($$01))|0;
+ $$0 = $32;
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _fwrite($src,$size,$nmemb,$f) {
+ $src = $src|0;
+ $size = $size|0;
+ $nmemb = $nmemb|0;
+ $f = $f|0;
+ var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = Math_imul($nmemb, $size)|0;
+ $1 = ((($f)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $5 = (___lockfile($f)|0);
+ $phitmp = ($5|0)==(0);
+ $6 = (___fwritex($src,$0,$f)|0);
+ if ($phitmp) {
+ $7 = $6;
+ } else {
+ ___unlockfile($f);
+ $7 = $6;
+ }
+ } else {
+ $4 = (___fwritex($src,$0,$f)|0);
+ $7 = $4;
+ }
+ $8 = ($7|0)==($0|0);
+ if ($8) {
+ $10 = $nmemb;
+ } else {
+ $9 = (($7>>>0) / ($size>>>0))&-1;
+ $10 = $9;
+ }
+ return ($10|0);
+}
+function _rewind($f) {
+ $f = $f|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 76|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)>(-1);
+ if ($2) {
+ $3 = (___lockfile($f)|0);
+ $phitmp = ($3|0)==(0);
+ (___fseeko_unlocked($f,0,0)|0);
+ $4 = HEAP32[$f>>2]|0;
+ $5 = $4 & -33;
+ HEAP32[$f>>2] = $5;
+ if (!($phitmp)) {
+ ___unlockfile($f);
+ }
+ } else {
+ (___fseeko_unlocked($f,0,0)|0);
+ $6 = HEAP32[$f>>2]|0;
+ $7 = $6 & -33;
+ HEAP32[$f>>2] = $7;
+ }
+ return;
+}
+function _sprintf($s,$fmt,$varargs) {
+ $s = $s|0;
+ $fmt = $fmt|0;
+ $varargs = $varargs|0;
+ var $0 = 0, $ap = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $ap = sp;
+ HEAP32[$ap>>2] = $varargs;
+ $0 = (_vsprintf($s,$fmt,$ap)|0);
+ STACKTOP = sp;return ($0|0);
+}
+function _vfprintf($f,$fmt,$ap) {
+ $f = $f|0;
+ $fmt = $fmt|0;
+ $ap = $ap|0;
+ var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ap2 = 0, $internal_buf = 0, $nl_arg = 0, $nl_type = 0;
+ var $ret$1 = 0, $ret$1$ = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 224|0;
+ $ap2 = sp + 120|0;
+ $nl_type = sp + 80|0;
+ $nl_arg = sp;
+ $internal_buf = sp + 136|0;
+ dest=$nl_type; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $vacopy_currentptr = HEAP32[$ap>>2]|0;
+ HEAP32[$ap2>>2] = $vacopy_currentptr;
+ $0 = (_printf_core(0,$fmt,$ap2,$nl_arg,$nl_type)|0);
+ $1 = ($0|0)<(0);
+ if ($1) {
+ $$0 = -1;
+ } else {
+ $2 = ((($f)) + 76|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)>(-1);
+ if ($4) {
+ $5 = (___lockfile($f)|0);
+ $32 = $5;
+ } else {
+ $32 = 0;
+ }
+ $6 = HEAP32[$f>>2]|0;
+ $7 = $6 & 32;
+ $8 = ((($f)) + 74|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)<(1);
+ if ($10) {
+ $11 = $6 & -33;
+ HEAP32[$f>>2] = $11;
+ }
+ $12 = ((($f)) + 48|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $16 = ((($f)) + 44|0);
+ $17 = HEAP32[$16>>2]|0;
+ HEAP32[$16>>2] = $internal_buf;
+ $18 = ((($f)) + 28|0);
+ HEAP32[$18>>2] = $internal_buf;
+ $19 = ((($f)) + 20|0);
+ HEAP32[$19>>2] = $internal_buf;
+ HEAP32[$12>>2] = 80;
+ $20 = ((($internal_buf)) + 80|0);
+ $21 = ((($f)) + 16|0);
+ HEAP32[$21>>2] = $20;
+ $22 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0);
+ $23 = ($17|0)==(0|0);
+ if ($23) {
+ $ret$1 = $22;
+ } else {
+ $24 = ((($f)) + 36|0);
+ $25 = HEAP32[$24>>2]|0;
+ (FUNCTION_TABLE_iiii[$25 & 15]($f,0,0)|0);
+ $26 = HEAP32[$19>>2]|0;
+ $27 = ($26|0)==(0|0);
+ $$ = $27 ? -1 : $22;
+ HEAP32[$16>>2] = $17;
+ HEAP32[$12>>2] = 0;
+ HEAP32[$21>>2] = 0;
+ HEAP32[$18>>2] = 0;
+ HEAP32[$19>>2] = 0;
+ $ret$1 = $$;
+ }
+ } else {
+ $15 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0);
+ $ret$1 = $15;
+ }
+ $28 = HEAP32[$f>>2]|0;
+ $29 = $28 & 32;
+ $30 = ($29|0)==(0);
+ $ret$1$ = $30 ? $ret$1 : -1;
+ $31 = $28 | $7;
+ HEAP32[$f>>2] = $31;
+ $33 = ($32|0)==(0);
+ if (!($33)) {
+ ___unlockfile($f);
+ }
+ $$0 = $ret$1$;
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _vfscanf($f,$fmt,$ap) {
+ $f = $f|0;
+ $fmt = $fmt|0;
+ $ap = $ap|0;
+ var $$ = 0, $$10 = 0, $$11 = 0, $$12 = 0, $$9 = 0, $$lcssa = 0, $$lcssa38 = 0, $$lcssa384 = 0, $$not = 0, $$old4 = 0, $$pre = 0, $$pre$phi182Z2D = 0, $$pre168 = 0, $$pre170 = 0, $$pre172 = 0, $$pre174 = 0, $$pre176 = 0, $$pre178 = 0, $$pre180 = 0, $$pre181 = 0;
+ var $$size$0 = 0, $$width$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
+ var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
+ var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
+ var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0;
+ var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0;
+ var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0;
+ var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0;
+ var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0;
+ var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0;
+ var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0;
+ var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0;
+ var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0;
+ var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0;
+ var $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
+ var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
+ var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
+ var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $alloc$0 = 0, $alloc$0400 = 0, $alloc$1 = 0;
+ var $alloc$2 = 0, $ap2$i = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $base$0 = 0, $c$0100 = 0, $dest$0 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $factor = 0;
+ var $factor16 = 0, $i$0$i = 0, $i$0$ph = 0, $i$0$ph$phi = 0, $i$0$ph20 = 0, $i$0$ph20$lcssa = 0, $i$1 = 0, $i$2 = 0, $i$2$ph = 0, $i$2$ph$phi = 0, $i$3 = 0, $i$4 = 0, $invert$0 = 0, $isdigit = 0, $isdigit7 = 0, $isdigit795 = 0, $isdigittmp = 0, $isdigittmp6 = 0, $isdigittmp694 = 0, $k$0$ph = 0;
+ var $k$1$ph = 0, $matches$0$ = 0, $matches$0104 = 0, $matches$0104$lcssa = 0, $matches$0104376 = 0, $matches$1 = 0, $matches$2 = 0, $matches$3 = 0, $not$ = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond8 = 0, $p$0109 = 0, $p$1 = 0, $p$1$lcssa = 0, $p$10 = 0, $p$11 = 0, $p$2 = 0, $p$3$lcssa = 0;
+ var $p$396 = 0, $p$4 = 0, $p$5 = 0, $p$6 = 0, $p$7 = 0, $p$7$ph = 0, $p$8 = 0, $p$9 = 0, $pos$0108 = 0, $pos$1 = 0, $pos$2 = 0, $s$0107 = 0, $s$0107$lcssa = 0, $s$1 = 0, $s$2$ph = 0, $s$3 = 0, $s$4 = 0, $s$5 = 0, $s$6 = 0, $s$7 = 0;
+ var $s$8 = 0, $scanset = 0, $size$0 = 0, $st = 0, $vacopy_currentptr = 0, $wc = 0, $wcs$0103 = 0, $wcs$0103$lcssa = 0, $wcs$1 = 0, $wcs$2 = 0, $wcs$3$ph = 0, $wcs$3$ph$lcssa = 0, $wcs$4 = 0, $wcs$5 = 0, $wcs$6 = 0, $wcs$7 = 0, $wcs$8 = 0, $wcs$9 = 0, $width$0$lcssa = 0, $width$097 = 0;
+ var $width$1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 304|0;
+ $ap2$i = sp + 16|0;
+ $st = sp + 8|0;
+ $scanset = sp + 33|0;
+ $wc = sp;
+ $0 = sp + 32|0;
+ $1 = ((($f)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $4 = (___lockfile($f)|0);
+ $333 = $4;
+ } else {
+ $333 = 0;
+ }
+ $5 = HEAP8[$fmt>>0]|0;
+ $6 = ($5<<24>>24)==(0);
+ L4: do {
+ if ($6) {
+ $matches$3 = 0;
+ } else {
+ $7 = ((($f)) + 4|0);
+ $8 = ((($f)) + 100|0);
+ $9 = ((($f)) + 108|0);
+ $10 = ((($f)) + 8|0);
+ $11 = ((($scanset)) + 10|0);
+ $12 = ((($scanset)) + 33|0);
+ $13 = ((($st)) + 4|0);
+ $14 = ((($scanset)) + 46|0);
+ $15 = ((($scanset)) + 94|0);
+ $17 = $5;$matches$0104 = 0;$p$0109 = $fmt;$pos$0108 = 0;$s$0107 = 0;$wcs$0103 = 0;
+ L6: while(1) {
+ $16 = $17&255;
+ $18 = (_isspace($16)|0);
+ $19 = ($18|0)==(0);
+ L8: do {
+ if ($19) {
+ $46 = HEAP8[$p$0109>>0]|0;
+ $47 = ($46<<24>>24)==(37);
+ L10: do {
+ if ($47) {
+ $48 = ((($p$0109)) + 1|0);
+ $49 = HEAP8[$48>>0]|0;
+ L12: do {
+ switch ($49<<24>>24) {
+ case 37: {
+ break L10;
+ break;
+ }
+ case 42: {
+ $70 = ((($p$0109)) + 2|0);
+ $dest$0 = 0;$p$2 = $70;
+ break;
+ }
+ default: {
+ $71 = $49&255;
+ $isdigittmp = (($71) + -48)|0;
+ $isdigit = ($isdigittmp>>>0)<(10);
+ if ($isdigit) {
+ $72 = ((($p$0109)) + 2|0);
+ $73 = HEAP8[$72>>0]|0;
+ $74 = ($73<<24>>24)==(36);
+ if ($74) {
+ $vacopy_currentptr = HEAP32[$ap>>2]|0;
+ HEAP32[$ap2$i>>2] = $vacopy_currentptr;
+ $i$0$i = $isdigittmp;
+ while(1) {
+ $75 = ($i$0$i>>>0)>(1);
+ $arglist_current = HEAP32[$ap2$i>>2]|0;
+ $76 = $arglist_current;
+ $77 = ((0) + 4|0);
+ $expanded4 = $77;
+ $expanded = (($expanded4) - 1)|0;
+ $78 = (($76) + ($expanded))|0;
+ $79 = ((0) + 4|0);
+ $expanded8 = $79;
+ $expanded7 = (($expanded8) - 1)|0;
+ $expanded6 = $expanded7 ^ -1;
+ $80 = $78 & $expanded6;
+ $81 = $80;
+ $82 = HEAP32[$81>>2]|0;
+ $arglist_next = ((($81)) + 4|0);
+ HEAP32[$ap2$i>>2] = $arglist_next;
+ $83 = (($i$0$i) + -1)|0;
+ if ($75) {
+ $i$0$i = $83;
+ } else {
+ $$lcssa = $82;
+ break;
+ }
+ }
+ $84 = ((($p$0109)) + 3|0);
+ $dest$0 = $$lcssa;$p$2 = $84;
+ break L12;
+ }
+ }
+ $arglist_current2 = HEAP32[$ap>>2]|0;
+ $85 = $arglist_current2;
+ $86 = ((0) + 4|0);
+ $expanded11 = $86;
+ $expanded10 = (($expanded11) - 1)|0;
+ $87 = (($85) + ($expanded10))|0;
+ $88 = ((0) + 4|0);
+ $expanded15 = $88;
+ $expanded14 = (($expanded15) - 1)|0;
+ $expanded13 = $expanded14 ^ -1;
+ $89 = $87 & $expanded13;
+ $90 = $89;
+ $91 = HEAP32[$90>>2]|0;
+ $arglist_next3 = ((($90)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next3;
+ $dest$0 = $91;$p$2 = $48;
+ }
+ }
+ } while(0);
+ $92 = HEAP8[$p$2>>0]|0;
+ $93 = $92&255;
+ $isdigittmp694 = (($93) + -48)|0;
+ $isdigit795 = ($isdigittmp694>>>0)<(10);
+ if ($isdigit795) {
+ $97 = $93;$p$396 = $p$2;$width$097 = 0;
+ while(1) {
+ $94 = ($width$097*10)|0;
+ $95 = (($94) + -48)|0;
+ $96 = (($95) + ($97))|0;
+ $98 = ((($p$396)) + 1|0);
+ $99 = HEAP8[$98>>0]|0;
+ $100 = $99&255;
+ $isdigittmp6 = (($100) + -48)|0;
+ $isdigit7 = ($isdigittmp6>>>0)<(10);
+ if ($isdigit7) {
+ $97 = $100;$p$396 = $98;$width$097 = $96;
+ } else {
+ $$lcssa38 = $99;$p$3$lcssa = $98;$width$0$lcssa = $96;
+ break;
+ }
+ }
+ } else {
+ $$lcssa38 = $92;$p$3$lcssa = $p$2;$width$0$lcssa = 0;
+ }
+ $101 = ($$lcssa38<<24>>24)==(109);
+ if ($101) {
+ $102 = ($dest$0|0)!=(0|0);
+ $103 = $102&1;
+ $104 = ((($p$3$lcssa)) + 1|0);
+ $$pre168 = HEAP8[$104>>0]|0;
+ $107 = $$pre168;$alloc$0 = $103;$p$4 = $104;$s$1 = 0;$wcs$1 = 0;
+ } else {
+ $107 = $$lcssa38;$alloc$0 = 0;$p$4 = $p$3$lcssa;$s$1 = $s$0107;$wcs$1 = $wcs$0103;
+ }
+ $105 = ((($p$4)) + 1|0);
+ $106 = $107&255;
+ switch ($106|0) {
+ case 104: {
+ $108 = HEAP8[$105>>0]|0;
+ $109 = ($108<<24>>24)==(104);
+ $110 = ((($p$4)) + 2|0);
+ $$9 = $109 ? $110 : $105;
+ $$10 = $109 ? -2 : -1;
+ $p$5 = $$9;$size$0 = $$10;
+ break;
+ }
+ case 108: {
+ $111 = HEAP8[$105>>0]|0;
+ $112 = ($111<<24>>24)==(108);
+ $113 = ((($p$4)) + 2|0);
+ $$11 = $112 ? $113 : $105;
+ $$12 = $112 ? 3 : 1;
+ $p$5 = $$11;$size$0 = $$12;
+ break;
+ }
+ case 106: {
+ $p$5 = $105;$size$0 = 3;
+ break;
+ }
+ case 116: case 122: {
+ $p$5 = $105;$size$0 = 1;
+ break;
+ }
+ case 76: {
+ $p$5 = $105;$size$0 = 2;
+ break;
+ }
+ case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100: {
+ $p$5 = $p$4;$size$0 = 0;
+ break;
+ }
+ default: {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1;
+ label = 152;
+ break L6;
+ }
+ }
+ $114 = HEAP8[$p$5>>0]|0;
+ $115 = $114&255;
+ $116 = $115 & 47;
+ $117 = ($116|0)==(3);
+ $118 = $115 | 32;
+ $$ = $117 ? $118 : $115;
+ $$size$0 = $117 ? 1 : $size$0;
+ switch ($$|0) {
+ case 99: {
+ $119 = ($width$0$lcssa|0)<(1);
+ $$width$0 = $119 ? 1 : $width$0$lcssa;
+ $pos$1 = $pos$0108;$width$1 = $$width$0;
+ break;
+ }
+ case 91: {
+ $pos$1 = $pos$0108;$width$1 = $width$0$lcssa;
+ break;
+ }
+ case 110: {
+ $120 = ($pos$0108|0)<(0);
+ $121 = $120 << 31 >> 31;
+ $122 = ($dest$0|0)==(0|0);
+ if ($122) {
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ }
+ switch ($$size$0|0) {
+ case -2: {
+ $123 = $pos$0108&255;
+ HEAP8[$dest$0>>0] = $123;
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ break;
+ }
+ case -1: {
+ $124 = $pos$0108&65535;
+ HEAP16[$dest$0>>1] = $124;
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ break;
+ }
+ case 0: {
+ HEAP32[$dest$0>>2] = $pos$0108;
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ break;
+ }
+ case 1: {
+ HEAP32[$dest$0>>2] = $pos$0108;
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ break;
+ }
+ case 3: {
+ $125 = $dest$0;
+ $126 = $125;
+ HEAP32[$126>>2] = $pos$0108;
+ $127 = (($125) + 4)|0;
+ $128 = $127;
+ HEAP32[$128>>2] = $121;
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ break;
+ }
+ default: {
+ $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1;
+ break L8;
+ }
+ }
+ break;
+ }
+ default: {
+ ___shlim($f,0);
+ while(1) {
+ $129 = HEAP32[$7>>2]|0;
+ $130 = HEAP32[$8>>2]|0;
+ $131 = ($129>>>0)<($130>>>0);
+ if ($131) {
+ $132 = ((($129)) + 1|0);
+ HEAP32[$7>>2] = $132;
+ $133 = HEAP8[$129>>0]|0;
+ $134 = $133&255;
+ $136 = $134;
+ } else {
+ $135 = (___shgetc($f)|0);
+ $136 = $135;
+ }
+ $137 = (_isspace($136)|0);
+ $138 = ($137|0)==(0);
+ if ($138) {
+ break;
+ }
+ }
+ $139 = HEAP32[$8>>2]|0;
+ $140 = ($139|0)==(0|0);
+ $$pre170 = HEAP32[$7>>2]|0;
+ if ($140) {
+ $144 = $$pre170;
+ } else {
+ $141 = ((($$pre170)) + -1|0);
+ HEAP32[$7>>2] = $141;
+ $144 = $141;
+ }
+ $142 = HEAP32[$9>>2]|0;
+ $143 = HEAP32[$10>>2]|0;
+ $145 = $144;
+ $146 = $143;
+ $147 = (($142) + ($pos$0108))|0;
+ $148 = (($147) + ($145))|0;
+ $149 = (($148) - ($146))|0;
+ $pos$1 = $149;$width$1 = $width$0$lcssa;
+ }
+ }
+ ___shlim($f,$width$1);
+ $150 = HEAP32[$7>>2]|0;
+ $151 = HEAP32[$8>>2]|0;
+ $152 = ($150>>>0)<($151>>>0);
+ if ($152) {
+ $153 = ((($150)) + 1|0);
+ HEAP32[$7>>2] = $153;
+ $156 = $151;
+ } else {
+ $154 = (___shgetc($f)|0);
+ $155 = ($154|0)<(0);
+ if ($155) {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1;
+ label = 152;
+ break L6;
+ }
+ $$pre172 = HEAP32[$8>>2]|0;
+ $156 = $$pre172;
+ }
+ $157 = ($156|0)==(0|0);
+ if (!($157)) {
+ $158 = HEAP32[$7>>2]|0;
+ $159 = ((($158)) + -1|0);
+ HEAP32[$7>>2] = $159;
+ }
+ L67: do {
+ switch ($$|0) {
+ case 91: case 99: case 115: {
+ $160 = ($$|0)==(99);
+ $161 = $$ & 239;
+ $162 = ($161|0)==(99);
+ L69: do {
+ if ($162) {
+ $163 = ($$|0)==(115);
+ _memset(($scanset|0),-1,257)|0;
+ HEAP8[$scanset>>0] = 0;
+ if ($163) {
+ HEAP8[$12>>0] = 0;
+ ;HEAP8[$11>>0]=0|0;HEAP8[$11+1>>0]=0|0;HEAP8[$11+2>>0]=0|0;HEAP8[$11+3>>0]=0|0;HEAP8[$11+4>>0]=0|0;
+ $p$9 = $p$5;
+ } else {
+ $p$9 = $p$5;
+ }
+ } else {
+ $164 = ((($p$5)) + 1|0);
+ $165 = HEAP8[$164>>0]|0;
+ $166 = ($165<<24>>24)==(94);
+ $167 = ((($p$5)) + 2|0);
+ $invert$0 = $166&1;
+ $168 = $166 ? $164 : $p$5;
+ $p$6 = $166 ? $167 : $164;
+ $169 = $166&1;
+ _memset(($scanset|0),($169|0),257)|0;
+ HEAP8[$scanset>>0] = 0;
+ $170 = HEAP8[$p$6>>0]|0;
+ switch ($170<<24>>24) {
+ case 45: {
+ $171 = ((($168)) + 2|0);
+ $172 = $invert$0 ^ 1;
+ $173 = $172&255;
+ HEAP8[$14>>0] = $173;
+ $$pre$phi182Z2D = $173;$p$7$ph = $171;
+ break;
+ }
+ case 93: {
+ $174 = ((($168)) + 2|0);
+ $175 = $invert$0 ^ 1;
+ $176 = $175&255;
+ HEAP8[$15>>0] = $176;
+ $$pre$phi182Z2D = $176;$p$7$ph = $174;
+ break;
+ }
+ default: {
+ $$pre180 = $invert$0 ^ 1;
+ $$pre181 = $$pre180&255;
+ $$pre$phi182Z2D = $$pre181;$p$7$ph = $p$6;
+ }
+ }
+ $p$7 = $p$7$ph;
+ while(1) {
+ $177 = HEAP8[$p$7>>0]|0;
+ L80: do {
+ switch ($177<<24>>24) {
+ case 0: {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1;
+ label = 152;
+ break L6;
+ break;
+ }
+ case 93: {
+ $p$9 = $p$7;
+ break L69;
+ break;
+ }
+ case 45: {
+ $178 = ((($p$7)) + 1|0);
+ $179 = HEAP8[$178>>0]|0;
+ switch ($179<<24>>24) {
+ case 93: case 0: {
+ $190 = 45;$p$8 = $p$7;
+ break L80;
+ break;
+ }
+ default: {
+ }
+ }
+ $180 = ((($p$7)) + -1|0);
+ $181 = HEAP8[$180>>0]|0;
+ $182 = ($181&255)<($179&255);
+ if ($182) {
+ $183 = $181&255;
+ $c$0100 = $183;
+ while(1) {
+ $184 = (($c$0100) + 1)|0;
+ $185 = (($scanset) + ($184)|0);
+ HEAP8[$185>>0] = $$pre$phi182Z2D;
+ $186 = HEAP8[$178>>0]|0;
+ $187 = $186&255;
+ $188 = ($184|0)<($187|0);
+ if ($188) {
+ $c$0100 = $184;
+ } else {
+ $190 = $186;$p$8 = $178;
+ break;
+ }
+ }
+ } else {
+ $190 = $179;$p$8 = $178;
+ }
+ break;
+ }
+ default: {
+ $190 = $177;$p$8 = $p$7;
+ }
+ }
+ } while(0);
+ $189 = $190&255;
+ $191 = (($189) + 1)|0;
+ $192 = (($scanset) + ($191)|0);
+ HEAP8[$192>>0] = $$pre$phi182Z2D;
+ $193 = ((($p$8)) + 1|0);
+ $p$7 = $193;
+ }
+ }
+ } while(0);
+ $194 = (($width$1) + 1)|0;
+ $195 = $160 ? $194 : 31;
+ $196 = ($$size$0|0)==(1);
+ $197 = ($alloc$0|0)!=(0);
+ L88: do {
+ if ($196) {
+ if ($197) {
+ $198 = $195 << 2;
+ $199 = (_malloc($198)|0);
+ $200 = ($199|0)==(0|0);
+ if ($200) {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $199;
+ label = 152;
+ break L6;
+ } else {
+ $wcs$2 = $199;
+ }
+ } else {
+ $wcs$2 = $dest$0;
+ }
+ HEAP32[$st>>2] = 0;
+ HEAP32[$13>>2] = 0;
+ $i$0$ph = 0;$k$0$ph = $195;$wcs$3$ph = $wcs$2;
+ L94: while(1) {
+ $201 = ($wcs$3$ph|0)==(0|0);
+ $i$0$ph20 = $i$0$ph;
+ while(1) {
+ L98: while(1) {
+ $202 = HEAP32[$7>>2]|0;
+ $203 = HEAP32[$8>>2]|0;
+ $204 = ($202>>>0)<($203>>>0);
+ if ($204) {
+ $205 = ((($202)) + 1|0);
+ HEAP32[$7>>2] = $205;
+ $206 = HEAP8[$202>>0]|0;
+ $207 = $206&255;
+ $210 = $207;
+ } else {
+ $208 = (___shgetc($f)|0);
+ $210 = $208;
+ }
+ $209 = (($210) + 1)|0;
+ $211 = (($scanset) + ($209)|0);
+ $212 = HEAP8[$211>>0]|0;
+ $213 = ($212<<24>>24)==(0);
+ if ($213) {
+ $i$0$ph20$lcssa = $i$0$ph20;$wcs$3$ph$lcssa = $wcs$3$ph;
+ break L94;
+ }
+ $214 = $210&255;
+ HEAP8[$0>>0] = $214;
+ $215 = (_mbrtowc($wc,$0,1,$st)|0);
+ switch ($215|0) {
+ case -1: {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph;
+ label = 152;
+ break L6;
+ break;
+ }
+ case -2: {
+ break;
+ }
+ default: {
+ break L98;
+ }
+ }
+ }
+ if ($201) {
+ $i$1 = $i$0$ph20;
+ } else {
+ $216 = HEAP32[$wc>>2]|0;
+ $217 = (($i$0$ph20) + 1)|0;
+ $218 = (($wcs$3$ph) + ($i$0$ph20<<2)|0);
+ HEAP32[$218>>2] = $216;
+ $i$1 = $217;
+ }
+ $219 = ($i$1|0)==($k$0$ph|0);
+ $or$cond = $197 & $219;
+ if ($or$cond) {
+ break;
+ } else {
+ $i$0$ph20 = $i$1;
+ }
+ }
+ $factor = $k$0$ph << 1;
+ $220 = $factor | 1;
+ $221 = $220 << 2;
+ $222 = (_realloc($wcs$3$ph,$221)|0);
+ $223 = ($222|0)==(0|0);
+ if ($223) {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph;
+ label = 152;
+ break L6;
+ }
+ $i$0$ph$phi = $k$0$ph;$k$0$ph = $220;$wcs$3$ph = $222;$i$0$ph = $i$0$ph$phi;
+ }
+ $224 = (_mbsinit($st)|0);
+ $225 = ($224|0)==(0);
+ if ($225) {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph$lcssa;
+ label = 152;
+ break L6;
+ } else {
+ $i$4 = $i$0$ph20$lcssa;$s$3 = 0;$wcs$4 = $wcs$3$ph$lcssa;
+ }
+ } else {
+ if ($197) {
+ $226 = (_malloc($195)|0);
+ $227 = ($226|0)==(0|0);
+ if ($227) {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = 0;
+ label = 152;
+ break L6;
+ } else {
+ $i$2$ph = 0;$k$1$ph = $195;$s$2$ph = $226;
+ }
+ while(1) {
+ $i$2 = $i$2$ph;
+ while(1) {
+ $228 = HEAP32[$7>>2]|0;
+ $229 = HEAP32[$8>>2]|0;
+ $230 = ($228>>>0)<($229>>>0);
+ if ($230) {
+ $231 = ((($228)) + 1|0);
+ HEAP32[$7>>2] = $231;
+ $232 = HEAP8[$228>>0]|0;
+ $233 = $232&255;
+ $236 = $233;
+ } else {
+ $234 = (___shgetc($f)|0);
+ $236 = $234;
+ }
+ $235 = (($236) + 1)|0;
+ $237 = (($scanset) + ($235)|0);
+ $238 = HEAP8[$237>>0]|0;
+ $239 = ($238<<24>>24)==(0);
+ if ($239) {
+ $i$4 = $i$2;$s$3 = $s$2$ph;$wcs$4 = 0;
+ break L88;
+ }
+ $240 = $236&255;
+ $241 = (($i$2) + 1)|0;
+ $242 = (($s$2$ph) + ($i$2)|0);
+ HEAP8[$242>>0] = $240;
+ $243 = ($241|0)==($k$1$ph|0);
+ if ($243) {
+ break;
+ } else {
+ $i$2 = $241;
+ }
+ }
+ $factor16 = $k$1$ph << 1;
+ $244 = $factor16 | 1;
+ $245 = (_realloc($s$2$ph,$244)|0);
+ $246 = ($245|0)==(0|0);
+ if ($246) {
+ $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$2$ph;$wcs$7 = 0;
+ label = 152;
+ break L6;
+ } else {
+ $i$2$ph$phi = $k$1$ph;$k$1$ph = $244;$s$2$ph = $245;$i$2$ph = $i$2$ph$phi;
+ }
+ }
+ }
+ $247 = ($dest$0|0)==(0|0);
+ if ($247) {
+ $265 = $156;
+ while(1) {
+ $263 = HEAP32[$7>>2]|0;
+ $264 = ($263>>>0)<($265>>>0);
+ if ($264) {
+ $266 = ((($263)) + 1|0);
+ HEAP32[$7>>2] = $266;
+ $267 = HEAP8[$263>>0]|0;
+ $268 = $267&255;
+ $271 = $268;
+ } else {
+ $269 = (___shgetc($f)|0);
+ $271 = $269;
+ }
+ $270 = (($271) + 1)|0;
+ $272 = (($scanset) + ($270)|0);
+ $273 = HEAP8[$272>>0]|0;
+ $274 = ($273<<24>>24)==(0);
+ if ($274) {
+ $i$4 = 0;$s$3 = 0;$wcs$4 = 0;
+ break L88;
+ }
+ $$pre176 = HEAP32[$8>>2]|0;
+ $265 = $$pre176;
+ }
+ } else {
+ $250 = $156;$i$3 = 0;
+ while(1) {
+ $248 = HEAP32[$7>>2]|0;
+ $249 = ($248>>>0)<($250>>>0);
+ if ($249) {
+ $251 = ((($248)) + 1|0);
+ HEAP32[$7>>2] = $251;
+ $252 = HEAP8[$248>>0]|0;
+ $253 = $252&255;
+ $256 = $253;
+ } else {
+ $254 = (___shgetc($f)|0);
+ $256 = $254;
+ }
+ $255 = (($256) + 1)|0;
+ $257 = (($scanset) + ($255)|0);
+ $258 = HEAP8[$257>>0]|0;
+ $259 = ($258<<24>>24)==(0);
+ if ($259) {
+ $i$4 = $i$3;$s$3 = $dest$0;$wcs$4 = 0;
+ break L88;
+ }
+ $260 = $256&255;
+ $261 = (($i$3) + 1)|0;
+ $262 = (($dest$0) + ($i$3)|0);
+ HEAP8[$262>>0] = $260;
+ $$pre174 = HEAP32[$8>>2]|0;
+ $250 = $$pre174;$i$3 = $261;
+ }
+ }
+ }
+ } while(0);
+ $275 = HEAP32[$8>>2]|0;
+ $276 = ($275|0)==(0|0);
+ $$pre178 = HEAP32[$7>>2]|0;
+ if ($276) {
+ $280 = $$pre178;
+ } else {
+ $277 = ((($$pre178)) + -1|0);
+ HEAP32[$7>>2] = $277;
+ $280 = $277;
+ }
+ $278 = HEAP32[$9>>2]|0;
+ $279 = HEAP32[$10>>2]|0;
+ $281 = $280;
+ $282 = $279;
+ $283 = (($281) - ($282))|0;
+ $284 = (($283) + ($278))|0;
+ $285 = ($284|0)==(0);
+ if ($285) {
+ $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4;
+ break L6;
+ }
+ $$not = $160 ^ 1;
+ $286 = ($284|0)==($width$1|0);
+ $or$cond8 = $286 | $$not;
+ if (!($or$cond8)) {
+ $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4;
+ break L6;
+ }
+ do {
+ if ($197) {
+ if ($196) {
+ HEAP32[$dest$0>>2] = $wcs$4;
+ break;
+ } else {
+ HEAP32[$dest$0>>2] = $s$3;
+ break;
+ }
+ }
+ } while(0);
+ if ($160) {
+ $p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4;
+ } else {
+ $287 = ($wcs$4|0)==(0|0);
+ if (!($287)) {
+ $288 = (($wcs$4) + ($i$4<<2)|0);
+ HEAP32[$288>>2] = 0;
+ }
+ $289 = ($s$3|0)==(0|0);
+ if ($289) {
+ $p$10 = $p$9;$s$4 = 0;$wcs$5 = $wcs$4;
+ break L67;
+ }
+ $290 = (($s$3) + ($i$4)|0);
+ HEAP8[$290>>0] = 0;
+ $p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4;
+ }
+ break;
+ }
+ case 120: case 88: case 112: {
+ $base$0 = 16;
+ label = 134;
+ break;
+ }
+ case 111: {
+ $base$0 = 8;
+ label = 134;
+ break;
+ }
+ case 117: case 100: {
+ $base$0 = 10;
+ label = 134;
+ break;
+ }
+ case 105: {
+ $base$0 = 0;
+ label = 134;
+ break;
+ }
+ case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97: {
+ $310 = (+___floatscan($f,$$size$0,0));
+ $311 = HEAP32[$9>>2]|0;
+ $312 = HEAP32[$7>>2]|0;
+ $313 = HEAP32[$10>>2]|0;
+ $314 = $312;
+ $315 = $313;
+ $316 = (($315) - ($314))|0;
+ $317 = ($311|0)==($316|0);
+ if ($317) {
+ $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1;
+ break L6;
+ }
+ $318 = ($dest$0|0)==(0|0);
+ if ($318) {
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ } else {
+ switch ($$size$0|0) {
+ case 0: {
+ $319 = $310;
+ HEAPF32[$dest$0>>2] = $319;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L67;
+ break;
+ }
+ case 1: {
+ HEAPF64[$dest$0>>3] = $310;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L67;
+ break;
+ }
+ case 2: {
+ HEAPF64[$dest$0>>3] = $310;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L67;
+ break;
+ }
+ default: {
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L67;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ }
+ }
+ } while(0);
+ L168: do {
+ if ((label|0) == 134) {
+ label = 0;
+ $291 = (___intscan($f,$base$0,0,-1,-1)|0);
+ $292 = tempRet0;
+ $293 = HEAP32[$9>>2]|0;
+ $294 = HEAP32[$7>>2]|0;
+ $295 = HEAP32[$10>>2]|0;
+ $296 = $294;
+ $297 = $295;
+ $298 = (($297) - ($296))|0;
+ $299 = ($293|0)==($298|0);
+ if ($299) {
+ $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1;
+ break L6;
+ }
+ $300 = ($$|0)==(112);
+ $301 = ($dest$0|0)!=(0|0);
+ $or$cond3 = $301 & $300;
+ if ($or$cond3) {
+ $302 = $291;
+ HEAP32[$dest$0>>2] = $302;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break;
+ }
+ $303 = ($dest$0|0)==(0|0);
+ if ($303) {
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ } else {
+ switch ($$size$0|0) {
+ case -2: {
+ $304 = $291&255;
+ HEAP8[$dest$0>>0] = $304;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L168;
+ break;
+ }
+ case -1: {
+ $305 = $291&65535;
+ HEAP16[$dest$0>>1] = $305;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L168;
+ break;
+ }
+ case 0: {
+ HEAP32[$dest$0>>2] = $291;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L168;
+ break;
+ }
+ case 1: {
+ HEAP32[$dest$0>>2] = $291;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L168;
+ break;
+ }
+ case 3: {
+ $306 = $dest$0;
+ $307 = $306;
+ HEAP32[$307>>2] = $291;
+ $308 = (($306) + 4)|0;
+ $309 = $308;
+ HEAP32[$309>>2] = $292;
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L168;
+ break;
+ }
+ default: {
+ $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1;
+ break L168;
+ }
+ }
+ }
+ }
+ } while(0);
+ $320 = HEAP32[$9>>2]|0;
+ $321 = HEAP32[$7>>2]|0;
+ $322 = HEAP32[$10>>2]|0;
+ $323 = $321;
+ $324 = $322;
+ $325 = (($320) + ($pos$1))|0;
+ $326 = (($325) + ($323))|0;
+ $327 = (($326) - ($324))|0;
+ $not$ = ($dest$0|0)!=(0|0);
+ $328 = $not$&1;
+ $matches$0$ = (($328) + ($matches$0104))|0;
+ $matches$1 = $matches$0$;$p$11 = $p$10;$pos$2 = $327;$s$5 = $s$4;$wcs$6 = $wcs$5;
+ break L8;
+ }
+ } while(0);
+ $50 = $47&1;
+ $51 = (($p$0109) + ($50)|0);
+ ___shlim($f,0);
+ $52 = HEAP32[$7>>2]|0;
+ $53 = HEAP32[$8>>2]|0;
+ $54 = ($52>>>0)<($53>>>0);
+ if ($54) {
+ $55 = ((($52)) + 1|0);
+ HEAP32[$7>>2] = $55;
+ $56 = HEAP8[$52>>0]|0;
+ $57 = $56&255;
+ $61 = $57;
+ } else {
+ $58 = (___shgetc($f)|0);
+ $61 = $58;
+ }
+ $59 = HEAP8[$51>>0]|0;
+ $60 = $59&255;
+ $62 = ($61|0)==($60|0);
+ if (!($62)) {
+ $$lcssa384 = $61;$matches$0104$lcssa = $matches$0104;$s$0107$lcssa = $s$0107;$wcs$0103$lcssa = $wcs$0103;
+ label = 21;
+ break L6;
+ }
+ $69 = (($pos$0108) + 1)|0;
+ $matches$1 = $matches$0104;$p$11 = $51;$pos$2 = $69;$s$5 = $s$0107;$wcs$6 = $wcs$0103;
+ } else {
+ $p$1 = $p$0109;
+ while(1) {
+ $20 = ((($p$1)) + 1|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = $21&255;
+ $23 = (_isspace($22)|0);
+ $24 = ($23|0)==(0);
+ if ($24) {
+ $p$1$lcssa = $p$1;
+ break;
+ } else {
+ $p$1 = $20;
+ }
+ }
+ ___shlim($f,0);
+ while(1) {
+ $25 = HEAP32[$7>>2]|0;
+ $26 = HEAP32[$8>>2]|0;
+ $27 = ($25>>>0)<($26>>>0);
+ if ($27) {
+ $28 = ((($25)) + 1|0);
+ HEAP32[$7>>2] = $28;
+ $29 = HEAP8[$25>>0]|0;
+ $30 = $29&255;
+ $32 = $30;
+ } else {
+ $31 = (___shgetc($f)|0);
+ $32 = $31;
+ }
+ $33 = (_isspace($32)|0);
+ $34 = ($33|0)==(0);
+ if ($34) {
+ break;
+ }
+ }
+ $35 = HEAP32[$8>>2]|0;
+ $36 = ($35|0)==(0|0);
+ $$pre = HEAP32[$7>>2]|0;
+ if ($36) {
+ $40 = $$pre;
+ } else {
+ $37 = ((($$pre)) + -1|0);
+ HEAP32[$7>>2] = $37;
+ $40 = $37;
+ }
+ $38 = HEAP32[$9>>2]|0;
+ $39 = HEAP32[$10>>2]|0;
+ $41 = $40;
+ $42 = $39;
+ $43 = (($38) + ($pos$0108))|0;
+ $44 = (($43) + ($41))|0;
+ $45 = (($44) - ($42))|0;
+ $matches$1 = $matches$0104;$p$11 = $p$1$lcssa;$pos$2 = $45;$s$5 = $s$0107;$wcs$6 = $wcs$0103;
+ }
+ } while(0);
+ $329 = ((($p$11)) + 1|0);
+ $330 = HEAP8[$329>>0]|0;
+ $331 = ($330<<24>>24)==(0);
+ if ($331) {
+ $matches$3 = $matches$1;
+ break L4;
+ } else {
+ $17 = $330;$matches$0104 = $matches$1;$p$0109 = $329;$pos$0108 = $pos$2;$s$0107 = $s$5;$wcs$0103 = $wcs$6;
+ }
+ }
+ if ((label|0) == 21) {
+ $63 = HEAP32[$8>>2]|0;
+ $64 = ($63|0)==(0|0);
+ if (!($64)) {
+ $65 = HEAP32[$7>>2]|0;
+ $66 = ((($65)) + -1|0);
+ HEAP32[$7>>2] = $66;
+ }
+ $67 = ($$lcssa384|0)>(-1);
+ $68 = ($matches$0104$lcssa|0)!=(0);
+ $or$cond5 = $68 | $67;
+ if ($or$cond5) {
+ $matches$3 = $matches$0104$lcssa;
+ break;
+ } else {
+ $alloc$1 = 0;$s$7 = $s$0107$lcssa;$wcs$8 = $wcs$0103$lcssa;
+ label = 153;
+ }
+ }
+ else if ((label|0) == 152) {
+ $$old4 = ($matches$0104376|0)==(0);
+ if ($$old4) {
+ $alloc$1 = $alloc$0400;$s$7 = $s$6;$wcs$8 = $wcs$7;
+ label = 153;
+ } else {
+ $alloc$2 = $alloc$0400;$matches$2 = $matches$0104376;$s$8 = $s$6;$wcs$9 = $wcs$7;
+ }
+ }
+ if ((label|0) == 153) {
+ $alloc$2 = $alloc$1;$matches$2 = -1;$s$8 = $s$7;$wcs$9 = $wcs$8;
+ }
+ $332 = ($alloc$2|0)==(0);
+ if ($332) {
+ $matches$3 = $matches$2;
+ } else {
+ _free($s$8);
+ _free($wcs$9);
+ $matches$3 = $matches$2;
+ }
+ }
+ } while(0);
+ $334 = ($333|0)==(0);
+ if (!($334)) {
+ ___unlockfile($f);
+ }
+ STACKTOP = sp;return ($matches$3|0);
+}
+function _vsnprintf($s,$n,$fmt,$ap) {
+ $s = $s|0;
+ $n = $n|0;
+ $fmt = $fmt|0;
+ $ap = $ap|0;
+ var $$$02 = 0, $$0 = 0, $$01 = 0, $$02 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b = 0, $f = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0;
+ $b = sp + 112|0;
+ $f = sp;
+ dest=$f; src=6724; stop=dest+112|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $0 = (($n) + -1)|0;
+ $1 = ($0>>>0)>(2147483646);
+ if ($1) {
+ $2 = ($n|0)==(0);
+ if ($2) {
+ $$01 = $b;$$02 = 1;
+ label = 4;
+ } else {
+ $3 = (___errno_location()|0);
+ HEAP32[$3>>2] = 75;
+ $$0 = -1;
+ }
+ } else {
+ $$01 = $s;$$02 = $n;
+ label = 4;
+ }
+ if ((label|0) == 4) {
+ $4 = $$01;
+ $5 = (-2 - ($4))|0;
+ $6 = ($$02>>>0)>($5>>>0);
+ $$$02 = $6 ? $5 : $$02;
+ $7 = ((($f)) + 48|0);
+ HEAP32[$7>>2] = $$$02;
+ $8 = ((($f)) + 20|0);
+ HEAP32[$8>>2] = $$01;
+ $9 = ((($f)) + 44|0);
+ HEAP32[$9>>2] = $$01;
+ $10 = (($$01) + ($$$02)|0);
+ $11 = ((($f)) + 16|0);
+ HEAP32[$11>>2] = $10;
+ $12 = ((($f)) + 28|0);
+ HEAP32[$12>>2] = $10;
+ $13 = (_vfprintf($f,$fmt,$ap)|0);
+ $14 = ($$$02|0)==(0);
+ if ($14) {
+ $$0 = $13;
+ } else {
+ $15 = HEAP32[$8>>2]|0;
+ $16 = HEAP32[$11>>2]|0;
+ $17 = ($15|0)==($16|0);
+ $18 = $17 << 31 >> 31;
+ $19 = (($15) + ($18)|0);
+ HEAP8[$19>>0] = 0;
+ $$0 = $13;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _vsprintf($s,$fmt,$ap) {
+ $s = $s|0;
+ $fmt = $fmt|0;
+ $ap = $ap|0;
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_vsnprintf($s,2147483647,$fmt,$ap)|0);
+ return ($0|0);
+}
+function ___fdopen($fd,$mode) {
+ $fd = $fd|0;
+ $mode = $mode|0;
+ var $$0 = 0, $$pre = 0, $$pre1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $tio = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0;
+ var sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0;
+ $vararg_buffer12 = sp + 40|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $tio = sp + 52|0;
+ $0 = HEAP8[$mode>>0]|0;
+ $1 = $0 << 24 >> 24;
+ $memchr = (_memchr(22738,$1,4)|0);
+ $2 = ($memchr|0)==(0|0);
+ if ($2) {
+ $3 = (___errno_location()|0);
+ HEAP32[$3>>2] = 22;
+ $$0 = 0;
+ } else {
+ $4 = (_malloc(1144)|0);
+ $5 = ($4|0)==(0|0);
+ if ($5) {
+ $$0 = 0;
+ } else {
+ dest=$4; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $6 = (_strchr($mode,43)|0);
+ $7 = ($6|0)==(0|0);
+ if ($7) {
+ $8 = ($0<<24>>24)==(114);
+ $9 = $8 ? 8 : 4;
+ HEAP32[$4>>2] = $9;
+ }
+ $10 = (_strchr($mode,101)|0);
+ $11 = ($10|0)==(0|0);
+ if ($11) {
+ $12 = $0;
+ } else {
+ HEAP32[$vararg_buffer>>2] = $fd;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = 2;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 1;
+ (___syscall221(221,($vararg_buffer|0))|0);
+ $$pre = HEAP8[$mode>>0]|0;
+ $12 = $$pre;
+ }
+ $13 = ($12<<24>>24)==(97);
+ if ($13) {
+ HEAP32[$vararg_buffer3>>2] = $fd;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = 3;
+ $14 = (___syscall221(221,($vararg_buffer3|0))|0);
+ $15 = $14 & 1024;
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $17 = $14 | 1024;
+ HEAP32[$vararg_buffer7>>2] = $fd;
+ $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
+ HEAP32[$vararg_ptr10>>2] = 4;
+ $vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
+ HEAP32[$vararg_ptr11>>2] = $17;
+ (___syscall221(221,($vararg_buffer7|0))|0);
+ }
+ $18 = HEAP32[$4>>2]|0;
+ $19 = $18 | 128;
+ HEAP32[$4>>2] = $19;
+ $26 = $19;
+ } else {
+ $$pre1 = HEAP32[$4>>2]|0;
+ $26 = $$pre1;
+ }
+ $20 = ((($4)) + 60|0);
+ HEAP32[$20>>2] = $fd;
+ $21 = ((($4)) + 120|0);
+ $22 = ((($4)) + 44|0);
+ HEAP32[$22>>2] = $21;
+ $23 = ((($4)) + 48|0);
+ HEAP32[$23>>2] = 1024;
+ $24 = ((($4)) + 75|0);
+ HEAP8[$24>>0] = -1;
+ $25 = $26 & 8;
+ $27 = ($25|0)==(0);
+ if ($27) {
+ HEAP32[$vararg_buffer12>>2] = $fd;
+ $vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
+ HEAP32[$vararg_ptr15>>2] = 21505;
+ $vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
+ HEAP32[$vararg_ptr16>>2] = $tio;
+ $28 = (___syscall54(54,($vararg_buffer12|0))|0);
+ $29 = ($28|0)==(0);
+ if ($29) {
+ HEAP8[$24>>0] = 10;
+ }
+ }
+ $30 = ((($4)) + 32|0);
+ HEAP32[$30>>2] = 7;
+ $31 = ((($4)) + 36|0);
+ HEAP32[$31>>2] = 8;
+ $32 = ((($4)) + 40|0);
+ HEAP32[$32>>2] = 4;
+ $33 = ((($4)) + 12|0);
+ HEAP32[$33>>2] = 2;
+ $34 = HEAP32[(6432)>>2]|0;
+ $35 = ($34|0)==(0);
+ if ($35) {
+ $36 = ((($4)) + 76|0);
+ HEAP32[$36>>2] = -1;
+ }
+ ___lock(((6456)|0));
+ $37 = HEAP32[(6452)>>2]|0;
+ $38 = ((($4)) + 56|0);
+ HEAP32[$38>>2] = $37;
+ $39 = ($37|0)==(0);
+ if (!($39)) {
+ $40 = $37;
+ $41 = ((($40)) + 52|0);
+ HEAP32[$41>>2] = $4;
+ }
+ HEAP32[(6452)>>2] = $4;
+ ___unlock(((6456)|0));
+ $$0 = $4;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___fmodeflags($mode) {
+ $mode = $mode|0;
+ var $$ = 0, $$flags$4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $flags$0 = 0, $flags$0$ = 0, $flags$2 = 0;
+ var $flags$2$ = 0, $flags$4 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_strchr($mode,43)|0);
+ $1 = ($0|0)==(0|0);
+ $2 = HEAP8[$mode>>0]|0;
+ $not$ = ($2<<24>>24)!=(114);
+ $$ = $not$&1;
+ $flags$0 = $1 ? $$ : 2;
+ $3 = (_strchr($mode,120)|0);
+ $4 = ($3|0)==(0|0);
+ $5 = $flags$0 | 128;
+ $flags$0$ = $4 ? $flags$0 : $5;
+ $6 = (_strchr($mode,101)|0);
+ $7 = ($6|0)==(0|0);
+ $8 = $flags$0$ | 524288;
+ $flags$2 = $7 ? $flags$0$ : $8;
+ $9 = ($2<<24>>24)==(114);
+ $10 = $flags$2 | 64;
+ $flags$2$ = $9 ? $flags$2 : $10;
+ $11 = ($2<<24>>24)==(119);
+ $12 = $flags$2$ | 512;
+ $flags$4 = $11 ? $12 : $flags$2$;
+ $13 = ($2<<24>>24)==(97);
+ $14 = $flags$4 | 1024;
+ $$flags$4 = $13 ? $14 : $flags$4;
+ return ($$flags$4|0);
+}
+function ___lockfile($f) {
+ $f = $f|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return 0;
+}
+function ___unlockfile($f) {
+ $f = $f|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function ___overflow($f,$_c) {
+ $f = $f|0;
+ $_c = $_c|0;
+ var $$0 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $c = sp;
+ $0 = $_c&255;
+ HEAP8[$c>>0] = $0;
+ $1 = ((($f)) + 16|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0|0);
+ if ($3) {
+ $4 = (___towrite($f)|0);
+ $5 = ($4|0)==(0);
+ if ($5) {
+ $$pre = HEAP32[$1>>2]|0;
+ $9 = $$pre;
+ label = 4;
+ } else {
+ $$0 = -1;
+ }
+ } else {
+ $9 = $2;
+ label = 4;
+ }
+ do {
+ if ((label|0) == 4) {
+ $6 = ((($f)) + 20|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7>>>0)<($9>>>0);
+ if ($8) {
+ $10 = $_c & 255;
+ $11 = ((($f)) + 75|0);
+ $12 = HEAP8[$11>>0]|0;
+ $13 = $12 << 24 >> 24;
+ $14 = ($10|0)==($13|0);
+ if (!($14)) {
+ $15 = ((($7)) + 1|0);
+ HEAP32[$6>>2] = $15;
+ HEAP8[$7>>0] = $0;
+ $$0 = $10;
+ break;
+ }
+ }
+ $16 = ((($f)) + 36|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (FUNCTION_TABLE_iiii[$17 & 15]($f,$c,1)|0);
+ $19 = ($18|0)==(1);
+ if ($19) {
+ $20 = HEAP8[$c>>0]|0;
+ $21 = $20&255;
+ $$0 = $21;
+ } else {
+ $$0 = -1;
+ }
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function ___stdio_close($f) {
+ $f = $f|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $vararg_buffer = sp;
+ $0 = ((($f)) + 60|0);
+ $1 = HEAP32[$0>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $1;
+ $2 = (___syscall6(6,($vararg_buffer|0))|0);
+ $3 = (___syscall_ret($2)|0);
+ STACKTOP = sp;return ($3|0);
+}
+function ___stdio_read($f,$buf,$len) {
+ $f = $f|0;
+ $buf = $buf|0;
+ $len = $len|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, $cnt$0 = 0, $iov = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $iov = sp + 32|0;
+ HEAP32[$iov>>2] = $buf;
+ $0 = ((($iov)) + 4|0);
+ $1 = ((($f)) + 48|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)!=(0);
+ $4 = $3&1;
+ $5 = (($len) - ($4))|0;
+ HEAP32[$0>>2] = $5;
+ $6 = ((($iov)) + 8|0);
+ $7 = ((($f)) + 44|0);
+ $8 = HEAP32[$7>>2]|0;
+ HEAP32[$6>>2] = $8;
+ $9 = ((($iov)) + 12|0);
+ HEAP32[$9>>2] = $2;
+ $10 = HEAP32[6428>>2]|0;
+ $11 = ($10|0)==(0|0);
+ if ($11) {
+ $16 = ((($f)) + 60|0);
+ $17 = HEAP32[$16>>2]|0;
+ HEAP32[$vararg_buffer3>>2] = $17;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = $iov;
+ $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
+ HEAP32[$vararg_ptr7>>2] = 2;
+ $18 = (___syscall145(145,($vararg_buffer3|0))|0);
+ $19 = (___syscall_ret($18)|0);
+ $cnt$0 = $19;
+ } else {
+ _pthread_cleanup_push((27|0),($f|0));
+ $12 = ((($f)) + 60|0);
+ $13 = HEAP32[$12>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $13;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $iov;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 2;
+ $14 = (___syscall145(145,($vararg_buffer|0))|0);
+ $15 = (___syscall_ret($14)|0);
+ _pthread_cleanup_pop(0);
+ $cnt$0 = $15;
+ }
+ $20 = ($cnt$0|0)<(1);
+ if ($20) {
+ $21 = $cnt$0 & 48;
+ $22 = $21 ^ 16;
+ $23 = HEAP32[$f>>2]|0;
+ $24 = $23 | $22;
+ HEAP32[$f>>2] = $24;
+ $25 = ((($f)) + 8|0);
+ HEAP32[$25>>2] = 0;
+ $26 = ((($f)) + 4|0);
+ HEAP32[$26>>2] = 0;
+ $$0 = $cnt$0;
+ } else {
+ $27 = HEAP32[$0>>2]|0;
+ $28 = ($cnt$0>>>0)>($27>>>0);
+ if ($28) {
+ $29 = (($cnt$0) - ($27))|0;
+ $30 = HEAP32[$7>>2]|0;
+ $31 = ((($f)) + 4|0);
+ HEAP32[$31>>2] = $30;
+ $32 = $30;
+ $33 = (($32) + ($29)|0);
+ $34 = ((($f)) + 8|0);
+ HEAP32[$34>>2] = $33;
+ $35 = HEAP32[$1>>2]|0;
+ $36 = ($35|0)==(0);
+ if ($36) {
+ $$0 = $len;
+ } else {
+ $37 = ((($32)) + 1|0);
+ HEAP32[$31>>2] = $37;
+ $38 = HEAP8[$32>>0]|0;
+ $39 = (($len) + -1)|0;
+ $40 = (($buf) + ($39)|0);
+ HEAP8[$40>>0] = $38;
+ $$0 = $len;
+ }
+ } else {
+ $$0 = $cnt$0;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___stdio_seek($f,$off,$whence) {
+ $f = $f|0;
+ $off = $off|0;
+ $whence = $whence|0;
+ var $$pre = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $ret = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $vararg_buffer = sp;
+ $ret = sp + 20|0;
+ $0 = ((($f)) + 60|0);
+ $1 = HEAP32[$0>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $1;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = 0;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $off;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $ret;
+ $vararg_ptr4 = ((($vararg_buffer)) + 16|0);
+ HEAP32[$vararg_ptr4>>2] = $whence;
+ $2 = (___syscall140(140,($vararg_buffer|0))|0);
+ $3 = (___syscall_ret($2)|0);
+ $4 = ($3|0)<(0);
+ if ($4) {
+ HEAP32[$ret>>2] = -1;
+ $5 = -1;
+ } else {
+ $$pre = HEAP32[$ret>>2]|0;
+ $5 = $$pre;
+ }
+ STACKTOP = sp;return ($5|0);
+}
+function ___stdio_write($f,$buf,$len) {
+ $f = $f|0;
+ $buf = $buf|0;
+ $len = $len|0;
+ var $$0 = 0, $$phi$trans$insert = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cnt$0 = 0, $cnt$1 = 0, $iov$0 = 0, $iov$0$lcssa11 = 0, $iov$1 = 0, $iovcnt$0 = 0;
+ var $iovcnt$0$lcssa12 = 0, $iovcnt$1 = 0, $iovs = 0, $rem$0 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $iovs = sp + 32|0;
+ $0 = ((($f)) + 28|0);
+ $1 = HEAP32[$0>>2]|0;
+ HEAP32[$iovs>>2] = $1;
+ $2 = ((($iovs)) + 4|0);
+ $3 = ((($f)) + 20|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4;
+ $6 = (($5) - ($1))|0;
+ HEAP32[$2>>2] = $6;
+ $7 = ((($iovs)) + 8|0);
+ HEAP32[$7>>2] = $buf;
+ $8 = ((($iovs)) + 12|0);
+ HEAP32[$8>>2] = $len;
+ $9 = (($6) + ($len))|0;
+ $10 = ((($f)) + 60|0);
+ $11 = ((($f)) + 44|0);
+ $iov$0 = $iovs;$iovcnt$0 = 2;$rem$0 = $9;
+ while(1) {
+ $12 = HEAP32[6428>>2]|0;
+ $13 = ($12|0)==(0|0);
+ if ($13) {
+ $17 = HEAP32[$10>>2]|0;
+ HEAP32[$vararg_buffer3>>2] = $17;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = $iov$0;
+ $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
+ HEAP32[$vararg_ptr7>>2] = $iovcnt$0;
+ $18 = (___syscall146(146,($vararg_buffer3|0))|0);
+ $19 = (___syscall_ret($18)|0);
+ $cnt$0 = $19;
+ } else {
+ _pthread_cleanup_push((28|0),($f|0));
+ $14 = HEAP32[$10>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $14;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $iov$0;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $iovcnt$0;
+ $15 = (___syscall146(146,($vararg_buffer|0))|0);
+ $16 = (___syscall_ret($15)|0);
+ _pthread_cleanup_pop(0);
+ $cnt$0 = $16;
+ }
+ $20 = ($rem$0|0)==($cnt$0|0);
+ if ($20) {
+ label = 6;
+ break;
+ }
+ $27 = ($cnt$0|0)<(0);
+ if ($27) {
+ $iov$0$lcssa11 = $iov$0;$iovcnt$0$lcssa12 = $iovcnt$0;
+ label = 8;
+ break;
+ }
+ $35 = (($rem$0) - ($cnt$0))|0;
+ $36 = ((($iov$0)) + 4|0);
+ $37 = HEAP32[$36>>2]|0;
+ $38 = ($cnt$0>>>0)>($37>>>0);
+ if ($38) {
+ $39 = HEAP32[$11>>2]|0;
+ HEAP32[$0>>2] = $39;
+ HEAP32[$3>>2] = $39;
+ $40 = (($cnt$0) - ($37))|0;
+ $41 = ((($iov$0)) + 8|0);
+ $42 = (($iovcnt$0) + -1)|0;
+ $$phi$trans$insert = ((($iov$0)) + 12|0);
+ $$pre = HEAP32[$$phi$trans$insert>>2]|0;
+ $50 = $$pre;$cnt$1 = $40;$iov$1 = $41;$iovcnt$1 = $42;
+ } else {
+ $43 = ($iovcnt$0|0)==(2);
+ if ($43) {
+ $44 = HEAP32[$0>>2]|0;
+ $45 = (($44) + ($cnt$0)|0);
+ HEAP32[$0>>2] = $45;
+ $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = 2;
+ } else {
+ $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = $iovcnt$0;
+ }
+ }
+ $46 = HEAP32[$iov$1>>2]|0;
+ $47 = (($46) + ($cnt$1)|0);
+ HEAP32[$iov$1>>2] = $47;
+ $48 = ((($iov$1)) + 4|0);
+ $49 = (($50) - ($cnt$1))|0;
+ HEAP32[$48>>2] = $49;
+ $iov$0 = $iov$1;$iovcnt$0 = $iovcnt$1;$rem$0 = $35;
+ }
+ if ((label|0) == 6) {
+ $21 = HEAP32[$11>>2]|0;
+ $22 = ((($f)) + 48|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = (($21) + ($23)|0);
+ $25 = ((($f)) + 16|0);
+ HEAP32[$25>>2] = $24;
+ $26 = $21;
+ HEAP32[$0>>2] = $26;
+ HEAP32[$3>>2] = $26;
+ $$0 = $len;
+ }
+ else if ((label|0) == 8) {
+ $28 = ((($f)) + 16|0);
+ HEAP32[$28>>2] = 0;
+ HEAP32[$0>>2] = 0;
+ HEAP32[$3>>2] = 0;
+ $29 = HEAP32[$f>>2]|0;
+ $30 = $29 | 32;
+ HEAP32[$f>>2] = $30;
+ $31 = ($iovcnt$0$lcssa12|0)==(2);
+ if ($31) {
+ $$0 = 0;
+ } else {
+ $32 = ((($iov$0$lcssa11)) + 4|0);
+ $33 = HEAP32[$32>>2]|0;
+ $34 = (($len) - ($33))|0;
+ $$0 = $34;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___stdout_write($f,$buf,$len) {
+ $f = $f|0;
+ $buf = $buf|0;
+ $len = $len|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tio = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0;
+ $vararg_buffer = sp;
+ $tio = sp + 12|0;
+ $0 = ((($f)) + 36|0);
+ HEAP32[$0>>2] = 8;
+ $1 = HEAP32[$f>>2]|0;
+ $2 = $1 & 64;
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $4 = ((($f)) + 60|0);
+ $5 = HEAP32[$4>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $5;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = 21505;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $tio;
+ $6 = (___syscall54(54,($vararg_buffer|0))|0);
+ $7 = ($6|0)==(0);
+ if (!($7)) {
+ $8 = ((($f)) + 75|0);
+ HEAP8[$8>>0] = -1;
+ }
+ }
+ $9 = (___stdio_write($f,$buf,$len)|0);
+ STACKTOP = sp;return ($9|0);
+}
+function ___toread($f) {
+ $f = $f|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 74|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = $1 << 24 >> 24;
+ $3 = (($2) + 255)|0;
+ $4 = $3 | $2;
+ $5 = $4&255;
+ HEAP8[$0>>0] = $5;
+ $6 = ((($f)) + 20|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($f)) + 44|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($7>>>0)>($9>>>0);
+ if ($10) {
+ $11 = ((($f)) + 36|0);
+ $12 = HEAP32[$11>>2]|0;
+ (FUNCTION_TABLE_iiii[$12 & 15]($f,0,0)|0);
+ }
+ $13 = ((($f)) + 16|0);
+ HEAP32[$13>>2] = 0;
+ $14 = ((($f)) + 28|0);
+ HEAP32[$14>>2] = 0;
+ HEAP32[$6>>2] = 0;
+ $15 = HEAP32[$f>>2]|0;
+ $16 = $15 & 20;
+ $17 = ($16|0)==(0);
+ if ($17) {
+ $21 = HEAP32[$8>>2]|0;
+ $22 = ((($f)) + 8|0);
+ HEAP32[$22>>2] = $21;
+ $23 = ((($f)) + 4|0);
+ HEAP32[$23>>2] = $21;
+ $$0 = 0;
+ } else {
+ $18 = $15 & 4;
+ $19 = ($18|0)==(0);
+ if ($19) {
+ $$0 = -1;
+ } else {
+ $20 = $15 | 32;
+ HEAP32[$f>>2] = $20;
+ $$0 = -1;
+ }
+ }
+ return ($$0|0);
+}
+function ___towrite($f) {
+ $f = $f|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 74|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = $1 << 24 >> 24;
+ $3 = (($2) + 255)|0;
+ $4 = $3 | $2;
+ $5 = $4&255;
+ HEAP8[$0>>0] = $5;
+ $6 = HEAP32[$f>>2]|0;
+ $7 = $6 & 8;
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $10 = ((($f)) + 8|0);
+ HEAP32[$10>>2] = 0;
+ $11 = ((($f)) + 4|0);
+ HEAP32[$11>>2] = 0;
+ $12 = ((($f)) + 44|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ((($f)) + 28|0);
+ HEAP32[$14>>2] = $13;
+ $15 = ((($f)) + 20|0);
+ HEAP32[$15>>2] = $13;
+ $16 = $13;
+ $17 = ((($f)) + 48|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = (($16) + ($18)|0);
+ $20 = ((($f)) + 16|0);
+ HEAP32[$20>>2] = $19;
+ $$0 = 0;
+ } else {
+ $9 = $6 | 32;
+ HEAP32[$f>>2] = $9;
+ $$0 = -1;
+ }
+ return ($$0|0);
+}
+function ___uflow($f) {
+ $f = $f|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0;
+ $c = sp;
+ $0 = ((($f)) + 8|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if ($2) {
+ $3 = (___toread($f)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ label = 3;
+ } else {
+ $$0 = -1;
+ }
+ } else {
+ label = 3;
+ }
+ if ((label|0) == 3) {
+ $5 = ((($f)) + 32|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = (FUNCTION_TABLE_iiii[$6 & 15]($f,$c,1)|0);
+ $8 = ($7|0)==(1);
+ if ($8) {
+ $9 = HEAP8[$c>>0]|0;
+ $10 = $9&255;
+ $$0 = $10;
+ } else {
+ $$0 = -1;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _memchr($src,$c,$n) {
+ $src = $src|0;
+ $c = $c|0;
+ $n = $n|0;
+ var $$0$lcssa = 0, $$0$lcssa44 = 0, $$019 = 0, $$1$lcssa = 0, $$110 = 0, $$110$lcssa = 0, $$24 = 0, $$3 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
+ var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
+ var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, $s$0$lcssa = 0, $s$0$lcssa43 = 0, $s$020 = 0, $s$15 = 0, $s$2 = 0, $w$0$lcssa = 0, $w$011 = 0, $w$011$lcssa = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $c & 255;
+ $1 = $src;
+ $2 = $1 & 3;
+ $3 = ($2|0)!=(0);
+ $4 = ($n|0)!=(0);
+ $or$cond18 = $4 & $3;
+ L1: do {
+ if ($or$cond18) {
+ $5 = $c&255;
+ $$019 = $n;$s$020 = $src;
+ while(1) {
+ $6 = HEAP8[$s$020>>0]|0;
+ $7 = ($6<<24>>24)==($5<<24>>24);
+ if ($7) {
+ $$0$lcssa44 = $$019;$s$0$lcssa43 = $s$020;
+ label = 6;
+ break L1;
+ }
+ $8 = ((($s$020)) + 1|0);
+ $9 = (($$019) + -1)|0;
+ $10 = $8;
+ $11 = $10 & 3;
+ $12 = ($11|0)!=(0);
+ $13 = ($9|0)!=(0);
+ $or$cond = $13 & $12;
+ if ($or$cond) {
+ $$019 = $9;$s$020 = $8;
+ } else {
+ $$0$lcssa = $9;$$lcssa = $13;$s$0$lcssa = $8;
+ label = 5;
+ break;
+ }
+ }
+ } else {
+ $$0$lcssa = $n;$$lcssa = $4;$s$0$lcssa = $src;
+ label = 5;
+ }
+ } while(0);
+ if ((label|0) == 5) {
+ if ($$lcssa) {
+ $$0$lcssa44 = $$0$lcssa;$s$0$lcssa43 = $s$0$lcssa;
+ label = 6;
+ } else {
+ $$3 = 0;$s$2 = $s$0$lcssa;
+ }
+ }
+ L8: do {
+ if ((label|0) == 6) {
+ $14 = HEAP8[$s$0$lcssa43>>0]|0;
+ $15 = $c&255;
+ $16 = ($14<<24>>24)==($15<<24>>24);
+ if ($16) {
+ $$3 = $$0$lcssa44;$s$2 = $s$0$lcssa43;
+ } else {
+ $17 = Math_imul($0, 16843009)|0;
+ $18 = ($$0$lcssa44>>>0)>(3);
+ L11: do {
+ if ($18) {
+ $$110 = $$0$lcssa44;$w$011 = $s$0$lcssa43;
+ while(1) {
+ $19 = HEAP32[$w$011>>2]|0;
+ $20 = $19 ^ $17;
+ $21 = (($20) + -16843009)|0;
+ $22 = $20 & -2139062144;
+ $23 = $22 ^ -2139062144;
+ $24 = $23 & $21;
+ $25 = ($24|0)==(0);
+ if (!($25)) {
+ $$110$lcssa = $$110;$w$011$lcssa = $w$011;
+ break;
+ }
+ $26 = ((($w$011)) + 4|0);
+ $27 = (($$110) + -4)|0;
+ $28 = ($27>>>0)>(3);
+ if ($28) {
+ $$110 = $27;$w$011 = $26;
+ } else {
+ $$1$lcssa = $27;$w$0$lcssa = $26;
+ label = 11;
+ break L11;
+ }
+ }
+ $$24 = $$110$lcssa;$s$15 = $w$011$lcssa;
+ } else {
+ $$1$lcssa = $$0$lcssa44;$w$0$lcssa = $s$0$lcssa43;
+ label = 11;
+ }
+ } while(0);
+ if ((label|0) == 11) {
+ $29 = ($$1$lcssa|0)==(0);
+ if ($29) {
+ $$3 = 0;$s$2 = $w$0$lcssa;
+ break;
+ } else {
+ $$24 = $$1$lcssa;$s$15 = $w$0$lcssa;
+ }
+ }
+ while(1) {
+ $30 = HEAP8[$s$15>>0]|0;
+ $31 = ($30<<24>>24)==($15<<24>>24);
+ if ($31) {
+ $$3 = $$24;$s$2 = $s$15;
+ break L8;
+ }
+ $32 = ((($s$15)) + 1|0);
+ $33 = (($$24) + -1)|0;
+ $34 = ($33|0)==(0);
+ if ($34) {
+ $$3 = 0;$s$2 = $32;
+ break;
+ } else {
+ $$24 = $33;$s$15 = $32;
+ }
+ }
+ }
+ }
+ } while(0);
+ $35 = ($$3|0)!=(0);
+ $36 = $35 ? $s$2 : 0;
+ return ($36|0);
+}
+function _memcmp($vl,$vr,$n) {
+ $vl = $vl|0;
+ $vr = $vr|0;
+ $n = $n|0;
+ var $$03 = 0, $$lcssa = 0, $$lcssa19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $l$04 = 0, $r$05 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($n|0)==(0);
+ L1: do {
+ if ($0) {
+ $11 = 0;
+ } else {
+ $$03 = $n;$l$04 = $vl;$r$05 = $vr;
+ while(1) {
+ $1 = HEAP8[$l$04>>0]|0;
+ $2 = HEAP8[$r$05>>0]|0;
+ $3 = ($1<<24>>24)==($2<<24>>24);
+ if (!($3)) {
+ $$lcssa = $1;$$lcssa19 = $2;
+ break;
+ }
+ $4 = (($$03) + -1)|0;
+ $5 = ((($l$04)) + 1|0);
+ $6 = ((($r$05)) + 1|0);
+ $7 = ($4|0)==(0);
+ if ($7) {
+ $11 = 0;
+ break L1;
+ } else {
+ $$03 = $4;$l$04 = $5;$r$05 = $6;
+ }
+ }
+ $8 = $$lcssa&255;
+ $9 = $$lcssa19&255;
+ $10 = (($8) - ($9))|0;
+ $11 = $10;
+ }
+ } while(0);
+ return ($11|0);
+}
+function ___memrchr($m,$c,$n) {
+ $m = $m|0;
+ $c = $c|0;
+ $n = $n|0;
+ var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $c&255;
+ $$01 = $n;
+ while(1) {
+ $1 = (($$01) + -1)|0;
+ $2 = ($$01|0)==(0);
+ if ($2) {
+ $$0 = 0;
+ break;
+ }
+ $3 = (($m) + ($1)|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = ($4<<24>>24)==($0<<24>>24);
+ if ($5) {
+ $$0 = $3;
+ break;
+ } else {
+ $$01 = $1;
+ }
+ }
+ return ($$0|0);
+}
+function ___stpcpy($d,$s) {
+ $d = $d|0;
+ $s = $s|0;
+ var $$0$lcssa = 0, $$01$lcssa = 0, $$0115 = 0, $$016 = 0, $$03 = 0, $$1$ph = 0, $$12$ph = 0, $$128 = 0, $$19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
+ var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $wd$0$lcssa = 0, $wd$010 = 0, $ws$0$lcssa = 0, $ws$011 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $s;
+ $1 = $d;
+ $2 = $0 ^ $1;
+ $3 = $2 & 3;
+ $4 = ($3|0)==(0);
+ L1: do {
+ if ($4) {
+ $5 = $0 & 3;
+ $6 = ($5|0)==(0);
+ if ($6) {
+ $$0$lcssa = $s;$$01$lcssa = $d;
+ } else {
+ $$0115 = $d;$$016 = $s;
+ while(1) {
+ $7 = HEAP8[$$016>>0]|0;
+ HEAP8[$$0115>>0] = $7;
+ $8 = ($7<<24>>24)==(0);
+ if ($8) {
+ $$03 = $$0115;
+ break L1;
+ }
+ $9 = ((($$016)) + 1|0);
+ $10 = ((($$0115)) + 1|0);
+ $11 = $9;
+ $12 = $11 & 3;
+ $13 = ($12|0)==(0);
+ if ($13) {
+ $$0$lcssa = $9;$$01$lcssa = $10;
+ break;
+ } else {
+ $$0115 = $10;$$016 = $9;
+ }
+ }
+ }
+ $14 = HEAP32[$$0$lcssa>>2]|0;
+ $15 = (($14) + -16843009)|0;
+ $16 = $14 & -2139062144;
+ $17 = $16 ^ -2139062144;
+ $18 = $17 & $15;
+ $19 = ($18|0)==(0);
+ if ($19) {
+ $22 = $14;$wd$010 = $$01$lcssa;$ws$011 = $$0$lcssa;
+ while(1) {
+ $20 = ((($ws$011)) + 4|0);
+ $21 = ((($wd$010)) + 4|0);
+ HEAP32[$wd$010>>2] = $22;
+ $23 = HEAP32[$20>>2]|0;
+ $24 = (($23) + -16843009)|0;
+ $25 = $23 & -2139062144;
+ $26 = $25 ^ -2139062144;
+ $27 = $26 & $24;
+ $28 = ($27|0)==(0);
+ if ($28) {
+ $22 = $23;$wd$010 = $21;$ws$011 = $20;
+ } else {
+ $wd$0$lcssa = $21;$ws$0$lcssa = $20;
+ break;
+ }
+ }
+ } else {
+ $wd$0$lcssa = $$01$lcssa;$ws$0$lcssa = $$0$lcssa;
+ }
+ $$1$ph = $ws$0$lcssa;$$12$ph = $wd$0$lcssa;
+ label = 8;
+ } else {
+ $$1$ph = $s;$$12$ph = $d;
+ label = 8;
+ }
+ } while(0);
+ if ((label|0) == 8) {
+ $29 = HEAP8[$$1$ph>>0]|0;
+ HEAP8[$$12$ph>>0] = $29;
+ $30 = ($29<<24>>24)==(0);
+ if ($30) {
+ $$03 = $$12$ph;
+ } else {
+ $$128 = $$12$ph;$$19 = $$1$ph;
+ while(1) {
+ $31 = ((($$19)) + 1|0);
+ $32 = ((($$128)) + 1|0);
+ $33 = HEAP8[$31>>0]|0;
+ HEAP8[$32>>0] = $33;
+ $34 = ($33<<24>>24)==(0);
+ if ($34) {
+ $$03 = $32;
+ break;
+ } else {
+ $$128 = $32;$$19 = $31;
+ }
+ }
+ }
+ }
+ return ($$03|0);
+}
+function _strchr($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (___strchrnul($s,$c)|0);
+ $1 = HEAP8[$0>>0]|0;
+ $2 = $c&255;
+ $3 = ($1<<24>>24)==($2<<24>>24);
+ $4 = $3 ? $0 : 0;
+ return ($4|0);
+}
+function ___strchrnul($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $$0 = 0, $$02$lcssa = 0, $$0211 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond5 = 0, $w$0$lcssa = 0, $w$08 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $c & 255;
+ $1 = ($0|0)==(0);
+ L1: do {
+ if ($1) {
+ $6 = (_strlen($s)|0);
+ $7 = (($s) + ($6)|0);
+ $$0 = $7;
+ } else {
+ $2 = $s;
+ $3 = $2 & 3;
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $$02$lcssa = $s;
+ } else {
+ $5 = $c&255;
+ $$0211 = $s;
+ while(1) {
+ $8 = HEAP8[$$0211>>0]|0;
+ $9 = ($8<<24>>24)==(0);
+ $10 = ($8<<24>>24)==($5<<24>>24);
+ $or$cond = $9 | $10;
+ if ($or$cond) {
+ $$0 = $$0211;
+ break L1;
+ }
+ $11 = ((($$0211)) + 1|0);
+ $12 = $11;
+ $13 = $12 & 3;
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $$02$lcssa = $11;
+ break;
+ } else {
+ $$0211 = $11;
+ }
+ }
+ }
+ $15 = Math_imul($0, 16843009)|0;
+ $16 = HEAP32[$$02$lcssa>>2]|0;
+ $17 = (($16) + -16843009)|0;
+ $18 = $16 & -2139062144;
+ $19 = $18 ^ -2139062144;
+ $20 = $19 & $17;
+ $21 = ($20|0)==(0);
+ L10: do {
+ if ($21) {
+ $23 = $16;$w$08 = $$02$lcssa;
+ while(1) {
+ $22 = $23 ^ $15;
+ $24 = (($22) + -16843009)|0;
+ $25 = $22 & -2139062144;
+ $26 = $25 ^ -2139062144;
+ $27 = $26 & $24;
+ $28 = ($27|0)==(0);
+ if (!($28)) {
+ $w$0$lcssa = $w$08;
+ break L10;
+ }
+ $29 = ((($w$08)) + 4|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = (($30) + -16843009)|0;
+ $32 = $30 & -2139062144;
+ $33 = $32 ^ -2139062144;
+ $34 = $33 & $31;
+ $35 = ($34|0)==(0);
+ if ($35) {
+ $23 = $30;$w$08 = $29;
+ } else {
+ $w$0$lcssa = $29;
+ break;
+ }
+ }
+ } else {
+ $w$0$lcssa = $$02$lcssa;
+ }
+ } while(0);
+ $36 = $c&255;
+ $$1 = $w$0$lcssa;
+ while(1) {
+ $37 = HEAP8[$$1>>0]|0;
+ $38 = ($37<<24>>24)==(0);
+ $39 = ($37<<24>>24)==($36<<24>>24);
+ $or$cond5 = $38 | $39;
+ $40 = ((($$1)) + 1|0);
+ if ($or$cond5) {
+ $$0 = $$1;
+ break;
+ } else {
+ $$1 = $40;
+ }
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _strcmp($l,$r) {
+ $l = $l|0;
+ $r = $r|0;
+ var $$014 = 0, $$05 = 0, $$lcssa = 0, $$lcssa2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP8[$l>>0]|0;
+ $1 = HEAP8[$r>>0]|0;
+ $2 = ($0<<24>>24)!=($1<<24>>24);
+ $3 = ($0<<24>>24)==(0);
+ $or$cond3 = $3 | $2;
+ if ($or$cond3) {
+ $$lcssa = $0;$$lcssa2 = $1;
+ } else {
+ $$014 = $l;$$05 = $r;
+ while(1) {
+ $4 = ((($$014)) + 1|0);
+ $5 = ((($$05)) + 1|0);
+ $6 = HEAP8[$4>>0]|0;
+ $7 = HEAP8[$5>>0]|0;
+ $8 = ($6<<24>>24)!=($7<<24>>24);
+ $9 = ($6<<24>>24)==(0);
+ $or$cond = $9 | $8;
+ if ($or$cond) {
+ $$lcssa = $6;$$lcssa2 = $7;
+ break;
+ } else {
+ $$014 = $4;$$05 = $5;
+ }
+ }
+ }
+ $10 = $$lcssa&255;
+ $11 = $$lcssa2&255;
+ $12 = (($10) - ($11))|0;
+ return ($12|0);
+}
+function _strcpy($dest,$src) {
+ $dest = $dest|0;
+ $src = $src|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ (___stpcpy($dest,$src)|0);
+ return ($dest|0);
+}
+function _strcspn($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $$0 = 0, $$027 = 0, $$03$lcssa = 0, $$035 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $byteset = sp;
+ $0 = HEAP8[$c>>0]|0;
+ $1 = ($0<<24>>24)==(0);
+ if ($1) {
+ label = 3;
+ } else {
+ $2 = ((($c)) + 1|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ($3<<24>>24)==(0);
+ if ($4) {
+ label = 3;
+ } else {
+ ;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0;
+ $$027 = $c;$13 = $0;
+ while(1) {
+ $12 = $13 & 31;
+ $14 = $12&255;
+ $15 = 1 << $14;
+ $div4 = ($13&255) >>> 5;
+ $16 = $div4&255;
+ $17 = (($byteset) + ($16<<2)|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = $18 | $15;
+ HEAP32[$17>>2] = $19;
+ $20 = ((($$027)) + 1|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)==(0);
+ if ($22) {
+ break;
+ } else {
+ $$027 = $20;$13 = $21;
+ }
+ }
+ $10 = HEAP8[$s>>0]|0;
+ $11 = ($10<<24>>24)==(0);
+ L7: do {
+ if ($11) {
+ $$03$lcssa = $s;
+ } else {
+ $$035 = $s;$23 = $10;
+ while(1) {
+ $div = ($23&255) >>> 5;
+ $24 = $div&255;
+ $25 = (($byteset) + ($24<<2)|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = $23 & 31;
+ $28 = $27&255;
+ $29 = 1 << $28;
+ $30 = $26 & $29;
+ $31 = ($30|0)==(0);
+ if (!($31)) {
+ $$03$lcssa = $$035;
+ break L7;
+ }
+ $32 = ((($$035)) + 1|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = ($33<<24>>24)==(0);
+ if ($34) {
+ $$03$lcssa = $32;
+ break;
+ } else {
+ $$035 = $32;$23 = $33;
+ }
+ }
+ }
+ } while(0);
+ $35 = $$03$lcssa;
+ $36 = $s;
+ $37 = (($35) - ($36))|0;
+ $$0 = $37;
+ }
+ }
+ if ((label|0) == 3) {
+ $5 = $0 << 24 >> 24;
+ $6 = (___strchrnul($s,$5)|0);
+ $7 = $6;
+ $8 = $s;
+ $9 = (($7) - ($8))|0;
+ $$0 = $9;
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _strlen($s) {
+ $s = $s|0;
+ var $$0 = 0, $$01$lcssa = 0, $$014 = 0, $$1$lcssa = 0, $$lcssa20 = 0, $$pn = 0, $$pn15 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $w$0 = 0, $w$0$lcssa = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = $s;
+ $1 = $0 & 3;
+ $2 = ($1|0)==(0);
+ L1: do {
+ if ($2) {
+ $$01$lcssa = $s;
+ label = 4;
+ } else {
+ $$014 = $s;$21 = $0;
+ while(1) {
+ $3 = HEAP8[$$014>>0]|0;
+ $4 = ($3<<24>>24)==(0);
+ if ($4) {
+ $$pn = $21;
+ break L1;
+ }
+ $5 = ((($$014)) + 1|0);
+ $6 = $5;
+ $7 = $6 & 3;
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $$01$lcssa = $5;
+ label = 4;
+ break;
+ } else {
+ $$014 = $5;$21 = $6;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 4) {
+ $w$0 = $$01$lcssa;
+ while(1) {
+ $9 = HEAP32[$w$0>>2]|0;
+ $10 = (($9) + -16843009)|0;
+ $11 = $9 & -2139062144;
+ $12 = $11 ^ -2139062144;
+ $13 = $12 & $10;
+ $14 = ($13|0)==(0);
+ $15 = ((($w$0)) + 4|0);
+ if ($14) {
+ $w$0 = $15;
+ } else {
+ $$lcssa20 = $9;$w$0$lcssa = $w$0;
+ break;
+ }
+ }
+ $16 = $$lcssa20&255;
+ $17 = ($16<<24>>24)==(0);
+ if ($17) {
+ $$1$lcssa = $w$0$lcssa;
+ } else {
+ $$pn15 = $w$0$lcssa;
+ while(1) {
+ $18 = ((($$pn15)) + 1|0);
+ $$pre = HEAP8[$18>>0]|0;
+ $19 = ($$pre<<24>>24)==(0);
+ if ($19) {
+ $$1$lcssa = $18;
+ break;
+ } else {
+ $$pn15 = $18;
+ }
+ }
+ }
+ $20 = $$1$lcssa;
+ $$pn = $20;
+ }
+ $$0 = (($$pn) - ($0))|0;
+ return ($$0|0);
+}
+function _strncmp($_l,$_r,$n) {
+ $_l = $_l|0;
+ $_r = $_r|0;
+ $n = $n|0;
+ var $$03 = 0, $$08 = 0, $$08$in = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var $l$06 = 0, $or$cond = 0, $or$cond4 = 0, $r$0$lcssa = 0, $r$07 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($n|0)==(0);
+ if ($0) {
+ $$03 = 0;
+ } else {
+ $1 = HEAP8[$_l>>0]|0;
+ $2 = ($1<<24>>24)==(0);
+ L3: do {
+ if ($2) {
+ $13 = 0;$r$0$lcssa = $_r;
+ } else {
+ $$08$in = $n;$6 = $1;$l$06 = $_l;$r$07 = $_r;
+ while(1) {
+ $$08 = (($$08$in) + -1)|0;
+ $3 = HEAP8[$r$07>>0]|0;
+ $4 = ($3<<24>>24)!=(0);
+ $5 = ($$08|0)!=(0);
+ $or$cond = $5 & $4;
+ $7 = ($6<<24>>24)==($3<<24>>24);
+ $or$cond4 = $7 & $or$cond;
+ if (!($or$cond4)) {
+ $13 = $6;$r$0$lcssa = $r$07;
+ break L3;
+ }
+ $8 = ((($l$06)) + 1|0);
+ $9 = ((($r$07)) + 1|0);
+ $10 = HEAP8[$8>>0]|0;
+ $11 = ($10<<24>>24)==(0);
+ if ($11) {
+ $13 = 0;$r$0$lcssa = $9;
+ break;
+ } else {
+ $$08$in = $$08;$6 = $10;$l$06 = $8;$r$07 = $9;
+ }
+ }
+ }
+ } while(0);
+ $12 = $13&255;
+ $14 = HEAP8[$r$0$lcssa>>0]|0;
+ $15 = $14&255;
+ $16 = (($12) - ($15))|0;
+ $$03 = $16;
+ }
+ return ($$03|0);
+}
+function _strrchr($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_strlen($s)|0);
+ $1 = (($0) + 1)|0;
+ $2 = (___memrchr($s,$c,$1)|0);
+ return ($2|0);
+}
+function _strspn($s,$c) {
+ $s = $s|0;
+ $c = $c|0;
+ var $$0 = 0, $$028 = 0, $$03 = 0, $$03$lcssa = 0, $$1$lcssa = 0, $$16 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0;
+ $byteset = sp;
+ ;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0;
+ $0 = HEAP8[$c>>0]|0;
+ $1 = ($0<<24>>24)==(0);
+ do {
+ if ($1) {
+ $$0 = 0;
+ } else {
+ $2 = ((($c)) + 1|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ($3<<24>>24)==(0);
+ if ($4) {
+ $$03 = $s;
+ while(1) {
+ $5 = HEAP8[$$03>>0]|0;
+ $6 = ($5<<24>>24)==($0<<24>>24);
+ $7 = ((($$03)) + 1|0);
+ if ($6) {
+ $$03 = $7;
+ } else {
+ $$03$lcssa = $$03;
+ break;
+ }
+ }
+ $8 = $$03$lcssa;
+ $9 = $s;
+ $10 = (($8) - ($9))|0;
+ $$0 = $10;
+ break;
+ } else {
+ $$028 = $c;$14 = $0;
+ }
+ while(1) {
+ $13 = $14 & 31;
+ $15 = $13&255;
+ $16 = 1 << $15;
+ $div4 = ($14&255) >>> 5;
+ $17 = $div4&255;
+ $18 = (($byteset) + ($17<<2)|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = $19 | $16;
+ HEAP32[$18>>2] = $20;
+ $21 = ((($$028)) + 1|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = ($22<<24>>24)==(0);
+ if ($23) {
+ break;
+ } else {
+ $$028 = $21;$14 = $22;
+ }
+ }
+ $11 = HEAP8[$s>>0]|0;
+ $12 = ($11<<24>>24)==(0);
+ L10: do {
+ if ($12) {
+ $$1$lcssa = $s;
+ } else {
+ $$16 = $s;$24 = $11;
+ while(1) {
+ $div = ($24&255) >>> 5;
+ $25 = $div&255;
+ $26 = (($byteset) + ($25<<2)|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = $24 & 31;
+ $29 = $28&255;
+ $30 = 1 << $29;
+ $31 = $27 & $30;
+ $32 = ($31|0)==(0);
+ if ($32) {
+ $$1$lcssa = $$16;
+ break L10;
+ }
+ $33 = ((($$16)) + 1|0);
+ $34 = HEAP8[$33>>0]|0;
+ $35 = ($34<<24>>24)==(0);
+ if ($35) {
+ $$1$lcssa = $33;
+ break;
+ } else {
+ $$16 = $33;$24 = $34;
+ }
+ }
+ }
+ } while(0);
+ $36 = $$1$lcssa;
+ $37 = $s;
+ $38 = (($36) - ($37))|0;
+ $$0 = $38;
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function _strstr($h,$n) {
+ $h = $h|0;
+ $n = $n|0;
+ var $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$0$lcssa$i11 = 0, $$01$i = 0, $$02$i = 0, $$02$i7 = 0, $$03$i = 0, $$lcssa$i = 0, $$lcssa$i10 = 0, $$lcssa$i4 = 0, $$lcssa281 = 0, $$lcssa284 = 0, $$lcssa287 = 0, $$lcssa301 = 0, $$lcssa304 = 0, $$lcssa307 = 0, $$lcssa322 = 0, $$pr$i = 0, $0 = 0;
+ var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
+ var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
+ var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
+ var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
+ var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
+ var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
+ var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
+ var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $233$phi = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
+ var $byteset$i = 0, $div$i = 0, $div4$i = 0, $hw$0$in2$i = 0, $hw$03$i = 0, $hw$03$i6 = 0, $ip$0$ph$lcssa$i = 0, $ip$0$ph$lcssa143$i = 0, $ip$0$ph76$i = 0, $ip$1$ip$0$$i = 0, $ip$1$ip$0$i = 0, $ip$1$ph$lcssa$i = 0, $ip$1$ph55$i = 0, $jp$0$ph13$ph70$i = 0, $jp$0$ph1365$i = 0, $jp$0$ph1365$i$lcssa = 0, $jp$0$ph1365$i$lcssa$lcssa = 0, $jp$0$ph77$i = 0, $jp$1$ph56$i = 0, $jp$1$ph9$ph49$i = 0;
+ var $jp$1$ph944$i = 0, $jp$1$ph944$i$lcssa = 0, $jp$1$ph944$i$lcssa$lcssa = 0, $k$059$i = 0, $k$139$i = 0, $k$2$i = 0, $k$338$i = 0, $k$338$i$lcssa = 0, $k$4$i = 0, $l$080$i = 0, $l$080$i$lcssa321 = 0, $mem$0$i = 0, $mem0$0$i = 0, $or$cond$i = 0, $or$cond$i2 = 0, $or$cond$i8 = 0, $or$cond5$i = 0, $p$0$ph$ph$lcssa32$i = 0, $p$0$ph$ph$lcssa32147$i = 0, $p$0$ph$ph71$i = 0;
+ var $p$1$p$0$i = 0, $p$1$ph$ph$lcssa23$i = 0, $p$1$ph$ph50$i = 0, $p$3$i = 0, $shift$i = 0, $z$0$i = 0, $z$1$i = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1056|0;
+ $byteset$i = sp + 1024|0;
+ $shift$i = sp;
+ $0 = HEAP8[$n>>0]|0;
+ $1 = ($0<<24>>24)==(0);
+ do {
+ if ($1) {
+ $$0 = $h;
+ } else {
+ $2 = $0 << 24 >> 24;
+ $3 = (_strchr($h,$2)|0);
+ $4 = ($3|0)==(0|0);
+ if ($4) {
+ $$0 = 0;
+ } else {
+ $5 = ((($n)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ($6<<24>>24)==(0);
+ if ($7) {
+ $$0 = $3;
+ } else {
+ $8 = ((($3)) + 1|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)==(0);
+ if ($10) {
+ $$0 = 0;
+ } else {
+ $11 = ((($n)) + 2|0);
+ $12 = HEAP8[$11>>0]|0;
+ $13 = ($12<<24>>24)==(0);
+ if ($13) {
+ $14 = $0&255;
+ $15 = $14 << 8;
+ $16 = $6&255;
+ $17 = $16 | $15;
+ $18 = HEAP8[$3>>0]|0;
+ $19 = $18&255;
+ $20 = $19 << 8;
+ $21 = $9&255;
+ $22 = $20 | $21;
+ $$01$i = $8;$232 = $9;$233 = $3;$hw$0$in2$i = $22;
+ while(1) {
+ $23 = $hw$0$in2$i & 65535;
+ $24 = ($23|0)==($17|0);
+ if ($24) {
+ $$lcssa$i = $233;$31 = $232;
+ break;
+ }
+ $25 = $23 << 8;
+ $26 = ((($$01$i)) + 1|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = $27&255;
+ $29 = $28 | $25;
+ $30 = ($27<<24>>24)==(0);
+ if ($30) {
+ $$lcssa$i = $$01$i;$31 = 0;
+ break;
+ } else {
+ $233$phi = $$01$i;$$01$i = $26;$232 = $27;$hw$0$in2$i = $29;$233 = $233$phi;
+ }
+ }
+ $32 = ($31<<24>>24)!=(0);
+ $33 = $32 ? $$lcssa$i : 0;
+ $$0 = $33;
+ break;
+ }
+ $34 = ((($3)) + 2|0);
+ $35 = HEAP8[$34>>0]|0;
+ $36 = ($35<<24>>24)==(0);
+ if ($36) {
+ $$0 = 0;
+ } else {
+ $37 = ((($n)) + 3|0);
+ $38 = HEAP8[$37>>0]|0;
+ $39 = ($38<<24>>24)==(0);
+ if ($39) {
+ $40 = $0&255;
+ $41 = $40 << 24;
+ $42 = $6&255;
+ $43 = $42 << 16;
+ $44 = $43 | $41;
+ $45 = $12&255;
+ $46 = $45 << 8;
+ $47 = $44 | $46;
+ $48 = HEAP8[$3>>0]|0;
+ $49 = $48&255;
+ $50 = $49 << 24;
+ $51 = $9&255;
+ $52 = $51 << 16;
+ $53 = $35&255;
+ $54 = $53 << 8;
+ $55 = $54 | $52;
+ $56 = $55 | $50;
+ $57 = ($56|0)==($47|0);
+ if ($57) {
+ $$0$lcssa$i = $34;$$lcssa$i4 = $35;
+ } else {
+ $$02$i = $34;$hw$03$i = $56;
+ while(1) {
+ $58 = ((($$02$i)) + 1|0);
+ $59 = HEAP8[$58>>0]|0;
+ $60 = $59&255;
+ $61 = $60 | $hw$03$i;
+ $62 = $61 << 8;
+ $63 = ($59<<24>>24)==(0);
+ $64 = ($62|0)==($47|0);
+ $or$cond$i2 = $63 | $64;
+ if ($or$cond$i2) {
+ $$0$lcssa$i = $58;$$lcssa$i4 = $59;
+ break;
+ } else {
+ $$02$i = $58;$hw$03$i = $62;
+ }
+ }
+ }
+ $65 = ($$lcssa$i4<<24>>24)!=(0);
+ $66 = ((($$0$lcssa$i)) + -2|0);
+ $67 = $65 ? $66 : 0;
+ $$0 = $67;
+ break;
+ }
+ $68 = ((($3)) + 3|0);
+ $69 = HEAP8[$68>>0]|0;
+ $70 = ($69<<24>>24)==(0);
+ if ($70) {
+ $$0 = 0;
+ } else {
+ $71 = ((($n)) + 4|0);
+ $72 = HEAP8[$71>>0]|0;
+ $73 = ($72<<24>>24)==(0);
+ if ($73) {
+ $74 = $0&255;
+ $75 = $74 << 24;
+ $76 = $6&255;
+ $77 = $76 << 16;
+ $78 = $77 | $75;
+ $79 = $12&255;
+ $80 = $79 << 8;
+ $81 = $78 | $80;
+ $82 = $38&255;
+ $83 = $81 | $82;
+ $84 = HEAP8[$3>>0]|0;
+ $85 = $84&255;
+ $86 = $85 << 24;
+ $87 = $9&255;
+ $88 = $87 << 16;
+ $89 = $35&255;
+ $90 = $89 << 8;
+ $91 = $69&255;
+ $92 = $90 | $88;
+ $93 = $92 | $91;
+ $94 = $93 | $86;
+ $95 = ($94|0)==($83|0);
+ if ($95) {
+ $$0$lcssa$i11 = $68;$$lcssa$i10 = $69;
+ } else {
+ $$02$i7 = $68;$hw$03$i6 = $94;
+ while(1) {
+ $96 = $hw$03$i6 << 8;
+ $97 = ((($$02$i7)) + 1|0);
+ $98 = HEAP8[$97>>0]|0;
+ $99 = $98&255;
+ $100 = $99 | $96;
+ $101 = ($98<<24>>24)==(0);
+ $102 = ($100|0)==($83|0);
+ $or$cond$i8 = $101 | $102;
+ if ($or$cond$i8) {
+ $$0$lcssa$i11 = $97;$$lcssa$i10 = $98;
+ break;
+ } else {
+ $$02$i7 = $97;$hw$03$i6 = $100;
+ }
+ }
+ }
+ $103 = ($$lcssa$i10<<24>>24)!=(0);
+ $104 = ((($$0$lcssa$i11)) + -3|0);
+ $105 = $103 ? $104 : 0;
+ $$0 = $105;
+ break;
+ }
+ ;HEAP32[$byteset$i>>2]=0|0;HEAP32[$byteset$i+4>>2]=0|0;HEAP32[$byteset$i+8>>2]=0|0;HEAP32[$byteset$i+12>>2]=0|0;HEAP32[$byteset$i+16>>2]=0|0;HEAP32[$byteset$i+20>>2]=0|0;HEAP32[$byteset$i+24>>2]=0|0;HEAP32[$byteset$i+28>>2]=0|0;
+ $110 = $0;$l$080$i = 0;
+ while(1) {
+ $106 = (($3) + ($l$080$i)|0);
+ $107 = HEAP8[$106>>0]|0;
+ $108 = ($107<<24>>24)==(0);
+ if ($108) {
+ $$0$i = 0;
+ break;
+ }
+ $109 = $110 & 31;
+ $111 = $109&255;
+ $112 = 1 << $111;
+ $div4$i = ($110&255) >>> 5;
+ $113 = $div4$i&255;
+ $114 = (($byteset$i) + ($113<<2)|0);
+ $115 = HEAP32[$114>>2]|0;
+ $116 = $115 | $112;
+ HEAP32[$114>>2] = $116;
+ $117 = (($l$080$i) + 1)|0;
+ $118 = $110&255;
+ $119 = (($shift$i) + ($118<<2)|0);
+ HEAP32[$119>>2] = $117;
+ $120 = (($n) + ($117)|0);
+ $121 = HEAP8[$120>>0]|0;
+ $122 = ($121<<24>>24)==(0);
+ if ($122) {
+ $$lcssa322 = $117;$l$080$i$lcssa321 = $l$080$i;
+ label = 23;
+ break;
+ } else {
+ $110 = $121;$l$080$i = $117;
+ }
+ }
+ L32: do {
+ if ((label|0) == 23) {
+ $123 = ($$lcssa322>>>0)>(1);
+ L34: do {
+ if ($123) {
+ $234 = 1;$ip$0$ph76$i = -1;$jp$0$ph77$i = 0;
+ L35: while(1) {
+ $235 = $234;$jp$0$ph13$ph70$i = $jp$0$ph77$i;$p$0$ph$ph71$i = 1;
+ while(1) {
+ $236 = $235;$jp$0$ph1365$i = $jp$0$ph13$ph70$i;
+ L39: while(1) {
+ $133 = $236;$k$059$i = 1;
+ while(1) {
+ $129 = (($k$059$i) + ($ip$0$ph76$i))|0;
+ $130 = (($n) + ($129)|0);
+ $131 = HEAP8[$130>>0]|0;
+ $132 = (($n) + ($133)|0);
+ $134 = HEAP8[$132>>0]|0;
+ $135 = ($131<<24>>24)==($134<<24>>24);
+ if (!($135)) {
+ $$lcssa301 = $133;$$lcssa304 = $131;$$lcssa307 = $134;$jp$0$ph1365$i$lcssa = $jp$0$ph1365$i;
+ break L39;
+ }
+ $136 = ($k$059$i|0)==($p$0$ph$ph71$i|0);
+ $127 = (($k$059$i) + 1)|0;
+ if ($136) {
+ break;
+ }
+ $126 = (($127) + ($jp$0$ph1365$i))|0;
+ $128 = ($126>>>0)<($$lcssa322>>>0);
+ if ($128) {
+ $133 = $126;$k$059$i = $127;
+ } else {
+ $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i;
+ break L35;
+ }
+ }
+ $137 = (($jp$0$ph1365$i) + ($p$0$ph$ph71$i))|0;
+ $138 = (($137) + 1)|0;
+ $139 = ($138>>>0)<($$lcssa322>>>0);
+ if ($139) {
+ $236 = $138;$jp$0$ph1365$i = $137;
+ } else {
+ $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i;
+ break L35;
+ }
+ }
+ $140 = ($$lcssa304&255)>($$lcssa307&255);
+ $141 = (($$lcssa301) - ($ip$0$ph76$i))|0;
+ if (!($140)) {
+ $jp$0$ph1365$i$lcssa$lcssa = $jp$0$ph1365$i$lcssa;
+ break;
+ }
+ $124 = (($$lcssa301) + 1)|0;
+ $125 = ($124>>>0)<($$lcssa322>>>0);
+ if ($125) {
+ $235 = $124;$jp$0$ph13$ph70$i = $$lcssa301;$p$0$ph$ph71$i = $141;
+ } else {
+ $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $141;
+ break L35;
+ }
+ }
+ $142 = (($jp$0$ph1365$i$lcssa$lcssa) + 1)|0;
+ $143 = (($jp$0$ph1365$i$lcssa$lcssa) + 2)|0;
+ $144 = ($143>>>0)<($$lcssa322>>>0);
+ if ($144) {
+ $234 = $143;$ip$0$ph76$i = $jp$0$ph1365$i$lcssa$lcssa;$jp$0$ph77$i = $142;
+ } else {
+ $ip$0$ph$lcssa$i = $jp$0$ph1365$i$lcssa$lcssa;$p$0$ph$ph$lcssa32$i = 1;
+ break;
+ }
+ }
+ $237 = 1;$ip$1$ph55$i = -1;$jp$1$ph56$i = 0;
+ while(1) {
+ $239 = $237;$jp$1$ph9$ph49$i = $jp$1$ph56$i;$p$1$ph$ph50$i = 1;
+ while(1) {
+ $238 = $239;$jp$1$ph944$i = $jp$1$ph9$ph49$i;
+ L54: while(1) {
+ $152 = $238;$k$139$i = 1;
+ while(1) {
+ $148 = (($k$139$i) + ($ip$1$ph55$i))|0;
+ $149 = (($n) + ($148)|0);
+ $150 = HEAP8[$149>>0]|0;
+ $151 = (($n) + ($152)|0);
+ $153 = HEAP8[$151>>0]|0;
+ $154 = ($150<<24>>24)==($153<<24>>24);
+ if (!($154)) {
+ $$lcssa281 = $152;$$lcssa284 = $150;$$lcssa287 = $153;$jp$1$ph944$i$lcssa = $jp$1$ph944$i;
+ break L54;
+ }
+ $155 = ($k$139$i|0)==($p$1$ph$ph50$i|0);
+ $146 = (($k$139$i) + 1)|0;
+ if ($155) {
+ break;
+ }
+ $145 = (($146) + ($jp$1$ph944$i))|0;
+ $147 = ($145>>>0)<($$lcssa322>>>0);
+ if ($147) {
+ $152 = $145;$k$139$i = $146;
+ } else {
+ $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i;
+ break L34;
+ }
+ }
+ $156 = (($jp$1$ph944$i) + ($p$1$ph$ph50$i))|0;
+ $157 = (($156) + 1)|0;
+ $158 = ($157>>>0)<($$lcssa322>>>0);
+ if ($158) {
+ $238 = $157;$jp$1$ph944$i = $156;
+ } else {
+ $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i;
+ break L34;
+ }
+ }
+ $159 = ($$lcssa284&255)<($$lcssa287&255);
+ $160 = (($$lcssa281) - ($ip$1$ph55$i))|0;
+ if (!($159)) {
+ $jp$1$ph944$i$lcssa$lcssa = $jp$1$ph944$i$lcssa;
+ break;
+ }
+ $164 = (($$lcssa281) + 1)|0;
+ $165 = ($164>>>0)<($$lcssa322>>>0);
+ if ($165) {
+ $239 = $164;$jp$1$ph9$ph49$i = $$lcssa281;$p$1$ph$ph50$i = $160;
+ } else {
+ $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $160;
+ break L34;
+ }
+ }
+ $161 = (($jp$1$ph944$i$lcssa$lcssa) + 1)|0;
+ $162 = (($jp$1$ph944$i$lcssa$lcssa) + 2)|0;
+ $163 = ($162>>>0)<($$lcssa322>>>0);
+ if ($163) {
+ $237 = $162;$ip$1$ph55$i = $jp$1$ph944$i$lcssa$lcssa;$jp$1$ph56$i = $161;
+ } else {
+ $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $jp$1$ph944$i$lcssa$lcssa;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = 1;
+ break;
+ }
+ }
+ } else {
+ $ip$0$ph$lcssa143$i = -1;$ip$1$ph$lcssa$i = -1;$p$0$ph$ph$lcssa32147$i = 1;$p$1$ph$ph$lcssa23$i = 1;
+ }
+ } while(0);
+ $166 = (($ip$1$ph$lcssa$i) + 1)|0;
+ $167 = (($ip$0$ph$lcssa143$i) + 1)|0;
+ $168 = ($166>>>0)>($167>>>0);
+ $p$1$p$0$i = $168 ? $p$1$ph$ph$lcssa23$i : $p$0$ph$ph$lcssa32147$i;
+ $ip$1$ip$0$i = $168 ? $ip$1$ph$lcssa$i : $ip$0$ph$lcssa143$i;
+ $169 = (($n) + ($p$1$p$0$i)|0);
+ $170 = (($ip$1$ip$0$i) + 1)|0;
+ $171 = (_memcmp($n,$169,$170)|0);
+ $172 = ($171|0)==(0);
+ if ($172) {
+ $177 = (($$lcssa322) - ($p$1$p$0$i))|0;
+ $mem0$0$i = $177;$p$3$i = $p$1$p$0$i;
+ } else {
+ $173 = (($$lcssa322) - ($ip$1$ip$0$i))|0;
+ $174 = (($173) + -1)|0;
+ $175 = ($ip$1$ip$0$i>>>0)>($174>>>0);
+ $ip$1$ip$0$$i = $175 ? $ip$1$ip$0$i : $174;
+ $176 = (($ip$1$ip$0$$i) + 1)|0;
+ $mem0$0$i = 0;$p$3$i = $176;
+ }
+ $178 = $$lcssa322 | 63;
+ $179 = ($mem0$0$i|0)!=(0);
+ $180 = (($$lcssa322) - ($p$3$i))|0;
+ $$03$i = $3;$mem$0$i = 0;$z$0$i = $3;
+ L69: while(1) {
+ $181 = $z$0$i;
+ $182 = $$03$i;
+ $183 = (($181) - ($182))|0;
+ $184 = ($183>>>0)<($$lcssa322>>>0);
+ do {
+ if ($184) {
+ $185 = (_memchr($z$0$i,0,$178)|0);
+ $186 = ($185|0)==(0|0);
+ if ($186) {
+ $190 = (($z$0$i) + ($178)|0);
+ $z$1$i = $190;
+ break;
+ } else {
+ $187 = $185;
+ $188 = (($187) - ($182))|0;
+ $189 = ($188>>>0)<($$lcssa322>>>0);
+ if ($189) {
+ $$0$i = 0;
+ break L32;
+ } else {
+ $z$1$i = $185;
+ break;
+ }
+ }
+ } else {
+ $z$1$i = $z$0$i;
+ }
+ } while(0);
+ $191 = (($$03$i) + ($l$080$i$lcssa321)|0);
+ $192 = HEAP8[$191>>0]|0;
+ $div$i = ($192&255) >>> 5;
+ $193 = $div$i&255;
+ $194 = (($byteset$i) + ($193<<2)|0);
+ $195 = HEAP32[$194>>2]|0;
+ $196 = $192 & 31;
+ $197 = $196&255;
+ $198 = 1 << $197;
+ $199 = $198 & $195;
+ $200 = ($199|0)==(0);
+ if ($200) {
+ $209 = (($$03$i) + ($$lcssa322)|0);
+ $$03$i = $209;$mem$0$i = 0;$z$0$i = $z$1$i;
+ continue;
+ }
+ $201 = $192&255;
+ $202 = (($shift$i) + ($201<<2)|0);
+ $203 = HEAP32[$202>>2]|0;
+ $204 = (($$lcssa322) - ($203))|0;
+ $205 = ($$lcssa322|0)==($203|0);
+ if (!($205)) {
+ $206 = ($mem$0$i|0)!=(0);
+ $or$cond$i = $179 & $206;
+ $207 = ($204>>>0)<($p$3$i>>>0);
+ $or$cond5$i = $or$cond$i & $207;
+ $k$2$i = $or$cond5$i ? $180 : $204;
+ $208 = (($$03$i) + ($k$2$i)|0);
+ $$03$i = $208;$mem$0$i = 0;$z$0$i = $z$1$i;
+ continue;
+ }
+ $210 = ($170>>>0)>($mem$0$i>>>0);
+ $211 = $210 ? $170 : $mem$0$i;
+ $212 = (($n) + ($211)|0);
+ $213 = HEAP8[$212>>0]|0;
+ $214 = ($213<<24>>24)==(0);
+ L83: do {
+ if ($214) {
+ $k$4$i = $170;
+ } else {
+ $$pr$i = $213;$k$338$i = $211;
+ while(1) {
+ $215 = (($$03$i) + ($k$338$i)|0);
+ $216 = HEAP8[$215>>0]|0;
+ $217 = ($$pr$i<<24>>24)==($216<<24>>24);
+ if (!($217)) {
+ $k$338$i$lcssa = $k$338$i;
+ break;
+ }
+ $218 = (($k$338$i) + 1)|0;
+ $219 = (($n) + ($218)|0);
+ $220 = HEAP8[$219>>0]|0;
+ $221 = ($220<<24>>24)==(0);
+ if ($221) {
+ $k$4$i = $170;
+ break L83;
+ } else {
+ $$pr$i = $220;$k$338$i = $218;
+ }
+ }
+ $222 = (($k$338$i$lcssa) - ($ip$1$ip$0$i))|0;
+ $223 = (($$03$i) + ($222)|0);
+ $$03$i = $223;$mem$0$i = 0;$z$0$i = $z$1$i;
+ continue L69;
+ }
+ } while(0);
+ while(1) {
+ $224 = ($k$4$i>>>0)>($mem$0$i>>>0);
+ if (!($224)) {
+ $$0$i = $$03$i;
+ break L32;
+ }
+ $225 = (($k$4$i) + -1)|0;
+ $226 = (($n) + ($225)|0);
+ $227 = HEAP8[$226>>0]|0;
+ $228 = (($$03$i) + ($225)|0);
+ $229 = HEAP8[$228>>0]|0;
+ $230 = ($227<<24>>24)==($229<<24>>24);
+ if ($230) {
+ $k$4$i = $225;
+ } else {
+ break;
+ }
+ }
+ $231 = (($$03$i) + ($p$3$i)|0);
+ $$03$i = $231;$mem$0$i = $mem0$0$i;$z$0$i = $z$1$i;
+ }
+ }
+ } while(0);
+ $$0 = $$0$i;
+ }
+ }
+ }
+ }
+ }
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function _strtok($s,$sep) {
+ $s = $s|0;
+ $sep = $sep|0;
+ var $$0 = 0, $$01 = 0, $$sum = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($s|0)==(0|0);
+ if ($0) {
+ $1 = HEAP32[6836>>2]|0;
+ $2 = ($1|0)==(0|0);
+ if ($2) {
+ $$0 = 0;
+ } else {
+ $$01 = $1;
+ label = 3;
+ }
+ } else {
+ $$01 = $s;
+ label = 3;
+ }
+ do {
+ if ((label|0) == 3) {
+ $3 = (_strspn($$01,$sep)|0);
+ $4 = (($$01) + ($3)|0);
+ $5 = HEAP8[$4>>0]|0;
+ $6 = ($5<<24>>24)==(0);
+ if ($6) {
+ HEAP32[6836>>2] = 0;
+ $$0 = 0;
+ break;
+ }
+ $7 = (_strcspn($4,$sep)|0);
+ $$sum = (($7) + ($3))|0;
+ $8 = (($$01) + ($$sum)|0);
+ HEAP32[6836>>2] = $8;
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)==(0);
+ if ($10) {
+ HEAP32[6836>>2] = 0;
+ $$0 = $4;
+ break;
+ } else {
+ $$sum2 = (($$sum) + 1)|0;
+ $11 = (($$01) + ($$sum2)|0);
+ HEAP32[6836>>2] = $11;
+ HEAP8[$8>>0] = 0;
+ $$0 = $4;
+ break;
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _scanexp($f,$pok) {
+ $f = $f|0;
+ $pok = $pok|0;
+ var $$lcssa22 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
+ var $99 = 0, $c$0 = 0, $c$1$be = 0, $c$1$be$lcssa = 0, $c$112 = 0, $c$2$be = 0, $c$2$lcssa = 0, $c$27 = 0, $c$3$be = 0, $neg$0 = 0, $or$cond3 = 0, $x$013 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 4|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($f)) + 100|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($1>>>0)<($3>>>0);
+ if ($4) {
+ $5 = ((($1)) + 1|0);
+ HEAP32[$0>>2] = $5;
+ $6 = HEAP8[$1>>0]|0;
+ $7 = $6&255;
+ $9 = $7;
+ } else {
+ $8 = (___shgetc($f)|0);
+ $9 = $8;
+ }
+ $10 = ($9|0)==(45);
+ switch ($9|0) {
+ case 43: case 45: {
+ $11 = $10&1;
+ $12 = HEAP32[$0>>2]|0;
+ $13 = HEAP32[$2>>2]|0;
+ $14 = ($12>>>0)<($13>>>0);
+ if ($14) {
+ $15 = ((($12)) + 1|0);
+ HEAP32[$0>>2] = $15;
+ $16 = HEAP8[$12>>0]|0;
+ $17 = $16&255;
+ $20 = $17;
+ } else {
+ $18 = (___shgetc($f)|0);
+ $20 = $18;
+ }
+ $19 = (($20) + -48)|0;
+ $21 = ($19>>>0)>(9);
+ $22 = ($pok|0)!=(0);
+ $or$cond3 = $22 & $21;
+ if ($or$cond3) {
+ $23 = HEAP32[$2>>2]|0;
+ $24 = ($23|0)==(0|0);
+ if ($24) {
+ $c$0 = $20;$neg$0 = $11;
+ } else {
+ $25 = HEAP32[$0>>2]|0;
+ $26 = ((($25)) + -1|0);
+ HEAP32[$0>>2] = $26;
+ $c$0 = $20;$neg$0 = $11;
+ }
+ } else {
+ $c$0 = $20;$neg$0 = $11;
+ }
+ break;
+ }
+ default: {
+ $c$0 = $9;$neg$0 = 0;
+ }
+ }
+ $27 = (($c$0) + -48)|0;
+ $28 = ($27>>>0)>(9);
+ if ($28) {
+ $29 = HEAP32[$2>>2]|0;
+ $30 = ($29|0)==(0|0);
+ if ($30) {
+ $98 = -2147483648;$99 = 0;
+ } else {
+ $31 = HEAP32[$0>>2]|0;
+ $32 = ((($31)) + -1|0);
+ HEAP32[$0>>2] = $32;
+ $98 = -2147483648;$99 = 0;
+ }
+ } else {
+ $c$112 = $c$0;$x$013 = 0;
+ while(1) {
+ $33 = ($x$013*10)|0;
+ $34 = (($c$112) + -48)|0;
+ $35 = (($34) + ($33))|0;
+ $36 = HEAP32[$0>>2]|0;
+ $37 = HEAP32[$2>>2]|0;
+ $38 = ($36>>>0)<($37>>>0);
+ if ($38) {
+ $39 = ((($36)) + 1|0);
+ HEAP32[$0>>2] = $39;
+ $40 = HEAP8[$36>>0]|0;
+ $41 = $40&255;
+ $c$1$be = $41;
+ } else {
+ $42 = (___shgetc($f)|0);
+ $c$1$be = $42;
+ }
+ $43 = (($c$1$be) + -48)|0;
+ $44 = ($43>>>0)<(10);
+ $45 = ($35|0)<(214748364);
+ $46 = $44 & $45;
+ if ($46) {
+ $c$112 = $c$1$be;$x$013 = $35;
+ } else {
+ $$lcssa22 = $35;$c$1$be$lcssa = $c$1$be;
+ break;
+ }
+ }
+ $47 = ($$lcssa22|0)<(0);
+ $48 = $47 << 31 >> 31;
+ $49 = (($c$1$be$lcssa) + -48)|0;
+ $50 = ($49>>>0)<(10);
+ if ($50) {
+ $53 = $$lcssa22;$54 = $48;$c$27 = $c$1$be$lcssa;
+ while(1) {
+ $55 = (___muldi3(($53|0),($54|0),10,0)|0);
+ $56 = tempRet0;
+ $57 = ($c$27|0)<(0);
+ $58 = $57 << 31 >> 31;
+ $59 = (_i64Add(($c$27|0),($58|0),-48,-1)|0);
+ $60 = tempRet0;
+ $61 = (_i64Add(($59|0),($60|0),($55|0),($56|0))|0);
+ $62 = tempRet0;
+ $63 = HEAP32[$0>>2]|0;
+ $64 = HEAP32[$2>>2]|0;
+ $65 = ($63>>>0)<($64>>>0);
+ if ($65) {
+ $66 = ((($63)) + 1|0);
+ HEAP32[$0>>2] = $66;
+ $67 = HEAP8[$63>>0]|0;
+ $68 = $67&255;
+ $c$2$be = $68;
+ } else {
+ $69 = (___shgetc($f)|0);
+ $c$2$be = $69;
+ }
+ $70 = (($c$2$be) + -48)|0;
+ $71 = ($70>>>0)<(10);
+ $72 = ($62|0)<(21474836);
+ $73 = ($61>>>0)<(2061584302);
+ $74 = ($62|0)==(21474836);
+ $75 = $74 & $73;
+ $76 = $72 | $75;
+ $77 = $71 & $76;
+ if ($77) {
+ $53 = $61;$54 = $62;$c$27 = $c$2$be;
+ } else {
+ $92 = $61;$93 = $62;$c$2$lcssa = $c$2$be;
+ break;
+ }
+ }
+ } else {
+ $92 = $$lcssa22;$93 = $48;$c$2$lcssa = $c$1$be$lcssa;
+ }
+ $51 = (($c$2$lcssa) + -48)|0;
+ $52 = ($51>>>0)<(10);
+ if ($52) {
+ while(1) {
+ $78 = HEAP32[$0>>2]|0;
+ $79 = HEAP32[$2>>2]|0;
+ $80 = ($78>>>0)<($79>>>0);
+ if ($80) {
+ $81 = ((($78)) + 1|0);
+ HEAP32[$0>>2] = $81;
+ $82 = HEAP8[$78>>0]|0;
+ $83 = $82&255;
+ $c$3$be = $83;
+ } else {
+ $84 = (___shgetc($f)|0);
+ $c$3$be = $84;
+ }
+ $85 = (($c$3$be) + -48)|0;
+ $86 = ($85>>>0)<(10);
+ if (!($86)) {
+ break;
+ }
+ }
+ }
+ $87 = HEAP32[$2>>2]|0;
+ $88 = ($87|0)==(0|0);
+ if (!($88)) {
+ $89 = HEAP32[$0>>2]|0;
+ $90 = ((($89)) + -1|0);
+ HEAP32[$0>>2] = $90;
+ }
+ $91 = ($neg$0|0)!=(0);
+ $94 = (_i64Subtract(0,0,($92|0),($93|0))|0);
+ $95 = tempRet0;
+ $96 = $91 ? $94 : $92;
+ $97 = $91 ? $95 : $93;
+ $98 = $97;$99 = $96;
+ }
+ tempRet0 = ($98);
+ return ($99|0);
+}
+function ___fflush_unlocked($f) {
+ $f = $f|0;
+ var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 20|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($f)) + 28|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($1>>>0)>($3>>>0);
+ if ($4) {
+ $5 = ((($f)) + 36|0);
+ $6 = HEAP32[$5>>2]|0;
+ (FUNCTION_TABLE_iiii[$6 & 15]($f,0,0)|0);
+ $7 = HEAP32[$0>>2]|0;
+ $8 = ($7|0)==(0|0);
+ if ($8) {
+ $$0 = -1;
+ } else {
+ label = 3;
+ }
+ } else {
+ label = 3;
+ }
+ if ((label|0) == 3) {
+ $9 = ((($f)) + 4|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($f)) + 8|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ($10>>>0)<($12>>>0);
+ if ($13) {
+ $14 = ((($f)) + 40|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = $10;
+ $17 = $12;
+ $18 = (($16) - ($17))|0;
+ (FUNCTION_TABLE_iiii[$15 & 15]($f,$18,1)|0);
+ }
+ $19 = ((($f)) + 16|0);
+ HEAP32[$19>>2] = 0;
+ HEAP32[$2>>2] = 0;
+ HEAP32[$0>>2] = 0;
+ HEAP32[$11>>2] = 0;
+ HEAP32[$9>>2] = 0;
+ $$0 = 0;
+ }
+ return ($$0|0);
+}
+function _printf_core($f,$fmt,$ap,$nl_arg,$nl_type) {
+ $f = $f|0;
+ $fmt = $fmt|0;
+ $ap = $ap|0;
+ $nl_arg = $nl_arg|0;
+ $nl_type = $nl_type|0;
+ var $$ = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$012$i = 0, $$013$i = 0, $$03$i33 = 0, $$07$i = 0.0, $$1$i = 0.0, $$114$i = 0, $$2$i = 0.0, $$20$i = 0.0, $$21$i = 0, $$210$$22$i = 0, $$210$$24$i = 0, $$210$i = 0, $$23$i = 0, $$3$i = 0.0, $$31$i = 0;
+ var $$311$i = 0, $$4$i = 0.0, $$412$lcssa$i = 0, $$41276$i = 0, $$5$lcssa$i = 0, $$51 = 0, $$587$i = 0, $$a$3$i = 0, $$a$3185$i = 0, $$a$3186$i = 0, $$fl$4 = 0, $$l10n$0 = 0, $$lcssa = 0, $$lcssa159$i = 0, $$lcssa318 = 0, $$lcssa323 = 0, $$lcssa324 = 0, $$lcssa325 = 0, $$lcssa326 = 0, $$lcssa327 = 0;
+ var $$lcssa329 = 0, $$lcssa339 = 0, $$lcssa342 = 0.0, $$lcssa344 = 0, $$neg52$i = 0, $$neg53$i = 0, $$p$$i = 0, $$p$0 = 0, $$p$5 = 0, $$p$i = 0, $$pn$i = 0, $$pr$i = 0, $$pr47$i = 0, $$pre = 0, $$pre$i = 0, $$pre$phi184$iZ2D = 0, $$pre179$i = 0, $$pre182$i = 0, $$pre183$i = 0, $$pre193 = 0;
+ var $$sum$i = 0, $$sum15$i = 0, $$sum16$i = 0, $$z$3$i = 0, $$z$4$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
+ var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
+ var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
+ var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
+ var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0;
+ var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0;
+ var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0;
+ var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0;
+ var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0;
+ var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0;
+ var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0;
+ var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0;
+ var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0;
+ var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0;
+ var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0.0;
+ var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0;
+ var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0.0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0;
+ var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0.0, $413 = 0.0, $414 = 0.0, $415 = 0.0, $416 = 0.0, $417 = 0;
+ var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
+ var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0.0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
+ var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
+ var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0.0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0.0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0;
+ var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0;
+ var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0;
+ var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0;
+ var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0;
+ var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0;
+ var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0.0, $597 = 0.0, $598 = 0;
+ var $599 = 0.0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0;
+ var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0;
+ var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0;
+ var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0;
+ var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0;
+ var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0;
+ var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0;
+ var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0;
+ var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0;
+ var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0;
+ var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0;
+ var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
+ var $98 = 0, $99 = 0, $a$0 = 0, $a$1 = 0, $a$1$lcssa$i = 0, $a$1147$i = 0, $a$2 = 0, $a$2$ph$i = 0, $a$3$lcssa$i = 0, $a$3134$i = 0, $a$5$lcssa$i = 0, $a$5109$i = 0, $a$6$i = 0, $a$7$i = 0, $a$8$ph$i = 0, $arg = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0;
+ var $argpos$0 = 0, $big$i = 0, $buf = 0, $buf$i = 0, $carry$0140$i = 0, $carry3$0128$i = 0, $cnt$0 = 0, $cnt$1 = 0, $cnt$1$lcssa = 0, $d$0$i = 0, $d$0139$i = 0, $d$0141$i = 0, $d$1127$i = 0, $d$2$lcssa$i = 0, $d$2108$i = 0, $d$3$i = 0, $d$482$i = 0, $d$575$i = 0, $d$686$i = 0, $e$0123$i = 0;
+ var $e$1$i = 0, $e$2104$i = 0, $e$3$i = 0, $e$4$ph$i = 0, $e2$i = 0, $ebuf0$i = 0, $estr$0$i = 0, $estr$1$lcssa$i = 0, $estr$193$i = 0, $estr$2$i = 0, $exitcond$i = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0;
+ var $expanded8 = 0, $fl$0109 = 0, $fl$062 = 0, $fl$1 = 0, $fl$1$ = 0, $fl$3 = 0, $fl$4 = 0, $fl$6 = 0, $fmt39$lcssa = 0, $fmt39101 = 0, $fmt40 = 0, $fmt41 = 0, $fmt42 = 0, $fmt44 = 0, $fmt44$lcssa321 = 0, $fmt45 = 0, $i$0$lcssa = 0, $i$0$lcssa200 = 0, $i$0114 = 0, $i$0122$i = 0;
+ var $i$03$i = 0, $i$03$i25 = 0, $i$1$lcssa$i = 0, $i$1116$i = 0, $i$1125 = 0, $i$2100 = 0, $i$2100$lcssa = 0, $i$2103$i = 0, $i$398 = 0, $i$399$i = 0, $isdigit = 0, $isdigit$i = 0, $isdigit$i27 = 0, $isdigit10 = 0, $isdigit12 = 0, $isdigit2$i = 0, $isdigit2$i23 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp$i = 0;
+ var $isdigittmp$i26 = 0, $isdigittmp1$i = 0, $isdigittmp1$i22 = 0, $isdigittmp11 = 0, $isdigittmp4$i = 0, $isdigittmp4$i24 = 0, $isdigittmp9 = 0, $j$0$i = 0, $j$0115$i = 0, $j$0117$i = 0, $j$1100$i = 0, $j$2$i = 0, $l$0 = 0, $l$0$i = 0, $l$1$i = 0, $l$1113 = 0, $l$2 = 0, $l10n$0 = 0, $l10n$0$lcssa = 0, $l10n$0$phi = 0;
+ var $l10n$1 = 0, $l10n$2 = 0, $l10n$3 = 0, $mb = 0, $notlhs$i = 0, $notrhs$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond15 = 0, $or$cond17 = 0, $or$cond20 = 0, $or$cond240 = 0, $or$cond29$i = 0, $or$cond3$not$i = 0, $or$cond6$i = 0, $p$0 = 0, $p$1 = 0, $p$2 = 0, $p$2$ = 0, $p$3 = 0;
+ var $p$4198 = 0, $p$5 = 0, $pl$0 = 0, $pl$0$i = 0, $pl$1 = 0, $pl$1$i = 0, $pl$2 = 0, $prefix$0 = 0, $prefix$0$$i = 0, $prefix$0$i = 0, $prefix$1 = 0, $prefix$2 = 0, $r$0$a$8$i = 0, $re$169$i = 0, $round$068$i = 0.0, $round6$1$i = 0.0, $s$0$i = 0, $s$1$i = 0, $s$1$i$lcssa = 0, $s1$0$i = 0;
+ var $s7$079$i = 0, $s7$1$i = 0, $s8$0$lcssa$i = 0, $s8$070$i = 0, $s9$0$i = 0, $s9$183$i = 0, $s9$2$i = 0, $small$0$i = 0.0, $small$1$i = 0.0, $st$0 = 0, $st$0$lcssa322 = 0, $storemerge = 0, $storemerge13 = 0, $storemerge8108 = 0, $storemerge860 = 0, $sum = 0, $t$0 = 0, $t$1 = 0, $w$$i = 0, $w$0 = 0;
+ var $w$1 = 0, $w$2 = 0, $w$30$i = 0, $wc = 0, $ws$0115 = 0, $ws$1126 = 0, $z$0$i = 0, $z$0$lcssa = 0, $z$0102 = 0, $z$1 = 0, $z$1$lcssa$i = 0, $z$1146$i = 0, $z$2 = 0, $z$2$i = 0, $z$2$i$lcssa = 0, $z$3$lcssa$i = 0, $z$3133$i = 0, $z$4$i = 0, $z$6$$i = 0, $z$6$i = 0;
+ var $z$6$i$lcssa = 0, $z$6$ph$i = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 624|0;
+ $big$i = sp + 24|0;
+ $e2$i = sp + 16|0;
+ $buf$i = sp + 588|0;
+ $ebuf0$i = sp + 576|0;
+ $arg = sp;
+ $buf = sp + 536|0;
+ $wc = sp + 8|0;
+ $mb = sp + 528|0;
+ $0 = ($f|0)!=(0|0);
+ $1 = ((($buf)) + 40|0);
+ $2 = $1;
+ $3 = ((($buf)) + 39|0);
+ $4 = ((($wc)) + 4|0);
+ $5 = ((($ebuf0$i)) + 12|0);
+ $6 = ((($ebuf0$i)) + 11|0);
+ $7 = $buf$i;
+ $8 = $5;
+ $9 = (($8) - ($7))|0;
+ $10 = (-2 - ($7))|0;
+ $11 = (($8) + 2)|0;
+ $12 = ((($big$i)) + 288|0);
+ $13 = ((($buf$i)) + 9|0);
+ $14 = $13;
+ $15 = ((($buf$i)) + 8|0);
+ $cnt$0 = 0;$fmt41 = $fmt;$l$0 = 0;$l10n$0 = 0;
+ L1: while(1) {
+ $16 = ($cnt$0|0)>(-1);
+ do {
+ if ($16) {
+ $17 = (2147483647 - ($cnt$0))|0;
+ $18 = ($l$0|0)>($17|0);
+ if ($18) {
+ $19 = (___errno_location()|0);
+ HEAP32[$19>>2] = 75;
+ $cnt$1 = -1;
+ break;
+ } else {
+ $20 = (($l$0) + ($cnt$0))|0;
+ $cnt$1 = $20;
+ break;
+ }
+ } else {
+ $cnt$1 = $cnt$0;
+ }
+ } while(0);
+ $21 = HEAP8[$fmt41>>0]|0;
+ $22 = ($21<<24>>24)==(0);
+ if ($22) {
+ $cnt$1$lcssa = $cnt$1;$l10n$0$lcssa = $l10n$0;
+ label = 245;
+ break;
+ } else {
+ $23 = $21;$fmt40 = $fmt41;
+ }
+ L9: while(1) {
+ switch ($23<<24>>24) {
+ case 37: {
+ $fmt39101 = $fmt40;$z$0102 = $fmt40;
+ label = 9;
+ break L9;
+ break;
+ }
+ case 0: {
+ $fmt39$lcssa = $fmt40;$z$0$lcssa = $fmt40;
+ break L9;
+ break;
+ }
+ default: {
+ }
+ }
+ $24 = ((($fmt40)) + 1|0);
+ $$pre = HEAP8[$24>>0]|0;
+ $23 = $$pre;$fmt40 = $24;
+ }
+ L12: do {
+ if ((label|0) == 9) {
+ while(1) {
+ label = 0;
+ $25 = ((($fmt39101)) + 1|0);
+ $26 = HEAP8[$25>>0]|0;
+ $27 = ($26<<24>>24)==(37);
+ if (!($27)) {
+ $fmt39$lcssa = $fmt39101;$z$0$lcssa = $z$0102;
+ break L12;
+ }
+ $28 = ((($z$0102)) + 1|0);
+ $29 = ((($fmt39101)) + 2|0);
+ $30 = HEAP8[$29>>0]|0;
+ $31 = ($30<<24>>24)==(37);
+ if ($31) {
+ $fmt39101 = $29;$z$0102 = $28;
+ label = 9;
+ } else {
+ $fmt39$lcssa = $29;$z$0$lcssa = $28;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $32 = $z$0$lcssa;
+ $33 = $fmt41;
+ $34 = (($32) - ($33))|0;
+ if ($0) {
+ $35 = HEAP32[$f>>2]|0;
+ $36 = $35 & 32;
+ $37 = ($36|0)==(0);
+ if ($37) {
+ (___fwritex($fmt41,$34,$f)|0);
+ }
+ }
+ $38 = ($z$0$lcssa|0)==($fmt41|0);
+ if (!($38)) {
+ $l10n$0$phi = $l10n$0;$cnt$0 = $cnt$1;$fmt41 = $fmt39$lcssa;$l$0 = $34;$l10n$0 = $l10n$0$phi;
+ continue;
+ }
+ $39 = ((($fmt39$lcssa)) + 1|0);
+ $40 = HEAP8[$39>>0]|0;
+ $41 = $40 << 24 >> 24;
+ $isdigittmp = (($41) + -48)|0;
+ $isdigit = ($isdigittmp>>>0)<(10);
+ if ($isdigit) {
+ $42 = ((($fmt39$lcssa)) + 2|0);
+ $43 = HEAP8[$42>>0]|0;
+ $44 = ($43<<24>>24)==(36);
+ $45 = ((($fmt39$lcssa)) + 3|0);
+ $$51 = $44 ? $45 : $39;
+ $$l10n$0 = $44 ? 1 : $l10n$0;
+ $isdigittmp$ = $44 ? $isdigittmp : -1;
+ $$pre193 = HEAP8[$$51>>0]|0;
+ $47 = $$pre193;$argpos$0 = $isdigittmp$;$l10n$1 = $$l10n$0;$storemerge = $$51;
+ } else {
+ $47 = $40;$argpos$0 = -1;$l10n$1 = $l10n$0;$storemerge = $39;
+ }
+ $46 = $47 << 24 >> 24;
+ $48 = $46 & -32;
+ $49 = ($48|0)==(32);
+ L25: do {
+ if ($49) {
+ $51 = $46;$56 = $47;$fl$0109 = 0;$storemerge8108 = $storemerge;
+ while(1) {
+ $50 = (($51) + -32)|0;
+ $52 = 1 << $50;
+ $53 = $52 & 75913;
+ $54 = ($53|0)==(0);
+ if ($54) {
+ $65 = $56;$fl$062 = $fl$0109;$storemerge860 = $storemerge8108;
+ break L25;
+ }
+ $55 = $56 << 24 >> 24;
+ $57 = (($55) + -32)|0;
+ $58 = 1 << $57;
+ $59 = $58 | $fl$0109;
+ $60 = ((($storemerge8108)) + 1|0);
+ $61 = HEAP8[$60>>0]|0;
+ $62 = $61 << 24 >> 24;
+ $63 = $62 & -32;
+ $64 = ($63|0)==(32);
+ if ($64) {
+ $51 = $62;$56 = $61;$fl$0109 = $59;$storemerge8108 = $60;
+ } else {
+ $65 = $61;$fl$062 = $59;$storemerge860 = $60;
+ break;
+ }
+ }
+ } else {
+ $65 = $47;$fl$062 = 0;$storemerge860 = $storemerge;
+ }
+ } while(0);
+ $66 = ($65<<24>>24)==(42);
+ do {
+ if ($66) {
+ $67 = ((($storemerge860)) + 1|0);
+ $68 = HEAP8[$67>>0]|0;
+ $69 = $68 << 24 >> 24;
+ $isdigittmp11 = (($69) + -48)|0;
+ $isdigit12 = ($isdigittmp11>>>0)<(10);
+ if ($isdigit12) {
+ $70 = ((($storemerge860)) + 2|0);
+ $71 = HEAP8[$70>>0]|0;
+ $72 = ($71<<24>>24)==(36);
+ if ($72) {
+ $73 = (($nl_type) + ($isdigittmp11<<2)|0);
+ HEAP32[$73>>2] = 10;
+ $74 = HEAP8[$67>>0]|0;
+ $75 = $74 << 24 >> 24;
+ $76 = (($75) + -48)|0;
+ $77 = (($nl_arg) + ($76<<3)|0);
+ $78 = $77;
+ $79 = $78;
+ $80 = HEAP32[$79>>2]|0;
+ $81 = (($78) + 4)|0;
+ $82 = $81;
+ $83 = HEAP32[$82>>2]|0;
+ $84 = ((($storemerge860)) + 3|0);
+ $l10n$2 = 1;$storemerge13 = $84;$w$0 = $80;
+ } else {
+ label = 24;
+ }
+ } else {
+ label = 24;
+ }
+ if ((label|0) == 24) {
+ label = 0;
+ $85 = ($l10n$1|0)==(0);
+ if (!($85)) {
+ $$0 = -1;
+ break L1;
+ }
+ if (!($0)) {
+ $fl$1 = $fl$062;$fmt42 = $67;$l10n$3 = 0;$w$1 = 0;
+ break;
+ }
+ $arglist_current = HEAP32[$ap>>2]|0;
+ $86 = $arglist_current;
+ $87 = ((0) + 4|0);
+ $expanded4 = $87;
+ $expanded = (($expanded4) - 1)|0;
+ $88 = (($86) + ($expanded))|0;
+ $89 = ((0) + 4|0);
+ $expanded8 = $89;
+ $expanded7 = (($expanded8) - 1)|0;
+ $expanded6 = $expanded7 ^ -1;
+ $90 = $88 & $expanded6;
+ $91 = $90;
+ $92 = HEAP32[$91>>2]|0;
+ $arglist_next = ((($91)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next;
+ $l10n$2 = 0;$storemerge13 = $67;$w$0 = $92;
+ }
+ $93 = ($w$0|0)<(0);
+ if ($93) {
+ $94 = $fl$062 | 8192;
+ $95 = (0 - ($w$0))|0;
+ $fl$1 = $94;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $95;
+ } else {
+ $fl$1 = $fl$062;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $w$0;
+ }
+ } else {
+ $96 = $65 << 24 >> 24;
+ $isdigittmp1$i = (($96) + -48)|0;
+ $isdigit2$i = ($isdigittmp1$i>>>0)<(10);
+ if ($isdigit2$i) {
+ $100 = $storemerge860;$i$03$i = 0;$isdigittmp4$i = $isdigittmp1$i;
+ while(1) {
+ $97 = ($i$03$i*10)|0;
+ $98 = (($97) + ($isdigittmp4$i))|0;
+ $99 = ((($100)) + 1|0);
+ $101 = HEAP8[$99>>0]|0;
+ $102 = $101 << 24 >> 24;
+ $isdigittmp$i = (($102) + -48)|0;
+ $isdigit$i = ($isdigittmp$i>>>0)<(10);
+ if ($isdigit$i) {
+ $100 = $99;$i$03$i = $98;$isdigittmp4$i = $isdigittmp$i;
+ } else {
+ $$lcssa = $98;$$lcssa318 = $99;
+ break;
+ }
+ }
+ $103 = ($$lcssa|0)<(0);
+ if ($103) {
+ $$0 = -1;
+ break L1;
+ } else {
+ $fl$1 = $fl$062;$fmt42 = $$lcssa318;$l10n$3 = $l10n$1;$w$1 = $$lcssa;
+ }
+ } else {
+ $fl$1 = $fl$062;$fmt42 = $storemerge860;$l10n$3 = $l10n$1;$w$1 = 0;
+ }
+ }
+ } while(0);
+ $104 = HEAP8[$fmt42>>0]|0;
+ $105 = ($104<<24>>24)==(46);
+ L46: do {
+ if ($105) {
+ $106 = ((($fmt42)) + 1|0);
+ $107 = HEAP8[$106>>0]|0;
+ $108 = ($107<<24>>24)==(42);
+ if (!($108)) {
+ $135 = $107 << 24 >> 24;
+ $isdigittmp1$i22 = (($135) + -48)|0;
+ $isdigit2$i23 = ($isdigittmp1$i22>>>0)<(10);
+ if ($isdigit2$i23) {
+ $139 = $106;$i$03$i25 = 0;$isdigittmp4$i24 = $isdigittmp1$i22;
+ } else {
+ $fmt45 = $106;$p$0 = 0;
+ break;
+ }
+ while(1) {
+ $136 = ($i$03$i25*10)|0;
+ $137 = (($136) + ($isdigittmp4$i24))|0;
+ $138 = ((($139)) + 1|0);
+ $140 = HEAP8[$138>>0]|0;
+ $141 = $140 << 24 >> 24;
+ $isdigittmp$i26 = (($141) + -48)|0;
+ $isdigit$i27 = ($isdigittmp$i26>>>0)<(10);
+ if ($isdigit$i27) {
+ $139 = $138;$i$03$i25 = $137;$isdigittmp4$i24 = $isdigittmp$i26;
+ } else {
+ $fmt45 = $138;$p$0 = $137;
+ break L46;
+ }
+ }
+ }
+ $109 = ((($fmt42)) + 2|0);
+ $110 = HEAP8[$109>>0]|0;
+ $111 = $110 << 24 >> 24;
+ $isdigittmp9 = (($111) + -48)|0;
+ $isdigit10 = ($isdigittmp9>>>0)<(10);
+ if ($isdigit10) {
+ $112 = ((($fmt42)) + 3|0);
+ $113 = HEAP8[$112>>0]|0;
+ $114 = ($113<<24>>24)==(36);
+ if ($114) {
+ $115 = (($nl_type) + ($isdigittmp9<<2)|0);
+ HEAP32[$115>>2] = 10;
+ $116 = HEAP8[$109>>0]|0;
+ $117 = $116 << 24 >> 24;
+ $118 = (($117) + -48)|0;
+ $119 = (($nl_arg) + ($118<<3)|0);
+ $120 = $119;
+ $121 = $120;
+ $122 = HEAP32[$121>>2]|0;
+ $123 = (($120) + 4)|0;
+ $124 = $123;
+ $125 = HEAP32[$124>>2]|0;
+ $126 = ((($fmt42)) + 4|0);
+ $fmt45 = $126;$p$0 = $122;
+ break;
+ }
+ }
+ $127 = ($l10n$3|0)==(0);
+ if (!($127)) {
+ $$0 = -1;
+ break L1;
+ }
+ if ($0) {
+ $arglist_current2 = HEAP32[$ap>>2]|0;
+ $128 = $arglist_current2;
+ $129 = ((0) + 4|0);
+ $expanded11 = $129;
+ $expanded10 = (($expanded11) - 1)|0;
+ $130 = (($128) + ($expanded10))|0;
+ $131 = ((0) + 4|0);
+ $expanded15 = $131;
+ $expanded14 = (($expanded15) - 1)|0;
+ $expanded13 = $expanded14 ^ -1;
+ $132 = $130 & $expanded13;
+ $133 = $132;
+ $134 = HEAP32[$133>>2]|0;
+ $arglist_next3 = ((($133)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next3;
+ $fmt45 = $109;$p$0 = $134;
+ } else {
+ $fmt45 = $109;$p$0 = 0;
+ }
+ } else {
+ $fmt45 = $fmt42;$p$0 = -1;
+ }
+ } while(0);
+ $fmt44 = $fmt45;$st$0 = 0;
+ while(1) {
+ $142 = HEAP8[$fmt44>>0]|0;
+ $143 = $142 << 24 >> 24;
+ $144 = (($143) + -65)|0;
+ $145 = ($144>>>0)>(57);
+ if ($145) {
+ $$0 = -1;
+ break L1;
+ }
+ $146 = ((($fmt44)) + 1|0);
+ $147 = ((23774 + (($st$0*58)|0)|0) + ($144)|0);
+ $148 = HEAP8[$147>>0]|0;
+ $149 = $148&255;
+ $150 = (($149) + -1)|0;
+ $151 = ($150>>>0)<(8);
+ if ($151) {
+ $fmt44 = $146;$st$0 = $149;
+ } else {
+ $$lcssa323 = $146;$$lcssa324 = $148;$$lcssa325 = $149;$fmt44$lcssa321 = $fmt44;$st$0$lcssa322 = $st$0;
+ break;
+ }
+ }
+ $152 = ($$lcssa324<<24>>24)==(0);
+ if ($152) {
+ $$0 = -1;
+ break;
+ }
+ $153 = ($$lcssa324<<24>>24)==(19);
+ $154 = ($argpos$0|0)>(-1);
+ do {
+ if ($153) {
+ if ($154) {
+ $$0 = -1;
+ break L1;
+ } else {
+ label = 52;
+ }
+ } else {
+ if ($154) {
+ $155 = (($nl_type) + ($argpos$0<<2)|0);
+ HEAP32[$155>>2] = $$lcssa325;
+ $156 = (($nl_arg) + ($argpos$0<<3)|0);
+ $157 = $156;
+ $158 = $157;
+ $159 = HEAP32[$158>>2]|0;
+ $160 = (($157) + 4)|0;
+ $161 = $160;
+ $162 = HEAP32[$161>>2]|0;
+ $163 = $arg;
+ $164 = $163;
+ HEAP32[$164>>2] = $159;
+ $165 = (($163) + 4)|0;
+ $166 = $165;
+ HEAP32[$166>>2] = $162;
+ label = 52;
+ break;
+ }
+ if (!($0)) {
+ $$0 = 0;
+ break L1;
+ }
+ _pop_arg($arg,$$lcssa325,$ap);
+ }
+ } while(0);
+ if ((label|0) == 52) {
+ label = 0;
+ if (!($0)) {
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue;
+ }
+ }
+ $167 = HEAP8[$fmt44$lcssa321>>0]|0;
+ $168 = $167 << 24 >> 24;
+ $169 = ($st$0$lcssa322|0)!=(0);
+ $170 = $168 & 15;
+ $171 = ($170|0)==(3);
+ $or$cond15 = $169 & $171;
+ $172 = $168 & -33;
+ $t$0 = $or$cond15 ? $172 : $168;
+ $173 = $fl$1 & 8192;
+ $174 = ($173|0)==(0);
+ $175 = $fl$1 & -65537;
+ $fl$1$ = $174 ? $fl$1 : $175;
+ L75: do {
+ switch ($t$0|0) {
+ case 110: {
+ switch ($st$0$lcssa322|0) {
+ case 0: {
+ $182 = HEAP32[$arg>>2]|0;
+ HEAP32[$182>>2] = $cnt$1;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ case 1: {
+ $183 = HEAP32[$arg>>2]|0;
+ HEAP32[$183>>2] = $cnt$1;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ case 2: {
+ $184 = ($cnt$1|0)<(0);
+ $185 = $184 << 31 >> 31;
+ $186 = HEAP32[$arg>>2]|0;
+ $187 = $186;
+ $188 = $187;
+ HEAP32[$188>>2] = $cnt$1;
+ $189 = (($187) + 4)|0;
+ $190 = $189;
+ HEAP32[$190>>2] = $185;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ case 3: {
+ $191 = $cnt$1&65535;
+ $192 = HEAP32[$arg>>2]|0;
+ HEAP16[$192>>1] = $191;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ case 4: {
+ $193 = $cnt$1&255;
+ $194 = HEAP32[$arg>>2]|0;
+ HEAP8[$194>>0] = $193;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ case 6: {
+ $195 = HEAP32[$arg>>2]|0;
+ HEAP32[$195>>2] = $cnt$1;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ case 7: {
+ $196 = ($cnt$1|0)<(0);
+ $197 = $196 << 31 >> 31;
+ $198 = HEAP32[$arg>>2]|0;
+ $199 = $198;
+ $200 = $199;
+ HEAP32[$200>>2] = $cnt$1;
+ $201 = (($199) + 4)|0;
+ $202 = $201;
+ HEAP32[$202>>2] = $197;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ default: {
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3;
+ continue L1;
+ }
+ }
+ break;
+ }
+ case 112: {
+ $203 = ($p$0>>>0)>(8);
+ $204 = $203 ? $p$0 : 8;
+ $205 = $fl$1$ | 8;
+ $fl$3 = $205;$p$1 = $204;$t$1 = 120;
+ label = 64;
+ break;
+ }
+ case 88: case 120: {
+ $fl$3 = $fl$1$;$p$1 = $p$0;$t$1 = $t$0;
+ label = 64;
+ break;
+ }
+ case 111: {
+ $243 = $arg;
+ $244 = $243;
+ $245 = HEAP32[$244>>2]|0;
+ $246 = (($243) + 4)|0;
+ $247 = $246;
+ $248 = HEAP32[$247>>2]|0;
+ $249 = ($245|0)==(0);
+ $250 = ($248|0)==(0);
+ $251 = $249 & $250;
+ if ($251) {
+ $$0$lcssa$i = $1;
+ } else {
+ $$03$i33 = $1;$253 = $245;$257 = $248;
+ while(1) {
+ $252 = $253 & 7;
+ $254 = $252 | 48;
+ $255 = $254&255;
+ $256 = ((($$03$i33)) + -1|0);
+ HEAP8[$256>>0] = $255;
+ $258 = (_bitshift64Lshr(($253|0),($257|0),3)|0);
+ $259 = tempRet0;
+ $260 = ($258|0)==(0);
+ $261 = ($259|0)==(0);
+ $262 = $260 & $261;
+ if ($262) {
+ $$0$lcssa$i = $256;
+ break;
+ } else {
+ $$03$i33 = $256;$253 = $258;$257 = $259;
+ }
+ }
+ }
+ $263 = $fl$1$ & 8;
+ $264 = ($263|0)==(0);
+ if ($264) {
+ $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = 0;$prefix$1 = 24254;
+ label = 77;
+ } else {
+ $265 = $$0$lcssa$i;
+ $266 = (($2) - ($265))|0;
+ $267 = (($266) + 1)|0;
+ $268 = ($p$0|0)<($267|0);
+ $$p$0 = $268 ? $267 : $p$0;
+ $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $$p$0;$pl$1 = 0;$prefix$1 = 24254;
+ label = 77;
+ }
+ break;
+ }
+ case 105: case 100: {
+ $269 = $arg;
+ $270 = $269;
+ $271 = HEAP32[$270>>2]|0;
+ $272 = (($269) + 4)|0;
+ $273 = $272;
+ $274 = HEAP32[$273>>2]|0;
+ $275 = ($274|0)<(0);
+ if ($275) {
+ $276 = (_i64Subtract(0,0,($271|0),($274|0))|0);
+ $277 = tempRet0;
+ $278 = $arg;
+ $279 = $278;
+ HEAP32[$279>>2] = $276;
+ $280 = (($278) + 4)|0;
+ $281 = $280;
+ HEAP32[$281>>2] = $277;
+ $286 = $276;$287 = $277;$pl$0 = 1;$prefix$0 = 24254;
+ label = 76;
+ break L75;
+ }
+ $282 = $fl$1$ & 2048;
+ $283 = ($282|0)==(0);
+ if ($283) {
+ $284 = $fl$1$ & 1;
+ $285 = ($284|0)==(0);
+ $$ = $285 ? 24254 : (24256);
+ $286 = $271;$287 = $274;$pl$0 = $284;$prefix$0 = $$;
+ label = 76;
+ } else {
+ $286 = $271;$287 = $274;$pl$0 = 1;$prefix$0 = (24255);
+ label = 76;
+ }
+ break;
+ }
+ case 117: {
+ $176 = $arg;
+ $177 = $176;
+ $178 = HEAP32[$177>>2]|0;
+ $179 = (($176) + 4)|0;
+ $180 = $179;
+ $181 = HEAP32[$180>>2]|0;
+ $286 = $178;$287 = $181;$pl$0 = 0;$prefix$0 = 24254;
+ label = 76;
+ break;
+ }
+ case 99: {
+ $307 = $arg;
+ $308 = $307;
+ $309 = HEAP32[$308>>2]|0;
+ $310 = (($307) + 4)|0;
+ $311 = $310;
+ $312 = HEAP32[$311>>2]|0;
+ $313 = $309&255;
+ HEAP8[$3>>0] = $313;
+ $a$2 = $3;$fl$6 = $175;$p$5 = 1;$pl$2 = 0;$prefix$2 = 24254;$z$2 = $1;
+ break;
+ }
+ case 109: {
+ $314 = (___errno_location()|0);
+ $315 = HEAP32[$314>>2]|0;
+ $316 = (_strerror($315)|0);
+ $a$1 = $316;
+ label = 82;
+ break;
+ }
+ case 115: {
+ $317 = HEAP32[$arg>>2]|0;
+ $318 = ($317|0)!=(0|0);
+ $319 = $318 ? $317 : 24264;
+ $a$1 = $319;
+ label = 82;
+ break;
+ }
+ case 67: {
+ $326 = $arg;
+ $327 = $326;
+ $328 = HEAP32[$327>>2]|0;
+ $329 = (($326) + 4)|0;
+ $330 = $329;
+ $331 = HEAP32[$330>>2]|0;
+ HEAP32[$wc>>2] = $328;
+ HEAP32[$4>>2] = 0;
+ HEAP32[$arg>>2] = $wc;
+ $p$4198 = -1;
+ label = 86;
+ break;
+ }
+ case 83: {
+ $332 = ($p$0|0)==(0);
+ if ($332) {
+ _pad($f,32,$w$1,0,$fl$1$);
+ $i$0$lcssa200 = 0;
+ label = 98;
+ } else {
+ $p$4198 = $p$0;
+ label = 86;
+ }
+ break;
+ }
+ case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: {
+ $359 = +HEAPF64[$arg>>3];
+ HEAP32[$e2$i>>2] = 0;
+ HEAPF64[tempDoublePtr>>3] = $359;$360 = HEAP32[tempDoublePtr>>2]|0;
+ $361 = HEAP32[tempDoublePtr+4>>2]|0;
+ $362 = ($361|0)<(0);
+ if ($362) {
+ $363 = -$359;
+ $$07$i = $363;$pl$0$i = 1;$prefix$0$i = 24271;
+ } else {
+ $364 = $fl$1$ & 2048;
+ $365 = ($364|0)==(0);
+ if ($365) {
+ $366 = $fl$1$ & 1;
+ $367 = ($366|0)==(0);
+ $$$i = $367 ? (24272) : (24277);
+ $$07$i = $359;$pl$0$i = $366;$prefix$0$i = $$$i;
+ } else {
+ $$07$i = $359;$pl$0$i = 1;$prefix$0$i = (24274);
+ }
+ }
+ HEAPF64[tempDoublePtr>>3] = $$07$i;$368 = HEAP32[tempDoublePtr>>2]|0;
+ $369 = HEAP32[tempDoublePtr+4>>2]|0;
+ $370 = $369 & 2146435072;
+ $371 = ($370>>>0)<(2146435072);
+ $372 = (0)<(0);
+ $373 = ($370|0)==(2146435072);
+ $374 = $373 & $372;
+ $375 = $371 | $374;
+ do {
+ if ($375) {
+ $391 = (+_frexpl($$07$i,$e2$i));
+ $392 = $391 * 2.0;
+ $393 = $392 != 0.0;
+ if ($393) {
+ $394 = HEAP32[$e2$i>>2]|0;
+ $395 = (($394) + -1)|0;
+ HEAP32[$e2$i>>2] = $395;
+ }
+ $396 = $t$0 | 32;
+ $397 = ($396|0)==(97);
+ if ($397) {
+ $398 = $t$0 & 32;
+ $399 = ($398|0)==(0);
+ $400 = ((($prefix$0$i)) + 9|0);
+ $prefix$0$$i = $399 ? $prefix$0$i : $400;
+ $401 = $pl$0$i | 2;
+ $402 = ($p$0>>>0)>(11);
+ $403 = (12 - ($p$0))|0;
+ $404 = ($403|0)==(0);
+ $405 = $402 | $404;
+ do {
+ if ($405) {
+ $$1$i = $392;
+ } else {
+ $re$169$i = $403;$round$068$i = 8.0;
+ while(1) {
+ $406 = (($re$169$i) + -1)|0;
+ $407 = $round$068$i * 16.0;
+ $408 = ($406|0)==(0);
+ if ($408) {
+ $$lcssa342 = $407;
+ break;
+ } else {
+ $re$169$i = $406;$round$068$i = $407;
+ }
+ }
+ $409 = HEAP8[$prefix$0$$i>>0]|0;
+ $410 = ($409<<24>>24)==(45);
+ if ($410) {
+ $411 = -$392;
+ $412 = $411 - $$lcssa342;
+ $413 = $$lcssa342 + $412;
+ $414 = -$413;
+ $$1$i = $414;
+ break;
+ } else {
+ $415 = $392 + $$lcssa342;
+ $416 = $415 - $$lcssa342;
+ $$1$i = $416;
+ break;
+ }
+ }
+ } while(0);
+ $417 = HEAP32[$e2$i>>2]|0;
+ $418 = ($417|0)<(0);
+ $419 = (0 - ($417))|0;
+ $420 = $418 ? $419 : $417;
+ $421 = ($420|0)<(0);
+ $422 = $421 << 31 >> 31;
+ $423 = (_fmt_u($420,$422,$5)|0);
+ $424 = ($423|0)==($5|0);
+ if ($424) {
+ HEAP8[$6>>0] = 48;
+ $estr$0$i = $6;
+ } else {
+ $estr$0$i = $423;
+ }
+ $425 = $417 >> 31;
+ $426 = $425 & 2;
+ $427 = (($426) + 43)|0;
+ $428 = $427&255;
+ $429 = ((($estr$0$i)) + -1|0);
+ HEAP8[$429>>0] = $428;
+ $430 = (($t$0) + 15)|0;
+ $431 = $430&255;
+ $432 = ((($estr$0$i)) + -2|0);
+ HEAP8[$432>>0] = $431;
+ $notrhs$i = ($p$0|0)<(1);
+ $433 = $fl$1$ & 8;
+ $434 = ($433|0)==(0);
+ $$2$i = $$1$i;$s$0$i = $buf$i;
+ while(1) {
+ $435 = (~~(($$2$i)));
+ $436 = (24238 + ($435)|0);
+ $437 = HEAP8[$436>>0]|0;
+ $438 = $437&255;
+ $439 = $438 | $398;
+ $440 = $439&255;
+ $441 = ((($s$0$i)) + 1|0);
+ HEAP8[$s$0$i>>0] = $440;
+ $442 = (+($435|0));
+ $443 = $$2$i - $442;
+ $444 = $443 * 16.0;
+ $445 = $441;
+ $446 = (($445) - ($7))|0;
+ $447 = ($446|0)==(1);
+ do {
+ if ($447) {
+ $notlhs$i = $444 == 0.0;
+ $or$cond3$not$i = $notrhs$i & $notlhs$i;
+ $or$cond$i = $434 & $or$cond3$not$i;
+ if ($or$cond$i) {
+ $s$1$i = $441;
+ break;
+ }
+ $448 = ((($s$0$i)) + 2|0);
+ HEAP8[$441>>0] = 46;
+ $s$1$i = $448;
+ } else {
+ $s$1$i = $441;
+ }
+ } while(0);
+ $449 = $444 != 0.0;
+ if ($449) {
+ $$2$i = $444;$s$0$i = $s$1$i;
+ } else {
+ $s$1$i$lcssa = $s$1$i;
+ break;
+ }
+ }
+ $450 = ($p$0|0)!=(0);
+ $$pre182$i = $s$1$i$lcssa;
+ $451 = (($10) + ($$pre182$i))|0;
+ $452 = ($451|0)<($p$0|0);
+ $or$cond240 = $450 & $452;
+ $453 = $432;
+ $454 = (($11) + ($p$0))|0;
+ $455 = (($454) - ($453))|0;
+ $456 = $432;
+ $457 = (($9) - ($456))|0;
+ $458 = (($457) + ($$pre182$i))|0;
+ $l$0$i = $or$cond240 ? $455 : $458;
+ $459 = (($l$0$i) + ($401))|0;
+ _pad($f,32,$w$1,$459,$fl$1$);
+ $460 = HEAP32[$f>>2]|0;
+ $461 = $460 & 32;
+ $462 = ($461|0)==(0);
+ if ($462) {
+ (___fwritex($prefix$0$$i,$401,$f)|0);
+ }
+ $463 = $fl$1$ ^ 65536;
+ _pad($f,48,$w$1,$459,$463);
+ $464 = (($$pre182$i) - ($7))|0;
+ $465 = HEAP32[$f>>2]|0;
+ $466 = $465 & 32;
+ $467 = ($466|0)==(0);
+ if ($467) {
+ (___fwritex($buf$i,$464,$f)|0);
+ }
+ $468 = $432;
+ $469 = (($8) - ($468))|0;
+ $sum = (($464) + ($469))|0;
+ $470 = (($l$0$i) - ($sum))|0;
+ _pad($f,48,$470,0,0);
+ $471 = HEAP32[$f>>2]|0;
+ $472 = $471 & 32;
+ $473 = ($472|0)==(0);
+ if ($473) {
+ (___fwritex($432,$469,$f)|0);
+ }
+ $474 = $fl$1$ ^ 8192;
+ _pad($f,32,$w$1,$459,$474);
+ $475 = ($459|0)<($w$1|0);
+ $w$$i = $475 ? $w$1 : $459;
+ $$0$i = $w$$i;
+ break;
+ }
+ $476 = ($p$0|0)<(0);
+ $$p$i = $476 ? 6 : $p$0;
+ if ($393) {
+ $477 = $392 * 268435456.0;
+ $478 = HEAP32[$e2$i>>2]|0;
+ $479 = (($478) + -28)|0;
+ HEAP32[$e2$i>>2] = $479;
+ $$3$i = $477;$480 = $479;
+ } else {
+ $$pre179$i = HEAP32[$e2$i>>2]|0;
+ $$3$i = $392;$480 = $$pre179$i;
+ }
+ $481 = ($480|0)<(0);
+ $$31$i = $481 ? $big$i : $12;
+ $482 = $$31$i;
+ $$4$i = $$3$i;$z$0$i = $$31$i;
+ while(1) {
+ $483 = (~~(($$4$i))>>>0);
+ HEAP32[$z$0$i>>2] = $483;
+ $484 = ((($z$0$i)) + 4|0);
+ $485 = (+($483>>>0));
+ $486 = $$4$i - $485;
+ $487 = $486 * 1.0E+9;
+ $488 = $487 != 0.0;
+ if ($488) {
+ $$4$i = $487;$z$0$i = $484;
+ } else {
+ $$lcssa326 = $484;
+ break;
+ }
+ }
+ $$pr$i = HEAP32[$e2$i>>2]|0;
+ $489 = ($$pr$i|0)>(0);
+ if ($489) {
+ $490 = $$pr$i;$a$1147$i = $$31$i;$z$1146$i = $$lcssa326;
+ while(1) {
+ $491 = ($490|0)>(29);
+ $492 = $491 ? 29 : $490;
+ $d$0139$i = ((($z$1146$i)) + -4|0);
+ $493 = ($d$0139$i>>>0)<($a$1147$i>>>0);
+ do {
+ if ($493) {
+ $a$2$ph$i = $a$1147$i;
+ } else {
+ $carry$0140$i = 0;$d$0141$i = $d$0139$i;
+ while(1) {
+ $494 = HEAP32[$d$0141$i>>2]|0;
+ $495 = (_bitshift64Shl(($494|0),0,($492|0))|0);
+ $496 = tempRet0;
+ $497 = (_i64Add(($495|0),($496|0),($carry$0140$i|0),0)|0);
+ $498 = tempRet0;
+ $499 = (___uremdi3(($497|0),($498|0),1000000000,0)|0);
+ $500 = tempRet0;
+ HEAP32[$d$0141$i>>2] = $499;
+ $501 = (___udivdi3(($497|0),($498|0),1000000000,0)|0);
+ $502 = tempRet0;
+ $d$0$i = ((($d$0141$i)) + -4|0);
+ $503 = ($d$0$i>>>0)<($a$1147$i>>>0);
+ if ($503) {
+ $$lcssa327 = $501;
+ break;
+ } else {
+ $carry$0140$i = $501;$d$0141$i = $d$0$i;
+ }
+ }
+ $504 = ($$lcssa327|0)==(0);
+ if ($504) {
+ $a$2$ph$i = $a$1147$i;
+ break;
+ }
+ $505 = ((($a$1147$i)) + -4|0);
+ HEAP32[$505>>2] = $$lcssa327;
+ $a$2$ph$i = $505;
+ }
+ } while(0);
+ $z$2$i = $z$1146$i;
+ while(1) {
+ $506 = ($z$2$i>>>0)>($a$2$ph$i>>>0);
+ if (!($506)) {
+ $z$2$i$lcssa = $z$2$i;
+ break;
+ }
+ $507 = ((($z$2$i)) + -4|0);
+ $508 = HEAP32[$507>>2]|0;
+ $509 = ($508|0)==(0);
+ if ($509) {
+ $z$2$i = $507;
+ } else {
+ $z$2$i$lcssa = $z$2$i;
+ break;
+ }
+ }
+ $510 = HEAP32[$e2$i>>2]|0;
+ $511 = (($510) - ($492))|0;
+ HEAP32[$e2$i>>2] = $511;
+ $512 = ($511|0)>(0);
+ if ($512) {
+ $490 = $511;$a$1147$i = $a$2$ph$i;$z$1146$i = $z$2$i$lcssa;
+ } else {
+ $$pr47$i = $511;$a$1$lcssa$i = $a$2$ph$i;$z$1$lcssa$i = $z$2$i$lcssa;
+ break;
+ }
+ }
+ } else {
+ $$pr47$i = $$pr$i;$a$1$lcssa$i = $$31$i;$z$1$lcssa$i = $$lcssa326;
+ }
+ $513 = ($$pr47$i|0)<(0);
+ if ($513) {
+ $514 = (($$p$i) + 25)|0;
+ $515 = (($514|0) / 9)&-1;
+ $516 = (($515) + 1)|0;
+ $517 = ($396|0)==(102);
+ $519 = $$pr47$i;$a$3134$i = $a$1$lcssa$i;$z$3133$i = $z$1$lcssa$i;
+ while(1) {
+ $518 = (0 - ($519))|0;
+ $520 = ($518|0)>(9);
+ $521 = $520 ? 9 : $518;
+ $522 = ($a$3134$i>>>0)<($z$3133$i>>>0);
+ do {
+ if ($522) {
+ $526 = 1 << $521;
+ $527 = (($526) + -1)|0;
+ $528 = 1000000000 >>> $521;
+ $carry3$0128$i = 0;$d$1127$i = $a$3134$i;
+ while(1) {
+ $529 = HEAP32[$d$1127$i>>2]|0;
+ $530 = $529 & $527;
+ $531 = $529 >>> $521;
+ $532 = (($531) + ($carry3$0128$i))|0;
+ HEAP32[$d$1127$i>>2] = $532;
+ $533 = Math_imul($530, $528)|0;
+ $534 = ((($d$1127$i)) + 4|0);
+ $535 = ($534>>>0)<($z$3133$i>>>0);
+ if ($535) {
+ $carry3$0128$i = $533;$d$1127$i = $534;
+ } else {
+ $$lcssa329 = $533;
+ break;
+ }
+ }
+ $536 = HEAP32[$a$3134$i>>2]|0;
+ $537 = ($536|0)==(0);
+ $538 = ((($a$3134$i)) + 4|0);
+ $$a$3$i = $537 ? $538 : $a$3134$i;
+ $539 = ($$lcssa329|0)==(0);
+ if ($539) {
+ $$a$3186$i = $$a$3$i;$z$4$i = $z$3133$i;
+ break;
+ }
+ $540 = ((($z$3133$i)) + 4|0);
+ HEAP32[$z$3133$i>>2] = $$lcssa329;
+ $$a$3186$i = $$a$3$i;$z$4$i = $540;
+ } else {
+ $523 = HEAP32[$a$3134$i>>2]|0;
+ $524 = ($523|0)==(0);
+ $525 = ((($a$3134$i)) + 4|0);
+ $$a$3185$i = $524 ? $525 : $a$3134$i;
+ $$a$3186$i = $$a$3185$i;$z$4$i = $z$3133$i;
+ }
+ } while(0);
+ $541 = $517 ? $$31$i : $$a$3186$i;
+ $542 = $z$4$i;
+ $543 = $541;
+ $544 = (($542) - ($543))|0;
+ $545 = $544 >> 2;
+ $546 = ($545|0)>($516|0);
+ $547 = (($541) + ($516<<2)|0);
+ $$z$4$i = $546 ? $547 : $z$4$i;
+ $548 = HEAP32[$e2$i>>2]|0;
+ $549 = (($548) + ($521))|0;
+ HEAP32[$e2$i>>2] = $549;
+ $550 = ($549|0)<(0);
+ if ($550) {
+ $519 = $549;$a$3134$i = $$a$3186$i;$z$3133$i = $$z$4$i;
+ } else {
+ $a$3$lcssa$i = $$a$3186$i;$z$3$lcssa$i = $$z$4$i;
+ break;
+ }
+ }
+ } else {
+ $a$3$lcssa$i = $a$1$lcssa$i;$z$3$lcssa$i = $z$1$lcssa$i;
+ }
+ $551 = ($a$3$lcssa$i>>>0)<($z$3$lcssa$i>>>0);
+ do {
+ if ($551) {
+ $552 = $a$3$lcssa$i;
+ $553 = (($482) - ($552))|0;
+ $554 = $553 >> 2;
+ $555 = ($554*9)|0;
+ $556 = HEAP32[$a$3$lcssa$i>>2]|0;
+ $557 = ($556>>>0)<(10);
+ if ($557) {
+ $e$1$i = $555;
+ break;
+ } else {
+ $e$0123$i = $555;$i$0122$i = 10;
+ }
+ while(1) {
+ $558 = ($i$0122$i*10)|0;
+ $559 = (($e$0123$i) + 1)|0;
+ $560 = ($556>>>0)<($558>>>0);
+ if ($560) {
+ $e$1$i = $559;
+ break;
+ } else {
+ $e$0123$i = $559;$i$0122$i = $558;
+ }
+ }
+ } else {
+ $e$1$i = 0;
+ }
+ } while(0);
+ $561 = ($396|0)!=(102);
+ $562 = $561 ? $e$1$i : 0;
+ $563 = (($$p$i) - ($562))|0;
+ $564 = ($396|0)==(103);
+ $565 = ($$p$i|0)!=(0);
+ $566 = $565 & $564;
+ $$neg52$i = $566 << 31 >> 31;
+ $567 = (($563) + ($$neg52$i))|0;
+ $568 = $z$3$lcssa$i;
+ $569 = (($568) - ($482))|0;
+ $570 = $569 >> 2;
+ $571 = ($570*9)|0;
+ $572 = (($571) + -9)|0;
+ $573 = ($567|0)<($572|0);
+ if ($573) {
+ $574 = (($567) + 9216)|0;
+ $575 = (($574|0) / 9)&-1;
+ $$sum$i = (($575) + -1023)|0;
+ $576 = (($$31$i) + ($$sum$i<<2)|0);
+ $577 = (($574|0) % 9)&-1;
+ $j$0115$i = (($577) + 1)|0;
+ $578 = ($j$0115$i|0)<(9);
+ if ($578) {
+ $i$1116$i = 10;$j$0117$i = $j$0115$i;
+ while(1) {
+ $579 = ($i$1116$i*10)|0;
+ $j$0$i = (($j$0117$i) + 1)|0;
+ $exitcond$i = ($j$0$i|0)==(9);
+ if ($exitcond$i) {
+ $i$1$lcssa$i = $579;
+ break;
+ } else {
+ $i$1116$i = $579;$j$0117$i = $j$0$i;
+ }
+ }
+ } else {
+ $i$1$lcssa$i = 10;
+ }
+ $580 = HEAP32[$576>>2]|0;
+ $581 = (($580>>>0) % ($i$1$lcssa$i>>>0))&-1;
+ $582 = ($581|0)==(0);
+ if ($582) {
+ $$sum15$i = (($575) + -1022)|0;
+ $583 = (($$31$i) + ($$sum15$i<<2)|0);
+ $584 = ($583|0)==($z$3$lcssa$i|0);
+ if ($584) {
+ $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i;
+ } else {
+ label = 163;
+ }
+ } else {
+ label = 163;
+ }
+ do {
+ if ((label|0) == 163) {
+ label = 0;
+ $585 = (($580>>>0) / ($i$1$lcssa$i>>>0))&-1;
+ $586 = $585 & 1;
+ $587 = ($586|0)==(0);
+ $$20$i = $587 ? 9007199254740992.0 : 9007199254740994.0;
+ $588 = (($i$1$lcssa$i|0) / 2)&-1;
+ $589 = ($581>>>0)<($588>>>0);
+ do {
+ if ($589) {
+ $small$0$i = 0.5;
+ } else {
+ $590 = ($581|0)==($588|0);
+ if ($590) {
+ $$sum16$i = (($575) + -1022)|0;
+ $591 = (($$31$i) + ($$sum16$i<<2)|0);
+ $592 = ($591|0)==($z$3$lcssa$i|0);
+ if ($592) {
+ $small$0$i = 1.0;
+ break;
+ }
+ }
+ $small$0$i = 1.5;
+ }
+ } while(0);
+ $593 = ($pl$0$i|0)==(0);
+ do {
+ if ($593) {
+ $round6$1$i = $$20$i;$small$1$i = $small$0$i;
+ } else {
+ $594 = HEAP8[$prefix$0$i>>0]|0;
+ $595 = ($594<<24>>24)==(45);
+ if (!($595)) {
+ $round6$1$i = $$20$i;$small$1$i = $small$0$i;
+ break;
+ }
+ $596 = -$$20$i;
+ $597 = -$small$0$i;
+ $round6$1$i = $596;$small$1$i = $597;
+ }
+ } while(0);
+ $598 = (($580) - ($581))|0;
+ HEAP32[$576>>2] = $598;
+ $599 = $round6$1$i + $small$1$i;
+ $600 = $599 != $round6$1$i;
+ if (!($600)) {
+ $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i;
+ break;
+ }
+ $601 = (($598) + ($i$1$lcssa$i))|0;
+ HEAP32[$576>>2] = $601;
+ $602 = ($601>>>0)>(999999999);
+ if ($602) {
+ $a$5109$i = $a$3$lcssa$i;$d$2108$i = $576;
+ while(1) {
+ $603 = ((($d$2108$i)) + -4|0);
+ HEAP32[$d$2108$i>>2] = 0;
+ $604 = ($603>>>0)<($a$5109$i>>>0);
+ if ($604) {
+ $605 = ((($a$5109$i)) + -4|0);
+ HEAP32[$605>>2] = 0;
+ $a$6$i = $605;
+ } else {
+ $a$6$i = $a$5109$i;
+ }
+ $606 = HEAP32[$603>>2]|0;
+ $607 = (($606) + 1)|0;
+ HEAP32[$603>>2] = $607;
+ $608 = ($607>>>0)>(999999999);
+ if ($608) {
+ $a$5109$i = $a$6$i;$d$2108$i = $603;
+ } else {
+ $a$5$lcssa$i = $a$6$i;$d$2$lcssa$i = $603;
+ break;
+ }
+ }
+ } else {
+ $a$5$lcssa$i = $a$3$lcssa$i;$d$2$lcssa$i = $576;
+ }
+ $609 = $a$5$lcssa$i;
+ $610 = (($482) - ($609))|0;
+ $611 = $610 >> 2;
+ $612 = ($611*9)|0;
+ $613 = HEAP32[$a$5$lcssa$i>>2]|0;
+ $614 = ($613>>>0)<(10);
+ if ($614) {
+ $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $612;
+ break;
+ } else {
+ $e$2104$i = $612;$i$2103$i = 10;
+ }
+ while(1) {
+ $615 = ($i$2103$i*10)|0;
+ $616 = (($e$2104$i) + 1)|0;
+ $617 = ($613>>>0)<($615>>>0);
+ if ($617) {
+ $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $616;
+ break;
+ } else {
+ $e$2104$i = $616;$i$2103$i = $615;
+ }
+ }
+ }
+ } while(0);
+ $618 = ((($d$3$i)) + 4|0);
+ $619 = ($z$3$lcssa$i>>>0)>($618>>>0);
+ $$z$3$i = $619 ? $618 : $z$3$lcssa$i;
+ $a$8$ph$i = $a$7$i;$e$4$ph$i = $e$3$i;$z$6$ph$i = $$z$3$i;
+ } else {
+ $a$8$ph$i = $a$3$lcssa$i;$e$4$ph$i = $e$1$i;$z$6$ph$i = $z$3$lcssa$i;
+ }
+ $620 = (0 - ($e$4$ph$i))|0;
+ $z$6$i = $z$6$ph$i;
+ while(1) {
+ $621 = ($z$6$i>>>0)>($a$8$ph$i>>>0);
+ if (!($621)) {
+ $$lcssa159$i = 0;$z$6$i$lcssa = $z$6$i;
+ break;
+ }
+ $622 = ((($z$6$i)) + -4|0);
+ $623 = HEAP32[$622>>2]|0;
+ $624 = ($623|0)==(0);
+ if ($624) {
+ $z$6$i = $622;
+ } else {
+ $$lcssa159$i = 1;$z$6$i$lcssa = $z$6$i;
+ break;
+ }
+ }
+ do {
+ if ($564) {
+ $625 = $565&1;
+ $626 = $625 ^ 1;
+ $$p$$i = (($626) + ($$p$i))|0;
+ $627 = ($$p$$i|0)>($e$4$ph$i|0);
+ $628 = ($e$4$ph$i|0)>(-5);
+ $or$cond6$i = $627 & $628;
+ if ($or$cond6$i) {
+ $629 = (($t$0) + -1)|0;
+ $$neg53$i = (($$p$$i) + -1)|0;
+ $630 = (($$neg53$i) - ($e$4$ph$i))|0;
+ $$013$i = $629;$$210$i = $630;
+ } else {
+ $631 = (($t$0) + -2)|0;
+ $632 = (($$p$$i) + -1)|0;
+ $$013$i = $631;$$210$i = $632;
+ }
+ $633 = $fl$1$ & 8;
+ $634 = ($633|0)==(0);
+ if (!($634)) {
+ $$114$i = $$013$i;$$311$i = $$210$i;$$pre$phi184$iZ2D = $633;
+ break;
+ }
+ do {
+ if ($$lcssa159$i) {
+ $635 = ((($z$6$i$lcssa)) + -4|0);
+ $636 = HEAP32[$635>>2]|0;
+ $637 = ($636|0)==(0);
+ if ($637) {
+ $j$2$i = 9;
+ break;
+ }
+ $638 = (($636>>>0) % 10)&-1;
+ $639 = ($638|0)==(0);
+ if ($639) {
+ $i$399$i = 10;$j$1100$i = 0;
+ } else {
+ $j$2$i = 0;
+ break;
+ }
+ while(1) {
+ $640 = ($i$399$i*10)|0;
+ $641 = (($j$1100$i) + 1)|0;
+ $642 = (($636>>>0) % ($640>>>0))&-1;
+ $643 = ($642|0)==(0);
+ if ($643) {
+ $i$399$i = $640;$j$1100$i = $641;
+ } else {
+ $j$2$i = $641;
+ break;
+ }
+ }
+ } else {
+ $j$2$i = 9;
+ }
+ } while(0);
+ $644 = $$013$i | 32;
+ $645 = ($644|0)==(102);
+ $646 = $z$6$i$lcssa;
+ $647 = (($646) - ($482))|0;
+ $648 = $647 >> 2;
+ $649 = ($648*9)|0;
+ $650 = (($649) + -9)|0;
+ if ($645) {
+ $651 = (($650) - ($j$2$i))|0;
+ $652 = ($651|0)<(0);
+ $$21$i = $652 ? 0 : $651;
+ $653 = ($$210$i|0)<($$21$i|0);
+ $$210$$22$i = $653 ? $$210$i : $$21$i;
+ $$114$i = $$013$i;$$311$i = $$210$$22$i;$$pre$phi184$iZ2D = 0;
+ break;
+ } else {
+ $654 = (($650) + ($e$4$ph$i))|0;
+ $655 = (($654) - ($j$2$i))|0;
+ $656 = ($655|0)<(0);
+ $$23$i = $656 ? 0 : $655;
+ $657 = ($$210$i|0)<($$23$i|0);
+ $$210$$24$i = $657 ? $$210$i : $$23$i;
+ $$114$i = $$013$i;$$311$i = $$210$$24$i;$$pre$phi184$iZ2D = 0;
+ break;
+ }
+ } else {
+ $$pre183$i = $fl$1$ & 8;
+ $$114$i = $t$0;$$311$i = $$p$i;$$pre$phi184$iZ2D = $$pre183$i;
+ }
+ } while(0);
+ $658 = $$311$i | $$pre$phi184$iZ2D;
+ $659 = ($658|0)!=(0);
+ $660 = $659&1;
+ $661 = $$114$i | 32;
+ $662 = ($661|0)==(102);
+ if ($662) {
+ $663 = ($e$4$ph$i|0)>(0);
+ $664 = $663 ? $e$4$ph$i : 0;
+ $$pn$i = $664;$estr$2$i = 0;
+ } else {
+ $665 = ($e$4$ph$i|0)<(0);
+ $666 = $665 ? $620 : $e$4$ph$i;
+ $667 = ($666|0)<(0);
+ $668 = $667 << 31 >> 31;
+ $669 = (_fmt_u($666,$668,$5)|0);
+ $670 = $669;
+ $671 = (($8) - ($670))|0;
+ $672 = ($671|0)<(2);
+ if ($672) {
+ $estr$193$i = $669;
+ while(1) {
+ $673 = ((($estr$193$i)) + -1|0);
+ HEAP8[$673>>0] = 48;
+ $674 = $673;
+ $675 = (($8) - ($674))|0;
+ $676 = ($675|0)<(2);
+ if ($676) {
+ $estr$193$i = $673;
+ } else {
+ $estr$1$lcssa$i = $673;
+ break;
+ }
+ }
+ } else {
+ $estr$1$lcssa$i = $669;
+ }
+ $677 = $e$4$ph$i >> 31;
+ $678 = $677 & 2;
+ $679 = (($678) + 43)|0;
+ $680 = $679&255;
+ $681 = ((($estr$1$lcssa$i)) + -1|0);
+ HEAP8[$681>>0] = $680;
+ $682 = $$114$i&255;
+ $683 = ((($estr$1$lcssa$i)) + -2|0);
+ HEAP8[$683>>0] = $682;
+ $684 = $683;
+ $685 = (($8) - ($684))|0;
+ $$pn$i = $685;$estr$2$i = $683;
+ }
+ $686 = (($pl$0$i) + 1)|0;
+ $687 = (($686) + ($$311$i))|0;
+ $l$1$i = (($687) + ($660))|0;
+ $688 = (($l$1$i) + ($$pn$i))|0;
+ _pad($f,32,$w$1,$688,$fl$1$);
+ $689 = HEAP32[$f>>2]|0;
+ $690 = $689 & 32;
+ $691 = ($690|0)==(0);
+ if ($691) {
+ (___fwritex($prefix$0$i,$pl$0$i,$f)|0);
+ }
+ $692 = $fl$1$ ^ 65536;
+ _pad($f,48,$w$1,$688,$692);
+ do {
+ if ($662) {
+ $693 = ($a$8$ph$i>>>0)>($$31$i>>>0);
+ $r$0$a$8$i = $693 ? $$31$i : $a$8$ph$i;
+ $d$482$i = $r$0$a$8$i;
+ while(1) {
+ $694 = HEAP32[$d$482$i>>2]|0;
+ $695 = (_fmt_u($694,0,$13)|0);
+ $696 = ($d$482$i|0)==($r$0$a$8$i|0);
+ do {
+ if ($696) {
+ $700 = ($695|0)==($13|0);
+ if (!($700)) {
+ $s7$1$i = $695;
+ break;
+ }
+ HEAP8[$15>>0] = 48;
+ $s7$1$i = $15;
+ } else {
+ $697 = ($695>>>0)>($buf$i>>>0);
+ if ($697) {
+ $s7$079$i = $695;
+ } else {
+ $s7$1$i = $695;
+ break;
+ }
+ while(1) {
+ $698 = ((($s7$079$i)) + -1|0);
+ HEAP8[$698>>0] = 48;
+ $699 = ($698>>>0)>($buf$i>>>0);
+ if ($699) {
+ $s7$079$i = $698;
+ } else {
+ $s7$1$i = $698;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $701 = HEAP32[$f>>2]|0;
+ $702 = $701 & 32;
+ $703 = ($702|0)==(0);
+ if ($703) {
+ $704 = $s7$1$i;
+ $705 = (($14) - ($704))|0;
+ (___fwritex($s7$1$i,$705,$f)|0);
+ }
+ $706 = ((($d$482$i)) + 4|0);
+ $707 = ($706>>>0)>($$31$i>>>0);
+ if ($707) {
+ $$lcssa339 = $706;
+ break;
+ } else {
+ $d$482$i = $706;
+ }
+ }
+ $708 = ($658|0)==(0);
+ do {
+ if (!($708)) {
+ $709 = HEAP32[$f>>2]|0;
+ $710 = $709 & 32;
+ $711 = ($710|0)==(0);
+ if (!($711)) {
+ break;
+ }
+ (___fwritex(24306,1,$f)|0);
+ }
+ } while(0);
+ $712 = ($$lcssa339>>>0)<($z$6$i$lcssa>>>0);
+ $713 = ($$311$i|0)>(0);
+ $714 = $713 & $712;
+ if ($714) {
+ $$41276$i = $$311$i;$d$575$i = $$lcssa339;
+ while(1) {
+ $715 = HEAP32[$d$575$i>>2]|0;
+ $716 = (_fmt_u($715,0,$13)|0);
+ $717 = ($716>>>0)>($buf$i>>>0);
+ if ($717) {
+ $s8$070$i = $716;
+ while(1) {
+ $718 = ((($s8$070$i)) + -1|0);
+ HEAP8[$718>>0] = 48;
+ $719 = ($718>>>0)>($buf$i>>>0);
+ if ($719) {
+ $s8$070$i = $718;
+ } else {
+ $s8$0$lcssa$i = $718;
+ break;
+ }
+ }
+ } else {
+ $s8$0$lcssa$i = $716;
+ }
+ $720 = HEAP32[$f>>2]|0;
+ $721 = $720 & 32;
+ $722 = ($721|0)==(0);
+ if ($722) {
+ $723 = ($$41276$i|0)>(9);
+ $724 = $723 ? 9 : $$41276$i;
+ (___fwritex($s8$0$lcssa$i,$724,$f)|0);
+ }
+ $725 = ((($d$575$i)) + 4|0);
+ $726 = (($$41276$i) + -9)|0;
+ $727 = ($725>>>0)<($z$6$i$lcssa>>>0);
+ $728 = ($$41276$i|0)>(9);
+ $729 = $728 & $727;
+ if ($729) {
+ $$41276$i = $726;$d$575$i = $725;
+ } else {
+ $$412$lcssa$i = $726;
+ break;
+ }
+ }
+ } else {
+ $$412$lcssa$i = $$311$i;
+ }
+ $730 = (($$412$lcssa$i) + 9)|0;
+ _pad($f,48,$730,9,0);
+ } else {
+ $731 = ((($a$8$ph$i)) + 4|0);
+ $z$6$$i = $$lcssa159$i ? $z$6$i$lcssa : $731;
+ $732 = ($$311$i|0)>(-1);
+ if ($732) {
+ $733 = ($$pre$phi184$iZ2D|0)==(0);
+ $$587$i = $$311$i;$d$686$i = $a$8$ph$i;
+ while(1) {
+ $734 = HEAP32[$d$686$i>>2]|0;
+ $735 = (_fmt_u($734,0,$13)|0);
+ $736 = ($735|0)==($13|0);
+ if ($736) {
+ HEAP8[$15>>0] = 48;
+ $s9$0$i = $15;
+ } else {
+ $s9$0$i = $735;
+ }
+ $737 = ($d$686$i|0)==($a$8$ph$i|0);
+ do {
+ if ($737) {
+ $741 = ((($s9$0$i)) + 1|0);
+ $742 = HEAP32[$f>>2]|0;
+ $743 = $742 & 32;
+ $744 = ($743|0)==(0);
+ if ($744) {
+ (___fwritex($s9$0$i,1,$f)|0);
+ }
+ $745 = ($$587$i|0)<(1);
+ $or$cond29$i = $733 & $745;
+ if ($or$cond29$i) {
+ $s9$2$i = $741;
+ break;
+ }
+ $746 = HEAP32[$f>>2]|0;
+ $747 = $746 & 32;
+ $748 = ($747|0)==(0);
+ if (!($748)) {
+ $s9$2$i = $741;
+ break;
+ }
+ (___fwritex(24306,1,$f)|0);
+ $s9$2$i = $741;
+ } else {
+ $738 = ($s9$0$i>>>0)>($buf$i>>>0);
+ if ($738) {
+ $s9$183$i = $s9$0$i;
+ } else {
+ $s9$2$i = $s9$0$i;
+ break;
+ }
+ while(1) {
+ $739 = ((($s9$183$i)) + -1|0);
+ HEAP8[$739>>0] = 48;
+ $740 = ($739>>>0)>($buf$i>>>0);
+ if ($740) {
+ $s9$183$i = $739;
+ } else {
+ $s9$2$i = $739;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $749 = $s9$2$i;
+ $750 = (($14) - ($749))|0;
+ $751 = HEAP32[$f>>2]|0;
+ $752 = $751 & 32;
+ $753 = ($752|0)==(0);
+ if ($753) {
+ $754 = ($$587$i|0)>($750|0);
+ $755 = $754 ? $750 : $$587$i;
+ (___fwritex($s9$2$i,$755,$f)|0);
+ }
+ $756 = (($$587$i) - ($750))|0;
+ $757 = ((($d$686$i)) + 4|0);
+ $758 = ($757>>>0)<($z$6$$i>>>0);
+ $759 = ($756|0)>(-1);
+ $760 = $758 & $759;
+ if ($760) {
+ $$587$i = $756;$d$686$i = $757;
+ } else {
+ $$5$lcssa$i = $756;
+ break;
+ }
+ }
+ } else {
+ $$5$lcssa$i = $$311$i;
+ }
+ $761 = (($$5$lcssa$i) + 18)|0;
+ _pad($f,48,$761,18,0);
+ $762 = HEAP32[$f>>2]|0;
+ $763 = $762 & 32;
+ $764 = ($763|0)==(0);
+ if (!($764)) {
+ break;
+ }
+ $765 = $estr$2$i;
+ $766 = (($8) - ($765))|0;
+ (___fwritex($estr$2$i,$766,$f)|0);
+ }
+ } while(0);
+ $767 = $fl$1$ ^ 8192;
+ _pad($f,32,$w$1,$688,$767);
+ $768 = ($688|0)<($w$1|0);
+ $w$30$i = $768 ? $w$1 : $688;
+ $$0$i = $w$30$i;
+ } else {
+ $376 = $t$0 & 32;
+ $377 = ($376|0)!=(0);
+ $378 = $377 ? 24290 : 24294;
+ $379 = ($$07$i != $$07$i) | (0.0 != 0.0);
+ $380 = $377 ? 24298 : 24302;
+ $pl$1$i = $379 ? 0 : $pl$0$i;
+ $s1$0$i = $379 ? $380 : $378;
+ $381 = (($pl$1$i) + 3)|0;
+ _pad($f,32,$w$1,$381,$175);
+ $382 = HEAP32[$f>>2]|0;
+ $383 = $382 & 32;
+ $384 = ($383|0)==(0);
+ if ($384) {
+ (___fwritex($prefix$0$i,$pl$1$i,$f)|0);
+ $$pre$i = HEAP32[$f>>2]|0;
+ $386 = $$pre$i;
+ } else {
+ $386 = $382;
+ }
+ $385 = $386 & 32;
+ $387 = ($385|0)==(0);
+ if ($387) {
+ (___fwritex($s1$0$i,3,$f)|0);
+ }
+ $388 = $fl$1$ ^ 8192;
+ _pad($f,32,$w$1,$381,$388);
+ $389 = ($381|0)<($w$1|0);
+ $390 = $389 ? $w$1 : $381;
+ $$0$i = $390;
+ }
+ } while(0);
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $$0$i;$l10n$0 = $l10n$3;
+ continue L1;
+ break;
+ }
+ default: {
+ $a$2 = $fmt41;$fl$6 = $fl$1$;$p$5 = $p$0;$pl$2 = 0;$prefix$2 = 24254;$z$2 = $1;
+ }
+ }
+ } while(0);
+ L313: do {
+ if ((label|0) == 64) {
+ label = 0;
+ $206 = $arg;
+ $207 = $206;
+ $208 = HEAP32[$207>>2]|0;
+ $209 = (($206) + 4)|0;
+ $210 = $209;
+ $211 = HEAP32[$210>>2]|0;
+ $212 = $t$1 & 32;
+ $213 = ($208|0)==(0);
+ $214 = ($211|0)==(0);
+ $215 = $213 & $214;
+ if ($215) {
+ $a$0 = $1;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 24254;
+ label = 77;
+ } else {
+ $$012$i = $1;$217 = $208;$224 = $211;
+ while(1) {
+ $216 = $217 & 15;
+ $218 = (24238 + ($216)|0);
+ $219 = HEAP8[$218>>0]|0;
+ $220 = $219&255;
+ $221 = $220 | $212;
+ $222 = $221&255;
+ $223 = ((($$012$i)) + -1|0);
+ HEAP8[$223>>0] = $222;
+ $225 = (_bitshift64Lshr(($217|0),($224|0),4)|0);
+ $226 = tempRet0;
+ $227 = ($225|0)==(0);
+ $228 = ($226|0)==(0);
+ $229 = $227 & $228;
+ if ($229) {
+ $$lcssa344 = $223;
+ break;
+ } else {
+ $$012$i = $223;$217 = $225;$224 = $226;
+ }
+ }
+ $230 = $arg;
+ $231 = $230;
+ $232 = HEAP32[$231>>2]|0;
+ $233 = (($230) + 4)|0;
+ $234 = $233;
+ $235 = HEAP32[$234>>2]|0;
+ $236 = ($232|0)==(0);
+ $237 = ($235|0)==(0);
+ $238 = $236 & $237;
+ $239 = $fl$3 & 8;
+ $240 = ($239|0)==(0);
+ $or$cond17 = $240 | $238;
+ if ($or$cond17) {
+ $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 24254;
+ label = 77;
+ } else {
+ $241 = $t$1 >> 4;
+ $242 = (24254 + ($241)|0);
+ $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 2;$prefix$1 = $242;
+ label = 77;
+ }
+ }
+ }
+ else if ((label|0) == 76) {
+ label = 0;
+ $288 = (_fmt_u($286,$287,$1)|0);
+ $a$0 = $288;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = $pl$0;$prefix$1 = $prefix$0;
+ label = 77;
+ }
+ else if ((label|0) == 82) {
+ label = 0;
+ $320 = (_memchr($a$1,0,$p$0)|0);
+ $321 = ($320|0)==(0|0);
+ $322 = $320;
+ $323 = $a$1;
+ $324 = (($322) - ($323))|0;
+ $325 = (($a$1) + ($p$0)|0);
+ $z$1 = $321 ? $325 : $320;
+ $p$3 = $321 ? $p$0 : $324;
+ $a$2 = $a$1;$fl$6 = $175;$p$5 = $p$3;$pl$2 = 0;$prefix$2 = 24254;$z$2 = $z$1;
+ }
+ else if ((label|0) == 86) {
+ label = 0;
+ $333 = HEAP32[$arg>>2]|0;
+ $i$0114 = 0;$l$1113 = 0;$ws$0115 = $333;
+ while(1) {
+ $334 = HEAP32[$ws$0115>>2]|0;
+ $335 = ($334|0)==(0);
+ if ($335) {
+ $i$0$lcssa = $i$0114;$l$2 = $l$1113;
+ break;
+ }
+ $336 = (_wctomb($mb,$334)|0);
+ $337 = ($336|0)<(0);
+ $338 = (($p$4198) - ($i$0114))|0;
+ $339 = ($336>>>0)>($338>>>0);
+ $or$cond20 = $337 | $339;
+ if ($or$cond20) {
+ $i$0$lcssa = $i$0114;$l$2 = $336;
+ break;
+ }
+ $340 = ((($ws$0115)) + 4|0);
+ $341 = (($336) + ($i$0114))|0;
+ $342 = ($p$4198>>>0)>($341>>>0);
+ if ($342) {
+ $i$0114 = $341;$l$1113 = $336;$ws$0115 = $340;
+ } else {
+ $i$0$lcssa = $341;$l$2 = $336;
+ break;
+ }
+ }
+ $343 = ($l$2|0)<(0);
+ if ($343) {
+ $$0 = -1;
+ break L1;
+ }
+ _pad($f,32,$w$1,$i$0$lcssa,$fl$1$);
+ $344 = ($i$0$lcssa|0)==(0);
+ if ($344) {
+ $i$0$lcssa200 = 0;
+ label = 98;
+ } else {
+ $345 = HEAP32[$arg>>2]|0;
+ $i$1125 = 0;$ws$1126 = $345;
+ while(1) {
+ $346 = HEAP32[$ws$1126>>2]|0;
+ $347 = ($346|0)==(0);
+ if ($347) {
+ $i$0$lcssa200 = $i$0$lcssa;
+ label = 98;
+ break L313;
+ }
+ $348 = ((($ws$1126)) + 4|0);
+ $349 = (_wctomb($mb,$346)|0);
+ $350 = (($349) + ($i$1125))|0;
+ $351 = ($350|0)>($i$0$lcssa|0);
+ if ($351) {
+ $i$0$lcssa200 = $i$0$lcssa;
+ label = 98;
+ break L313;
+ }
+ $352 = HEAP32[$f>>2]|0;
+ $353 = $352 & 32;
+ $354 = ($353|0)==(0);
+ if ($354) {
+ (___fwritex($mb,$349,$f)|0);
+ }
+ $355 = ($350>>>0)<($i$0$lcssa>>>0);
+ if ($355) {
+ $i$1125 = $350;$ws$1126 = $348;
+ } else {
+ $i$0$lcssa200 = $i$0$lcssa;
+ label = 98;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 98) {
+ label = 0;
+ $356 = $fl$1$ ^ 8192;
+ _pad($f,32,$w$1,$i$0$lcssa200,$356);
+ $357 = ($w$1|0)>($i$0$lcssa200|0);
+ $358 = $357 ? $w$1 : $i$0$lcssa200;
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $358;$l10n$0 = $l10n$3;
+ continue;
+ }
+ if ((label|0) == 77) {
+ label = 0;
+ $289 = ($p$2|0)>(-1);
+ $290 = $fl$4 & -65537;
+ $$fl$4 = $289 ? $290 : $fl$4;
+ $291 = $arg;
+ $292 = $291;
+ $293 = HEAP32[$292>>2]|0;
+ $294 = (($291) + 4)|0;
+ $295 = $294;
+ $296 = HEAP32[$295>>2]|0;
+ $297 = ($293|0)!=(0);
+ $298 = ($296|0)!=(0);
+ $299 = $297 | $298;
+ $300 = ($p$2|0)!=(0);
+ $or$cond = $300 | $299;
+ if ($or$cond) {
+ $301 = $a$0;
+ $302 = (($2) - ($301))|0;
+ $303 = $299&1;
+ $304 = $303 ^ 1;
+ $305 = (($304) + ($302))|0;
+ $306 = ($p$2|0)>($305|0);
+ $p$2$ = $306 ? $p$2 : $305;
+ $a$2 = $a$0;$fl$6 = $$fl$4;$p$5 = $p$2$;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1;
+ } else {
+ $a$2 = $1;$fl$6 = $$fl$4;$p$5 = 0;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1;
+ }
+ }
+ $769 = $z$2;
+ $770 = $a$2;
+ $771 = (($769) - ($770))|0;
+ $772 = ($p$5|0)<($771|0);
+ $$p$5 = $772 ? $771 : $p$5;
+ $773 = (($pl$2) + ($$p$5))|0;
+ $774 = ($w$1|0)<($773|0);
+ $w$2 = $774 ? $773 : $w$1;
+ _pad($f,32,$w$2,$773,$fl$6);
+ $775 = HEAP32[$f>>2]|0;
+ $776 = $775 & 32;
+ $777 = ($776|0)==(0);
+ if ($777) {
+ (___fwritex($prefix$2,$pl$2,$f)|0);
+ }
+ $778 = $fl$6 ^ 65536;
+ _pad($f,48,$w$2,$773,$778);
+ _pad($f,48,$$p$5,$771,0);
+ $779 = HEAP32[$f>>2]|0;
+ $780 = $779 & 32;
+ $781 = ($780|0)==(0);
+ if ($781) {
+ (___fwritex($a$2,$771,$f)|0);
+ }
+ $782 = $fl$6 ^ 8192;
+ _pad($f,32,$w$2,$773,$782);
+ $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $w$2;$l10n$0 = $l10n$3;
+ }
+ L348: do {
+ if ((label|0) == 245) {
+ $783 = ($f|0)==(0|0);
+ if ($783) {
+ $784 = ($l10n$0$lcssa|0)==(0);
+ if ($784) {
+ $$0 = 0;
+ } else {
+ $i$2100 = 1;
+ while(1) {
+ $785 = (($nl_type) + ($i$2100<<2)|0);
+ $786 = HEAP32[$785>>2]|0;
+ $787 = ($786|0)==(0);
+ if ($787) {
+ $i$2100$lcssa = $i$2100;
+ break;
+ }
+ $789 = (($nl_arg) + ($i$2100<<3)|0);
+ _pop_arg($789,$786,$ap);
+ $790 = (($i$2100) + 1)|0;
+ $791 = ($790|0)<(10);
+ if ($791) {
+ $i$2100 = $790;
+ } else {
+ $$0 = 1;
+ break L348;
+ }
+ }
+ $788 = ($i$2100$lcssa|0)<(10);
+ if ($788) {
+ $i$398 = $i$2100$lcssa;
+ while(1) {
+ $794 = (($nl_type) + ($i$398<<2)|0);
+ $795 = HEAP32[$794>>2]|0;
+ $796 = ($795|0)==(0);
+ $792 = (($i$398) + 1)|0;
+ if (!($796)) {
+ $$0 = -1;
+ break L348;
+ }
+ $793 = ($792|0)<(10);
+ if ($793) {
+ $i$398 = $792;
+ } else {
+ $$0 = 1;
+ break;
+ }
+ }
+ } else {
+ $$0 = 1;
+ }
+ }
+ } else {
+ $$0 = $cnt$1$lcssa;
+ }
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function _cleanup521($p) {
+ $p = $p|0;
+ var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($p)) + 68|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ ___unlockfile($p);
+ }
+ return;
+}
+function _cleanup526($p) {
+ $p = $p|0;
+ var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($p)) + 68|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ ___unlockfile($p);
+ }
+ return;
+}
+function _sn_write($f,$s,$l) {
+ $f = $f|0;
+ $s = $s|0;
+ $l = $l|0;
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $l$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($f)) + 16|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($f)) + 20|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = $1;
+ $5 = $3;
+ $6 = (($4) - ($5))|0;
+ $7 = ($6>>>0)>($l>>>0);
+ $l$ = $7 ? $l : $6;
+ _memcpy(($3|0),($s|0),($l$|0))|0;
+ $8 = HEAP32[$2>>2]|0;
+ $9 = (($8) + ($l$)|0);
+ HEAP32[$2>>2] = $9;
+ return ($l|0);
+}
+function _pop_arg($arg,$type,$ap) {
+ $arg = $arg|0;
+ $type = $type|0;
+ $ap = $ap|0;
+ var $$mask = 0, $$mask1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0;
+ var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
+ var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
+ var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
+ var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
+ var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
+ var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
+ var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
+ var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($type>>>0)>(20);
+ L1: do {
+ if (!($0)) {
+ do {
+ switch ($type|0) {
+ case 9: {
+ $arglist_current = HEAP32[$ap>>2]|0;
+ $1 = $arglist_current;
+ $2 = ((0) + 4|0);
+ $expanded28 = $2;
+ $expanded = (($expanded28) - 1)|0;
+ $3 = (($1) + ($expanded))|0;
+ $4 = ((0) + 4|0);
+ $expanded32 = $4;
+ $expanded31 = (($expanded32) - 1)|0;
+ $expanded30 = $expanded31 ^ -1;
+ $5 = $3 & $expanded30;
+ $6 = $5;
+ $7 = HEAP32[$6>>2]|0;
+ $arglist_next = ((($6)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next;
+ HEAP32[$arg>>2] = $7;
+ break L1;
+ break;
+ }
+ case 10: {
+ $arglist_current2 = HEAP32[$ap>>2]|0;
+ $8 = $arglist_current2;
+ $9 = ((0) + 4|0);
+ $expanded35 = $9;
+ $expanded34 = (($expanded35) - 1)|0;
+ $10 = (($8) + ($expanded34))|0;
+ $11 = ((0) + 4|0);
+ $expanded39 = $11;
+ $expanded38 = (($expanded39) - 1)|0;
+ $expanded37 = $expanded38 ^ -1;
+ $12 = $10 & $expanded37;
+ $13 = $12;
+ $14 = HEAP32[$13>>2]|0;
+ $arglist_next3 = ((($13)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next3;
+ $15 = ($14|0)<(0);
+ $16 = $15 << 31 >> 31;
+ $17 = $arg;
+ $18 = $17;
+ HEAP32[$18>>2] = $14;
+ $19 = (($17) + 4)|0;
+ $20 = $19;
+ HEAP32[$20>>2] = $16;
+ break L1;
+ break;
+ }
+ case 11: {
+ $arglist_current5 = HEAP32[$ap>>2]|0;
+ $21 = $arglist_current5;
+ $22 = ((0) + 4|0);
+ $expanded42 = $22;
+ $expanded41 = (($expanded42) - 1)|0;
+ $23 = (($21) + ($expanded41))|0;
+ $24 = ((0) + 4|0);
+ $expanded46 = $24;
+ $expanded45 = (($expanded46) - 1)|0;
+ $expanded44 = $expanded45 ^ -1;
+ $25 = $23 & $expanded44;
+ $26 = $25;
+ $27 = HEAP32[$26>>2]|0;
+ $arglist_next6 = ((($26)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next6;
+ $28 = $arg;
+ $29 = $28;
+ HEAP32[$29>>2] = $27;
+ $30 = (($28) + 4)|0;
+ $31 = $30;
+ HEAP32[$31>>2] = 0;
+ break L1;
+ break;
+ }
+ case 12: {
+ $arglist_current8 = HEAP32[$ap>>2]|0;
+ $32 = $arglist_current8;
+ $33 = ((0) + 8|0);
+ $expanded49 = $33;
+ $expanded48 = (($expanded49) - 1)|0;
+ $34 = (($32) + ($expanded48))|0;
+ $35 = ((0) + 8|0);
+ $expanded53 = $35;
+ $expanded52 = (($expanded53) - 1)|0;
+ $expanded51 = $expanded52 ^ -1;
+ $36 = $34 & $expanded51;
+ $37 = $36;
+ $38 = $37;
+ $39 = $38;
+ $40 = HEAP32[$39>>2]|0;
+ $41 = (($38) + 4)|0;
+ $42 = $41;
+ $43 = HEAP32[$42>>2]|0;
+ $arglist_next9 = ((($37)) + 8|0);
+ HEAP32[$ap>>2] = $arglist_next9;
+ $44 = $arg;
+ $45 = $44;
+ HEAP32[$45>>2] = $40;
+ $46 = (($44) + 4)|0;
+ $47 = $46;
+ HEAP32[$47>>2] = $43;
+ break L1;
+ break;
+ }
+ case 13: {
+ $arglist_current11 = HEAP32[$ap>>2]|0;
+ $48 = $arglist_current11;
+ $49 = ((0) + 4|0);
+ $expanded56 = $49;
+ $expanded55 = (($expanded56) - 1)|0;
+ $50 = (($48) + ($expanded55))|0;
+ $51 = ((0) + 4|0);
+ $expanded60 = $51;
+ $expanded59 = (($expanded60) - 1)|0;
+ $expanded58 = $expanded59 ^ -1;
+ $52 = $50 & $expanded58;
+ $53 = $52;
+ $54 = HEAP32[$53>>2]|0;
+ $arglist_next12 = ((($53)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next12;
+ $55 = $54&65535;
+ $56 = $55 << 16 >> 16;
+ $57 = ($56|0)<(0);
+ $58 = $57 << 31 >> 31;
+ $59 = $arg;
+ $60 = $59;
+ HEAP32[$60>>2] = $56;
+ $61 = (($59) + 4)|0;
+ $62 = $61;
+ HEAP32[$62>>2] = $58;
+ break L1;
+ break;
+ }
+ case 14: {
+ $arglist_current14 = HEAP32[$ap>>2]|0;
+ $63 = $arglist_current14;
+ $64 = ((0) + 4|0);
+ $expanded63 = $64;
+ $expanded62 = (($expanded63) - 1)|0;
+ $65 = (($63) + ($expanded62))|0;
+ $66 = ((0) + 4|0);
+ $expanded67 = $66;
+ $expanded66 = (($expanded67) - 1)|0;
+ $expanded65 = $expanded66 ^ -1;
+ $67 = $65 & $expanded65;
+ $68 = $67;
+ $69 = HEAP32[$68>>2]|0;
+ $arglist_next15 = ((($68)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next15;
+ $$mask1 = $69 & 65535;
+ $70 = $arg;
+ $71 = $70;
+ HEAP32[$71>>2] = $$mask1;
+ $72 = (($70) + 4)|0;
+ $73 = $72;
+ HEAP32[$73>>2] = 0;
+ break L1;
+ break;
+ }
+ case 15: {
+ $arglist_current17 = HEAP32[$ap>>2]|0;
+ $74 = $arglist_current17;
+ $75 = ((0) + 4|0);
+ $expanded70 = $75;
+ $expanded69 = (($expanded70) - 1)|0;
+ $76 = (($74) + ($expanded69))|0;
+ $77 = ((0) + 4|0);
+ $expanded74 = $77;
+ $expanded73 = (($expanded74) - 1)|0;
+ $expanded72 = $expanded73 ^ -1;
+ $78 = $76 & $expanded72;
+ $79 = $78;
+ $80 = HEAP32[$79>>2]|0;
+ $arglist_next18 = ((($79)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next18;
+ $81 = $80&255;
+ $82 = $81 << 24 >> 24;
+ $83 = ($82|0)<(0);
+ $84 = $83 << 31 >> 31;
+ $85 = $arg;
+ $86 = $85;
+ HEAP32[$86>>2] = $82;
+ $87 = (($85) + 4)|0;
+ $88 = $87;
+ HEAP32[$88>>2] = $84;
+ break L1;
+ break;
+ }
+ case 16: {
+ $arglist_current20 = HEAP32[$ap>>2]|0;
+ $89 = $arglist_current20;
+ $90 = ((0) + 4|0);
+ $expanded77 = $90;
+ $expanded76 = (($expanded77) - 1)|0;
+ $91 = (($89) + ($expanded76))|0;
+ $92 = ((0) + 4|0);
+ $expanded81 = $92;
+ $expanded80 = (($expanded81) - 1)|0;
+ $expanded79 = $expanded80 ^ -1;
+ $93 = $91 & $expanded79;
+ $94 = $93;
+ $95 = HEAP32[$94>>2]|0;
+ $arglist_next21 = ((($94)) + 4|0);
+ HEAP32[$ap>>2] = $arglist_next21;
+ $$mask = $95 & 255;
+ $96 = $arg;
+ $97 = $96;
+ HEAP32[$97>>2] = $$mask;
+ $98 = (($96) + 4)|0;
+ $99 = $98;
+ HEAP32[$99>>2] = 0;
+ break L1;
+ break;
+ }
+ case 17: {
+ $arglist_current23 = HEAP32[$ap>>2]|0;
+ $100 = $arglist_current23;
+ $101 = ((0) + 8|0);
+ $expanded84 = $101;
+ $expanded83 = (($expanded84) - 1)|0;
+ $102 = (($100) + ($expanded83))|0;
+ $103 = ((0) + 8|0);
+ $expanded88 = $103;
+ $expanded87 = (($expanded88) - 1)|0;
+ $expanded86 = $expanded87 ^ -1;
+ $104 = $102 & $expanded86;
+ $105 = $104;
+ $106 = +HEAPF64[$105>>3];
+ $arglist_next24 = ((($105)) + 8|0);
+ HEAP32[$ap>>2] = $arglist_next24;
+ HEAPF64[$arg>>3] = $106;
+ break L1;
+ break;
+ }
+ case 18: {
+ $arglist_current26 = HEAP32[$ap>>2]|0;
+ $107 = $arglist_current26;
+ $108 = ((0) + 8|0);
+ $expanded91 = $108;
+ $expanded90 = (($expanded91) - 1)|0;
+ $109 = (($107) + ($expanded90))|0;
+ $110 = ((0) + 8|0);
+ $expanded95 = $110;
+ $expanded94 = (($expanded95) - 1)|0;
+ $expanded93 = $expanded94 ^ -1;
+ $111 = $109 & $expanded93;
+ $112 = $111;
+ $113 = +HEAPF64[$112>>3];
+ $arglist_next27 = ((($112)) + 8|0);
+ HEAP32[$ap>>2] = $arglist_next27;
+ HEAPF64[$arg>>3] = $113;
+ break L1;
+ break;
+ }
+ default: {
+ break L1;
+ }
+ }
+ } while(0);
+ }
+ } while(0);
+ return;
+}
+function _fmt_u($0,$1,$s) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $s = $s|0;
+ var $$0$lcssa = 0, $$01$lcssa$off0 = 0, $$05 = 0, $$1$lcssa = 0, $$12 = 0, $$lcssa20 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $y$03 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1>>>0)>(0);
+ $3 = ($0>>>0)>(4294967295);
+ $4 = ($1|0)==(0);
+ $5 = $4 & $3;
+ $6 = $2 | $5;
+ if ($6) {
+ $$05 = $s;$7 = $0;$8 = $1;
+ while(1) {
+ $9 = (___uremdi3(($7|0),($8|0),10,0)|0);
+ $10 = tempRet0;
+ $11 = $9 | 48;
+ $12 = $11&255;
+ $13 = ((($$05)) + -1|0);
+ HEAP8[$13>>0] = $12;
+ $14 = (___udivdi3(($7|0),($8|0),10,0)|0);
+ $15 = tempRet0;
+ $16 = ($8>>>0)>(9);
+ $17 = ($7>>>0)>(4294967295);
+ $18 = ($8|0)==(9);
+ $19 = $18 & $17;
+ $20 = $16 | $19;
+ if ($20) {
+ $$05 = $13;$7 = $14;$8 = $15;
+ } else {
+ $$lcssa20 = $13;$28 = $14;$29 = $15;
+ break;
+ }
+ }
+ $$0$lcssa = $$lcssa20;$$01$lcssa$off0 = $28;
+ } else {
+ $$0$lcssa = $s;$$01$lcssa$off0 = $0;
+ }
+ $21 = ($$01$lcssa$off0|0)==(0);
+ if ($21) {
+ $$1$lcssa = $$0$lcssa;
+ } else {
+ $$12 = $$0$lcssa;$y$03 = $$01$lcssa$off0;
+ while(1) {
+ $22 = (($y$03>>>0) % 10)&-1;
+ $23 = $22 | 48;
+ $24 = $23&255;
+ $25 = ((($$12)) + -1|0);
+ HEAP8[$25>>0] = $24;
+ $26 = (($y$03>>>0) / 10)&-1;
+ $27 = ($y$03>>>0)<(10);
+ if ($27) {
+ $$1$lcssa = $25;
+ break;
+ } else {
+ $$12 = $25;$y$03 = $26;
+ }
+ }
+ }
+ return ($$1$lcssa|0);
+}
+function _pad($f,$c,$w,$l,$fl) {
+ $f = $f|0;
+ $c = $c|0;
+ $w = $w|0;
+ $l = $l|0;
+ $fl = $fl|0;
+ var $$0$lcssa6 = 0, $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, $or$cond = 0, $pad = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0;
+ $pad = sp;
+ $0 = $fl & 73728;
+ $1 = ($0|0)==(0);
+ $2 = ($w|0)>($l|0);
+ $or$cond = $2 & $1;
+ do {
+ if ($or$cond) {
+ $3 = (($w) - ($l))|0;
+ $4 = ($3>>>0)>(256);
+ $5 = $4 ? 256 : $3;
+ _memset(($pad|0),($c|0),($5|0))|0;
+ $6 = ($3>>>0)>(255);
+ $7 = HEAP32[$f>>2]|0;
+ $8 = $7 & 32;
+ $9 = ($8|0)==(0);
+ if ($6) {
+ $10 = (($w) - ($l))|0;
+ $$02 = $3;$17 = $7;$18 = $9;
+ while(1) {
+ if ($18) {
+ (___fwritex($pad,256,$f)|0);
+ $$pre = HEAP32[$f>>2]|0;
+ $14 = $$pre;
+ } else {
+ $14 = $17;
+ }
+ $11 = (($$02) + -256)|0;
+ $12 = ($11>>>0)>(255);
+ $13 = $14 & 32;
+ $15 = ($13|0)==(0);
+ if ($12) {
+ $$02 = $11;$17 = $14;$18 = $15;
+ } else {
+ break;
+ }
+ }
+ $16 = $10 & 255;
+ if ($15) {
+ $$0$lcssa6 = $16;
+ } else {
+ break;
+ }
+ } else {
+ if ($9) {
+ $$0$lcssa6 = $3;
+ } else {
+ break;
+ }
+ }
+ (___fwritex($pad,$$0$lcssa6,$f)|0);
+ }
+ } while(0);
+ STACKTOP = sp;return;
+}
+function _malloc($bytes) {
+ $bytes = $bytes|0;
+ var $$3$i = 0, $$lcssa = 0, $$lcssa211 = 0, $$lcssa215 = 0, $$lcssa216 = 0, $$lcssa217 = 0, $$lcssa219 = 0, $$lcssa222 = 0, $$lcssa224 = 0, $$lcssa226 = 0, $$lcssa228 = 0, $$lcssa230 = 0, $$lcssa232 = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i22$i = 0, $$pre$i25 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i23$iZ2D = 0;
+ var $$pre$phi$i26Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi58$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre105 = 0, $$pre106 = 0, $$pre14$i$i = 0, $$pre43$i = 0, $$pre56$i$i = 0, $$pre57$i$i = 0, $$pre8$i = 0, $$rsize$0$i = 0, $$rsize$3$i = 0, $$sum = 0, $$sum$i$i = 0, $$sum$i$i$i = 0, $$sum$i13$i = 0, $$sum$i14$i = 0, $$sum$i17$i = 0, $$sum$i19$i = 0;
+ var $$sum$i2334 = 0, $$sum$i32 = 0, $$sum$i35 = 0, $$sum1 = 0, $$sum1$i = 0, $$sum1$i$i = 0, $$sum1$i15$i = 0, $$sum1$i20$i = 0, $$sum1$i24 = 0, $$sum10 = 0, $$sum10$i = 0, $$sum10$i$i = 0, $$sum11$i = 0, $$sum11$i$i = 0, $$sum1112 = 0, $$sum112$i = 0, $$sum113$i = 0, $$sum114$i = 0, $$sum115$i = 0, $$sum116$i = 0;
+ var $$sum117$i = 0, $$sum118$i = 0, $$sum119$i = 0, $$sum12$i = 0, $$sum12$i$i = 0, $$sum120$i = 0, $$sum121$i = 0, $$sum122$i = 0, $$sum123$i = 0, $$sum124$i = 0, $$sum125$i = 0, $$sum13$i = 0, $$sum13$i$i = 0, $$sum14$i$i = 0, $$sum15$i = 0, $$sum15$i$i = 0, $$sum16$i = 0, $$sum16$i$i = 0, $$sum17$i = 0, $$sum17$i$i = 0;
+ var $$sum18$i = 0, $$sum1819$i$i = 0, $$sum2 = 0, $$sum2$i = 0, $$sum2$i$i = 0, $$sum2$i$i$i = 0, $$sum2$i16$i = 0, $$sum2$i18$i = 0, $$sum2$i21$i = 0, $$sum20$i$i = 0, $$sum21$i$i = 0, $$sum22$i$i = 0, $$sum23$i$i = 0, $$sum24$i$i = 0, $$sum25$i$i = 0, $$sum27$i$i = 0, $$sum28$i$i = 0, $$sum29$i$i = 0, $$sum3$i = 0, $$sum3$i27 = 0;
+ var $$sum30$i$i = 0, $$sum3132$i$i = 0, $$sum34$i$i = 0, $$sum3536$i$i = 0, $$sum3738$i$i = 0, $$sum39$i$i = 0, $$sum4 = 0, $$sum4$i = 0, $$sum4$i$i = 0, $$sum4$i28 = 0, $$sum40$i$i = 0, $$sum41$i$i = 0, $$sum42$i$i = 0, $$sum5$i = 0, $$sum5$i$i = 0, $$sum56 = 0, $$sum6$i = 0, $$sum67$i$i = 0, $$sum7$i = 0, $$sum8$i = 0;
+ var $$sum9 = 0, $$sum9$i = 0, $$sum9$i$i = 0, $$tsize$1$i = 0, $$v$0$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0;
+ var $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0;
+ var $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0;
+ var $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0;
+ var $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0;
+ var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
+ var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0;
+ var $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0;
+ var $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0;
+ var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0;
+ var $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0;
+ var $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0;
+ var $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0;
+ var $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0;
+ var $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0;
+ var $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0;
+ var $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0;
+ var $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0;
+ var $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0;
+ var $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0;
+ var $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0;
+ var $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0;
+ var $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0;
+ var $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0;
+ var $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0;
+ var $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0;
+ var $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0;
+ var $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0;
+ var $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0;
+ var $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0;
+ var $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0;
+ var $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0;
+ var $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0;
+ var $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0;
+ var $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0;
+ var $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0;
+ var $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0;
+ var $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0;
+ var $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0;
+ var $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0;
+ var $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0;
+ var $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0;
+ var $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0;
+ var $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0;
+ var $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0;
+ var $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0;
+ var $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0;
+ var $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0;
+ var $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0;
+ var $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0;
+ var $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0;
+ var $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0;
+ var $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0;
+ var $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $F$0$i$i = 0, $F1$0$i = 0, $F4$0 = 0, $F4$0$i$i = 0;
+ var $F5$0$i = 0, $I1$0$i$i = 0, $I7$0$i = 0, $I7$0$i$i = 0, $K12$029$i = 0, $K2$07$i$i = 0, $K8$051$i$i = 0, $R$0$i = 0, $R$0$i$i = 0, $R$0$i$i$lcssa = 0, $R$0$i$lcssa = 0, $R$0$i18 = 0, $R$0$i18$lcssa = 0, $R$1$i = 0, $R$1$i$i = 0, $R$1$i20 = 0, $RP$0$i = 0, $RP$0$i$i = 0, $RP$0$i$i$lcssa = 0, $RP$0$i$lcssa = 0;
+ var $RP$0$i17 = 0, $RP$0$i17$lcssa = 0, $T$0$lcssa$i = 0, $T$0$lcssa$i$i = 0, $T$0$lcssa$i25$i = 0, $T$028$i = 0, $T$028$i$lcssa = 0, $T$050$i$i = 0, $T$050$i$i$lcssa = 0, $T$06$i$i = 0, $T$06$i$i$lcssa = 0, $br$0$ph$i = 0, $cond$i = 0, $cond$i$i = 0, $cond$i21 = 0, $exitcond$i$i = 0, $i$02$i$i = 0, $idx$0$i = 0, $mem$0 = 0, $nb$0 = 0;
+ var $not$$i = 0, $not$$i$i = 0, $not$$i26$i = 0, $oldfirst$0$i$i = 0, $or$cond$i = 0, $or$cond$i30 = 0, $or$cond1$i = 0, $or$cond19$i = 0, $or$cond2$i = 0, $or$cond3$i = 0, $or$cond5$i = 0, $or$cond57$i = 0, $or$cond6$i = 0, $or$cond8$i = 0, $or$cond9$i = 0, $qsize$0$i$i = 0, $rsize$0$i = 0, $rsize$0$i$lcssa = 0, $rsize$0$i15 = 0, $rsize$1$i = 0;
+ var $rsize$2$i = 0, $rsize$3$lcssa$i = 0, $rsize$331$i = 0, $rst$0$i = 0, $rst$1$i = 0, $sizebits$0$i = 0, $sp$0$i$i = 0, $sp$0$i$i$i = 0, $sp$084$i = 0, $sp$084$i$lcssa = 0, $sp$183$i = 0, $sp$183$i$lcssa = 0, $ssize$0$$i = 0, $ssize$0$i = 0, $ssize$1$ph$i = 0, $ssize$2$i = 0, $t$0$i = 0, $t$0$i14 = 0, $t$1$i = 0, $t$2$ph$i = 0;
+ var $t$2$v$3$i = 0, $t$230$i = 0, $tbase$255$i = 0, $tsize$0$ph$i = 0, $tsize$0323944$i = 0, $tsize$1$i = 0, $tsize$254$i = 0, $v$0$i = 0, $v$0$i$lcssa = 0, $v$0$i16 = 0, $v$1$i = 0, $v$2$i = 0, $v$3$lcssa$i = 0, $v$3$ph$i = 0, $v$332$i = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($bytes>>>0)<(245);
+ do {
+ if ($0) {
+ $1 = ($bytes>>>0)<(11);
+ $2 = (($bytes) + 11)|0;
+ $3 = $2 & -8;
+ $4 = $1 ? 16 : $3;
+ $5 = $4 >>> 3;
+ $6 = HEAP32[6952>>2]|0;
+ $7 = $6 >>> $5;
+ $8 = $7 & 3;
+ $9 = ($8|0)==(0);
+ if (!($9)) {
+ $10 = $7 & 1;
+ $11 = $10 ^ 1;
+ $12 = (($11) + ($5))|0;
+ $13 = $12 << 1;
+ $14 = (6992 + ($13<<2)|0);
+ $$sum10 = (($13) + 2)|0;
+ $15 = (6992 + ($$sum10<<2)|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = ((($16)) + 8|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = ($14|0)==($18|0);
+ do {
+ if ($19) {
+ $20 = 1 << $12;
+ $21 = $20 ^ -1;
+ $22 = $6 & $21;
+ HEAP32[6952>>2] = $22;
+ } else {
+ $23 = HEAP32[(6968)>>2]|0;
+ $24 = ($18>>>0)<($23>>>0);
+ if ($24) {
+ _abort();
+ // unreachable;
+ }
+ $25 = ((($18)) + 12|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($26|0)==($16|0);
+ if ($27) {
+ HEAP32[$25>>2] = $14;
+ HEAP32[$15>>2] = $18;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $28 = $12 << 3;
+ $29 = $28 | 3;
+ $30 = ((($16)) + 4|0);
+ HEAP32[$30>>2] = $29;
+ $$sum1112 = $28 | 4;
+ $31 = (($16) + ($$sum1112)|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = $32 | 1;
+ HEAP32[$31>>2] = $33;
+ $mem$0 = $17;
+ return ($mem$0|0);
+ }
+ $34 = HEAP32[(6960)>>2]|0;
+ $35 = ($4>>>0)>($34>>>0);
+ if ($35) {
+ $36 = ($7|0)==(0);
+ if (!($36)) {
+ $37 = $7 << $5;
+ $38 = 2 << $5;
+ $39 = (0 - ($38))|0;
+ $40 = $38 | $39;
+ $41 = $37 & $40;
+ $42 = (0 - ($41))|0;
+ $43 = $41 & $42;
+ $44 = (($43) + -1)|0;
+ $45 = $44 >>> 12;
+ $46 = $45 & 16;
+ $47 = $44 >>> $46;
+ $48 = $47 >>> 5;
+ $49 = $48 & 8;
+ $50 = $49 | $46;
+ $51 = $47 >>> $49;
+ $52 = $51 >>> 2;
+ $53 = $52 & 4;
+ $54 = $50 | $53;
+ $55 = $51 >>> $53;
+ $56 = $55 >>> 1;
+ $57 = $56 & 2;
+ $58 = $54 | $57;
+ $59 = $55 >>> $57;
+ $60 = $59 >>> 1;
+ $61 = $60 & 1;
+ $62 = $58 | $61;
+ $63 = $59 >>> $61;
+ $64 = (($62) + ($63))|0;
+ $65 = $64 << 1;
+ $66 = (6992 + ($65<<2)|0);
+ $$sum4 = (($65) + 2)|0;
+ $67 = (6992 + ($$sum4<<2)|0);
+ $68 = HEAP32[$67>>2]|0;
+ $69 = ((($68)) + 8|0);
+ $70 = HEAP32[$69>>2]|0;
+ $71 = ($66|0)==($70|0);
+ do {
+ if ($71) {
+ $72 = 1 << $64;
+ $73 = $72 ^ -1;
+ $74 = $6 & $73;
+ HEAP32[6952>>2] = $74;
+ $88 = $34;
+ } else {
+ $75 = HEAP32[(6968)>>2]|0;
+ $76 = ($70>>>0)<($75>>>0);
+ if ($76) {
+ _abort();
+ // unreachable;
+ }
+ $77 = ((($70)) + 12|0);
+ $78 = HEAP32[$77>>2]|0;
+ $79 = ($78|0)==($68|0);
+ if ($79) {
+ HEAP32[$77>>2] = $66;
+ HEAP32[$67>>2] = $70;
+ $$pre = HEAP32[(6960)>>2]|0;
+ $88 = $$pre;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $80 = $64 << 3;
+ $81 = (($80) - ($4))|0;
+ $82 = $4 | 3;
+ $83 = ((($68)) + 4|0);
+ HEAP32[$83>>2] = $82;
+ $84 = (($68) + ($4)|0);
+ $85 = $81 | 1;
+ $$sum56 = $4 | 4;
+ $86 = (($68) + ($$sum56)|0);
+ HEAP32[$86>>2] = $85;
+ $87 = (($68) + ($80)|0);
+ HEAP32[$87>>2] = $81;
+ $89 = ($88|0)==(0);
+ if (!($89)) {
+ $90 = HEAP32[(6972)>>2]|0;
+ $91 = $88 >>> 3;
+ $92 = $91 << 1;
+ $93 = (6992 + ($92<<2)|0);
+ $94 = HEAP32[6952>>2]|0;
+ $95 = 1 << $91;
+ $96 = $94 & $95;
+ $97 = ($96|0)==(0);
+ if ($97) {
+ $98 = $94 | $95;
+ HEAP32[6952>>2] = $98;
+ $$pre105 = (($92) + 2)|0;
+ $$pre106 = (6992 + ($$pre105<<2)|0);
+ $$pre$phiZ2D = $$pre106;$F4$0 = $93;
+ } else {
+ $$sum9 = (($92) + 2)|0;
+ $99 = (6992 + ($$sum9<<2)|0);
+ $100 = HEAP32[$99>>2]|0;
+ $101 = HEAP32[(6968)>>2]|0;
+ $102 = ($100>>>0)<($101>>>0);
+ if ($102) {
+ _abort();
+ // unreachable;
+ } else {
+ $$pre$phiZ2D = $99;$F4$0 = $100;
+ }
+ }
+ HEAP32[$$pre$phiZ2D>>2] = $90;
+ $103 = ((($F4$0)) + 12|0);
+ HEAP32[$103>>2] = $90;
+ $104 = ((($90)) + 8|0);
+ HEAP32[$104>>2] = $F4$0;
+ $105 = ((($90)) + 12|0);
+ HEAP32[$105>>2] = $93;
+ }
+ HEAP32[(6960)>>2] = $81;
+ HEAP32[(6972)>>2] = $84;
+ $mem$0 = $69;
+ return ($mem$0|0);
+ }
+ $106 = HEAP32[(6956)>>2]|0;
+ $107 = ($106|0)==(0);
+ if ($107) {
+ $nb$0 = $4;
+ } else {
+ $108 = (0 - ($106))|0;
+ $109 = $106 & $108;
+ $110 = (($109) + -1)|0;
+ $111 = $110 >>> 12;
+ $112 = $111 & 16;
+ $113 = $110 >>> $112;
+ $114 = $113 >>> 5;
+ $115 = $114 & 8;
+ $116 = $115 | $112;
+ $117 = $113 >>> $115;
+ $118 = $117 >>> 2;
+ $119 = $118 & 4;
+ $120 = $116 | $119;
+ $121 = $117 >>> $119;
+ $122 = $121 >>> 1;
+ $123 = $122 & 2;
+ $124 = $120 | $123;
+ $125 = $121 >>> $123;
+ $126 = $125 >>> 1;
+ $127 = $126 & 1;
+ $128 = $124 | $127;
+ $129 = $125 >>> $127;
+ $130 = (($128) + ($129))|0;
+ $131 = (7256 + ($130<<2)|0);
+ $132 = HEAP32[$131>>2]|0;
+ $133 = ((($132)) + 4|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = $134 & -8;
+ $136 = (($135) - ($4))|0;
+ $rsize$0$i = $136;$t$0$i = $132;$v$0$i = $132;
+ while(1) {
+ $137 = ((($t$0$i)) + 16|0);
+ $138 = HEAP32[$137>>2]|0;
+ $139 = ($138|0)==(0|0);
+ if ($139) {
+ $140 = ((($t$0$i)) + 20|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = ($141|0)==(0|0);
+ if ($142) {
+ $rsize$0$i$lcssa = $rsize$0$i;$v$0$i$lcssa = $v$0$i;
+ break;
+ } else {
+ $144 = $141;
+ }
+ } else {
+ $144 = $138;
+ }
+ $143 = ((($144)) + 4|0);
+ $145 = HEAP32[$143>>2]|0;
+ $146 = $145 & -8;
+ $147 = (($146) - ($4))|0;
+ $148 = ($147>>>0)<($rsize$0$i>>>0);
+ $$rsize$0$i = $148 ? $147 : $rsize$0$i;
+ $$v$0$i = $148 ? $144 : $v$0$i;
+ $rsize$0$i = $$rsize$0$i;$t$0$i = $144;$v$0$i = $$v$0$i;
+ }
+ $149 = HEAP32[(6968)>>2]|0;
+ $150 = ($v$0$i$lcssa>>>0)<($149>>>0);
+ if ($150) {
+ _abort();
+ // unreachable;
+ }
+ $151 = (($v$0$i$lcssa) + ($4)|0);
+ $152 = ($v$0$i$lcssa>>>0)<($151>>>0);
+ if (!($152)) {
+ _abort();
+ // unreachable;
+ }
+ $153 = ((($v$0$i$lcssa)) + 24|0);
+ $154 = HEAP32[$153>>2]|0;
+ $155 = ((($v$0$i$lcssa)) + 12|0);
+ $156 = HEAP32[$155>>2]|0;
+ $157 = ($156|0)==($v$0$i$lcssa|0);
+ do {
+ if ($157) {
+ $167 = ((($v$0$i$lcssa)) + 20|0);
+ $168 = HEAP32[$167>>2]|0;
+ $169 = ($168|0)==(0|0);
+ if ($169) {
+ $170 = ((($v$0$i$lcssa)) + 16|0);
+ $171 = HEAP32[$170>>2]|0;
+ $172 = ($171|0)==(0|0);
+ if ($172) {
+ $R$1$i = 0;
+ break;
+ } else {
+ $R$0$i = $171;$RP$0$i = $170;
+ }
+ } else {
+ $R$0$i = $168;$RP$0$i = $167;
+ }
+ while(1) {
+ $173 = ((($R$0$i)) + 20|0);
+ $174 = HEAP32[$173>>2]|0;
+ $175 = ($174|0)==(0|0);
+ if (!($175)) {
+ $R$0$i = $174;$RP$0$i = $173;
+ continue;
+ }
+ $176 = ((($R$0$i)) + 16|0);
+ $177 = HEAP32[$176>>2]|0;
+ $178 = ($177|0)==(0|0);
+ if ($178) {
+ $R$0$i$lcssa = $R$0$i;$RP$0$i$lcssa = $RP$0$i;
+ break;
+ } else {
+ $R$0$i = $177;$RP$0$i = $176;
+ }
+ }
+ $179 = ($RP$0$i$lcssa>>>0)<($149>>>0);
+ if ($179) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP$0$i$lcssa>>2] = 0;
+ $R$1$i = $R$0$i$lcssa;
+ break;
+ }
+ } else {
+ $158 = ((($v$0$i$lcssa)) + 8|0);
+ $159 = HEAP32[$158>>2]|0;
+ $160 = ($159>>>0)<($149>>>0);
+ if ($160) {
+ _abort();
+ // unreachable;
+ }
+ $161 = ((($159)) + 12|0);
+ $162 = HEAP32[$161>>2]|0;
+ $163 = ($162|0)==($v$0$i$lcssa|0);
+ if (!($163)) {
+ _abort();
+ // unreachable;
+ }
+ $164 = ((($156)) + 8|0);
+ $165 = HEAP32[$164>>2]|0;
+ $166 = ($165|0)==($v$0$i$lcssa|0);
+ if ($166) {
+ HEAP32[$161>>2] = $156;
+ HEAP32[$164>>2] = $159;
+ $R$1$i = $156;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $180 = ($154|0)==(0|0);
+ do {
+ if (!($180)) {
+ $181 = ((($v$0$i$lcssa)) + 28|0);
+ $182 = HEAP32[$181>>2]|0;
+ $183 = (7256 + ($182<<2)|0);
+ $184 = HEAP32[$183>>2]|0;
+ $185 = ($v$0$i$lcssa|0)==($184|0);
+ if ($185) {
+ HEAP32[$183>>2] = $R$1$i;
+ $cond$i = ($R$1$i|0)==(0|0);
+ if ($cond$i) {
+ $186 = 1 << $182;
+ $187 = $186 ^ -1;
+ $188 = HEAP32[(6956)>>2]|0;
+ $189 = $188 & $187;
+ HEAP32[(6956)>>2] = $189;
+ break;
+ }
+ } else {
+ $190 = HEAP32[(6968)>>2]|0;
+ $191 = ($154>>>0)<($190>>>0);
+ if ($191) {
+ _abort();
+ // unreachable;
+ }
+ $192 = ((($154)) + 16|0);
+ $193 = HEAP32[$192>>2]|0;
+ $194 = ($193|0)==($v$0$i$lcssa|0);
+ if ($194) {
+ HEAP32[$192>>2] = $R$1$i;
+ } else {
+ $195 = ((($154)) + 20|0);
+ HEAP32[$195>>2] = $R$1$i;
+ }
+ $196 = ($R$1$i|0)==(0|0);
+ if ($196) {
+ break;
+ }
+ }
+ $197 = HEAP32[(6968)>>2]|0;
+ $198 = ($R$1$i>>>0)<($197>>>0);
+ if ($198) {
+ _abort();
+ // unreachable;
+ }
+ $199 = ((($R$1$i)) + 24|0);
+ HEAP32[$199>>2] = $154;
+ $200 = ((($v$0$i$lcssa)) + 16|0);
+ $201 = HEAP32[$200>>2]|0;
+ $202 = ($201|0)==(0|0);
+ do {
+ if (!($202)) {
+ $203 = ($201>>>0)<($197>>>0);
+ if ($203) {
+ _abort();
+ // unreachable;
+ } else {
+ $204 = ((($R$1$i)) + 16|0);
+ HEAP32[$204>>2] = $201;
+ $205 = ((($201)) + 24|0);
+ HEAP32[$205>>2] = $R$1$i;
+ break;
+ }
+ }
+ } while(0);
+ $206 = ((($v$0$i$lcssa)) + 20|0);
+ $207 = HEAP32[$206>>2]|0;
+ $208 = ($207|0)==(0|0);
+ if (!($208)) {
+ $209 = HEAP32[(6968)>>2]|0;
+ $210 = ($207>>>0)<($209>>>0);
+ if ($210) {
+ _abort();
+ // unreachable;
+ } else {
+ $211 = ((($R$1$i)) + 20|0);
+ HEAP32[$211>>2] = $207;
+ $212 = ((($207)) + 24|0);
+ HEAP32[$212>>2] = $R$1$i;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $213 = ($rsize$0$i$lcssa>>>0)<(16);
+ if ($213) {
+ $214 = (($rsize$0$i$lcssa) + ($4))|0;
+ $215 = $214 | 3;
+ $216 = ((($v$0$i$lcssa)) + 4|0);
+ HEAP32[$216>>2] = $215;
+ $$sum4$i = (($214) + 4)|0;
+ $217 = (($v$0$i$lcssa) + ($$sum4$i)|0);
+ $218 = HEAP32[$217>>2]|0;
+ $219 = $218 | 1;
+ HEAP32[$217>>2] = $219;
+ } else {
+ $220 = $4 | 3;
+ $221 = ((($v$0$i$lcssa)) + 4|0);
+ HEAP32[$221>>2] = $220;
+ $222 = $rsize$0$i$lcssa | 1;
+ $$sum$i35 = $4 | 4;
+ $223 = (($v$0$i$lcssa) + ($$sum$i35)|0);
+ HEAP32[$223>>2] = $222;
+ $$sum1$i = (($rsize$0$i$lcssa) + ($4))|0;
+ $224 = (($v$0$i$lcssa) + ($$sum1$i)|0);
+ HEAP32[$224>>2] = $rsize$0$i$lcssa;
+ $225 = HEAP32[(6960)>>2]|0;
+ $226 = ($225|0)==(0);
+ if (!($226)) {
+ $227 = HEAP32[(6972)>>2]|0;
+ $228 = $225 >>> 3;
+ $229 = $228 << 1;
+ $230 = (6992 + ($229<<2)|0);
+ $231 = HEAP32[6952>>2]|0;
+ $232 = 1 << $228;
+ $233 = $231 & $232;
+ $234 = ($233|0)==(0);
+ if ($234) {
+ $235 = $231 | $232;
+ HEAP32[6952>>2] = $235;
+ $$pre$i = (($229) + 2)|0;
+ $$pre8$i = (6992 + ($$pre$i<<2)|0);
+ $$pre$phi$iZ2D = $$pre8$i;$F1$0$i = $230;
+ } else {
+ $$sum3$i = (($229) + 2)|0;
+ $236 = (6992 + ($$sum3$i<<2)|0);
+ $237 = HEAP32[$236>>2]|0;
+ $238 = HEAP32[(6968)>>2]|0;
+ $239 = ($237>>>0)<($238>>>0);
+ if ($239) {
+ _abort();
+ // unreachable;
+ } else {
+ $$pre$phi$iZ2D = $236;$F1$0$i = $237;
+ }
+ }
+ HEAP32[$$pre$phi$iZ2D>>2] = $227;
+ $240 = ((($F1$0$i)) + 12|0);
+ HEAP32[$240>>2] = $227;
+ $241 = ((($227)) + 8|0);
+ HEAP32[$241>>2] = $F1$0$i;
+ $242 = ((($227)) + 12|0);
+ HEAP32[$242>>2] = $230;
+ }
+ HEAP32[(6960)>>2] = $rsize$0$i$lcssa;
+ HEAP32[(6972)>>2] = $151;
+ }
+ $243 = ((($v$0$i$lcssa)) + 8|0);
+ $mem$0 = $243;
+ return ($mem$0|0);
+ }
+ } else {
+ $nb$0 = $4;
+ }
+ } else {
+ $244 = ($bytes>>>0)>(4294967231);
+ if ($244) {
+ $nb$0 = -1;
+ } else {
+ $245 = (($bytes) + 11)|0;
+ $246 = $245 & -8;
+ $247 = HEAP32[(6956)>>2]|0;
+ $248 = ($247|0)==(0);
+ if ($248) {
+ $nb$0 = $246;
+ } else {
+ $249 = (0 - ($246))|0;
+ $250 = $245 >>> 8;
+ $251 = ($250|0)==(0);
+ if ($251) {
+ $idx$0$i = 0;
+ } else {
+ $252 = ($246>>>0)>(16777215);
+ if ($252) {
+ $idx$0$i = 31;
+ } else {
+ $253 = (($250) + 1048320)|0;
+ $254 = $253 >>> 16;
+ $255 = $254 & 8;
+ $256 = $250 << $255;
+ $257 = (($256) + 520192)|0;
+ $258 = $257 >>> 16;
+ $259 = $258 & 4;
+ $260 = $259 | $255;
+ $261 = $256 << $259;
+ $262 = (($261) + 245760)|0;
+ $263 = $262 >>> 16;
+ $264 = $263 & 2;
+ $265 = $260 | $264;
+ $266 = (14 - ($265))|0;
+ $267 = $261 << $264;
+ $268 = $267 >>> 15;
+ $269 = (($266) + ($268))|0;
+ $270 = $269 << 1;
+ $271 = (($269) + 7)|0;
+ $272 = $246 >>> $271;
+ $273 = $272 & 1;
+ $274 = $273 | $270;
+ $idx$0$i = $274;
+ }
+ }
+ $275 = (7256 + ($idx$0$i<<2)|0);
+ $276 = HEAP32[$275>>2]|0;
+ $277 = ($276|0)==(0|0);
+ L123: do {
+ if ($277) {
+ $rsize$2$i = $249;$t$1$i = 0;$v$2$i = 0;
+ label = 86;
+ } else {
+ $278 = ($idx$0$i|0)==(31);
+ $279 = $idx$0$i >>> 1;
+ $280 = (25 - ($279))|0;
+ $281 = $278 ? 0 : $280;
+ $282 = $246 << $281;
+ $rsize$0$i15 = $249;$rst$0$i = 0;$sizebits$0$i = $282;$t$0$i14 = $276;$v$0$i16 = 0;
+ while(1) {
+ $283 = ((($t$0$i14)) + 4|0);
+ $284 = HEAP32[$283>>2]|0;
+ $285 = $284 & -8;
+ $286 = (($285) - ($246))|0;
+ $287 = ($286>>>0)<($rsize$0$i15>>>0);
+ if ($287) {
+ $288 = ($285|0)==($246|0);
+ if ($288) {
+ $rsize$331$i = $286;$t$230$i = $t$0$i14;$v$332$i = $t$0$i14;
+ label = 90;
+ break L123;
+ } else {
+ $rsize$1$i = $286;$v$1$i = $t$0$i14;
+ }
+ } else {
+ $rsize$1$i = $rsize$0$i15;$v$1$i = $v$0$i16;
+ }
+ $289 = ((($t$0$i14)) + 20|0);
+ $290 = HEAP32[$289>>2]|0;
+ $291 = $sizebits$0$i >>> 31;
+ $292 = (((($t$0$i14)) + 16|0) + ($291<<2)|0);
+ $293 = HEAP32[$292>>2]|0;
+ $294 = ($290|0)==(0|0);
+ $295 = ($290|0)==($293|0);
+ $or$cond19$i = $294 | $295;
+ $rst$1$i = $or$cond19$i ? $rst$0$i : $290;
+ $296 = ($293|0)==(0|0);
+ $297 = $sizebits$0$i << 1;
+ if ($296) {
+ $rsize$2$i = $rsize$1$i;$t$1$i = $rst$1$i;$v$2$i = $v$1$i;
+ label = 86;
+ break;
+ } else {
+ $rsize$0$i15 = $rsize$1$i;$rst$0$i = $rst$1$i;$sizebits$0$i = $297;$t$0$i14 = $293;$v$0$i16 = $v$1$i;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 86) {
+ $298 = ($t$1$i|0)==(0|0);
+ $299 = ($v$2$i|0)==(0|0);
+ $or$cond$i = $298 & $299;
+ if ($or$cond$i) {
+ $300 = 2 << $idx$0$i;
+ $301 = (0 - ($300))|0;
+ $302 = $300 | $301;
+ $303 = $247 & $302;
+ $304 = ($303|0)==(0);
+ if ($304) {
+ $nb$0 = $246;
+ break;
+ }
+ $305 = (0 - ($303))|0;
+ $306 = $303 & $305;
+ $307 = (($306) + -1)|0;
+ $308 = $307 >>> 12;
+ $309 = $308 & 16;
+ $310 = $307 >>> $309;
+ $311 = $310 >>> 5;
+ $312 = $311 & 8;
+ $313 = $312 | $309;
+ $314 = $310 >>> $312;
+ $315 = $314 >>> 2;
+ $316 = $315 & 4;
+ $317 = $313 | $316;
+ $318 = $314 >>> $316;
+ $319 = $318 >>> 1;
+ $320 = $319 & 2;
+ $321 = $317 | $320;
+ $322 = $318 >>> $320;
+ $323 = $322 >>> 1;
+ $324 = $323 & 1;
+ $325 = $321 | $324;
+ $326 = $322 >>> $324;
+ $327 = (($325) + ($326))|0;
+ $328 = (7256 + ($327<<2)|0);
+ $329 = HEAP32[$328>>2]|0;
+ $t$2$ph$i = $329;$v$3$ph$i = 0;
+ } else {
+ $t$2$ph$i = $t$1$i;$v$3$ph$i = $v$2$i;
+ }
+ $330 = ($t$2$ph$i|0)==(0|0);
+ if ($330) {
+ $rsize$3$lcssa$i = $rsize$2$i;$v$3$lcssa$i = $v$3$ph$i;
+ } else {
+ $rsize$331$i = $rsize$2$i;$t$230$i = $t$2$ph$i;$v$332$i = $v$3$ph$i;
+ label = 90;
+ }
+ }
+ if ((label|0) == 90) {
+ while(1) {
+ label = 0;
+ $331 = ((($t$230$i)) + 4|0);
+ $332 = HEAP32[$331>>2]|0;
+ $333 = $332 & -8;
+ $334 = (($333) - ($246))|0;
+ $335 = ($334>>>0)<($rsize$331$i>>>0);
+ $$rsize$3$i = $335 ? $334 : $rsize$331$i;
+ $t$2$v$3$i = $335 ? $t$230$i : $v$332$i;
+ $336 = ((($t$230$i)) + 16|0);
+ $337 = HEAP32[$336>>2]|0;
+ $338 = ($337|0)==(0|0);
+ if (!($338)) {
+ $rsize$331$i = $$rsize$3$i;$t$230$i = $337;$v$332$i = $t$2$v$3$i;
+ label = 90;
+ continue;
+ }
+ $339 = ((($t$230$i)) + 20|0);
+ $340 = HEAP32[$339>>2]|0;
+ $341 = ($340|0)==(0|0);
+ if ($341) {
+ $rsize$3$lcssa$i = $$rsize$3$i;$v$3$lcssa$i = $t$2$v$3$i;
+ break;
+ } else {
+ $rsize$331$i = $$rsize$3$i;$t$230$i = $340;$v$332$i = $t$2$v$3$i;
+ label = 90;
+ }
+ }
+ }
+ $342 = ($v$3$lcssa$i|0)==(0|0);
+ if ($342) {
+ $nb$0 = $246;
+ } else {
+ $343 = HEAP32[(6960)>>2]|0;
+ $344 = (($343) - ($246))|0;
+ $345 = ($rsize$3$lcssa$i>>>0)<($344>>>0);
+ if ($345) {
+ $346 = HEAP32[(6968)>>2]|0;
+ $347 = ($v$3$lcssa$i>>>0)<($346>>>0);
+ if ($347) {
+ _abort();
+ // unreachable;
+ }
+ $348 = (($v$3$lcssa$i) + ($246)|0);
+ $349 = ($v$3$lcssa$i>>>0)<($348>>>0);
+ if (!($349)) {
+ _abort();
+ // unreachable;
+ }
+ $350 = ((($v$3$lcssa$i)) + 24|0);
+ $351 = HEAP32[$350>>2]|0;
+ $352 = ((($v$3$lcssa$i)) + 12|0);
+ $353 = HEAP32[$352>>2]|0;
+ $354 = ($353|0)==($v$3$lcssa$i|0);
+ do {
+ if ($354) {
+ $364 = ((($v$3$lcssa$i)) + 20|0);
+ $365 = HEAP32[$364>>2]|0;
+ $366 = ($365|0)==(0|0);
+ if ($366) {
+ $367 = ((($v$3$lcssa$i)) + 16|0);
+ $368 = HEAP32[$367>>2]|0;
+ $369 = ($368|0)==(0|0);
+ if ($369) {
+ $R$1$i20 = 0;
+ break;
+ } else {
+ $R$0$i18 = $368;$RP$0$i17 = $367;
+ }
+ } else {
+ $R$0$i18 = $365;$RP$0$i17 = $364;
+ }
+ while(1) {
+ $370 = ((($R$0$i18)) + 20|0);
+ $371 = HEAP32[$370>>2]|0;
+ $372 = ($371|0)==(0|0);
+ if (!($372)) {
+ $R$0$i18 = $371;$RP$0$i17 = $370;
+ continue;
+ }
+ $373 = ((($R$0$i18)) + 16|0);
+ $374 = HEAP32[$373>>2]|0;
+ $375 = ($374|0)==(0|0);
+ if ($375) {
+ $R$0$i18$lcssa = $R$0$i18;$RP$0$i17$lcssa = $RP$0$i17;
+ break;
+ } else {
+ $R$0$i18 = $374;$RP$0$i17 = $373;
+ }
+ }
+ $376 = ($RP$0$i17$lcssa>>>0)<($346>>>0);
+ if ($376) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP$0$i17$lcssa>>2] = 0;
+ $R$1$i20 = $R$0$i18$lcssa;
+ break;
+ }
+ } else {
+ $355 = ((($v$3$lcssa$i)) + 8|0);
+ $356 = HEAP32[$355>>2]|0;
+ $357 = ($356>>>0)<($346>>>0);
+ if ($357) {
+ _abort();
+ // unreachable;
+ }
+ $358 = ((($356)) + 12|0);
+ $359 = HEAP32[$358>>2]|0;
+ $360 = ($359|0)==($v$3$lcssa$i|0);
+ if (!($360)) {
+ _abort();
+ // unreachable;
+ }
+ $361 = ((($353)) + 8|0);
+ $362 = HEAP32[$361>>2]|0;
+ $363 = ($362|0)==($v$3$lcssa$i|0);
+ if ($363) {
+ HEAP32[$358>>2] = $353;
+ HEAP32[$361>>2] = $356;
+ $R$1$i20 = $353;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $377 = ($351|0)==(0|0);
+ do {
+ if (!($377)) {
+ $378 = ((($v$3$lcssa$i)) + 28|0);
+ $379 = HEAP32[$378>>2]|0;
+ $380 = (7256 + ($379<<2)|0);
+ $381 = HEAP32[$380>>2]|0;
+ $382 = ($v$3$lcssa$i|0)==($381|0);
+ if ($382) {
+ HEAP32[$380>>2] = $R$1$i20;
+ $cond$i21 = ($R$1$i20|0)==(0|0);
+ if ($cond$i21) {
+ $383 = 1 << $379;
+ $384 = $383 ^ -1;
+ $385 = HEAP32[(6956)>>2]|0;
+ $386 = $385 & $384;
+ HEAP32[(6956)>>2] = $386;
+ break;
+ }
+ } else {
+ $387 = HEAP32[(6968)>>2]|0;
+ $388 = ($351>>>0)<($387>>>0);
+ if ($388) {
+ _abort();
+ // unreachable;
+ }
+ $389 = ((($351)) + 16|0);
+ $390 = HEAP32[$389>>2]|0;
+ $391 = ($390|0)==($v$3$lcssa$i|0);
+ if ($391) {
+ HEAP32[$389>>2] = $R$1$i20;
+ } else {
+ $392 = ((($351)) + 20|0);
+ HEAP32[$392>>2] = $R$1$i20;
+ }
+ $393 = ($R$1$i20|0)==(0|0);
+ if ($393) {
+ break;
+ }
+ }
+ $394 = HEAP32[(6968)>>2]|0;
+ $395 = ($R$1$i20>>>0)<($394>>>0);
+ if ($395) {
+ _abort();
+ // unreachable;
+ }
+ $396 = ((($R$1$i20)) + 24|0);
+ HEAP32[$396>>2] = $351;
+ $397 = ((($v$3$lcssa$i)) + 16|0);
+ $398 = HEAP32[$397>>2]|0;
+ $399 = ($398|0)==(0|0);
+ do {
+ if (!($399)) {
+ $400 = ($398>>>0)<($394>>>0);
+ if ($400) {
+ _abort();
+ // unreachable;
+ } else {
+ $401 = ((($R$1$i20)) + 16|0);
+ HEAP32[$401>>2] = $398;
+ $402 = ((($398)) + 24|0);
+ HEAP32[$402>>2] = $R$1$i20;
+ break;
+ }
+ }
+ } while(0);
+ $403 = ((($v$3$lcssa$i)) + 20|0);
+ $404 = HEAP32[$403>>2]|0;
+ $405 = ($404|0)==(0|0);
+ if (!($405)) {
+ $406 = HEAP32[(6968)>>2]|0;
+ $407 = ($404>>>0)<($406>>>0);
+ if ($407) {
+ _abort();
+ // unreachable;
+ } else {
+ $408 = ((($R$1$i20)) + 20|0);
+ HEAP32[$408>>2] = $404;
+ $409 = ((($404)) + 24|0);
+ HEAP32[$409>>2] = $R$1$i20;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $410 = ($rsize$3$lcssa$i>>>0)<(16);
+ L199: do {
+ if ($410) {
+ $411 = (($rsize$3$lcssa$i) + ($246))|0;
+ $412 = $411 | 3;
+ $413 = ((($v$3$lcssa$i)) + 4|0);
+ HEAP32[$413>>2] = $412;
+ $$sum18$i = (($411) + 4)|0;
+ $414 = (($v$3$lcssa$i) + ($$sum18$i)|0);
+ $415 = HEAP32[$414>>2]|0;
+ $416 = $415 | 1;
+ HEAP32[$414>>2] = $416;
+ } else {
+ $417 = $246 | 3;
+ $418 = ((($v$3$lcssa$i)) + 4|0);
+ HEAP32[$418>>2] = $417;
+ $419 = $rsize$3$lcssa$i | 1;
+ $$sum$i2334 = $246 | 4;
+ $420 = (($v$3$lcssa$i) + ($$sum$i2334)|0);
+ HEAP32[$420>>2] = $419;
+ $$sum1$i24 = (($rsize$3$lcssa$i) + ($246))|0;
+ $421 = (($v$3$lcssa$i) + ($$sum1$i24)|0);
+ HEAP32[$421>>2] = $rsize$3$lcssa$i;
+ $422 = $rsize$3$lcssa$i >>> 3;
+ $423 = ($rsize$3$lcssa$i>>>0)<(256);
+ if ($423) {
+ $424 = $422 << 1;
+ $425 = (6992 + ($424<<2)|0);
+ $426 = HEAP32[6952>>2]|0;
+ $427 = 1 << $422;
+ $428 = $426 & $427;
+ $429 = ($428|0)==(0);
+ if ($429) {
+ $430 = $426 | $427;
+ HEAP32[6952>>2] = $430;
+ $$pre$i25 = (($424) + 2)|0;
+ $$pre43$i = (6992 + ($$pre$i25<<2)|0);
+ $$pre$phi$i26Z2D = $$pre43$i;$F5$0$i = $425;
+ } else {
+ $$sum17$i = (($424) + 2)|0;
+ $431 = (6992 + ($$sum17$i<<2)|0);
+ $432 = HEAP32[$431>>2]|0;
+ $433 = HEAP32[(6968)>>2]|0;
+ $434 = ($432>>>0)<($433>>>0);
+ if ($434) {
+ _abort();
+ // unreachable;
+ } else {
+ $$pre$phi$i26Z2D = $431;$F5$0$i = $432;
+ }
+ }
+ HEAP32[$$pre$phi$i26Z2D>>2] = $348;
+ $435 = ((($F5$0$i)) + 12|0);
+ HEAP32[$435>>2] = $348;
+ $$sum15$i = (($246) + 8)|0;
+ $436 = (($v$3$lcssa$i) + ($$sum15$i)|0);
+ HEAP32[$436>>2] = $F5$0$i;
+ $$sum16$i = (($246) + 12)|0;
+ $437 = (($v$3$lcssa$i) + ($$sum16$i)|0);
+ HEAP32[$437>>2] = $425;
+ break;
+ }
+ $438 = $rsize$3$lcssa$i >>> 8;
+ $439 = ($438|0)==(0);
+ if ($439) {
+ $I7$0$i = 0;
+ } else {
+ $440 = ($rsize$3$lcssa$i>>>0)>(16777215);
+ if ($440) {
+ $I7$0$i = 31;
+ } else {
+ $441 = (($438) + 1048320)|0;
+ $442 = $441 >>> 16;
+ $443 = $442 & 8;
+ $444 = $438 << $443;
+ $445 = (($444) + 520192)|0;
+ $446 = $445 >>> 16;
+ $447 = $446 & 4;
+ $448 = $447 | $443;
+ $449 = $444 << $447;
+ $450 = (($449) + 245760)|0;
+ $451 = $450 >>> 16;
+ $452 = $451 & 2;
+ $453 = $448 | $452;
+ $454 = (14 - ($453))|0;
+ $455 = $449 << $452;
+ $456 = $455 >>> 15;
+ $457 = (($454) + ($456))|0;
+ $458 = $457 << 1;
+ $459 = (($457) + 7)|0;
+ $460 = $rsize$3$lcssa$i >>> $459;
+ $461 = $460 & 1;
+ $462 = $461 | $458;
+ $I7$0$i = $462;
+ }
+ }
+ $463 = (7256 + ($I7$0$i<<2)|0);
+ $$sum2$i = (($246) + 28)|0;
+ $464 = (($v$3$lcssa$i) + ($$sum2$i)|0);
+ HEAP32[$464>>2] = $I7$0$i;
+ $$sum3$i27 = (($246) + 16)|0;
+ $465 = (($v$3$lcssa$i) + ($$sum3$i27)|0);
+ $$sum4$i28 = (($246) + 20)|0;
+ $466 = (($v$3$lcssa$i) + ($$sum4$i28)|0);
+ HEAP32[$466>>2] = 0;
+ HEAP32[$465>>2] = 0;
+ $467 = HEAP32[(6956)>>2]|0;
+ $468 = 1 << $I7$0$i;
+ $469 = $467 & $468;
+ $470 = ($469|0)==(0);
+ if ($470) {
+ $471 = $467 | $468;
+ HEAP32[(6956)>>2] = $471;
+ HEAP32[$463>>2] = $348;
+ $$sum5$i = (($246) + 24)|0;
+ $472 = (($v$3$lcssa$i) + ($$sum5$i)|0);
+ HEAP32[$472>>2] = $463;
+ $$sum6$i = (($246) + 12)|0;
+ $473 = (($v$3$lcssa$i) + ($$sum6$i)|0);
+ HEAP32[$473>>2] = $348;
+ $$sum7$i = (($246) + 8)|0;
+ $474 = (($v$3$lcssa$i) + ($$sum7$i)|0);
+ HEAP32[$474>>2] = $348;
+ break;
+ }
+ $475 = HEAP32[$463>>2]|0;
+ $476 = ((($475)) + 4|0);
+ $477 = HEAP32[$476>>2]|0;
+ $478 = $477 & -8;
+ $479 = ($478|0)==($rsize$3$lcssa$i|0);
+ L217: do {
+ if ($479) {
+ $T$0$lcssa$i = $475;
+ } else {
+ $480 = ($I7$0$i|0)==(31);
+ $481 = $I7$0$i >>> 1;
+ $482 = (25 - ($481))|0;
+ $483 = $480 ? 0 : $482;
+ $484 = $rsize$3$lcssa$i << $483;
+ $K12$029$i = $484;$T$028$i = $475;
+ while(1) {
+ $491 = $K12$029$i >>> 31;
+ $492 = (((($T$028$i)) + 16|0) + ($491<<2)|0);
+ $487 = HEAP32[$492>>2]|0;
+ $493 = ($487|0)==(0|0);
+ if ($493) {
+ $$lcssa232 = $492;$T$028$i$lcssa = $T$028$i;
+ break;
+ }
+ $485 = $K12$029$i << 1;
+ $486 = ((($487)) + 4|0);
+ $488 = HEAP32[$486>>2]|0;
+ $489 = $488 & -8;
+ $490 = ($489|0)==($rsize$3$lcssa$i|0);
+ if ($490) {
+ $T$0$lcssa$i = $487;
+ break L217;
+ } else {
+ $K12$029$i = $485;$T$028$i = $487;
+ }
+ }
+ $494 = HEAP32[(6968)>>2]|0;
+ $495 = ($$lcssa232>>>0)<($494>>>0);
+ if ($495) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$lcssa232>>2] = $348;
+ $$sum11$i = (($246) + 24)|0;
+ $496 = (($v$3$lcssa$i) + ($$sum11$i)|0);
+ HEAP32[$496>>2] = $T$028$i$lcssa;
+ $$sum12$i = (($246) + 12)|0;
+ $497 = (($v$3$lcssa$i) + ($$sum12$i)|0);
+ HEAP32[$497>>2] = $348;
+ $$sum13$i = (($246) + 8)|0;
+ $498 = (($v$3$lcssa$i) + ($$sum13$i)|0);
+ HEAP32[$498>>2] = $348;
+ break L199;
+ }
+ }
+ } while(0);
+ $499 = ((($T$0$lcssa$i)) + 8|0);
+ $500 = HEAP32[$499>>2]|0;
+ $501 = HEAP32[(6968)>>2]|0;
+ $502 = ($500>>>0)>=($501>>>0);
+ $not$$i = ($T$0$lcssa$i>>>0)>=($501>>>0);
+ $503 = $502 & $not$$i;
+ if ($503) {
+ $504 = ((($500)) + 12|0);
+ HEAP32[$504>>2] = $348;
+ HEAP32[$499>>2] = $348;
+ $$sum8$i = (($246) + 8)|0;
+ $505 = (($v$3$lcssa$i) + ($$sum8$i)|0);
+ HEAP32[$505>>2] = $500;
+ $$sum9$i = (($246) + 12)|0;
+ $506 = (($v$3$lcssa$i) + ($$sum9$i)|0);
+ HEAP32[$506>>2] = $T$0$lcssa$i;
+ $$sum10$i = (($246) + 24)|0;
+ $507 = (($v$3$lcssa$i) + ($$sum10$i)|0);
+ HEAP32[$507>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $508 = ((($v$3$lcssa$i)) + 8|0);
+ $mem$0 = $508;
+ return ($mem$0|0);
+ } else {
+ $nb$0 = $246;
+ }
+ }
+ }
+ }
+ }
+ } while(0);
+ $509 = HEAP32[(6960)>>2]|0;
+ $510 = ($509>>>0)<($nb$0>>>0);
+ if (!($510)) {
+ $511 = (($509) - ($nb$0))|0;
+ $512 = HEAP32[(6972)>>2]|0;
+ $513 = ($511>>>0)>(15);
+ if ($513) {
+ $514 = (($512) + ($nb$0)|0);
+ HEAP32[(6972)>>2] = $514;
+ HEAP32[(6960)>>2] = $511;
+ $515 = $511 | 1;
+ $$sum2 = (($nb$0) + 4)|0;
+ $516 = (($512) + ($$sum2)|0);
+ HEAP32[$516>>2] = $515;
+ $517 = (($512) + ($509)|0);
+ HEAP32[$517>>2] = $511;
+ $518 = $nb$0 | 3;
+ $519 = ((($512)) + 4|0);
+ HEAP32[$519>>2] = $518;
+ } else {
+ HEAP32[(6960)>>2] = 0;
+ HEAP32[(6972)>>2] = 0;
+ $520 = $509 | 3;
+ $521 = ((($512)) + 4|0);
+ HEAP32[$521>>2] = $520;
+ $$sum1 = (($509) + 4)|0;
+ $522 = (($512) + ($$sum1)|0);
+ $523 = HEAP32[$522>>2]|0;
+ $524 = $523 | 1;
+ HEAP32[$522>>2] = $524;
+ }
+ $525 = ((($512)) + 8|0);
+ $mem$0 = $525;
+ return ($mem$0|0);
+ }
+ $526 = HEAP32[(6964)>>2]|0;
+ $527 = ($526>>>0)>($nb$0>>>0);
+ if ($527) {
+ $528 = (($526) - ($nb$0))|0;
+ HEAP32[(6964)>>2] = $528;
+ $529 = HEAP32[(6976)>>2]|0;
+ $530 = (($529) + ($nb$0)|0);
+ HEAP32[(6976)>>2] = $530;
+ $531 = $528 | 1;
+ $$sum = (($nb$0) + 4)|0;
+ $532 = (($529) + ($$sum)|0);
+ HEAP32[$532>>2] = $531;
+ $533 = $nb$0 | 3;
+ $534 = ((($529)) + 4|0);
+ HEAP32[$534>>2] = $533;
+ $535 = ((($529)) + 8|0);
+ $mem$0 = $535;
+ return ($mem$0|0);
+ }
+ $536 = HEAP32[7424>>2]|0;
+ $537 = ($536|0)==(0);
+ do {
+ if ($537) {
+ $538 = (_sysconf(30)|0);
+ $539 = (($538) + -1)|0;
+ $540 = $539 & $538;
+ $541 = ($540|0)==(0);
+ if ($541) {
+ HEAP32[(7432)>>2] = $538;
+ HEAP32[(7428)>>2] = $538;
+ HEAP32[(7436)>>2] = -1;
+ HEAP32[(7440)>>2] = -1;
+ HEAP32[(7444)>>2] = 0;
+ HEAP32[(7396)>>2] = 0;
+ $542 = (_time((0|0))|0);
+ $543 = $542 & -16;
+ $544 = $543 ^ 1431655768;
+ HEAP32[7424>>2] = $544;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $545 = (($nb$0) + 48)|0;
+ $546 = HEAP32[(7432)>>2]|0;
+ $547 = (($nb$0) + 47)|0;
+ $548 = (($546) + ($547))|0;
+ $549 = (0 - ($546))|0;
+ $550 = $548 & $549;
+ $551 = ($550>>>0)>($nb$0>>>0);
+ if (!($551)) {
+ $mem$0 = 0;
+ return ($mem$0|0);
+ }
+ $552 = HEAP32[(7392)>>2]|0;
+ $553 = ($552|0)==(0);
+ if (!($553)) {
+ $554 = HEAP32[(7384)>>2]|0;
+ $555 = (($554) + ($550))|0;
+ $556 = ($555>>>0)<=($554>>>0);
+ $557 = ($555>>>0)>($552>>>0);
+ $or$cond1$i = $556 | $557;
+ if ($or$cond1$i) {
+ $mem$0 = 0;
+ return ($mem$0|0);
+ }
+ }
+ $558 = HEAP32[(7396)>>2]|0;
+ $559 = $558 & 4;
+ $560 = ($559|0)==(0);
+ L258: do {
+ if ($560) {
+ $561 = HEAP32[(6976)>>2]|0;
+ $562 = ($561|0)==(0|0);
+ L260: do {
+ if ($562) {
+ label = 174;
+ } else {
+ $sp$0$i$i = (7400);
+ while(1) {
+ $563 = HEAP32[$sp$0$i$i>>2]|0;
+ $564 = ($563>>>0)>($561>>>0);
+ if (!($564)) {
+ $565 = ((($sp$0$i$i)) + 4|0);
+ $566 = HEAP32[$565>>2]|0;
+ $567 = (($563) + ($566)|0);
+ $568 = ($567>>>0)>($561>>>0);
+ if ($568) {
+ $$lcssa228 = $sp$0$i$i;$$lcssa230 = $565;
+ break;
+ }
+ }
+ $569 = ((($sp$0$i$i)) + 8|0);
+ $570 = HEAP32[$569>>2]|0;
+ $571 = ($570|0)==(0|0);
+ if ($571) {
+ label = 174;
+ break L260;
+ } else {
+ $sp$0$i$i = $570;
+ }
+ }
+ $594 = HEAP32[(6964)>>2]|0;
+ $595 = (($548) - ($594))|0;
+ $596 = $595 & $549;
+ $597 = ($596>>>0)<(2147483647);
+ if ($597) {
+ $598 = (_sbrk(($596|0))|0);
+ $599 = HEAP32[$$lcssa228>>2]|0;
+ $600 = HEAP32[$$lcssa230>>2]|0;
+ $601 = (($599) + ($600)|0);
+ $602 = ($598|0)==($601|0);
+ $$3$i = $602 ? $596 : 0;
+ if ($602) {
+ $603 = ($598|0)==((-1)|0);
+ if ($603) {
+ $tsize$0323944$i = $$3$i;
+ } else {
+ $tbase$255$i = $598;$tsize$254$i = $$3$i;
+ label = 194;
+ break L258;
+ }
+ } else {
+ $br$0$ph$i = $598;$ssize$1$ph$i = $596;$tsize$0$ph$i = $$3$i;
+ label = 184;
+ }
+ } else {
+ $tsize$0323944$i = 0;
+ }
+ }
+ } while(0);
+ do {
+ if ((label|0) == 174) {
+ $572 = (_sbrk(0)|0);
+ $573 = ($572|0)==((-1)|0);
+ if ($573) {
+ $tsize$0323944$i = 0;
+ } else {
+ $574 = $572;
+ $575 = HEAP32[(7428)>>2]|0;
+ $576 = (($575) + -1)|0;
+ $577 = $576 & $574;
+ $578 = ($577|0)==(0);
+ if ($578) {
+ $ssize$0$i = $550;
+ } else {
+ $579 = (($576) + ($574))|0;
+ $580 = (0 - ($575))|0;
+ $581 = $579 & $580;
+ $582 = (($550) - ($574))|0;
+ $583 = (($582) + ($581))|0;
+ $ssize$0$i = $583;
+ }
+ $584 = HEAP32[(7384)>>2]|0;
+ $585 = (($584) + ($ssize$0$i))|0;
+ $586 = ($ssize$0$i>>>0)>($nb$0>>>0);
+ $587 = ($ssize$0$i>>>0)<(2147483647);
+ $or$cond$i30 = $586 & $587;
+ if ($or$cond$i30) {
+ $588 = HEAP32[(7392)>>2]|0;
+ $589 = ($588|0)==(0);
+ if (!($589)) {
+ $590 = ($585>>>0)<=($584>>>0);
+ $591 = ($585>>>0)>($588>>>0);
+ $or$cond2$i = $590 | $591;
+ if ($or$cond2$i) {
+ $tsize$0323944$i = 0;
+ break;
+ }
+ }
+ $592 = (_sbrk(($ssize$0$i|0))|0);
+ $593 = ($592|0)==($572|0);
+ $ssize$0$$i = $593 ? $ssize$0$i : 0;
+ if ($593) {
+ $tbase$255$i = $572;$tsize$254$i = $ssize$0$$i;
+ label = 194;
+ break L258;
+ } else {
+ $br$0$ph$i = $592;$ssize$1$ph$i = $ssize$0$i;$tsize$0$ph$i = $ssize$0$$i;
+ label = 184;
+ }
+ } else {
+ $tsize$0323944$i = 0;
+ }
+ }
+ }
+ } while(0);
+ L280: do {
+ if ((label|0) == 184) {
+ $604 = (0 - ($ssize$1$ph$i))|0;
+ $605 = ($br$0$ph$i|0)!=((-1)|0);
+ $606 = ($ssize$1$ph$i>>>0)<(2147483647);
+ $or$cond5$i = $606 & $605;
+ $607 = ($545>>>0)>($ssize$1$ph$i>>>0);
+ $or$cond6$i = $607 & $or$cond5$i;
+ do {
+ if ($or$cond6$i) {
+ $608 = HEAP32[(7432)>>2]|0;
+ $609 = (($547) - ($ssize$1$ph$i))|0;
+ $610 = (($609) + ($608))|0;
+ $611 = (0 - ($608))|0;
+ $612 = $610 & $611;
+ $613 = ($612>>>0)<(2147483647);
+ if ($613) {
+ $614 = (_sbrk(($612|0))|0);
+ $615 = ($614|0)==((-1)|0);
+ if ($615) {
+ (_sbrk(($604|0))|0);
+ $tsize$0323944$i = $tsize$0$ph$i;
+ break L280;
+ } else {
+ $616 = (($612) + ($ssize$1$ph$i))|0;
+ $ssize$2$i = $616;
+ break;
+ }
+ } else {
+ $ssize$2$i = $ssize$1$ph$i;
+ }
+ } else {
+ $ssize$2$i = $ssize$1$ph$i;
+ }
+ } while(0);
+ $617 = ($br$0$ph$i|0)==((-1)|0);
+ if ($617) {
+ $tsize$0323944$i = $tsize$0$ph$i;
+ } else {
+ $tbase$255$i = $br$0$ph$i;$tsize$254$i = $ssize$2$i;
+ label = 194;
+ break L258;
+ }
+ }
+ } while(0);
+ $618 = HEAP32[(7396)>>2]|0;
+ $619 = $618 | 4;
+ HEAP32[(7396)>>2] = $619;
+ $tsize$1$i = $tsize$0323944$i;
+ label = 191;
+ } else {
+ $tsize$1$i = 0;
+ label = 191;
+ }
+ } while(0);
+ if ((label|0) == 191) {
+ $620 = ($550>>>0)<(2147483647);
+ if ($620) {
+ $621 = (_sbrk(($550|0))|0);
+ $622 = (_sbrk(0)|0);
+ $623 = ($621|0)!=((-1)|0);
+ $624 = ($622|0)!=((-1)|0);
+ $or$cond3$i = $623 & $624;
+ $625 = ($621>>>0)<($622>>>0);
+ $or$cond8$i = $625 & $or$cond3$i;
+ if ($or$cond8$i) {
+ $626 = $622;
+ $627 = $621;
+ $628 = (($626) - ($627))|0;
+ $629 = (($nb$0) + 40)|0;
+ $630 = ($628>>>0)>($629>>>0);
+ $$tsize$1$i = $630 ? $628 : $tsize$1$i;
+ if ($630) {
+ $tbase$255$i = $621;$tsize$254$i = $$tsize$1$i;
+ label = 194;
+ }
+ }
+ }
+ }
+ if ((label|0) == 194) {
+ $631 = HEAP32[(7384)>>2]|0;
+ $632 = (($631) + ($tsize$254$i))|0;
+ HEAP32[(7384)>>2] = $632;
+ $633 = HEAP32[(7388)>>2]|0;
+ $634 = ($632>>>0)>($633>>>0);
+ if ($634) {
+ HEAP32[(7388)>>2] = $632;
+ }
+ $635 = HEAP32[(6976)>>2]|0;
+ $636 = ($635|0)==(0|0);
+ L299: do {
+ if ($636) {
+ $637 = HEAP32[(6968)>>2]|0;
+ $638 = ($637|0)==(0|0);
+ $639 = ($tbase$255$i>>>0)<($637>>>0);
+ $or$cond9$i = $638 | $639;
+ if ($or$cond9$i) {
+ HEAP32[(6968)>>2] = $tbase$255$i;
+ }
+ HEAP32[(7400)>>2] = $tbase$255$i;
+ HEAP32[(7404)>>2] = $tsize$254$i;
+ HEAP32[(7412)>>2] = 0;
+ $640 = HEAP32[7424>>2]|0;
+ HEAP32[(6988)>>2] = $640;
+ HEAP32[(6984)>>2] = -1;
+ $i$02$i$i = 0;
+ while(1) {
+ $641 = $i$02$i$i << 1;
+ $642 = (6992 + ($641<<2)|0);
+ $$sum$i$i = (($641) + 3)|0;
+ $643 = (6992 + ($$sum$i$i<<2)|0);
+ HEAP32[$643>>2] = $642;
+ $$sum1$i$i = (($641) + 2)|0;
+ $644 = (6992 + ($$sum1$i$i<<2)|0);
+ HEAP32[$644>>2] = $642;
+ $645 = (($i$02$i$i) + 1)|0;
+ $exitcond$i$i = ($645|0)==(32);
+ if ($exitcond$i$i) {
+ break;
+ } else {
+ $i$02$i$i = $645;
+ }
+ }
+ $646 = (($tsize$254$i) + -40)|0;
+ $647 = ((($tbase$255$i)) + 8|0);
+ $648 = $647;
+ $649 = $648 & 7;
+ $650 = ($649|0)==(0);
+ $651 = (0 - ($648))|0;
+ $652 = $651 & 7;
+ $653 = $650 ? 0 : $652;
+ $654 = (($tbase$255$i) + ($653)|0);
+ $655 = (($646) - ($653))|0;
+ HEAP32[(6976)>>2] = $654;
+ HEAP32[(6964)>>2] = $655;
+ $656 = $655 | 1;
+ $$sum$i13$i = (($653) + 4)|0;
+ $657 = (($tbase$255$i) + ($$sum$i13$i)|0);
+ HEAP32[$657>>2] = $656;
+ $$sum2$i$i = (($tsize$254$i) + -36)|0;
+ $658 = (($tbase$255$i) + ($$sum2$i$i)|0);
+ HEAP32[$658>>2] = 40;
+ $659 = HEAP32[(7440)>>2]|0;
+ HEAP32[(6980)>>2] = $659;
+ } else {
+ $sp$084$i = (7400);
+ while(1) {
+ $660 = HEAP32[$sp$084$i>>2]|0;
+ $661 = ((($sp$084$i)) + 4|0);
+ $662 = HEAP32[$661>>2]|0;
+ $663 = (($660) + ($662)|0);
+ $664 = ($tbase$255$i|0)==($663|0);
+ if ($664) {
+ $$lcssa222 = $660;$$lcssa224 = $661;$$lcssa226 = $662;$sp$084$i$lcssa = $sp$084$i;
+ label = 204;
+ break;
+ }
+ $665 = ((($sp$084$i)) + 8|0);
+ $666 = HEAP32[$665>>2]|0;
+ $667 = ($666|0)==(0|0);
+ if ($667) {
+ break;
+ } else {
+ $sp$084$i = $666;
+ }
+ }
+ if ((label|0) == 204) {
+ $668 = ((($sp$084$i$lcssa)) + 12|0);
+ $669 = HEAP32[$668>>2]|0;
+ $670 = $669 & 8;
+ $671 = ($670|0)==(0);
+ if ($671) {
+ $672 = ($635>>>0)>=($$lcssa222>>>0);
+ $673 = ($635>>>0)<($tbase$255$i>>>0);
+ $or$cond57$i = $673 & $672;
+ if ($or$cond57$i) {
+ $674 = (($$lcssa226) + ($tsize$254$i))|0;
+ HEAP32[$$lcssa224>>2] = $674;
+ $675 = HEAP32[(6964)>>2]|0;
+ $676 = (($675) + ($tsize$254$i))|0;
+ $677 = ((($635)) + 8|0);
+ $678 = $677;
+ $679 = $678 & 7;
+ $680 = ($679|0)==(0);
+ $681 = (0 - ($678))|0;
+ $682 = $681 & 7;
+ $683 = $680 ? 0 : $682;
+ $684 = (($635) + ($683)|0);
+ $685 = (($676) - ($683))|0;
+ HEAP32[(6976)>>2] = $684;
+ HEAP32[(6964)>>2] = $685;
+ $686 = $685 | 1;
+ $$sum$i17$i = (($683) + 4)|0;
+ $687 = (($635) + ($$sum$i17$i)|0);
+ HEAP32[$687>>2] = $686;
+ $$sum2$i18$i = (($676) + 4)|0;
+ $688 = (($635) + ($$sum2$i18$i)|0);
+ HEAP32[$688>>2] = 40;
+ $689 = HEAP32[(7440)>>2]|0;
+ HEAP32[(6980)>>2] = $689;
+ break;
+ }
+ }
+ }
+ $690 = HEAP32[(6968)>>2]|0;
+ $691 = ($tbase$255$i>>>0)<($690>>>0);
+ if ($691) {
+ HEAP32[(6968)>>2] = $tbase$255$i;
+ $755 = $tbase$255$i;
+ } else {
+ $755 = $690;
+ }
+ $692 = (($tbase$255$i) + ($tsize$254$i)|0);
+ $sp$183$i = (7400);
+ while(1) {
+ $693 = HEAP32[$sp$183$i>>2]|0;
+ $694 = ($693|0)==($692|0);
+ if ($694) {
+ $$lcssa219 = $sp$183$i;$sp$183$i$lcssa = $sp$183$i;
+ label = 212;
+ break;
+ }
+ $695 = ((($sp$183$i)) + 8|0);
+ $696 = HEAP32[$695>>2]|0;
+ $697 = ($696|0)==(0|0);
+ if ($697) {
+ $sp$0$i$i$i = (7400);
+ break;
+ } else {
+ $sp$183$i = $696;
+ }
+ }
+ if ((label|0) == 212) {
+ $698 = ((($sp$183$i$lcssa)) + 12|0);
+ $699 = HEAP32[$698>>2]|0;
+ $700 = $699 & 8;
+ $701 = ($700|0)==(0);
+ if ($701) {
+ HEAP32[$$lcssa219>>2] = $tbase$255$i;
+ $702 = ((($sp$183$i$lcssa)) + 4|0);
+ $703 = HEAP32[$702>>2]|0;
+ $704 = (($703) + ($tsize$254$i))|0;
+ HEAP32[$702>>2] = $704;
+ $705 = ((($tbase$255$i)) + 8|0);
+ $706 = $705;
+ $707 = $706 & 7;
+ $708 = ($707|0)==(0);
+ $709 = (0 - ($706))|0;
+ $710 = $709 & 7;
+ $711 = $708 ? 0 : $710;
+ $712 = (($tbase$255$i) + ($711)|0);
+ $$sum112$i = (($tsize$254$i) + 8)|0;
+ $713 = (($tbase$255$i) + ($$sum112$i)|0);
+ $714 = $713;
+ $715 = $714 & 7;
+ $716 = ($715|0)==(0);
+ $717 = (0 - ($714))|0;
+ $718 = $717 & 7;
+ $719 = $716 ? 0 : $718;
+ $$sum113$i = (($719) + ($tsize$254$i))|0;
+ $720 = (($tbase$255$i) + ($$sum113$i)|0);
+ $721 = $720;
+ $722 = $712;
+ $723 = (($721) - ($722))|0;
+ $$sum$i19$i = (($711) + ($nb$0))|0;
+ $724 = (($tbase$255$i) + ($$sum$i19$i)|0);
+ $725 = (($723) - ($nb$0))|0;
+ $726 = $nb$0 | 3;
+ $$sum1$i20$i = (($711) + 4)|0;
+ $727 = (($tbase$255$i) + ($$sum1$i20$i)|0);
+ HEAP32[$727>>2] = $726;
+ $728 = ($720|0)==($635|0);
+ L324: do {
+ if ($728) {
+ $729 = HEAP32[(6964)>>2]|0;
+ $730 = (($729) + ($725))|0;
+ HEAP32[(6964)>>2] = $730;
+ HEAP32[(6976)>>2] = $724;
+ $731 = $730 | 1;
+ $$sum42$i$i = (($$sum$i19$i) + 4)|0;
+ $732 = (($tbase$255$i) + ($$sum42$i$i)|0);
+ HEAP32[$732>>2] = $731;
+ } else {
+ $733 = HEAP32[(6972)>>2]|0;
+ $734 = ($720|0)==($733|0);
+ if ($734) {
+ $735 = HEAP32[(6960)>>2]|0;
+ $736 = (($735) + ($725))|0;
+ HEAP32[(6960)>>2] = $736;
+ HEAP32[(6972)>>2] = $724;
+ $737 = $736 | 1;
+ $$sum40$i$i = (($$sum$i19$i) + 4)|0;
+ $738 = (($tbase$255$i) + ($$sum40$i$i)|0);
+ HEAP32[$738>>2] = $737;
+ $$sum41$i$i = (($736) + ($$sum$i19$i))|0;
+ $739 = (($tbase$255$i) + ($$sum41$i$i)|0);
+ HEAP32[$739>>2] = $736;
+ break;
+ }
+ $$sum2$i21$i = (($tsize$254$i) + 4)|0;
+ $$sum114$i = (($$sum2$i21$i) + ($719))|0;
+ $740 = (($tbase$255$i) + ($$sum114$i)|0);
+ $741 = HEAP32[$740>>2]|0;
+ $742 = $741 & 3;
+ $743 = ($742|0)==(1);
+ if ($743) {
+ $744 = $741 & -8;
+ $745 = $741 >>> 3;
+ $746 = ($741>>>0)<(256);
+ L332: do {
+ if ($746) {
+ $$sum3738$i$i = $719 | 8;
+ $$sum124$i = (($$sum3738$i$i) + ($tsize$254$i))|0;
+ $747 = (($tbase$255$i) + ($$sum124$i)|0);
+ $748 = HEAP32[$747>>2]|0;
+ $$sum39$i$i = (($tsize$254$i) + 12)|0;
+ $$sum125$i = (($$sum39$i$i) + ($719))|0;
+ $749 = (($tbase$255$i) + ($$sum125$i)|0);
+ $750 = HEAP32[$749>>2]|0;
+ $751 = $745 << 1;
+ $752 = (6992 + ($751<<2)|0);
+ $753 = ($748|0)==($752|0);
+ do {
+ if (!($753)) {
+ $754 = ($748>>>0)<($755>>>0);
+ if ($754) {
+ _abort();
+ // unreachable;
+ }
+ $756 = ((($748)) + 12|0);
+ $757 = HEAP32[$756>>2]|0;
+ $758 = ($757|0)==($720|0);
+ if ($758) {
+ break;
+ }
+ _abort();
+ // unreachable;
+ }
+ } while(0);
+ $759 = ($750|0)==($748|0);
+ if ($759) {
+ $760 = 1 << $745;
+ $761 = $760 ^ -1;
+ $762 = HEAP32[6952>>2]|0;
+ $763 = $762 & $761;
+ HEAP32[6952>>2] = $763;
+ break;
+ }
+ $764 = ($750|0)==($752|0);
+ do {
+ if ($764) {
+ $$pre57$i$i = ((($750)) + 8|0);
+ $$pre$phi58$i$iZ2D = $$pre57$i$i;
+ } else {
+ $765 = ($750>>>0)<($755>>>0);
+ if ($765) {
+ _abort();
+ // unreachable;
+ }
+ $766 = ((($750)) + 8|0);
+ $767 = HEAP32[$766>>2]|0;
+ $768 = ($767|0)==($720|0);
+ if ($768) {
+ $$pre$phi58$i$iZ2D = $766;
+ break;
+ }
+ _abort();
+ // unreachable;
+ }
+ } while(0);
+ $769 = ((($748)) + 12|0);
+ HEAP32[$769>>2] = $750;
+ HEAP32[$$pre$phi58$i$iZ2D>>2] = $748;
+ } else {
+ $$sum34$i$i = $719 | 24;
+ $$sum115$i = (($$sum34$i$i) + ($tsize$254$i))|0;
+ $770 = (($tbase$255$i) + ($$sum115$i)|0);
+ $771 = HEAP32[$770>>2]|0;
+ $$sum5$i$i = (($tsize$254$i) + 12)|0;
+ $$sum116$i = (($$sum5$i$i) + ($719))|0;
+ $772 = (($tbase$255$i) + ($$sum116$i)|0);
+ $773 = HEAP32[$772>>2]|0;
+ $774 = ($773|0)==($720|0);
+ do {
+ if ($774) {
+ $$sum67$i$i = $719 | 16;
+ $$sum122$i = (($$sum2$i21$i) + ($$sum67$i$i))|0;
+ $784 = (($tbase$255$i) + ($$sum122$i)|0);
+ $785 = HEAP32[$784>>2]|0;
+ $786 = ($785|0)==(0|0);
+ if ($786) {
+ $$sum123$i = (($$sum67$i$i) + ($tsize$254$i))|0;
+ $787 = (($tbase$255$i) + ($$sum123$i)|0);
+ $788 = HEAP32[$787>>2]|0;
+ $789 = ($788|0)==(0|0);
+ if ($789) {
+ $R$1$i$i = 0;
+ break;
+ } else {
+ $R$0$i$i = $788;$RP$0$i$i = $787;
+ }
+ } else {
+ $R$0$i$i = $785;$RP$0$i$i = $784;
+ }
+ while(1) {
+ $790 = ((($R$0$i$i)) + 20|0);
+ $791 = HEAP32[$790>>2]|0;
+ $792 = ($791|0)==(0|0);
+ if (!($792)) {
+ $R$0$i$i = $791;$RP$0$i$i = $790;
+ continue;
+ }
+ $793 = ((($R$0$i$i)) + 16|0);
+ $794 = HEAP32[$793>>2]|0;
+ $795 = ($794|0)==(0|0);
+ if ($795) {
+ $R$0$i$i$lcssa = $R$0$i$i;$RP$0$i$i$lcssa = $RP$0$i$i;
+ break;
+ } else {
+ $R$0$i$i = $794;$RP$0$i$i = $793;
+ }
+ }
+ $796 = ($RP$0$i$i$lcssa>>>0)<($755>>>0);
+ if ($796) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP$0$i$i$lcssa>>2] = 0;
+ $R$1$i$i = $R$0$i$i$lcssa;
+ break;
+ }
+ } else {
+ $$sum3536$i$i = $719 | 8;
+ $$sum117$i = (($$sum3536$i$i) + ($tsize$254$i))|0;
+ $775 = (($tbase$255$i) + ($$sum117$i)|0);
+ $776 = HEAP32[$775>>2]|0;
+ $777 = ($776>>>0)<($755>>>0);
+ if ($777) {
+ _abort();
+ // unreachable;
+ }
+ $778 = ((($776)) + 12|0);
+ $779 = HEAP32[$778>>2]|0;
+ $780 = ($779|0)==($720|0);
+ if (!($780)) {
+ _abort();
+ // unreachable;
+ }
+ $781 = ((($773)) + 8|0);
+ $782 = HEAP32[$781>>2]|0;
+ $783 = ($782|0)==($720|0);
+ if ($783) {
+ HEAP32[$778>>2] = $773;
+ HEAP32[$781>>2] = $776;
+ $R$1$i$i = $773;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $797 = ($771|0)==(0|0);
+ if ($797) {
+ break;
+ }
+ $$sum30$i$i = (($tsize$254$i) + 28)|0;
+ $$sum118$i = (($$sum30$i$i) + ($719))|0;
+ $798 = (($tbase$255$i) + ($$sum118$i)|0);
+ $799 = HEAP32[$798>>2]|0;
+ $800 = (7256 + ($799<<2)|0);
+ $801 = HEAP32[$800>>2]|0;
+ $802 = ($720|0)==($801|0);
+ do {
+ if ($802) {
+ HEAP32[$800>>2] = $R$1$i$i;
+ $cond$i$i = ($R$1$i$i|0)==(0|0);
+ if (!($cond$i$i)) {
+ break;
+ }
+ $803 = 1 << $799;
+ $804 = $803 ^ -1;
+ $805 = HEAP32[(6956)>>2]|0;
+ $806 = $805 & $804;
+ HEAP32[(6956)>>2] = $806;
+ break L332;
+ } else {
+ $807 = HEAP32[(6968)>>2]|0;
+ $808 = ($771>>>0)<($807>>>0);
+ if ($808) {
+ _abort();
+ // unreachable;
+ }
+ $809 = ((($771)) + 16|0);
+ $810 = HEAP32[$809>>2]|0;
+ $811 = ($810|0)==($720|0);
+ if ($811) {
+ HEAP32[$809>>2] = $R$1$i$i;
+ } else {
+ $812 = ((($771)) + 20|0);
+ HEAP32[$812>>2] = $R$1$i$i;
+ }
+ $813 = ($R$1$i$i|0)==(0|0);
+ if ($813) {
+ break L332;
+ }
+ }
+ } while(0);
+ $814 = HEAP32[(6968)>>2]|0;
+ $815 = ($R$1$i$i>>>0)<($814>>>0);
+ if ($815) {
+ _abort();
+ // unreachable;
+ }
+ $816 = ((($R$1$i$i)) + 24|0);
+ HEAP32[$816>>2] = $771;
+ $$sum3132$i$i = $719 | 16;
+ $$sum119$i = (($$sum3132$i$i) + ($tsize$254$i))|0;
+ $817 = (($tbase$255$i) + ($$sum119$i)|0);
+ $818 = HEAP32[$817>>2]|0;
+ $819 = ($818|0)==(0|0);
+ do {
+ if (!($819)) {
+ $820 = ($818>>>0)<($814>>>0);
+ if ($820) {
+ _abort();
+ // unreachable;
+ } else {
+ $821 = ((($R$1$i$i)) + 16|0);
+ HEAP32[$821>>2] = $818;
+ $822 = ((($818)) + 24|0);
+ HEAP32[$822>>2] = $R$1$i$i;
+ break;
+ }
+ }
+ } while(0);
+ $$sum120$i = (($$sum2$i21$i) + ($$sum3132$i$i))|0;
+ $823 = (($tbase$255$i) + ($$sum120$i)|0);
+ $824 = HEAP32[$823>>2]|0;
+ $825 = ($824|0)==(0|0);
+ if ($825) {
+ break;
+ }
+ $826 = HEAP32[(6968)>>2]|0;
+ $827 = ($824>>>0)<($826>>>0);
+ if ($827) {
+ _abort();
+ // unreachable;
+ } else {
+ $828 = ((($R$1$i$i)) + 20|0);
+ HEAP32[$828>>2] = $824;
+ $829 = ((($824)) + 24|0);
+ HEAP32[$829>>2] = $R$1$i$i;
+ break;
+ }
+ }
+ } while(0);
+ $$sum9$i$i = $744 | $719;
+ $$sum121$i = (($$sum9$i$i) + ($tsize$254$i))|0;
+ $830 = (($tbase$255$i) + ($$sum121$i)|0);
+ $831 = (($744) + ($725))|0;
+ $oldfirst$0$i$i = $830;$qsize$0$i$i = $831;
+ } else {
+ $oldfirst$0$i$i = $720;$qsize$0$i$i = $725;
+ }
+ $832 = ((($oldfirst$0$i$i)) + 4|0);
+ $833 = HEAP32[$832>>2]|0;
+ $834 = $833 & -2;
+ HEAP32[$832>>2] = $834;
+ $835 = $qsize$0$i$i | 1;
+ $$sum10$i$i = (($$sum$i19$i) + 4)|0;
+ $836 = (($tbase$255$i) + ($$sum10$i$i)|0);
+ HEAP32[$836>>2] = $835;
+ $$sum11$i$i = (($qsize$0$i$i) + ($$sum$i19$i))|0;
+ $837 = (($tbase$255$i) + ($$sum11$i$i)|0);
+ HEAP32[$837>>2] = $qsize$0$i$i;
+ $838 = $qsize$0$i$i >>> 3;
+ $839 = ($qsize$0$i$i>>>0)<(256);
+ if ($839) {
+ $840 = $838 << 1;
+ $841 = (6992 + ($840<<2)|0);
+ $842 = HEAP32[6952>>2]|0;
+ $843 = 1 << $838;
+ $844 = $842 & $843;
+ $845 = ($844|0)==(0);
+ do {
+ if ($845) {
+ $846 = $842 | $843;
+ HEAP32[6952>>2] = $846;
+ $$pre$i22$i = (($840) + 2)|0;
+ $$pre56$i$i = (6992 + ($$pre$i22$i<<2)|0);
+ $$pre$phi$i23$iZ2D = $$pre56$i$i;$F4$0$i$i = $841;
+ } else {
+ $$sum29$i$i = (($840) + 2)|0;
+ $847 = (6992 + ($$sum29$i$i<<2)|0);
+ $848 = HEAP32[$847>>2]|0;
+ $849 = HEAP32[(6968)>>2]|0;
+ $850 = ($848>>>0)<($849>>>0);
+ if (!($850)) {
+ $$pre$phi$i23$iZ2D = $847;$F4$0$i$i = $848;
+ break;
+ }
+ _abort();
+ // unreachable;
+ }
+ } while(0);
+ HEAP32[$$pre$phi$i23$iZ2D>>2] = $724;
+ $851 = ((($F4$0$i$i)) + 12|0);
+ HEAP32[$851>>2] = $724;
+ $$sum27$i$i = (($$sum$i19$i) + 8)|0;
+ $852 = (($tbase$255$i) + ($$sum27$i$i)|0);
+ HEAP32[$852>>2] = $F4$0$i$i;
+ $$sum28$i$i = (($$sum$i19$i) + 12)|0;
+ $853 = (($tbase$255$i) + ($$sum28$i$i)|0);
+ HEAP32[$853>>2] = $841;
+ break;
+ }
+ $854 = $qsize$0$i$i >>> 8;
+ $855 = ($854|0)==(0);
+ do {
+ if ($855) {
+ $I7$0$i$i = 0;
+ } else {
+ $856 = ($qsize$0$i$i>>>0)>(16777215);
+ if ($856) {
+ $I7$0$i$i = 31;
+ break;
+ }
+ $857 = (($854) + 1048320)|0;
+ $858 = $857 >>> 16;
+ $859 = $858 & 8;
+ $860 = $854 << $859;
+ $861 = (($860) + 520192)|0;
+ $862 = $861 >>> 16;
+ $863 = $862 & 4;
+ $864 = $863 | $859;
+ $865 = $860 << $863;
+ $866 = (($865) + 245760)|0;
+ $867 = $866 >>> 16;
+ $868 = $867 & 2;
+ $869 = $864 | $868;
+ $870 = (14 - ($869))|0;
+ $871 = $865 << $868;
+ $872 = $871 >>> 15;
+ $873 = (($870) + ($872))|0;
+ $874 = $873 << 1;
+ $875 = (($873) + 7)|0;
+ $876 = $qsize$0$i$i >>> $875;
+ $877 = $876 & 1;
+ $878 = $877 | $874;
+ $I7$0$i$i = $878;
+ }
+ } while(0);
+ $879 = (7256 + ($I7$0$i$i<<2)|0);
+ $$sum12$i$i = (($$sum$i19$i) + 28)|0;
+ $880 = (($tbase$255$i) + ($$sum12$i$i)|0);
+ HEAP32[$880>>2] = $I7$0$i$i;
+ $$sum13$i$i = (($$sum$i19$i) + 16)|0;
+ $881 = (($tbase$255$i) + ($$sum13$i$i)|0);
+ $$sum14$i$i = (($$sum$i19$i) + 20)|0;
+ $882 = (($tbase$255$i) + ($$sum14$i$i)|0);
+ HEAP32[$882>>2] = 0;
+ HEAP32[$881>>2] = 0;
+ $883 = HEAP32[(6956)>>2]|0;
+ $884 = 1 << $I7$0$i$i;
+ $885 = $883 & $884;
+ $886 = ($885|0)==(0);
+ if ($886) {
+ $887 = $883 | $884;
+ HEAP32[(6956)>>2] = $887;
+ HEAP32[$879>>2] = $724;
+ $$sum15$i$i = (($$sum$i19$i) + 24)|0;
+ $888 = (($tbase$255$i) + ($$sum15$i$i)|0);
+ HEAP32[$888>>2] = $879;
+ $$sum16$i$i = (($$sum$i19$i) + 12)|0;
+ $889 = (($tbase$255$i) + ($$sum16$i$i)|0);
+ HEAP32[$889>>2] = $724;
+ $$sum17$i$i = (($$sum$i19$i) + 8)|0;
+ $890 = (($tbase$255$i) + ($$sum17$i$i)|0);
+ HEAP32[$890>>2] = $724;
+ break;
+ }
+ $891 = HEAP32[$879>>2]|0;
+ $892 = ((($891)) + 4|0);
+ $893 = HEAP32[$892>>2]|0;
+ $894 = $893 & -8;
+ $895 = ($894|0)==($qsize$0$i$i|0);
+ L418: do {
+ if ($895) {
+ $T$0$lcssa$i25$i = $891;
+ } else {
+ $896 = ($I7$0$i$i|0)==(31);
+ $897 = $I7$0$i$i >>> 1;
+ $898 = (25 - ($897))|0;
+ $899 = $896 ? 0 : $898;
+ $900 = $qsize$0$i$i << $899;
+ $K8$051$i$i = $900;$T$050$i$i = $891;
+ while(1) {
+ $907 = $K8$051$i$i >>> 31;
+ $908 = (((($T$050$i$i)) + 16|0) + ($907<<2)|0);
+ $903 = HEAP32[$908>>2]|0;
+ $909 = ($903|0)==(0|0);
+ if ($909) {
+ $$lcssa = $908;$T$050$i$i$lcssa = $T$050$i$i;
+ break;
+ }
+ $901 = $K8$051$i$i << 1;
+ $902 = ((($903)) + 4|0);
+ $904 = HEAP32[$902>>2]|0;
+ $905 = $904 & -8;
+ $906 = ($905|0)==($qsize$0$i$i|0);
+ if ($906) {
+ $T$0$lcssa$i25$i = $903;
+ break L418;
+ } else {
+ $K8$051$i$i = $901;$T$050$i$i = $903;
+ }
+ }
+ $910 = HEAP32[(6968)>>2]|0;
+ $911 = ($$lcssa>>>0)<($910>>>0);
+ if ($911) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$lcssa>>2] = $724;
+ $$sum23$i$i = (($$sum$i19$i) + 24)|0;
+ $912 = (($tbase$255$i) + ($$sum23$i$i)|0);
+ HEAP32[$912>>2] = $T$050$i$i$lcssa;
+ $$sum24$i$i = (($$sum$i19$i) + 12)|0;
+ $913 = (($tbase$255$i) + ($$sum24$i$i)|0);
+ HEAP32[$913>>2] = $724;
+ $$sum25$i$i = (($$sum$i19$i) + 8)|0;
+ $914 = (($tbase$255$i) + ($$sum25$i$i)|0);
+ HEAP32[$914>>2] = $724;
+ break L324;
+ }
+ }
+ } while(0);
+ $915 = ((($T$0$lcssa$i25$i)) + 8|0);
+ $916 = HEAP32[$915>>2]|0;
+ $917 = HEAP32[(6968)>>2]|0;
+ $918 = ($916>>>0)>=($917>>>0);
+ $not$$i26$i = ($T$0$lcssa$i25$i>>>0)>=($917>>>0);
+ $919 = $918 & $not$$i26$i;
+ if ($919) {
+ $920 = ((($916)) + 12|0);
+ HEAP32[$920>>2] = $724;
+ HEAP32[$915>>2] = $724;
+ $$sum20$i$i = (($$sum$i19$i) + 8)|0;
+ $921 = (($tbase$255$i) + ($$sum20$i$i)|0);
+ HEAP32[$921>>2] = $916;
+ $$sum21$i$i = (($$sum$i19$i) + 12)|0;
+ $922 = (($tbase$255$i) + ($$sum21$i$i)|0);
+ HEAP32[$922>>2] = $T$0$lcssa$i25$i;
+ $$sum22$i$i = (($$sum$i19$i) + 24)|0;
+ $923 = (($tbase$255$i) + ($$sum22$i$i)|0);
+ HEAP32[$923>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $$sum1819$i$i = $711 | 8;
+ $924 = (($tbase$255$i) + ($$sum1819$i$i)|0);
+ $mem$0 = $924;
+ return ($mem$0|0);
+ } else {
+ $sp$0$i$i$i = (7400);
+ }
+ }
+ while(1) {
+ $925 = HEAP32[$sp$0$i$i$i>>2]|0;
+ $926 = ($925>>>0)>($635>>>0);
+ if (!($926)) {
+ $927 = ((($sp$0$i$i$i)) + 4|0);
+ $928 = HEAP32[$927>>2]|0;
+ $929 = (($925) + ($928)|0);
+ $930 = ($929>>>0)>($635>>>0);
+ if ($930) {
+ $$lcssa215 = $925;$$lcssa216 = $928;$$lcssa217 = $929;
+ break;
+ }
+ }
+ $931 = ((($sp$0$i$i$i)) + 8|0);
+ $932 = HEAP32[$931>>2]|0;
+ $sp$0$i$i$i = $932;
+ }
+ $$sum$i14$i = (($$lcssa216) + -47)|0;
+ $$sum1$i15$i = (($$lcssa216) + -39)|0;
+ $933 = (($$lcssa215) + ($$sum1$i15$i)|0);
+ $934 = $933;
+ $935 = $934 & 7;
+ $936 = ($935|0)==(0);
+ $937 = (0 - ($934))|0;
+ $938 = $937 & 7;
+ $939 = $936 ? 0 : $938;
+ $$sum2$i16$i = (($$sum$i14$i) + ($939))|0;
+ $940 = (($$lcssa215) + ($$sum2$i16$i)|0);
+ $941 = ((($635)) + 16|0);
+ $942 = ($940>>>0)<($941>>>0);
+ $943 = $942 ? $635 : $940;
+ $944 = ((($943)) + 8|0);
+ $945 = (($tsize$254$i) + -40)|0;
+ $946 = ((($tbase$255$i)) + 8|0);
+ $947 = $946;
+ $948 = $947 & 7;
+ $949 = ($948|0)==(0);
+ $950 = (0 - ($947))|0;
+ $951 = $950 & 7;
+ $952 = $949 ? 0 : $951;
+ $953 = (($tbase$255$i) + ($952)|0);
+ $954 = (($945) - ($952))|0;
+ HEAP32[(6976)>>2] = $953;
+ HEAP32[(6964)>>2] = $954;
+ $955 = $954 | 1;
+ $$sum$i$i$i = (($952) + 4)|0;
+ $956 = (($tbase$255$i) + ($$sum$i$i$i)|0);
+ HEAP32[$956>>2] = $955;
+ $$sum2$i$i$i = (($tsize$254$i) + -36)|0;
+ $957 = (($tbase$255$i) + ($$sum2$i$i$i)|0);
+ HEAP32[$957>>2] = 40;
+ $958 = HEAP32[(7440)>>2]|0;
+ HEAP32[(6980)>>2] = $958;
+ $959 = ((($943)) + 4|0);
+ HEAP32[$959>>2] = 27;
+ ;HEAP32[$944>>2]=HEAP32[(7400)>>2]|0;HEAP32[$944+4>>2]=HEAP32[(7400)+4>>2]|0;HEAP32[$944+8>>2]=HEAP32[(7400)+8>>2]|0;HEAP32[$944+12>>2]=HEAP32[(7400)+12>>2]|0;
+ HEAP32[(7400)>>2] = $tbase$255$i;
+ HEAP32[(7404)>>2] = $tsize$254$i;
+ HEAP32[(7412)>>2] = 0;
+ HEAP32[(7408)>>2] = $944;
+ $960 = ((($943)) + 28|0);
+ HEAP32[$960>>2] = 7;
+ $961 = ((($943)) + 32|0);
+ $962 = ($961>>>0)<($$lcssa217>>>0);
+ if ($962) {
+ $964 = $960;
+ while(1) {
+ $963 = ((($964)) + 4|0);
+ HEAP32[$963>>2] = 7;
+ $965 = ((($964)) + 8|0);
+ $966 = ($965>>>0)<($$lcssa217>>>0);
+ if ($966) {
+ $964 = $963;
+ } else {
+ break;
+ }
+ }
+ }
+ $967 = ($943|0)==($635|0);
+ if (!($967)) {
+ $968 = $943;
+ $969 = $635;
+ $970 = (($968) - ($969))|0;
+ $971 = HEAP32[$959>>2]|0;
+ $972 = $971 & -2;
+ HEAP32[$959>>2] = $972;
+ $973 = $970 | 1;
+ $974 = ((($635)) + 4|0);
+ HEAP32[$974>>2] = $973;
+ HEAP32[$943>>2] = $970;
+ $975 = $970 >>> 3;
+ $976 = ($970>>>0)<(256);
+ if ($976) {
+ $977 = $975 << 1;
+ $978 = (6992 + ($977<<2)|0);
+ $979 = HEAP32[6952>>2]|0;
+ $980 = 1 << $975;
+ $981 = $979 & $980;
+ $982 = ($981|0)==(0);
+ if ($982) {
+ $983 = $979 | $980;
+ HEAP32[6952>>2] = $983;
+ $$pre$i$i = (($977) + 2)|0;
+ $$pre14$i$i = (6992 + ($$pre$i$i<<2)|0);
+ $$pre$phi$i$iZ2D = $$pre14$i$i;$F$0$i$i = $978;
+ } else {
+ $$sum4$i$i = (($977) + 2)|0;
+ $984 = (6992 + ($$sum4$i$i<<2)|0);
+ $985 = HEAP32[$984>>2]|0;
+ $986 = HEAP32[(6968)>>2]|0;
+ $987 = ($985>>>0)<($986>>>0);
+ if ($987) {
+ _abort();
+ // unreachable;
+ } else {
+ $$pre$phi$i$iZ2D = $984;$F$0$i$i = $985;
+ }
+ }
+ HEAP32[$$pre$phi$i$iZ2D>>2] = $635;
+ $988 = ((($F$0$i$i)) + 12|0);
+ HEAP32[$988>>2] = $635;
+ $989 = ((($635)) + 8|0);
+ HEAP32[$989>>2] = $F$0$i$i;
+ $990 = ((($635)) + 12|0);
+ HEAP32[$990>>2] = $978;
+ break;
+ }
+ $991 = $970 >>> 8;
+ $992 = ($991|0)==(0);
+ if ($992) {
+ $I1$0$i$i = 0;
+ } else {
+ $993 = ($970>>>0)>(16777215);
+ if ($993) {
+ $I1$0$i$i = 31;
+ } else {
+ $994 = (($991) + 1048320)|0;
+ $995 = $994 >>> 16;
+ $996 = $995 & 8;
+ $997 = $991 << $996;
+ $998 = (($997) + 520192)|0;
+ $999 = $998 >>> 16;
+ $1000 = $999 & 4;
+ $1001 = $1000 | $996;
+ $1002 = $997 << $1000;
+ $1003 = (($1002) + 245760)|0;
+ $1004 = $1003 >>> 16;
+ $1005 = $1004 & 2;
+ $1006 = $1001 | $1005;
+ $1007 = (14 - ($1006))|0;
+ $1008 = $1002 << $1005;
+ $1009 = $1008 >>> 15;
+ $1010 = (($1007) + ($1009))|0;
+ $1011 = $1010 << 1;
+ $1012 = (($1010) + 7)|0;
+ $1013 = $970 >>> $1012;
+ $1014 = $1013 & 1;
+ $1015 = $1014 | $1011;
+ $I1$0$i$i = $1015;
+ }
+ }
+ $1016 = (7256 + ($I1$0$i$i<<2)|0);
+ $1017 = ((($635)) + 28|0);
+ HEAP32[$1017>>2] = $I1$0$i$i;
+ $1018 = ((($635)) + 20|0);
+ HEAP32[$1018>>2] = 0;
+ HEAP32[$941>>2] = 0;
+ $1019 = HEAP32[(6956)>>2]|0;
+ $1020 = 1 << $I1$0$i$i;
+ $1021 = $1019 & $1020;
+ $1022 = ($1021|0)==(0);
+ if ($1022) {
+ $1023 = $1019 | $1020;
+ HEAP32[(6956)>>2] = $1023;
+ HEAP32[$1016>>2] = $635;
+ $1024 = ((($635)) + 24|0);
+ HEAP32[$1024>>2] = $1016;
+ $1025 = ((($635)) + 12|0);
+ HEAP32[$1025>>2] = $635;
+ $1026 = ((($635)) + 8|0);
+ HEAP32[$1026>>2] = $635;
+ break;
+ }
+ $1027 = HEAP32[$1016>>2]|0;
+ $1028 = ((($1027)) + 4|0);
+ $1029 = HEAP32[$1028>>2]|0;
+ $1030 = $1029 & -8;
+ $1031 = ($1030|0)==($970|0);
+ L459: do {
+ if ($1031) {
+ $T$0$lcssa$i$i = $1027;
+ } else {
+ $1032 = ($I1$0$i$i|0)==(31);
+ $1033 = $I1$0$i$i >>> 1;
+ $1034 = (25 - ($1033))|0;
+ $1035 = $1032 ? 0 : $1034;
+ $1036 = $970 << $1035;
+ $K2$07$i$i = $1036;$T$06$i$i = $1027;
+ while(1) {
+ $1043 = $K2$07$i$i >>> 31;
+ $1044 = (((($T$06$i$i)) + 16|0) + ($1043<<2)|0);
+ $1039 = HEAP32[$1044>>2]|0;
+ $1045 = ($1039|0)==(0|0);
+ if ($1045) {
+ $$lcssa211 = $1044;$T$06$i$i$lcssa = $T$06$i$i;
+ break;
+ }
+ $1037 = $K2$07$i$i << 1;
+ $1038 = ((($1039)) + 4|0);
+ $1040 = HEAP32[$1038>>2]|0;
+ $1041 = $1040 & -8;
+ $1042 = ($1041|0)==($970|0);
+ if ($1042) {
+ $T$0$lcssa$i$i = $1039;
+ break L459;
+ } else {
+ $K2$07$i$i = $1037;$T$06$i$i = $1039;
+ }
+ }
+ $1046 = HEAP32[(6968)>>2]|0;
+ $1047 = ($$lcssa211>>>0)<($1046>>>0);
+ if ($1047) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$lcssa211>>2] = $635;
+ $1048 = ((($635)) + 24|0);
+ HEAP32[$1048>>2] = $T$06$i$i$lcssa;
+ $1049 = ((($635)) + 12|0);
+ HEAP32[$1049>>2] = $635;
+ $1050 = ((($635)) + 8|0);
+ HEAP32[$1050>>2] = $635;
+ break L299;
+ }
+ }
+ } while(0);
+ $1051 = ((($T$0$lcssa$i$i)) + 8|0);
+ $1052 = HEAP32[$1051>>2]|0;
+ $1053 = HEAP32[(6968)>>2]|0;
+ $1054 = ($1052>>>0)>=($1053>>>0);
+ $not$$i$i = ($T$0$lcssa$i$i>>>0)>=($1053>>>0);
+ $1055 = $1054 & $not$$i$i;
+ if ($1055) {
+ $1056 = ((($1052)) + 12|0);
+ HEAP32[$1056>>2] = $635;
+ HEAP32[$1051>>2] = $635;
+ $1057 = ((($635)) + 8|0);
+ HEAP32[$1057>>2] = $1052;
+ $1058 = ((($635)) + 12|0);
+ HEAP32[$1058>>2] = $T$0$lcssa$i$i;
+ $1059 = ((($635)) + 24|0);
+ HEAP32[$1059>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ }
+ } while(0);
+ $1060 = HEAP32[(6964)>>2]|0;
+ $1061 = ($1060>>>0)>($nb$0>>>0);
+ if ($1061) {
+ $1062 = (($1060) - ($nb$0))|0;
+ HEAP32[(6964)>>2] = $1062;
+ $1063 = HEAP32[(6976)>>2]|0;
+ $1064 = (($1063) + ($nb$0)|0);
+ HEAP32[(6976)>>2] = $1064;
+ $1065 = $1062 | 1;
+ $$sum$i32 = (($nb$0) + 4)|0;
+ $1066 = (($1063) + ($$sum$i32)|0);
+ HEAP32[$1066>>2] = $1065;
+ $1067 = $nb$0 | 3;
+ $1068 = ((($1063)) + 4|0);
+ HEAP32[$1068>>2] = $1067;
+ $1069 = ((($1063)) + 8|0);
+ $mem$0 = $1069;
+ return ($mem$0|0);
+ }
+ }
+ $1070 = (___errno_location()|0);
+ HEAP32[$1070>>2] = 12;
+ $mem$0 = 0;
+ return ($mem$0|0);
+}
+function _free($mem) {
+ $mem = $mem|0;
+ var $$lcssa = 0, $$pre = 0, $$pre$phi59Z2D = 0, $$pre$phi61Z2D = 0, $$pre$phiZ2D = 0, $$pre57 = 0, $$pre58 = 0, $$pre60 = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum1718 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0;
+ var $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum5 = 0, $$sum67 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0;
+ var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0;
+ var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0;
+ var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0;
+ var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0;
+ var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0;
+ var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0;
+ var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0;
+ var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0;
+ var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0;
+ var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0;
+ var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
+ var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
+ var $321 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0;
+ var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0;
+ var $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0;
+ var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I18$0 = 0, $K19$052 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0;
+ var $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$051 = 0, $T$051$lcssa = 0, $cond = 0, $cond47 = 0, $not$ = 0, $p$0 = 0, $psize$0 = 0, $psize$1 = 0, $sp$0$i = 0, $sp$0$in$i = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($mem|0)==(0|0);
+ if ($0) {
+ return;
+ }
+ $1 = ((($mem)) + -8|0);
+ $2 = HEAP32[(6968)>>2]|0;
+ $3 = ($1>>>0)<($2>>>0);
+ if ($3) {
+ _abort();
+ // unreachable;
+ }
+ $4 = ((($mem)) + -4|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = $5 & 3;
+ $7 = ($6|0)==(1);
+ if ($7) {
+ _abort();
+ // unreachable;
+ }
+ $8 = $5 & -8;
+ $$sum = (($8) + -8)|0;
+ $9 = (($mem) + ($$sum)|0);
+ $10 = $5 & 1;
+ $11 = ($10|0)==(0);
+ do {
+ if ($11) {
+ $12 = HEAP32[$1>>2]|0;
+ $13 = ($6|0)==(0);
+ if ($13) {
+ return;
+ }
+ $$sum2 = (-8 - ($12))|0;
+ $14 = (($mem) + ($$sum2)|0);
+ $15 = (($12) + ($8))|0;
+ $16 = ($14>>>0)<($2>>>0);
+ if ($16) {
+ _abort();
+ // unreachable;
+ }
+ $17 = HEAP32[(6972)>>2]|0;
+ $18 = ($14|0)==($17|0);
+ if ($18) {
+ $$sum3 = (($8) + -4)|0;
+ $103 = (($mem) + ($$sum3)|0);
+ $104 = HEAP32[$103>>2]|0;
+ $105 = $104 & 3;
+ $106 = ($105|0)==(3);
+ if (!($106)) {
+ $p$0 = $14;$psize$0 = $15;
+ break;
+ }
+ HEAP32[(6960)>>2] = $15;
+ $107 = $104 & -2;
+ HEAP32[$103>>2] = $107;
+ $108 = $15 | 1;
+ $$sum20 = (($$sum2) + 4)|0;
+ $109 = (($mem) + ($$sum20)|0);
+ HEAP32[$109>>2] = $108;
+ HEAP32[$9>>2] = $15;
+ return;
+ }
+ $19 = $12 >>> 3;
+ $20 = ($12>>>0)<(256);
+ if ($20) {
+ $$sum30 = (($$sum2) + 8)|0;
+ $21 = (($mem) + ($$sum30)|0);
+ $22 = HEAP32[$21>>2]|0;
+ $$sum31 = (($$sum2) + 12)|0;
+ $23 = (($mem) + ($$sum31)|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = $19 << 1;
+ $26 = (6992 + ($25<<2)|0);
+ $27 = ($22|0)==($26|0);
+ if (!($27)) {
+ $28 = ($22>>>0)<($2>>>0);
+ if ($28) {
+ _abort();
+ // unreachable;
+ }
+ $29 = ((($22)) + 12|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = ($30|0)==($14|0);
+ if (!($31)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $32 = ($24|0)==($22|0);
+ if ($32) {
+ $33 = 1 << $19;
+ $34 = $33 ^ -1;
+ $35 = HEAP32[6952>>2]|0;
+ $36 = $35 & $34;
+ HEAP32[6952>>2] = $36;
+ $p$0 = $14;$psize$0 = $15;
+ break;
+ }
+ $37 = ($24|0)==($26|0);
+ if ($37) {
+ $$pre60 = ((($24)) + 8|0);
+ $$pre$phi61Z2D = $$pre60;
+ } else {
+ $38 = ($24>>>0)<($2>>>0);
+ if ($38) {
+ _abort();
+ // unreachable;
+ }
+ $39 = ((($24)) + 8|0);
+ $40 = HEAP32[$39>>2]|0;
+ $41 = ($40|0)==($14|0);
+ if ($41) {
+ $$pre$phi61Z2D = $39;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $42 = ((($22)) + 12|0);
+ HEAP32[$42>>2] = $24;
+ HEAP32[$$pre$phi61Z2D>>2] = $22;
+ $p$0 = $14;$psize$0 = $15;
+ break;
+ }
+ $$sum22 = (($$sum2) + 24)|0;
+ $43 = (($mem) + ($$sum22)|0);
+ $44 = HEAP32[$43>>2]|0;
+ $$sum23 = (($$sum2) + 12)|0;
+ $45 = (($mem) + ($$sum23)|0);
+ $46 = HEAP32[$45>>2]|0;
+ $47 = ($46|0)==($14|0);
+ do {
+ if ($47) {
+ $$sum25 = (($$sum2) + 20)|0;
+ $57 = (($mem) + ($$sum25)|0);
+ $58 = HEAP32[$57>>2]|0;
+ $59 = ($58|0)==(0|0);
+ if ($59) {
+ $$sum24 = (($$sum2) + 16)|0;
+ $60 = (($mem) + ($$sum24)|0);
+ $61 = HEAP32[$60>>2]|0;
+ $62 = ($61|0)==(0|0);
+ if ($62) {
+ $R$1 = 0;
+ break;
+ } else {
+ $R$0 = $61;$RP$0 = $60;
+ }
+ } else {
+ $R$0 = $58;$RP$0 = $57;
+ }
+ while(1) {
+ $63 = ((($R$0)) + 20|0);
+ $64 = HEAP32[$63>>2]|0;
+ $65 = ($64|0)==(0|0);
+ if (!($65)) {
+ $R$0 = $64;$RP$0 = $63;
+ continue;
+ }
+ $66 = ((($R$0)) + 16|0);
+ $67 = HEAP32[$66>>2]|0;
+ $68 = ($67|0)==(0|0);
+ if ($68) {
+ $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0;
+ break;
+ } else {
+ $R$0 = $67;$RP$0 = $66;
+ }
+ }
+ $69 = ($RP$0$lcssa>>>0)<($2>>>0);
+ if ($69) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP$0$lcssa>>2] = 0;
+ $R$1 = $R$0$lcssa;
+ break;
+ }
+ } else {
+ $$sum29 = (($$sum2) + 8)|0;
+ $48 = (($mem) + ($$sum29)|0);
+ $49 = HEAP32[$48>>2]|0;
+ $50 = ($49>>>0)<($2>>>0);
+ if ($50) {
+ _abort();
+ // unreachable;
+ }
+ $51 = ((($49)) + 12|0);
+ $52 = HEAP32[$51>>2]|0;
+ $53 = ($52|0)==($14|0);
+ if (!($53)) {
+ _abort();
+ // unreachable;
+ }
+ $54 = ((($46)) + 8|0);
+ $55 = HEAP32[$54>>2]|0;
+ $56 = ($55|0)==($14|0);
+ if ($56) {
+ HEAP32[$51>>2] = $46;
+ HEAP32[$54>>2] = $49;
+ $R$1 = $46;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $70 = ($44|0)==(0|0);
+ if ($70) {
+ $p$0 = $14;$psize$0 = $15;
+ } else {
+ $$sum26 = (($$sum2) + 28)|0;
+ $71 = (($mem) + ($$sum26)|0);
+ $72 = HEAP32[$71>>2]|0;
+ $73 = (7256 + ($72<<2)|0);
+ $74 = HEAP32[$73>>2]|0;
+ $75 = ($14|0)==($74|0);
+ if ($75) {
+ HEAP32[$73>>2] = $R$1;
+ $cond = ($R$1|0)==(0|0);
+ if ($cond) {
+ $76 = 1 << $72;
+ $77 = $76 ^ -1;
+ $78 = HEAP32[(6956)>>2]|0;
+ $79 = $78 & $77;
+ HEAP32[(6956)>>2] = $79;
+ $p$0 = $14;$psize$0 = $15;
+ break;
+ }
+ } else {
+ $80 = HEAP32[(6968)>>2]|0;
+ $81 = ($44>>>0)<($80>>>0);
+ if ($81) {
+ _abort();
+ // unreachable;
+ }
+ $82 = ((($44)) + 16|0);
+ $83 = HEAP32[$82>>2]|0;
+ $84 = ($83|0)==($14|0);
+ if ($84) {
+ HEAP32[$82>>2] = $R$1;
+ } else {
+ $85 = ((($44)) + 20|0);
+ HEAP32[$85>>2] = $R$1;
+ }
+ $86 = ($R$1|0)==(0|0);
+ if ($86) {
+ $p$0 = $14;$psize$0 = $15;
+ break;
+ }
+ }
+ $87 = HEAP32[(6968)>>2]|0;
+ $88 = ($R$1>>>0)<($87>>>0);
+ if ($88) {
+ _abort();
+ // unreachable;
+ }
+ $89 = ((($R$1)) + 24|0);
+ HEAP32[$89>>2] = $44;
+ $$sum27 = (($$sum2) + 16)|0;
+ $90 = (($mem) + ($$sum27)|0);
+ $91 = HEAP32[$90>>2]|0;
+ $92 = ($91|0)==(0|0);
+ do {
+ if (!($92)) {
+ $93 = ($91>>>0)<($87>>>0);
+ if ($93) {
+ _abort();
+ // unreachable;
+ } else {
+ $94 = ((($R$1)) + 16|0);
+ HEAP32[$94>>2] = $91;
+ $95 = ((($91)) + 24|0);
+ HEAP32[$95>>2] = $R$1;
+ break;
+ }
+ }
+ } while(0);
+ $$sum28 = (($$sum2) + 20)|0;
+ $96 = (($mem) + ($$sum28)|0);
+ $97 = HEAP32[$96>>2]|0;
+ $98 = ($97|0)==(0|0);
+ if ($98) {
+ $p$0 = $14;$psize$0 = $15;
+ } else {
+ $99 = HEAP32[(6968)>>2]|0;
+ $100 = ($97>>>0)<($99>>>0);
+ if ($100) {
+ _abort();
+ // unreachable;
+ } else {
+ $101 = ((($R$1)) + 20|0);
+ HEAP32[$101>>2] = $97;
+ $102 = ((($97)) + 24|0);
+ HEAP32[$102>>2] = $R$1;
+ $p$0 = $14;$psize$0 = $15;
+ break;
+ }
+ }
+ }
+ } else {
+ $p$0 = $1;$psize$0 = $8;
+ }
+ } while(0);
+ $110 = ($p$0>>>0)<($9>>>0);
+ if (!($110)) {
+ _abort();
+ // unreachable;
+ }
+ $$sum19 = (($8) + -4)|0;
+ $111 = (($mem) + ($$sum19)|0);
+ $112 = HEAP32[$111>>2]|0;
+ $113 = $112 & 1;
+ $114 = ($113|0)==(0);
+ if ($114) {
+ _abort();
+ // unreachable;
+ }
+ $115 = $112 & 2;
+ $116 = ($115|0)==(0);
+ if ($116) {
+ $117 = HEAP32[(6976)>>2]|0;
+ $118 = ($9|0)==($117|0);
+ if ($118) {
+ $119 = HEAP32[(6964)>>2]|0;
+ $120 = (($119) + ($psize$0))|0;
+ HEAP32[(6964)>>2] = $120;
+ HEAP32[(6976)>>2] = $p$0;
+ $121 = $120 | 1;
+ $122 = ((($p$0)) + 4|0);
+ HEAP32[$122>>2] = $121;
+ $123 = HEAP32[(6972)>>2]|0;
+ $124 = ($p$0|0)==($123|0);
+ if (!($124)) {
+ return;
+ }
+ HEAP32[(6972)>>2] = 0;
+ HEAP32[(6960)>>2] = 0;
+ return;
+ }
+ $125 = HEAP32[(6972)>>2]|0;
+ $126 = ($9|0)==($125|0);
+ if ($126) {
+ $127 = HEAP32[(6960)>>2]|0;
+ $128 = (($127) + ($psize$0))|0;
+ HEAP32[(6960)>>2] = $128;
+ HEAP32[(6972)>>2] = $p$0;
+ $129 = $128 | 1;
+ $130 = ((($p$0)) + 4|0);
+ HEAP32[$130>>2] = $129;
+ $131 = (($p$0) + ($128)|0);
+ HEAP32[$131>>2] = $128;
+ return;
+ }
+ $132 = $112 & -8;
+ $133 = (($132) + ($psize$0))|0;
+ $134 = $112 >>> 3;
+ $135 = ($112>>>0)<(256);
+ do {
+ if ($135) {
+ $136 = (($mem) + ($8)|0);
+ $137 = HEAP32[$136>>2]|0;
+ $$sum1718 = $8 | 4;
+ $138 = (($mem) + ($$sum1718)|0);
+ $139 = HEAP32[$138>>2]|0;
+ $140 = $134 << 1;
+ $141 = (6992 + ($140<<2)|0);
+ $142 = ($137|0)==($141|0);
+ if (!($142)) {
+ $143 = HEAP32[(6968)>>2]|0;
+ $144 = ($137>>>0)<($143>>>0);
+ if ($144) {
+ _abort();
+ // unreachable;
+ }
+ $145 = ((($137)) + 12|0);
+ $146 = HEAP32[$145>>2]|0;
+ $147 = ($146|0)==($9|0);
+ if (!($147)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $148 = ($139|0)==($137|0);
+ if ($148) {
+ $149 = 1 << $134;
+ $150 = $149 ^ -1;
+ $151 = HEAP32[6952>>2]|0;
+ $152 = $151 & $150;
+ HEAP32[6952>>2] = $152;
+ break;
+ }
+ $153 = ($139|0)==($141|0);
+ if ($153) {
+ $$pre58 = ((($139)) + 8|0);
+ $$pre$phi59Z2D = $$pre58;
+ } else {
+ $154 = HEAP32[(6968)>>2]|0;
+ $155 = ($139>>>0)<($154>>>0);
+ if ($155) {
+ _abort();
+ // unreachable;
+ }
+ $156 = ((($139)) + 8|0);
+ $157 = HEAP32[$156>>2]|0;
+ $158 = ($157|0)==($9|0);
+ if ($158) {
+ $$pre$phi59Z2D = $156;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $159 = ((($137)) + 12|0);
+ HEAP32[$159>>2] = $139;
+ HEAP32[$$pre$phi59Z2D>>2] = $137;
+ } else {
+ $$sum5 = (($8) + 16)|0;
+ $160 = (($mem) + ($$sum5)|0);
+ $161 = HEAP32[$160>>2]|0;
+ $$sum67 = $8 | 4;
+ $162 = (($mem) + ($$sum67)|0);
+ $163 = HEAP32[$162>>2]|0;
+ $164 = ($163|0)==($9|0);
+ do {
+ if ($164) {
+ $$sum9 = (($8) + 12)|0;
+ $175 = (($mem) + ($$sum9)|0);
+ $176 = HEAP32[$175>>2]|0;
+ $177 = ($176|0)==(0|0);
+ if ($177) {
+ $$sum8 = (($8) + 8)|0;
+ $178 = (($mem) + ($$sum8)|0);
+ $179 = HEAP32[$178>>2]|0;
+ $180 = ($179|0)==(0|0);
+ if ($180) {
+ $R7$1 = 0;
+ break;
+ } else {
+ $R7$0 = $179;$RP9$0 = $178;
+ }
+ } else {
+ $R7$0 = $176;$RP9$0 = $175;
+ }
+ while(1) {
+ $181 = ((($R7$0)) + 20|0);
+ $182 = HEAP32[$181>>2]|0;
+ $183 = ($182|0)==(0|0);
+ if (!($183)) {
+ $R7$0 = $182;$RP9$0 = $181;
+ continue;
+ }
+ $184 = ((($R7$0)) + 16|0);
+ $185 = HEAP32[$184>>2]|0;
+ $186 = ($185|0)==(0|0);
+ if ($186) {
+ $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0;
+ break;
+ } else {
+ $R7$0 = $185;$RP9$0 = $184;
+ }
+ }
+ $187 = HEAP32[(6968)>>2]|0;
+ $188 = ($RP9$0$lcssa>>>0)<($187>>>0);
+ if ($188) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP9$0$lcssa>>2] = 0;
+ $R7$1 = $R7$0$lcssa;
+ break;
+ }
+ } else {
+ $165 = (($mem) + ($8)|0);
+ $166 = HEAP32[$165>>2]|0;
+ $167 = HEAP32[(6968)>>2]|0;
+ $168 = ($166>>>0)<($167>>>0);
+ if ($168) {
+ _abort();
+ // unreachable;
+ }
+ $169 = ((($166)) + 12|0);
+ $170 = HEAP32[$169>>2]|0;
+ $171 = ($170|0)==($9|0);
+ if (!($171)) {
+ _abort();
+ // unreachable;
+ }
+ $172 = ((($163)) + 8|0);
+ $173 = HEAP32[$172>>2]|0;
+ $174 = ($173|0)==($9|0);
+ if ($174) {
+ HEAP32[$169>>2] = $163;
+ HEAP32[$172>>2] = $166;
+ $R7$1 = $163;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $189 = ($161|0)==(0|0);
+ if (!($189)) {
+ $$sum12 = (($8) + 20)|0;
+ $190 = (($mem) + ($$sum12)|0);
+ $191 = HEAP32[$190>>2]|0;
+ $192 = (7256 + ($191<<2)|0);
+ $193 = HEAP32[$192>>2]|0;
+ $194 = ($9|0)==($193|0);
+ if ($194) {
+ HEAP32[$192>>2] = $R7$1;
+ $cond47 = ($R7$1|0)==(0|0);
+ if ($cond47) {
+ $195 = 1 << $191;
+ $196 = $195 ^ -1;
+ $197 = HEAP32[(6956)>>2]|0;
+ $198 = $197 & $196;
+ HEAP32[(6956)>>2] = $198;
+ break;
+ }
+ } else {
+ $199 = HEAP32[(6968)>>2]|0;
+ $200 = ($161>>>0)<($199>>>0);
+ if ($200) {
+ _abort();
+ // unreachable;
+ }
+ $201 = ((($161)) + 16|0);
+ $202 = HEAP32[$201>>2]|0;
+ $203 = ($202|0)==($9|0);
+ if ($203) {
+ HEAP32[$201>>2] = $R7$1;
+ } else {
+ $204 = ((($161)) + 20|0);
+ HEAP32[$204>>2] = $R7$1;
+ }
+ $205 = ($R7$1|0)==(0|0);
+ if ($205) {
+ break;
+ }
+ }
+ $206 = HEAP32[(6968)>>2]|0;
+ $207 = ($R7$1>>>0)<($206>>>0);
+ if ($207) {
+ _abort();
+ // unreachable;
+ }
+ $208 = ((($R7$1)) + 24|0);
+ HEAP32[$208>>2] = $161;
+ $$sum13 = (($8) + 8)|0;
+ $209 = (($mem) + ($$sum13)|0);
+ $210 = HEAP32[$209>>2]|0;
+ $211 = ($210|0)==(0|0);
+ do {
+ if (!($211)) {
+ $212 = ($210>>>0)<($206>>>0);
+ if ($212) {
+ _abort();
+ // unreachable;
+ } else {
+ $213 = ((($R7$1)) + 16|0);
+ HEAP32[$213>>2] = $210;
+ $214 = ((($210)) + 24|0);
+ HEAP32[$214>>2] = $R7$1;
+ break;
+ }
+ }
+ } while(0);
+ $$sum14 = (($8) + 12)|0;
+ $215 = (($mem) + ($$sum14)|0);
+ $216 = HEAP32[$215>>2]|0;
+ $217 = ($216|0)==(0|0);
+ if (!($217)) {
+ $218 = HEAP32[(6968)>>2]|0;
+ $219 = ($216>>>0)<($218>>>0);
+ if ($219) {
+ _abort();
+ // unreachable;
+ } else {
+ $220 = ((($R7$1)) + 20|0);
+ HEAP32[$220>>2] = $216;
+ $221 = ((($216)) + 24|0);
+ HEAP32[$221>>2] = $R7$1;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $222 = $133 | 1;
+ $223 = ((($p$0)) + 4|0);
+ HEAP32[$223>>2] = $222;
+ $224 = (($p$0) + ($133)|0);
+ HEAP32[$224>>2] = $133;
+ $225 = HEAP32[(6972)>>2]|0;
+ $226 = ($p$0|0)==($225|0);
+ if ($226) {
+ HEAP32[(6960)>>2] = $133;
+ return;
+ } else {
+ $psize$1 = $133;
+ }
+ } else {
+ $227 = $112 & -2;
+ HEAP32[$111>>2] = $227;
+ $228 = $psize$0 | 1;
+ $229 = ((($p$0)) + 4|0);
+ HEAP32[$229>>2] = $228;
+ $230 = (($p$0) + ($psize$0)|0);
+ HEAP32[$230>>2] = $psize$0;
+ $psize$1 = $psize$0;
+ }
+ $231 = $psize$1 >>> 3;
+ $232 = ($psize$1>>>0)<(256);
+ if ($232) {
+ $233 = $231 << 1;
+ $234 = (6992 + ($233<<2)|0);
+ $235 = HEAP32[6952>>2]|0;
+ $236 = 1 << $231;
+ $237 = $235 & $236;
+ $238 = ($237|0)==(0);
+ if ($238) {
+ $239 = $235 | $236;
+ HEAP32[6952>>2] = $239;
+ $$pre = (($233) + 2)|0;
+ $$pre57 = (6992 + ($$pre<<2)|0);
+ $$pre$phiZ2D = $$pre57;$F16$0 = $234;
+ } else {
+ $$sum11 = (($233) + 2)|0;
+ $240 = (6992 + ($$sum11<<2)|0);
+ $241 = HEAP32[$240>>2]|0;
+ $242 = HEAP32[(6968)>>2]|0;
+ $243 = ($241>>>0)<($242>>>0);
+ if ($243) {
+ _abort();
+ // unreachable;
+ } else {
+ $$pre$phiZ2D = $240;$F16$0 = $241;
+ }
+ }
+ HEAP32[$$pre$phiZ2D>>2] = $p$0;
+ $244 = ((($F16$0)) + 12|0);
+ HEAP32[$244>>2] = $p$0;
+ $245 = ((($p$0)) + 8|0);
+ HEAP32[$245>>2] = $F16$0;
+ $246 = ((($p$0)) + 12|0);
+ HEAP32[$246>>2] = $234;
+ return;
+ }
+ $247 = $psize$1 >>> 8;
+ $248 = ($247|0)==(0);
+ if ($248) {
+ $I18$0 = 0;
+ } else {
+ $249 = ($psize$1>>>0)>(16777215);
+ if ($249) {
+ $I18$0 = 31;
+ } else {
+ $250 = (($247) + 1048320)|0;
+ $251 = $250 >>> 16;
+ $252 = $251 & 8;
+ $253 = $247 << $252;
+ $254 = (($253) + 520192)|0;
+ $255 = $254 >>> 16;
+ $256 = $255 & 4;
+ $257 = $256 | $252;
+ $258 = $253 << $256;
+ $259 = (($258) + 245760)|0;
+ $260 = $259 >>> 16;
+ $261 = $260 & 2;
+ $262 = $257 | $261;
+ $263 = (14 - ($262))|0;
+ $264 = $258 << $261;
+ $265 = $264 >>> 15;
+ $266 = (($263) + ($265))|0;
+ $267 = $266 << 1;
+ $268 = (($266) + 7)|0;
+ $269 = $psize$1 >>> $268;
+ $270 = $269 & 1;
+ $271 = $270 | $267;
+ $I18$0 = $271;
+ }
+ }
+ $272 = (7256 + ($I18$0<<2)|0);
+ $273 = ((($p$0)) + 28|0);
+ HEAP32[$273>>2] = $I18$0;
+ $274 = ((($p$0)) + 16|0);
+ $275 = ((($p$0)) + 20|0);
+ HEAP32[$275>>2] = 0;
+ HEAP32[$274>>2] = 0;
+ $276 = HEAP32[(6956)>>2]|0;
+ $277 = 1 << $I18$0;
+ $278 = $276 & $277;
+ $279 = ($278|0)==(0);
+ L199: do {
+ if ($279) {
+ $280 = $276 | $277;
+ HEAP32[(6956)>>2] = $280;
+ HEAP32[$272>>2] = $p$0;
+ $281 = ((($p$0)) + 24|0);
+ HEAP32[$281>>2] = $272;
+ $282 = ((($p$0)) + 12|0);
+ HEAP32[$282>>2] = $p$0;
+ $283 = ((($p$0)) + 8|0);
+ HEAP32[$283>>2] = $p$0;
+ } else {
+ $284 = HEAP32[$272>>2]|0;
+ $285 = ((($284)) + 4|0);
+ $286 = HEAP32[$285>>2]|0;
+ $287 = $286 & -8;
+ $288 = ($287|0)==($psize$1|0);
+ L202: do {
+ if ($288) {
+ $T$0$lcssa = $284;
+ } else {
+ $289 = ($I18$0|0)==(31);
+ $290 = $I18$0 >>> 1;
+ $291 = (25 - ($290))|0;
+ $292 = $289 ? 0 : $291;
+ $293 = $psize$1 << $292;
+ $K19$052 = $293;$T$051 = $284;
+ while(1) {
+ $300 = $K19$052 >>> 31;
+ $301 = (((($T$051)) + 16|0) + ($300<<2)|0);
+ $296 = HEAP32[$301>>2]|0;
+ $302 = ($296|0)==(0|0);
+ if ($302) {
+ $$lcssa = $301;$T$051$lcssa = $T$051;
+ break;
+ }
+ $294 = $K19$052 << 1;
+ $295 = ((($296)) + 4|0);
+ $297 = HEAP32[$295>>2]|0;
+ $298 = $297 & -8;
+ $299 = ($298|0)==($psize$1|0);
+ if ($299) {
+ $T$0$lcssa = $296;
+ break L202;
+ } else {
+ $K19$052 = $294;$T$051 = $296;
+ }
+ }
+ $303 = HEAP32[(6968)>>2]|0;
+ $304 = ($$lcssa>>>0)<($303>>>0);
+ if ($304) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$lcssa>>2] = $p$0;
+ $305 = ((($p$0)) + 24|0);
+ HEAP32[$305>>2] = $T$051$lcssa;
+ $306 = ((($p$0)) + 12|0);
+ HEAP32[$306>>2] = $p$0;
+ $307 = ((($p$0)) + 8|0);
+ HEAP32[$307>>2] = $p$0;
+ break L199;
+ }
+ }
+ } while(0);
+ $308 = ((($T$0$lcssa)) + 8|0);
+ $309 = HEAP32[$308>>2]|0;
+ $310 = HEAP32[(6968)>>2]|0;
+ $311 = ($309>>>0)>=($310>>>0);
+ $not$ = ($T$0$lcssa>>>0)>=($310>>>0);
+ $312 = $311 & $not$;
+ if ($312) {
+ $313 = ((($309)) + 12|0);
+ HEAP32[$313>>2] = $p$0;
+ HEAP32[$308>>2] = $p$0;
+ $314 = ((($p$0)) + 8|0);
+ HEAP32[$314>>2] = $309;
+ $315 = ((($p$0)) + 12|0);
+ HEAP32[$315>>2] = $T$0$lcssa;
+ $316 = ((($p$0)) + 24|0);
+ HEAP32[$316>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $317 = HEAP32[(6984)>>2]|0;
+ $318 = (($317) + -1)|0;
+ HEAP32[(6984)>>2] = $318;
+ $319 = ($318|0)==(0);
+ if ($319) {
+ $sp$0$in$i = (7408);
+ } else {
+ return;
+ }
+ while(1) {
+ $sp$0$i = HEAP32[$sp$0$in$i>>2]|0;
+ $320 = ($sp$0$i|0)==(0|0);
+ $321 = ((($sp$0$i)) + 8|0);
+ if ($320) {
+ break;
+ } else {
+ $sp$0$in$i = $321;
+ }
+ }
+ HEAP32[(6984)>>2] = -1;
+ return;
+}
+function _realloc($oldmem,$bytes) {
+ $oldmem = $oldmem|0;
+ $bytes = $bytes|0;
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $mem$0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ($oldmem|0)==(0|0);
+ if ($0) {
+ $1 = (_malloc($bytes)|0);
+ $mem$0 = $1;
+ return ($mem$0|0);
+ }
+ $2 = ($bytes>>>0)>(4294967231);
+ if ($2) {
+ $3 = (___errno_location()|0);
+ HEAP32[$3>>2] = 12;
+ $mem$0 = 0;
+ return ($mem$0|0);
+ }
+ $4 = ($bytes>>>0)<(11);
+ $5 = (($bytes) + 11)|0;
+ $6 = $5 & -8;
+ $7 = $4 ? 16 : $6;
+ $8 = ((($oldmem)) + -8|0);
+ $9 = (_try_realloc_chunk($8,$7)|0);
+ $10 = ($9|0)==(0|0);
+ if (!($10)) {
+ $11 = ((($9)) + 8|0);
+ $mem$0 = $11;
+ return ($mem$0|0);
+ }
+ $12 = (_malloc($bytes)|0);
+ $13 = ($12|0)==(0|0);
+ if ($13) {
+ $mem$0 = 0;
+ return ($mem$0|0);
+ }
+ $14 = ((($oldmem)) + -4|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = $15 & -8;
+ $17 = $15 & 3;
+ $18 = ($17|0)==(0);
+ $19 = $18 ? 8 : 4;
+ $20 = (($16) - ($19))|0;
+ $21 = ($20>>>0)<($bytes>>>0);
+ $22 = $21 ? $20 : $bytes;
+ _memcpy(($12|0),($oldmem|0),($22|0))|0;
+ _free($oldmem);
+ $mem$0 = $12;
+ return ($mem$0|0);
+}
+function _try_realloc_chunk($p,$nb) {
+ $p = $p|0;
+ $nb = $nb|0;
+ var $$pre = 0, $$pre$phiZ2D = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum2728 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum78 = 0;
+ var $$sum910 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
+ var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
+ var $17 = 0, $170 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $cond = 0, $newp$0 = 0, $notlhs = 0;
+ var $notrhs = 0, $or$cond$not = 0, $or$cond30 = 0, $storemerge = 0, $storemerge21 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = ((($p)) + 4|0);
+ $1 = HEAP32[$0>>2]|0;
+ $2 = $1 & -8;
+ $3 = (($p) + ($2)|0);
+ $4 = HEAP32[(6968)>>2]|0;
+ $5 = $1 & 3;
+ $notlhs = ($p>>>0)>=($4>>>0);
+ $notrhs = ($5|0)!=(1);
+ $or$cond$not = $notrhs & $notlhs;
+ $6 = ($p>>>0)<($3>>>0);
+ $or$cond30 = $or$cond$not & $6;
+ if (!($or$cond30)) {
+ _abort();
+ // unreachable;
+ }
+ $$sum2728 = $2 | 4;
+ $7 = (($p) + ($$sum2728)|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = $8 & 1;
+ $10 = ($9|0)==(0);
+ if ($10) {
+ _abort();
+ // unreachable;
+ }
+ $11 = ($5|0)==(0);
+ if ($11) {
+ $12 = ($nb>>>0)<(256);
+ if ($12) {
+ $newp$0 = 0;
+ return ($newp$0|0);
+ }
+ $13 = (($nb) + 4)|0;
+ $14 = ($2>>>0)<($13>>>0);
+ if (!($14)) {
+ $15 = (($2) - ($nb))|0;
+ $16 = HEAP32[(7432)>>2]|0;
+ $17 = $16 << 1;
+ $18 = ($15>>>0)>($17>>>0);
+ if (!($18)) {
+ $newp$0 = $p;
+ return ($newp$0|0);
+ }
+ }
+ $newp$0 = 0;
+ return ($newp$0|0);
+ }
+ $19 = ($2>>>0)<($nb>>>0);
+ if (!($19)) {
+ $20 = (($2) - ($nb))|0;
+ $21 = ($20>>>0)>(15);
+ if (!($21)) {
+ $newp$0 = $p;
+ return ($newp$0|0);
+ }
+ $22 = (($p) + ($nb)|0);
+ $23 = $1 & 1;
+ $24 = $23 | $nb;
+ $25 = $24 | 2;
+ HEAP32[$0>>2] = $25;
+ $$sum23 = (($nb) + 4)|0;
+ $26 = (($p) + ($$sum23)|0);
+ $27 = $20 | 3;
+ HEAP32[$26>>2] = $27;
+ $28 = HEAP32[$7>>2]|0;
+ $29 = $28 | 1;
+ HEAP32[$7>>2] = $29;
+ _dispose_chunk($22,$20);
+ $newp$0 = $p;
+ return ($newp$0|0);
+ }
+ $30 = HEAP32[(6976)>>2]|0;
+ $31 = ($3|0)==($30|0);
+ if ($31) {
+ $32 = HEAP32[(6964)>>2]|0;
+ $33 = (($32) + ($2))|0;
+ $34 = ($33>>>0)>($nb>>>0);
+ if (!($34)) {
+ $newp$0 = 0;
+ return ($newp$0|0);
+ }
+ $35 = (($33) - ($nb))|0;
+ $36 = (($p) + ($nb)|0);
+ $37 = $1 & 1;
+ $38 = $37 | $nb;
+ $39 = $38 | 2;
+ HEAP32[$0>>2] = $39;
+ $$sum22 = (($nb) + 4)|0;
+ $40 = (($p) + ($$sum22)|0);
+ $41 = $35 | 1;
+ HEAP32[$40>>2] = $41;
+ HEAP32[(6976)>>2] = $36;
+ HEAP32[(6964)>>2] = $35;
+ $newp$0 = $p;
+ return ($newp$0|0);
+ }
+ $42 = HEAP32[(6972)>>2]|0;
+ $43 = ($3|0)==($42|0);
+ if ($43) {
+ $44 = HEAP32[(6960)>>2]|0;
+ $45 = (($44) + ($2))|0;
+ $46 = ($45>>>0)<($nb>>>0);
+ if ($46) {
+ $newp$0 = 0;
+ return ($newp$0|0);
+ }
+ $47 = (($45) - ($nb))|0;
+ $48 = ($47>>>0)>(15);
+ if ($48) {
+ $49 = (($p) + ($nb)|0);
+ $50 = (($p) + ($45)|0);
+ $51 = $1 & 1;
+ $52 = $51 | $nb;
+ $53 = $52 | 2;
+ HEAP32[$0>>2] = $53;
+ $$sum19 = (($nb) + 4)|0;
+ $54 = (($p) + ($$sum19)|0);
+ $55 = $47 | 1;
+ HEAP32[$54>>2] = $55;
+ HEAP32[$50>>2] = $47;
+ $$sum20 = (($45) + 4)|0;
+ $56 = (($p) + ($$sum20)|0);
+ $57 = HEAP32[$56>>2]|0;
+ $58 = $57 & -2;
+ HEAP32[$56>>2] = $58;
+ $storemerge = $49;$storemerge21 = $47;
+ } else {
+ $59 = $1 & 1;
+ $60 = $59 | $45;
+ $61 = $60 | 2;
+ HEAP32[$0>>2] = $61;
+ $$sum17 = (($45) + 4)|0;
+ $62 = (($p) + ($$sum17)|0);
+ $63 = HEAP32[$62>>2]|0;
+ $64 = $63 | 1;
+ HEAP32[$62>>2] = $64;
+ $storemerge = 0;$storemerge21 = 0;
+ }
+ HEAP32[(6960)>>2] = $storemerge21;
+ HEAP32[(6972)>>2] = $storemerge;
+ $newp$0 = $p;
+ return ($newp$0|0);
+ }
+ $65 = $8 & 2;
+ $66 = ($65|0)==(0);
+ if (!($66)) {
+ $newp$0 = 0;
+ return ($newp$0|0);
+ }
+ $67 = $8 & -8;
+ $68 = (($67) + ($2))|0;
+ $69 = ($68>>>0)<($nb>>>0);
+ if ($69) {
+ $newp$0 = 0;
+ return ($newp$0|0);
+ }
+ $70 = (($68) - ($nb))|0;
+ $71 = $8 >>> 3;
+ $72 = ($8>>>0)<(256);
+ do {
+ if ($72) {
+ $$sum15 = (($2) + 8)|0;
+ $73 = (($p) + ($$sum15)|0);
+ $74 = HEAP32[$73>>2]|0;
+ $$sum16 = (($2) + 12)|0;
+ $75 = (($p) + ($$sum16)|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = $71 << 1;
+ $78 = (6992 + ($77<<2)|0);
+ $79 = ($74|0)==($78|0);
+ if (!($79)) {
+ $80 = ($74>>>0)<($4>>>0);
+ if ($80) {
+ _abort();
+ // unreachable;
+ }
+ $81 = ((($74)) + 12|0);
+ $82 = HEAP32[$81>>2]|0;
+ $83 = ($82|0)==($3|0);
+ if (!($83)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $84 = ($76|0)==($74|0);
+ if ($84) {
+ $85 = 1 << $71;
+ $86 = $85 ^ -1;
+ $87 = HEAP32[6952>>2]|0;
+ $88 = $87 & $86;
+ HEAP32[6952>>2] = $88;
+ break;
+ }
+ $89 = ($76|0)==($78|0);
+ if ($89) {
+ $$pre = ((($76)) + 8|0);
+ $$pre$phiZ2D = $$pre;
+ } else {
+ $90 = ($76>>>0)<($4>>>0);
+ if ($90) {
+ _abort();
+ // unreachable;
+ }
+ $91 = ((($76)) + 8|0);
+ $92 = HEAP32[$91>>2]|0;
+ $93 = ($92|0)==($3|0);
+ if ($93) {
+ $$pre$phiZ2D = $91;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $94 = ((($74)) + 12|0);
+ HEAP32[$94>>2] = $76;
+ HEAP32[$$pre$phiZ2D>>2] = $74;
+ } else {
+ $$sum = (($2) + 24)|0;
+ $95 = (($p) + ($$sum)|0);
+ $96 = HEAP32[$95>>2]|0;
+ $$sum2 = (($2) + 12)|0;
+ $97 = (($p) + ($$sum2)|0);
+ $98 = HEAP32[$97>>2]|0;
+ $99 = ($98|0)==($3|0);
+ do {
+ if ($99) {
+ $$sum4 = (($2) + 20)|0;
+ $109 = (($p) + ($$sum4)|0);
+ $110 = HEAP32[$109>>2]|0;
+ $111 = ($110|0)==(0|0);
+ if ($111) {
+ $$sum3 = (($2) + 16)|0;
+ $112 = (($p) + ($$sum3)|0);
+ $113 = HEAP32[$112>>2]|0;
+ $114 = ($113|0)==(0|0);
+ if ($114) {
+ $R$1 = 0;
+ break;
+ } else {
+ $R$0 = $113;$RP$0 = $112;
+ }
+ } else {
+ $R$0 = $110;$RP$0 = $109;
+ }
+ while(1) {
+ $115 = ((($R$0)) + 20|0);
+ $116 = HEAP32[$115>>2]|0;
+ $117 = ($116|0)==(0|0);
+ if (!($117)) {
+ $R$0 = $116;$RP$0 = $115;
+ continue;
+ }
+ $118 = ((($R$0)) + 16|0);
+ $119 = HEAP32[$118>>2]|0;
+ $120 = ($119|0)==(0|0);
+ if ($120) {
+ $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0;
+ break;
+ } else {
+ $R$0 = $119;$RP$0 = $118;
+ }
+ }
+ $121 = ($RP$0$lcssa>>>0)<($4>>>0);
+ if ($121) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP$0$lcssa>>2] = 0;
+ $R$1 = $R$0$lcssa;
+ break;
+ }
+ } else {
+ $$sum14 = (($2) + 8)|0;
+ $100 = (($p) + ($$sum14)|0);
+ $101 = HEAP32[$100>>2]|0;
+ $102 = ($101>>>0)<($4>>>0);
+ if ($102) {
+ _abort();
+ // unreachable;
+ }
+ $103 = ((($101)) + 12|0);
+ $104 = HEAP32[$103>>2]|0;
+ $105 = ($104|0)==($3|0);
+ if (!($105)) {
+ _abort();
+ // unreachable;
+ }
+ $106 = ((($98)) + 8|0);
+ $107 = HEAP32[$106>>2]|0;
+ $108 = ($107|0)==($3|0);
+ if ($108) {
+ HEAP32[$103>>2] = $98;
+ HEAP32[$106>>2] = $101;
+ $R$1 = $98;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $122 = ($96|0)==(0|0);
+ if (!($122)) {
+ $$sum11 = (($2) + 28)|0;
+ $123 = (($p) + ($$sum11)|0);
+ $124 = HEAP32[$123>>2]|0;
+ $125 = (7256 + ($124<<2)|0);
+ $126 = HEAP32[$125>>2]|0;
+ $127 = ($3|0)==($126|0);
+ if ($127) {
+ HEAP32[$125>>2] = $R$1;
+ $cond = ($R$1|0)==(0|0);
+ if ($cond) {
+ $128 = 1 << $124;
+ $129 = $128 ^ -1;
+ $130 = HEAP32[(6956)>>2]|0;
+ $131 = $130 & $129;
+ HEAP32[(6956)>>2] = $131;
+ break;
+ }
+ } else {
+ $132 = HEAP32[(6968)>>2]|0;
+ $133 = ($96>>>0)<($132>>>0);
+ if ($133) {
+ _abort();
+ // unreachable;
+ }
+ $134 = ((($96)) + 16|0);
+ $135 = HEAP32[$134>>2]|0;
+ $136 = ($135|0)==($3|0);
+ if ($136) {
+ HEAP32[$134>>2] = $R$1;
+ } else {
+ $137 = ((($96)) + 20|0);
+ HEAP32[$137>>2] = $R$1;
+ }
+ $138 = ($R$1|0)==(0|0);
+ if ($138) {
+ break;
+ }
+ }
+ $139 = HEAP32[(6968)>>2]|0;
+ $140 = ($R$1>>>0)<($139>>>0);
+ if ($140) {
+ _abort();
+ // unreachable;
+ }
+ $141 = ((($R$1)) + 24|0);
+ HEAP32[$141>>2] = $96;
+ $$sum12 = (($2) + 16)|0;
+ $142 = (($p) + ($$sum12)|0);
+ $143 = HEAP32[$142>>2]|0;
+ $144 = ($143|0)==(0|0);
+ do {
+ if (!($144)) {
+ $145 = ($143>>>0)<($139>>>0);
+ if ($145) {
+ _abort();
+ // unreachable;
+ } else {
+ $146 = ((($R$1)) + 16|0);
+ HEAP32[$146>>2] = $143;
+ $147 = ((($143)) + 24|0);
+ HEAP32[$147>>2] = $R$1;
+ break;
+ }
+ }
+ } while(0);
+ $$sum13 = (($2) + 20)|0;
+ $148 = (($p) + ($$sum13)|0);
+ $149 = HEAP32[$148>>2]|0;
+ $150 = ($149|0)==(0|0);
+ if (!($150)) {
+ $151 = HEAP32[(6968)>>2]|0;
+ $152 = ($149>>>0)<($151>>>0);
+ if ($152) {
+ _abort();
+ // unreachable;
+ } else {
+ $153 = ((($R$1)) + 20|0);
+ HEAP32[$153>>2] = $149;
+ $154 = ((($149)) + 24|0);
+ HEAP32[$154>>2] = $R$1;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $155 = ($70>>>0)<(16);
+ if ($155) {
+ $156 = $1 & 1;
+ $157 = $68 | $156;
+ $158 = $157 | 2;
+ HEAP32[$0>>2] = $158;
+ $$sum910 = $68 | 4;
+ $159 = (($p) + ($$sum910)|0);
+ $160 = HEAP32[$159>>2]|0;
+ $161 = $160 | 1;
+ HEAP32[$159>>2] = $161;
+ $newp$0 = $p;
+ return ($newp$0|0);
+ } else {
+ $162 = (($p) + ($nb)|0);
+ $163 = $1 & 1;
+ $164 = $163 | $nb;
+ $165 = $164 | 2;
+ HEAP32[$0>>2] = $165;
+ $$sum5 = (($nb) + 4)|0;
+ $166 = (($p) + ($$sum5)|0);
+ $167 = $70 | 3;
+ HEAP32[$166>>2] = $167;
+ $$sum78 = $68 | 4;
+ $168 = (($p) + ($$sum78)|0);
+ $169 = HEAP32[$168>>2]|0;
+ $170 = $169 | 1;
+ HEAP32[$168>>2] = $170;
+ _dispose_chunk($162,$70);
+ $newp$0 = $p;
+ return ($newp$0|0);
+ }
+ return (0)|0;
+}
+function _dispose_chunk($p,$psize) {
+ $p = $p|0;
+ $psize = $psize|0;
+ var $$0 = 0, $$02 = 0, $$1 = 0, $$lcssa = 0, $$pre = 0, $$pre$phi50Z2D = 0, $$pre$phi52Z2D = 0, $$pre$phiZ2D = 0, $$pre48 = 0, $$pre49 = 0, $$pre51 = 0, $$sum = 0, $$sum1 = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum16 = 0, $$sum17 = 0;
+ var $$sum18 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0;
+ var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
+ var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
+ var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0;
+ var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
+ var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
+ var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0;
+ var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0;
+ var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0;
+ var $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0;
+ var $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0;
+ var $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0;
+ var $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
+ var $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I19$0 = 0, $K20$043 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$042 = 0, $T$042$lcssa = 0, $cond = 0;
+ var $cond39 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (($p) + ($psize)|0);
+ $1 = ((($p)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = $2 & 1;
+ $4 = ($3|0)==(0);
+ do {
+ if ($4) {
+ $5 = HEAP32[$p>>2]|0;
+ $6 = $2 & 3;
+ $7 = ($6|0)==(0);
+ if ($7) {
+ return;
+ }
+ $8 = (0 - ($5))|0;
+ $9 = (($p) + ($8)|0);
+ $10 = (($5) + ($psize))|0;
+ $11 = HEAP32[(6968)>>2]|0;
+ $12 = ($9>>>0)<($11>>>0);
+ if ($12) {
+ _abort();
+ // unreachable;
+ }
+ $13 = HEAP32[(6972)>>2]|0;
+ $14 = ($9|0)==($13|0);
+ if ($14) {
+ $$sum = (($psize) + 4)|0;
+ $99 = (($p) + ($$sum)|0);
+ $100 = HEAP32[$99>>2]|0;
+ $101 = $100 & 3;
+ $102 = ($101|0)==(3);
+ if (!($102)) {
+ $$0 = $9;$$02 = $10;
+ break;
+ }
+ HEAP32[(6960)>>2] = $10;
+ $103 = $100 & -2;
+ HEAP32[$99>>2] = $103;
+ $104 = $10 | 1;
+ $$sum14 = (4 - ($5))|0;
+ $105 = (($p) + ($$sum14)|0);
+ HEAP32[$105>>2] = $104;
+ HEAP32[$0>>2] = $10;
+ return;
+ }
+ $15 = $5 >>> 3;
+ $16 = ($5>>>0)<(256);
+ if ($16) {
+ $$sum24 = (8 - ($5))|0;
+ $17 = (($p) + ($$sum24)|0);
+ $18 = HEAP32[$17>>2]|0;
+ $$sum25 = (12 - ($5))|0;
+ $19 = (($p) + ($$sum25)|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = $15 << 1;
+ $22 = (6992 + ($21<<2)|0);
+ $23 = ($18|0)==($22|0);
+ if (!($23)) {
+ $24 = ($18>>>0)<($11>>>0);
+ if ($24) {
+ _abort();
+ // unreachable;
+ }
+ $25 = ((($18)) + 12|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($26|0)==($9|0);
+ if (!($27)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $28 = ($20|0)==($18|0);
+ if ($28) {
+ $29 = 1 << $15;
+ $30 = $29 ^ -1;
+ $31 = HEAP32[6952>>2]|0;
+ $32 = $31 & $30;
+ HEAP32[6952>>2] = $32;
+ $$0 = $9;$$02 = $10;
+ break;
+ }
+ $33 = ($20|0)==($22|0);
+ if ($33) {
+ $$pre51 = ((($20)) + 8|0);
+ $$pre$phi52Z2D = $$pre51;
+ } else {
+ $34 = ($20>>>0)<($11>>>0);
+ if ($34) {
+ _abort();
+ // unreachable;
+ }
+ $35 = ((($20)) + 8|0);
+ $36 = HEAP32[$35>>2]|0;
+ $37 = ($36|0)==($9|0);
+ if ($37) {
+ $$pre$phi52Z2D = $35;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $38 = ((($18)) + 12|0);
+ HEAP32[$38>>2] = $20;
+ HEAP32[$$pre$phi52Z2D>>2] = $18;
+ $$0 = $9;$$02 = $10;
+ break;
+ }
+ $$sum16 = (24 - ($5))|0;
+ $39 = (($p) + ($$sum16)|0);
+ $40 = HEAP32[$39>>2]|0;
+ $$sum17 = (12 - ($5))|0;
+ $41 = (($p) + ($$sum17)|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = ($42|0)==($9|0);
+ do {
+ if ($43) {
+ $$sum18 = (16 - ($5))|0;
+ $$sum19 = (($$sum18) + 4)|0;
+ $53 = (($p) + ($$sum19)|0);
+ $54 = HEAP32[$53>>2]|0;
+ $55 = ($54|0)==(0|0);
+ if ($55) {
+ $56 = (($p) + ($$sum18)|0);
+ $57 = HEAP32[$56>>2]|0;
+ $58 = ($57|0)==(0|0);
+ if ($58) {
+ $R$1 = 0;
+ break;
+ } else {
+ $R$0 = $57;$RP$0 = $56;
+ }
+ } else {
+ $R$0 = $54;$RP$0 = $53;
+ }
+ while(1) {
+ $59 = ((($R$0)) + 20|0);
+ $60 = HEAP32[$59>>2]|0;
+ $61 = ($60|0)==(0|0);
+ if (!($61)) {
+ $R$0 = $60;$RP$0 = $59;
+ continue;
+ }
+ $62 = ((($R$0)) + 16|0);
+ $63 = HEAP32[$62>>2]|0;
+ $64 = ($63|0)==(0|0);
+ if ($64) {
+ $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0;
+ break;
+ } else {
+ $R$0 = $63;$RP$0 = $62;
+ }
+ }
+ $65 = ($RP$0$lcssa>>>0)<($11>>>0);
+ if ($65) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP$0$lcssa>>2] = 0;
+ $R$1 = $R$0$lcssa;
+ break;
+ }
+ } else {
+ $$sum23 = (8 - ($5))|0;
+ $44 = (($p) + ($$sum23)|0);
+ $45 = HEAP32[$44>>2]|0;
+ $46 = ($45>>>0)<($11>>>0);
+ if ($46) {
+ _abort();
+ // unreachable;
+ }
+ $47 = ((($45)) + 12|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = ($48|0)==($9|0);
+ if (!($49)) {
+ _abort();
+ // unreachable;
+ }
+ $50 = ((($42)) + 8|0);
+ $51 = HEAP32[$50>>2]|0;
+ $52 = ($51|0)==($9|0);
+ if ($52) {
+ HEAP32[$47>>2] = $42;
+ HEAP32[$50>>2] = $45;
+ $R$1 = $42;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $66 = ($40|0)==(0|0);
+ if ($66) {
+ $$0 = $9;$$02 = $10;
+ } else {
+ $$sum20 = (28 - ($5))|0;
+ $67 = (($p) + ($$sum20)|0);
+ $68 = HEAP32[$67>>2]|0;
+ $69 = (7256 + ($68<<2)|0);
+ $70 = HEAP32[$69>>2]|0;
+ $71 = ($9|0)==($70|0);
+ if ($71) {
+ HEAP32[$69>>2] = $R$1;
+ $cond = ($R$1|0)==(0|0);
+ if ($cond) {
+ $72 = 1 << $68;
+ $73 = $72 ^ -1;
+ $74 = HEAP32[(6956)>>2]|0;
+ $75 = $74 & $73;
+ HEAP32[(6956)>>2] = $75;
+ $$0 = $9;$$02 = $10;
+ break;
+ }
+ } else {
+ $76 = HEAP32[(6968)>>2]|0;
+ $77 = ($40>>>0)<($76>>>0);
+ if ($77) {
+ _abort();
+ // unreachable;
+ }
+ $78 = ((($40)) + 16|0);
+ $79 = HEAP32[$78>>2]|0;
+ $80 = ($79|0)==($9|0);
+ if ($80) {
+ HEAP32[$78>>2] = $R$1;
+ } else {
+ $81 = ((($40)) + 20|0);
+ HEAP32[$81>>2] = $R$1;
+ }
+ $82 = ($R$1|0)==(0|0);
+ if ($82) {
+ $$0 = $9;$$02 = $10;
+ break;
+ }
+ }
+ $83 = HEAP32[(6968)>>2]|0;
+ $84 = ($R$1>>>0)<($83>>>0);
+ if ($84) {
+ _abort();
+ // unreachable;
+ }
+ $85 = ((($R$1)) + 24|0);
+ HEAP32[$85>>2] = $40;
+ $$sum21 = (16 - ($5))|0;
+ $86 = (($p) + ($$sum21)|0);
+ $87 = HEAP32[$86>>2]|0;
+ $88 = ($87|0)==(0|0);
+ do {
+ if (!($88)) {
+ $89 = ($87>>>0)<($83>>>0);
+ if ($89) {
+ _abort();
+ // unreachable;
+ } else {
+ $90 = ((($R$1)) + 16|0);
+ HEAP32[$90>>2] = $87;
+ $91 = ((($87)) + 24|0);
+ HEAP32[$91>>2] = $R$1;
+ break;
+ }
+ }
+ } while(0);
+ $$sum22 = (($$sum21) + 4)|0;
+ $92 = (($p) + ($$sum22)|0);
+ $93 = HEAP32[$92>>2]|0;
+ $94 = ($93|0)==(0|0);
+ if ($94) {
+ $$0 = $9;$$02 = $10;
+ } else {
+ $95 = HEAP32[(6968)>>2]|0;
+ $96 = ($93>>>0)<($95>>>0);
+ if ($96) {
+ _abort();
+ // unreachable;
+ } else {
+ $97 = ((($R$1)) + 20|0);
+ HEAP32[$97>>2] = $93;
+ $98 = ((($93)) + 24|0);
+ HEAP32[$98>>2] = $R$1;
+ $$0 = $9;$$02 = $10;
+ break;
+ }
+ }
+ }
+ } else {
+ $$0 = $p;$$02 = $psize;
+ }
+ } while(0);
+ $106 = HEAP32[(6968)>>2]|0;
+ $107 = ($0>>>0)<($106>>>0);
+ if ($107) {
+ _abort();
+ // unreachable;
+ }
+ $$sum1 = (($psize) + 4)|0;
+ $108 = (($p) + ($$sum1)|0);
+ $109 = HEAP32[$108>>2]|0;
+ $110 = $109 & 2;
+ $111 = ($110|0)==(0);
+ if ($111) {
+ $112 = HEAP32[(6976)>>2]|0;
+ $113 = ($0|0)==($112|0);
+ if ($113) {
+ $114 = HEAP32[(6964)>>2]|0;
+ $115 = (($114) + ($$02))|0;
+ HEAP32[(6964)>>2] = $115;
+ HEAP32[(6976)>>2] = $$0;
+ $116 = $115 | 1;
+ $117 = ((($$0)) + 4|0);
+ HEAP32[$117>>2] = $116;
+ $118 = HEAP32[(6972)>>2]|0;
+ $119 = ($$0|0)==($118|0);
+ if (!($119)) {
+ return;
+ }
+ HEAP32[(6972)>>2] = 0;
+ HEAP32[(6960)>>2] = 0;
+ return;
+ }
+ $120 = HEAP32[(6972)>>2]|0;
+ $121 = ($0|0)==($120|0);
+ if ($121) {
+ $122 = HEAP32[(6960)>>2]|0;
+ $123 = (($122) + ($$02))|0;
+ HEAP32[(6960)>>2] = $123;
+ HEAP32[(6972)>>2] = $$0;
+ $124 = $123 | 1;
+ $125 = ((($$0)) + 4|0);
+ HEAP32[$125>>2] = $124;
+ $126 = (($$0) + ($123)|0);
+ HEAP32[$126>>2] = $123;
+ return;
+ }
+ $127 = $109 & -8;
+ $128 = (($127) + ($$02))|0;
+ $129 = $109 >>> 3;
+ $130 = ($109>>>0)<(256);
+ do {
+ if ($130) {
+ $$sum12 = (($psize) + 8)|0;
+ $131 = (($p) + ($$sum12)|0);
+ $132 = HEAP32[$131>>2]|0;
+ $$sum13 = (($psize) + 12)|0;
+ $133 = (($p) + ($$sum13)|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = $129 << 1;
+ $136 = (6992 + ($135<<2)|0);
+ $137 = ($132|0)==($136|0);
+ if (!($137)) {
+ $138 = ($132>>>0)<($106>>>0);
+ if ($138) {
+ _abort();
+ // unreachable;
+ }
+ $139 = ((($132)) + 12|0);
+ $140 = HEAP32[$139>>2]|0;
+ $141 = ($140|0)==($0|0);
+ if (!($141)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $142 = ($134|0)==($132|0);
+ if ($142) {
+ $143 = 1 << $129;
+ $144 = $143 ^ -1;
+ $145 = HEAP32[6952>>2]|0;
+ $146 = $145 & $144;
+ HEAP32[6952>>2] = $146;
+ break;
+ }
+ $147 = ($134|0)==($136|0);
+ if ($147) {
+ $$pre49 = ((($134)) + 8|0);
+ $$pre$phi50Z2D = $$pre49;
+ } else {
+ $148 = ($134>>>0)<($106>>>0);
+ if ($148) {
+ _abort();
+ // unreachable;
+ }
+ $149 = ((($134)) + 8|0);
+ $150 = HEAP32[$149>>2]|0;
+ $151 = ($150|0)==($0|0);
+ if ($151) {
+ $$pre$phi50Z2D = $149;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $152 = ((($132)) + 12|0);
+ HEAP32[$152>>2] = $134;
+ HEAP32[$$pre$phi50Z2D>>2] = $132;
+ } else {
+ $$sum2 = (($psize) + 24)|0;
+ $153 = (($p) + ($$sum2)|0);
+ $154 = HEAP32[$153>>2]|0;
+ $$sum3 = (($psize) + 12)|0;
+ $155 = (($p) + ($$sum3)|0);
+ $156 = HEAP32[$155>>2]|0;
+ $157 = ($156|0)==($0|0);
+ do {
+ if ($157) {
+ $$sum5 = (($psize) + 20)|0;
+ $167 = (($p) + ($$sum5)|0);
+ $168 = HEAP32[$167>>2]|0;
+ $169 = ($168|0)==(0|0);
+ if ($169) {
+ $$sum4 = (($psize) + 16)|0;
+ $170 = (($p) + ($$sum4)|0);
+ $171 = HEAP32[$170>>2]|0;
+ $172 = ($171|0)==(0|0);
+ if ($172) {
+ $R7$1 = 0;
+ break;
+ } else {
+ $R7$0 = $171;$RP9$0 = $170;
+ }
+ } else {
+ $R7$0 = $168;$RP9$0 = $167;
+ }
+ while(1) {
+ $173 = ((($R7$0)) + 20|0);
+ $174 = HEAP32[$173>>2]|0;
+ $175 = ($174|0)==(0|0);
+ if (!($175)) {
+ $R7$0 = $174;$RP9$0 = $173;
+ continue;
+ }
+ $176 = ((($R7$0)) + 16|0);
+ $177 = HEAP32[$176>>2]|0;
+ $178 = ($177|0)==(0|0);
+ if ($178) {
+ $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0;
+ break;
+ } else {
+ $R7$0 = $177;$RP9$0 = $176;
+ }
+ }
+ $179 = ($RP9$0$lcssa>>>0)<($106>>>0);
+ if ($179) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$RP9$0$lcssa>>2] = 0;
+ $R7$1 = $R7$0$lcssa;
+ break;
+ }
+ } else {
+ $$sum11 = (($psize) + 8)|0;
+ $158 = (($p) + ($$sum11)|0);
+ $159 = HEAP32[$158>>2]|0;
+ $160 = ($159>>>0)<($106>>>0);
+ if ($160) {
+ _abort();
+ // unreachable;
+ }
+ $161 = ((($159)) + 12|0);
+ $162 = HEAP32[$161>>2]|0;
+ $163 = ($162|0)==($0|0);
+ if (!($163)) {
+ _abort();
+ // unreachable;
+ }
+ $164 = ((($156)) + 8|0);
+ $165 = HEAP32[$164>>2]|0;
+ $166 = ($165|0)==($0|0);
+ if ($166) {
+ HEAP32[$161>>2] = $156;
+ HEAP32[$164>>2] = $159;
+ $R7$1 = $156;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $180 = ($154|0)==(0|0);
+ if (!($180)) {
+ $$sum8 = (($psize) + 28)|0;
+ $181 = (($p) + ($$sum8)|0);
+ $182 = HEAP32[$181>>2]|0;
+ $183 = (7256 + ($182<<2)|0);
+ $184 = HEAP32[$183>>2]|0;
+ $185 = ($0|0)==($184|0);
+ if ($185) {
+ HEAP32[$183>>2] = $R7$1;
+ $cond39 = ($R7$1|0)==(0|0);
+ if ($cond39) {
+ $186 = 1 << $182;
+ $187 = $186 ^ -1;
+ $188 = HEAP32[(6956)>>2]|0;
+ $189 = $188 & $187;
+ HEAP32[(6956)>>2] = $189;
+ break;
+ }
+ } else {
+ $190 = HEAP32[(6968)>>2]|0;
+ $191 = ($154>>>0)<($190>>>0);
+ if ($191) {
+ _abort();
+ // unreachable;
+ }
+ $192 = ((($154)) + 16|0);
+ $193 = HEAP32[$192>>2]|0;
+ $194 = ($193|0)==($0|0);
+ if ($194) {
+ HEAP32[$192>>2] = $R7$1;
+ } else {
+ $195 = ((($154)) + 20|0);
+ HEAP32[$195>>2] = $R7$1;
+ }
+ $196 = ($R7$1|0)==(0|0);
+ if ($196) {
+ break;
+ }
+ }
+ $197 = HEAP32[(6968)>>2]|0;
+ $198 = ($R7$1>>>0)<($197>>>0);
+ if ($198) {
+ _abort();
+ // unreachable;
+ }
+ $199 = ((($R7$1)) + 24|0);
+ HEAP32[$199>>2] = $154;
+ $$sum9 = (($psize) + 16)|0;
+ $200 = (($p) + ($$sum9)|0);
+ $201 = HEAP32[$200>>2]|0;
+ $202 = ($201|0)==(0|0);
+ do {
+ if (!($202)) {
+ $203 = ($201>>>0)<($197>>>0);
+ if ($203) {
+ _abort();
+ // unreachable;
+ } else {
+ $204 = ((($R7$1)) + 16|0);
+ HEAP32[$204>>2] = $201;
+ $205 = ((($201)) + 24|0);
+ HEAP32[$205>>2] = $R7$1;
+ break;
+ }
+ }
+ } while(0);
+ $$sum10 = (($psize) + 20)|0;
+ $206 = (($p) + ($$sum10)|0);
+ $207 = HEAP32[$206>>2]|0;
+ $208 = ($207|0)==(0|0);
+ if (!($208)) {
+ $209 = HEAP32[(6968)>>2]|0;
+ $210 = ($207>>>0)<($209>>>0);
+ if ($210) {
+ _abort();
+ // unreachable;
+ } else {
+ $211 = ((($R7$1)) + 20|0);
+ HEAP32[$211>>2] = $207;
+ $212 = ((($207)) + 24|0);
+ HEAP32[$212>>2] = $R7$1;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $213 = $128 | 1;
+ $214 = ((($$0)) + 4|0);
+ HEAP32[$214>>2] = $213;
+ $215 = (($$0) + ($128)|0);
+ HEAP32[$215>>2] = $128;
+ $216 = HEAP32[(6972)>>2]|0;
+ $217 = ($$0|0)==($216|0);
+ if ($217) {
+ HEAP32[(6960)>>2] = $128;
+ return;
+ } else {
+ $$1 = $128;
+ }
+ } else {
+ $218 = $109 & -2;
+ HEAP32[$108>>2] = $218;
+ $219 = $$02 | 1;
+ $220 = ((($$0)) + 4|0);
+ HEAP32[$220>>2] = $219;
+ $221 = (($$0) + ($$02)|0);
+ HEAP32[$221>>2] = $$02;
+ $$1 = $$02;
+ }
+ $222 = $$1 >>> 3;
+ $223 = ($$1>>>0)<(256);
+ if ($223) {
+ $224 = $222 << 1;
+ $225 = (6992 + ($224<<2)|0);
+ $226 = HEAP32[6952>>2]|0;
+ $227 = 1 << $222;
+ $228 = $226 & $227;
+ $229 = ($228|0)==(0);
+ if ($229) {
+ $230 = $226 | $227;
+ HEAP32[6952>>2] = $230;
+ $$pre = (($224) + 2)|0;
+ $$pre48 = (6992 + ($$pre<<2)|0);
+ $$pre$phiZ2D = $$pre48;$F16$0 = $225;
+ } else {
+ $$sum7 = (($224) + 2)|0;
+ $231 = (6992 + ($$sum7<<2)|0);
+ $232 = HEAP32[$231>>2]|0;
+ $233 = HEAP32[(6968)>>2]|0;
+ $234 = ($232>>>0)<($233>>>0);
+ if ($234) {
+ _abort();
+ // unreachable;
+ } else {
+ $$pre$phiZ2D = $231;$F16$0 = $232;
+ }
+ }
+ HEAP32[$$pre$phiZ2D>>2] = $$0;
+ $235 = ((($F16$0)) + 12|0);
+ HEAP32[$235>>2] = $$0;
+ $236 = ((($$0)) + 8|0);
+ HEAP32[$236>>2] = $F16$0;
+ $237 = ((($$0)) + 12|0);
+ HEAP32[$237>>2] = $225;
+ return;
+ }
+ $238 = $$1 >>> 8;
+ $239 = ($238|0)==(0);
+ if ($239) {
+ $I19$0 = 0;
+ } else {
+ $240 = ($$1>>>0)>(16777215);
+ if ($240) {
+ $I19$0 = 31;
+ } else {
+ $241 = (($238) + 1048320)|0;
+ $242 = $241 >>> 16;
+ $243 = $242 & 8;
+ $244 = $238 << $243;
+ $245 = (($244) + 520192)|0;
+ $246 = $245 >>> 16;
+ $247 = $246 & 4;
+ $248 = $247 | $243;
+ $249 = $244 << $247;
+ $250 = (($249) + 245760)|0;
+ $251 = $250 >>> 16;
+ $252 = $251 & 2;
+ $253 = $248 | $252;
+ $254 = (14 - ($253))|0;
+ $255 = $249 << $252;
+ $256 = $255 >>> 15;
+ $257 = (($254) + ($256))|0;
+ $258 = $257 << 1;
+ $259 = (($257) + 7)|0;
+ $260 = $$1 >>> $259;
+ $261 = $260 & 1;
+ $262 = $261 | $258;
+ $I19$0 = $262;
+ }
+ }
+ $263 = (7256 + ($I19$0<<2)|0);
+ $264 = ((($$0)) + 28|0);
+ HEAP32[$264>>2] = $I19$0;
+ $265 = ((($$0)) + 16|0);
+ $266 = ((($$0)) + 20|0);
+ HEAP32[$266>>2] = 0;
+ HEAP32[$265>>2] = 0;
+ $267 = HEAP32[(6956)>>2]|0;
+ $268 = 1 << $I19$0;
+ $269 = $267 & $268;
+ $270 = ($269|0)==(0);
+ if ($270) {
+ $271 = $267 | $268;
+ HEAP32[(6956)>>2] = $271;
+ HEAP32[$263>>2] = $$0;
+ $272 = ((($$0)) + 24|0);
+ HEAP32[$272>>2] = $263;
+ $273 = ((($$0)) + 12|0);
+ HEAP32[$273>>2] = $$0;
+ $274 = ((($$0)) + 8|0);
+ HEAP32[$274>>2] = $$0;
+ return;
+ }
+ $275 = HEAP32[$263>>2]|0;
+ $276 = ((($275)) + 4|0);
+ $277 = HEAP32[$276>>2]|0;
+ $278 = $277 & -8;
+ $279 = ($278|0)==($$1|0);
+ L191: do {
+ if ($279) {
+ $T$0$lcssa = $275;
+ } else {
+ $280 = ($I19$0|0)==(31);
+ $281 = $I19$0 >>> 1;
+ $282 = (25 - ($281))|0;
+ $283 = $280 ? 0 : $282;
+ $284 = $$1 << $283;
+ $K20$043 = $284;$T$042 = $275;
+ while(1) {
+ $291 = $K20$043 >>> 31;
+ $292 = (((($T$042)) + 16|0) + ($291<<2)|0);
+ $287 = HEAP32[$292>>2]|0;
+ $293 = ($287|0)==(0|0);
+ if ($293) {
+ $$lcssa = $292;$T$042$lcssa = $T$042;
+ break;
+ }
+ $285 = $K20$043 << 1;
+ $286 = ((($287)) + 4|0);
+ $288 = HEAP32[$286>>2]|0;
+ $289 = $288 & -8;
+ $290 = ($289|0)==($$1|0);
+ if ($290) {
+ $T$0$lcssa = $287;
+ break L191;
+ } else {
+ $K20$043 = $285;$T$042 = $287;
+ }
+ }
+ $294 = HEAP32[(6968)>>2]|0;
+ $295 = ($$lcssa>>>0)<($294>>>0);
+ if ($295) {
+ _abort();
+ // unreachable;
+ }
+ HEAP32[$$lcssa>>2] = $$0;
+ $296 = ((($$0)) + 24|0);
+ HEAP32[$296>>2] = $T$042$lcssa;
+ $297 = ((($$0)) + 12|0);
+ HEAP32[$297>>2] = $$0;
+ $298 = ((($$0)) + 8|0);
+ HEAP32[$298>>2] = $$0;
+ return;
+ }
+ } while(0);
+ $299 = ((($T$0$lcssa)) + 8|0);
+ $300 = HEAP32[$299>>2]|0;
+ $301 = HEAP32[(6968)>>2]|0;
+ $302 = ($300>>>0)>=($301>>>0);
+ $not$ = ($T$0$lcssa>>>0)>=($301>>>0);
+ $303 = $302 & $not$;
+ if (!($303)) {
+ _abort();
+ // unreachable;
+ }
+ $304 = ((($300)) + 12|0);
+ HEAP32[$304>>2] = $$0;
+ HEAP32[$299>>2] = $$0;
+ $305 = ((($$0)) + 8|0);
+ HEAP32[$305>>2] = $300;
+ $306 = ((($$0)) + 12|0);
+ HEAP32[$306>>2] = $T$0$lcssa;
+ $307 = ((($$0)) + 24|0);
+ HEAP32[$307>>2] = 0;
+ return;
+}
+function runPostSets() {
+}
+function _memcpy(dest, src, num) {
+ dest = dest|0; src = src|0; num = num|0;
+ var ret = 0;
+ if ((num|0) >= 4096) return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
+ ret = dest|0;
+ if ((dest&3) == (src&3)) {
+ while (dest & 3) {
+ if ((num|0) == 0) return ret|0;
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ dest = (dest+1)|0;
+ src = (src+1)|0;
+ num = (num-1)|0;
+ }
+ while ((num|0) >= 4) {
+ HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
+ dest = (dest+4)|0;
+ src = (src+4)|0;
+ num = (num-4)|0;
+ }
+ }
+ while ((num|0) > 0) {
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ dest = (dest+1)|0;
+ src = (src+1)|0;
+ num = (num-1)|0;
+ }
+ return ret|0;
+}
+function _memset(ptr, value, num) {
+ ptr = ptr|0; value = value|0; num = num|0;
+ var stop = 0, value4 = 0, stop4 = 0, unaligned = 0;
+ stop = (ptr + num)|0;
+ if ((num|0) >= 20) {
+ // This is unaligned, but quite large, so work hard to get to aligned settings
+ value = value & 0xff;
+ unaligned = ptr & 3;
+ value4 = value | (value << 8) | (value << 16) | (value << 24);
+ stop4 = stop & ~3;
+ if (unaligned) {
+ unaligned = (ptr + 4 - unaligned)|0;
+ while ((ptr|0) < (unaligned|0)) { // no need to check for stop, since we have large num
+ HEAP8[((ptr)>>0)]=value;
+ ptr = (ptr+1)|0;
+ }
+ }
+ while ((ptr|0) < (stop4|0)) {
+ HEAP32[((ptr)>>2)]=value4;
+ ptr = (ptr+4)|0;
+ }
+ }
+ while ((ptr|0) < (stop|0)) {
+ HEAP8[((ptr)>>0)]=value;
+ ptr = (ptr+1)|0;
+ }
+ return (ptr-num)|0;
+}
+function _i64Subtract(a, b, c, d) {
+ a = a|0; b = b|0; c = c|0; d = d|0;
+ var l = 0, h = 0;
+ l = (a - c)>>>0;
+ h = (b - d)>>>0;
+ h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
+ return ((tempRet0 = h,l|0)|0);
+}
+function _i64Add(a, b, c, d) {
+ /*
+ x = a + b*2^32
+ y = c + d*2^32
+ result = l + h*2^32
+ */
+ a = a|0; b = b|0; c = c|0; d = d|0;
+ var l = 0, h = 0;
+ l = (a + c)>>>0;
+ h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
+ return ((tempRet0 = h,l|0)|0);
+}
+function _memmove(dest, src, num) {
+ dest = dest|0; src = src|0; num = num|0;
+ var ret = 0;
+ if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) {
+ // Unlikely case: Copy backwards in a safe manner
+ ret = dest;
+ src = (src + num)|0;
+ dest = (dest + num)|0;
+ while ((num|0) > 0) {
+ dest = (dest - 1)|0;
+ src = (src - 1)|0;
+ num = (num - 1)|0;
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ }
+ dest = ret;
+ } else {
+ _memcpy(dest, src, num) | 0;
+ }
+ return dest | 0;
+}
+function _bitshift64Lshr(low, high, bits) {
+ low = low|0; high = high|0; bits = bits|0;
+ var ander = 0;
+ if ((bits|0) < 32) {
+ ander = ((1 << bits) - 1)|0;
+ tempRet0 = high >>> bits;
+ return (low >>> bits) | ((high&ander) << (32 - bits));
+ }
+ tempRet0 = 0;
+ return (high >>> (bits - 32))|0;
+}
+function _bitshift64Shl(low, high, bits) {
+ low = low|0; high = high|0; bits = bits|0;
+ var ander = 0;
+ if ((bits|0) < 32) {
+ ander = ((1 << bits) - 1)|0;
+ tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
+ return low << bits;
+ }
+ tempRet0 = low << (bits - 32);
+ return 0;
+}
+function _bitshift64Ashr(low, high, bits) {
+ low = low|0; high = high|0; bits = bits|0;
+ var ander = 0;
+ if ((bits|0) < 32) {
+ ander = ((1 << bits) - 1)|0;
+ tempRet0 = high >> bits;
+ return (low >>> bits) | ((high&ander) << (32 - bits));
+ }
+ tempRet0 = (high|0) < 0 ? -1 : 0;
+ return (high >> (bits - 32))|0;
+ }
+function _llvm_cttz_i32(x) {
+ x = x|0;
+ var ret = 0;
+ ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
+ if ((ret|0) < 8) return ret|0;
+ ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
+ if ((ret|0) < 8) return (ret + 8)|0;
+ ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
+ if ((ret|0) < 8) return (ret + 16)|0;
+ return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
+ }
+
+// ======== compiled code from system/lib/compiler-rt , see readme therein
+function ___muldsi3($a, $b) {
+ $a = $a | 0;
+ $b = $b | 0;
+ var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
+ $1 = $a & 65535;
+ $2 = $b & 65535;
+ $3 = Math_imul($2, $1) | 0;
+ $6 = $a >>> 16;
+ $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
+ $11 = $b >>> 16;
+ $12 = Math_imul($11, $1) | 0;
+ return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
+}
+function ___divdi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $7$0 = 0, $7$1 = 0, $8$0 = 0, $10$0 = 0;
+ $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
+ $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
+ $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
+ $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
+ $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0;
+ $4$1 = tempRet0;
+ $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0;
+ $7$0 = $2$0 ^ $1$0;
+ $7$1 = $2$1 ^ $1$1;
+ $8$0 = ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, 0) | 0;
+ $10$0 = _i64Subtract($8$0 ^ $7$0, tempRet0 ^ $7$1, $7$0, $7$1) | 0;
+ return $10$0 | 0;
+}
+function ___remdi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $rem = 0, $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $10$0 = 0, $10$1 = 0, __stackBase__ = 0;
+ __stackBase__ = STACKTOP;
+ STACKTOP = STACKTOP + 16 | 0;
+ $rem = __stackBase__ | 0;
+ $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
+ $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1;
+ $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
+ $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1;
+ $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0;
+ $4$1 = tempRet0;
+ $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0;
+ ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, $rem) | 0;
+ $10$0 = _i64Subtract(HEAP32[$rem >> 2] ^ $1$0, HEAP32[$rem + 4 >> 2] ^ $1$1, $1$0, $1$1) | 0;
+ $10$1 = tempRet0;
+ STACKTOP = __stackBase__;
+ return (tempRet0 = $10$1, $10$0) | 0;
+}
+function ___muldi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
+ $x_sroa_0_0_extract_trunc = $a$0;
+ $y_sroa_0_0_extract_trunc = $b$0;
+ $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
+ $1$1 = tempRet0;
+ $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
+ return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
+}
+function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $1$0 = 0;
+ $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
+ return $1$0 | 0;
+}
+function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $rem = 0, __stackBase__ = 0;
+ __stackBase__ = STACKTOP;
+ STACKTOP = STACKTOP + 16 | 0;
+ $rem = __stackBase__ | 0;
+ ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
+ STACKTOP = __stackBase__;
+ return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
+}
+function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ $rem = $rem | 0;
+ var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
+ $n_sroa_0_0_extract_trunc = $a$0;
+ $n_sroa_1_4_extract_shift$0 = $a$1;
+ $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
+ $d_sroa_0_0_extract_trunc = $b$0;
+ $d_sroa_1_4_extract_shift$0 = $b$1;
+ $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
+ if (($n_sroa_1_4_extract_trunc | 0) == 0) {
+ $4 = ($rem | 0) != 0;
+ if (($d_sroa_1_4_extract_trunc | 0) == 0) {
+ if ($4) {
+ HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
+ HEAP32[$rem + 4 >> 2] = 0;
+ }
+ $_0$1 = 0;
+ $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ } else {
+ if (!$4) {
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ HEAP32[$rem >> 2] = $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $a$1 & 0;
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ }
+ $17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
+ do {
+ if (($d_sroa_0_0_extract_trunc | 0) == 0) {
+ if ($17) {
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
+ HEAP32[$rem + 4 >> 2] = 0;
+ }
+ $_0$1 = 0;
+ $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ if (($n_sroa_0_0_extract_trunc | 0) == 0) {
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = 0;
+ HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
+ }
+ $_0$1 = 0;
+ $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ $37 = $d_sroa_1_4_extract_trunc - 1 | 0;
+ if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = 0 | $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
+ }
+ $_0$1 = 0;
+ $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
+ $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
+ if ($51 >>> 0 <= 30) {
+ $57 = $51 + 1 | 0;
+ $58 = 31 - $51 | 0;
+ $sr_1_ph = $57;
+ $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
+ $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
+ $q_sroa_0_1_ph = 0;
+ $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
+ break;
+ }
+ if (($rem | 0) == 0) {
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ HEAP32[$rem >> 2] = 0 | $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ } else {
+ if (!$17) {
+ $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
+ $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
+ if ($119 >>> 0 <= 31) {
+ $125 = $119 + 1 | 0;
+ $126 = 31 - $119 | 0;
+ $130 = $119 - 31 >> 31;
+ $sr_1_ph = $125;
+ $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
+ $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
+ $q_sroa_0_1_ph = 0;
+ $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
+ break;
+ }
+ if (($rem | 0) == 0) {
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ HEAP32[$rem >> 2] = 0 | $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ $66 = $d_sroa_0_0_extract_trunc - 1 | 0;
+ if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
+ $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
+ $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
+ $89 = 64 - $88 | 0;
+ $91 = 32 - $88 | 0;
+ $92 = $91 >> 31;
+ $95 = $88 - 32 | 0;
+ $105 = $95 >> 31;
+ $sr_1_ph = $88;
+ $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
+ $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
+ $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
+ $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
+ break;
+ }
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
+ HEAP32[$rem + 4 >> 2] = 0;
+ }
+ if (($d_sroa_0_0_extract_trunc | 0) == 1) {
+ $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
+ $_0$0 = 0 | $a$0 & -1;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ } else {
+ $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
+ $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
+ $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ }
+ } while (0);
+ if (($sr_1_ph | 0) == 0) {
+ $q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
+ $q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
+ $r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
+ $r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
+ $carry_0_lcssa$1 = 0;
+ $carry_0_lcssa$0 = 0;
+ } else {
+ $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
+ $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
+ $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
+ $137$1 = tempRet0;
+ $q_sroa_1_1198 = $q_sroa_1_1_ph;
+ $q_sroa_0_1199 = $q_sroa_0_1_ph;
+ $r_sroa_1_1200 = $r_sroa_1_1_ph;
+ $r_sroa_0_1201 = $r_sroa_0_1_ph;
+ $sr_1202 = $sr_1_ph;
+ $carry_0203 = 0;
+ while (1) {
+ $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
+ $149 = $carry_0203 | $q_sroa_0_1199 << 1;
+ $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
+ $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
+ _i64Subtract($137$0, $137$1, $r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1) | 0;
+ $150$1 = tempRet0;
+ $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
+ $152 = $151$0 & 1;
+ $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1, $151$0 & $d_sroa_0_0_insert_insert99$0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1) | 0;
+ $r_sroa_0_0_extract_trunc = $154$0;
+ $r_sroa_1_4_extract_trunc = tempRet0;
+ $155 = $sr_1202 - 1 | 0;
+ if (($155 | 0) == 0) {
+ break;
+ } else {
+ $q_sroa_1_1198 = $147;
+ $q_sroa_0_1199 = $149;
+ $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
+ $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
+ $sr_1202 = $155;
+ $carry_0203 = $152;
+ }
+ }
+ $q_sroa_1_1_lcssa = $147;
+ $q_sroa_0_1_lcssa = $149;
+ $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
+ $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
+ $carry_0_lcssa$1 = 0;
+ $carry_0_lcssa$0 = $152;
+ }
+ $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
+ $q_sroa_0_0_insert_ext75$1 = 0;
+ $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
+ HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
+ }
+ $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
+ $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+}
+// =======================================================================
+
+
+
+
+function dynCall_viiiii(index,a1,a2,a3,a4,a5) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
+ FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0);
+}
+
+
+function dynCall_vd(index,a1) {
+ index = index|0;
+ a1=+a1;
+ FUNCTION_TABLE_vd[index&3](+a1);
+}
+
+
+function dynCall_vid(index,a1,a2) {
+ index = index|0;
+ a1=a1|0; a2=+a2;
+ FUNCTION_TABLE_vid[index&3](a1|0,+a2);
+}
+
+
+function dynCall_vi(index,a1) {
+ index = index|0;
+ a1=a1|0;
+ FUNCTION_TABLE_vi[index&31](a1|0);
+}
+
+
+function dynCall_vii(index,a1,a2) {
+ index = index|0;
+ a1=a1|0; a2=a2|0;
+ FUNCTION_TABLE_vii[index&63](a1|0,a2|0);
+}
+
+
+function dynCall_ii(index,a1) {
+ index = index|0;
+ a1=a1|0;
+ return FUNCTION_TABLE_ii[index&15](a1|0)|0;
+}
+
+
+function dynCall_viddd(index,a1,a2,a3,a4) {
+ index = index|0;
+ a1=a1|0; a2=+a2; a3=+a3; a4=+a4;
+ FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4);
+}
+
+
+function dynCall_vidd(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=+a2; a3=+a3;
+ FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3);
+}
+
+
+function dynCall_iiii(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0;
+ return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0;
+}
+
+
+function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0;
+ FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0);
+}
+
+
+function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0;
+ FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0);
+}
+
+
+function dynCall_viii(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0;
+ FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0);
+}
+
+
+function dynCall_vidddd(index,a1,a2,a3,a4,a5) {
+ index = index|0;
+ a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5;
+ FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5);
+}
+
+
+function dynCall_vdi(index,a1,a2) {
+ index = index|0;
+ a1=+a1; a2=a2|0;
+ FUNCTION_TABLE_vdi[index&1](+a1,a2|0);
+}
+
+
+function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0;
+ FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0);
+}
+
+
+function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0;
+ FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0);
+}
+
+
+function dynCall_iii(index,a1,a2) {
+ index = index|0;
+ a1=a1|0; a2=a2|0;
+ return FUNCTION_TABLE_iii[index&3](a1|0,a2|0)|0;
+}
+
+
+function dynCall_i(index) {
+ index = index|0;
+
+ return FUNCTION_TABLE_i[index&3]()|0;
+}
+
+
+function dynCall_iiiiii(index,a1,a2,a3,a4,a5) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
+ return FUNCTION_TABLE_iiiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0)|0;
+}
+
+
+function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) {
+ index = index|0;
+ a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6;
+ FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6);
+}
+
+
+function dynCall_vdddd(index,a1,a2,a3,a4) {
+ index = index|0;
+ a1=+a1; a2=+a2; a3=+a3; a4=+a4;
+ FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4);
+}
+
+
+function dynCall_vdd(index,a1,a2) {
+ index = index|0;
+ a1=+a1; a2=+a2;
+ FUNCTION_TABLE_vdd[index&3](+a1,+a2);
+}
+
+
+function dynCall_v(index) {
+ index = index|0;
+
+ FUNCTION_TABLE_v[index&7]();
+}
+
+
+function dynCall_viid(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=+a3;
+ FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3);
+}
+
+
+function dynCall_viiii(index,a1,a2,a3,a4) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0;
+ FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0);
+}
+
+function b0(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(0);
+}
+function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function b1(p0) {
+ p0 = +p0; abort(1);
+}
+function _emscripten_glClearDepth__wrapper(p0) {
+ p0 = +p0; _emscripten_glClearDepth(+p0);
+}
+function _emscripten_glClearDepthf__wrapper(p0) {
+ p0 = +p0; _emscripten_glClearDepthf(+p0);
+}
+function _emscripten_glLineWidth__wrapper(p0) {
+ p0 = +p0; _emscripten_glLineWidth(+p0);
+}
+function b2(p0,p1) {
+ p0 = p0|0;p1 = +p1; abort(2);
+}
+function _emscripten_glUniform1f__wrapper(p0,p1) {
+ p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1);
+}
+function _emscripten_glVertexAttrib1f__wrapper(p0,p1) {
+ p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1);
+}
+function b3(p0) {
+ p0 = p0|0; abort(3);
+}
+function _emscripten_glDeleteShader__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDeleteShader(p0|0);
+}
+function _emscripten_glCompileShader__wrapper(p0) {
+ p0 = p0|0; _emscripten_glCompileShader(p0|0);
+}
+function _emscripten_glDeleteProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDeleteProgram(p0|0);
+}
+function _emscripten_glLinkProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glLinkProgram(p0|0);
+}
+function _emscripten_glUseProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glUseProgram(p0|0);
+}
+function _emscripten_glValidateProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glValidateProgram(p0|0);
+}
+function _emscripten_glDeleteObjectARB__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0);
+}
+function _emscripten_glEnableClientState__wrapper(p0) {
+ p0 = p0|0; _emscripten_glEnableClientState(p0|0);
+}
+function _emscripten_glClientActiveTexture__wrapper(p0) {
+ p0 = p0|0; _emscripten_glClientActiveTexture(p0|0);
+}
+function _emscripten_glBindVertexArray__wrapper(p0) {
+ p0 = p0|0; _emscripten_glBindVertexArray(p0|0);
+}
+function _emscripten_glMatrixMode__wrapper(p0) {
+ p0 = p0|0; _emscripten_glMatrixMode(p0|0);
+}
+function _emscripten_glLoadMatrixf__wrapper(p0) {
+ p0 = p0|0; _emscripten_glLoadMatrixf(p0|0);
+}
+function _emscripten_glEnableVertexAttribArray__wrapper(p0) {
+ p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0);
+}
+function _emscripten_glDisableVertexAttribArray__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0);
+}
+function _emscripten_glDepthFunc__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDepthFunc(p0|0);
+}
+function _emscripten_glEnable__wrapper(p0) {
+ p0 = p0|0; _emscripten_glEnable(p0|0);
+}
+function _emscripten_glDisable__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDisable(p0|0);
+}
+function _emscripten_glFrontFace__wrapper(p0) {
+ p0 = p0|0; _emscripten_glFrontFace(p0|0);
+}
+function _emscripten_glCullFace__wrapper(p0) {
+ p0 = p0|0; _emscripten_glCullFace(p0|0);
+}
+function _emscripten_glClear__wrapper(p0) {
+ p0 = p0|0; _emscripten_glClear(p0|0);
+}
+function _emscripten_glClearStencil__wrapper(p0) {
+ p0 = p0|0; _emscripten_glClearStencil(p0|0);
+}
+function _emscripten_glDepthMask__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDepthMask(p0|0);
+}
+function _emscripten_glStencilMask__wrapper(p0) {
+ p0 = p0|0; _emscripten_glStencilMask(p0|0);
+}
+function _emscripten_glGenerateMipmap__wrapper(p0) {
+ p0 = p0|0; _emscripten_glGenerateMipmap(p0|0);
+}
+function _emscripten_glActiveTexture__wrapper(p0) {
+ p0 = p0|0; _emscripten_glActiveTexture(p0|0);
+}
+function _emscripten_glBlendEquation__wrapper(p0) {
+ p0 = p0|0; _emscripten_glBlendEquation(p0|0);
+}
+function b4(p0,p1) {
+ p0 = p0|0;p1 = p1|0; abort(4);
+}
+function _emscripten_glPixelStorei__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0);
+}
+function _emscripten_glGetIntegerv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0);
+}
+function _emscripten_glGetFloatv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0);
+}
+function _emscripten_glGetBooleanv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0);
+}
+function _emscripten_glGenTextures__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0);
+}
+function _emscripten_glDeleteTextures__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0);
+}
+function _emscripten_glBindTexture__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0);
+}
+function _emscripten_glGenBuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0);
+}
+function _emscripten_glDeleteBuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0);
+}
+function _emscripten_glGenRenderbuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0);
+}
+function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0);
+}
+function _emscripten_glBindRenderbuffer__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0);
+}
+function _emscripten_glUniform1i__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0);
+}
+function _emscripten_glBindBuffer__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0);
+}
+function _emscripten_glAttachShader__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0);
+}
+function _emscripten_glDetachShader__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0);
+}
+function _emscripten_glBindFramebuffer__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0);
+}
+function _emscripten_glGenFramebuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0);
+}
+function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0);
+}
+function _emscripten_glBindProgramARB__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0);
+}
+function _emscripten_glGetPointerv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0);
+}
+function _emscripten_glGenVertexArrays__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0);
+}
+function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0);
+}
+function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0);
+}
+function _emscripten_glBlendFunc__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0);
+}
+function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0);
+}
+function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0);
+}
+function _emscripten_glHint__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0);
+}
+function _emscripten_glDrawBuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0);
+}
+function b5(p0) {
+ p0 = p0|0; abort(5);return 0;
+}
+function _emscripten_glGetString__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glGetString(p0|0)|0;
+}
+function _emscripten_glIsTexture__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0;
+}
+function _emscripten_glIsBuffer__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0;
+}
+function _emscripten_glIsRenderbuffer__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0;
+}
+function _emscripten_glCreateShader__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0;
+}
+function _emscripten_glIsShader__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsShader(p0|0)|0;
+}
+function _emscripten_glIsProgram__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0;
+}
+function _emscripten_glIsFramebuffer__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0;
+}
+function _emscripten_glCheckFramebufferStatus__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0;
+}
+function _emscripten_glIsEnabled__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0;
+}
+function b6(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; abort(6);
+}
+function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3);
+}
+function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3);
+}
+function b7(p0,p1,p2) {
+ p0 = p0|0;p1 = +p1;p2 = +p2; abort(7);
+}
+function _emscripten_glUniform2f__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2);
+}
+function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2);
+}
+function b8(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(8);return 0;
+}
+function b9(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; abort(9);
+}
+function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
+}
+function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
+}
+function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
+}
+function b10(p0,p1,p2,p3,p4,p5) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; abort(10);
+}
+function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
+}
+function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
+}
+function b11(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(11);
+}
+function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform2i__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform1iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform2iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform3iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform4iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform1fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform2fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform3fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform4fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0);
+}
+function _emscripten_glNormalPointer__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0);
+}
+function _emscripten_glDrawArrays__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0);
+}
+function _emscripten_glTexParameteri__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0);
+}
+function _emscripten_glStencilFunc__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0);
+}
+function _emscripten_glStencilOp__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0);
+}
+function b12(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; abort(12);
+}
+function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4);
+}
+function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4);
+}
+function b13(p0,p1) {
+ p0 = +p0;p1 = p1|0; abort(13);
+}
+function _emscripten_glSampleCoverage__wrapper(p0,p1) {
+ p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0);
+}
+function b14(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; abort(14);
+}
+function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
+}
+function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
+}
+function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
+}
+function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; abort(15);
+}
+function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
+}
+function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
+}
+function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
+}
+function b16(p0,p1) {
+ p0 = p0|0;p1 = p1|0; abort(16);return 0;
+}
+function _emscripten_glGetUniformLocation__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0;
+}
+function _emscripten_glGetAttribLocation__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0;
+}
+function b17() {
+ ; abort(17);return 0;
+}
+function _emscripten_glCreateProgram__wrapper() {
+ ; return _emscripten_glCreateProgram()|0;
+}
+function _emscripten_glGetError__wrapper() {
+ ; return _emscripten_glGetError()|0;
+}
+function b18(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(18);return 0;
+}
+function b19(p0,p1,p2,p3,p4,p5) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; abort(19);
+}
+function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5);
+}
+function b20(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; abort(20);
+}
+function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3);
+}
+function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3);
+}
+function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3);
+}
+function b21(p0,p1) {
+ p0 = +p0;p1 = +p1; abort(21);
+}
+function _emscripten_glDepthRange__wrapper(p0,p1) {
+ p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1);
+}
+function _emscripten_glDepthRangef__wrapper(p0,p1) {
+ p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1);
+}
+function _emscripten_glPolygonOffset__wrapper(p0,p1) {
+ p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1);
+}
+function b22() {
+ ; abort(22);
+}
+function _emscripten_glLoadIdentity__wrapper() {
+ ; _emscripten_glLoadIdentity();
+}
+function _emscripten_glReleaseShaderCompiler__wrapper() {
+ ; _emscripten_glReleaseShaderCompiler();
+}
+function _emscripten_glFinish__wrapper() {
+ ; _emscripten_glFinish();
+}
+function _emscripten_glFlush__wrapper() {
+ ; _emscripten_glFlush();
+}
+function b23(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = +p2; abort(23);
+}
+function _emscripten_glTexParameterf__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2);
+}
+function b24(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; abort(24);
+}
+function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glViewport__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glScissor__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0);
+}
+
+// EMSCRIPTEN_END_FUNCS
+var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0];
+var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper];
+var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2];
+var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,_cleanup521,_cleanup526
+,b3,b3,b3];
+var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4
+,b4,b4,b4,b4,b4];
+var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5];
+var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6];
+var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7];
+var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,_sn_write,___stdout_write,___stdio_seek,_EmscriptenFullscreenChangeCallback,_EmscriptenInputCallback,___stdio_read,___stdio_write,b8,b8,b8,b8,b8,b8,b8];
+var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper];
+var FUNCTION_TABLE_viiiiii = [b10,_stbi__YCbCr_to_RGB_row,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper];
+var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_stbi__idct_block,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper];
+var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12];
+var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper];
+var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper];
+var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper];
+var FUNCTION_TABLE_iii = [b16,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16];
+var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17];
+var FUNCTION_TABLE_iiiiii = [b18,_stbi__resample_row_hv_2,_resample_row_1,_stbi__resample_row_v_2,_stbi__resample_row_h_2,_stbi__resample_row_generic,b18,b18];
+var FUNCTION_TABLE_vdddddd = [b19,_emscripten_glFrustum__wrapper];
+var FUNCTION_TABLE_vdddd = [b20,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper];
+var FUNCTION_TABLE_vdd = [b21,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper];
+var FUNCTION_TABLE_v = [b22,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b22,b22];
+var FUNCTION_TABLE_viid = [b23,_emscripten_glTexParameterf__wrapper];
+var FUNCTION_TABLE_viiii = [b24,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b24,b24,b24];
+
+ return { _i64Subtract: _i64Subtract, _fflush: _fflush, _main: _main, _i64Add: _i64Add, _memmove: _memmove, _strstr: _strstr, _memset: _memset, _malloc: _malloc, _memcpy: _memcpy, _bitshift64Lshr: _bitshift64Lshr, _free: _free, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___errno_location: ___errno_location, _bitshift64Shl: _bitshift64Shl, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_iiiiii: dynCall_iiiiii, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii };
+})
+// EMSCRIPTEN_END_ASM
+(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
+var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
+var _fflush = Module["_fflush"] = asm["_fflush"];
+var _main = Module["_main"] = asm["_main"];
+var _i64Add = Module["_i64Add"] = asm["_i64Add"];
+var _memmove = Module["_memmove"] = asm["_memmove"];
+var _strstr = Module["_strstr"] = asm["_strstr"];
+var _memset = Module["_memset"] = asm["_memset"];
+var runPostSets = Module["runPostSets"] = asm["runPostSets"];
+var _malloc = Module["_malloc"] = asm["_malloc"];
+var _memcpy = Module["_memcpy"] = asm["_memcpy"];
+var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
+var _free = Module["_free"] = asm["_free"];
+var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"];
+var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
+var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
+var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"];
+var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"];
+var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"];
+var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
+var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"];
+var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
+var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"];
+var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"];
+var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
+var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"];
+var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"];
+var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"];
+var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"];
+var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"];
+var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"];
+var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"];
+var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"];
+var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"];
+var dynCall_iiiiii = Module["dynCall_iiiiii"] = asm["dynCall_iiiiii"];
+var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"];
+var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"];
+var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"];
+var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"];
+var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"];
+var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"];
+;
+
+Runtime.stackAlloc = asm['stackAlloc'];
+Runtime.stackSave = asm['stackSave'];
+Runtime.stackRestore = asm['stackRestore'];
+Runtime.establishStackSpace = asm['establishStackSpace'];
+
+Runtime.setTempRet0 = asm['setTempRet0'];
+Runtime.getTempRet0 = asm['getTempRet0'];
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+
+function ExitStatus(status) {
+ this.name = "ExitStatus";
+ this.message = "Program terminated with exit(" + status + ")";
+ this.status = status;
+};
+ExitStatus.prototype = new Error();
+ExitStatus.prototype.constructor = ExitStatus;
+
+var initialStackTop;
+var preloadStartTime = null;
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!Module['calledRun']) run();
+ if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+}
+
+Module['callMain'] = Module.callMain = function callMain(args) {
+ assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
+ assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');
+
+ args = args || [];
+
+ ensureInitRuntime();
+
+ var argc = args.length+1;
+ function pad() {
+ for (var i = 0; i < 4-1; i++) {
+ argv.push(0);
+ }
+ }
+ var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
+ pad();
+ for (var i = 0; i < argc-1; i = i + 1) {
+ argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
+ pad();
+ }
+ argv.push(0);
+ argv = allocate(argv, 'i32', ALLOC_NORMAL);
+
+
+ try {
+
+ var ret = Module['_main'](argc, argv, 0);
+
+
+ // if we're not running an evented main loop, it's time to exit
+ exit(ret, /* implicit = */ true);
+ }
+ catch(e) {
+ if (e instanceof ExitStatus) {
+ // exit() throws this once it's done to make sure execution
+ // has been stopped completely
+ return;
+ } else if (e == 'SimulateInfiniteLoop') {
+ // running an evented main loop, don't immediately exit
+ Module['noExitRuntime'] = true;
+ return;
+ } else {
+ if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
+ throw e;
+ }
+ } finally {
+ calledMain = true;
+ }
+}
+
+
+
+
+function run(args) {
+ args = args || Module['arguments'];
+
+ if (preloadStartTime === null) preloadStartTime = Date.now();
+
+ if (runDependencies > 0) {
+ return;
+ }
+
+ preRun();
+
+ if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
+ if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
+
+ function doRun() {
+ if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
+ Module['calledRun'] = true;
+
+ if (ABORT) return;
+
+ ensureInitRuntime();
+
+ preMain();
+
+
+ if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+ if (Module['_main'] && shouldRunNow) Module['callMain'](args);
+
+ postRun();
+ }
+
+ if (Module['setStatus']) {
+ Module['setStatus']('Running...');
+ setTimeout(function() {
+ setTimeout(function() {
+ Module['setStatus']('');
+ }, 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+}
+Module['run'] = Module.run = run;
+
+function exit(status, implicit) {
+ if (implicit && Module['noExitRuntime']) {
+ return;
+ }
+
+ if (Module['noExitRuntime']) {
+ } else {
+
+ ABORT = true;
+ EXITSTATUS = status;
+ STACKTOP = initialStackTop;
+
+ exitRuntime();
+
+ if (Module['onExit']) Module['onExit'](status);
+ }
+
+ if (ENVIRONMENT_IS_NODE) {
+ // Work around a node.js bug where stdout buffer is not flushed at process exit:
+ // Instead of process.exit() directly, wait for stdout flush event.
+ // See https://github.com/joyent/node/issues/1669 and https://github.com/kripken/emscripten/issues/2582
+ // Workaround is based on https://github.com/RReverser/acorn/commit/50ab143cecc9ed71a2d66f78b4aec3bb2e9844f6
+ process['stdout']['once']('drain', function () {
+ process['exit'](status);
+ });
+ console.log(' '); // Make sure to print something to force the drain event to occur, in case the stdout buffer was empty.
+ // Work around another node bug where sometimes 'drain' is never fired - make another effort
+ // to emit the exit status, after a significant delay (if node hasn't fired drain by then, give up)
+ setTimeout(function() {
+ process['exit'](status);
+ }, 500);
+ } else
+ if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') {
+ quit(status);
+ }
+ // if we reach here, we must throw an exception to halt the current execution
+ throw new ExitStatus(status);
+}
+Module['exit'] = Module.exit = exit;
+
+var abortDecorators = [];
+
+function abort(what) {
+ if (what !== undefined) {
+ Module.print(what);
+ Module.printErr(what);
+ what = JSON.stringify(what)
+ } else {
+ what = '';
+ }
+
+ ABORT = true;
+ EXITSTATUS = 1;
+
+ var extra = '\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.';
+
+ var output = 'abort(' + what + ') at ' + stackTrace() + extra;
+ if (abortDecorators) {
+ abortDecorators.forEach(function(decorator) {
+ output = decorator(output, what);
+ });
+ }
+ throw output;
+}
+Module['abort'] = Module.abort = abort;
+
+// {{PRE_RUN_ADDITIONS}}
+
+if (Module['preInit']) {
+ if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+ while (Module['preInit'].length > 0) {
+ Module['preInit'].pop()();
+ }
+}
+
+// shouldRunNow refers to calling main(), not run().
+var shouldRunNow = true;
+if (Module['noInitialRun']) {
+ shouldRunNow = false;
+}
+
+
+run();
+
+// {{POST_RUN_ADDITIONS}}
+
+
+
+
+
+
+// {{MODULE_ADDITIONS}}
+
+
+