diff options
| author | Ray <raysan5@gmail.com> | 2017-02-07 09:40:06 +0100 |
|---|---|---|
| committer | GitHub <noreply@github.com> | 2017-02-07 09:40:06 +0100 |
| commit | 94929011330b27f3d027975b52cf0d43ba85c38b (patch) | |
| tree | 9ddff0e6ddba65004557c3628a3d56dfaf47ea4b /docs/examples/web/models_obj_loading.js | |
| parent | 17f09cb03484a408cdd50a3d2e4d6604bb1f4c70 (diff) | |
| parent | 1f6eb1fc61d2cc0cca54a79c1516432f09c86313 (diff) | |
| download | raylib-94929011330b27f3d027975b52cf0d43ba85c38b.tar.gz raylib-94929011330b27f3d027975b52cf0d43ba85c38b.zip | |
Merge pull request #223 from raysan5/develop
Integrate develop branch into master
Diffstat (limited to 'docs/examples/web/models_obj_loading.js')
| -rw-r--r-- | docs/examples/web/models_obj_loading.js | 50580 |
1 files changed, 50580 insertions, 0 deletions
diff --git a/docs/examples/web/models_obj_loading.js b/docs/examples/web/models_obj_loading.js new file mode 100644 index 00000000..8491af04 --- /dev/null +++ b/docs/examples/web/models_obj_loading.js @@ -0,0 +1,50580 @@ + +var Module; + +if (typeof Module === 'undefined') Module = {}; + +if (!Module.expectedDataFileDownloads) { + Module.expectedDataFileDownloads = 0; + Module.finishedDataFileDownloads = 0; +} +Module.expectedDataFileDownloads++; +(function() { + var loadPackage = function(metadata) { + + var PACKAGE_PATH; + if (typeof window === 'object') { + PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/'); + } else if (typeof location !== 'undefined') { + // worker + PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/'); + } else { + throw 'using preloaded data can only be done on a web page or in a web worker'; + } + var PACKAGE_NAME = 'models_obj_loading.data'; + var REMOTE_PACKAGE_BASE = 'models_obj_loading.data'; + if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) { + Module['locateFile'] = Module['locateFilePackage']; + Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)'); + } + var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ? + Module['locateFile'](REMOTE_PACKAGE_BASE) : + ((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE); + + var REMOTE_PACKAGE_SIZE = metadata.remote_package_size; + var PACKAGE_UUID = metadata.package_uuid; + + function fetchRemotePackage(packageName, packageSize, callback, errback) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', packageName, true); + xhr.responseType = 'arraybuffer'; + xhr.onprogress = function(event) { + var url = packageName; + var size = packageSize; + if (event.total) size = event.total; + if (event.loaded) { + if (!xhr.addedTotal) { + xhr.addedTotal = true; + if (!Module.dataFileDownloads) Module.dataFileDownloads = {}; + Module.dataFileDownloads[url] = { + loaded: event.loaded, + total: size + }; + } else { + Module.dataFileDownloads[url].loaded = event.loaded; + } + var total = 0; + var loaded = 0; + var num = 0; + for (var download in Module.dataFileDownloads) { + var data = Module.dataFileDownloads[download]; + total += data.total; + loaded += data.loaded; + num++; + } + total = Math.ceil(total * Module.expectedDataFileDownloads/num); + if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')'); + } else if (!Module.dataFileDownloads) { + if (Module['setStatus']) Module['setStatus']('Downloading data...'); + } + }; + xhr.onload = function(event) { + var packageData = xhr.response; + callback(packageData); + }; + xhr.send(null); + }; + + function handleError(error) { + console.error('package error:', error); + }; + + var fetched = null, fetchedCallback = null; + fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) { + if (fetchedCallback) { + fetchedCallback(data); + fetchedCallback = null; + } else { + fetched = data; + } + }, handleError); + + function runWithFS() { + + function assert(check, msg) { + if (!check) throw msg + new Error().stack; + } +Module['FS_createPath']('/', 'resources', true, true); +Module['FS_createPath']('/resources', 'model', true, true); + + function DataRequest(start, end, crunched, audio) { + this.start = start; + this.end = end; + this.crunched = crunched; + this.audio = audio; + } + DataRequest.prototype = { + requests: {}, + open: function(mode, name) { + this.name = name; + this.requests[name] = this; + Module['addRunDependency']('fp ' + this.name); + }, + send: function() {}, + onload: function() { + var byteArray = this.byteArray.subarray(this.start, this.end); + + this.finish(byteArray); + + }, + finish: function(byteArray) { + var that = this; + + Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change + Module['removeRunDependency']('fp ' + that.name); + + this.requests[this.name] = null; + }, + }; + + var files = metadata.files; + for (i = 0; i < files.length; ++i) { + new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename); + } + + + function processPackageData(arrayBuffer) { + Module.finishedDataFileDownloads++; + assert(arrayBuffer, 'Loading data file failed.'); + assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData'); + var byteArray = new Uint8Array(arrayBuffer); + var curr; + + // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though + // (we may be allocating before malloc is ready, during startup). + if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting'); + var ptr = Module['getMemory'](byteArray.length); + Module['HEAPU8'].set(byteArray, ptr); + DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length); + + var files = metadata.files; + for (i = 0; i < files.length; ++i) { + DataRequest.prototype.requests[files[i].filename].onload(); + } + Module['removeRunDependency']('datafile_models_obj_loading.data'); + + }; + Module['addRunDependency']('datafile_models_obj_loading.data'); + + if (!Module.preloadResults) Module.preloadResults = {}; + + Module.preloadResults[PACKAGE_NAME] = {fromCache: false}; + if (fetched) { + processPackageData(fetched); + fetched = null; + } else { + fetchedCallback = processPackageData; + } + + } + if (Module['calledRun']) { + runWithFS(); + } else { + if (!Module['preRun']) Module['preRun'] = []; + Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it + } + + } + loadPackage({"files": [{"audio": 0, "start": 0, "crunched": 0, "end": 2748249, "filename": "/resources/model/dwarf.obj"}, {"audio": 0, "start": 2748249, "crunched": 0, "end": 4022872, "filename": "/resources/model/dwarf_diffuse.png"}], "remote_package_size": 4022872, "package_uuid": "e7903c6f-6424-4eec-9ca9-573c243d7358"}); + +})(); + +// The Module object: Our interface to the outside world. We import +// and export values on it, and do the work to get that through +// closure compiler if necessary. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to do an eval in order to handle the closure compiler +// case, where this code here is minified but Module was defined +// elsewhere (e.g. case 4 above). We also need to check if Module +// already exists (e.g. case 3 above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module; +if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {}; + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = {}; +for (var key in Module) { + if (Module.hasOwnProperty(key)) { + moduleOverrides[key] = Module[key]; + } +} + +// The environment setup code below is customized to use Module. +// *** Environment setup code *** +var ENVIRONMENT_IS_WEB = typeof window === 'object'; +// Three configurations we can be running in: +// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) +// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) +// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) +var ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; +var ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; +var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; + +if (ENVIRONMENT_IS_NODE) { + // Expose functionality in the same simple way that the shells work + // Note that we pollute the global namespace here, otherwise we break in node + if (!Module['print']) Module['print'] = function print(x) { + process['stdout'].write(x + '\n'); + }; + if (!Module['printErr']) Module['printErr'] = function printErr(x) { + process['stderr'].write(x + '\n'); + }; + + var nodeFS = require('fs'); + var nodePath = require('path'); + + Module['read'] = function read(filename, binary) { + filename = nodePath['normalize'](filename); + var ret = nodeFS['readFileSync'](filename); + // The path is absolute if the normalized version is the same as the resolved. + if (!ret && filename != nodePath['resolve'](filename)) { + filename = path.join(__dirname, '..', 'src', filename); + ret = nodeFS['readFileSync'](filename); + } + if (ret && !binary) ret = ret.toString(); + return ret; + }; + + Module['readBinary'] = function readBinary(filename) { + var ret = Module['read'](filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; + }; + + Module['load'] = function load(f) { + globalEval(read(f)); + }; + + if (!Module['thisProgram']) { + if (process['argv'].length > 1) { + Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); + } else { + Module['thisProgram'] = 'unknown-program'; + } + } + + Module['arguments'] = process['argv'].slice(2); + + if (typeof module !== 'undefined') { + module['exports'] = Module; + } + + process['on']('uncaughtException', function(ex) { + // suppress ExitStatus exceptions from showing an error + if (!(ex instanceof ExitStatus)) { + throw ex; + } + }); + + Module['inspect'] = function () { return '[Emscripten Module object]'; }; +} +else if (ENVIRONMENT_IS_SHELL) { + if (!Module['print']) Module['print'] = print; + if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm + + if (typeof read != 'undefined') { + Module['read'] = read; + } else { + Module['read'] = function read() { throw 'no read() available (jsc?)' }; + } + + Module['readBinary'] = function readBinary(f) { + if (typeof readbuffer === 'function') { + return new Uint8Array(readbuffer(f)); + } + var data = read(f, 'binary'); + assert(typeof data === 'object'); + return data; + }; + + if (typeof scriptArgs != 'undefined') { + Module['arguments'] = scriptArgs; + } else if (typeof arguments != 'undefined') { + Module['arguments'] = arguments; + } + +} +else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + Module['read'] = function read(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.send(null); + return xhr.responseText; + }; + + if (typeof arguments != 'undefined') { + Module['arguments'] = arguments; + } + + if (typeof console !== 'undefined') { + if (!Module['print']) Module['print'] = function print(x) { + console.log(x); + }; + if (!Module['printErr']) Module['printErr'] = function printErr(x) { + console.log(x); + }; + } else { + // Probably a worker, and without console.log. We can do very little here... + var TRY_USE_DUMP = false; + if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) { + dump(x); + }) : (function(x) { + // self.postMessage(x); // enable this if you want stdout to be sent as messages + })); + } + + if (ENVIRONMENT_IS_WORKER) { + Module['load'] = importScripts; + } + + if (typeof Module['setWindowTitle'] === 'undefined') { + Module['setWindowTitle'] = function(title) { document.title = title }; + } +} +else { + // Unreachable because SHELL is dependant on the others + throw 'Unknown runtime environment. Where are we?'; +} + +function globalEval(x) { + eval.call(null, x); +} +if (!Module['load'] && Module['read']) { + Module['load'] = function load(f) { + globalEval(Module['read'](f)); + }; +} +if (!Module['print']) { + Module['print'] = function(){}; +} +if (!Module['printErr']) { + Module['printErr'] = Module['print']; +} +if (!Module['arguments']) { + Module['arguments'] = []; +} +if (!Module['thisProgram']) { + Module['thisProgram'] = './this.program'; +} + +// *** Environment setup code *** + +// Closure helpers +Module.print = Module['print']; +Module.printErr = Module['printErr']; + +// Callbacks +Module['preRun'] = []; +Module['postRun'] = []; + +// Merge back in the overrides +for (var key in moduleOverrides) { + if (moduleOverrides.hasOwnProperty(key)) { + Module[key] = moduleOverrides[key]; + } +} + + + +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + +//======================================== +// Runtime code shared with compiler +//======================================== + +var Runtime = { + setTempRet0: function (value) { + tempRet0 = value; + }, + getTempRet0: function () { + return tempRet0; + }, + stackSave: function () { + return STACKTOP; + }, + stackRestore: function (stackTop) { + STACKTOP = stackTop; + }, + getNativeTypeSize: function (type) { + switch (type) { + case 'i1': case 'i8': return 1; + case 'i16': return 2; + case 'i32': return 4; + case 'i64': return 8; + case 'float': return 4; + case 'double': return 8; + default: { + if (type[type.length-1] === '*') { + return Runtime.QUANTUM_SIZE; // A pointer + } else if (type[0] === 'i') { + var bits = parseInt(type.substr(1)); + assert(bits % 8 === 0); + return bits/8; + } else { + return 0; + } + } + } + }, + getNativeFieldSize: function (type) { + return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE); + }, + STACK_ALIGN: 16, + prepVararg: function (ptr, type) { + if (type === 'double' || type === 'i64') { + // move so the load is aligned + if (ptr & 7) { + assert((ptr & 7) === 4); + ptr += 4; + } + } else { + assert((ptr & 3) === 0); + } + return ptr; + }, + getAlignSize: function (type, size, vararg) { + // we align i64s and doubles on 64-bit boundaries, unlike x86 + if (!vararg && (type == 'i64' || type == 'double')) return 8; + if (!type) return Math.min(size, 8); // align structures internally to 64 bits + return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE); + }, + dynCall: function (sig, ptr, args) { + if (args && args.length) { + if (!args.splice) args = Array.prototype.slice.call(args); + args.splice(0, 0, ptr); + return Module['dynCall_' + sig].apply(null, args); + } else { + return Module['dynCall_' + sig].call(null, ptr); + } + }, + functionPointers: [], + addFunction: function (func) { + for (var i = 0; i < Runtime.functionPointers.length; i++) { + if (!Runtime.functionPointers[i]) { + Runtime.functionPointers[i] = func; + return 2*(1 + i); + } + } + throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; + }, + removeFunction: function (index) { + Runtime.functionPointers[(index-2)/2] = null; + }, + warnOnce: function (text) { + if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {}; + if (!Runtime.warnOnce.shown[text]) { + Runtime.warnOnce.shown[text] = 1; + Module.printErr(text); + } + }, + funcWrappers: {}, + getFuncWrapper: function (func, sig) { + assert(sig); + if (!Runtime.funcWrappers[sig]) { + Runtime.funcWrappers[sig] = {}; + } + var sigCache = Runtime.funcWrappers[sig]; + if (!sigCache[func]) { + sigCache[func] = function dynCall_wrapper() { + return Runtime.dynCall(sig, func, arguments); + }; + } + return sigCache[func]; + }, + getCompilerSetting: function (name) { + throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work'; + }, + stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; }, + staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; }, + dynamicAlloc: function (size) { var ret = DYNAMICTOP;DYNAMICTOP = (DYNAMICTOP + size)|0;DYNAMICTOP = (((DYNAMICTOP)+15)&-16); if (DYNAMICTOP >= TOTAL_MEMORY) { var success = enlargeMemory(); if (!success) { DYNAMICTOP = ret; return 0; } }; return ret; }, + alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; }, + makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; }, + GLOBAL_BASE: 8, + QUANTUM_SIZE: 4, + __dummy__: 0 +} + + + +Module["Runtime"] = Runtime; + + + +//======================================== +// Runtime essentials +//======================================== + +var __THREW__ = 0; // Used in checking for thrown exceptions. + +var ABORT = false; // whether we are quitting the application. no code should run after this. set in exit() and abort() +var EXITSTATUS = 0; + +var undef = 0; +// tempInt is used for 32-bit signed values or smaller. tempBigInt is used +// for 32-bit unsigned values or more than 32 bits. TODO: audit all uses of tempInt +var tempValue, tempInt, tempBigInt, tempInt2, tempBigInt2, tempPair, tempBigIntI, tempBigIntR, tempBigIntS, tempBigIntP, tempBigIntD, tempDouble, tempFloat; +var tempI64, tempI64b; +var tempRet0, tempRet1, tempRet2, tempRet3, tempRet4, tempRet5, tempRet6, tempRet7, tempRet8, tempRet9; + +function assert(condition, text) { + if (!condition) { + abort('Assertion failed: ' + text); + } +} + +var globalScope = this; + +// Returns the C function with a specified identifier (for C++, you need to do manual name mangling) +function getCFunc(ident) { + var func = Module['_' + ident]; // closure exported function + if (!func) { + try { + func = eval('_' + ident); // explicit lookup + } catch(e) {} + } + assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)'); + return func; +} + +var cwrap, ccall; +(function(){ + var JSfuncs = { + // Helpers for cwrap -- it can't refer to Runtime directly because it might + // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find + // out what the minified function name is. + 'stackSave': function() { + Runtime.stackSave() + }, + 'stackRestore': function() { + Runtime.stackRestore() + }, + // type conversion from js to c + 'arrayToC' : function(arr) { + var ret = Runtime.stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + }, + 'stringToC' : function(str) { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { // null string + // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' + ret = Runtime.stackAlloc((str.length << 2) + 1); + writeStringToMemory(str, ret); + } + return ret; + } + }; + // For fast lookup of conversion functions + var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']}; + + // C calling interface. + ccall = function ccallFunc(ident, returnType, argTypes, args, opts) { + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = Runtime.stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + if (returnType === 'string') ret = Pointer_stringify(ret); + if (stack !== 0) { + if (opts && opts.async) { + EmterpreterAsync.asyncFinalizers.push(function() { + Runtime.stackRestore(stack); + }); + return; + } + Runtime.stackRestore(stack); + } + return ret; + } + + var sourceRegex = /^function\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/; + function parseJSFunc(jsfunc) { + // Match the body and the return value of a javascript function source + var parsed = jsfunc.toString().match(sourceRegex).slice(1); + return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]} + } + var JSsource = {}; + for (var fun in JSfuncs) { + if (JSfuncs.hasOwnProperty(fun)) { + // Elements of toCsource are arrays of three items: + // the code, and the return value + JSsource[fun] = parseJSFunc(JSfuncs[fun]); + } + } + + + cwrap = function cwrap(ident, returnType, argTypes) { + argTypes = argTypes || []; + var cfunc = getCFunc(ident); + // When the function takes numbers and returns a number, we can just return + // the original function + var numericArgs = argTypes.every(function(type){ return type === 'number'}); + var numericRet = (returnType !== 'string'); + if ( numericRet && numericArgs) { + return cfunc; + } + // Creation of the arguments list (["$1","$2",...,"$nargs"]) + var argNames = argTypes.map(function(x,i){return '$'+i}); + var funcstr = "(function(" + argNames.join(',') + ") {"; + var nargs = argTypes.length; + if (!numericArgs) { + // Generate the code needed to convert the arguments from javascript + // values to pointers + funcstr += 'var stack = ' + JSsource['stackSave'].body + ';'; + for (var i = 0; i < nargs; i++) { + var arg = argNames[i], type = argTypes[i]; + if (type === 'number') continue; + var convertCode = JSsource[type + 'ToC']; // [code, return] + funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';'; + funcstr += convertCode.body + ';'; + funcstr += arg + '=' + convertCode.returnValue + ';'; + } + } + + // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore + var cfuncname = parseJSFunc(function(){return cfunc}).returnValue; + // Call the function + funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');'; + if (!numericRet) { // Return type can only by 'string' or 'number' + // Convert the result to a string + var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue; + funcstr += 'ret = ' + strgfy + '(ret);'; + } + if (!numericArgs) { + // If we had a stack, restore it + funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';'; + } + funcstr += 'return ret})'; + return eval(funcstr); + }; +})(); +Module["ccall"] = ccall; +Module["cwrap"] = cwrap; + +function setValue(ptr, value, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': HEAP8[((ptr)>>0)]=value; break; + case 'i8': HEAP8[((ptr)>>0)]=value; break; + case 'i16': HEAP16[((ptr)>>1)]=value; break; + case 'i32': HEAP32[((ptr)>>2)]=value; break; + case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; + case 'float': HEAPF32[((ptr)>>2)]=value; break; + case 'double': HEAPF64[((ptr)>>3)]=value; break; + default: abort('invalid type for setValue: ' + type); + } +} +Module["setValue"] = setValue; + + +function getValue(ptr, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': return HEAP32[((ptr)>>2)]; + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return HEAPF64[((ptr)>>3)]; + default: abort('invalid type for setValue: ' + type); + } + return null; +} +Module["getValue"] = getValue; + +var ALLOC_NORMAL = 0; // Tries to use _malloc() +var ALLOC_STACK = 1; // Lives for the duration of the current function call +var ALLOC_STATIC = 2; // Cannot be freed +var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk +var ALLOC_NONE = 4; // Do not allocate +Module["ALLOC_NORMAL"] = ALLOC_NORMAL; +Module["ALLOC_STACK"] = ALLOC_STACK; +Module["ALLOC_STATIC"] = ALLOC_STATIC; +Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC; +Module["ALLOC_NONE"] = ALLOC_NONE; + +// allocate(): This is for internal use. You can use it yourself as well, but the interface +// is a little tricky (see docs right below). The reason is that it is optimized +// for multiple syntaxes to save space in generated code. So you should +// normally not use allocate(), and instead allocate memory using _malloc(), +// initialize it with setValue(), and so forth. +// @slab: An array of data, or a number. If a number, then the size of the block to allocate, +// in *bytes* (note that this is sometimes confusing: the next parameter does not +// affect this!) +// @types: Either an array of types, one for each byte (or 0 if no type at that position), +// or a single type which is used for the entire block. This only matters if there +// is initial data - if @slab is a number, then this does not matter at all and is +// ignored. +// @allocator: How to allocate memory, see ALLOC_* +function allocate(slab, types, allocator, ptr) { + var zeroinit, size; + if (typeof slab === 'number') { + zeroinit = true; + size = slab; + } else { + zeroinit = false; + size = slab.length; + } + + var singleType = typeof types === 'string' ? types : null; + + var ret; + if (allocator == ALLOC_NONE) { + ret = ptr; + } else { + ret = [_malloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); + } + + if (zeroinit) { + var ptr = ret, stop; + assert((ret & 3) == 0); + stop = ret + (size & ~3); + for (; ptr < stop; ptr += 4) { + HEAP32[((ptr)>>2)]=0; + } + stop = ret + size; + while (ptr < stop) { + HEAP8[((ptr++)>>0)]=0; + } + return ret; + } + + if (singleType === 'i8') { + if (slab.subarray || slab.slice) { + HEAPU8.set(slab, ret); + } else { + HEAPU8.set(new Uint8Array(slab), ret); + } + return ret; + } + + var i = 0, type, typeSize, previousType; + while (i < size) { + var curr = slab[i]; + + if (typeof curr === 'function') { + curr = Runtime.getFunctionIndex(curr); + } + + type = singleType || types[i]; + if (type === 0) { + i++; + continue; + } + + if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later + + setValue(ret+i, curr, type); + + // no need to look up size unless type changes, so cache it + if (previousType !== type) { + typeSize = Runtime.getNativeTypeSize(type); + previousType = type; + } + i += typeSize; + } + + return ret; +} +Module["allocate"] = allocate; + +// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready +function getMemory(size) { + if (!staticSealed) return Runtime.staticAlloc(size); + if ((typeof _sbrk !== 'undefined' && !_sbrk.called) || !runtimeInitialized) return Runtime.dynamicAlloc(size); + return _malloc(size); +} +Module["getMemory"] = getMemory; + +function Pointer_stringify(ptr, /* optional */ length) { + if (length === 0 || !ptr) return ''; + // TODO: use TextDecoder + // Find the length, and check for UTF while doing so + var hasUtf = 0; + var t; + var i = 0; + while (1) { + t = HEAPU8[(((ptr)+(i))>>0)]; + hasUtf |= t; + if (t == 0 && !length) break; + i++; + if (length && i == length) break; + } + if (!length) length = i; + + var ret = ''; + + if (hasUtf < 128) { + var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack + var curr; + while (length > 0) { + curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); + ret = ret ? ret + curr : curr; + ptr += MAX_CHUNK; + length -= MAX_CHUNK; + } + return ret; + } + return Module['UTF8ToString'](ptr); +} +Module["Pointer_stringify"] = Pointer_stringify; + +// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function AsciiToString(ptr) { + var str = ''; + while (1) { + var ch = HEAP8[((ptr++)>>0)]; + if (!ch) return str; + str += String.fromCharCode(ch); + } +} +Module["AsciiToString"] = AsciiToString; + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. + +function stringToAscii(str, outPtr) { + return writeAsciiToMemory(str, outPtr, false); +} +Module["stringToAscii"] = stringToAscii; + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns +// a copy of that string as a Javascript String object. + +function UTF8ArrayToString(u8Array, idx) { + var u0, u1, u2, u3, u4, u5; + + var str = ''; + while (1) { + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + u0 = u8Array[idx++]; + if (!u0) return str; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + u1 = u8Array[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + u2 = u8Array[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + u3 = u8Array[idx++] & 63; + if ((u0 & 0xF8) == 0xF0) { + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; + } else { + u4 = u8Array[idx++] & 63; + if ((u0 & 0xFC) == 0xF8) { + u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; + } else { + u5 = u8Array[idx++] & 63; + u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; + } + } + } + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } +} +Module["UTF8ArrayToString"] = UTF8ArrayToString; + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function UTF8ToString(ptr) { + return UTF8ArrayToString(HEAPU8,ptr); +} +Module["UTF8ToString"] = UTF8ToString; + +// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', +// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. +// outIdx: The starting offset in the array to begin the copying. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. +// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + outU8Array[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + outU8Array[outIdx++] = 0xC0 | (u >> 6); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + outU8Array[outIdx++] = 0xE0 | (u >> 12); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0x1FFFFF) { + if (outIdx + 3 >= endIdx) break; + outU8Array[outIdx++] = 0xF0 | (u >> 18); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0x3FFFFFF) { + if (outIdx + 4 >= endIdx) break; + outU8Array[outIdx++] = 0xF8 | (u >> 24); + outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 5 >= endIdx) break; + outU8Array[outIdx++] = 0xFC | (u >> 30); + outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + outU8Array[outIdx] = 0; + return outIdx - startIdx; +} +Module["stringToUTF8Array"] = stringToUTF8Array; + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8(str, outPtr, maxBytesToWrite) { + return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); +} +Module["stringToUTF8"] = stringToUTF8; + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) { + ++len; + } else if (u <= 0x7FF) { + len += 2; + } else if (u <= 0xFFFF) { + len += 3; + } else if (u <= 0x1FFFFF) { + len += 4; + } else if (u <= 0x3FFFFFF) { + len += 5; + } else { + len += 6; + } + } + return len; +} +Module["lengthBytesUTF8"] = lengthBytesUTF8; + +// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function UTF16ToString(ptr) { + var i = 0; + + var str = ''; + while (1) { + var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; + if (codeUnit == 0) + return str; + ++i; + // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. + str += String.fromCharCode(codeUnit); + } +} +Module["UTF16ToString"] = UTF16ToString; + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. +// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. +// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF16(str, outPtr, maxBytesToWrite) { + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; // Null terminator. + var startPtr = outPtr; + var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + HEAP16[((outPtr)>>1)]=codeUnit; + outPtr += 2; + } + // Null-terminate the pointer to the HEAP. + HEAP16[((outPtr)>>1)]=0; + return outPtr - startPtr; +} +Module["stringToUTF16"] = stringToUTF16; + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF16(str) { + return str.length*2; +} +Module["lengthBytesUTF16"] = lengthBytesUTF16; + +function UTF32ToString(ptr) { + var i = 0; + + var str = ''; + while (1) { + var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; + if (utf32 == 0) + return str; + ++i; + // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + if (utf32 >= 0x10000) { + var ch = utf32 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } else { + str += String.fromCharCode(utf32); + } + } +} +Module["UTF32ToString"] = UTF32ToString; + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. +// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. +// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF32(str, outPtr, maxBytesToWrite) { + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); + } + HEAP32[((outPtr)>>2)]=codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + // Null-terminate the pointer to the HEAP. + HEAP32[((outPtr)>>2)]=0; + return outPtr - startPtr; +} +Module["stringToUTF32"] = stringToUTF32; + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. + len += 4; + } + + return len; +} +Module["lengthBytesUTF32"] = lengthBytesUTF32; + +function demangle(func) { + var hasLibcxxabi = !!Module['___cxa_demangle']; + if (hasLibcxxabi) { + try { + var buf = _malloc(func.length); + writeStringToMemory(func.substr(1), buf); + var status = _malloc(4); + var ret = Module['___cxa_demangle'](buf, 0, 0, status); + if (getValue(status, 'i32') === 0 && ret) { + return Pointer_stringify(ret); + } + // otherwise, libcxxabi failed, we can try ours which may return a partial result + } catch(e) { + // failure when using libcxxabi, we can try ours which may return a partial result + } finally { + if (buf) _free(buf); + if (status) _free(status); + if (ret) _free(ret); + } + } + var i = 3; + // params, etc. + var basicTypes = { + 'v': 'void', + 'b': 'bool', + 'c': 'char', + 's': 'short', + 'i': 'int', + 'l': 'long', + 'f': 'float', + 'd': 'double', + 'w': 'wchar_t', + 'a': 'signed char', + 'h': 'unsigned char', + 't': 'unsigned short', + 'j': 'unsigned int', + 'm': 'unsigned long', + 'x': 'long long', + 'y': 'unsigned long long', + 'z': '...' + }; + var subs = []; + var first = true; + function dump(x) { + //return; + if (x) Module.print(x); + Module.print(func); + var pre = ''; + for (var a = 0; a < i; a++) pre += ' '; + Module.print (pre + '^'); + } + function parseNested() { + i++; + if (func[i] === 'K') i++; // ignore const + var parts = []; + while (func[i] !== 'E') { + if (func[i] === 'S') { // substitution + i++; + var next = func.indexOf('_', i); + var num = func.substring(i, next) || 0; + parts.push(subs[num] || '?'); + i = next+1; + continue; + } + if (func[i] === 'C') { // constructor + parts.push(parts[parts.length-1]); + i += 2; + continue; + } + var size = parseInt(func.substr(i)); + var pre = size.toString().length; + if (!size || !pre) { i--; break; } // counter i++ below us + var curr = func.substr(i + pre, size); + parts.push(curr); + subs.push(curr); + i += pre + size; + } + i++; // skip E + return parts; + } + function parse(rawList, limit, allowVoid) { // main parser + limit = limit || Infinity; + var ret = '', list = []; + function flushList() { + return '(' + list.join(', ') + ')'; + } + var name; + if (func[i] === 'N') { + // namespaced N-E + name = parseNested().join('::'); + limit--; + if (limit === 0) return rawList ? [name] : name; + } else { + // not namespaced + if (func[i] === 'K' || (first && func[i] === 'L')) i++; // ignore const and first 'L' + var size = parseInt(func.substr(i)); + if (size) { + var pre = size.toString().length; + name = func.substr(i + pre, size); + i += pre + size; + } + } + first = false; + if (func[i] === 'I') { + i++; + var iList = parse(true); + var iRet = parse(true, 1, true); + ret += iRet[0] + ' ' + name + '<' + iList.join(', ') + '>'; + } else { + ret = name; + } + paramLoop: while (i < func.length && limit-- > 0) { + //dump('paramLoop'); + var c = func[i++]; + if (c in basicTypes) { + list.push(basicTypes[c]); + } else { + switch (c) { + case 'P': list.push(parse(true, 1, true)[0] + '*'); break; // pointer + case 'R': list.push(parse(true, 1, true)[0] + '&'); break; // reference + case 'L': { // literal + i++; // skip basic type + var end = func.indexOf('E', i); + var size = end - i; + list.push(func.substr(i, size)); + i += size + 2; // size + 'EE' + break; + } + case 'A': { // array + var size = parseInt(func.substr(i)); + i += size.toString().length; + if (func[i] !== '_') throw '?'; + i++; // skip _ + list.push(parse(true, 1, true)[0] + ' [' + size + ']'); + break; + } + case 'E': break paramLoop; + default: ret += '?' + c; break paramLoop; + } + } + } + if (!allowVoid && list.length === 1 && list[0] === 'void') list = []; // avoid (void) + if (rawList) { + if (ret) { + list.push(ret + '?'); + } + return list; + } else { + return ret + flushList(); + } + } + var parsed = func; + try { + // Special-case the entry point, since its name differs from other name mangling. + if (func == 'Object._main' || func == '_main') { + return 'main()'; + } + if (typeof func === 'number') func = Pointer_stringify(func); + if (func[0] !== '_') return func; + if (func[1] !== '_') return func; // C function + if (func[2] !== 'Z') return func; + switch (func[3]) { + case 'n': return 'operator new()'; + case 'd': return 'operator delete()'; + } + parsed = parse(); + } catch(e) { + parsed += '?'; + } + if (parsed.indexOf('?') >= 0 && !hasLibcxxabi) { + Runtime.warnOnce('warning: a problem occurred in builtin C++ name demangling; build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling'); + } + return parsed; +} + +function demangleAll(text) { + return text.replace(/__Z[\w\d_]+/g, function(x) { var y = demangle(x); return x === y ? x : (x + ' [' + y + ']') }); +} + +function jsStackTrace() { + var err = new Error(); + if (!err.stack) { + // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, + // so try that as a special-case. + try { + throw new Error(0); + } catch(e) { + err = e; + } + if (!err.stack) { + return '(no stack trace available)'; + } + } + return err.stack.toString(); +} + +function stackTrace() { + return demangleAll(jsStackTrace()); +} +Module["stackTrace"] = stackTrace; + +// Memory management + +var PAGE_SIZE = 4096; + +function alignMemoryPage(x) { + if (x % 4096 > 0) { + x += (4096 - (x % 4096)); + } + return x; +} + +var HEAP; +var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; + +var STATIC_BASE = 0, STATICTOP = 0, staticSealed = false; // static area +var STACK_BASE = 0, STACKTOP = 0, STACK_MAX = 0; // stack area +var DYNAMIC_BASE = 0, DYNAMICTOP = 0; // dynamic area handled by sbrk + + +function abortOnCannotGrowMemory() { + abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); +} + +function enlargeMemory() { + abortOnCannotGrowMemory(); +} + + +var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; +var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 67108864; + +var totalMemory = 64*1024; +while (totalMemory < TOTAL_MEMORY || totalMemory < 2*TOTAL_STACK) { + if (totalMemory < 16*1024*1024) { + totalMemory *= 2; + } else { + totalMemory += 16*1024*1024 + } +} +if (totalMemory !== TOTAL_MEMORY) { + TOTAL_MEMORY = totalMemory; +} + +// Initialize the runtime's memory +// check for full engine support (use string 'subarray' to avoid closure compiler confusion) +assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']), + 'JS engine does not provide full typed array support'); + +var buffer; + + + +buffer = new ArrayBuffer(TOTAL_MEMORY); +HEAP8 = new Int8Array(buffer); +HEAP16 = new Int16Array(buffer); +HEAP32 = new Int32Array(buffer); +HEAPU8 = new Uint8Array(buffer); +HEAPU16 = new Uint16Array(buffer); +HEAPU32 = new Uint32Array(buffer); +HEAPF32 = new Float32Array(buffer); +HEAPF64 = new Float64Array(buffer); + + +// Endianness check (note: assumes compiler arch was little-endian) +HEAP32[0] = 255; +assert(HEAPU8[0] === 255 && HEAPU8[3] === 0, 'Typed arrays 2 must be run on a little-endian system'); + +Module['HEAP'] = HEAP; +Module['buffer'] = buffer; +Module['HEAP8'] = HEAP8; +Module['HEAP16'] = HEAP16; +Module['HEAP32'] = HEAP32; +Module['HEAPU8'] = HEAPU8; +Module['HEAPU16'] = HEAPU16; +Module['HEAPU32'] = HEAPU32; +Module['HEAPF32'] = HEAPF32; +Module['HEAPF64'] = HEAPF64; + +function callRuntimeCallbacks(callbacks) { + while(callbacks.length > 0) { + var callback = callbacks.shift(); + if (typeof callback == 'function') { + callback(); + continue; + } + var func = callback.func; + if (typeof func === 'number') { + if (callback.arg === undefined) { + Runtime.dynCall('v', func); + } else { + Runtime.dynCall('vi', func, [callback.arg]); + } + } else { + func(callback.arg === undefined ? null : callback.arg); + } + } +} + +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATMAIN__ = []; // functions called when main() is to be run +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the runtime has exited + +var runtimeInitialized = false; +var runtimeExited = false; + + +function preRun() { + // compatibility - merge in anything from Module['preRun'] at this time + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); +} + +function ensureInitRuntime() { + if (runtimeInitialized) return; + runtimeInitialized = true; + callRuntimeCallbacks(__ATINIT__); +} + +function preMain() { + callRuntimeCallbacks(__ATMAIN__); +} + +function exitRuntime() { + callRuntimeCallbacks(__ATEXIT__); + runtimeExited = true; +} + +function postRun() { + // compatibility - merge in anything from Module['postRun'] at this time + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} +Module["addOnPreRun"] = addOnPreRun; + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} +Module["addOnInit"] = addOnInit; + +function addOnPreMain(cb) { + __ATMAIN__.unshift(cb); +} +Module["addOnPreMain"] = addOnPreMain; + +function addOnExit(cb) { + __ATEXIT__.unshift(cb); +} +Module["addOnExit"] = addOnExit; + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} +Module["addOnPostRun"] = addOnPostRun; + +// Tools + + +function intArrayFromString(stringy, dontAddNull, length /* optional */) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; +} +Module["intArrayFromString"] = intArrayFromString; + +function intArrayToString(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + var chr = array[i]; + if (chr > 0xFF) { + chr &= 0xFF; + } + ret.push(String.fromCharCode(chr)); + } + return ret.join(''); +} +Module["intArrayToString"] = intArrayToString; + +function writeStringToMemory(string, buffer, dontAddNull) { + var array = intArrayFromString(string, dontAddNull); + var i = 0; + while (i < array.length) { + var chr = array[i]; + HEAP8[(((buffer)+(i))>>0)]=chr; + i = i + 1; + } +} +Module["writeStringToMemory"] = writeStringToMemory; + +function writeArrayToMemory(array, buffer) { + for (var i = 0; i < array.length; i++) { + HEAP8[((buffer++)>>0)]=array[i]; + } +} +Module["writeArrayToMemory"] = writeArrayToMemory; + +function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + HEAP8[((buffer++)>>0)]=str.charCodeAt(i); + } + // Null-terminate the pointer to the HEAP. + if (!dontAddNull) HEAP8[((buffer)>>0)]=0; +} +Module["writeAsciiToMemory"] = writeAsciiToMemory; + +function unSign(value, bits, ignore) { + if (value >= 0) { + return value; + } + return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts + : Math.pow(2, bits) + value; +} +function reSign(value, bits, ignore) { + if (value <= 0) { + return value; + } + var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 + : Math.pow(2, bits-1); + if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that + // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors + // TODO: In i64 mode 1, resign the two parts separately and safely + value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts + } + return value; +} + + +// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 ) +if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) { + var ah = a >>> 16; + var al = a & 0xffff; + var bh = b >>> 16; + var bl = b & 0xffff; + return (al*bl + ((ah*bl + al*bh) << 16))|0; +}; +Math.imul = Math['imul']; + + +if (!Math['clz32']) Math['clz32'] = function(x) { + x = x >>> 0; + for (var i = 0; i < 32; i++) { + if (x & (1 << (31 - i))) return i; + } + return 32; +}; +Math.clz32 = Math['clz32'] + +var Math_abs = Math.abs; +var Math_cos = Math.cos; +var Math_sin = Math.sin; +var Math_tan = Math.tan; +var Math_acos = Math.acos; +var Math_asin = Math.asin; +var Math_atan = Math.atan; +var Math_atan2 = Math.atan2; +var Math_exp = Math.exp; +var Math_log = Math.log; +var Math_sqrt = Math.sqrt; +var Math_ceil = Math.ceil; +var Math_floor = Math.floor; +var Math_pow = Math.pow; +var Math_imul = Math.imul; +var Math_fround = Math.fround; +var Math_min = Math.min; +var Math_clz32 = Math.clz32; + +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// PRE_RUN_ADDITIONS (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled + +function getUniqueRunDependency(id) { + return id; +} + +function addRunDependency(id) { + runDependencies++; + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } +} +Module["addRunDependency"] = addRunDependency; + +function removeRunDependency(id) { + runDependencies--; + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} +Module["removeRunDependency"] = removeRunDependency; + +Module["preloadedImages"] = {}; // maps url to image data +Module["preloadedAudios"] = {}; // maps url to audio data + + + +var memoryInitializer = null; + + + +// === Body === + +var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }]; + +function _emscripten_asm_const_2(code, a0, a1) { + return ASM_CONSTS[code](a0, a1); +} + + + +STATIC_BASE = 8; + +STATICTOP = STATIC_BASE + 24304; + /* global initializers */ __ATINIT__.push(); + + +/* memory initializer */ allocate([0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,3,0,0,194,1,0,0,0,0,64,64,0,0,64,64,0,0,64,64,0,0,0,0,0,0,192,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,52,66,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,1], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE); +/* memory initializer */ allocate([128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,0,0,0,0,20,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,3,0,0,0,7,0,0,0,15,0,0,0,31,0,0,0,63,0,0,0,127,0,0,0,255,0,0,0,255,1,0,0,255,3,0,0,255,7,0,0,255,15,0,0,255,31,0,0,255,63,0,0,255,127,0,0,255,255,0,0,0,0,0,0,255,255,255,255,253,255,255,255,249,255,255,255,241,255,255,255,225,255,255,255,193,255,255,255,129,255,255,255,1,255,255,255,1,254,255,255,1,252,255,255,1,248,255,255,1,240,255,255,1,224,255,255,1,192,255,255,1,128,255,255,1,0,0,0,1,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,184,26,0,0,184,26,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,4,0,0,0,222,88,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,114,97,121,108,105,98,32,91,109,111,100,101,108,115,93,32,101,120,97,109,112,108,101,32,45,32,111,98,106,32,109,111,100,101,108,32,108,111,97,100,105,110,103,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,46,111,98,106,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,95,100,105,102,102,117,115,101,46,112,110,103,0,40,99,41,32,68,119,97,114,102,32,51,68,32,109,111,100,101,108,32,98,121,32,68,97,118,105,100,32,77,111,114,101,110,111,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,53,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+1998); +/* memory initializer */ allocate([83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,118,101,114,116,101,120,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,91,86,65,79,32,73,68,32,37,105,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,115,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,109,111,100,101,108,77,97,116,114,105,120,0,118,105,101,119,68,105,114,0,99,111,108,65,109,98,105,101,110,116,0,99,111,108,83,112,101,99,117,108,97,114,0,103,108,111,115,115,105,110,101,115,115,0,117,115,101,78,111,114,109,97,108,0,117,115,101,83,112,101,99,117,108,97,114,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,108,111,99,97,116,105,111,110,32,102,111,114,32,37,115,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,99,97,110,39,116,32,102,111,112,101,110,0,112,110,103,0,98,109,112,0,116,103,97,0,106,112,103,0,103,105,102,0,112,115,100,0,112,105,99,0,100,100,115,0,112,107,109,0,107,116,120,0,112,118,114,0,97,115,116,99,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,102,105,108,101,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,114,98,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,37,50,46,48,102,32,70,80,83,0,111,98,106,0,91,37,115,93,32,77,111,100,101,108,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,77,111,100,101,108,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,82,65,77,32,97,110,100,32,86,82,65,77,0,73,78,70,79,58,32,0,69,82,82,79,82,58,32,0,87,65,82,78,73,78,71,58,32,0,114,116,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,117,109,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,65,83,84,67,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,98,108,111,99,107,115,58,32,37,105,120,37,105,0,91,37,115,93,32,65,83,84,67,32,98,108,111,99,107,32,115,105,122,101,32,99,111,110,102,105,103,117,114,97,116,105,111,110,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,80,86,82,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,86,82,32,118,50,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,117,112,100,97,116,101,32,121,111,117,114,32,102,105,108,101,115,32,116,111,32,80,86,82,32,118,51,0,91,37,115,93,32,75,84,88,32,105,109,97,103,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,75,84,88,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,102,105,108,101,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,80,75,77,32,0,91,37,115,93,32,80,75,77,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,80,75,77,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,68,68,83,32,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,104,101,97,100,101,114,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,102,108,97,103,115,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,98,105,116,32,99,111,117,110,116,58,32,48,120,37,120,0,80,105,116,99,104,32,111,114,32,108,105,110,101,97,114,32,115,105,122,101,58,32,37,105,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,109,97,120,32,118,97,108,117,101,32,62,32,50,53,53,0,83,128,246,52,0,110,111,116,32,66,77,80,0,117,110,107,110,111,119,110,32,66,77,80,0,98,97,100,32,66,77,80,0,109,111,110,111,99,104,114,111,109,101,0,66,77,80,32,82,76,69,0,110,111,116,32,71,73,70,0,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,47,49,54,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,109,101,109,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,49,54,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,109,103,95,110,32,61,61,32,51,0,98,97,100,32,112,110,103,32,115,105,103,0,110,111,32,83,79,73,0,110,111,32,83,79,70,0,98,97,100,32,83,79,70,32,108,101,110,0,111,110,108,121,32,56,45,98,105,116,0,110,111,32,104,101,97,100,101,114,32,104,101,105,103,104,116,0,48,32,119,105,100,116,104,0,98,97,100,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,82,71,66,98,97,100,32,99,111,109,112,111,110,101,110,116,32,73,68,0,98,97,100,32,72,0,98,97,100,32,86,0,98,97,100,32,84,81,0,101,120,112,101,99,116,101,100,32,109,97,114,107,101,114,0,98,97,100,32,68,82,73,32,108,101,110,0,98,97,100,32,68,81,84,32,116,121,112,101,0,98,97,100,32,68,81,84,32,116,97,98,108,101,0,0,1,8,16,9,2,3,10,17,24,32,25,18,11,4,5,12,19,26,33,40,48,41,34,27,20,13,6,7,14,21,28,35,42,49,56,57,50,43,36,29,22,15,23,30,37,44,51,58,59,52,45,38,31,39,46,53,60,61,54,47,55,62,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,63,98,97,100,32,68,72,84,32,104,101,97,100,101,114,0,98,97,100,32,99,111,100,101,32,108,101,110,103,116,104,115,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,114,101,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,102,111,114,109,97,116,0,116,103,97,95,99,111,109,112,32,61,61,32,83,84,66,73,95,114,103,98,0,115,116,98,105,95,95,116,103,97,95,108,111,97,100,0,98,97,100,32,112,97,108,101,116,116,101,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,48,0,98,97,100,32,102,105,108,101,0,80,73,67,84,0,110,111,116,32,80,83,68,0,119,114,111,110,103,32,118,101,114,115,105,111,110,0,119,114,111,110,103,32,99,104,97,110,110,101,108,32,99,111,117,110,116,0,117,110,115,117,112,112,111,114,116,101,100,32,98,105,116,32,100,101,112,116,104,0,119,114,111,110,103,32,99,111,108,111,114,32,102,111,114,109,97,116,0,98,97,100,32,73,109,97,103,101,32,68,101,115,99,114,105,112,116,111,114,0,109,105,115,115,105,110,103,32,99,111,108,111,114,32,116,97,98,108,101,0,117,110,107,110,111,119,110,32,99,111,100,101,0,110,111,32,99,108,101,97,114,32,99,111,100,101,0,116,111,111,32,109,97,110,121,32,99,111,100,101,115,0,105,108,108,101,103,97,108,32,99,111,100,101,32,105,110,32,114,97,115,116,101,114,0,105,110,118,97,108,105,100,0,98,97,100,32,98,112,112,0,98,97,100,32,109,97,115,107,115,0,98,97,100,32,114,101,113,95,99,111,109,112,0,106,117,110,107,32,98,101,102,111,114,101,32,109,97,114,107,101,114,0,99,97,110,39,116,32,109,101,114,103,101,32,100,99,32,97,110,100,32,97,99,0,110,32,62,61,32,48,32,38,38,32,110,32,60,32,40,105,110,116,41,32,40,115,105,122,101,111,102,40,115,116,98,105,95,95,98,109,97,115,107,41,47,115,105,122,101,111,102,40,42,115,116,98,105,95,95,98,109,97,115,107,41,41,0,115,116,98,105,95,95,101,120,116,101,110,100,95,114,101,99,101,105,118,101,0,40,40,40,106,45,62,99,111,100,101,95,98,117,102,102,101,114,41,32,62,62,32,40,51,50,32,45,32,104,45,62,115,105,122,101,91,99,93,41,41,32,38,32,115,116,98,105,95,95,98,109,97,115,107,91,104,45,62,115,105,122,101,91,99,93,93,41,32,61,61,32,104,45,62,99,111,100,101,91,99,93,0,115,116,98,105,95,95,106,112,101,103,95,104,117,102,102,95,100,101,99,111,100,101,0,98,97,100,32,83,79,83,32,99,111,109,112,111,110,101,110,116,32,99,111,117,110,116,0,98,97,100,32,83,79,83,32,108,101,110,0,98,97,100,32,68,67,32,104,117,102,102,0,98,97,100,32,65,67,32,104,117,102,102,0,98,97,100,32,83,79,83,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,77,97,116,114,105,120,0,99,111,108,68,105,102,102,117,115,101,0,116,101,120,116,117,114,101,48,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,108,105,103,104,116,115,91,120,93,46,112,111,115,105,116,105,111,110,0,0,0,0,0,0,0,0,0,0,0,0,0,0,116,121,112,101,0,0,100,105,102,102,117,115,101,0,0,105,110,116,101,110,115,105,116,121,0,0,112,111,115,105,116,105,111,110,0,0,100,105,114,101,99,116,105,111,110,0,0,99,111,110,101,65,110,103,108,101,0,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+8718); +/* memory initializer */ allocate([83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,114,119,97], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+18958); +/* memory initializer */ allocate([17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,46,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+23766); + + + + + +/* no memory initializer */ +var tempDoublePtr = Runtime.alignMemory(allocate(12, "i8", ALLOC_STATIC), 8); + +assert(tempDoublePtr % 8 == 0); + +function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much + + HEAP8[tempDoublePtr] = HEAP8[ptr]; + + HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; + + HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; + + HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; + +} + +function copyTempDouble(ptr) { + + HEAP8[tempDoublePtr] = HEAP8[ptr]; + + HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; + + HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; + + HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; + + HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; + + HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; + + HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; + + HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; + +} + +// {{PRE_LIBRARY}} + + + + var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},packAlignment:4,unpackAlignment:4,init:function () { + GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE); + for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) { + GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1); + } + },recordError:function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode; + } + },getNewId:function (table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null; + } + return ret; + },MINI_TEMP_BUFFER_SIZE:16,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) { + var source = ''; + for (var i = 0; i < count; ++i) { + var frag; + if (length) { + var len = HEAP32[(((length)+(i*4))>>2)]; + if (len < 0) { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); + } else { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len); + } + } else { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); + } + source += frag; + } + return source; + },createContext:function (canvas, webGLContextAttributes) { + if (typeof webGLContextAttributes.majorVersion === 'undefined' && typeof webGLContextAttributes.minorVersion === 'undefined') { + webGLContextAttributes.majorVersion = 1; + webGLContextAttributes.minorVersion = 0; + } + var ctx; + var errorInfo = '?'; + function onContextCreationError(event) { + errorInfo = event.statusMessage || errorInfo; + } + try { + canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false); + try { + if (webGLContextAttributes.majorVersion == 1 && webGLContextAttributes.minorVersion == 0) { + ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes); + } else if (webGLContextAttributes.majorVersion == 2 && webGLContextAttributes.minorVersion == 0) { + ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes); + } else { + throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!' + } + } finally { + canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false); + } + if (!ctx) throw ':('; + } catch (e) { + Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]); + return 0; + } + // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx); + + if (!ctx) return 0; + return GL.registerContext(ctx, webGLContextAttributes); + },registerContext:function (ctx, webGLContextAttributes) { + var handle = GL.getNewId(GL.contexts); + var context = { + handle: handle, + version: webGLContextAttributes.majorVersion, + GLctx: ctx + }; + // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) { + GL.initExtensions(context); + } + return handle; + },makeContextCurrent:function (contextHandle) { + var context = GL.contexts[contextHandle]; + if (!context) return false; + GLctx = Module.ctx = context.GLctx; // Active WebGL context object. + GL.currentContext = context; // Active Emscripten GL layer context object. + return true; + },getContext:function (contextHandle) { + return GL.contexts[contextHandle]; + },deleteContext:function (contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. + GL.contexts[contextHandle] = null; + },initExtensions:function (context) { + // If this function is called without a specific context object, init the extensions of the currently active context. + if (!context) context = GL.currentContext; + + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + + var GLctx = context.GLctx; + + context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS); + + // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. + + if (context.version < 2) { + // Extension available from Firefox 26 and Google Chrome 30 + var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays'); + if (instancedArraysExt) { + GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); }; + GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); }; + GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; + } + + // Extension available from Firefox 25 and WebKit + var vaoExt = GLctx.getExtension('OES_vertex_array_object'); + if (vaoExt) { + GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); }; + GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); }; + GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); }; + GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); }; + } + + var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers'); + if (drawBuffersExt) { + GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); }; + } + } + + // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and + // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working. + // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions + // here, as long as they don't produce a performance impact for users that might not be using those extensions. + // E.g. debugging-related extensions should probably be off by default. + var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", + "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", + "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays", + "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc", + "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", + "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources", + "EXT_shader_texture_lod" ]; + + function shouldEnableAutomatically(extension) { + var ret = false; + automaticallyEnabledExtensions.forEach(function(include) { + if (ext.indexOf(include) != -1) { + ret = true; + } + }); + return ret; + } + + var exts = GLctx.getSupportedExtensions(); + if (exts && exts.length > 0) { + GLctx.getSupportedExtensions().forEach(function(ext) { + if (automaticallyEnabledExtensions.indexOf(ext) != -1) { + GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled. + } + }); + } + },populateUniformTable:function (program) { + var p = GL.programs[program]; + GL.programInfos[program] = { + uniforms: {}, + maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway. + maxAttributeLength: -1 // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet. + }; + + var ptable = GL.programInfos[program]; + var utable = ptable.uniforms; + // A program's uniform table maps the string name of an uniform to an integer location of that uniform. + // The global GL.uniforms map maps integer locations to WebGLUniformLocations. + var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS); + for (var i = 0; i < numUniforms; ++i) { + var u = GLctx.getActiveUniform(p, i); + + var name = u.name; + ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1); + + // Strip off any trailing array specifier we might have got, e.g. "[0]". + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + name = name.slice(0, ls); + } + + // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then + // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i. + // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices. + var loc = GLctx.getUniformLocation(p, name); + var id = GL.getNewId(GL.uniforms); + utable[name] = [u.size, id]; + GL.uniforms[id] = loc; + + for (var j = 1; j < u.size; ++j) { + var n = name + '['+j+']'; + loc = GLctx.getUniformLocation(p, n); + id = GL.getNewId(GL.uniforms); + + GL.uniforms[id] = loc; + } + } + }};function _emscripten_glIsRenderbuffer(renderbuffer) { + var rb = GL.renderbuffers[renderbuffer]; + if (!rb) return 0; + return GLctx.isRenderbuffer(rb); + } + + function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx.stencilMaskSeparate(x0, x1) } + + + + function _emscripten_get_now() { + if (!_emscripten_get_now.actual) { + if (ENVIRONMENT_IS_NODE) { + _emscripten_get_now.actual = function _emscripten_get_now_actual() { + var t = process['hrtime'](); + return t[0] * 1e3 + t[1] / 1e6; + } + } else if (typeof dateNow !== 'undefined') { + _emscripten_get_now.actual = dateNow; + } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') { + _emscripten_get_now.actual = function _emscripten_get_now_actual() { return self['performance']['now'](); }; + } else if (typeof performance === 'object' && typeof performance['now'] === 'function') { + _emscripten_get_now.actual = function _emscripten_get_now_actual() { return performance['now'](); }; + } else { + _emscripten_get_now.actual = Date.now; + } + } + return _emscripten_get_now.actual(); + }var GLFW={Window:function (id, width, height, title, monitor, share) { + this.id = id; + this.x = 0; + this.y = 0; + this.storedX = 0; // Used to store X before fullscreen + this.storedY = 0; // Used to store Y before fullscreen + this.width = width; + this.height = height; + this.storedWidth = width; // Used to store width before fullscreen + this.storedHeight = height; // Used to store height before fullscreen + this.title = title; + this.monitor = monitor; + this.share = share; + this.attributes = GLFW.hints; + this.inputModes = { + 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL) + 0x00033002:0, // GLFW_STICKY_KEYS + 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS + }; + this.buttons = 0; + this.keys = new Array(); + this.shouldClose = 0; + this.title = null; + this.windowPosFunc = null; // GLFWwindowposfun + this.windowSizeFunc = null; // GLFWwindowsizefun + this.windowCloseFunc = null; // GLFWwindowclosefun + this.windowRefreshFunc = null; // GLFWwindowrefreshfun + this.windowFocusFunc = null; // GLFWwindowfocusfun + this.windowIconifyFunc = null; // GLFWwindowiconifyfun + this.framebufferSizeFunc = null; // GLFWframebuffersizefun + this.mouseButtonFunc = null; // GLFWmousebuttonfun + this.cursorPosFunc = null; // GLFWcursorposfun + this.cursorEnterFunc = null; // GLFWcursorenterfun + this.scrollFunc = null; // GLFWscrollfun + this.keyFunc = null; // GLFWkeyfun + this.charFunc = null; // GLFWcharfun + this.userptr = null; + },WindowFromId:function (id) { + if (id <= 0 || !GLFW.windows) return null; + return GLFW.windows[id - 1]; + },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) { + switch (keycode) { + case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE + case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE + case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA + case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS + case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD + case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH + case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0 + case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1 + case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2 + case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3 + case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4 + case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5 + case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6 + case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7 + case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8 + case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9 + case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON + case 0x61:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL + case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A + case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B + case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C + case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D + case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E + case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F + case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G + case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H + case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I + case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J + case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K + case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L + case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M + case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N + case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O + case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P + case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q + case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R + case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S + case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T + case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U + case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V + case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W + case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X + case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y + case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z + case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET + case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH + case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET + case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT + case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE + case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER + case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB + case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE + case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT + case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE + case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT + case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT + case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN + case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP + case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP + case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN + case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME + case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END + case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK + case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK + case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK + case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN + case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE + case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1 + case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2 + case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3 + case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4 + case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5 + case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6 + case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7 + case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8 + case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9 + case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10 + case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11 + case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12 + case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13 + case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14 + case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15 + case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16 + case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17 + case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18 + case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19 + case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20 + case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21 + case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22 + case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23 + case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24 + case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25 + case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0 + case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1 + case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2 + case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3 + case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4 + case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5 + case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6 + case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7 + case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8 + case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9 + case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL + case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE + case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY + case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT + case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD + // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT) + // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT) + case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT + case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL + case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT + case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER + // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT) + // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT) + // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT) + // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT) + case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU + + // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these? + default:return -1; // GLFW_KEY_UNKNOWN + }; + },getModBits:function (win) { + var mod = 0; + if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT + if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL + if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT + if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER + return mod; + },onKeyPress:function (event) { + if (!GLFW.active || !GLFW.active.charFunc) return; + + // correct unicode charCode is only available with onKeyPress event + var charCode = event.charCode; + if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return; + + + Runtime.dynCall('vii', GLFW.active.charFunc, [GLFW.active.id, charCode]); + },onKeyChanged:function (event, status) { + if (!GLFW.active) return; + + var key = GLFW.DOMToGLFWKeyCode(event.keyCode); + if (key == -1) return; + + GLFW.active.keys[key] = status; + if (!GLFW.active.keyFunc) return; + + + Runtime.dynCall('viiiii', GLFW.active.keyFunc, [GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active)]); + },onKeydown:function (event) { + GLFW.onKeyChanged(event, 1); // GLFW_PRESS + + // This logic comes directly from the sdl implementation. We cannot + // call preventDefault on all keydown events otherwise onKeyPress will + // not get called + if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) { + event.preventDefault(); + } + },onKeyup:function (event) { + GLFW.onKeyChanged(event, 0); // GLFW_RELEASE + },onMousemove:function (event) { + if (!GLFW.active) return; + + Browser.calculateMouseEvent(event); + + if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return; + + + Runtime.dynCall('vidd', GLFW.active.cursorPosFunc, [GLFW.active.id, Browser.mouseX, Browser.mouseY]); + },onMouseButtonChanged:function (event, status) { + if (!GLFW.active || !GLFW.active.mouseButtonFunc) return; + + Browser.calculateMouseEvent(event); + + if (event.target != Module["canvas"]) return; + + if (status == 1) { // GLFW_PRESS + try { + event.target.setCapture(); + } catch (e) {} + } + + // DOM and glfw have different button codes + var eventButton = event['button']; + if (eventButton > 0) { + if (eventButton == 1) { + eventButton = 2; + } else { + eventButton = 1; + } + } + + + Runtime.dynCall('viiii', GLFW.active.mouseButtonFunc, [GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)]); + },onMouseButtonDown:function (event) { + if (!GLFW.active) return; + GLFW.active.buttons |= (1 << event['button']); + GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS + },onMouseButtonUp:function (event) { + if (!GLFW.active) return; + GLFW.active.buttons &= ~(1 << event['button']); + GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE + },onMouseWheel:function (event) { + // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up) + var delta = -Browser.getMouseWheelDelta(event); + delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1. + GLFW.wheelPos += delta; + + if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return; + + + var sx = 0; + var sy = 0; + if (event.type == 'mousewheel') { + sx = event.wheelDeltaX; + sy = event.wheelDeltaY; + } else { + sx = event.deltaX; + sy = event.deltaY; + } + + Runtime.dynCall('vidd', GLFW.active.scrollFunc, [GLFW.active.id, sx, sy]); + + event.preventDefault(); + },onFullScreenEventChange:function () { + if (!GLFW.active) return; + + if (document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) { + GLFW.active.storedX = GLFW.active.x; + GLFW.active.storedY = GLFW.active.y; + GLFW.active.storedWidth = GLFW.active.width; + GLFW.active.storedHeight = GLFW.active.height; + GLFW.active.x = GLFW.active.y = 0; + GLFW.active.width = screen.width; + GLFW.active.height = screen.height; + } else { + GLFW.active.x = GLFW.active.storedX; + GLFW.active.y = GLFW.active.storedY; + GLFW.active.width = GLFW.active.storedWidth; + GLFW.active.height = GLFW.active.storedHeight; + } + + Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions + + if (!GLFW.active.windowSizeFunc) return; + + + Runtime.dynCall('viii', GLFW.active.windowSizeFunc, [GLFW.active.id, GLFW.active.width, GLFW.active.height]); + },requestFullScreen:function () { + var RFS = Module["canvas"]['requestFullscreen'] || + Module["canvas"]['requestFullScreen'] || + Module["canvas"]['mozRequestFullScreen'] || + Module["canvas"]['webkitRequestFullScreen'] || + (function() {}); + RFS.apply(Module["canvas"], []); + },cancelFullScreen:function () { + var CFS = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['webkitCancelFullScreen'] || + (function() {}); + CFS.apply(document, []); + },getTime:function () { + return _emscripten_get_now() / 1000; + },setWindowTitle:function (winid, title) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + win.title = Pointer_stringify(title); + if (GLFW.active.id == win.id) { + document.title = win.title; + } + },setKeyCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.keyFunc = cbfun; + },setCharCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.charFunc = cbfun; + },setMouseButtonCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.mouseButtonFunc = cbfun; + },setCursorPosCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.cursorPosFunc = cbfun; + },setScrollCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.scrollFunc = cbfun; + },setWindowSizeCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowSizeFunc = cbfun; + },setWindowCloseCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowCloseFunc = cbfun; + },setWindowRefreshCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowRefreshFunc = cbfun; + },getKey:function (winid, key) { + var win = GLFW.WindowFromId(winid); + if (!win) return 0; + return win.keys[key]; + },getMouseButton:function (winid, button) { + var win = GLFW.WindowFromId(winid); + if (!win) return 0; + return (win.buttons & (1 << button)) > 0; + },getCursorPos:function (winid, x, y) { + setValue(x, Browser.mouseX, 'double'); + setValue(y, Browser.mouseY, 'double'); + },getMousePos:function (winid, x, y) { + setValue(x, Browser.mouseX, 'i32'); + setValue(y, Browser.mouseY, 'i32'); + },setCursorPos:function (winid, x, y) { + },getWindowPos:function (winid, x, y) { + var wx = 0; + var wy = 0; + + var win = GLFW.WindowFromId(winid); + if (win) { + wx = win.x; + wy = win.y; + } + + setValue(x, wx, 'i32'); + setValue(y, wy, 'i32'); + },setWindowPos:function (winid, x, y) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.x = x; + win.y = y; + },getWindowSize:function (winid, width, height) { + var ww = 0; + var wh = 0; + + var win = GLFW.WindowFromId(winid); + if (win) { + ww = win.width; + wh = win.height; + } + + setValue(width, ww, 'i32'); + setValue(height, wh, 'i32'); + },setWindowSize:function (winid, width, height) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + if (GLFW.active.id == win.id) { + if (width == screen.width && height == screen.height) { + GLFW.requestFullScreen(); + } else { + GLFW.cancelFullScreen(); + Browser.setCanvasSize(width, height); + win.width = width; + win.height = height; + } + } + + if (!win.windowResizeFunc) return; + + + Runtime.dynCall('viii', win.windowResizeFunc, [win.id, width, height]); + },createWindow:function (width, height, title, monitor, share) { + var i, id; + for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++); + if (i > 0) throw "glfwCreateWindow only supports one window at time currently"; + + // id for window + id = i + 1; + + // not valid + if (width <= 0 || height <= 0) return 0; + + if (monitor) { + GLFW.requestFullScreen(); + } else { + Browser.setCanvasSize(width, height); + } + + // Create context when there are no existing alive windows + for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++); + if (i == GLFW.windows.length) { + var contextAttributes = { + antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES + depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS + stencil: (GLFW.hints[0x00021006] > 0) // GLFW_STENCIL_BITS + } + Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes); + } + + // If context creation failed, do not return a valid window + if (!Module.ctx) return 0; + + // Get non alive id + var win = new GLFW.Window(id, width, height, title, monitor, share); + + // Set window to array + if (id - 1 == GLFW.windows.length) { + GLFW.windows.push(win); + } else { + GLFW.windows[id - 1] = win; + } + + GLFW.active = win; + return win.id; + },destroyWindow:function (winid) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + if (win.windowCloseFunc) + Runtime.dynCall('vi', win.windowCloseFunc, [win.id]); + + GLFW.windows[win.id - 1] = null; + if (GLFW.active.id == win.id) + GLFW.active = null; + + // Destroy context when no alive windows + for (var i = 0; i < GLFW.windows.length; i++) + if (GLFW.windows[i] !== null) return; + + Module.ctx = Browser.destroyContext(Module['canvas'], true, true); + },swapBuffers:function (winid) { + },GLFW2ParamToGLFW3Param:function (param) { + table = { + 0x00030001:0, // GLFW_MOUSE_CURSOR + 0x00030002:0, // GLFW_STICKY_KEYS + 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS + 0x00030004:0, // GLFW_SYSTEM_KEYS + 0x00030005:0, // GLFW_KEY_REPEAT + 0x00030006:0, // GLFW_AUTO_POLL_EVENTS + 0x00020001:0, // GLFW_OPENED + 0x00020002:0, // GLFW_ACTIVE + 0x00020003:0, // GLFW_ICONIFIED + 0x00020004:0, // GLFW_ACCELERATED + 0x00020005:0x00021001, // GLFW_RED_BITS + 0x00020006:0x00021002, // GLFW_GREEN_BITS + 0x00020007:0x00021003, // GLFW_BLUE_BITS + 0x00020008:0x00021004, // GLFW_ALPHA_BITS + 0x00020009:0x00021005, // GLFW_DEPTH_BITS + 0x0002000A:0x00021006, // GLFW_STENCIL_BITS + 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE + 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS + 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS + 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS + 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS + 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS + 0x00020011:0x0002100C, // GLFW_STEREO + 0x00020012:0, // GLFW_WINDOW_NO_RESIZE + 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES + 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR + 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR + 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT + 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT + 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE + }; + return table[param]; + }};function _glfwGetVideoModes(monitor, count) { + setValue(count, 0, 'i32'); + return 0; + } + + function _glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.programInfos[program] = null; // uniforms no longer keep the same names after linking + GL.populateUniformTable(program); + } + + function _glBindTexture(target, texture) { + GLctx.bindTexture(target, texture ? GL.textures[texture] : null); + } + + function _emscripten_glStencilFunc(x0, x1, x2) { GLctx.stencilFunc(x0, x1, x2) } + + function _glGetString(name_) { + if (GL.stringCache[name_]) return GL.stringCache[name_]; + var ret; + switch(name_) { + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x1F02 /* GL_VERSION */: + ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL); + break; + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions(); + var gl_exts = []; + for (var i in exts) { + gl_exts.push(exts[i]); + gl_exts.push("GL_" + exts[i]); + } + ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL); + break; + default: + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return 0; + } + GL.stringCache[name_] = ret; + return ret; + } + + function _emscripten_glUniform3iv(location, count, value) { + location = GL.uniforms[location]; + count *= 3; + value = HEAP32.subarray((value)>>2,(value+count*4)>>2); + GLctx.uniform3iv(location, value); + } + + function _emscripten_glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + GLctx.shaderSource(GL.shaders[shader], source); + } + + function _emscripten_glReleaseShaderCompiler() { + // NOP (as allowed by GLES 2.0 spec) + } + + function _glfwSetScrollCallback(winid, cbfun) { + GLFW.setScrollCallback(winid, cbfun); + } + + function _emscripten_glTexParameterf(x0, x1, x2) { GLctx.texParameterf(x0, x1, x2) } + + function _emscripten_glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) } + + function _glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + + + + var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86}; + + var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; + + function ___setErrNo(value) { + if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; + return value; + } + + var PATH={splitPath:function (filename) { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + },normalizeArray:function (parts, allowAboveRoot) { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up--; up) { + parts.unshift('..'); + } + } + return parts; + },normalize:function (path) { + var isAbsolute = path.charAt(0) === '/', + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + },dirname:function (path) { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + },basename:function (path) { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + },extname:function (path) { + return PATH.splitPath(path)[3]; + },join:function () { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join('/')); + },join2:function (l, r) { + return PATH.normalize(l + '/' + r); + },resolve:function () { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path !== 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charAt(0) === '/'; + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { + return !!p; + }), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + },relative:function (from, to) { + from = PATH.resolve(from).substr(1); + to = PATH.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }}; + + var TTY={ttys:[],init:function () { + // https://github.com/kripken/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process['stdin']['setEncoding']('utf8'); + // } + },shutdown:function () { + // https://github.com/kripken/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process['stdin']['pause'](); + // } + },register:function (dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + },stream_ops:{open:function (stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + stream.tty = tty; + stream.seekable = false; + },close:function (stream) { + // flush any pending line data + stream.tty.ops.flush(stream.tty); + },flush:function (stream) { + stream.tty.ops.flush(stream.tty); + },read:function (stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(ERRNO_CODES.ENXIO); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + },write:function (stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(ERRNO_CODES.ENXIO); + } + for (var i = 0; i < length; i++) { + try { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }},default_tty_ops:{get_char:function (tty) { + if (!tty.input.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = new Buffer(BUFSIZE); + var bytesRead = 0; + + var fd = process.stdin.fd; + // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) + var usingDevice = false; + try { + fd = fs.openSync('/dev/stdin', 'r'); + usingDevice = true; + } catch (e) {} + + bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); + + if (usingDevice) { fs.closeSync(fd); } + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + + } else if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + },put_char:function (tty, val) { + if (val === null || val === 10) { + Module['print'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + },flush:function (tty) { + if (tty.output && tty.output.length > 0) { + Module['print'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }},default_tty1_ops:{put_char:function (tty, val) { + if (val === null || val === 10) { + Module['printErr'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + },flush:function (tty) { + if (tty.output && tty.output.length > 0) { + Module['printErr'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }}}; + + var MEMFS={ops_table:null,mount:function (mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createNode:function (parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.buffer.byteLength which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + } + return node; + },getFileDataAsRegularArray:function (node) { + if (node.contents && node.contents.subarray) { + var arr = []; + for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); + return arr; // Returns a copy of the original data. + } + return node.contents; // No-op, the file contents are already in a JS array. Return as-is. + },getFileDataAsTypedArray:function (node) { + if (!node.contents) return new Uint8Array; + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + },expandFileStorage:function (node, newCapacity) { + // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file + // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to + // increase the size. + if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { + node.contents = MEMFS.getFileDataAsRegularArray(node); + node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. + } + + if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. + var prevCapacity = node.contents ? node.contents.buffer.byteLength : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + return; + } + // Not using a typed array to back the file storage. Use a standard JS array instead. + if (!node.contents && newCapacity > 0) node.contents = []; + while (node.contents.length < newCapacity) node.contents.push(0); + },resizeFileStorage:function (node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + return; + } + if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. + var oldContents = node.contents; + node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + return; + } + // Backing with a JS array. + if (!node.contents) node.contents = []; + if (node.contents.length > newSize) node.contents.length = newSize; + else while (node.contents.length < newSize) node.contents.push(0); + node.usedBytes = newSize; + },node_ops:{getattr:function (node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + },setattr:function (node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + },lookup:function (parent, name) { + throw FS.genericErrors[ERRNO_CODES.ENOENT]; + },mknod:function (parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + },rename:function (old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + old_node.parent = new_dir; + },unlink:function (parent, name) { + delete parent.contents[name]; + },rmdir:function (parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + delete parent.contents[name]; + },readdir:function (node) { + var entries = ['.', '..'] + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function (parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + },readlink:function (node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return node.link; + }},stream_ops:{read:function (stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + },write:function (stream, buffer, offset, length, position, canOwn) { + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { // Can we just reuse the buffer we are given? + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. + else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position+length); + return length; + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return position; + },allocate:function (stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + },mmap:function (stream, buffer, offset, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if ( !(flags & 2) && + (contents.buffer === buffer || contents.buffer === buffer.buffer) ) { + // We can't emulate MAP_SHARED when the file is not backed by the buffer + // we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < stream.node.usedBytes) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = _malloc(length); + if (!ptr) { + throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); + } + buffer.set(contents, ptr); + } + return { ptr: ptr, allocated: allocated }; + },msync:function (stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + if (mmapFlags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }}}; + + var IDBFS={dbs:{},indexedDB:function () { + if (typeof indexedDB !== 'undefined') return indexedDB; + var ret = null; + if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + assert(ret, 'IDBFS used, but indexedDB not supported'); + return ret; + },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { + // reuse all of the core MEMFS functionality + return MEMFS.mount.apply(null, arguments); + },syncfs:function (mount, populate, callback) { + IDBFS.getLocalSet(mount, function(err, local) { + if (err) return callback(err); + + IDBFS.getRemoteSet(mount, function(err, remote) { + if (err) return callback(err); + + var src = populate ? remote : local; + var dst = populate ? local : remote; + + IDBFS.reconcile(src, dst, callback); + }); + }); + },getDB:function (name, callback) { + // check the cache first + var db = IDBFS.dbs[name]; + if (db) { + return callback(null, db); + } + + var req; + try { + req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); + } catch (e) { + return callback(e); + } + req.onupgradeneeded = function(e) { + var db = e.target.result; + var transaction = e.target.transaction; + + var fileStore; + + if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { + fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); + } else { + fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); + } + + if (!fileStore.indexNames.contains('timestamp')) { + fileStore.createIndex('timestamp', 'timestamp', { unique: false }); + } + }; + req.onsuccess = function() { + db = req.result; + + // add to the cache + IDBFS.dbs[name] = db; + callback(null, db); + }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },getLocalSet:function (mount, callback) { + var entries = {}; + + function isRealDir(p) { + return p !== '.' && p !== '..'; + }; + function toAbsolute(root) { + return function(p) { + return PATH.join2(root, p); + } + }; + + var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); + + while (check.length) { + var path = check.pop(); + var stat; + + try { + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); + } + + entries[path] = { timestamp: stat.mtime }; + } + + return callback(null, { type: 'local', entries: entries }); + },getRemoteSet:function (mount, callback) { + var entries = {}; + + IDBFS.getDB(mount.mountpoint, function(err, db) { + if (err) return callback(err); + + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); + transaction.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + var index = store.index('timestamp'); + + index.openKeyCursor().onsuccess = function(event) { + var cursor = event.target.result; + + if (!cursor) { + return callback(null, { type: 'remote', db: db, entries: entries }); + } + + entries[cursor.primaryKey] = { timestamp: cursor.key }; + + cursor.continue(); + }; + }); + },loadLocalEntry:function (path, callback) { + var stat, node; + + try { + var lookup = FS.lookupPath(path); + node = lookup.node; + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + return callback(null, { timestamp: stat.mtime, mode: stat.mode }); + } else if (FS.isFile(stat.mode)) { + // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. + // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. + node.contents = MEMFS.getFileDataAsTypedArray(node); + return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); + } else { + return callback(new Error('node type not supported')); + } + },storeLocalEntry:function (path, entry, callback) { + try { + if (FS.isDir(entry.mode)) { + FS.mkdir(path, entry.mode); + } else if (FS.isFile(entry.mode)) { + FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true }); + } else { + return callback(new Error('node type not supported')); + } + + FS.chmod(path, entry.mode); + FS.utime(path, entry.timestamp, entry.timestamp); + } catch (e) { + return callback(e); + } + + callback(null); + },removeLocalEntry:function (path, callback) { + try { + var lookup = FS.lookupPath(path); + var stat = FS.stat(path); + + if (FS.isDir(stat.mode)) { + FS.rmdir(path); + } else if (FS.isFile(stat.mode)) { + FS.unlink(path); + } + } catch (e) { + return callback(e); + } + + callback(null); + },loadRemoteEntry:function (store, path, callback) { + var req = store.get(path); + req.onsuccess = function(event) { callback(null, event.target.result); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },storeRemoteEntry:function (store, path, entry, callback) { + var req = store.put(entry, path); + req.onsuccess = function() { callback(null); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },removeRemoteEntry:function (store, path, callback) { + var req = store.delete(path); + req.onsuccess = function() { callback(null); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },reconcile:function (src, dst, callback) { + var total = 0; + + var create = []; + Object.keys(src.entries).forEach(function (key) { + var e = src.entries[key]; + var e2 = dst.entries[key]; + if (!e2 || e.timestamp > e2.timestamp) { + create.push(key); + total++; + } + }); + + var remove = []; + Object.keys(dst.entries).forEach(function (key) { + var e = dst.entries[key]; + var e2 = src.entries[key]; + if (!e2) { + remove.push(key); + total++; + } + }); + + if (!total) { + return callback(null); + } + + var errored = false; + var completed = 0; + var db = src.type === 'remote' ? src.db : dst.db; + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + + function done(err) { + if (err) { + if (!done.errored) { + done.errored = true; + return callback(err); + } + return; + } + if (++completed >= total) { + return callback(null); + } + }; + + transaction.onerror = function(e) { + done(this.error); + e.preventDefault(); + }; + + // sort paths in ascending order so directory entries are created + // before the files inside them + create.sort().forEach(function (path) { + if (dst.type === 'local') { + IDBFS.loadRemoteEntry(store, path, function (err, entry) { + if (err) return done(err); + IDBFS.storeLocalEntry(path, entry, done); + }); + } else { + IDBFS.loadLocalEntry(path, function (err, entry) { + if (err) return done(err); + IDBFS.storeRemoteEntry(store, path, entry, done); + }); + } + }); + + // sort paths in descending order so files are deleted before their + // parent directories + remove.sort().reverse().forEach(function(path) { + if (dst.type === 'local') { + IDBFS.removeLocalEntry(path, done); + } else { + IDBFS.removeRemoteEntry(store, path, done); + } + }); + }}; + + var NODEFS={isWindows:false,staticInit:function () { + NODEFS.isWindows = !!process.platform.match(/^win/); + },mount:function (mount) { + assert(ENVIRONMENT_IS_NODE); + return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); + },createNode:function (parent, name, mode, dev) { + if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var node = FS.createNode(parent, name, mode); + node.node_ops = NODEFS.node_ops; + node.stream_ops = NODEFS.stream_ops; + return node; + },getMode:function (path) { + var stat; + try { + stat = fs.lstatSync(path); + if (NODEFS.isWindows) { + // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so + // propagate write bits to execute bits. + stat.mode = stat.mode | ((stat.mode & 146) >> 1); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return stat.mode; + },realPath:function (node) { + var parts = []; + while (node.parent !== node) { + parts.push(node.name); + node = node.parent; + } + parts.push(node.mount.opts.root); + parts.reverse(); + return PATH.join.apply(null, parts); + },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) { + flags &= ~0100000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + if (flags in NODEFS.flagsToPermissionStringMap) { + return NODEFS.flagsToPermissionStringMap[flags]; + } else { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + },node_ops:{getattr:function (node) { + var path = NODEFS.realPath(node); + var stat; + try { + stat = fs.lstatSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. + // See http://support.microsoft.com/kb/140365 + if (NODEFS.isWindows && !stat.blksize) { + stat.blksize = 4096; + } + if (NODEFS.isWindows && !stat.blocks) { + stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; + } + return { + dev: stat.dev, + ino: stat.ino, + mode: stat.mode, + nlink: stat.nlink, + uid: stat.uid, + gid: stat.gid, + rdev: stat.rdev, + size: stat.size, + atime: stat.atime, + mtime: stat.mtime, + ctime: stat.ctime, + blksize: stat.blksize, + blocks: stat.blocks + }; + },setattr:function (node, attr) { + var path = NODEFS.realPath(node); + try { + if (attr.mode !== undefined) { + fs.chmodSync(path, attr.mode); + // update the common node structure mode as well + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + var date = new Date(attr.timestamp); + fs.utimesSync(path, date, date); + } + if (attr.size !== undefined) { + fs.truncateSync(path, attr.size); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },lookup:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + var mode = NODEFS.getMode(path); + return NODEFS.createNode(parent, name, mode); + },mknod:function (parent, name, mode, dev) { + var node = NODEFS.createNode(parent, name, mode, dev); + // create the backing node for this in the fs root as well + var path = NODEFS.realPath(node); + try { + if (FS.isDir(node.mode)) { + fs.mkdirSync(path, node.mode); + } else { + fs.writeFileSync(path, '', { mode: node.mode }); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return node; + },rename:function (oldNode, newDir, newName) { + var oldPath = NODEFS.realPath(oldNode); + var newPath = PATH.join2(NODEFS.realPath(newDir), newName); + try { + fs.renameSync(oldPath, newPath); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },unlink:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + try { + fs.unlinkSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },rmdir:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + try { + fs.rmdirSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },readdir:function (node) { + var path = NODEFS.realPath(node); + try { + return fs.readdirSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },symlink:function (parent, newName, oldPath) { + var newPath = PATH.join2(NODEFS.realPath(parent), newName); + try { + fs.symlinkSync(oldPath, newPath); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },readlink:function (node) { + var path = NODEFS.realPath(node); + try { + path = fs.readlinkSync(path); + path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); + return path; + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + }},stream_ops:{open:function (stream) { + var path = NODEFS.realPath(stream.node); + try { + if (FS.isFile(stream.node.mode)) { + stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags)); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },close:function (stream) { + try { + if (FS.isFile(stream.node.mode) && stream.nfd) { + fs.closeSync(stream.nfd); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },read:function (stream, buffer, offset, length, position) { + if (length === 0) return 0; // node errors on 0 length reads + // FIXME this is terrible. + var nbuffer = new Buffer(length); + var res; + try { + res = fs.readSync(stream.nfd, nbuffer, 0, length, position); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + if (res > 0) { + for (var i = 0; i < res; i++) { + buffer[offset + i] = nbuffer[i]; + } + } + return res; + },write:function (stream, buffer, offset, length, position) { + // FIXME this is terrible. + var nbuffer = new Buffer(buffer.subarray(offset, offset + length)); + var res; + try { + res = fs.writeSync(stream.nfd, nbuffer, 0, length, position); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return res; + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + try { + var stat = fs.fstatSync(stream.nfd); + position += stat.size; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + } + } + + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + + return position; + }}}; + + var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { + assert(ENVIRONMENT_IS_WORKER); + if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); + var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); + var createdParents = {}; + function ensureParent(path) { + // return the parent node, creating subdirs as necessary + var parts = path.split('/'); + var parent = root; + for (var i = 0; i < parts.length-1; i++) { + var curr = parts.slice(0, i+1).join('/'); + if (!createdParents[curr]) { + createdParents[curr] = WORKERFS.createNode(parent, curr, WORKERFS.DIR_MODE, 0); + } + parent = createdParents[curr]; + } + return parent; + } + function base(path) { + var parts = path.split('/'); + return parts[parts.length-1]; + } + // We also accept FileList here, by using Array.prototype + Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { + WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); + }); + (mount.opts["blobs"] || []).forEach(function(obj) { + WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); + }); + (mount.opts["packages"] || []).forEach(function(pack) { + pack['metadata'].files.forEach(function(file) { + var name = file.filename.substr(1); // remove initial slash + WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); + }); + }); + return root; + },createNode:function (parent, name, mode, dev, contents, mtime) { + var node = FS.createNode(parent, name, mode); + node.mode = mode; + node.node_ops = WORKERFS.node_ops; + node.stream_ops = WORKERFS.stream_ops; + node.timestamp = (mtime || new Date).getTime(); + assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); + if (mode === WORKERFS.FILE_MODE) { + node.size = contents.size; + node.contents = contents; + } else { + node.size = 4096; + node.contents = {}; + } + if (parent) { + parent.contents[name] = node; + } + return node; + },node_ops:{getattr:function (node) { + return { + dev: 1, + ino: undefined, + mode: node.mode, + nlink: 1, + uid: 0, + gid: 0, + rdev: undefined, + size: node.size, + atime: new Date(node.timestamp), + mtime: new Date(node.timestamp), + ctime: new Date(node.timestamp), + blksize: 4096, + blocks: Math.ceil(node.size / 4096), + }; + },setattr:function (node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + },lookup:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + },mknod:function (parent, name, mode, dev) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },rename:function (oldNode, newDir, newName) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },unlink:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },rmdir:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },readdir:function (node) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },symlink:function (parent, newName, oldPath) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },readlink:function (node) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + }},stream_ops:{read:function (stream, buffer, offset, length, position) { + if (position >= stream.node.size) return 0; + var chunk = stream.node.contents.slice(position, position + length); + var ab = WORKERFS.reader.readAsArrayBuffer(chunk); + buffer.set(new Uint8Array(ab), offset); + return chunk.size; + },write:function (stream, buffer, offset, length, position) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + position += stream.node.size; + } + } + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return position; + }}}; + + var _stdin=allocate(1, "i32*", ALLOC_STATIC); + + var _stdout=allocate(1, "i32*", ALLOC_STATIC); + + var _stderr=allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,handleFSError:function (e) { + if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); + return ___setErrNo(e.errno); + },lookupPath:function (path, opts) { + path = PATH.resolve(FS.cwd(), path); + opts = opts || {}; + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + for (var key in defaults) { + if (opts[key] === undefined) { + opts[key] = defaults[key]; + } + } + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(ERRNO_CODES.ELOOP); + } + + // split the path + var parts = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), false); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(ERRNO_CODES.ELOOP); + } + } + } + } + + return { path: current_path, node: current }; + },getPath:function (node) { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; + } + path = path ? node.name + '/' + path : node.name; + node = node.parent; + } + },hashName:function (parentid, name) { + var hash = 0; + + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + },hashAddNode:function (node) { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + },hashRemoveNode:function (node) { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + },lookupNode:function (parent, name) { + var err = FS.mayLookup(parent); + if (err) { + throw new FS.ErrnoError(err, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + },createNode:function (parent, name, mode, rdev) { + if (!FS.FSNode) { + FS.FSNode = function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + + FS.FSNode.prototype = {}; + + // compatibility + var readMode = 292 | 73; + var writeMode = 146; + + // NOTE we must use Object.defineProperties instead of individual calls to + // Object.defineProperty in order to make closure compiler happy + Object.defineProperties(FS.FSNode.prototype, { + read: { + get: function() { return (this.mode & readMode) === readMode; }, + set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } + }, + write: { + get: function() { return (this.mode & writeMode) === writeMode; }, + set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } + }, + isFolder: { + get: function() { return FS.isDir(this.mode); } + }, + isDevice: { + get: function() { return FS.isChrdev(this.mode); } + } + }); + } + + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + },destroyNode:function (node) { + FS.hashRemoveNode(node); + },isRoot:function (node) { + return node === node.parent; + },isMountpoint:function (node) { + return !!node.mounted; + },isFile:function (mode) { + return (mode & 61440) === 32768; + },isDir:function (mode) { + return (mode & 61440) === 16384; + },isLink:function (mode) { + return (mode & 61440) === 40960; + },isChrdev:function (mode) { + return (mode & 61440) === 8192; + },isBlkdev:function (mode) { + return (mode & 61440) === 24576; + },isFIFO:function (mode) { + return (mode & 61440) === 4096; + },isSocket:function (mode) { + return (mode & 49152) === 49152; + },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { + var flags = FS.flagModes[str]; + if (typeof flags === 'undefined') { + throw new Error('Unknown file open mode: ' + str); + } + return flags; + },flagsToPermissionString:function (flag) { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + },nodePermissions:function (node, perms) { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { + return ERRNO_CODES.EACCES; + } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { + return ERRNO_CODES.EACCES; + } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { + return ERRNO_CODES.EACCES; + } + return 0; + },mayLookup:function (dir) { + var err = FS.nodePermissions(dir, 'x'); + if (err) return err; + if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; + return 0; + },mayCreate:function (dir, name) { + try { + var node = FS.lookupNode(dir, name); + return ERRNO_CODES.EEXIST; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + },mayDelete:function (dir, name, isdir) { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var err = FS.nodePermissions(dir, 'wx'); + if (err) { + return err; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return ERRNO_CODES.ENOTDIR; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return ERRNO_CODES.EBUSY; + } + } else { + if (FS.isDir(node.mode)) { + return ERRNO_CODES.EISDIR; + } + } + return 0; + },mayOpen:function (node, flags) { + if (!node) { + return ERRNO_CODES.ENOENT; + } + if (FS.isLink(node.mode)) { + return ERRNO_CODES.ELOOP; + } else if (FS.isDir(node.mode)) { + if ((flags & 2097155) !== 0 || // opening for write + (flags & 512)) { + return ERRNO_CODES.EISDIR; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { + fd_start = fd_start || 0; + fd_end = fd_end || FS.MAX_OPEN_FDS; + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(ERRNO_CODES.EMFILE); + },getStream:function (fd) { + return FS.streams[fd]; + },createStream:function (stream, fd_start, fd_end) { + if (!FS.FSStream) { + FS.FSStream = function(){}; + FS.FSStream.prototype = {}; + // compatibility + Object.defineProperties(FS.FSStream.prototype, { + object: { + get: function() { return this.node; }, + set: function(val) { this.node = val; } + }, + isRead: { + get: function() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + get: function() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + get: function() { return (this.flags & 1024); } + } + }); + } + // clone it, so we can return an instance of FSStream + var newStream = new FS.FSStream(); + for (var p in stream) { + newStream[p] = stream[p]; + } + stream = newStream; + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + },closeStream:function (fd) { + FS.streams[fd] = null; + },chrdev_stream_ops:{open:function (stream) { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + },llseek:function () { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + }},major:function (dev) { + return ((dev) >> 8); + },minor:function (dev) { + return ((dev) & 0xff); + },makedev:function (ma, mi) { + return ((ma) << 8 | (mi)); + },registerDevice:function (dev, ops) { + FS.devices[dev] = { stream_ops: ops }; + },getDevice:function (dev) { + return FS.devices[dev]; + },getMounts:function (mount) { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + },syncfs:function (populate, callback) { + if (typeof(populate) === 'function') { + callback = populate; + populate = false; + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function done(err) { + if (err) { + if (!done.errored) { + done.errored = true; + return callback(err); + } + return; + } + if (++completed >= mounts.length) { + callback(null); + } + }; + + // sync all mounts + mounts.forEach(function (mount) { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + },mount:function (type, opts, mountpoint) { + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + } + + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + },unmount:function (mountpoint) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach(function (hash) { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.indexOf(current.mount) !== -1) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + },lookup:function (parent, name) { + return parent.node_ops.lookup(parent, name); + },mknod:function (path, mode, dev) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var err = FS.mayCreate(parent, name); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return parent.node_ops.mknod(parent, name, mode, dev); + },create:function (path, mode) { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + },mkdir:function (path, mode) { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + },mkdev:function (path, mode, dev) { + if (typeof(dev) === 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + },symlink:function (oldpath, newpath) { + if (!PATH.resolve(oldpath)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + var newname = PATH.basename(newpath); + var err = FS.mayCreate(parent, newname); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return parent.node_ops.symlink(parent, newname, oldpath); + },rename:function (old_path, new_path) { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + try { + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(ERRNO_CODES.EXDEV); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + // new path should not be an ancestor of the old path + relative = PATH.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var err = FS.mayDelete(old_dir, old_name, isdir); + if (err) { + throw new FS.ErrnoError(err); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + err = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (err) { + throw new FS.ErrnoError(err); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + err = FS.nodePermissions(old_dir, 'w'); + if (err) { + throw new FS.ErrnoError(err); + } + } + try { + if (FS.trackingDelegate['willMovePath']) { + FS.trackingDelegate['willMovePath'](old_path, new_path); + } + } catch(e) { + console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + try { + if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); + } catch(e) { + console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + },rmdir:function (path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var err = FS.mayDelete(parent, name, true); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readdir:function (path) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + return node.node_ops.readdir(node); + },unlink:function (path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var err = FS.mayDelete(parent, name, false); + if (err) { + // POSIX says unlink should set EPERM, not EISDIR + if (err === ERRNO_CODES.EISDIR) err = ERRNO_CODES.EPERM; + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readlink:function (path) { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + },stat:function (path, dontFollow) { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return node.node_ops.getattr(node); + },lstat:function (path) { + return FS.stat(path, true); + },chmod:function (path, mode, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + },lchmod:function (path, mode) { + FS.chmod(path, mode, true); + },fchmod:function (fd, mode) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + FS.chmod(stream.node, mode); + },chown:function (path, uid, gid, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + },lchown:function (path, uid, gid) { + FS.chown(path, uid, gid, true); + },fchown:function (fd, uid, gid) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + FS.chown(stream.node, uid, gid); + },truncate:function (path, len) { + if (len < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var err = FS.nodePermissions(node, 'w'); + if (err) { + throw new FS.ErrnoError(err); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + },ftruncate:function (fd, len) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + FS.truncate(stream.node, len); + },utime:function (path, atime, mtime) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + },open:function (path, flags, mode, fd_start, fd_end) { + if (path === "") { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path === 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(ERRNO_CODES.EEXIST); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var err = FS.mayOpen(node, flags); + if (err) { + throw new FS.ErrnoError(err); + } + } + // do truncation if necessary + if ((flags & 512)) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512); + + // register the stream with the filesystem + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), // we want the absolute path to the node + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }, fd_start, fd_end); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + Module['printErr']('read file: ' + path); + } + } + try { + if (FS.trackingDelegate['onOpenFile']) { + var trackingFlags = 0; + if ((flags & 2097155) !== 1) { + trackingFlags |= FS.tracking.openFlags.READ; + } + if ((flags & 2097155) !== 0) { + trackingFlags |= FS.tracking.openFlags.WRITE; + } + FS.trackingDelegate['onOpenFile'](path, trackingFlags); + } + } catch(e) { + console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); + } + return stream; + },close:function (stream) { + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + },llseek:function (stream, offset, whence) { + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + },read:function (stream, buffer, offset, length, position) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var seeking = true; + if (typeof position === 'undefined') { + position = stream.position; + seeking = false; + } else if (!stream.seekable) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + },write:function (stream, buffer, offset, length, position, canOwn) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if (stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = true; + if (typeof position === 'undefined') { + position = stream.position; + seeking = false; + } else if (!stream.seekable) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + try { + if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); + } catch(e) { + console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); + } + return bytesWritten; + },allocate:function (stream, offset, length) { + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); + } + stream.stream_ops.allocate(stream, offset, length); + },mmap:function (stream, buffer, offset, length, position, prot, flags) { + // TODO if PROT is PROT_WRITE, make sure we have write access + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(ERRNO_CODES.EACCES); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); + },msync:function (stream, buffer, offset, length, mmapFlags) { + if (!stream || !stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + },munmap:function (stream) { + return 0; + },ioctl:function (stream, cmd, arg) { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + },readFile:function (path, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'r'; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + },writeFile:function (path, data, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'w'; + opts.encoding = opts.encoding || 'utf8'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var stream = FS.open(path, opts.flags, opts.mode); + if (opts.encoding === 'utf8') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn); + } else if (opts.encoding === 'binary') { + FS.write(stream, data, 0, data.length, 0, opts.canOwn); + } + FS.close(stream); + },cwd:function () { + return FS.currentPath; + },chdir:function (path) { + var lookup = FS.lookupPath(path, { follow: true }); + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + var err = FS.nodePermissions(lookup.node, 'x'); + if (err) { + throw new FS.ErrnoError(err); + } + FS.currentPath = lookup.path; + },createDefaultDirectories:function () { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + },createDefaultDevices:function () { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: function() { return 0; }, + write: function(stream, buffer, offset, length, pos) { return length; } + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using Module['printErr'] + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + var random_device; + if (typeof crypto !== 'undefined') { + // for modern web browsers + var randomBuffer = new Uint8Array(1); + random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; + } else if (ENVIRONMENT_IS_NODE) { + // for nodejs + random_device = function() { return require('crypto').randomBytes(1)[0]; }; + } else { + // default for ES5 platforms + random_device = function() { return (Math.random()*256)|0; }; + } + FS.createDevice('/dev', 'random', random_device); + FS.createDevice('/dev', 'urandom', random_device); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + },createSpecialDirectories:function () { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount: function() { + var node = FS.createNode('/proc/self', 'fd', 16384 | 0777, 73); + node.node_ops = { + lookup: function(parent, name) { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: function() { return stream.path } } + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + },createStandardStreams:function () { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 'r'); + assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); + + var stdout = FS.open('/dev/stdout', 'w'); + assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); + + var stderr = FS.open('/dev/stderr', 'w'); + assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); + },ensureErrnoError:function () { + if (FS.ErrnoError) return; + FS.ErrnoError = function ErrnoError(errno, node) { + //Module.printErr(stackTrace()); // useful for debugging + this.node = node; + this.setErrno = function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [ERRNO_CODES.ENOENT].forEach(function(code) { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = '<generic error, no stack>'; + }); + },staticInit:function () { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + 'IDBFS': IDBFS, + 'NODEFS': NODEFS, + 'WORKERFS': WORKERFS, + }; + },init:function (input, output, error) { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + },quit:function () { + FS.init.initialized = false; + // force-flush all streams, so we get musl std streams printed out + var fflush = Module['_fflush']; + if (fflush) fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + },getMode:function (canRead, canWrite) { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + },joinPath:function (parts, forceRelative) { + var path = PATH.join.apply(null, parts); + if (forceRelative && path[0] == '/') path = path.substr(1); + return path; + },absolutePath:function (relative, base) { + return PATH.resolve(base, relative); + },standardizePath:function (path) { + return PATH.normalize(path); + },findObject:function (path, dontResolveLastLink) { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (ret.exists) { + return ret.object; + } else { + ___setErrNo(ret.error); + return null; + } + },analyzePath:function (path, dontResolveLastLink) { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + },createFolder:function (parent, name, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.mkdir(path, mode); + },createPath:function (parent, path, canRead, canWrite) { + parent = typeof parent === 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + },createFile:function (parent, name, properties, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { + var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data === 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 'w'); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + },createDevice:function (parent, name, input, output) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open: function(stream) { + stream.seekable = false; + }, + close: function(stream) { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: function(stream, buffer, offset, length, pos /* ignored */) { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: function(stream, buffer, offset, length, pos) { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + },createLink:function (parent, name, target, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + return FS.symlink(target, path); + },forceLoadFile:function (obj) { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + var success = true; + if (typeof XMLHttpRequest !== 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (Module['read']) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(Module['read'](obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + success = false; + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + if (!success) ___setErrNo(ERRNO_CODES.EIO); + return success; + },createLazyFile:function (parent, name, url, canRead, canWrite) { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + } + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + } + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (function(from, to) { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(xhr.response || []); + } else { + return intArrayFromString(xhr.responseText || '', true); + } + }); + var lazyArray = this; + lazyArray.setDataGetter(function(chunkNum) { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum]; + }); + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + } + if (typeof XMLHttpRequest !== 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperty(lazyArray, "length", { + get: function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }); + Object.defineProperty(lazyArray, "chunkSize", { + get: function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperty(node, "usedBytes", { + get: function() { return this.contents.length; } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach(function(key) { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + return fn.apply(null, arguments); + }; + }); + // use a custom read function + stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + }; + node.stream_ops = stream_ops; + return node; + },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { + Browser.init(); + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + var handled = false; + Module['preloadPlugins'].forEach(function(plugin) { + if (handled) return; + if (plugin['canHandle'](fullname)) { + plugin['handle'](byteArray, fullname, finish, function() { + if (onerror) onerror(); + removeRunDependency(dep); + }); + handled = true; + } + }); + if (!handled) finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + Browser.asyncLoad(url, function(byteArray) { + processData(byteArray); + }, onerror); + } else { + processData(url); + } + },indexedDB:function () { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + },DB_NAME:function () { + return 'EM_FS_' + window.location.pathname; + },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { + console.log('creating db'); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; + putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },loadFilesFromDB:function (paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; // no database to load from + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); + } catch(e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var getRequest = files.get(path); + getRequest.onsuccess = function getRequest_onsuccess() { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { + if (path[0] !== '/') { + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + dir = dirstream.path; + } + path = PATH.join2(dir, path); + } + return path; + },doStat:function (func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -ERRNO_CODES.ENOTDIR; + } + throw e; + } + HEAP32[((buf)>>2)]=stat.dev; + HEAP32[(((buf)+(4))>>2)]=0; + HEAP32[(((buf)+(8))>>2)]=stat.ino; + HEAP32[(((buf)+(12))>>2)]=stat.mode; + HEAP32[(((buf)+(16))>>2)]=stat.nlink; + HEAP32[(((buf)+(20))>>2)]=stat.uid; + HEAP32[(((buf)+(24))>>2)]=stat.gid; + HEAP32[(((buf)+(28))>>2)]=stat.rdev; + HEAP32[(((buf)+(32))>>2)]=0; + HEAP32[(((buf)+(36))>>2)]=stat.size; + HEAP32[(((buf)+(40))>>2)]=4096; + HEAP32[(((buf)+(44))>>2)]=stat.blocks; + HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; + HEAP32[(((buf)+(52))>>2)]=0; + HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; + HEAP32[(((buf)+(60))>>2)]=0; + HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; + HEAP32[(((buf)+(68))>>2)]=0; + HEAP32[(((buf)+(72))>>2)]=stat.ino; + return 0; + },doMsync:function (addr, stream, len, flags) { + var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); + FS.msync(stream, buffer, 0, len, flags); + },doMkdir:function (path, mode) { + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + },doMknod:function (path, mode, dev) { + // we don't want this in the JS API as it uses mknod to create all nodes. + switch (mode & 61440) { + case 32768: + case 8192: + case 24576: + case 4096: + case 49152: + break; + default: return -ERRNO_CODES.EINVAL; + } + FS.mknod(path, mode, dev); + return 0; + },doReadlink:function (path, buf, bufsize) { + if (bufsize <= 0) return -ERRNO_CODES.EINVAL; + var ret = FS.readlink(path); + ret = ret.slice(0, Math.max(0, bufsize)); + writeStringToMemory(ret, buf, true); + return ret.length; + },doAccess:function (path, amode) { + if (amode & ~7) { + // need a valid mode + return -ERRNO_CODES.EINVAL; + } + var node; + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -ERRNO_CODES.EACCES; + } + return 0; + },doDup:function (path, flags, suggestFD) { + var suggest = FS.getStream(suggestFD); + if (suggest) FS.close(suggest); + return FS.open(path, flags, 0, suggestFD, suggestFD).fd; + },doReadv:function (stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.read(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + } + return ret; + },doWritev:function (stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.write(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + } + return ret; + },varargs:0,get:function (varargs) { + SYSCALLS.varargs += 4; + var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; + return ret; + },getStr:function () { + var ret = Pointer_stringify(SYSCALLS.get()); + return ret; + },getStreamFromFD:function () { + var stream = FS.getStream(SYSCALLS.get()); + if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + return stream; + },getSocketFromFD:function () { + var socket = SOCKFS.getSocket(SYSCALLS.get()); + if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + return socket; + },getSocketAddress:function (allowNull) { + var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); + if (allowNull && addrp === 0) return null; + var info = __read_sockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + },get64:function () { + var low = SYSCALLS.get(), high = SYSCALLS.get(); + if (low >= 0) assert(high === 0); + else assert(high === -1); + return low; + },getZero:function () { + assert(SYSCALLS.get() === 0); + }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; + try { + // ioctl + var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); + switch (op) { + case 21505: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; + } + case 21506: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + var argp = SYSCALLS.get(); + HEAP32[((argp)>>2)]=0; + return 0; + } + case 21520: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return -ERRNO_CODES.EINVAL; // not supported + } + case 21531: { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + default: abort('bad ioctl syscall ' + op); + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function _emscripten_glSampleCoverage(x0, x1) { GLctx.sampleCoverage(x0, x1) } + + function _glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _emscripten_glFrustum() { + Module['printErr']('missing function: emscripten_glFrustum'); abort(-1); + } + + function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) } + + function _glfwSetWindowSizeCallback(winid, cbfun) { + GLFW.setWindowSizeCallback(winid, cbfun); + } + + function _emscripten_glGetTexParameterfv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _emscripten_glUniform4i(location, v0, v1, v2, v3) { + location = GL.uniforms[location]; + GLctx.uniform4i(location, v0, v1, v2, v3); + } + + function _emscripten_glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null); + } + + function _emscripten_glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) } + + + function _emscripten_memcpy_big(dest, src, num) { + HEAPU8.set(HEAPU8.subarray(src, src+num), dest); + return dest; + } + Module["_memcpy"] = _memcpy; + + function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) } + + function _emscripten_glTexParameterfv(target, pname, params) { + var param = HEAPF32[((params)>>2)]; + GLctx.texParameterf(target, pname, param); + } + + function _emscripten_glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.programInfos[program] = null; // uniforms no longer keep the same names after linking + GL.populateUniformTable(program); + } + + function _glUniform1f(location, v0) { + location = GL.uniforms[location]; + GLctx.uniform1f(location, v0); + } + + function _emscripten_glUniform3f(location, v0, v1, v2) { + location = GL.uniforms[location]; + GLctx.uniform3f(location, v0, v1, v2); + } + + function _emscripten_glGetObjectParameterivARB() { + Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1); + } + + function _emscripten_glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) } + + function _emscripten_glUniform3i(location, v0, v1, v2) { + location = GL.uniforms[location]; + GLctx.uniform3i(location, v0, v1, v2); + } + + function _emscripten_glStencilOp(x0, x1, x2) { GLctx.stencilOp(x0, x1, x2) } + + function _glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; + } + + function _glUniform1i(location, v0) { + location = GL.uniforms[location]; + GLctx.uniform1i(location, v0); + } + + function _emscripten_glBindAttribLocation(program, index, name) { + name = Pointer_stringify(name); + GLctx.bindAttribLocation(GL.programs[program], index, name); + } + + var _cosf=Math_cos; + + function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + var heapView; + if (data) { + heapView = HEAPU8.subarray((data),(data+imageSize)); + } else { + heapView = null; + } + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView); + } + + function _glDisable(x0) { GLctx.disable(x0) } + + function _emscripten_glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); + } + + + Module["_memset"] = _memset; + + var _BDtoILow=true; + + function _glfwMakeContextCurrent(winid) {} + + + var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,registerRemoveEventListeners:function () { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(function() { + for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { + JSEvents._removeHandler(i); + } + }); + JSEvents.removeEventListenersRegistered = true; + } + },findEventTarget:function (target) { + if (target) { + if (typeof target == "number") { + target = Pointer_stringify(target); + } + if (target == '#window') return window; + else if (target == '#document') return document; + else if (target == '#screen') return window.screen; + else if (target == '#canvas') return Module['canvas']; + + if (typeof target == 'string') return document.getElementById(target); + else return target; + } else { + // The sensible target varies between events, but use window as the default + // since DOM events mostly can default to that. Specific callback registrations + // override their own defaults. + return window; + } + },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + + for(var i in arrA) { + if (arrA[i] != arrB[i]) return false; + } + return true; + } + // Test if the given call was already queued, and if so, don't add it again. + for(var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return; + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + + JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); + },removeDeferredCalls:function (targetFunction) { + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i; + } + } + },canPerformEventHandlerRequests:function () { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; + },runDeferredCalls:function () { + if (!JSEvents.canPerformEventHandlerRequests()) { + return; + } + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(this, call.argsList); + } + },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && + (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--); + } + } + },_removeHandler:function (i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1); + },registerOrRemoveHandler:function (eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + // Increment nesting count for the event handler. + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + // Process any old deferred calls the user has placed. + JSEvents.runDeferredCalls(); + // Process the actual event, calls back to user C code handler. + eventHandler.handlerFunc(event); + // Process any new deferred calls that were placed right now from this event handler. + JSEvents.runDeferredCalls(); + // Out of event handler - restore nesting count. + --JSEvents.inEventHandler; + } + + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners(); + } else { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target + && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--); + } + } + } + },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.keyEvent) { + JSEvents.keyEvent = _malloc( 164 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + writeStringToMemory(e.key ? e.key : "", JSEvents.keyEvent + 0 ); + writeStringToMemory(e.code ? e.code : "", JSEvents.keyEvent + 32 ); + HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location; + HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey; + HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey; + HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey; + HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey; + HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat; + writeStringToMemory(e.locale ? e.locale : "", JSEvents.keyEvent + 88 ); + writeStringToMemory(e.char ? e.char : "", JSEvents.keyEvent + 120 ); + HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode; + HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode; + HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which; + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.keyEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do. + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },getBoundingClientRectOrZeros:function (target) { + return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 }; + },fillMouseEventData:function (eventStruct, e, target) { + HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); + HEAP32[(((eventStruct)+(8))>>2)]=e.screenX; + HEAP32[(((eventStruct)+(12))>>2)]=e.screenY; + HEAP32[(((eventStruct)+(16))>>2)]=e.clientX; + HEAP32[(((eventStruct)+(20))>>2)]=e.clientY; + HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey; + HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey; + HEAP32[(((eventStruct)+(32))>>2)]=e.altKey; + HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey; + HEAP16[(((eventStruct)+(40))>>1)]=e.button; + HEAP16[(((eventStruct)+(42))>>1)]=e.buttons; + HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX); + HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY); + + if (Module['canvas']) { + var rect = Module['canvas'].getBoundingClientRect(); + HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left; + HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top; + } else { // Canvas is not initialized, return 0. + HEAP32[(((eventStruct)+(60))>>2)]=0; + HEAP32[(((eventStruct)+(64))>>2)]=0; + } + if (target) { + var rect = JSEvents.getBoundingClientRectOrZeros(target); + HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left; + HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top; + } else { // No specific target passed, return 0. + HEAP32[(((eventStruct)+(52))>>2)]=0; + HEAP32[(((eventStruct)+(56))>>2)]=0; + } + JSEvents.previousScreenX = e.screenX; + JSEvents.previousScreenY = e.screenY; + },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.mouseEvent) { + JSEvents.mouseEvent = _malloc( 72 ); + } + target = JSEvents.findEventTarget(target); + var handlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target); + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.mouseEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + // In IE, mousedown events don't either allow deferred calls to be run! + if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.wheelEvent) { + JSEvents.wheelEvent = _malloc( 104 ); + } + target = JSEvents.findEventTarget(target); + // The DOM Level 3 events spec event 'wheel' + var wheelHandlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); + HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"]; + HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"]; + HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"]; + HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"]; + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + // The 'mousewheel' event as implemented in Safari 6.0.5 + var mouseWheelHandlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); + HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"]; + HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-e["wheelDeltaY"] /* Invert to unify direction with the DOM Level 3 wheel event. */; + HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */; + HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */; + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.wheelEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },pageScrollPos:function () { + if (window.pageXOffset > 0 || window.pageYOffset > 0) { + return [window.pageXOffset, window.pageYOffset]; + } + if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') { + return [document.documentElement.scrollLeft, document.documentElement.scrollTop]; + } + return [document.body.scrollLeft|0, document.body.scrollTop|0]; + },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.uiEvent) { + JSEvents.uiEvent = _malloc( 36 ); + } + + if (eventTypeString == "scroll" && !target) { + target = document; // By default read scroll events on document rather than window. + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + if (e.target != target) { + // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that + // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log + // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print, + // causing a new scroll, etc.. + return; + } + var scrollPos = JSEvents.pageScrollPos(); + HEAP32[((JSEvents.uiEvent)>>2)]=e.detail; + HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth; + HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight; + HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth; + HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight; + HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth; + HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight; + HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0]; + HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1]; + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.uiEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them. + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },getNodeNameForTarget:function (target) { + if (!target) return ''; + if (target == window) return '#window'; + if (target == window.screen) return '#screen'; + return (target && target.nodeName) ? target.nodeName : ''; + },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.focusEvent) { + JSEvents.focusEvent = _malloc( 256 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + + var nodeName = JSEvents.getNodeNameForTarget(e.target); + var id = e.target.id ? e.target.id : ''; + writeStringToMemory(nodeName, JSEvents.focusEvent + 0 ); + writeStringToMemory(id, JSEvents.focusEvent + 128 ); + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.focusEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },tick:function () { + if (window['performance'] && window['performance']['now']) return window['performance']['now'](); + else return Date.now(); + },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.deviceOrientationEvent) { + JSEvents.deviceOrientationEvent = _malloc( 40 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + + HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick(); + HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha; + HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta; + HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma; + HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute; + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceOrientationEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.deviceMotionEvent) { + JSEvents.deviceMotionEvent = _malloc( 80 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + + HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick(); + HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x; + HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y; + HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z; + HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x; + HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y; + HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z; + HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha; + HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta; + HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma; + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.deviceMotionEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },screenOrientation:function () { + if (!window.screen) return undefined; + return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation; + },fillOrientationChangeEventData:function (eventStruct, e) { + var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"]; + var orientations2 = ["portrait", "portrait", "landscape", "landscape"]; + + var orientationString = JSEvents.screenOrientation(); + var orientation = orientations.indexOf(orientationString); + if (orientation == -1) { + orientation = orientations2.indexOf(orientationString); + } + + HEAP32[((eventStruct)>>2)]=1 << orientation; + HEAP32[(((eventStruct)+(4))>>2)]=window.orientation; + },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.orientationChangeEvent) { + JSEvents.orientationChangeEvent = _malloc( 8 ); + } + + if (!target) { + target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e); + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.orientationChangeEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) { + eventTypeString = "mozorientationchange"; + } + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fullscreenEnabled:function () { + return document.fullscreenEnabled || document.mozFullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled; + },fillFullscreenChangeEventData:function (eventStruct, e) { + var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + var isFullscreen = !!fullscreenElement; + HEAP32[((eventStruct)>>2)]=isFullscreen; + HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled(); + // If transitioning to fullscreen, report info about the element that is now fullscreen. + // If transitioning to windowed mode, report info about the element that just was fullscreen. + var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; + var nodeName = JSEvents.getNodeNameForTarget(reportedElement); + var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; + writeStringToMemory(nodeName, eventStruct + 8 ); + writeStringToMemory(id, eventStruct + 136 ); + HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0; + HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0; + HEAP32[(((eventStruct)+(272))>>2)]=screen.width; + HEAP32[(((eventStruct)+(276))>>2)]=screen.height; + if (isFullscreen) { + JSEvents.previousFullscreenElement = fullscreenElement; + } + },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.fullscreenChangeEvent) { + JSEvents.fullscreenChangeEvent = _malloc( 280 ); + } + + if (!target) { + target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e); + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.fullscreenChangeEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },resizeCanvasForFullscreen:function (target, strategy) { + var restoreOldStyle = __registerRestoreOldStyle(target); + var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width; + var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height; + var rect = target.getBoundingClientRect(); + var windowedCssWidth = rect.right - rect.left; + var windowedCssHeight = rect.bottom - rect.top; + var windowedRttWidth = target.width; + var windowedRttHeight = target.height; + + if (strategy.scaleMode == 3) { + __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); + cssWidth = windowedCssWidth; + cssHeight = windowedCssHeight; + } else if (strategy.scaleMode == 2) { + if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { + var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; + __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); + cssHeight = desiredCssHeight; + } else { + var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; + __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); + cssWidth = desiredCssWidth; + } + } + + // If we are adding padding, must choose a background color or otherwise Chrome will give the + // padding a default white color. Do it only if user has not customized their own background color. + if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; + // IE11 does the same, but requires the color to be set in the document body. + if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 + // Firefox always shows black letterboxes independent of style color. + + target.style.width = cssWidth + 'px'; + target.style.height = cssHeight + 'px'; + + if (strategy.filteringMode == 1) { + target.style.imageRendering = 'optimizeSpeed'; + target.style.imageRendering = '-moz-crisp-edges'; + target.style.imageRendering = '-o-crisp-edges'; + target.style.imageRendering = '-webkit-optimize-contrast'; + target.style.imageRendering = 'optimize-contrast'; + target.style.imageRendering = 'crisp-edges'; + target.style.imageRendering = 'pixelated'; + } + + var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1; + if (strategy.canvasResolutionScaleMode != 0) { + target.width = cssWidth * dpiScale; + target.height = cssHeight * dpiScale; + if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height); + } + return restoreOldStyle; + },requestFullscreen:function (target, strategy) { + // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. + if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { + JSEvents.resizeCanvasForFullscreen(target, strategy); + } + + if (target.requestFullscreen) { + target.requestFullscreen(); + } else if (target.msRequestFullscreen) { + target.msRequestFullscreen(); + } else if (target.mozRequestFullScreen) { + target.mozRequestFullScreen(); + } else if (target.mozRequestFullscreen) { + target.mozRequestFullscreen(); + } else if (target.webkitRequestFullscreen) { + target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); + } else { + if (typeof JSEvents.fullscreenEnabled() === 'undefined') { + return -1; + } else { + return -3; + } + } + + if (strategy.canvasResizedCallback) { + Runtime.dynCall('iiii', strategy.canvasResizedCallback, [37, 0, strategy.canvasResizedCallbackUserData]); + } + + return 0; + },fillPointerlockChangeEventData:function (eventStruct, e) { + var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; + var isPointerlocked = !!pointerLockElement; + HEAP32[((eventStruct)>>2)]=isPointerlocked; + var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); + var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; + writeStringToMemory(nodeName, eventStruct + 4 ); + writeStringToMemory(id, eventStruct + 132); + },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.pointerlockChangeEvent) { + JSEvents.pointerlockChangeEvent = _malloc( 260 ); + } + + if (!target) { + target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e); + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.pointerlockChangeEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },requestPointerLock:function (target) { + if (target.requestPointerLock) { + target.requestPointerLock(); + } else if (target.mozRequestPointerLock) { + target.mozRequestPointerLock(); + } else if (target.webkitRequestPointerLock) { + target.webkitRequestPointerLock(); + } else if (target.msRequestPointerLock) { + target.msRequestPointerLock(); + } else { + // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, + // or if the whole browser just doesn't support the feature. + if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) { + return -3; + } else { + return -1; + } + } + return 0; + },fillVisibilityChangeEventData:function (eventStruct, e) { + var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ]; + var visibilityState = visibilityStates.indexOf(document.visibilityState); + + HEAP32[((eventStruct)>>2)]=document.hidden; + HEAP32[(((eventStruct)+(4))>>2)]=visibilityState; + },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.visibilityChangeEvent) { + JSEvents.visibilityChangeEvent = _malloc( 8 ); + } + + if (!target) { + target = document; // Visibility change events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e); + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.visibilityChangeEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.touchEvent) { + JSEvents.touchEvent = _malloc( 1684 ); + } + + target = JSEvents.findEventTarget(target); + + var handlerFunc = function(event) { + var e = event || window.event; + + var touches = {}; + for(var i = 0; i < e.touches.length; ++i) { + var touch = e.touches[i]; + touches[touch.identifier] = touch; + } + for(var i = 0; i < e.changedTouches.length; ++i) { + var touch = e.changedTouches[i]; + touches[touch.identifier] = touch; + touch.changed = true; + } + for(var i = 0; i < e.targetTouches.length; ++i) { + var touch = e.targetTouches[i]; + touches[touch.identifier].onTarget = true; + } + + var ptr = JSEvents.touchEvent; + HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey; + HEAP32[(((ptr)+(8))>>2)]=e.shiftKey; + HEAP32[(((ptr)+(12))>>2)]=e.altKey; + HEAP32[(((ptr)+(16))>>2)]=e.metaKey; + ptr += 20; // Advance to the start of the touch array. + var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined; + var targetRect = JSEvents.getBoundingClientRectOrZeros(target); + var numTouches = 0; + for(var i in touches) { + var t = touches[i]; + HEAP32[((ptr)>>2)]=t.identifier; + HEAP32[(((ptr)+(4))>>2)]=t.screenX; + HEAP32[(((ptr)+(8))>>2)]=t.screenY; + HEAP32[(((ptr)+(12))>>2)]=t.clientX; + HEAP32[(((ptr)+(16))>>2)]=t.clientY; + HEAP32[(((ptr)+(20))>>2)]=t.pageX; + HEAP32[(((ptr)+(24))>>2)]=t.pageY; + HEAP32[(((ptr)+(28))>>2)]=t.changed; + HEAP32[(((ptr)+(32))>>2)]=t.onTarget; + if (canvasRect) { + HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left; + HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top; + } else { + HEAP32[(((ptr)+(44))>>2)]=0; + HEAP32[(((ptr)+(48))>>2)]=0; + } + HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left; + HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top; + + ptr += 52; + + if (++numTouches >= 32) { + break; + } + } + HEAP32[((JSEvents.touchEvent)>>2)]=numTouches; + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.touchEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493 + // Once the above bug is resolved, enable the following condition if possible: + // allowsDeferredCalls: eventTypeString == 'touchstart', + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fillGamepadEventData:function (eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.timestamp; + for(var i = 0; i < e.axes.length; ++i) { + HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i]; + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value; + } else { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i]; + } + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed; + } else { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0; + } + } + HEAP32[(((eventStruct)+(1296))>>2)]=e.connected; + HEAP32[(((eventStruct)+(1300))>>2)]=e.index; + HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length; + HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length; + writeStringToMemory(e.id, eventStruct + 1304 ); + writeStringToMemory(e.mapping, eventStruct + 1368 ); + },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.gamepadEvent) { + JSEvents.gamepadEvent = _malloc( 1432 ); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad); + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.gamepadEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + var handlerFunc = function(event) { + var e = event || window.event; + + var confirmationMessage = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]); + + if (confirmationMessage) { + confirmationMessage = Pointer_stringify(confirmationMessage); + } + if (confirmationMessage) { + e.preventDefault(); + e.returnValue = confirmationMessage; + return confirmationMessage; + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.chargingTime; + HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime; + HEAPF64[(((eventStruct)+(16))>>3)]=e.level; + HEAP32[(((eventStruct)+(24))>>2)]=e.charging; + },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.batteryEvent) { + JSEvents.batteryEvent = _malloc( 32 ); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery()); + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, JSEvents.batteryEvent, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!target) { + target = Module['canvas']; + } + var handlerFunc = function(event) { + var e = event || window.event; + + var shouldCancel = Runtime.dynCall('iiii', callbackfunc, [eventTypeId, 0, userData]); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }};function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel"); + return 0; + } + + function _glBindFramebuffer(target, framebuffer) { + GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null); + } + + function ___lock() {} + + function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx.blendFuncSeparate(x0, x1, x2, x3) } + + function _glCullFace(x0) { GLctx.cullFace(x0) } + + function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) { + if (!pointer) { + // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense + // if pointer == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname); + } + + function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx.vertexAttrib3f(x0, x1, x2, x3) } + + function _emscripten_glEnable(x0) { GLctx.enable(x0) } + + function _emscripten_glNormalPointer() { + Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1); + } + + + var _emscripten_GetProcAddress=undefined; + Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress; + + + function _eglWaitClient() { + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + }var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) { + EGL.errorCode = code; + },chooseConfig:function (display, attribList, config, config_size, numConfigs) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + // TODO: read attribList. + if ((!config || !config_size) && !numConfigs) { + EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); + return 0; + } + if (numConfigs) { + HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1. + } + if (config && config_size > 0) { + HEAP32[((config)>>2)]=62002; + } + + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + }};function _eglGetProcAddress(name_) { + return _emscripten_GetProcAddress(name_); + } + + function _glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + GL.programInfos[id] = null; + } + + + + function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + + if (!Browser.mainLoop.func) { + return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. + } + + if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + setTimeout(Browser.mainLoop.runner, value); // doing this each time means that on exception, we stop + }; + Browser.mainLoop.method = 'timeout'; + } else if (mode == 1 /*EM_TIMING_RAF*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'rAF'; + } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { + if (!window['setImmediate']) { + // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) + var setImmediates = []; + var emscriptenMainLoopMessageId = '__emcc'; + function Browser_setImmediate_messageHandler(event) { + if (event.source === window && event.data === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()(); + } + } + window.addEventListener("message", Browser_setImmediate_messageHandler, true); + window['setImmediate'] = function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + window.postMessage(emscriptenMainLoopMessageId, "*"); + } + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + window['setImmediate'](Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'immediate'; + } + return 0; + }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { + Module['noExitRuntime'] = true; + + assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); + + Browser.mainLoop.func = func; + Browser.mainLoop.arg = arg; + + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next; + } else { + // not counted, but move the progress along a tiny bit + next = next + 0.5; // do not steal all the next one's progress + Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; + } + } + console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); + Browser.mainLoop.updateStatus(); + setTimeout(Browser.mainLoop.runner, 0); + return; + } + + // catch pauses from non-main loop sources + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Implement very basic swap interval control + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + // Not the scheduled time to render this frame - skip. + Browser.mainLoop.scheduler(); + return; + } + + // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize + // VBO double-buffering and reduce GPU stalls. + + if (Browser.mainLoop.method === 'timeout' && Module.ctx) { + Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); + Browser.mainLoop.method = ''; // just warn once per call to set main loop + } + + Browser.mainLoop.runIter(function() { + if (typeof arg !== 'undefined') { + Runtime.dynCall('vi', func, [arg]); + } else { + Runtime.dynCall('v', func); + } + }); + + // catch pauses from the main loop itself + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able + // to queue the newest produced audio samples. + // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() + // do not need to be hardcoded into this function, but can be more generic. + if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + + Browser.mainLoop.scheduler(); + } + + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) + + Browser.mainLoop.scheduler(); + } + + if (simulateInfiniteLoop) { + throw 'SimulateInfiniteLoop'; + } + }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () { + Browser.mainLoop.scheduler = null; + Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. + },resume:function () { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler(); + },updateStatus:function () { + if (Module['setStatus']) { + var message = Module['statusMessage'] || 'Please wait...'; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); + } else { + Module['setStatus'](message); + } + } else { + Module['setStatus'](''); + } + } + },runIter:function (func) { + if (ABORT) return; + if (Module['preMainLoop']) { + var preRet = Module['preMainLoop'](); + if (preRet === false) { + return; // |return false| skips a frame + } + } + try { + func(); + } catch (e) { + if (e instanceof ExitStatus) { + return; + } else { + if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); + throw e; + } + } + if (Module['postMainLoop']) Module['postMainLoop'](); + }},isFullScreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers + + if (Browser.initted) return; + Browser.initted = true; + + try { + new Blob(); + Browser.hasBlobConstructor = true; + } catch(e) { + Browser.hasBlobConstructor = false; + console.log("warning: no blob constructor, cannot create blobs with mimetypes"); + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); + Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { + console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true; + } + + // Support for plugins that can process preloaded files. You can add more of these to + // your app by creating and appending to Module.preloadPlugins. + // + // Each plugin is asked if it can handle a file based on the file's name. If it can, + // it is given the file's raw data. When it is done, it calls a callback with the file's + // (possibly modified) data. For example, a plugin might decompress a file, or it + // might create some side data structure for use later (like an Image element, etc.). + + var imagePlugin = {}; + imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); + }; + imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + if (b.size !== byteArray.length) { // Safari bug #118630 + // Safari's Blob can only take an ArrayBuffer + b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); + } + } catch(e) { + Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); + } + } + if (!b) { + var bb = new Browser.BlobBuilder(); + bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range + b = bb.getBlob(); + } + var url = Browser.URLObject.createObjectURL(b); + var img = new Image(); + img.onload = function img_onload() { + assert(img.complete, 'Image ' + name + ' could not be decoded'); + var canvas = document.createElement('canvas'); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext('2d'); + ctx.drawImage(img, 0, 0); + Module["preloadedImages"][name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray); + }; + img.onerror = function img_onerror(event) { + console.log('Image ' + url + ' could not be decoded'); + if (onerror) onerror(); + }; + img.src = url; + }; + Module['preloadPlugins'].push(imagePlugin); + + var audioPlugin = {}; + audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; + }; + audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + function finish(audio) { + if (done) return; + done = true; + Module["preloadedAudios"][name] = audio; + if (onload) onload(byteArray); + } + function fail() { + if (done) return; + done = true; + Module["preloadedAudios"][name] = new Audio(); // empty shim + if (onerror) onerror(); + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + } catch(e) { + return fail(); + } + var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! + var audio = new Audio(); + audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 + audio.onerror = function audio_onerror(event) { + if (done) return; + console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); + function encode64(data) { + var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + var PAD = '='; + var ret = ''; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = (leftchar << 8) | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = (leftchar >> (leftbits-6)) & 0x3f; + leftbits -= 6; + ret += BASE[curr]; + } + } + if (leftbits == 2) { + ret += BASE[(leftchar&3) << 4]; + ret += PAD + PAD; + } else if (leftbits == 4) { + ret += BASE[(leftchar&0xf) << 2]; + ret += PAD; + } + return ret; + } + audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); + finish(audio); // we don't wait for confirmation this worked - but it's worth trying + }; + audio.src = url; + // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror + Browser.safeSetTimeout(function() { + finish(audio); // try to use it even though it is not necessarily ready to play + }, 10000); + } else { + return fail(); + } + }; + Module['preloadPlugins'].push(audioPlugin); + + // Canvas event setup + + var canvas = Module['canvas']; + function pointerLockChange() { + Browser.pointerLock = document['pointerLockElement'] === canvas || + document['mozPointerLockElement'] === canvas || + document['webkitPointerLockElement'] === canvas || + document['msPointerLockElement'] === canvas; + } + if (canvas) { + // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module + // Module['forcedAspectRatio'] = 4 / 3; + + canvas.requestPointerLock = canvas['requestPointerLock'] || + canvas['mozRequestPointerLock'] || + canvas['webkitRequestPointerLock'] || + canvas['msRequestPointerLock'] || + function(){}; + canvas.exitPointerLock = document['exitPointerLock'] || + document['mozExitPointerLock'] || + document['webkitExitPointerLock'] || + document['msExitPointerLock'] || + function(){}; // no-op if function does not exist + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + + + document.addEventListener('pointerlockchange', pointerLockChange, false); + document.addEventListener('mozpointerlockchange', pointerLockChange, false); + document.addEventListener('webkitpointerlockchange', pointerLockChange, false); + document.addEventListener('mspointerlockchange', pointerLockChange, false); + + if (Module['elementPointerLock']) { + canvas.addEventListener("click", function(ev) { + if (!Browser.pointerLock && canvas.requestPointerLock) { + canvas.requestPointerLock(); + ev.preventDefault(); + } + }, false); + } + } + },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. + + var ctx; + var contextHandle; + if (useWebGL) { + // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. + var contextAttributes = { + antialias: false, + alpha: false + }; + + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute]; + } + } + + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx; + } + // Set the background of the WebGL canvas to black + canvas.style.backgroundColor = "black"; + } else { + ctx = canvas.getContext('2d'); + } + + if (!ctx) return null; + + if (setInModule) { + if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); + + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); + Browser.init(); + } + return ctx; + },destroyContext:function (canvas, useWebGL, setInModule) {},fullScreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + Browser.vrDevice = vrDevice; + if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; + if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; + if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null; + + var canvas = Module['canvas']; + function fullScreenChange() { + Browser.isFullScreen = false; + var canvasContainer = canvas.parentNode; + if ((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] || + document['mozFullScreenElement'] || document['mozFullscreenElement'] || + document['fullScreenElement'] || document['fullscreenElement'] || + document['msFullScreenElement'] || document['msFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvasContainer) { + canvas.cancelFullScreen = document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['webkitCancelFullScreen'] || + document['msExitFullscreen'] || + document['exitFullscreen'] || + function() {}; + canvas.cancelFullScreen = canvas.cancelFullScreen.bind(document); + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullScreen = true; + if (Browser.resizeCanvas) Browser.setFullScreenCanvasSize(); + } else { + + // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + + if (Browser.resizeCanvas) Browser.setWindowedCanvasSize(); + } + if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullScreen); + Browser.updateCanvasDimensions(canvas); + } + + if (!Browser.fullScreenHandlersInstalled) { + Browser.fullScreenHandlersInstalled = true; + document.addEventListener('fullscreenchange', fullScreenChange, false); + document.addEventListener('mozfullscreenchange', fullScreenChange, false); + document.addEventListener('webkitfullscreenchange', fullScreenChange, false); + document.addEventListener('MSFullscreenChange', fullScreenChange, false); + } + + // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + + // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) + canvasContainer.requestFullScreen = canvasContainer['requestFullScreen'] || + canvasContainer['mozRequestFullScreen'] || + canvasContainer['msRequestFullscreen'] || + (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); + + if (vrDevice) { + canvasContainer.requestFullScreen({ vrDisplay: vrDevice }); + } else { + canvasContainer.requestFullScreen(); + } + },nextRAF:0,fakeRequestAnimationFrame:function (func) { + // try to keep 60fps between calls to here + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1000/60; + } else { + while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 + Browser.nextRAF += 1000/60; + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay); + },requestAnimationFrame:function requestAnimationFrame(func) { + if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js) + Browser.fakeRequestAnimationFrame(func); + } else { + if (!window.requestAnimationFrame) { + window.requestAnimationFrame = window['requestAnimationFrame'] || + window['mozRequestAnimationFrame'] || + window['webkitRequestAnimationFrame'] || + window['msRequestAnimationFrame'] || + window['oRequestAnimationFrame'] || + Browser.fakeRequestAnimationFrame; + } + window.requestAnimationFrame(func); + } + },safeCallback:function (func) { + return function() { + if (!ABORT) return func.apply(null, arguments); + }; + },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () { + Browser.allowAsyncCallbacks = false; + },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now + Browser.allowAsyncCallbacks = true; + if (Browser.queuedAsyncCallbacks.length > 0) { + var callbacks = Browser.queuedAsyncCallbacks; + Browser.queuedAsyncCallbacks = []; + callbacks.forEach(function(func) { + func(); + }); + } + },safeRequestAnimationFrame:function (func) { + return Browser.requestAnimationFrame(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }); + },safeSetTimeout:function (func, timeout) { + Module['noExitRuntime'] = true; + return setTimeout(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }, timeout); + },safeSetInterval:function (func, timeout) { + Module['noExitRuntime'] = true; + return setInterval(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } // drop it on the floor otherwise, next interval will kick in + }, timeout); + },getMimetype:function (name) { + return { + 'jpg': 'image/jpeg', + 'jpeg': 'image/jpeg', + 'png': 'image/png', + 'bmp': 'image/bmp', + 'ogg': 'audio/ogg', + 'wav': 'audio/wav', + 'mp3': 'audio/mpeg' + }[name.substr(name.lastIndexOf('.')+1)]; + },getUserMedia:function (func) { + if(!window.getUserMedia) { + window.getUserMedia = navigator['getUserMedia'] || + navigator['mozGetUserMedia']; + } + window.getUserMedia(func); + },getMovementX:function (event) { + return event['movementX'] || + event['mozMovementX'] || + event['webkitMovementX'] || + 0; + },getMovementY:function (event) { + return event['movementY'] || + event['mozMovementY'] || + event['webkitMovementY'] || + 0; + },getMouseWheelDelta:function (event) { + var delta = 0; + switch (event.type) { + case 'DOMMouseScroll': + delta = event.detail; + break; + case 'mousewheel': + delta = event.wheelDelta; + break; + case 'wheel': + delta = event['deltaY']; + break; + default: + throw 'unrecognized mouse wheel event: ' + event.type; + } + return delta; + },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup + if (Browser.pointerLock) { + // When the pointer is locked, calculate the coordinates + // based on the movement of the mouse. + // Workaround for Firefox bug 764498 + if (event.type != 'mousemove' && + ('mozMovementX' in event)) { + Browser.mouseMovementX = Browser.mouseMovementY = 0; + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event); + } + + // check if SDL is available + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; + } else { + // just add the mouse delta to the current absolut mouse position + // FIXME: ideally this should be clamped against the canvas size and zero + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY; + } + } else { + // Otherwise, calculate the movement based on the changes + // in the coordinates. + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + + // Neither .scrollX or .pageXOffset are defined in a spec, but + // we prefer .scrollX because it is currently in a spec draft. + // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) + var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); + var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); + + if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { + var touch = event.touch; + if (touch === undefined) { + return; // the "touch" property is only defined in SDL + + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + + var coords = { x: adjustedX, y: adjustedY }; + + if (event.type === 'touchstart') { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords; + } else if (event.type === 'touchend' || event.type === 'touchmove') { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords; + } + return; + } + + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + + // the canvas might be CSS-scaled compared to its backbuffer; + // SDL-using content will want mouse coordinates in terms + // of backbuffer units. + x = x * (cw / rect.width); + y = y * (ch / rect.height); + + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y; + } + },xhrLoad:function (url, onload, onerror) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, true); + xhr.responseType = 'arraybuffer'; + xhr.onload = function xhr_onload() { + if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + onload(xhr.response); + } else { + onerror(); + } + }; + xhr.onerror = onerror; + xhr.send(null); + },asyncLoad:function (url, onload, onerror, noRunDep) { + Browser.xhrLoad(url, function(arrayBuffer) { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (!noRunDep) removeRunDependency('al ' + url); + }, function(event) { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (!noRunDep) addRunDependency('al ' + url); + },resizeListeners:[],updateResizeListeners:function () { + var canvas = Module['canvas']; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height); + }); + },setCanvasSize:function (width, height, noUpdates) { + var canvas = Module['canvas']; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners(); + },windowedWidth:0,windowedHeight:0,setFullScreenCanvasSize:function () { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; + flags = flags | 0x00800000; // set SDL_FULLSCREEN flag + HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags + } + Browser.updateResizeListeners(); + },setWindowedCanvasSize:function () { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; + flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag + HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags + } + Browser.updateResizeListeners(); + },updateCanvasDimensions:function (canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative; + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative; + } + var w = wNative; + var h = hNative; + if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { + if (w/h < Module['forcedAspectRatio']) { + w = Math.round(h * Module['forcedAspectRatio']); + } else { + h = Math.round(w / Module['forcedAspectRatio']); + } + } + if (((document['webkitFullScreenElement'] || document['webkitFullscreenElement'] || + document['mozFullScreenElement'] || document['mozFullscreenElement'] || + document['fullScreenElement'] || document['fullscreenElement'] || + document['msFullScreenElement'] || document['msFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor); + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != 'undefined') { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != 'undefined') { + if (w != wNative || h != hNative) { + canvas.style.setProperty( "width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important"); + } else { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } + } + },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () { + var handle = Browser.nextWgetRequestHandle; + Browser.nextWgetRequestHandle++; + return handle; + }}; + + function _glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _glfwGetPrimaryMonitor() { + return 1; + } + + + function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + var data = GLctx.getVertexAttrib(index, pname); + if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 'Integer': HEAP32[((params)>>2)]=data; break; + case 'Float': HEAPF32[((params)>>2)]=data; break; + case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break; + default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break; + case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break; + case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break; + default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type; + } + } + } + }function _emscripten_glGetVertexAttribfv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float'); + } + + function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart"); + return 0; + } + + function _glUniform3f(location, v0, v1, v2) { + location = GL.uniforms[location]; + GLctx.uniform3f(location, v0, v1, v2); + } + + function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _emscripten_glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; + if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; + } + } + + function _emscripten_glTexParameteriv(target, pname, params) { + var param = HEAP32[((params)>>2)]; + GLctx.texParameteri(target, pname, param); + } + + function _glDrawElements(mode, count, type, indices) { + + GLctx.drawElements(mode, count, type, indices); + + } + + function _glfwTerminate() { + window.removeEventListener("keydown", GLFW.onKeydown, true); + window.removeEventListener("keypress", GLFW.onKeyPress, true); + window.removeEventListener("keyup", GLFW.onKeyup, true); + Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true); + Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true); + Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true); + Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true); + Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true); + Module["canvas"].width = Module["canvas"].height = 1; + GLFW.windows = null; + GLFW.active = null; + } + + function _emscripten_glUniformMatrix2fv(location, count, transpose, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform matrix + view = GL.miniTempBufferViews[3]; + for (var i = 0; i < 4; i++) { + view[i] = HEAPF32[(((value)+(i*4))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniformMatrix2fv(location, transpose, view); + } + + function _emscripten_glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs; + try { + // open + var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO + var stream = FS.open(pathname, flags, mode); + return stream.fd; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs; + try { + // close + var stream = SYSCALLS.getStreamFromFD(); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function _llvm_stacksave() { + var self = _llvm_stacksave; + if (!self.LLVM_SAVEDSTACKS) { + self.LLVM_SAVEDSTACKS = []; + } + self.LLVM_SAVEDSTACKS.push(Runtime.stackSave()); + return self.LLVM_SAVEDSTACKS.length-1; + } + + function _emscripten_glGetVertexAttribiv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger'); + } + + function _emscripten_glUniformMatrix4fv(location, count, transpose, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform matrix + view = GL.miniTempBufferViews[15]; + for (var i = 0; i < 16; i++) { + view[i] = HEAPF32[(((value)+(i*4))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); + } + GLctx.uniformMatrix4fv(location, transpose, view); + } + + function _glVertexAttrib3f(x0, x1, x2, x3) { GLctx.vertexAttrib3f(x0, x1, x2, x3) } + + function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) { + GLctx['drawArraysInstanced'](mode, first, count, primcount); + } + + function _emscripten_glEnableClientState() { + Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1); + } + + function _emscripten_glGetPointerv() { + Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1); + } + + function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs; + try { + // llseek + var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); + var offset = offset_low; + assert(offset_high === 0); + FS.llseek(stream, offset, whence); + HEAP32[((result)>>2)]=stream.position; + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs; + try { + // writev + var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); + return SYSCALLS.doWritev(stream, iov, iovcnt); + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs; + try { + // readv + var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); + return SYSCALLS.doReadv(stream, iov, iovcnt); + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function _emscripten_glStencilMask(x0) { GLctx.stencilMask(x0) } + + function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx.stencilFuncSeparate(x0, x1, x2, x3) } + + + Module["_i64Subtract"] = _i64Subtract; + + + Module["_i64Add"] = _i64Add; + + function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend"); + return 0; + } + + function _glUseProgram(program) { + GLctx.useProgram(program ? GL.programs[program] : null); + } + + var _sinf=Math_sin; + + function _emscripten_glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); + } + + function _emscripten_glVertexAttrib1f(x0, x1) { GLctx.vertexAttrib1f(x0, x1) } + + function _emscripten_glFinish() { GLctx.finish() } + + function _glDrawArrays(mode, first, count) { + + GLctx.drawArrays(mode, first, count); + + } + + function _emscripten_glDepthFunc(x0) { GLctx.depthFunc(x0) } + + function _sysconf(name) { + // long sysconf(int name); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html + switch(name) { + case 30: return PAGE_SIZE; + case 85: return totalMemory / PAGE_SIZE; + case 132: + case 133: + case 12: + case 137: + case 138: + case 15: + case 235: + case 16: + case 17: + case 18: + case 19: + case 20: + case 149: + case 13: + case 10: + case 236: + case 153: + case 9: + case 21: + case 22: + case 159: + case 154: + case 14: + case 77: + case 78: + case 139: + case 80: + case 81: + case 82: + case 68: + case 67: + case 164: + case 11: + case 29: + case 47: + case 48: + case 95: + case 52: + case 51: + case 46: + return 200809; + case 79: + return 0; + case 27: + case 246: + case 127: + case 128: + case 23: + case 24: + case 160: + case 161: + case 181: + case 182: + case 242: + case 183: + case 184: + case 243: + case 244: + case 245: + case 165: + case 178: + case 179: + case 49: + case 50: + case 168: + case 169: + case 175: + case 170: + case 171: + case 172: + case 97: + case 76: + case 32: + case 173: + case 35: + return -1; + case 176: + case 177: + case 7: + case 155: + case 8: + case 157: + case 125: + case 126: + case 92: + case 93: + case 129: + case 130: + case 131: + case 94: + case 91: + return 1; + case 74: + case 60: + case 69: + case 70: + case 4: + return 1024; + case 31: + case 42: + case 72: + return 32; + case 87: + case 26: + case 33: + return 2147483647; + case 34: + case 1: + return 47839; + case 38: + case 36: + return 99; + case 43: + case 37: + return 2048; + case 0: return 2097152; + case 3: return 65536; + case 28: return 32768; + case 44: return 32767; + case 75: return 16384; + case 39: return 1000; + case 89: return 700; + case 71: return 256; + case 40: return 255; + case 2: return 100; + case 180: return 64; + case 25: return 20; + case 5: return 16; + case 6: return 6; + case 73: return 4; + case 84: { + if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1; + return 1; + } + } + ___setErrNo(ERRNO_CODES.EINVAL); + return -1; + } + + function _emscripten_glUniform4iv(location, count, value) { + location = GL.uniforms[location]; + count *= 4; + value = HEAP32.subarray((value)>>2,(value+count*4)>>2); + GLctx.uniform4iv(location, value); + } + + function _glClear(x0) { GLctx.clear(x0) } + + function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _emscripten_glUniform3fv(location, count, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform + view = GL.miniTempBufferViews[2]; + view[0] = HEAPF32[((value)>>2)]; + view[1] = HEAPF32[(((value)+(4))>>2)]; + view[2] = HEAPF32[(((value)+(8))>>2)]; + } else { + view = HEAPF32.subarray((value)>>2,(value+count*12)>>2); + } + GLctx.uniform3fv(location, view); + } + + function _emscripten_glIsTexture(texture) { + var texture = GL.textures[texture]; + if (!texture) return 0; + return GLctx.isTexture(texture); + } + + function _glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); + } + + function _emscripten_glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _glUniform4f(location, v0, v1, v2, v3) { + location = GL.uniforms[location]; + GLctx.uniform4f(location, v0, v1, v2, v3); + } + + function _glfwCreateWindow(width, height, title, monitor, share) { + return GLFW.createWindow(width, height, title, monitor, share); + } + + function _glfwDefaultWindowHints() { + GLFW.hints = GLFW.defaultHints; + } + + function _pthread_cleanup_pop() { + assert(_pthread_cleanup_push.level == __ATEXIT__.length, 'cannot pop if something else added meanwhile!'); + __ATEXIT__.pop(); + _pthread_cleanup_push.level = __ATEXIT__.length; + } + + function _emscripten_glClearStencil(x0) { GLctx.clearStencil(x0) } + + function _emscripten_glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _emscripten_glDeleteVertexArrays(n, vaos) { + for(var i = 0; i < n; i++) { + var id = HEAP32[(((vaos)+(i*4))>>2)]; + GLctx['deleteVertexArray'](GL.vaos[id]); + GL.vaos[id] = null; + } + } + + function _glfwInit() { + if (GLFW.windows) return 1; // GL_TRUE + + GLFW.initialTime = GLFW.getTime(); + GLFW.hints = GLFW.defaultHints; + GLFW.windows = new Array() + GLFW.active = null; + + window.addEventListener("keydown", GLFW.onKeydown, true); + window.addEventListener("keypress", GLFW.onKeyPress, true); + window.addEventListener("keyup", GLFW.onKeyup, true); + Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true); + Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true); + Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true); + Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true); + Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true); + + Browser.resizeListeners.push(function(width, height) { + GLFW.onFullScreenEventChange(); + }); + return 1; // GL_TRUE + } + + function _emscripten_glGetTexParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _glfwSwapBuffers(winid) { + GLFW.swapBuffers(winid); + } + + function _emscripten_glGenerateMipmap(x0) { GLctx.generateMipmap(x0) } + + function _emscripten_glCullFace(x0) { GLctx.cullFace(x0) } + + function _emscripten_glUniform4f(location, v0, v1, v2, v3) { + location = GL.uniforms[location]; + GLctx.uniform4f(location, v0, v1, v2, v3); + } + + function _glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); + } + + function _emscripten_glUseProgram(program) { + GLctx.useProgram(program ? GL.programs[program] : null); + } + + function _emscripten_glHint(x0, x1) { GLctx.hint(x0, x1) } + + function _emscripten_glUniform2fv(location, count, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform + view = GL.miniTempBufferViews[1]; + view[0] = HEAPF32[((value)>>2)]; + view[1] = HEAPF32[(((value)+(4))>>2)]; + } else { + view = HEAPF32.subarray((value)>>2,(value+count*8)>>2); + } + GLctx.uniform2fv(location, view); + } + + function _glfwSwapInterval(interval) { + interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same. + if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval); + } + + function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + log = log.substr(0, maxLength - 1); + if (maxLength > 0 && infoLog) { + writeStringToMemory(log, infoLog); + if (length) HEAP32[((length)>>2)]=log.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _abort() { + Module['abort'](); + } + + function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, + GL.renderbuffers[renderbuffer]); + } + + var _tan=Math_tan; + + function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + var heapView; + if (data) { + heapView = HEAPU8.subarray((data),(data+imageSize)); + } else { + heapView = null; + } + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, heapView); + } + + function _emscripten_glIsBuffer(buffer) { + var b = GL.buffers[buffer]; + if (!b) return 0; + return GLctx.isBuffer(b); + } + + function _emscripten_glUniform2iv(location, count, value) { + location = GL.uniforms[location]; + count *= 2; + value = HEAP32.subarray((value)>>2,(value+count*4)>>2); + GLctx.uniform2iv(location, value); + } + + function _emscripten_glVertexAttrib1fv(index, v) { + v = HEAPF32.subarray((v)>>2,(v+4)>>2); + GLctx.vertexAttrib1fv(index, v); + } + + function _glEnable(x0) { GLctx.enable(x0) } + + var _fabs=Math_abs; + + + + function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) { + function roundedToNextMultipleOf(x, y) { + return Math.floor((x + y - 1) / y) * y + } + var plainRowSize = width * sizePerPixel; + var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); + return (height <= 0) ? 0 : + ((height - 1) * alignedRowSize + plainRowSize); + }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { + var sizePerPixel; + var numChannels; + switch(format) { + case 0x1906 /* GL_ALPHA */: + case 0x1909 /* GL_LUMINANCE */: + case 0x1902 /* GL_DEPTH_COMPONENT */: + case 0x1903 /* GL_RED */: + numChannels = 1; + break; + case 0x190A /* GL_LUMINANCE_ALPHA */: + case 0x8227 /* GL_RG */: + numChannels = 2; + break; + case 0x1907 /* GL_RGB */: + case 0x8C40 /* GL_SRGB_EXT */: + numChannels = 3; + break; + case 0x1908 /* GL_RGBA */: + case 0x8C42 /* GL_SRGB_ALPHA_EXT */: + numChannels = 4; + break; + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return { + pixels: null, + internalFormat: 0x0 + }; + } + switch (type) { + case 0x1401 /* GL_UNSIGNED_BYTE */: + sizePerPixel = numChannels*1; + break; + case 0x1403 /* GL_UNSIGNED_SHORT */: + case 0x8D61 /* GL_HALF_FLOAT_OES */: + sizePerPixel = numChannels*2; + break; + case 0x1405 /* GL_UNSIGNED_INT */: + case 0x1406 /* GL_FLOAT */: + sizePerPixel = numChannels*4; + break; + case 0x84FA /* UNSIGNED_INT_24_8_WEBGL/UNSIGNED_INT_24_8 */: + sizePerPixel = 4; + break; + case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */: + case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */: + case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */: + sizePerPixel = 2; + break; + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return { + pixels: null, + internalFormat: 0x0 + }; + } + var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment); + if (type == 0x1401 /* GL_UNSIGNED_BYTE */) { + pixels = HEAPU8.subarray((pixels),(pixels+bytes)); + } else if (type == 0x1406 /* GL_FLOAT */) { + pixels = HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2); + } else if (type == 0x1405 /* GL_UNSIGNED_INT */ || type == 0x84FA /* UNSIGNED_INT_24_8_WEBGL */) { + pixels = HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2); + } else { + pixels = HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1); + } + return { + pixels: pixels, + internalFormat: internalFormat + }; + }function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { + var pixelData; + if (pixels) { + pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, -1).pixels; + } else { + pixelData = null; + } + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData); + } + + function _emscripten_glPolygonOffset(x0, x1) { GLctx.polygonOffset(x0, x1) } + + var _emscripten_asm_const_int=true; + + function _emscripten_glUniform2f(location, v0, v1) { + location = GL.uniforms[location]; + GLctx.uniform2f(location, v0, v1); + } + + function _glGetAttribLocation(program, name) { + program = GL.programs[program]; + name = Pointer_stringify(name); + return GLctx.getAttribLocation(program, name); + } + + function _glfwWindowHint(target, hint) { + GLFW.hints[target] = hint; + } + + function _emscripten_glUniform2i(location, v0, v1) { + location = GL.uniforms[location]; + GLctx.uniform2i(location, v0, v1); + } + + function _glBlendFunc(x0, x1) { GLctx.blendFunc(x0, x1) } + + function _glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + GL.programs[id] = program; + return id; + } + + function _emscripten_glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((renderbuffers)+(i*4))>>2)]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects". + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null; + } + } + + function _emscripten_glGetBufferParameteriv(target, value, data) { + if (!data) { + // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense + // if data == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value); + } + + + function emscriptenWebGLGetUniform(program, location, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]); + if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 'Integer': HEAP32[((params)>>2)]=data; break; + case 'Float': HEAPF32[((params)>>2)]=data; break; + default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break; + case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break; + default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type; + } + } + } + }function _emscripten_glGetUniformiv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 'Integer'); + } + + function _emscripten_glDepthMask(x0) { GLctx.depthMask(x0) } + + + function _emscripten_glDepthRangef(x0, x1) { GLctx.depthRange(x0, x1) } + + function _emscripten_glDepthRange(x0, x1) { GLctx.depthRange(x0, x1) } + + function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) { + if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1; + if (!target) target = document; + else { + target = JSEvents.findEventTarget(target); + if (!target) return -4; + } + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange"); + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange"); + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange"); + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange"); + return 0; + } + + function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { + var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); + HEAP32[((range)>>2)]=result.rangeMin; + HEAP32[(((range)+(4))>>2)]=result.rangeMax; + HEAP32[((precision)>>2)]=result.precision; + } + + function _emscripten_glUniform1fv(location, count, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform + view = GL.miniTempBufferViews[0]; + view[0] = HEAPF32[((value)>>2)]; + } else { + view = HEAPF32.subarray((value)>>2,(value+count*4)>>2); + } + GLctx.uniform1fv(location, view); + } + + function _glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; + if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; + } + } + + var _atan2=Math_atan2; + + function _emscripten_glBindProgramARB() { + Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1); + } + + function _emscripten_glBindTexture(target, texture) { + GLctx.bindTexture(target, texture ? GL.textures[texture] : null); + } + + function _emscripten_glCheckFramebufferStatus(x0) { return GLctx.checkFramebufferStatus(x0) } + + function _emscripten_glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + GL.programInfos[id] = null; + } + + function _emscripten_glDisable(x0) { GLctx.disable(x0) } + + function _emscripten_glVertexAttrib3fv(index, v) { + v = HEAPF32.subarray((v)>>2,(v+12)>>2); + GLctx.vertexAttrib3fv(index, v); + } + + function _glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) } + + function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx.getActiveAttrib(program, index); + if (!info) return; // If an error occurs, nothing will be written to length, size and type and name. + + var infoname = info.name.slice(0, Math.max(0, bufSize - 1)); + if (bufSize > 0 && name) { + writeStringToMemory(infoname, name); + if (length) HEAP32[((length)>>2)]=infoname.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + + if (size) HEAP32[((size)>>2)]=info.size; + if (type) HEAP32[((type)>>2)]=info.type; + } + + function _emscripten_glIsFramebuffer(framebuffer) { + var fb = GL.framebuffers[framebuffer]; + if (!fb) return 0; + return GLctx.isFramebuffer(fb); + } + + function _emscripten_glLineWidth(x0) { GLctx.lineWidth(x0) } + + function _glfwGetCursorPos(winid, x, y) { + GLFW.getCursorPos(winid, x, y); + } + + function _emscripten_glGetString(name_) { + if (GL.stringCache[name_]) return GL.stringCache[name_]; + var ret; + switch(name_) { + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x1F02 /* GL_VERSION */: + ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL); + break; + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions(); + var gl_exts = []; + for (var i in exts) { + gl_exts.push(exts[i]); + gl_exts.push("GL_" + exts[i]); + } + ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + ret = allocate(intArrayFromString('OpenGL ES GLSL 1.00 (WebGL)'), 'i8', ALLOC_NORMAL); + break; + default: + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return 0; + } + GL.stringCache[name_] = ret; + return ret; + } + + function _emscripten_glGetAttribLocation(program, name) { + program = GL.programs[program]; + name = Pointer_stringify(name); + return GLctx.getAttribLocation(program, name); + } + + function _emscripten_glRotatef() { + Module['printErr']('missing function: emscripten_glRotatef'); abort(-1); + } + + + function emscriptenWebGLGet(name_, p, type) { + // Guard against user passing a null pointer. + // Note that GLES2 spec does not say anything about how passing a null pointer should be treated. + // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but + // better to report an error instead of doing anything random. + if (!p) { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + var ret = undefined; + switch(name_) { // Handle a few trivial GLES values + case 0x8DFA: // GL_SHADER_COMPILER + ret = 1; + break; + case 0x8DF8: // GL_SHADER_BINARY_FORMATS + if (type !== 'Integer' && type !== 'Integer64') { + GL.recordError(0x0500); // GL_INVALID_ENUM + } + return; // Do not write anything to the out pointer, since no binary formats are supported. + case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS + ret = 0; + break; + case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS + // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length), + // so implement it ourselves to allow C++ GLES2 code get the length. + var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/); + ret = formats.length; + break; + case 0x8B9A: // GL_IMPLEMENTATION_COLOR_READ_TYPE + ret = 0x1401; // GL_UNSIGNED_BYTE + break; + case 0x8B9B: // GL_IMPLEMENTATION_COLOR_READ_FORMAT + ret = 0x1908; // GL_RGBA + break; + } + + if (ret === undefined) { + var result = GLctx.getParameter(name_); + switch (typeof(result)) { + case "number": + ret = result; + break; + case "boolean": + ret = result ? 1 : 0; + break; + case "string": + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + case "object": + if (result === null) { + // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise + // can mean an invalid name_, which we need to report as an error + switch(name_) { + case 0x8894: // ARRAY_BUFFER_BINDING + case 0x8B8D: // CURRENT_PROGRAM + case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING + case 0x8CA6: // FRAMEBUFFER_BINDING + case 0x8CA7: // RENDERBUFFER_BINDING + case 0x8069: // TEXTURE_BINDING_2D + case 0x8514: { // TEXTURE_BINDING_CUBE_MAP + ret = 0; + break; + } + default: { + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + } + } + } else if (result instanceof Float32Array || + result instanceof Uint32Array || + result instanceof Int32Array || + result instanceof Array) { + for (var i = 0; i < result.length; ++i) { + switch (type) { + case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break; + case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break; + case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break; + default: throw 'internal glGet error, bad type: ' + type; + } + } + return; + } else if (result instanceof WebGLBuffer || + result instanceof WebGLProgram || + result instanceof WebGLFramebuffer || + result instanceof WebGLRenderbuffer || + result instanceof WebGLTexture) { + ret = result.name | 0; + } else { + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + } + break; + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + } + } + + switch (type) { + case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break; + case 'Integer': HEAP32[((p)>>2)]=ret; break; + case 'Float': HEAPF32[((p)>>2)]=ret; break; + case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break; + default: throw 'internal glGet error, bad type: ' + type; + } + }function _emscripten_glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 'Integer'); + } + + function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { + var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); + HEAP32[((params)>>2)]=result; + } + + function _llvm_stackrestore(p) { + var self = _llvm_stacksave; + var ret = self.LLVM_SAVEDSTACKS[p]; + self.LLVM_SAVEDSTACKS.splice(p, 1); + Runtime.stackRestore(ret); + } + + function _glfwSetWindowShouldClose(winid, value) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.shouldClose = value; + } + + function _emscripten_glClientActiveTexture() { + Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1); + } + + function _glGenBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var buffer = GLctx.createBuffer(); + if (!buffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.buffers); + buffer.name = id; + GL.buffers[id] = buffer; + HEAP32[(((buffers)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + log = log.substr(0, maxLength - 1); + if (maxLength > 0 && infoLog) { + writeStringToMemory(log, infoLog); + if (length) HEAP32[((length)>>2)]=log.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _glfwGetTime() { + return GLFW.getTime() - GLFW.initialTime; + } + + function _emscripten_glGetRenderbufferParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname); + } + + function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx.stencilOpSeparate(x0, x1, x2, x3) } + + function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) { + var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!data.pixels) { + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return; + } + GLctx.readPixels(x, y, width, height, format, type, data.pixels); + } + + function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { + var heapView; + if (data) { + heapView = HEAPU8.subarray((data),(data+imageSize)); + } else { + heapView = null; + } + GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, heapView); + } + + function _emscripten_glGetError() { + // First return any GL error generated by the emscripten library_gl.js interop layer. + if (GL.lastError) { + var error = GL.lastError; + GL.lastError = 0/*GL_NO_ERROR*/; + return error; + } else { // If there were none, return the GL error from the browser GL context. + return GLctx.getError(); + } + } + + function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, + GL.textures[texture], level); + } + + function _pthread_cleanup_push(routine, arg) { + __ATEXIT__.push(function() { Runtime.dynCall('vi', routine, [arg]) }) + _pthread_cleanup_push.level = __ATEXIT__.length; + } + + function _emscripten_glIsEnabled(x0) { return GLctx.isEnabled(x0) } + + function _glClearDepthf(x0) { GLctx.clearDepth(x0) } + + + Module["_memmove"] = _memmove; + + function _glGenTextures(n, textures) { + for (var i = 0; i < n; i++) { + var texture = GLctx.createTexture(); + if (!texture) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. + while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.textures); + texture.name = id; + GL.textures[id] = texture; + HEAP32[(((textures)+(i*4))>>2)]=id; + } + } + + function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx.vertexAttrib4f(x0, x1, x2, x3, x4) } + + function _glDepthFunc(x0) { GLctx.depthFunc(x0) } + + function _emscripten_glClearDepthf(x0) { GLctx.clearDepth(x0) } + + function _emscripten_glClear(x0) { GLctx.clear(x0) } + + function _emscripten_glBindBuffer(target, buffer) { + var bufferObj = buffer ? GL.buffers[buffer] : null; + + + GLctx.bindBuffer(target, bufferObj); + } + + function _emscripten_glGetUniformfv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 'Float'); + } + + function _glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + var ptable = GL.programInfos[program]; + if (ptable) { + HEAP32[((p)>>2)]=ptable.maxUniformLength; + return; + } else if (program < GL.counter) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + } else { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + } + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + var ptable = GL.programInfos[program]; + if (ptable) { + if (ptable.maxAttributeLength == -1) { + var program = GL.programs[program]; + var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); + ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. + for(var i = 0; i < numAttribs; ++i) { + var activeAttrib = GLctx.getActiveAttrib(program, i); + ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxAttributeLength; + return; + } else if (program < GL.counter) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + } else { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + } + } else { + HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); + } + } + + function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr); + } + + function _emscripten_glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + var ptable = GL.programInfos[program]; + if (ptable) { + HEAP32[((p)>>2)]=ptable.maxUniformLength; + return; + } else if (program < GL.counter) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + } else { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + } + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + var ptable = GL.programInfos[program]; + if (ptable) { + if (ptable.maxAttributeLength == -1) { + var program = GL.programs[program]; + var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); + ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. + for(var i = 0; i < numAttribs; ++i) { + var activeAttrib = GLctx.getActiveAttrib(program, i); + ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxAttributeLength; + return; + } else if (program < GL.counter) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + } else { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + } + } else { + HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); + } + } + + function _emscripten_glDrawRangeElements() { + Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1); + } + + function _glGetUniformLocation(program, name) { + name = Pointer_stringify(name); + + var arrayOffset = 0; + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + var arrayIndex = name.slice(ls+1, -1); + if (arrayIndex.length > 0) { + arrayOffset = parseInt(arrayIndex); + if (arrayOffset < 0) { + return -1; + } + } + name = name.slice(0, ls); + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + return -1; + } + var utable = ptable.uniforms; + var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] + if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. + return uniformInfo[1]+arrayOffset; + } else { + return -1; + } + } + + function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) { + var result = GLctx.getAttachedShaders(GL.programs[program]); + var len = result.length; + if (len > maxCount) { + len = maxCount; + } + HEAP32[((count)>>2)]=len; + for (var i = 0; i < len; ++i) { + var id = GL.shaders.indexOf(result[i]); + HEAP32[(((shaders)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var renderbuffer = GLctx.createRenderbuffer(); + if (!renderbuffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.renderbuffers); + renderbuffer.name = id; + GL.renderbuffers[id] = renderbuffer; + HEAP32[(((renderbuffers)+(i*4))>>2)]=id; + } + } + + function _emscripten_glFrontFace(x0) { GLctx.frontFace(x0) } + + function _emscripten_glActiveTexture(x0) { GLctx.activeTexture(x0) } + + function _emscripten_glUniform1iv(location, count, value) { + location = GL.uniforms[location]; + value = HEAP32.subarray((value)>>2,(value+count*4)>>2); + GLctx.uniform1iv(location, value); + } + + function _glUniform4fv(location, count, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform + view = GL.miniTempBufferViews[3]; + view[0] = HEAPF32[((value)>>2)]; + view[1] = HEAPF32[(((value)+(4))>>2)]; + view[2] = HEAPF32[(((value)+(8))>>2)]; + view[3] = HEAPF32[(((value)+(12))>>2)]; + } else { + view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniform4fv(location, view); + } + + function _emscripten_glTexCoordPointer() { + Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1); + } + + function _emscripten_glGetInfoLogARB() { + Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1); + } + + + function __exit(status) { + // void _exit(int status); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html + Module['exit'](status); + }function _exit(status) { + __exit(status); + } + + function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx.renderbufferStorage(x0, x1, x2, x3) } + + function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx.copyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) } + + function _glfwSetCursorPosCallback(winid, cbfun) { + GLFW.setCursorPosCallback(winid, cbfun); + } + + function _glBindAttribLocation(program, index, name) { + name = Pointer_stringify(name); + GLctx.bindAttribLocation(GL.programs[program], index, name); + } + + function _emscripten_glShaderBinary() { + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + } + + function _emscripten_glIsProgram(program) { + var program = GL.programs[program]; + if (!program) return 0; + return GLctx.isProgram(program); + } + + function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx.blendColor(x0, x1, x2, x3) } + + function _emscripten_glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else { + HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + function _emscripten_glUniformMatrix3fv(location, count, transpose, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform matrix + view = GL.miniTempBufferViews[8]; + for (var i = 0; i < 9; i++) { + view[i] = HEAPF32[(((value)+(i*4))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*36)>>2); + } + GLctx.uniformMatrix3fv(location, transpose, view); + } + + function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx.vertexAttrib2f(x0, x1, x2) } + + function _emscripten_glUniform4fv(location, count, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform + view = GL.miniTempBufferViews[3]; + view[0] = HEAPF32[((value)>>2)]; + view[1] = HEAPF32[(((value)+(4))>>2)]; + view[2] = HEAPF32[(((value)+(8))>>2)]; + view[3] = HEAPF32[(((value)+(12))>>2)]; + } else { + view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniform4fv(location, view); + } + + function _glBufferSubData(target, offset, size, data) { + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); + } + + function _glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + + log = log.substr(0, maxLength - 1); + if (maxLength > 0 && infoLog) { + writeStringToMemory(log, infoLog); + if (length) HEAP32[((length)>>2)]=log.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _emscripten_glGenFramebuffers(n, ids) { + for (var i = 0; i < n; ++i) { + var framebuffer = GLctx.createFramebuffer(); + if (!framebuffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.framebuffers); + framebuffer.name = id; + GL.framebuffers[id] = framebuffer; + HEAP32[(((ids)+(i*4))>>2)]=id; + } + } + + function _glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else { + HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx.blendEquationSeparate(x0, x1) } + + function _glfwSetWindowIconifyCallback(winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowIconifyFunc = cbfun; + } + + function _emscripten_glUniform1i(location, v0) { + location = GL.uniforms[location]; + GLctx.uniform1i(location, v0); + } + + function _emscripten_glGenTextures(n, textures) { + for (var i = 0; i < n; i++) { + var texture = GLctx.createTexture(); + if (!texture) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. + while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.textures); + texture.name = id; + GL.textures[id] = texture; + HEAP32[(((textures)+(i*4))>>2)]=id; + } + } + + function _emscripten_glVertexAttrib2fv(index, v) { + v = HEAPF32.subarray((v)>>2,(v+8)>>2); + GLctx.vertexAttrib2fv(index, v); + } + + function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx.getActiveUniform(program, index); + if (!info) return; // If an error occurs, nothing will be written to length, size, type and name. + + var infoname = info.name.slice(0, Math.max(0, bufSize - 1)); + if (bufSize > 0 && name) { + writeStringToMemory(infoname, name); + if (length) HEAP32[((length)>>2)]=infoname.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + + if (size) HEAP32[((size)>>2)]=info.size; + if (type) HEAP32[((type)>>2)]=info.type; + } + + function _emscripten_glDeleteObjectARB() { + Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1); + } + + function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove"); + return 0; + } + + function _emscripten_glUniform1f(location, v0) { + location = GL.uniforms[location]; + GLctx.uniform1f(location, v0); + } + + function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, normalized, stride, ptr); + } + + function _glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + GLctx.shaderSource(GL.shaders[shader], source); + } + + var _sqrtf=Math_sqrt; + + function _emscripten_glDrawArrays(mode, first, count) { + + GLctx.drawArrays(mode, first, count); + + } + + function _emscripten_glGenBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var buffer = GLctx.createBuffer(); + if (!buffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.buffers); + buffer.name = id; + GL.buffers[id] = buffer; + HEAP32[(((buffers)+(i*4))>>2)]=id; + } + } + + function _emscripten_glClearDepth(x0) { GLctx.clearDepth(x0) } + + function _glfwSetCharCallback(winid, cbfun) { + GLFW.setCharCallback(winid, cbfun); + } + + function _emscripten_glGetUniformLocation(program, name) { + name = Pointer_stringify(name); + + var arrayOffset = 0; + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + var arrayIndex = name.slice(ls+1, -1); + if (arrayIndex.length > 0) { + arrayOffset = parseInt(arrayIndex); + if (arrayOffset < 0) { + return -1; + } + } + name = name.slice(0, ls); + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + return -1; + } + var utable = ptable.uniforms; + var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] + if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. + return uniformInfo[1]+arrayOffset; + } else { + return -1; + } + } + + function _glActiveTexture(x0) { GLctx.activeTexture(x0) } + + function _glBindBuffer(target, buffer) { + var bufferObj = buffer ? GL.buffers[buffer] : null; + + + GLctx.bindBuffer(target, bufferObj); + } + + function _emscripten_glVertexAttrib4fv(index, v) { + v = HEAPF32.subarray((v)>>2,(v+16)>>2); + GLctx.vertexAttrib4fv(index, v); + } + + function _emscripten_glScissor(x0, x1, x2, x3) { GLctx.scissor(x0, x1, x2, x3) } + + function _glfwSetCursorEnterCallback(winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.cursorEnterFunc = cbfun; + } + + + Module["_bitshift64Lshr"] = _bitshift64Lshr; + + function _glBufferData(target, size, data, usage) { + switch (usage) { // fix usages, WebGL only has *_DRAW + case 0x88E1: // GL_STREAM_READ + case 0x88E2: // GL_STREAM_COPY + usage = 0x88E0; // GL_STREAM_DRAW + break; + case 0x88E5: // GL_STATIC_READ + case 0x88E6: // GL_STATIC_COPY + usage = 0x88E4; // GL_STATIC_DRAW + break; + case 0x88E9: // GL_DYNAMIC_READ + case 0x88EA: // GL_DYNAMIC_COPY + usage = 0x88E8; // GL_DYNAMIC_DRAW + break; + } + if (!data) { + GLctx.bufferData(target, size, usage); + } else { + GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); + } + } + + var _BDtoIHigh=true; + + function _emscripten_glIsShader(shader) { + var s = GL.shaders[shader]; + if (!s) return 0; + return GLctx.isShader(s); + } + + function _emscripten_glDrawBuffers(n, bufs) { + var bufArray = []; + for (var i = 0; i < n; i++) + bufArray.push(HEAP32[(((bufs)+(i*4))>>2)]); + + GLctx['drawBuffers'](bufArray); + } + + function _emscripten_glBindFramebuffer(target, framebuffer) { + GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null); + } + + function _emscripten_glBlendEquation(x0) { GLctx.blendEquation(x0) } + + function _emscripten_glBufferSubData(target, offset, size, data) { + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); + } + + function _emscripten_glBufferData(target, size, data, usage) { + switch (usage) { // fix usages, WebGL only has *_DRAW + case 0x88E1: // GL_STREAM_READ + case 0x88E2: // GL_STREAM_COPY + usage = 0x88E0; // GL_STREAM_DRAW + break; + case 0x88E5: // GL_STATIC_READ + case 0x88E6: // GL_STATIC_COPY + usage = 0x88E4; // GL_STATIC_DRAW + break; + case 0x88E9: // GL_DYNAMIC_READ + case 0x88EA: // GL_DYNAMIC_COPY + usage = 0x88E8; // GL_DYNAMIC_DRAW + break; + } + if (!data) { + GLctx.bufferData(target, size, usage); + } else { + GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); + } + } + + function _sbrk(bytes) { + // Implement a Linux-like 'memory area' for our 'process'. + // Changes the size of the memory area by |bytes|; returns the + // address of the previous top ('break') of the memory area + // We control the "dynamic" memory - DYNAMIC_BASE to DYNAMICTOP + var self = _sbrk; + if (!self.called) { + DYNAMICTOP = alignMemoryPage(DYNAMICTOP); // make sure we start out aligned + self.called = true; + assert(Runtime.dynamicAlloc); + self.alloc = Runtime.dynamicAlloc; + Runtime.dynamicAlloc = function() { abort('cannot dynamically allocate, sbrk now has control') }; + } + var ret = DYNAMICTOP; + if (bytes != 0) { + var success = self.alloc(bytes); + if (!success) return -1 >>> 0; // sbrk failure code + } + return ret; // Previous break location. + } + + + Module["_bitshift64Shl"] = _bitshift64Shl; + + var _BItoD=true; + + function _emscripten_glGetShaderSource(shader, bufSize, length, source) { + var result = GLctx.getShaderSource(GL.shaders[shader]); + if (!result) return; // If an error occurs, nothing will be written to length or source. + result = result.slice(0, Math.max(0, bufSize - 1)); + if (bufSize > 0 && source) { + writeStringToMemory(result, source); + if (length) HEAP32[((length)>>2)]=result.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _glfwSetKeyCallback(winid, cbfun) { + GLFW.setKeyCallback(winid, cbfun); + } + + function _emscripten_glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 'Float'); + } + + function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + var pixelData; + if (pixels) { + var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); + pixelData = data.pixels; + internalFormat = data.internalFormat; + } else { + pixelData = null; + } + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); + } + + function ___assert_fail(condition, filename, line, func) { + ABORT = true; + throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace(); + } + + function _emscripten_glVertexAttribDivisor(index, divisor) { + GLctx['vertexAttribDivisor'](index, divisor); + } + + function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) { + GLctx['drawElementsInstanced'](mode, count, type, indices, primcount); + } + + function _emscripten_glDrawElements(mode, count, type, indices) { + + GLctx.drawElements(mode, count, type, indices); + + } + + function _glfwSetMouseButtonCallback(winid, cbfun) { + GLFW.setMouseButtonCallback(winid, cbfun); + } + + function _emscripten_glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + GL.programs[id] = program; + return id; + } + + function _emscripten_glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[(((framebuffers)+(i*4))>>2)]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null; + } + } + + function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx.clearColor(x0, x1, x2, x3) } + + function _emscripten_glBindVertexArray(vao) { + GLctx['bindVertexArray'](GL.vaos[vao]); + } + + function _emscripten_glLoadMatrixf() { + Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1); + } + + function _glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + + log = log.substr(0, maxLength - 1); + if (maxLength > 0 && infoLog) { + writeStringToMemory(log, infoLog); + if (length) HEAP32[((length)>>2)]=log.length; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + var pixelData; + if (pixels) { + var data = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); + pixelData = data.pixels; + internalFormat = data.internalFormat; + } else { + pixelData = null; + } + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); + } + + function _glPixelStorei(pname, param) { + if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) { + GL.packAlignment = param; + } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); + } + + function ___unlock() {} + + function _emscripten_glColorPointer() { + Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1); + } + + function _glViewport(x0, x1, x2, x3) { GLctx.viewport(x0, x1, x2, x3) } + + function _glfwPollEvents() {} + + function _glVertexAttrib2f(x0, x1, x2) { GLctx.vertexAttrib2f(x0, x1, x2) } + + function _glfwDestroyWindow(winid) { + return GLFW.destroyWindow(winid); + } + + function _emscripten_glFlush() { GLctx.flush() } + + function _glfwSetErrorCallback(cbfun) { + GLFW.errorFunc = cbfun; + } + + function _emscripten_glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; + } + + function _glUniformMatrix4fv(location, count, transpose, value) { + location = GL.uniforms[location]; + var view; + if (count === 1) { + // avoid allocation for the common case of uploading one uniform matrix + view = GL.miniTempBufferViews[15]; + for (var i = 0; i < 16; i++) { + view[i] = HEAPF32[(((value)+(i*4))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); + } + GLctx.uniformMatrix4fv(location, transpose, view); + } + + function _emscripten_glValidateProgram(program) { + GLctx.validateProgram(GL.programs[program]); + } + + function _glTexParameteri(x0, x1, x2) { GLctx.texParameteri(x0, x1, x2) } + + function _glFrontFace(x0) { GLctx.frontFace(x0) } + + function _emscripten_glColorMask(x0, x1, x2, x3) { GLctx.colorMask(x0, x1, x2, x3) } + + function _emscripten_glPixelStorei(pname, param) { + if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) { + GL.packAlignment = param; + } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); + } + + function _emscripten_glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _emscripten_glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + function _emscripten_glGenVertexArrays(n, arrays) { + + for(var i = 0; i < n; i++) { + var vao = GLctx['createVertexArray'](); + if (!vao) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.vaos); + vao.name = id; + GL.vaos[id] = vao; + HEAP32[(((arrays)+(i*4))>>2)]=id; + } + } + + function _time(ptr) { + var ret = (Date.now()/1000)|0; + if (ptr) { + HEAP32[((ptr)>>2)]=ret; + } + return ret; + } + + function _pthread_self() { + //FIXME: assumes only a single thread + return 0; + } + + function _emscripten_glGetBooleanv(name_, p) { + emscriptenWebGLGet(name_, p, 'Boolean'); + } + + function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs; + try { + // fcntl64 + var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get(); + switch (cmd) { + case 0: { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -ERRNO_CODES.EINVAL; + } + var newStream; + newStream = FS.open(stream.path, stream.flags, 0, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + case 12: + case 12: { + var arg = SYSCALLS.get(); + var offset = 0; + // We're always unlocked. + HEAP16[(((arg)+(offset))>>1)]=2; + return 0; + } + case 13: + case 14: + case 13: + case 14: + return 0; // Pretend that the locking is successful. + case 16: + case 8: + return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet. + case 9: + // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves. + ___setErrNo(ERRNO_CODES.EINVAL); + return -1; + default: { + return -ERRNO_CODES.EINVAL; + } + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } +var GLctx; GL.init() +FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink; +__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() }); +if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); } +Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) }; + Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; + Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; + Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; + Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; + Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } + Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) } +STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP); + +staticSealed = true; // seal the static portion of memory + +STACK_MAX = STACK_BASE + TOTAL_STACK; + +DYNAMIC_BASE = DYNAMICTOP = Runtime.alignMemory(STACK_MAX); + +assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack"); + + var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_DYNAMIC); + + +function invoke_viiiii(index,a1,a2,a3,a4,a5) { + try { + Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vd(index,a1) { + try { + Module["dynCall_vd"](index,a1); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vid(index,a1,a2) { + try { + Module["dynCall_vid"](index,a1,a2); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vi(index,a1) { + try { + Module["dynCall_vi"](index,a1); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vii(index,a1,a2) { + try { + Module["dynCall_vii"](index,a1,a2); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_ii(index,a1) { + try { + return Module["dynCall_ii"](index,a1); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viddd(index,a1,a2,a3,a4) { + try { + Module["dynCall_viddd"](index,a1,a2,a3,a4); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vidd(index,a1,a2,a3) { + try { + Module["dynCall_vidd"](index,a1,a2,a3); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_iiii(index,a1,a2,a3) { + try { + return Module["dynCall_iiii"](index,a1,a2,a3); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + try { + Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) { + try { + Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viii(index,a1,a2,a3) { + try { + Module["dynCall_viii"](index,a1,a2,a3); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vidddd(index,a1,a2,a3,a4,a5) { + try { + Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vdi(index,a1,a2) { + try { + Module["dynCall_vdi"](index,a1,a2); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + try { + Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + try { + Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_iii(index,a1,a2) { + try { + return Module["dynCall_iii"](index,a1,a2); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_i(index) { + try { + return Module["dynCall_i"](index); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_iiiiii(index,a1,a2,a3,a4,a5) { + try { + return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) { + try { + Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vdddd(index,a1,a2,a3,a4) { + try { + Module["dynCall_vdddd"](index,a1,a2,a3,a4); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_vdd(index,a1,a2) { + try { + Module["dynCall_vdd"](index,a1,a2); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_v(index) { + try { + Module["dynCall_v"](index); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viid(index,a1,a2,a3) { + try { + Module["dynCall_viid"](index,a1,a2,a3); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +function invoke_viiii(index,a1,a2,a3,a4) { + try { + Module["dynCall_viiii"](index,a1,a2,a3,a4); + } catch(e) { + if (typeof e !== 'number' && e !== 'longjmp') throw e; + asm["setThrew"](1, 0); + } +} + +Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity }; + +Module.asmLibraryArg = { "abort": abort, "assert": assert, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_iiiiii": invoke_iiiiii, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_eglGetProcAddress": _eglGetProcAddress, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_glVertexAttrib4f": _glVertexAttrib4f, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_sbrk": _sbrk, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_sysconf": _sysconf, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_fabs": _fabs, "_glUniform4f": _glUniform4f, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_tan": _tan, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_glVertexAttrib3f": _glVertexAttrib3f, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_pthread_cleanup_push": _pthread_cleanup_push, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "___syscall146": ___syscall146, "_glfwDestroyWindow": _glfwDestroyWindow, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_atan2": _atan2, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glClear": _emscripten_glClear, "_glDrawElements": _glDrawElements, "_glBufferSubData": _glBufferSubData, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_glUniform3f": _glUniform3f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_glGenTextures": _glGenTextures, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_glGetString": _glGetString, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_glCreateShader": _glCreateShader, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_eglWaitClient": _eglWaitClient, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glEnable": _emscripten_glEnable, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "_glDisable": _glDisable, "___lock": ___lock, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_glBindFramebuffer": _glBindFramebuffer, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_asm_const_2": _emscripten_asm_const_2, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_glCullFace": _glCullFace, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_glfwPollEvents": _glfwPollEvents, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_glfwGetVideoModes": _glfwGetVideoModes, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "___syscall221": ___syscall221, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_glClearDepthf": _glClearDepthf, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glDisable": _emscripten_glDisable, "_glfwSetCharCallback": _glfwSetCharCallback, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glHint": _emscripten_glHint, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_sqrtf": _sqrtf, "_glActiveTexture": _glActiveTexture, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_glfwTerminate": _glfwTerminate, "_glFrontFace": _glFrontFace, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_glfwSwapInterval": _glfwSwapInterval, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_glUniform1f": _glUniform1f, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_glGetProgramiv": _glGetProgramiv, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_glUniform4fv": _glUniform4fv, "_emscripten_glFrustum": _emscripten_glFrustum, "_glVertexAttrib2f": _glVertexAttrib2f, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_sinf": _sinf, "__exit": __exit, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glBindAttribLocation": _glBindAttribLocation, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_pthread_self": _pthread_self, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_cosf": _cosf, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_glTexParameteri": _glTexParameteri, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "cttz_i8": cttz_i8 }; +// EMSCRIPTEN_START_ASM +var asm = (function(global, env, buffer) { + 'use asm'; + + + var HEAP8 = new global.Int8Array(buffer); + var HEAP16 = new global.Int16Array(buffer); + var HEAP32 = new global.Int32Array(buffer); + var HEAPU8 = new global.Uint8Array(buffer); + var HEAPU16 = new global.Uint16Array(buffer); + var HEAPU32 = new global.Uint32Array(buffer); + var HEAPF32 = new global.Float32Array(buffer); + var HEAPF64 = new global.Float64Array(buffer); + + + var STACKTOP=env.STACKTOP|0; + var STACK_MAX=env.STACK_MAX|0; + var tempDoublePtr=env.tempDoublePtr|0; + var ABORT=env.ABORT|0; + var cttz_i8=env.cttz_i8|0; + + var __THREW__ = 0; + var threwValue = 0; + var setjmpId = 0; + var undef = 0; + var nan = global.NaN, inf = global.Infinity; + var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0; + + var tempRet0 = 0; + var tempRet1 = 0; + var tempRet2 = 0; + var tempRet3 = 0; + var tempRet4 = 0; + var tempRet5 = 0; + var tempRet6 = 0; + var tempRet7 = 0; + var tempRet8 = 0; + var tempRet9 = 0; + var Math_floor=global.Math.floor; + var Math_abs=global.Math.abs; + var Math_sqrt=global.Math.sqrt; + var Math_pow=global.Math.pow; + var Math_cos=global.Math.cos; + var Math_sin=global.Math.sin; + var Math_tan=global.Math.tan; + var Math_acos=global.Math.acos; + var Math_asin=global.Math.asin; + var Math_atan=global.Math.atan; + var Math_atan2=global.Math.atan2; + var Math_exp=global.Math.exp; + var Math_log=global.Math.log; + var Math_ceil=global.Math.ceil; + var Math_imul=global.Math.imul; + var Math_min=global.Math.min; + var Math_clz32=global.Math.clz32; + var abort=env.abort; + var assert=env.assert; + var invoke_viiiii=env.invoke_viiiii; + var invoke_vd=env.invoke_vd; + var invoke_vid=env.invoke_vid; + var invoke_vi=env.invoke_vi; + var invoke_vii=env.invoke_vii; + var invoke_ii=env.invoke_ii; + var invoke_viddd=env.invoke_viddd; + var invoke_vidd=env.invoke_vidd; + var invoke_iiii=env.invoke_iiii; + var invoke_viiiiiiii=env.invoke_viiiiiiii; + var invoke_viiiiii=env.invoke_viiiiii; + var invoke_viii=env.invoke_viii; + var invoke_vidddd=env.invoke_vidddd; + var invoke_vdi=env.invoke_vdi; + var invoke_viiiiiii=env.invoke_viiiiiii; + var invoke_viiiiiiiii=env.invoke_viiiiiiiii; + var invoke_iii=env.invoke_iii; + var invoke_i=env.invoke_i; + var invoke_iiiiii=env.invoke_iiiiii; + var invoke_vdddddd=env.invoke_vdddddd; + var invoke_vdddd=env.invoke_vdddd; + var invoke_vdd=env.invoke_vdd; + var invoke_v=env.invoke_v; + var invoke_viid=env.invoke_viid; + var invoke_viiii=env.invoke_viiii; + var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv; + var _glUseProgram=env._glUseProgram; + var _emscripten_glShaderSource=env._emscripten_glShaderSource; + var _glfwCreateWindow=env._glfwCreateWindow; + var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler; + var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate; + var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer; + var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv; + var _emscripten_glCullFace=env._emscripten_glCullFace; + var _emscripten_glIsProgram=env._emscripten_glIsProgram; + var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate; + var _emscripten_glViewport=env._emscripten_glViewport; + var _emscripten_glFrontFace=env._emscripten_glFrontFace; + var _eglGetProcAddress=env._eglGetProcAddress; + var ___assert_fail=env.___assert_fail; + var _glDeleteProgram=env._glDeleteProgram; + var _emscripten_glUniform3fv=env._emscripten_glUniform3fv; + var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset; + var _emscripten_glUseProgram=env._emscripten_glUseProgram; + var _glVertexAttrib4f=env._glVertexAttrib4f; + var _glBindBuffer=env._glBindBuffer; + var _emscripten_glDepthFunc=env._emscripten_glDepthFunc; + var _glGetShaderInfoLog=env._glGetShaderInfoLog; + var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback; + var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback; + var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing; + var _sbrk=env._sbrk; + var _glBlendFunc=env._glBlendFunc; + var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray; + var _glGetAttribLocation=env._glGetAttribLocation; + var _glDisableVertexAttribArray=env._glDisableVertexAttribArray; + var _emscripten_memcpy_big=env._emscripten_memcpy_big; + var _emscripten_glReadPixels=env._emscripten_glReadPixels; + var _sysconf=env._sysconf; + var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage; + var _emscripten_glVertexPointer=env._emscripten_glVertexPointer; + var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback; + var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize; + var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv; + var _fabs=env._fabs; + var _glUniform4f=env._glUniform4f; + var _llvm_stacksave=env._llvm_stacksave; + var _emscripten_glUniform1i=env._emscripten_glUniform1i; + var _emscripten_glGenBuffers=env._emscripten_glGenBuffers; + var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB; + var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback; + var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat; + var _glfwInit=env._glfwInit; + var _tan=env._tan; + var _glGenBuffers=env._glGenBuffers; + var _glShaderSource=env._glShaderSource; + var _emscripten_glGetString=env._emscripten_glGetString; + var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer; + var _glVertexAttrib3f=env._glVertexAttrib3f; + var _emscripten_glIsEnabled=env._emscripten_glIsEnabled; + var _emscripten_glScissor=env._emscripten_glScissor; + var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv; + var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv; + var _pthread_cleanup_push=env._pthread_cleanup_push; + var ___syscall145=env.___syscall145; + var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB; + var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate; + var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer; + var ___syscall140=env.___syscall140; + var _glfwSetErrorCallback=env._glfwSetErrorCallback; + var _glfwDefaultWindowHints=env._glfwDefaultWindowHints; + var _emscripten_glIsBuffer=env._emscripten_glIsBuffer; + var ___syscall146=env.___syscall146; + var _glfwDestroyWindow=env._glfwDestroyWindow; + var _pthread_cleanup_pop=env._pthread_cleanup_pop; + var _emscripten_glColorPointer=env._emscripten_glColorPointer; + var _emscripten_glAttachShader=env._emscripten_glAttachShader; + var _glVertexAttribPointer=env._glVertexAttribPointer; + var _emscripten_glUniform2i=env._emscripten_glUniform2i; + var _emscripten_glUniform2f=env._emscripten_glUniform2f; + var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv; + var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv; + var _atan2=env._atan2; + var _glGetProgramInfoLog=env._glGetProgramInfoLog; + var _glfwSetScrollCallback=env._glfwSetScrollCallback; + var _emscripten_glTexParameterf=env._emscripten_glTexParameterf; + var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders; + var _emscripten_glGenTextures=env._emscripten_glGenTextures; + var _emscripten_glTexParameteri=env._emscripten_glTexParameteri; + var _llvm_stackrestore=env._llvm_stackrestore; + var _glfwMakeContextCurrent=env._glfwMakeContextCurrent; + var _emscripten_glClear=env._emscripten_glClear; + var _glDrawElements=env._glDrawElements; + var _glBufferSubData=env._glBufferSubData; + var _emscripten_glValidateProgram=env._emscripten_glValidateProgram; + var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv; + var _glViewport=env._glViewport; + var _emscripten_glUniform4iv=env._emscripten_glUniform4iv; + var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv; + var ___setErrNo=env.___setErrNo; + var _emscripten_glDrawArrays=env._emscripten_glDrawArrays; + var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation; + var _glDeleteTextures=env._glDeleteTextures; + var _glDepthFunc=env._glDepthFunc; + var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture; + var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f; + var _glUniform3f=env._glUniform3f; + var _emscripten_glFlush=env._emscripten_glFlush; + var _emscripten_glUniform4i=env._emscripten_glUniform4i; + var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus; + var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap; + var _emscripten_glGetError=env._emscripten_glGetError; + var _emscripten_glClearDepthf=env._emscripten_glClearDepthf; + var _emscripten_glBufferData=env._emscripten_glBufferData; + var _emscripten_glUniform3i=env._emscripten_glUniform3i; + var _emscripten_glRotatef=env._emscripten_glRotatef; + var _emscripten_glDeleteShader=env._emscripten_glDeleteShader; + var _glEnable=env._glEnable; + var _glGenTextures=env._glGenTextures; + var _emscripten_glMatrixMode=env._emscripten_glMatrixMode; + var _glGetString=env._glGetString; + var _emscripten_glClearStencil=env._emscripten_glClearStencil; + var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation; + var emscriptenWebGLGet=env.emscriptenWebGLGet; + var _glCreateShader=env._glCreateShader; + var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray; + var _eglWaitClient=env._eglWaitClient; + var _emscripten_get_now=env._emscripten_get_now; + var _emscripten_glNormalPointer=env._emscripten_glNormalPointer; + var _glAttachShader=env._glAttachShader; + var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer; + var _emscripten_glEnable=env._emscripten_glEnable; + var _glCreateProgram=env._glCreateProgram; + var _glUniformMatrix4fv=env._glUniformMatrix4fv; + var _emscripten_glClearDepth=env._emscripten_glClearDepth; + var _glDisable=env._glDisable; + var ___lock=env.___lock; + var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer; + var ___syscall6=env.___syscall6; + var ___syscall5=env.___syscall5; + var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate; + var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f; + var _time=env._time; + var _glBindFramebuffer=env._glBindFramebuffer; + var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f; + var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv; + var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate; + var _exit=env._exit; + var _emscripten_asm_const_2=env._emscripten_asm_const_2; + var _emscripten_glEnableClientState=env._emscripten_glEnableClientState; + var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib; + var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements; + var _glCullFace=env._glCullFace; + var _emscripten_glGetPointerv=env._emscripten_glGetPointerv; + var _glfwPollEvents=env._glfwPollEvents; + var _emscripten_glUniform4f=env._emscripten_glUniform4f; + var _emscripten_glUniform2fv=env._emscripten_glUniform2fv; + var _glfwGetVideoModes=env._glfwGetVideoModes; + var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf; + var _emscripten_glFinish=env._emscripten_glFinish; + var _emscripten_glShaderBinary=env._emscripten_glShaderBinary; + var _emscripten_glDrawElements=env._emscripten_glDrawElements; + var _emscripten_glBlendFunc=env._emscripten_glBlendFunc; + var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog; + var ___syscall221=env.___syscall221; + var _glCompressedTexImage2D=env._glCompressedTexImage2D; + var _emscripten_glUniform1iv=env._emscripten_glUniform1iv; + var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv; + var _glClearDepthf=env._glClearDepthf; + var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D; + var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform; + var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers; + var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays; + var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose; + var _emscripten_glUniform1fv=env._emscripten_glUniform1fv; + var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform; + var _glBindTexture=env._glBindTexture; + var _emscripten_glUniform3iv=env._emscripten_glUniform3iv; + var _emscripten_glUniform2iv=env._emscripten_glUniform2iv; + var _emscripten_glDisable=env._emscripten_glDisable; + var _glfwSetCharCallback=env._glfwSetCharCallback; + var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib; + var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram; + var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers; + var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced; + var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f; + var _glDrawArrays=env._glDrawArrays; + var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D; + var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv; + var _emscripten_glPixelStorei=env._emscripten_glPixelStorei; + var _glCompileShader=env._glCompileShader; + var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv; + var _emscripten_glHint=env._emscripten_glHint; + var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D; + var _sqrtf=env._sqrtf; + var _glActiveTexture=env._glActiveTexture; + var _glfwSwapBuffers=env._glfwSwapBuffers; + var _emscripten_glDepthMask=env._emscripten_glDepthMask; + var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback; + var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers; + var _glfwTerminate=env._glfwTerminate; + var _glFrontFace=env._glFrontFace; + var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB; + var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D; + var _glfwSwapInterval=env._glfwSwapInterval; + var _glUniform1i=env._glUniform1i; + var _glEnableVertexAttribArray=env._glEnableVertexAttribArray; + var _emscripten_glStencilFunc=env._emscripten_glStencilFunc; + var _abort=env._abort; + var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv; + var _glDeleteBuffers=env._glDeleteBuffers; + var _glBufferData=env._glBufferData; + var _glTexImage2D=env._glTexImage2D; + var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv; + var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers; + var _glUniform1f=env._glUniform1f; + var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv; + var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity; + var _glDeleteShader=env._glDeleteShader; + var _emscripten_glUniform1f=env._emscripten_glUniform1f; + var _glGetProgramiv=env._glGetProgramiv; + var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData; + var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer; + var _glfwGetTime=env._glfwGetTime; + var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage; + var _emscripten_glBlendColor=env._emscripten_glBlendColor; + var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv; + var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray; + var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced; + var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback; + var _emscripten_glCreateShader=env._emscripten_glCreateShader; + var _emscripten_glStencilMask=env._emscripten_glStencilMask; + var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures; + var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer; + var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor; + var _glLinkProgram=env._glLinkProgram; + var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor; + var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback; + var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv; + var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv; + var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv; + var _glGetShaderiv=env._glGetShaderiv; + var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv; + var _glGetUniformLocation=env._glGetUniformLocation; + var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB; + var _emscripten_glCompileShader=env._emscripten_glCompileShader; + var _glClear=env._glClear; + var _glUniform4fv=env._glUniform4fv; + var _emscripten_glFrustum=env._emscripten_glFrustum; + var _glVertexAttrib2f=env._glVertexAttrib2f; + var _emscripten_glDepthRangef=env._emscripten_glDepthRangef; + var _sinf=env._sinf; + var __exit=env.__exit; + var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv; + var _emscripten_glUniform3f=env._emscripten_glUniform3f; + var _emscripten_glStencilOp=env._emscripten_glStencilOp; + var _glBindAttribLocation=env._glBindAttribLocation; + var _glPixelStorei=env._glPixelStorei; + var _emscripten_glColorMask=env._emscripten_glColorMask; + var _emscripten_glLinkProgram=env._emscripten_glLinkProgram; + var _emscripten_glBlendEquation=env._emscripten_glBlendEquation; + var _emscripten_glIsTexture=env._emscripten_glIsTexture; + var _pthread_self=env._pthread_self; + var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv; + var _emscripten_glLineWidth=env._emscripten_glLineWidth; + var _emscripten_glBindTexture=env._emscripten_glBindTexture; + var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback; + var _glfwGetCursorPos=env._glfwGetCursorPos; + var _emscripten_glActiveTexture=env._emscripten_glActiveTexture; + var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers; + var ___syscall54=env.___syscall54; + var ___unlock=env.___unlock; + var _emscripten_glBufferSubData=env._emscripten_glBufferSubData; + var _emscripten_glDepthRange=env._emscripten_glDepthRange; + var _emscripten_set_main_loop=env._emscripten_set_main_loop; + var _emscripten_glIsShader=env._emscripten_glIsShader; + var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog; + var _glfwWindowHint=env._glfwWindowHint; + var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers; + var _emscripten_glUniform4fv=env._emscripten_glUniform4fv; + var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays; + var _cosf=env._cosf; + var _glfwSetKeyCallback=env._glfwSetKeyCallback; + var _emscripten_glClearColor=env._emscripten_glClearColor; + var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource; + var _emscripten_glCreateProgram=env._emscripten_glCreateProgram; + var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D; + var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation; + var _glTexParameteri=env._glTexParameteri; + var _emscripten_glBindBuffer=env._emscripten_glBindBuffer; + var _emscripten_glGetFloatv=env._emscripten_glGetFloatv; + var _emscripten_glDetachShader=env._emscripten_glDetachShader; + var _glClearColor=env._glClearColor; + var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback; + var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback; + var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D; + var _emscripten_glTexImage2D=env._emscripten_glTexImage2D; + var tempFloat = 0.0; + +// EMSCRIPTEN_START_FUNCS +function stackAlloc(size) { + size = size|0; + var ret = 0; + ret = STACKTOP; + STACKTOP = (STACKTOP + size)|0; + STACKTOP = (STACKTOP + 15)&-16; + + return ret|0; +} +function stackSave() { + return STACKTOP|0; +} +function stackRestore(top) { + top = top|0; + STACKTOP = top; +} +function establishStackSpace(stackBase, stackMax) { + stackBase = stackBase|0; + stackMax = stackMax|0; + STACKTOP = stackBase; + STACK_MAX = stackMax; +} + +function setThrew(threw, value) { + threw = threw|0; + value = value|0; + if ((__THREW__|0) == 0) { + __THREW__ = threw; + threwValue = value; + } +} +function copyTempFloat(ptr) { + ptr = ptr|0; + HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0]; + HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0]; + HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0]; + HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0]; +} +function copyTempDouble(ptr) { + ptr = ptr|0; + HEAP8[tempDoublePtr>>0] = HEAP8[ptr>>0]; + HEAP8[tempDoublePtr+1>>0] = HEAP8[ptr+1>>0]; + HEAP8[tempDoublePtr+2>>0] = HEAP8[ptr+2>>0]; + HEAP8[tempDoublePtr+3>>0] = HEAP8[ptr+3>>0]; + HEAP8[tempDoublePtr+4>>0] = HEAP8[ptr+4>>0]; + HEAP8[tempDoublePtr+5>>0] = HEAP8[ptr+5>>0]; + HEAP8[tempDoublePtr+6>>0] = HEAP8[ptr+6>>0]; + HEAP8[tempDoublePtr+7>>0] = HEAP8[ptr+7>>0]; +} + +function setTempRet0(value) { + value = value|0; + tempRet0 = value; +} +function getTempRet0() { + return tempRet0|0; +} + +function _main() { + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $dwarf$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 544|0; + $dwarf$byval_copy = sp + 280|0; + $0 = sp + 24|0; + $1 = sp; + $2 = HEAP32[152>>2]|0; + $3 = HEAP32[156>>2]|0; + _InitWindow($2,$3,7448); + _LoadModel($0,7492); + _memcpy((212|0),($0|0),256)|0; + _LoadTexture($1,7518); + ;HEAP32[468>>2]=HEAP32[$1>>2]|0;HEAP32[468+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[468+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[468+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[468+16>>2]=HEAP32[$1+16>>2]|0; + ;HEAP32[(392)>>2]=HEAP32[$1>>2]|0;HEAP32[(392)+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[(392)+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[(392)+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[(392)+16>>2]=HEAP32[$1+16>>2]|0; + _emscripten_set_main_loop((1|0),0,1); + ;HEAP32[$dwarf$byval_copy>>2]=HEAP32[468>>2]|0;HEAP32[$dwarf$byval_copy+4>>2]=HEAP32[468+4>>2]|0;HEAP32[$dwarf$byval_copy+8>>2]=HEAP32[468+8>>2]|0;HEAP32[$dwarf$byval_copy+12>>2]=HEAP32[468+12>>2]|0;HEAP32[$dwarf$byval_copy+16>>2]=HEAP32[468+16>>2]|0; + _UnloadTexture($dwarf$byval_copy); + _memcpy(($dwarf$byval_copy|0),(212|0),256)|0; + _UnloadModel($dwarf$byval_copy); + _CloseWindow(); + STACKTOP = sp;return 0; +} +function _UpdateDrawFrame() { + var $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dwarf$byval_copy = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0; + var stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 320|0; + $$byval_copy2 = sp + 272|0; + $position$byval_copy = sp + 260|0; + $dwarf$byval_copy = sp; + $0 = sp + 316|0; + $1 = sp + 256|0; + $2 = sp + 312|0; + _BeginDrawing(); + HEAP8[$0>>0] = -11; + $3 = ((($0)) + 1|0); + HEAP8[$3>>0] = -11; + $4 = ((($0)) + 2|0); + HEAP8[$4>>0] = -11; + $5 = ((($0)) + 3|0); + HEAP8[$5>>0] = -1; + ;HEAP8[$$byval_copy2>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$0+3>>0]|0; + _ClearBackground($$byval_copy2); + dest=$$byval_copy2; src=160; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _Begin3dMode($$byval_copy2); + HEAP32[$1>>2] = -1; + _memcpy(($dwarf$byval_copy|0),(212|0),256)|0; + ;HEAP32[$position$byval_copy>>2]=HEAP32[200>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[200+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[200+8>>2]|0; + ;HEAP8[$$byval_copy2>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$1+3>>0]|0; + _DrawModel($dwarf$byval_copy,$position$byval_copy,2.0,$$byval_copy2); + _DrawGrid(10,1.0); + ;HEAP32[$$byval_copy2>>2]=HEAP32[200>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[200+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[200+8>>2]|0; + _DrawGizmo($$byval_copy2); + _End3dMode(); + $6 = HEAP32[152>>2]|0; + $7 = (($6) + -200)|0; + $8 = HEAP32[156>>2]|0; + $9 = (($8) + -20)|0; + HEAP8[$2>>0] = -126; + $10 = ((($2)) + 1|0); + HEAP8[$10>>0] = -126; + $11 = ((($2)) + 2|0); + HEAP8[$11>>0] = -126; + $12 = ((($2)) + 3|0); + HEAP8[$12>>0] = -1; + ;HEAP8[$$byval_copy2>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$2+3>>0]|0; + _DrawText(7552,$7,$9,10,$$byval_copy2); + _DrawFPS(10,10); + _EndDrawing(); + STACKTOP = sp;return; +} +function _VectorSubtract($agg$result,$v1,$v2) { + $agg$result = $agg$result|0; + $v1 = $v1|0; + $v2 = $v2|0; + var $0 = 0.0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[$v1>>2]; + $1 = +HEAPF32[$v2>>2]; + $2 = $0 - $1; + $3 = ((($v1)) + 4|0); + $4 = +HEAPF32[$3>>2]; + $5 = ((($v2)) + 4|0); + $6 = +HEAPF32[$5>>2]; + $7 = $4 - $6; + $8 = ((($v1)) + 8|0); + $9 = +HEAPF32[$8>>2]; + $10 = ((($v2)) + 8|0); + $11 = +HEAPF32[$10>>2]; + $12 = $9 - $11; + HEAPF32[$agg$result>>2] = $2; + $13 = ((($agg$result)) + 4|0); + HEAPF32[$13>>2] = $7; + $14 = ((($agg$result)) + 8|0); + HEAPF32[$14>>2] = $12; + return; +} +function _VectorCrossProduct($agg$result,$v1,$v2) { + $agg$result = $agg$result|0; + $v1 = $v1|0; + $v2 = $v2|0; + var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0; + var $9 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($v1)) + 4|0); + $1 = +HEAPF32[$0>>2]; + $2 = ((($v2)) + 8|0); + $3 = +HEAPF32[$2>>2]; + $4 = $1 * $3; + $5 = ((($v1)) + 8|0); + $6 = +HEAPF32[$5>>2]; + $7 = ((($v2)) + 4|0); + $8 = +HEAPF32[$7>>2]; + $9 = $6 * $8; + $10 = $4 - $9; + $11 = +HEAPF32[$v2>>2]; + $12 = $6 * $11; + $13 = +HEAPF32[$v1>>2]; + $14 = $3 * $13; + $15 = $12 - $14; + $16 = $8 * $13; + $17 = $1 * $11; + $18 = $16 - $17; + HEAPF32[$agg$result>>2] = $10; + $19 = ((($agg$result)) + 4|0); + HEAPF32[$19>>2] = $15; + $20 = ((($agg$result)) + 8|0); + HEAPF32[$20>>2] = $18; + return; +} +function _VectorLength($v) { + $v = $v|0; + var $0 = 0.0, $1 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[$v>>2]; + $1 = $0 * $0; + $2 = ((($v)) + 4|0); + $3 = +HEAPF32[$2>>2]; + $4 = $3 * $3; + $5 = $1 + $4; + $6 = ((($v)) + 8|0); + $7 = +HEAPF32[$6>>2]; + $8 = $7 * $7; + $9 = $5 + $8; + $sqrtf = (+Math_sqrt((+$9))); + return (+$sqrtf); +} +function _VectorNormalize($v) { + $v = $v|0; + var $$op = 0.0, $0 = 0.0, $1 = 0, $10 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, $v$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $v$byval_copy = sp; + ;HEAP32[$v$byval_copy>>2]=HEAP32[$v>>2]|0;HEAP32[$v$byval_copy+4>>2]=HEAP32[$v+4>>2]|0;HEAP32[$v$byval_copy+8>>2]=HEAP32[$v+8>>2]|0; + $0 = (+_VectorLength($v$byval_copy)); + $1 = $0 == 0.0; + $$op = 1.0 / $0; + $2 = $1 ? 1.0 : $$op; + $3 = +HEAPF32[$v>>2]; + $4 = $3 * $2; + HEAPF32[$v>>2] = $4; + $5 = ((($v)) + 4|0); + $6 = +HEAPF32[$5>>2]; + $7 = $2 * $6; + HEAPF32[$5>>2] = $7; + $8 = ((($v)) + 8|0); + $9 = +HEAPF32[$8>>2]; + $10 = $2 * $9; + HEAPF32[$8>>2] = $10; + STACKTOP = sp;return; +} +function _VectorTransform($v,$mat) { + $v = $v|0; + $mat = $mat|0; + var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0; + var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0; + var $45 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[$v>>2]; + $1 = ((($v)) + 4|0); + $2 = +HEAPF32[$1>>2]; + $3 = ((($v)) + 8|0); + $4 = +HEAPF32[$3>>2]; + $5 = +HEAPF32[$mat>>2]; + $6 = $0 * $5; + $7 = ((($mat)) + 4|0); + $8 = +HEAPF32[$7>>2]; + $9 = $2 * $8; + $10 = $6 + $9; + $11 = ((($mat)) + 8|0); + $12 = +HEAPF32[$11>>2]; + $13 = $4 * $12; + $14 = $10 + $13; + $15 = ((($mat)) + 12|0); + $16 = +HEAPF32[$15>>2]; + $17 = $16 + $14; + HEAPF32[$v>>2] = $17; + $18 = ((($mat)) + 16|0); + $19 = +HEAPF32[$18>>2]; + $20 = $0 * $19; + $21 = ((($mat)) + 20|0); + $22 = +HEAPF32[$21>>2]; + $23 = $2 * $22; + $24 = $20 + $23; + $25 = ((($mat)) + 24|0); + $26 = +HEAPF32[$25>>2]; + $27 = $4 * $26; + $28 = $24 + $27; + $29 = ((($mat)) + 28|0); + $30 = +HEAPF32[$29>>2]; + $31 = $30 + $28; + HEAPF32[$1>>2] = $31; + $32 = ((($mat)) + 32|0); + $33 = +HEAPF32[$32>>2]; + $34 = $0 * $33; + $35 = ((($mat)) + 36|0); + $36 = +HEAPF32[$35>>2]; + $37 = $2 * $36; + $38 = $34 + $37; + $39 = ((($mat)) + 40|0); + $40 = +HEAPF32[$39>>2]; + $41 = $4 * $40; + $42 = $38 + $41; + $43 = ((($mat)) + 44|0); + $44 = +HEAPF32[$43>>2]; + $45 = $44 + $42; + HEAPF32[$3>>2] = $45; + return; +} +function _VectorZero($agg$result) { + $agg$result = $agg$result|0; + var label = 0, sp = 0; + sp = STACKTOP; + ;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0; + return; +} +function _MatrixTranspose($mat) { + $mat = $mat|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($mat)) + 4|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($mat)) + 8|0); + $3 = HEAP32[$2>>2]|0; + $4 = ((($mat)) + 12|0); + $5 = HEAP32[$4>>2]|0; + $6 = ((($mat)) + 16|0); + $7 = HEAP32[$6>>2]|0; + $8 = ((($mat)) + 24|0); + $9 = HEAP32[$8>>2]|0; + $10 = ((($mat)) + 28|0); + $11 = HEAP32[$10>>2]|0; + $12 = ((($mat)) + 32|0); + $13 = HEAP32[$12>>2]|0; + $14 = ((($mat)) + 36|0); + $15 = HEAP32[$14>>2]|0; + $16 = ((($mat)) + 44|0); + $17 = HEAP32[$16>>2]|0; + $18 = ((($mat)) + 48|0); + $19 = HEAP32[$18>>2]|0; + $20 = ((($mat)) + 52|0); + $21 = HEAP32[$20>>2]|0; + $22 = ((($mat)) + 56|0); + $23 = HEAP32[$22>>2]|0; + HEAP32[$0>>2] = $7; + HEAP32[$2>>2] = $13; + HEAP32[$4>>2] = $19; + HEAP32[$6>>2] = $1; + HEAP32[$8>>2] = $15; + HEAP32[$10>>2] = $21; + HEAP32[$12>>2] = $3; + HEAP32[$14>>2] = $9; + HEAP32[$16>>2] = $23; + HEAP32[$18>>2] = $5; + HEAP32[$20>>2] = $11; + HEAP32[$22>>2] = $17; + return; +} +function _MatrixInvert($mat) { + $mat = $mat|0; + var $0 = 0.0, $1 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0; + var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0; + var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0.0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0; + var $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0; + var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0; + var $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0; + var $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0; + var $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0; + var $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[$mat>>2]; + $1 = ((($mat)) + 16|0); + $2 = +HEAPF32[$1>>2]; + $3 = ((($mat)) + 32|0); + $4 = +HEAPF32[$3>>2]; + $5 = ((($mat)) + 48|0); + $6 = +HEAPF32[$5>>2]; + $7 = ((($mat)) + 4|0); + $8 = +HEAPF32[$7>>2]; + $9 = ((($mat)) + 20|0); + $10 = +HEAPF32[$9>>2]; + $11 = ((($mat)) + 36|0); + $12 = +HEAPF32[$11>>2]; + $13 = ((($mat)) + 52|0); + $14 = +HEAPF32[$13>>2]; + $15 = ((($mat)) + 8|0); + $16 = +HEAPF32[$15>>2]; + $17 = ((($mat)) + 24|0); + $18 = +HEAPF32[$17>>2]; + $19 = ((($mat)) + 40|0); + $20 = +HEAPF32[$19>>2]; + $21 = ((($mat)) + 56|0); + $22 = +HEAPF32[$21>>2]; + $23 = ((($mat)) + 12|0); + $24 = +HEAPF32[$23>>2]; + $25 = ((($mat)) + 28|0); + $26 = +HEAPF32[$25>>2]; + $27 = ((($mat)) + 44|0); + $28 = +HEAPF32[$27>>2]; + $29 = ((($mat)) + 60|0); + $30 = +HEAPF32[$29>>2]; + $31 = $0 * $10; + $32 = $2 * $8; + $33 = $31 - $32; + $34 = $0 * $12; + $35 = $4 * $8; + $36 = $34 - $35; + $37 = $0 * $14; + $38 = $6 * $8; + $39 = $37 - $38; + $40 = $2 * $12; + $41 = $4 * $10; + $42 = $40 - $41; + $43 = $2 * $14; + $44 = $6 * $10; + $45 = $43 - $44; + $46 = $4 * $14; + $47 = $6 * $12; + $48 = $46 - $47; + $49 = $16 * $26; + $50 = $18 * $24; + $51 = $49 - $50; + $52 = $16 * $28; + $53 = $20 * $24; + $54 = $52 - $53; + $55 = $16 * $30; + $56 = $22 * $24; + $57 = $55 - $56; + $58 = $18 * $28; + $59 = $20 * $26; + $60 = $58 - $59; + $61 = $18 * $30; + $62 = $22 * $26; + $63 = $61 - $62; + $64 = $20 * $30; + $65 = $22 * $28; + $66 = $64 - $65; + $67 = $33 * $66; + $68 = $36 * $63; + $69 = $67 - $68; + $70 = $39 * $60; + $71 = $70 + $69; + $72 = $42 * $57; + $73 = $72 + $71; + $74 = $45 * $54; + $75 = $73 - $74; + $76 = $48 * $51; + $77 = $76 + $75; + $78 = 1.0 / $77; + $79 = $10 * $66; + $80 = $12 * $63; + $81 = $79 - $80; + $82 = $14 * $60; + $83 = $82 + $81; + $84 = $78 * $83; + $85 = $2 * $66; + $86 = $4 * $63; + $87 = $86 - $85; + $88 = $6 * $60; + $89 = $87 - $88; + $90 = $78 * $89; + $91 = $48 * $26; + $92 = $45 * $28; + $93 = $91 - $92; + $94 = $42 * $30; + $95 = $93 + $94; + $96 = $78 * $95; + $97 = $18 * $48; + $98 = $45 * $20; + $99 = $98 - $97; + $100 = $42 * $22; + $101 = $99 - $100; + $102 = $101 * $78; + $103 = -$8; + $104 = $66 * $103; + $105 = $12 * $57; + $106 = $104 + $105; + $107 = $14 * $54; + $108 = $106 - $107; + $109 = $78 * $108; + $110 = $0 * $66; + $111 = $4 * $57; + $112 = $110 - $111; + $113 = $6 * $54; + $114 = $113 + $112; + $115 = $78 * $114; + $116 = -$24; + $117 = $48 * $116; + $118 = $39 * $28; + $119 = $117 + $118; + $120 = $36 * $30; + $121 = $119 - $120; + $122 = $78 * $121; + $123 = $16 * $48; + $124 = $39 * $20; + $125 = $123 - $124; + $126 = $36 * $22; + $127 = $125 + $126; + $128 = $127 * $78; + $129 = $8 * $63; + $130 = $10 * $57; + $131 = $129 - $130; + $132 = $14 * $51; + $133 = $132 + $131; + $134 = $78 * $133; + $135 = $0 * $63; + $136 = $2 * $57; + $137 = $136 - $135; + $138 = $6 * $51; + $139 = $137 - $138; + $140 = $78 * $139; + $141 = $45 * $24; + $142 = $39 * $26; + $143 = $141 - $142; + $144 = $33 * $30; + $145 = $143 + $144; + $146 = $78 * $145; + $147 = $16 * $45; + $148 = $18 * $39; + $149 = $148 - $147; + $150 = $33 * $22; + $151 = $149 - $150; + $152 = $151 * $78; + $153 = $60 * $103; + $154 = $10 * $54; + $155 = $153 + $154; + $156 = $12 * $51; + $157 = $155 - $156; + $158 = $78 * $157; + $159 = $0 * $60; + $160 = $2 * $54; + $161 = $159 - $160; + $162 = $4 * $51; + $163 = $162 + $161; + $164 = $78 * $163; + $165 = $42 * $116; + $166 = $36 * $26; + $167 = $165 + $166; + $168 = $33 * $28; + $169 = $167 - $168; + $170 = $169 * $78; + $171 = $16 * $42; + $172 = $36 * $18; + $173 = $171 - $172; + $174 = $33 * $20; + $175 = $173 + $174; + $176 = $175 * $78; + HEAPF32[$mat>>2] = $84; + HEAPF32[$7>>2] = $109; + HEAPF32[$15>>2] = $134; + HEAPF32[$23>>2] = $158; + HEAPF32[$1>>2] = $90; + HEAPF32[$9>>2] = $115; + HEAPF32[$17>>2] = $140; + HEAPF32[$25>>2] = $164; + HEAPF32[$3>>2] = $96; + HEAPF32[$11>>2] = $122; + HEAPF32[$19>>2] = $146; + HEAPF32[$27>>2] = $170; + HEAPF32[$5>>2] = $102; + HEAPF32[$13>>2] = $128; + HEAPF32[$21>>2] = $152; + HEAPF32[$29>>2] = $176; + return; +} +function _MatrixIdentity($agg$result) { + $agg$result = $agg$result|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 48|0; + $result$sroa$5 = sp + 32|0; + $result$sroa$6 = sp + 16|0; + $result$sroa$7 = sp; + ;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0; + ;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0; + ;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0; + HEAPF32[$agg$result>>2] = 1.0; + $0 = ((($agg$result)) + 4|0); + ;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0; + $1 = ((($agg$result)) + 20|0); + HEAPF32[$1>>2] = 1.0; + $2 = ((($agg$result)) + 24|0); + ;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0; + $3 = ((($agg$result)) + 40|0); + HEAPF32[$3>>2] = 1.0; + $4 = ((($agg$result)) + 44|0); + ;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0; + $5 = ((($agg$result)) + 60|0); + HEAPF32[$5>>2] = 1.0; + STACKTOP = sp;return; +} +function _MatrixTranslate($agg$result,$x,$y,$z) { + $agg$result = $agg$result|0; + $x = +$x; + $y = +$y; + $z = +$z; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; + sp = STACKTOP; + HEAPF32[$agg$result>>2] = 1.0; + $0 = ((($agg$result)) + 4|0); + $1 = ((($agg$result)) + 20|0); + ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0; + HEAPF32[$1>>2] = 1.0; + $2 = ((($agg$result)) + 24|0); + $3 = ((($agg$result)) + 40|0); + ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0; + HEAPF32[$3>>2] = 1.0; + $4 = ((($agg$result)) + 44|0); + HEAPF32[$4>>2] = 0.0; + $5 = ((($agg$result)) + 48|0); + HEAPF32[$5>>2] = $x; + $6 = ((($agg$result)) + 52|0); + HEAPF32[$6>>2] = $y; + $7 = ((($agg$result)) + 56|0); + HEAPF32[$7>>2] = $z; + $8 = ((($agg$result)) + 60|0); + HEAPF32[$8>>2] = 1.0; + return; +} +function _MatrixRotate($agg$result,$axis,$angle) { + $agg$result = $agg$result|0; + $axis = $axis|0; + $angle = +$angle; + var $0 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0; + var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; + var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0; + var $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0; + var $37 = 0.0, $38 = 0, $39 = 0.0, $4 = 0.0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0; + var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0; + var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0; + var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $mat = 0, $or$cond = 0, $sqrtf = 0.0, $x$0 = 0.0, $y$0 = 0.0, $z$0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $mat = sp; + _MatrixIdentity($mat); + $0 = +HEAPF32[$axis>>2]; + $1 = ((($axis)) + 4|0); + $2 = +HEAPF32[$1>>2]; + $3 = ((($axis)) + 8|0); + $4 = +HEAPF32[$3>>2]; + $5 = $0 * $0; + $6 = $2 * $2; + $7 = $5 + $6; + $8 = $4 * $4; + $9 = $7 + $8; + $sqrtf = (+Math_sqrt((+$9))); + $10 = $sqrtf != 1.0; + $11 = $sqrtf != 0.0; + $or$cond = $10 & $11; + if ($or$cond) { + $12 = 1.0 / $sqrtf; + $13 = $0 * $12; + $14 = $2 * $12; + $15 = $4 * $12; + $x$0 = $13;$y$0 = $14;$z$0 = $15; + } else { + $x$0 = $0;$y$0 = $2;$z$0 = $4; + } + $16 = (+Math_sin((+$angle))); + $17 = (+Math_cos((+$angle))); + $18 = 1.0 - $17; + $19 = +HEAPF32[$mat>>2]; + $20 = ((($mat)) + 16|0); + $21 = +HEAPF32[$20>>2]; + $22 = ((($mat)) + 32|0); + $23 = +HEAPF32[$22>>2]; + $24 = ((($mat)) + 48|0); + $25 = +HEAPF32[$24>>2]; + $26 = ((($mat)) + 4|0); + $27 = +HEAPF32[$26>>2]; + $28 = ((($mat)) + 20|0); + $29 = +HEAPF32[$28>>2]; + $30 = ((($mat)) + 36|0); + $31 = +HEAPF32[$30>>2]; + $32 = ((($mat)) + 52|0); + $33 = +HEAPF32[$32>>2]; + $34 = ((($mat)) + 8|0); + $35 = +HEAPF32[$34>>2]; + $36 = ((($mat)) + 24|0); + $37 = +HEAPF32[$36>>2]; + $38 = ((($mat)) + 40|0); + $39 = +HEAPF32[$38>>2]; + $40 = ((($mat)) + 56|0); + $41 = +HEAPF32[$40>>2]; + $42 = $x$0 * $x$0; + $43 = $42 * $18; + $44 = $17 + $43; + $45 = $y$0 * $x$0; + $46 = $45 * $18; + $47 = $z$0 * $16; + $48 = $47 + $46; + $49 = $z$0 * $x$0; + $50 = $49 * $18; + $51 = $y$0 * $16; + $52 = $50 - $51; + $53 = $46 - $47; + $54 = $y$0 * $y$0; + $55 = $54 * $18; + $56 = $17 + $55; + $57 = $z$0 * $y$0; + $58 = $57 * $18; + $59 = $x$0 * $16; + $60 = $59 + $58; + $61 = $51 + $50; + $62 = $58 - $59; + $63 = $z$0 * $z$0; + $64 = $63 * $18; + $65 = $17 + $64; + $66 = $19 * $44; + $67 = $48 * $27; + $68 = $66 + $67; + $69 = $52 * $35; + $70 = $68 + $69; + $71 = $21 * $44; + $72 = $48 * $29; + $73 = $71 + $72; + $74 = $52 * $37; + $75 = $73 + $74; + $76 = $23 * $44; + $77 = $48 * $31; + $78 = $76 + $77; + $79 = $52 * $39; + $80 = $78 + $79; + $81 = $44 * $25; + $82 = $48 * $33; + $83 = $81 + $82; + $84 = $52 * $41; + $85 = $83 + $84; + $86 = $19 * $53; + $87 = $56 * $27; + $88 = $86 + $87; + $89 = $60 * $35; + $90 = $88 + $89; + $91 = $21 * $53; + $92 = $56 * $29; + $93 = $91 + $92; + $94 = $60 * $37; + $95 = $93 + $94; + $96 = $23 * $53; + $97 = $56 * $31; + $98 = $96 + $97; + $99 = $60 * $39; + $100 = $98 + $99; + $101 = $53 * $25; + $102 = $56 * $33; + $103 = $101 + $102; + $104 = $60 * $41; + $105 = $103 + $104; + $106 = $19 * $61; + $107 = $62 * $27; + $108 = $106 + $107; + $109 = $65 * $35; + $110 = $108 + $109; + $111 = $21 * $61; + $112 = $62 * $29; + $113 = $111 + $112; + $114 = $65 * $37; + $115 = $113 + $114; + $116 = $23 * $61; + $117 = $62 * $31; + $118 = $116 + $117; + $119 = $65 * $39; + $120 = $118 + $119; + $121 = $61 * $25; + $122 = $62 * $33; + $123 = $121 + $122; + $124 = $65 * $41; + $125 = $123 + $124; + $126 = ((($mat)) + 12|0); + $127 = HEAP32[$126>>2]|0; + $128 = ((($mat)) + 28|0); + $129 = HEAP32[$128>>2]|0; + $130 = ((($mat)) + 44|0); + $131 = HEAP32[$130>>2]|0; + $132 = ((($mat)) + 60|0); + $133 = HEAP32[$132>>2]|0; + HEAPF32[$agg$result>>2] = $70; + $134 = ((($agg$result)) + 4|0); + HEAPF32[$134>>2] = $90; + $135 = ((($agg$result)) + 8|0); + HEAPF32[$135>>2] = $110; + $136 = ((($agg$result)) + 12|0); + HEAP32[$136>>2] = $127; + $137 = ((($agg$result)) + 16|0); + HEAPF32[$137>>2] = $75; + $138 = ((($agg$result)) + 20|0); + HEAPF32[$138>>2] = $95; + $139 = ((($agg$result)) + 24|0); + HEAPF32[$139>>2] = $115; + $140 = ((($agg$result)) + 28|0); + HEAP32[$140>>2] = $129; + $141 = ((($agg$result)) + 32|0); + HEAPF32[$141>>2] = $80; + $142 = ((($agg$result)) + 36|0); + HEAPF32[$142>>2] = $100; + $143 = ((($agg$result)) + 40|0); + HEAPF32[$143>>2] = $120; + $144 = ((($agg$result)) + 44|0); + HEAP32[$144>>2] = $131; + $145 = ((($agg$result)) + 48|0); + HEAPF32[$145>>2] = $85; + $146 = ((($agg$result)) + 52|0); + HEAPF32[$146>>2] = $105; + $147 = ((($agg$result)) + 56|0); + HEAPF32[$147>>2] = $125; + $148 = ((($agg$result)) + 60|0); + HEAP32[$148>>2] = $133; + STACKTOP = sp;return; +} +function _MatrixScale($agg$result,$x,$y,$z) { + $agg$result = $agg$result|0; + $x = +$x; + $y = +$y; + $z = +$z; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $result$sroa$5 = 0, $result$sroa$6 = 0, $result$sroa$7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 48|0; + $result$sroa$5 = sp + 32|0; + $result$sroa$6 = sp + 16|0; + $result$sroa$7 = sp; + ;HEAP32[$result$sroa$5>>2]=0|0;HEAP32[$result$sroa$5+4>>2]=0|0;HEAP32[$result$sroa$5+8>>2]=0|0;HEAP32[$result$sroa$5+12>>2]=0|0; + ;HEAP32[$result$sroa$6>>2]=0|0;HEAP32[$result$sroa$6+4>>2]=0|0;HEAP32[$result$sroa$6+8>>2]=0|0;HEAP32[$result$sroa$6+12>>2]=0|0; + ;HEAP32[$result$sroa$7>>2]=0|0;HEAP32[$result$sroa$7+4>>2]=0|0;HEAP32[$result$sroa$7+8>>2]=0|0;HEAP32[$result$sroa$7+12>>2]=0|0; + HEAPF32[$agg$result>>2] = $x; + $0 = ((($agg$result)) + 4|0); + ;HEAP32[$0>>2]=HEAP32[$result$sroa$5>>2]|0;HEAP32[$0+4>>2]=HEAP32[$result$sroa$5+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$result$sroa$5+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$result$sroa$5+12>>2]|0; + $1 = ((($agg$result)) + 20|0); + HEAPF32[$1>>2] = $y; + $2 = ((($agg$result)) + 24|0); + ;HEAP32[$2>>2]=HEAP32[$result$sroa$6>>2]|0;HEAP32[$2+4>>2]=HEAP32[$result$sroa$6+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$result$sroa$6+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$result$sroa$6+12>>2]|0; + $3 = ((($agg$result)) + 40|0); + HEAPF32[$3>>2] = $z; + $4 = ((($agg$result)) + 44|0); + ;HEAP32[$4>>2]=HEAP32[$result$sroa$7>>2]|0;HEAP32[$4+4>>2]=HEAP32[$result$sroa$7+4>>2]|0;HEAP32[$4+8>>2]=HEAP32[$result$sroa$7+8>>2]|0;HEAP32[$4+12>>2]=HEAP32[$result$sroa$7+12>>2]|0; + $5 = ((($agg$result)) + 60|0); + HEAPF32[$5>>2] = 1.0; + STACKTOP = sp;return; +} +function _MatrixMultiply($agg$result,$left,$right) { + $agg$result = $agg$result|0; + $left = $left|0; + $right = $right|0; + var $0 = 0.0, $1 = 0.0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0.0, $115 = 0.0; + var $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0; + var $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0, $139 = 0.0, $14 = 0.0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0, $15 = 0, $150 = 0.0, $151 = 0.0; + var $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0; + var $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0.0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; + var $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0; + var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0; + var $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0; + var $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0; + var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[$right>>2]; + $1 = +HEAPF32[$left>>2]; + $2 = $0 * $1; + $3 = ((($right)) + 16|0); + $4 = +HEAPF32[$3>>2]; + $5 = ((($left)) + 4|0); + $6 = +HEAPF32[$5>>2]; + $7 = $4 * $6; + $8 = $2 + $7; + $9 = ((($right)) + 32|0); + $10 = +HEAPF32[$9>>2]; + $11 = ((($left)) + 8|0); + $12 = +HEAPF32[$11>>2]; + $13 = $10 * $12; + $14 = $8 + $13; + $15 = ((($right)) + 48|0); + $16 = +HEAPF32[$15>>2]; + $17 = ((($left)) + 12|0); + $18 = +HEAPF32[$17>>2]; + $19 = $16 * $18; + $20 = $14 + $19; + $21 = ((($left)) + 16|0); + $22 = +HEAPF32[$21>>2]; + $23 = $0 * $22; + $24 = ((($left)) + 20|0); + $25 = +HEAPF32[$24>>2]; + $26 = $4 * $25; + $27 = $23 + $26; + $28 = ((($left)) + 24|0); + $29 = +HEAPF32[$28>>2]; + $30 = $10 * $29; + $31 = $27 + $30; + $32 = ((($left)) + 28|0); + $33 = +HEAPF32[$32>>2]; + $34 = $16 * $33; + $35 = $31 + $34; + $36 = ((($left)) + 32|0); + $37 = +HEAPF32[$36>>2]; + $38 = $0 * $37; + $39 = ((($left)) + 36|0); + $40 = +HEAPF32[$39>>2]; + $41 = $4 * $40; + $42 = $38 + $41; + $43 = ((($left)) + 40|0); + $44 = +HEAPF32[$43>>2]; + $45 = $10 * $44; + $46 = $42 + $45; + $47 = ((($left)) + 44|0); + $48 = +HEAPF32[$47>>2]; + $49 = $16 * $48; + $50 = $46 + $49; + $51 = ((($left)) + 48|0); + $52 = +HEAPF32[$51>>2]; + $53 = $0 * $52; + $54 = ((($left)) + 52|0); + $55 = +HEAPF32[$54>>2]; + $56 = $4 * $55; + $57 = $53 + $56; + $58 = ((($left)) + 56|0); + $59 = +HEAPF32[$58>>2]; + $60 = $10 * $59; + $61 = $57 + $60; + $62 = ((($left)) + 60|0); + $63 = +HEAPF32[$62>>2]; + $64 = $16 * $63; + $65 = $61 + $64; + $66 = ((($right)) + 4|0); + $67 = +HEAPF32[$66>>2]; + $68 = $1 * $67; + $69 = ((($right)) + 20|0); + $70 = +HEAPF32[$69>>2]; + $71 = $6 * $70; + $72 = $68 + $71; + $73 = ((($right)) + 36|0); + $74 = +HEAPF32[$73>>2]; + $75 = $12 * $74; + $76 = $72 + $75; + $77 = ((($right)) + 52|0); + $78 = +HEAPF32[$77>>2]; + $79 = $18 * $78; + $80 = $76 + $79; + $81 = $22 * $67; + $82 = $25 * $70; + $83 = $81 + $82; + $84 = $29 * $74; + $85 = $83 + $84; + $86 = $33 * $78; + $87 = $85 + $86; + $88 = $37 * $67; + $89 = $40 * $70; + $90 = $88 + $89; + $91 = $44 * $74; + $92 = $90 + $91; + $93 = $48 * $78; + $94 = $92 + $93; + $95 = $52 * $67; + $96 = $55 * $70; + $97 = $95 + $96; + $98 = $59 * $74; + $99 = $97 + $98; + $100 = $63 * $78; + $101 = $99 + $100; + $102 = ((($right)) + 8|0); + $103 = +HEAPF32[$102>>2]; + $104 = $1 * $103; + $105 = ((($right)) + 24|0); + $106 = +HEAPF32[$105>>2]; + $107 = $6 * $106; + $108 = $104 + $107; + $109 = ((($right)) + 40|0); + $110 = +HEAPF32[$109>>2]; + $111 = $12 * $110; + $112 = $108 + $111; + $113 = ((($right)) + 56|0); + $114 = +HEAPF32[$113>>2]; + $115 = $18 * $114; + $116 = $112 + $115; + $117 = $22 * $103; + $118 = $25 * $106; + $119 = $117 + $118; + $120 = $29 * $110; + $121 = $119 + $120; + $122 = $33 * $114; + $123 = $121 + $122; + $124 = $37 * $103; + $125 = $40 * $106; + $126 = $124 + $125; + $127 = $44 * $110; + $128 = $126 + $127; + $129 = $48 * $114; + $130 = $128 + $129; + $131 = $52 * $103; + $132 = $55 * $106; + $133 = $131 + $132; + $134 = $59 * $110; + $135 = $133 + $134; + $136 = $63 * $114; + $137 = $135 + $136; + $138 = ((($right)) + 12|0); + $139 = +HEAPF32[$138>>2]; + $140 = $1 * $139; + $141 = ((($right)) + 28|0); + $142 = +HEAPF32[$141>>2]; + $143 = $6 * $142; + $144 = $140 + $143; + $145 = ((($right)) + 44|0); + $146 = +HEAPF32[$145>>2]; + $147 = $12 * $146; + $148 = $144 + $147; + $149 = ((($right)) + 60|0); + $150 = +HEAPF32[$149>>2]; + $151 = $18 * $150; + $152 = $148 + $151; + $153 = $22 * $139; + $154 = $25 * $142; + $155 = $153 + $154; + $156 = $29 * $146; + $157 = $155 + $156; + $158 = $33 * $150; + $159 = $157 + $158; + $160 = $37 * $139; + $161 = $40 * $142; + $162 = $160 + $161; + $163 = $44 * $146; + $164 = $162 + $163; + $165 = $48 * $150; + $166 = $164 + $165; + $167 = $52 * $139; + $168 = $55 * $142; + $169 = $167 + $168; + $170 = $59 * $146; + $171 = $169 + $170; + $172 = $63 * $150; + $173 = $171 + $172; + HEAPF32[$agg$result>>2] = $20; + $174 = ((($agg$result)) + 4|0); + HEAPF32[$174>>2] = $80; + $175 = ((($agg$result)) + 8|0); + HEAPF32[$175>>2] = $116; + $176 = ((($agg$result)) + 12|0); + HEAPF32[$176>>2] = $152; + $177 = ((($agg$result)) + 16|0); + HEAPF32[$177>>2] = $35; + $178 = ((($agg$result)) + 20|0); + HEAPF32[$178>>2] = $87; + $179 = ((($agg$result)) + 24|0); + HEAPF32[$179>>2] = $123; + $180 = ((($agg$result)) + 28|0); + HEAPF32[$180>>2] = $159; + $181 = ((($agg$result)) + 32|0); + HEAPF32[$181>>2] = $50; + $182 = ((($agg$result)) + 36|0); + HEAPF32[$182>>2] = $94; + $183 = ((($agg$result)) + 40|0); + HEAPF32[$183>>2] = $130; + $184 = ((($agg$result)) + 44|0); + HEAPF32[$184>>2] = $166; + $185 = ((($agg$result)) + 48|0); + HEAPF32[$185>>2] = $65; + $186 = ((($agg$result)) + 52|0); + HEAPF32[$186>>2] = $101; + $187 = ((($agg$result)) + 56|0); + HEAPF32[$187>>2] = $137; + $188 = ((($agg$result)) + 60|0); + HEAPF32[$188>>2] = $173; + return; +} +function _MatrixFrustum($agg$result,$left,$right,$bottom,$top,$near,$far) { + $agg$result = $agg$result|0; + $left = +$left; + $right = +$right; + $bottom = +$bottom; + $top = +$top; + $near = +$near; + $far = +$far; + var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; + var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $5 = 0.0; + var $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $right - $left; + $1 = $0; + $2 = $top - $bottom; + $3 = $2; + $4 = $far - $near; + $5 = $4; + $6 = $near * 2.0; + $7 = $1; + $8 = $6 / $7; + $9 = $8; + $10 = $3; + $11 = $6 / $10; + $12 = $11; + $13 = $left + $right; + $14 = $13 / $7; + $15 = $14; + $16 = $bottom + $top; + $17 = $16 / $10; + $18 = $17; + $19 = $near + $far; + $20 = -$19; + $21 = $5; + $22 = $20 / $21; + $23 = $22; + $24 = $near * $far; + $25 = $24 * 2.0; + $26 = -$25; + $27 = $26 / $21; + $28 = $27; + HEAPF32[$agg$result>>2] = $9; + $29 = ((($agg$result)) + 4|0); + HEAPF32[$29>>2] = 0.0; + $30 = ((($agg$result)) + 8|0); + HEAPF32[$30>>2] = $15; + $31 = ((($agg$result)) + 12|0); + HEAPF32[$31>>2] = 0.0; + $32 = ((($agg$result)) + 16|0); + HEAPF32[$32>>2] = 0.0; + $33 = ((($agg$result)) + 20|0); + HEAPF32[$33>>2] = $12; + $34 = ((($agg$result)) + 24|0); + HEAPF32[$34>>2] = $18; + $35 = ((($agg$result)) + 28|0); + HEAPF32[$35>>2] = 0.0; + $36 = ((($agg$result)) + 32|0); + HEAPF32[$36>>2] = 0.0; + $37 = ((($agg$result)) + 36|0); + HEAPF32[$37>>2] = 0.0; + $38 = ((($agg$result)) + 40|0); + HEAPF32[$38>>2] = $23; + $39 = ((($agg$result)) + 44|0); + HEAPF32[$39>>2] = $28; + $40 = ((($agg$result)) + 48|0); + HEAPF32[$40>>2] = 0.0; + $41 = ((($agg$result)) + 52|0); + HEAPF32[$41>>2] = 0.0; + $42 = ((($agg$result)) + 56|0); + HEAPF32[$42>>2] = -1.0; + $43 = ((($agg$result)) + 60|0); + HEAPF32[$43>>2] = 0.0; + return; +} +function _MatrixOrtho($agg$result,$left,$right,$bottom,$top,$near,$far) { + $agg$result = $agg$result|0; + $left = +$left; + $right = +$right; + $bottom = +$bottom; + $top = +$top; + $near = +$near; + $far = +$far; + var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0; + var sp = 0; + sp = STACKTOP; + $0 = $right - $left; + $1 = $0; + $2 = $top - $bottom; + $3 = $2; + $4 = $far - $near; + $5 = $4; + $6 = 2.0 / $1; + $7 = 2.0 / $3; + $8 = -2.0 / $5; + $9 = $left + $right; + $10 = -$9; + $11 = $1; + $12 = $10 / $11; + $13 = $12; + $14 = $bottom + $top; + $15 = -$14; + $16 = $3; + $17 = $15 / $16; + $18 = $17; + $19 = $near + $far; + $20 = -$19; + $21 = $5; + $22 = $20 / $21; + $23 = $22; + HEAPF32[$agg$result>>2] = $6; + $24 = ((($agg$result)) + 4|0); + HEAPF32[$24>>2] = 0.0; + $25 = ((($agg$result)) + 8|0); + HEAPF32[$25>>2] = 0.0; + $26 = ((($agg$result)) + 12|0); + HEAPF32[$26>>2] = $13; + $27 = ((($agg$result)) + 16|0); + HEAPF32[$27>>2] = 0.0; + $28 = ((($agg$result)) + 20|0); + HEAPF32[$28>>2] = $7; + $29 = ((($agg$result)) + 24|0); + HEAPF32[$29>>2] = 0.0; + $30 = ((($agg$result)) + 28|0); + HEAPF32[$30>>2] = $18; + $31 = ((($agg$result)) + 32|0); + HEAPF32[$31>>2] = 0.0; + $32 = ((($agg$result)) + 36|0); + HEAPF32[$32>>2] = 0.0; + $33 = ((($agg$result)) + 40|0); + HEAPF32[$33>>2] = $8; + $34 = ((($agg$result)) + 44|0); + HEAPF32[$34>>2] = $23; + $35 = ((($agg$result)) + 48|0); + HEAPF32[$35>>2] = 0.0; + $36 = ((($agg$result)) + 52|0); + HEAPF32[$36>>2] = 0.0; + $37 = ((($agg$result)) + 56|0); + HEAPF32[$37>>2] = 0.0; + $38 = ((($agg$result)) + 60|0); + HEAPF32[$38>>2] = 1.0; + return; +} +function _MatrixLookAt($agg$result,$eye,$target,$up) { + $agg$result = $agg$result|0; + $eye = $eye|0; + $target = $target|0; + $up = $up|0; + var $0 = 0.0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0; + var $27 = 0.0, $28 = 0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0.0, $50 = 0, $51 = 0, $52 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, $x = 0, $x$byval_copy = 0, $y = 0, $z = 0, $z$byval_copy1 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $x$byval_copy = sp + 48|0; + $z$byval_copy1 = sp + 36|0; + $z = sp + 24|0; + $x = sp + 12|0; + $y = sp; + ;HEAP32[$z$byval_copy1>>2]=HEAP32[$eye>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$eye+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$eye+8>>2]|0; + ;HEAP32[$x$byval_copy>>2]=HEAP32[$target>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$target+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$target+8>>2]|0; + _VectorSubtract($z,$z$byval_copy1,$x$byval_copy); + _VectorNormalize($z); + ;HEAP32[$z$byval_copy1>>2]=HEAP32[$up>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$up+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$up+8>>2]|0; + ;HEAP32[$x$byval_copy>>2]=HEAP32[$z>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$z+8>>2]|0; + _VectorCrossProduct($x,$z$byval_copy1,$x$byval_copy); + _VectorNormalize($x); + ;HEAP32[$z$byval_copy1>>2]=HEAP32[$z>>2]|0;HEAP32[$z$byval_copy1+4>>2]=HEAP32[$z+4>>2]|0;HEAP32[$z$byval_copy1+8>>2]=HEAP32[$z+8>>2]|0; + ;HEAP32[$x$byval_copy>>2]=HEAP32[$x>>2]|0;HEAP32[$x$byval_copy+4>>2]=HEAP32[$x+4>>2]|0;HEAP32[$x$byval_copy+8>>2]=HEAP32[$x+8>>2]|0; + _VectorCrossProduct($y,$z$byval_copy1,$x$byval_copy); + _VectorNormalize($y); + $0 = +HEAPF32[$x>>2]; + $1 = ((($x)) + 4|0); + $2 = +HEAPF32[$1>>2]; + $3 = ((($x)) + 8|0); + $4 = +HEAPF32[$3>>2]; + $5 = +HEAPF32[$eye>>2]; + $6 = $0 * $5; + $7 = ((($eye)) + 4|0); + $8 = +HEAPF32[$7>>2]; + $9 = $2 * $8; + $10 = $6 + $9; + $11 = ((($eye)) + 8|0); + $12 = +HEAPF32[$11>>2]; + $13 = $4 * $12; + $14 = $10 + $13; + $15 = -$14; + $16 = +HEAPF32[$y>>2]; + $17 = ((($y)) + 4|0); + $18 = +HEAPF32[$17>>2]; + $19 = ((($y)) + 8|0); + $20 = +HEAPF32[$19>>2]; + $21 = $5 * $16; + $22 = $8 * $18; + $23 = $21 + $22; + $24 = $12 * $20; + $25 = $23 + $24; + $26 = -$25; + $27 = +HEAPF32[$z>>2]; + $28 = ((($z)) + 4|0); + $29 = +HEAPF32[$28>>2]; + $30 = ((($z)) + 8|0); + $31 = +HEAPF32[$30>>2]; + $32 = $5 * $27; + $33 = $8 * $29; + $34 = $32 + $33; + $35 = $12 * $31; + $36 = $34 + $35; + $37 = -$36; + HEAPF32[$agg$result>>2] = $0; + $38 = ((($agg$result)) + 4|0); + HEAPF32[$38>>2] = $16; + $39 = ((($agg$result)) + 8|0); + HEAPF32[$39>>2] = $27; + $40 = ((($agg$result)) + 12|0); + HEAPF32[$40>>2] = 0.0; + $41 = ((($agg$result)) + 16|0); + HEAPF32[$41>>2] = $2; + $42 = ((($agg$result)) + 20|0); + HEAPF32[$42>>2] = $18; + $43 = ((($agg$result)) + 24|0); + HEAPF32[$43>>2] = $29; + $44 = ((($agg$result)) + 28|0); + HEAPF32[$44>>2] = 0.0; + $45 = ((($agg$result)) + 32|0); + HEAPF32[$45>>2] = $4; + $46 = ((($agg$result)) + 36|0); + HEAPF32[$46>>2] = $20; + $47 = ((($agg$result)) + 40|0); + HEAPF32[$47>>2] = $31; + $48 = ((($agg$result)) + 44|0); + HEAPF32[$48>>2] = 0.0; + $49 = ((($agg$result)) + 48|0); + HEAPF32[$49>>2] = $15; + $50 = ((($agg$result)) + 52|0); + HEAPF32[$50>>2] = $26; + $51 = ((($agg$result)) + 56|0); + HEAPF32[$51>>2] = $37; + $52 = ((($agg$result)) + 60|0); + HEAPF32[$52>>2] = 1.0; + STACKTOP = sp;return; +} +function _InitWindow($width,$height,$title) { + $width = $width|0; + $height = $height|0; + $title = $title|0; + var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + _TraceLog(0,7587,$vararg_buffer); + HEAP32[488>>2] = $title; + _InitGraphicsDevice($width,$height); + _LoadDefaultFont(); + _InitTimer(); + (_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(5|0))|0); + (_emscripten_set_touchstart_callback((7616|0),(0|0),1,(6|0))|0); + (_emscripten_set_touchend_callback((7616|0),(0|0),1,(6|0))|0); + (_emscripten_set_touchmove_callback((7616|0),(0|0),1,(6|0))|0); + (_emscripten_set_touchcancel_callback((7616|0),(0|0),1,(6|0))|0); + $0 = HEAP32[492>>2]|0; + $1 = (+($0|0)); + $2 = $1 * 0.5; + HEAPF32[8>>2] = $2; + $3 = HEAP32[496>>2]|0; + $4 = (+($3|0)); + $5 = $4 * 0.5; + HEAPF32[(12)>>2] = $5; + $6 = HEAP32[500>>2]|0; + $7 = ($6|0)==(0); + if ($7) { + STACKTOP = sp;return; + } + _SetTargetFPS(60); + _LogoAnimation(); + STACKTOP = sp;return; +} +function _SetTargetFPS($fps) { + $fps = $fps|0; + var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = (+($fps|0)); + $1 = 1.0 / $0; + HEAPF64[16>>3] = $1; + $2 = $1; + $3 = $2 * 1000.0; + $4 = $3; + HEAPF64[$vararg_buffer>>3] = $4; + _TraceLog(0,7624,$vararg_buffer); + STACKTOP = sp;return; +} +function _CloseWindow() { + var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + _UnloadDefaultFont(); + _rlglClose(); + $0 = HEAP32[504>>2]|0; + _glfwDestroyWindow(($0|0)); + _glfwTerminate(); + _TraceLog(0,7668,$vararg_buffer); + STACKTOP = sp;return; +} +function _GetScreenWidth() { + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[492>>2]|0; + return ($0|0); +} +function _GetScreenHeight() { + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[496>>2]|0; + return ($0|0); +} +function _ClearBackground($color) { + $color = $color|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP8[$color>>0]|0; + $1 = ((($color)) + 1|0); + $2 = HEAP8[$1>>0]|0; + $3 = ((($color)) + 2|0); + $4 = HEAP8[$3>>0]|0; + $5 = ((($color)) + 3|0); + $6 = HEAP8[$5>>0]|0; + _rlClearColor($0,$2,$4,$6); + return; +} +function _BeginDrawing() { + var $0 = 0.0, $1 = 0.0, $2 = 0.0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $downscaleView$byval_copy = sp; + $0 = (+_GetTime()); + HEAPF64[24>>3] = $0; + $1 = +HEAPF64[32>>3]; + $2 = $0 - $1; + HEAPF64[40>>3] = $2; + HEAPF64[32>>3] = $0; + _rlClearScreenBuffers(); + _rlLoadIdentity(); + dest=$downscaleView$byval_copy; src=512; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + (_MatrixToFloat($downscaleView$byval_copy)|0); + _rlMultMatrixf(576); + STACKTOP = sp;return; +} +function _MatrixToFloat($mat) { + $mat = $mat|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$mat>>2]|0; + HEAP32[576>>2] = $0; + $1 = ((($mat)) + 4|0); + $2 = HEAP32[$1>>2]|0; + HEAP32[(580)>>2] = $2; + $3 = ((($mat)) + 8|0); + $4 = HEAP32[$3>>2]|0; + HEAP32[(584)>>2] = $4; + $5 = ((($mat)) + 12|0); + $6 = HEAP32[$5>>2]|0; + HEAP32[(588)>>2] = $6; + $7 = ((($mat)) + 16|0); + $8 = HEAP32[$7>>2]|0; + HEAP32[(592)>>2] = $8; + $9 = ((($mat)) + 20|0); + $10 = HEAP32[$9>>2]|0; + HEAP32[(596)>>2] = $10; + $11 = ((($mat)) + 24|0); + $12 = HEAP32[$11>>2]|0; + HEAP32[(600)>>2] = $12; + $13 = ((($mat)) + 28|0); + $14 = HEAP32[$13>>2]|0; + HEAP32[(604)>>2] = $14; + $15 = ((($mat)) + 32|0); + $16 = HEAP32[$15>>2]|0; + HEAP32[(608)>>2] = $16; + $17 = ((($mat)) + 36|0); + $18 = HEAP32[$17>>2]|0; + HEAP32[(612)>>2] = $18; + $19 = ((($mat)) + 40|0); + $20 = HEAP32[$19>>2]|0; + HEAP32[(616)>>2] = $20; + $21 = ((($mat)) + 44|0); + $22 = HEAP32[$21>>2]|0; + HEAP32[(620)>>2] = $22; + $23 = ((($mat)) + 48|0); + $24 = HEAP32[$23>>2]|0; + HEAP32[(624)>>2] = $24; + $25 = ((($mat)) + 52|0); + $26 = HEAP32[$25>>2]|0; + HEAP32[(628)>>2] = $26; + $27 = ((($mat)) + 56|0); + $28 = HEAP32[$27>>2]|0; + HEAP32[(632)>>2] = $28; + $29 = ((($mat)) + 60|0); + $30 = HEAP32[$29>>2]|0; + HEAP32[(636)>>2] = $30; + return (576|0); +} +function _EndDrawing() { + var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + _rlglDraw(); + _SwapBuffers(); + _PollInputEvents(); + $0 = (+_GetTime()); + HEAPF64[24>>3] = $0; + $1 = +HEAPF64[32>>3]; + $2 = $0 - $1; + HEAPF64[48>>3] = $2; + HEAPF64[32>>3] = $0; + $3 = +HEAPF64[40>>3]; + $4 = $3 + $2; + HEAPF64[56>>3] = $4; + $5 = +HEAPF64[16>>3]; + $6 = $4 < $5; + if (!($6)) { + return; + } + while(1) { + $7 = (+_GetTime()); + HEAPF64[24>>3] = $7; + $8 = +HEAPF64[32>>3]; + $9 = $7 - $8; + HEAPF64[32>>3] = $7; + $10 = +HEAPF64[56>>3]; + $11 = $10 + $9; + HEAPF64[56>>3] = $11; + $12 = +HEAPF64[16>>3]; + $13 = $11 < $12; + if (!($13)) { + break; + } + } + return; +} +function _Begin3dMode($camera) { + $camera = $camera|0; + var $$byval_copy = 0, $$byval_copy1 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0; + var $8 = 0.0, $9 = 0.0, $cameraView = 0, $cameraView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 160|0; + $cameraView$byval_copy = sp + 88|0; + $$byval_copy1 = sp + 76|0; + $$byval_copy = sp + 64|0; + $cameraView = sp; + _rlglDraw(); + $0 = (_IsVrDeviceReady()|0); + $1 = ($0|0)==(0); + if (!($1)) { + _BeginVrDrawing(); + } + _rlMatrixMode(0); + _rlPushMatrix(); + _rlLoadIdentity(); + $2 = HEAP32[492>>2]|0; + $3 = (+($2|0)); + $4 = HEAP32[496>>2]|0; + $5 = (+($4|0)); + $6 = $3 / $5; + $7 = ((($camera)) + 36|0); + $8 = +HEAPF32[$7>>2]; + $9 = $8; + $10 = $9 * 3.1415926535897931; + $11 = $10 / 360.0; + $12 = (+Math_tan((+$11))); + $13 = $12 * 0.01; + $14 = $6; + $15 = $14 * $13; + $16 = -$15; + $17 = -$13; + _rlFrustum($16,$15,$17,$13,0.01,1000.0); + _rlMatrixMode(1); + _rlLoadIdentity(); + $18 = ((($camera)) + 12|0); + $19 = ((($camera)) + 24|0); + ;HEAP32[$$byval_copy>>2]=HEAP32[$camera>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$camera+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$camera+8>>2]|0; + ;HEAP32[$$byval_copy1>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$18+8>>2]|0; + ;HEAP32[$cameraView$byval_copy>>2]=HEAP32[$19>>2]|0;HEAP32[$cameraView$byval_copy+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$cameraView$byval_copy+8>>2]=HEAP32[$19+8>>2]|0; + _MatrixLookAt($cameraView,$$byval_copy,$$byval_copy1,$cameraView$byval_copy); + dest=$cameraView$byval_copy; src=$cameraView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + (_MatrixToFloat($cameraView$byval_copy)|0); + _rlMultMatrixf(576); + _rlEnableDepthTest(); + STACKTOP = sp;return; +} +function _End3dMode() { + var $0 = 0, $1 = 0, label = 0, sp = 0; + sp = STACKTOP; + _rlglDraw(); + $0 = (_IsVrDeviceReady()|0); + $1 = ($0|0)==(0); + if (!($1)) { + _EndVrDrawing(); + } + _rlMatrixMode(0); + _rlPopMatrix(); + _rlMatrixMode(1); + _rlLoadIdentity(); + _rlDisableDepthTest(); + return; +} +function _GetFPS() { + var $0 = 0.0, $1 = 0.0, $2 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF64[56>>3]; + $1 = 1.0 / $0; + $2 = $1; + return (+$2); +} +function _IsMouseButtonPressed($button) { + $button = $button|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $pressed$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (8720 + ($button)|0); + $1 = HEAP8[$0>>0]|0; + $2 = (8723 + ($button)|0); + $3 = HEAP8[$2>>0]|0; + $4 = ($1<<24>>24)!=($3<<24>>24); + $5 = ($1<<24>>24)==(1); + $or$cond = $5 & $4; + $pressed$0 = $or$cond&1; + return ($pressed$0|0); +} +function _IsMouseButtonReleased($button) { + $button = $button|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $or$cond = 0, $released$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (8720 + ($button)|0); + $1 = HEAP8[$0>>0]|0; + $2 = (8723 + ($button)|0); + $3 = HEAP8[$2>>0]|0; + $4 = ($1<<24>>24)!=($3<<24>>24); + $5 = ($1<<24>>24)==(0); + $or$cond = $5 & $4; + $released$0 = $or$cond&1; + return ($released$0|0); +} +function _GetMousePosition($agg$result) { + $agg$result = $agg$result|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = 8; + $1 = $0; + $2 = HEAP32[$1>>2]|0; + $3 = (($0) + 4)|0; + $4 = $3; + $5 = HEAP32[$4>>2]|0; + $6 = $agg$result; + $7 = $6; + HEAP32[$7>>2] = $2; + $8 = (($6) + 4)|0; + $9 = $8; + HEAP32[$9>>2] = $5; + return; +} +function _rlMatrixMode($mode) { + $mode = $mode|0; + var label = 0, sp = 0; + sp = STACKTOP; + switch ($mode|0) { + case 0: { + HEAP32[744>>2] = 680; + break; + } + case 1: { + HEAP32[744>>2] = 748; + break; + } + default: { + } + } + HEAP32[812>>2] = $mode; + return; +} +function _rlPushMatrix() { + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = HEAP32[816>>2]|0; + $1 = ($0|0)==(15); + if ($1) { + HEAP32[$vararg_buffer>>2] = 16; + _TraceLog(1,8726,$vararg_buffer); + } + $2 = HEAP32[816>>2]|0; + $3 = (820 + ($2<<6)|0); + $4 = HEAP32[744>>2]|0; + dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _rlLoadIdentity(); + $5 = HEAP32[816>>2]|0; + $6 = (($5) + 1)|0; + HEAP32[816>>2] = $6; + $7 = HEAP32[812>>2]|0; + $8 = ($7|0)==(1); + if (!($8)) { + STACKTOP = sp;return; + } + HEAP32[1844>>2] = 1; + STACKTOP = sp;return; +} +function _rlLoadIdentity() { + var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $0 = sp; + $1 = HEAP32[744>>2]|0; + _MatrixIdentity($0); + dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlPopMatrix() { + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[816>>2]|0; + $1 = ($0|0)>(0); + if (!($1)) { + return; + } + $2 = HEAP32[816>>2]|0; + $3 = (($2) + -1)|0; + $4 = (820 + ($3<<6)|0); + $5 = HEAP32[744>>2]|0; + _memmove(($5|0),($4|0),64)|0; + $6 = HEAP32[816>>2]|0; + $7 = (($6) + -1)|0; + HEAP32[816>>2] = $7; + return; +} +function _rlTranslatef($x,$y,$z) { + $x = +$x; + $y = +$y; + $z = +$z; + var $$byval_copy = 0, $0 = 0, $1 = 0, $matTranslation = 0, $matTranslation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $matTranslation$byval_copy = sp + 192|0; + $$byval_copy = sp + 128|0; + $matTranslation = sp + 64|0; + $0 = sp; + _MatrixTranslate($matTranslation,$x,$y,$z); + _MatrixTranspose($matTranslation); + $1 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matTranslation$byval_copy; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$$byval_copy,$matTranslation$byval_copy); + dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlRotatef($angleDeg,$x,$y,$z) { + $angleDeg = +$angleDeg; + $x = +$x; + $y = +$y; + $z = +$z; + var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $axis = 0, $matRotation = 0, $matRotation$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 336|0; + $matRotation$byval_copy = sp + 272|0; + $$byval_copy = sp + 208|0; + $matRotation = sp + 144|0; + $axis = sp + 128|0; + $0 = sp + 64|0; + $1 = sp; + _MatrixIdentity($matRotation); + HEAPF32[$axis>>2] = $x; + $2 = ((($axis)) + 4|0); + HEAPF32[$2>>2] = $y; + $3 = ((($axis)) + 8|0); + HEAPF32[$3>>2] = $z; + _VectorNormalize($axis); + $4 = $angleDeg; + $5 = $4 * 0.017453292519943295; + $6 = $5; + ;HEAP32[$matRotation$byval_copy>>2]=HEAP32[$axis>>2]|0;HEAP32[$matRotation$byval_copy+4>>2]=HEAP32[$axis+4>>2]|0;HEAP32[$matRotation$byval_copy+8>>2]=HEAP32[$axis+8>>2]|0; + _MatrixRotate($0,$matRotation$byval_copy,$6); + dest=$matRotation; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixTranspose($matRotation); + $7 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matRotation$byval_copy; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($1,$$byval_copy,$matRotation$byval_copy); + dest=$7; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlScalef($x,$y,$z) { + $x = +$x; + $y = +$y; + $z = +$z; + var $$byval_copy = 0, $0 = 0, $1 = 0, $matScale = 0, $matScale$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $matScale$byval_copy = sp + 192|0; + $$byval_copy = sp + 128|0; + $matScale = sp + 64|0; + $0 = sp; + _MatrixScale($matScale,$x,$y,$z); + _MatrixTranspose($matScale); + $1 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matScale$byval_copy; src=$matScale; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$$byval_copy,$matScale$byval_copy); + dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlMultMatrixf($m) { + $m = $m|0; + var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $mat = 0, $mat$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $mat$byval_copy = sp + 192|0; + $$byval_copy = sp + 128|0; + $mat = sp + 64|0; + $0 = sp; + $1 = HEAP32[$m>>2]|0; + HEAP32[$mat>>2] = $1; + $2 = ((($mat)) + 4|0); + $3 = ((($m)) + 4|0); + $4 = HEAP32[$3>>2]|0; + HEAP32[$2>>2] = $4; + $5 = ((($mat)) + 8|0); + $6 = ((($m)) + 8|0); + $7 = HEAP32[$6>>2]|0; + HEAP32[$5>>2] = $7; + $8 = ((($mat)) + 12|0); + $9 = ((($m)) + 12|0); + $10 = HEAP32[$9>>2]|0; + HEAP32[$8>>2] = $10; + $11 = ((($mat)) + 16|0); + $12 = ((($m)) + 16|0); + $13 = HEAP32[$12>>2]|0; + HEAP32[$11>>2] = $13; + $14 = ((($mat)) + 20|0); + $15 = ((($m)) + 20|0); + $16 = HEAP32[$15>>2]|0; + HEAP32[$14>>2] = $16; + $17 = ((($mat)) + 24|0); + $18 = ((($m)) + 24|0); + $19 = HEAP32[$18>>2]|0; + HEAP32[$17>>2] = $19; + $20 = ((($mat)) + 28|0); + $21 = ((($m)) + 28|0); + $22 = HEAP32[$21>>2]|0; + HEAP32[$20>>2] = $22; + $23 = ((($mat)) + 32|0); + $24 = ((($m)) + 32|0); + $25 = HEAP32[$24>>2]|0; + HEAP32[$23>>2] = $25; + $26 = ((($mat)) + 36|0); + $27 = ((($m)) + 36|0); + $28 = HEAP32[$27>>2]|0; + HEAP32[$26>>2] = $28; + $29 = ((($mat)) + 40|0); + $30 = ((($m)) + 40|0); + $31 = HEAP32[$30>>2]|0; + HEAP32[$29>>2] = $31; + $32 = ((($mat)) + 44|0); + $33 = ((($m)) + 44|0); + $34 = HEAP32[$33>>2]|0; + HEAP32[$32>>2] = $34; + $35 = ((($mat)) + 48|0); + $36 = ((($m)) + 48|0); + $37 = HEAP32[$36>>2]|0; + HEAP32[$35>>2] = $37; + $38 = ((($mat)) + 52|0); + $39 = ((($m)) + 52|0); + $40 = HEAP32[$39>>2]|0; + HEAP32[$38>>2] = $40; + $41 = ((($mat)) + 56|0); + $42 = ((($m)) + 56|0); + $43 = HEAP32[$42>>2]|0; + HEAP32[$41>>2] = $43; + $44 = ((($mat)) + 60|0); + $45 = ((($m)) + 60|0); + $46 = HEAP32[$45>>2]|0; + HEAP32[$44>>2] = $46; + $47 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$47; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$mat$byval_copy; src=$mat; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$$byval_copy,$mat$byval_copy); + dest=$47; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlFrustum($left,$right,$bottom,$top,$near,$far) { + $left = +$left; + $right = +$right; + $bottom = +$bottom; + $top = +$top; + $near = +$near; + $far = +$far; + var $$byval_copy = 0, $0 = 0, $1 = 0, $matPerps = 0, $matPerps$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $matPerps$byval_copy = sp + 192|0; + $$byval_copy = sp + 128|0; + $matPerps = sp + 64|0; + $0 = sp; + _MatrixFrustum($matPerps,$left,$right,$bottom,$top,$near,$far); + _MatrixTranspose($matPerps); + $1 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matPerps$byval_copy; src=$matPerps; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$$byval_copy,$matPerps$byval_copy); + dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlOrtho($left,$right,$bottom,$top,$near,$far) { + $left = +$left; + $right = +$right; + $bottom = +$bottom; + $top = +$top; + $near = +$near; + $far = +$far; + var $$byval_copy = 0, $0 = 0, $1 = 0, $matOrtho = 0, $matOrtho$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $matOrtho$byval_copy = sp + 192|0; + $$byval_copy = sp + 128|0; + $matOrtho = sp + 64|0; + $0 = sp; + _MatrixOrtho($matOrtho,$left,$right,$bottom,$top,$near,$far); + _MatrixTranspose($matOrtho); + $1 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matOrtho$byval_copy; src=$matOrtho; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$$byval_copy,$matOrtho$byval_copy); + dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlViewport($x,$y,$width,$height) { + $x = $x|0; + $y = $y|0; + $width = $width|0; + $height = $height|0; + var label = 0, sp = 0; + sp = STACKTOP; + _glViewport(($x|0),($y|0),($width|0),($height|0)); + return; +} +function _rlBegin($mode) { + $mode = $mode|0; + var label = 0, sp = 0; + sp = STACKTOP; + HEAP32[1848>>2] = $mode; + return; +} +function _rlEnd() { + var $$byval_copy = 0, $$lcssa = 0, $$promoted = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; + var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0; + var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; + var $15 = 0.0, $150 = 0, $151 = 0.0, $152 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; + var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; + var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; + var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; + var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond16 = 0, $exitcond17 = 0, $exitcond18 = 0; + var $i$013 = 0, $i1$011 = 0, $i2$04 = 0, $i4$05 = 0, $i6$09 = 0, $i7$07 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $$byval_copy = sp; + $0 = HEAP32[1844>>2]|0; + $1 = ($0|0)==(0); + if (!($1)) { + $2 = HEAP32[1852>>2]|0; + $3 = ($2|0)>(0); + if ($3) { + $i$013 = 0; + while(1) { + $4 = HEAP32[1856>>2]|0; + $5 = (($4) + (($i$013*12)|0)|0); + $6 = HEAP32[744>>2]|0; + dest=$$byval_copy; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _VectorTransform($5,$$byval_copy); + $7 = (($i$013) + 1)|0; + $8 = HEAP32[1852>>2]|0; + $9 = ($7|0)<($8|0); + if ($9) { + $i$013 = $7; + } else { + $$lcssa = $8; + break; + } + } + HEAP32[1844>>2] = 0; + $10 = ($$lcssa|0)>(0); + if ($10) { + $i1$011 = 0; + while(1) { + $11 = HEAP32[1856>>2]|0; + $12 = (($11) + (($i1$011*12)|0)|0); + $13 = +HEAPF32[$12>>2]; + $14 = (((($11) + (($i1$011*12)|0)|0)) + 4|0); + $15 = +HEAPF32[$14>>2]; + $16 = (((($11) + (($i1$011*12)|0)|0)) + 8|0); + $17 = +HEAPF32[$16>>2]; + _rlVertex3f($13,$15,$17); + $18 = (($i1$011) + 1)|0; + $19 = HEAP32[1852>>2]|0; + $20 = ($18|0)<($19|0); + if ($20) { + $i1$011 = $18; + } else { + break; + } + } + } + } else { + HEAP32[1844>>2] = 0; + } + HEAP32[1852>>2] = 0; + } + $21 = HEAP32[1848>>2]|0; + switch ($21|0) { + case 0: { + $22 = HEAP32[1860>>2]|0; + $23 = HEAP32[(1868)>>2]|0; + $24 = ($22|0)>($23|0); + if (!($24)) { + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + } + $25 = (($22) - ($23))|0; + $i2$04 = 0; + while(1) { + $26 = HEAP32[(1868)>>2]|0; + $27 = $26 << 2; + $28 = (($27) + -4)|0; + $29 = HEAP32[(1880)>>2]|0; + $30 = (($29) + ($28)|0); + $31 = HEAP8[$30>>0]|0; + $32 = (($29) + ($27)|0); + HEAP8[$32>>0] = $31; + $33 = HEAP32[(1868)>>2]|0; + $34 = $33 << 2; + $35 = (($34) + -3)|0; + $36 = HEAP32[(1880)>>2]|0; + $37 = (($36) + ($35)|0); + $38 = HEAP8[$37>>0]|0; + $39 = $34 | 1; + $40 = (($36) + ($39)|0); + HEAP8[$40>>0] = $38; + $41 = HEAP32[(1868)>>2]|0; + $42 = $41 << 2; + $43 = (($42) + -2)|0; + $44 = HEAP32[(1880)>>2]|0; + $45 = (($44) + ($43)|0); + $46 = HEAP8[$45>>0]|0; + $47 = $42 | 2; + $48 = (($44) + ($47)|0); + HEAP8[$48>>0] = $46; + $49 = HEAP32[(1868)>>2]|0; + $50 = $49 << 2; + $51 = (($50) + -1)|0; + $52 = HEAP32[(1880)>>2]|0; + $53 = (($52) + ($51)|0); + $54 = HEAP8[$53>>0]|0; + $55 = $50 | 3; + $56 = (($52) + ($55)|0); + HEAP8[$56>>0] = $54; + $57 = HEAP32[(1868)>>2]|0; + $58 = (($57) + 1)|0; + HEAP32[(1868)>>2] = $58; + $59 = (($i2$04) + 1)|0; + $exitcond = ($59|0)==($25|0); + if ($exitcond) { + break; + } else { + $i2$04 = $59; + } + } + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + break; + } + case 1: { + $60 = HEAP32[1908>>2]|0; + $61 = HEAP32[(1916)>>2]|0; + $62 = ($60|0)>($61|0); + if (!($62)) { + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + } + $63 = (($60) - ($61))|0; + $i4$05 = 0; + while(1) { + $64 = HEAP32[(1916)>>2]|0; + $65 = $64 << 2; + $66 = (($65) + -4)|0; + $67 = HEAP32[(1928)>>2]|0; + $68 = (($67) + ($66)|0); + $69 = HEAP8[$68>>0]|0; + $70 = (($67) + ($65)|0); + HEAP8[$70>>0] = $69; + $71 = HEAP32[(1916)>>2]|0; + $72 = $71 << 2; + $73 = (($72) + -3)|0; + $74 = HEAP32[(1928)>>2]|0; + $75 = (($74) + ($73)|0); + $76 = HEAP8[$75>>0]|0; + $77 = $72 | 1; + $78 = (($74) + ($77)|0); + HEAP8[$78>>0] = $76; + $79 = HEAP32[(1916)>>2]|0; + $80 = $79 << 2; + $81 = (($80) + -2)|0; + $82 = HEAP32[(1928)>>2]|0; + $83 = (($82) + ($81)|0); + $84 = HEAP8[$83>>0]|0; + $85 = $80 | 2; + $86 = (($82) + ($85)|0); + HEAP8[$86>>0] = $84; + $87 = HEAP32[(1916)>>2]|0; + $88 = $87 << 2; + $89 = (($88) + -1)|0; + $90 = HEAP32[(1928)>>2]|0; + $91 = (($90) + ($89)|0); + $92 = HEAP8[$91>>0]|0; + $93 = $88 | 3; + $94 = (($90) + ($93)|0); + HEAP8[$94>>0] = $92; + $95 = HEAP32[(1916)>>2]|0; + $96 = (($95) + 1)|0; + HEAP32[(1916)>>2] = $96; + $97 = (($i4$05) + 1)|0; + $exitcond16 = ($97|0)==($63|0); + if ($exitcond16) { + break; + } else { + $i4$05 = $97; + } + } + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + break; + } + case 2: { + $98 = HEAP32[1956>>2]|0; + $99 = HEAP32[(1964)>>2]|0; + $100 = ($98|0)>($99|0); + if ($100) { + $101 = (($98) - ($99))|0; + $i6$09 = 0; + while(1) { + $102 = HEAP32[(1964)>>2]|0; + $103 = $102 << 2; + $104 = (($103) + -4)|0; + $105 = HEAP32[(1976)>>2]|0; + $106 = (($105) + ($104)|0); + $107 = HEAP8[$106>>0]|0; + $108 = (($105) + ($103)|0); + HEAP8[$108>>0] = $107; + $109 = HEAP32[(1964)>>2]|0; + $110 = $109 << 2; + $111 = (($110) + -3)|0; + $112 = HEAP32[(1976)>>2]|0; + $113 = (($112) + ($111)|0); + $114 = HEAP8[$113>>0]|0; + $115 = $110 | 1; + $116 = (($112) + ($115)|0); + HEAP8[$116>>0] = $114; + $117 = HEAP32[(1964)>>2]|0; + $118 = $117 << 2; + $119 = (($118) + -2)|0; + $120 = HEAP32[(1976)>>2]|0; + $121 = (($120) + ($119)|0); + $122 = HEAP8[$121>>0]|0; + $123 = $118 | 2; + $124 = (($120) + ($123)|0); + HEAP8[$124>>0] = $122; + $125 = HEAP32[(1964)>>2]|0; + $126 = $125 << 2; + $127 = (($126) + -1)|0; + $128 = HEAP32[(1976)>>2]|0; + $129 = (($128) + ($127)|0); + $130 = HEAP8[$129>>0]|0; + $131 = $126 | 3; + $132 = (($128) + ($131)|0); + HEAP8[$132>>0] = $130; + $133 = HEAP32[(1964)>>2]|0; + $134 = (($133) + 1)|0; + HEAP32[(1964)>>2] = $134; + $135 = (($i6$09) + 1)|0; + $exitcond18 = ($135|0)==($101|0); + if ($exitcond18) { + break; + } else { + $i6$09 = $135; + } + } + } + $136 = HEAP32[1956>>2]|0; + $137 = HEAP32[(1960)>>2]|0; + $138 = ($136|0)>($137|0); + if (!($138)) { + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + } + $139 = HEAP32[(1972)>>2]|0; + $$promoted = HEAP32[(1960)>>2]|0; + $140 = (($136) + ($$promoted))|0; + $141 = (($136) - ($137))|0; + $143 = $$promoted;$i7$07 = 0; + while(1) { + $142 = $143 << 1; + $144 = (($139) + ($142<<2)|0); + HEAPF32[$144>>2] = 0.0; + $145 = $143 << 1; + $146 = $145 | 1; + $147 = (($139) + ($146<<2)|0); + HEAPF32[$147>>2] = 0.0; + $148 = (($143) + 1)|0; + $149 = (($i7$07) + 1)|0; + $exitcond17 = ($149|0)==($141|0); + if ($exitcond17) { + break; + } else { + $143 = $148;$i7$07 = $149; + } + } + $150 = (($140) - ($137))|0; + HEAP32[(1960)>>2] = $150; + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + break; + } + default: { + $151 = +HEAPF32[2004>>2]; + $152 = $151 + 4.9999998736893758E-5; + HEAPF32[2004>>2] = $152; + STACKTOP = sp;return; + } + } +} +function _rlVertex3f($x,$y,$z) { + $x = +$x; + $y = +$y; + $z = +$z; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; + var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $0 = HEAP32[1844>>2]|0; + $1 = ($0|0)==(0); + if (!($1)) { + $2 = HEAP32[1852>>2]|0; + $3 = HEAP32[1856>>2]|0; + $4 = (($3) + (($2*12)|0)|0); + HEAPF32[$4>>2] = $x; + $5 = HEAP32[1852>>2]|0; + $6 = HEAP32[1856>>2]|0; + $7 = (((($6) + (($5*12)|0)|0)) + 4|0); + HEAPF32[$7>>2] = $y; + $8 = HEAP32[1852>>2]|0; + $9 = HEAP32[1856>>2]|0; + $10 = (((($9) + (($8*12)|0)|0)) + 8|0); + HEAPF32[$10>>2] = $z; + $11 = HEAP32[1852>>2]|0; + $12 = (($11) + 1)|0; + HEAP32[1852>>2] = $12; + STACKTOP = sp;return; + } + $13 = HEAP32[1848>>2]|0; + switch ($13|0) { + case 0: { + $14 = HEAP32[1860>>2]|0; + $15 = ($14|0)<(2048); + if ($15) { + $16 = ($14*3)|0; + $17 = HEAP32[(1872)>>2]|0; + $18 = (($17) + ($16<<2)|0); + HEAPF32[$18>>2] = $x; + $19 = HEAP32[1860>>2]|0; + $20 = ($19*3)|0; + $21 = (($20) + 1)|0; + $22 = HEAP32[(1872)>>2]|0; + $23 = (($22) + ($21<<2)|0); + HEAPF32[$23>>2] = $y; + $24 = HEAP32[1860>>2]|0; + $25 = ($24*3)|0; + $26 = (($25) + 2)|0; + $27 = HEAP32[(1872)>>2]|0; + $28 = (($27) + ($26<<2)|0); + HEAPF32[$28>>2] = $z; + $29 = HEAP32[1860>>2]|0; + $30 = (($29) + 1)|0; + HEAP32[1860>>2] = $30; + STACKTOP = sp;return; + } else { + _TraceLog(1,8764,$vararg_buffer); + STACKTOP = sp;return; + } + break; + } + case 1: { + $31 = HEAP32[1908>>2]|0; + $32 = ($31|0)<(6144); + if ($32) { + $33 = ($31*3)|0; + $34 = HEAP32[(1920)>>2]|0; + $35 = (($34) + ($33<<2)|0); + HEAPF32[$35>>2] = $x; + $36 = HEAP32[1908>>2]|0; + $37 = ($36*3)|0; + $38 = (($37) + 1)|0; + $39 = HEAP32[(1920)>>2]|0; + $40 = (($39) + ($38<<2)|0); + HEAPF32[$40>>2] = $y; + $41 = HEAP32[1908>>2]|0; + $42 = ($41*3)|0; + $43 = (($42) + 2)|0; + $44 = HEAP32[(1920)>>2]|0; + $45 = (($44) + ($43<<2)|0); + HEAPF32[$45>>2] = $z; + $46 = HEAP32[1908>>2]|0; + $47 = (($46) + 1)|0; + HEAP32[1908>>2] = $47; + STACKTOP = sp;return; + } else { + _TraceLog(1,8789,$vararg_buffer1); + STACKTOP = sp;return; + } + break; + } + case 2: { + $48 = HEAP32[1956>>2]|0; + $49 = ($48|0)<(4096); + if ($49) { + $50 = ($48*3)|0; + $51 = HEAP32[(1968)>>2]|0; + $52 = (($51) + ($50<<2)|0); + HEAPF32[$52>>2] = $x; + $53 = HEAP32[1956>>2]|0; + $54 = ($53*3)|0; + $55 = (($54) + 1)|0; + $56 = HEAP32[(1968)>>2]|0; + $57 = (($56) + ($55<<2)|0); + HEAPF32[$57>>2] = $y; + $58 = HEAP32[1956>>2]|0; + $59 = ($58*3)|0; + $60 = (($59) + 2)|0; + $61 = HEAP32[(1968)>>2]|0; + $62 = (($61) + ($60<<2)|0); + HEAPF32[$62>>2] = $z; + $63 = HEAP32[1956>>2]|0; + $64 = (($63) + 1)|0; + HEAP32[1956>>2] = $64; + $65 = HEAP32[2008>>2]|0; + $66 = (($65) + -1)|0; + $67 = HEAP32[2012>>2]|0; + $68 = (($67) + (($66*144)|0)|0); + $69 = HEAP32[$68>>2]|0; + $70 = (($69) + 1)|0; + HEAP32[$68>>2] = $70; + STACKTOP = sp;return; + } else { + _TraceLog(1,8818,$vararg_buffer3); + STACKTOP = sp;return; + } + break; + } + default: { + STACKTOP = sp;return; + } + } +} +function _rlVertex2f($x,$y) { + $x = +$x; + $y = +$y; + var $0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[2004>>2]; + _rlVertex3f($x,$y,$0); + return; +} +function _rlTexCoord2f($x,$y) { + $x = +$x; + $y = +$y; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[1848>>2]|0; + $1 = ($0|0)==(2); + if (!($1)) { + return; + } + $2 = HEAP32[(1960)>>2]|0; + $3 = $2 << 1; + $4 = HEAP32[(1972)>>2]|0; + $5 = (($4) + ($3<<2)|0); + HEAPF32[$5>>2] = $x; + $6 = HEAP32[(1960)>>2]|0; + $7 = $6 << 1; + $8 = $7 | 1; + $9 = HEAP32[(1972)>>2]|0; + $10 = (($9) + ($8<<2)|0); + HEAPF32[$10>>2] = $y; + $11 = HEAP32[(1960)>>2]|0; + $12 = (($11) + 1)|0; + HEAP32[(1960)>>2] = $12; + return; +} +function _rlNormal3f($x,$y,$z) { + $x = +$x; + $y = +$y; + $z = +$z; + var label = 0, sp = 0; + sp = STACKTOP; + return; +} +function _rlColor4ub($x,$y,$z,$w) { + $x = $x|0; + $y = $y|0; + $z = $z|0; + $w = $w|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; + var $63 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[1848>>2]|0; + switch ($0|0) { + case 0: { + $1 = HEAP32[(1868)>>2]|0; + $2 = $1 << 2; + $3 = HEAP32[(1880)>>2]|0; + $4 = (($3) + ($2)|0); + HEAP8[$4>>0] = $x; + $5 = HEAP32[(1868)>>2]|0; + $6 = $5 << 2; + $7 = $6 | 1; + $8 = HEAP32[(1880)>>2]|0; + $9 = (($8) + ($7)|0); + HEAP8[$9>>0] = $y; + $10 = HEAP32[(1868)>>2]|0; + $11 = $10 << 2; + $12 = $11 | 2; + $13 = HEAP32[(1880)>>2]|0; + $14 = (($13) + ($12)|0); + HEAP8[$14>>0] = $z; + $15 = HEAP32[(1868)>>2]|0; + $16 = $15 << 2; + $17 = $16 | 3; + $18 = HEAP32[(1880)>>2]|0; + $19 = (($18) + ($17)|0); + HEAP8[$19>>0] = $w; + $20 = HEAP32[(1868)>>2]|0; + $21 = (($20) + 1)|0; + HEAP32[(1868)>>2] = $21; + return; + break; + } + case 1: { + $22 = HEAP32[(1916)>>2]|0; + $23 = $22 << 2; + $24 = HEAP32[(1928)>>2]|0; + $25 = (($24) + ($23)|0); + HEAP8[$25>>0] = $x; + $26 = HEAP32[(1916)>>2]|0; + $27 = $26 << 2; + $28 = $27 | 1; + $29 = HEAP32[(1928)>>2]|0; + $30 = (($29) + ($28)|0); + HEAP8[$30>>0] = $y; + $31 = HEAP32[(1916)>>2]|0; + $32 = $31 << 2; + $33 = $32 | 2; + $34 = HEAP32[(1928)>>2]|0; + $35 = (($34) + ($33)|0); + HEAP8[$35>>0] = $z; + $36 = HEAP32[(1916)>>2]|0; + $37 = $36 << 2; + $38 = $37 | 3; + $39 = HEAP32[(1928)>>2]|0; + $40 = (($39) + ($38)|0); + HEAP8[$40>>0] = $w; + $41 = HEAP32[(1916)>>2]|0; + $42 = (($41) + 1)|0; + HEAP32[(1916)>>2] = $42; + return; + break; + } + case 2: { + $43 = HEAP32[(1964)>>2]|0; + $44 = $43 << 2; + $45 = HEAP32[(1976)>>2]|0; + $46 = (($45) + ($44)|0); + HEAP8[$46>>0] = $x; + $47 = HEAP32[(1964)>>2]|0; + $48 = $47 << 2; + $49 = $48 | 1; + $50 = HEAP32[(1976)>>2]|0; + $51 = (($50) + ($49)|0); + HEAP8[$51>>0] = $y; + $52 = HEAP32[(1964)>>2]|0; + $53 = $52 << 2; + $54 = $53 | 2; + $55 = HEAP32[(1976)>>2]|0; + $56 = (($55) + ($54)|0); + HEAP8[$56>>0] = $z; + $57 = HEAP32[(1964)>>2]|0; + $58 = $57 << 2; + $59 = $58 | 3; + $60 = HEAP32[(1976)>>2]|0; + $61 = (($60) + ($59)|0); + HEAP8[$61>>0] = $w; + $62 = HEAP32[(1964)>>2]|0; + $63 = (($62) + 1)|0; + HEAP32[(1964)>>2] = $63; + return; + break; + } + default: { + return; + } + } +} +function _rlColor3f($x,$y,$z) { + $x = +$x; + $y = +$y; + $z = +$z; + var $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $x * 255.0; + $1 = (~~(($0))&255); + $2 = $y * 255.0; + $3 = (~~(($2))&255); + $4 = $z * 255.0; + $5 = (~~(($4))&255); + _rlColor4ub($1,$3,$5,-1); + return; +} +function _rlEnableTexture($id) { + $id = $id|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[2008>>2]|0; + $1 = (($0) + -1)|0; + $2 = HEAP32[2012>>2]|0; + $3 = (((($2) + (($1*144)|0)|0)) + 8|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)==($id|0); + if ($5) { + return; + } + $6 = (($2) + (($1*144)|0)|0); + $7 = HEAP32[$6>>2]|0; + $8 = ($7|0)>(0); + if ($8) { + $9 = (($0) + 1)|0; + HEAP32[2008>>2] = $9; + } + $10 = HEAP32[2008>>2]|0; + $11 = (($10) + -1)|0; + $12 = HEAP32[2012>>2]|0; + $13 = (((($12) + (($11*144)|0)|0)) + 8|0); + HEAP32[$13>>2] = $id; + $14 = HEAP32[2008>>2]|0; + $15 = (($14) + -1)|0; + $16 = HEAP32[2012>>2]|0; + $17 = (($16) + (($15*144)|0)|0); + HEAP32[$17>>2] = 0; + return; +} +function _rlDisableTexture() { + var label = 0, sp = 0; + sp = STACKTOP; + return; +} +function _rlEnableRenderTexture($id) { + $id = $id|0; + var label = 0, sp = 0; + sp = STACKTOP; + _glBindFramebuffer(36160,($id|0)); + return; +} +function _rlDisableRenderTexture() { + var label = 0, sp = 0; + sp = STACKTOP; + _glBindFramebuffer(36160,0); + return; +} +function _rlEnableDepthTest() { + var label = 0, sp = 0; + sp = STACKTOP; + _glEnable(2929); + return; +} +function _rlDisableDepthTest() { + var label = 0, sp = 0; + sp = STACKTOP; + _glDisable(2929); + return; +} +function _rlDeleteTextures($id) { + $id = $id|0; + var $0 = 0, $1 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $0 = sp; + HEAP32[$0>>2] = $id; + $1 = ($id|0)==(0); + if (!($1)) { + _glDeleteTextures(1,($0|0)); + } + STACKTOP = sp;return; +} +function _rlDeleteVertexArrays($id) { + $id = $id|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = sp + 4|0; + HEAP32[$0>>2] = $id; + $1 = HEAP32[2016>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + STACKTOP = sp;return; + } + $3 = ($id|0)==(0); + if (!($3)) { + $4 = HEAP32[2020>>2]|0; + FUNCTION_TABLE_vii[$4 & 63](1,$0); + } + $5 = HEAP32[$0>>2]|0; + HEAP32[$vararg_buffer>>2] = $5; + _TraceLog(0,8843,$vararg_buffer); + STACKTOP = sp;return; +} +function _rlDeleteBuffers($id) { + $id = $id|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = sp + 4|0; + HEAP32[$0>>2] = $id; + $1 = ($id|0)==(0); + if ($1) { + STACKTOP = sp;return; + } + _glDeleteBuffers(1,($0|0)); + $2 = HEAP32[2016>>2]|0; + $3 = ($2|0)==(0); + if (!($3)) { + STACKTOP = sp;return; + } + $4 = HEAP32[$0>>2]|0; + HEAP32[$vararg_buffer>>2] = $4; + _TraceLog(0,8891,$vararg_buffer); + STACKTOP = sp;return; +} +function _rlClearColor($r,$g,$b,$a) { + $r = $r|0; + $g = $g|0; + $b = $b|0; + $a = $a|0; + var $0 = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (+($r&255)); + $1 = $0 / 255.0; + $2 = (+($g&255)); + $3 = $2 / 255.0; + $4 = (+($b&255)); + $5 = $4 / 255.0; + $6 = (+($a&255)); + $7 = $6 / 255.0; + _glClearColor((+$1),(+$3),(+$5),(+$7)); + return; +} +function _rlClearScreenBuffers() { + var label = 0, sp = 0; + sp = STACKTOP; + _glClear(16640); + return; +} +function _rlGetVersion() { + var label = 0, sp = 0; + sp = STACKTOP; + return 4; +} +function _rlglInit($width,$height) { + $width = $width|0; + $height = $height|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; + var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $8 = 0, $9 = 0, $exitcond = 0; + var $exitcond10 = 0, $exitcond11 = 0, $i$04 = 0, $i1$03 = 0, $i2$02 = 0, $numExt$0$lcssa = 0, $numExt$05 = 0, $pixels = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0, $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0; + var $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer36 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 2448|0; + $vararg_buffer36 = sp + 2168|0; + $vararg_buffer34 = sp + 2160|0; + $vararg_buffer31 = sp + 2152|0; + $vararg_buffer29 = sp + 2144|0; + $vararg_buffer27 = sp + 2136|0; + $vararg_buffer25 = sp + 2128|0; + $vararg_buffer23 = sp + 2120|0; + $vararg_buffer21 = sp + 2112|0; + $vararg_buffer19 = sp + 2104|0; + $vararg_buffer17 = sp + 2096|0; + $vararg_buffer15 = sp + 2088|0; + $vararg_buffer13 = sp + 2080|0; + $vararg_buffer10 = sp + 2072|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $pixels = sp + 2432|0; + $0 = sp + 2384|0; + $1 = sp + 2368|0; + $2 = sp + 2304|0; + $3 = sp + 2240|0; + $4 = sp + 2176|0; + $5 = (_glGetString(7936)|0); + HEAP32[$vararg_buffer>>2] = $5; + _TraceLog(0,8946,$vararg_buffer); + $6 = (_glGetString(7937)|0); + HEAP32[$vararg_buffer1>>2] = $6; + _TraceLog(0,8964,$vararg_buffer1); + $7 = (_glGetString(7938)|0); + HEAP32[$vararg_buffer4>>2] = $7; + _TraceLog(0,8982,$vararg_buffer4); + $8 = (_glGetString(35724)|0); + HEAP32[$vararg_buffer7>>2] = $8; + _TraceLog(0,9000,$vararg_buffer7); + $9 = (_glGetString(7939)|0); + $10 = (_strlen($9)|0); + $11 = (($10) + 1)|0; + $12 = (_malloc($11)|0); + _memcpy(($12|0),($9|0),($11|0))|0; + $13 = (_strtok($12,9018)|0); + HEAP32[$vararg_buffer7>>2] = $13; + $14 = ($13|0)==(0|0); + if ($14) { + $numExt$0$lcssa = -1; + } else { + $numExt$05 = 0; + while(1) { + $15 = (($numExt$05) + 1)|0; + $16 = (_strtok(0,9018)|0); + $17 = (($vararg_buffer7) + ($15<<2)|0); + HEAP32[$17>>2] = $16; + $18 = ($16|0)==(0|0); + if ($18) { + $numExt$0$lcssa = $numExt$05; + break; + } else { + $numExt$05 = $15; + } + } + } + _free($12); + HEAP32[$vararg_buffer10>>2] = $numExt$0$lcssa; + _TraceLog(0,9020,$vararg_buffer10); + $19 = ($numExt$0$lcssa|0)>(0); + if ($19) { + $i$04 = 0; + while(1) { + $20 = (($vararg_buffer7) + ($i$04<<2)|0); + $21 = HEAP32[$20>>2]|0; + $22 = (_strcmp($21,9055)|0); + $23 = ($22|0)==(0); + if ($23) { + HEAP32[2016>>2] = 1; + $24 = (_eglGetProcAddress((9082|0))|0); + HEAP32[2024>>2] = $24; + $25 = (_eglGetProcAddress((9103|0))|0); + HEAP32[2028>>2] = $25; + $26 = (_eglGetProcAddress((9124|0))|0); + HEAP32[2020>>2] = $26; + } + $27 = HEAP32[$20>>2]|0; + $28 = (_strcmp($27,9148)|0); + $29 = ($28|0)==(0); + if ($29) { + HEAP32[2032>>2] = 1; + } + $30 = HEAP32[$20>>2]|0; + $31 = (_strcmp($30,9168)|0); + $32 = ($31|0)==(0); + if ($32) { + label = 11; + } else { + $33 = (_strcmp($30,9200)|0); + $34 = ($33|0)==(0); + if ($34) { + label = 11; + } else { + $35 = (_strcmp($30,9233)|0); + $36 = ($35|0)==(0); + if ($36) { + label = 11; + } + } + } + if ((label|0) == 11) { + label = 0; + HEAP32[2036>>2] = 1; + } + $37 = HEAP32[$20>>2]|0; + $38 = (_strcmp($37,9273)|0); + $39 = ($38|0)==(0); + if ($39) { + label = 14; + } else { + $40 = (_strcmp($37,9309)|0); + $41 = ($40|0)==(0); + if ($41) { + label = 14; + } + } + if ((label|0) == 14) { + label = 0; + HEAP32[2040>>2] = 1; + } + $42 = HEAP32[$20>>2]|0; + $43 = (_strcmp($42,9342)|0); + $44 = ($43|0)==(0); + if ($44) { + HEAP32[2044>>2] = 1; + } + $45 = HEAP32[$20>>2]|0; + $46 = (_strcmp($45,9367)|0); + $47 = ($46|0)==(0); + if ($47) { + HEAP32[2048>>2] = 1; + } + $48 = HEAP32[$20>>2]|0; + $49 = (_strcmp($48,9400)|0); + $50 = ($49|0)==(0); + if ($50) { + HEAP32[2052>>2] = 1; + } + $51 = (($i$04) + 1)|0; + $exitcond11 = ($51|0)==($numExt$0$lcssa|0); + if ($exitcond11) { + break; + } else { + $i$04 = $51; + } + } + } + $52 = HEAP32[2016>>2]|0; + $53 = ($52|0)==(0); + if ($53) { + _TraceLog(2,9511,$vararg_buffer15); + } else { + _TraceLog(0,9436,$vararg_buffer13); + } + $54 = HEAP32[2032>>2]|0; + $55 = ($54|0)==(0); + if ($55) { + _TraceLog(2,9647,$vararg_buffer19); + } else { + _TraceLog(0,9572,$vararg_buffer17); + } + $56 = HEAP32[2036>>2]|0; + $57 = ($56|0)==(0); + if (!($57)) { + _TraceLog(0,9739,$vararg_buffer21); + } + $58 = HEAP32[2040>>2]|0; + $59 = ($58|0)==(0); + if (!($59)) { + _TraceLog(0,9785,$vararg_buffer23); + } + $60 = HEAP32[2044>>2]|0; + $61 = ($60|0)==(0); + if (!($61)) { + _TraceLog(0,9832,$vararg_buffer25); + } + $62 = HEAP32[2048>>2]|0; + $63 = ($62|0)==(0); + if (!($63)) { + _TraceLog(0,9883,$vararg_buffer27); + } + $64 = HEAP32[2052>>2]|0; + $65 = ($64|0)==(0); + if (!($65)) { + _TraceLog(0,9930,$vararg_buffer29); + } + HEAP32[$pixels>>2] = -1; + $66 = (_rlglLoadTexture($pixels,1,1,7,1)|0); + HEAP32[2056>>2] = $66; + $67 = ($66|0)==(0); + if ($67) { + _TraceLog(2,10028,$vararg_buffer34); + } else { + HEAP32[$vararg_buffer31>>2] = $66; + _TraceLog(0,9977,$vararg_buffer31); + } + _LoadDefaultShader($0); + dest=2060; src=$0; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=2108; src=$0; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _LoadDefaultBuffers(); + $68 = (_malloc(49152)|0); + HEAP32[1856>>2] = $68; + $i1$03 = 0; + while(1) { + $69 = HEAP32[1856>>2]|0; + $70 = (($69) + (($i1$03*12)|0)|0); + _VectorZero($1); + ;HEAP32[$70>>2]=HEAP32[$1>>2]|0;HEAP32[$70+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$70+8>>2]=HEAP32[$1+8>>2]|0; + $71 = (($i1$03) + 1)|0; + $exitcond10 = ($71|0)==(4096); + if ($exitcond10) { + break; + } else { + $i1$03 = $71; + } + } + $72 = (_malloc(36864)|0); + HEAP32[2012>>2] = $72; + $i2$02 = 0; + while(1) { + $73 = (((($72) + (($i2$02*144)|0)|0)) + 8|0); + HEAP32[$73>>2] = 0; + $74 = (($72) + (($i2$02*144)|0)|0); + HEAP32[$74>>2] = 0; + $75 = (($i2$02) + 1)|0; + $exitcond = ($75|0)==(256); + if ($exitcond) { + break; + } else { + $i2$02 = $75; + } + } + HEAP32[2008>>2] = 1; + $76 = HEAP32[2056>>2]|0; + $77 = HEAP32[2012>>2]|0; + $78 = ((($77)) + 8|0); + HEAP32[$78>>2] = $76; + HEAP32[1848>>2] = 1; + _MatrixIdentity($2); + dest=820; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(884); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(948); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1012); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1076); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1140); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1204); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1268); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1332); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1396); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1460); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1524); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1588); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1652); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1716); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($2); + dest=(1780); src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($3); + dest=680; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixIdentity($4); + dest=748; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + HEAP32[744>>2] = 748; + _glDepthFunc(515); + _glDisable(2929); + _glBlendFunc(770,771); + _glEnable(3042); + _glCullFace(1029); + _glFrontFace(2305); + _glEnable(2884); + _glClearColor(0.0,0.0,0.0,1.0); + _glClearDepthf(1.0); + _glClear(16640); + HEAP32[2156>>2] = $width; + HEAP32[2160>>2] = $height; + _TraceLog(0,10067,$vararg_buffer36); + STACKTOP = sp;return; +} +function _rlglLoadTexture($data,$width,$height,$textureFormat,$mipmapCount) { + $data = $data|0; + $width = $width|0; + $height = $height|0; + $textureFormat = $textureFormat|0; + $mipmapCount = $mipmapCount|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, $id = 0, $or$cond = 0, $or$cond18 = 0, $or$cond20 = 0, $or$cond22 = 0, $or$cond7 = 0, $switch = 0, $textureFormat$off = 0, $textureFormat$off14 = 0, $textureFormat$off15 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0; + var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 80|0; + $vararg_buffer15 = sp + 64|0; + $vararg_buffer11 = sp + 48|0; + $vararg_buffer9 = sp + 40|0; + $vararg_buffer7 = sp + 32|0; + $vararg_buffer5 = sp + 24|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $id = sp + 68|0; + _glBindTexture(3553,0); + HEAP32[$id>>2] = 0; + $0 = HEAP32[2036>>2]|0; + $1 = ($0|0)==(0); + $2 = $textureFormat & -4; + $switch = ($2|0)==(8); + $or$cond22 = $switch & $1; + if ($or$cond22) { + _TraceLog(2,10114,$vararg_buffer); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } + $3 = HEAP32[2040>>2]|0; + $4 = ($3|0)==(0); + $5 = ($textureFormat|0)==(12); + $or$cond7 = $5 & $4; + if ($or$cond7) { + _TraceLog(2,10158,$vararg_buffer1); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } + $6 = HEAP32[2044>>2]|0; + $7 = ($6|0)==(0); + $textureFormat$off = (($textureFormat) + -13)|0; + $8 = ($textureFormat$off>>>0)<(2); + $or$cond = $8 & $7; + if ($or$cond) { + _TraceLog(2,10203,$vararg_buffer3); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } + $9 = HEAP32[2048>>2]|0; + $10 = ($9|0)==(0); + $textureFormat$off14 = (($textureFormat) + -15)|0; + $11 = ($textureFormat$off14>>>0)<(2); + $or$cond18 = $11 & $10; + if ($or$cond18) { + _TraceLog(2,10248,$vararg_buffer5); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } + $12 = HEAP32[2052>>2]|0; + $13 = ($12|0)==(0); + $textureFormat$off15 = (($textureFormat) + -17)|0; + $14 = ($textureFormat$off15>>>0)<(2); + $or$cond20 = $14 & $13; + if ($or$cond20) { + _TraceLog(2,10293,$vararg_buffer7); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } + _glGenTextures(1,($id|0)); + $15 = HEAP32[$id>>2]|0; + _glBindTexture(3553,($15|0)); + do { + switch ($textureFormat|0) { + case 1: { + _glTexImage2D(3553,0,6409,($width|0),($height|0),0,6409,5121,($data|0)); + break; + } + case 2: { + _glTexImage2D(3553,0,6410,($width|0),($height|0),0,6410,5121,($data|0)); + break; + } + case 3: { + _glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,33635,($data|0)); + break; + } + case 4: { + _glTexImage2D(3553,0,6407,($width|0),($height|0),0,6407,5121,($data|0)); + break; + } + case 5: { + _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32820,($data|0)); + break; + } + case 6: { + _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,32819,($data|0)); + break; + } + case 7: { + _glTexImage2D(3553,0,6408,($width|0),($height|0),0,6408,5121,($data|0)); + break; + } + case 8: { + $16 = HEAP32[2036>>2]|0; + $17 = ($16|0)==(0); + if (!($17)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,33776); + } + break; + } + case 9: { + $18 = HEAP32[2036>>2]|0; + $19 = ($18|0)==(0); + if (!($19)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,33777); + } + break; + } + case 10: { + $20 = HEAP32[2036>>2]|0; + $21 = ($20|0)==(0); + if (!($21)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,33778); + } + break; + } + case 11: { + $22 = HEAP32[2036>>2]|0; + $23 = ($22|0)==(0); + if (!($23)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,33779); + } + break; + } + case 12: { + $24 = HEAP32[2040>>2]|0; + $25 = ($24|0)==(0); + if (!($25)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,36196); + } + break; + } + case 13: { + $26 = HEAP32[2044>>2]|0; + $27 = ($26|0)==(0); + if (!($27)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,37492); + } + break; + } + case 14: { + $28 = HEAP32[2044>>2]|0; + $29 = ($28|0)==(0); + if (!($29)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,37496); + } + break; + } + case 15: { + $30 = HEAP32[2048>>2]|0; + $31 = ($30|0)==(0); + if (!($31)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,35840); + } + break; + } + case 16: { + $32 = HEAP32[2048>>2]|0; + $33 = ($32|0)==(0); + if (!($33)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,35842); + } + break; + } + case 17: { + $34 = HEAP32[2052>>2]|0; + $35 = ($34|0)==(0); + if (!($35)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,37808); + } + break; + } + case 18: { + $36 = HEAP32[2052>>2]|0; + $37 = ($36|0)==(0); + if (!($37)) { + _LoadCompressedTexture($data,$width,$height,$mipmapCount,37815); + } + break; + } + default: { + _TraceLog(2,10338,$vararg_buffer9); + } + } + } while(0); + $38 = HEAP32[2032>>2]|0; + $39 = ($38|0)==(0); + if ($39) { + _glTexParameteri(3553,10242,33071); + _glTexParameteri(3553,10243,33071); + } else { + _glTexParameteri(3553,10242,10497); + _glTexParameteri(3553,10243,10497); + } + _glTexParameteri(3553,10240,9728); + _glTexParameteri(3553,10241,9728); + _glBindTexture(3553,0); + $40 = HEAP32[$id>>2]|0; + $41 = ($40|0)==(0); + if ($41) { + _TraceLog(2,10909,$vararg_buffer15); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } else { + HEAP32[$vararg_buffer11>>2] = $40; + $vararg_ptr13 = ((($vararg_buffer11)) + 4|0); + HEAP32[$vararg_ptr13>>2] = $width; + $vararg_ptr14 = ((($vararg_buffer11)) + 8|0); + HEAP32[$vararg_ptr14>>2] = $height; + _TraceLog(0,10367,$vararg_buffer11); + $$0 = HEAP32[$id>>2]|0; + STACKTOP = sp;return ($$0|0); + } + return (0)|0; +} +function _rlglClose() { + var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$01 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + _UnloadDefaultShader(); + _UnloadStandardShader(); + _UnloadDefaultBuffers(); + _glDeleteTextures(1,(2056|0)); + $0 = HEAP32[2056>>2]|0; + HEAP32[$vararg_buffer>>2] = $0; + _TraceLog(0,10416,$vararg_buffer); + $1 = HEAP32[2164>>2]|0; + $2 = ($1|0)>(0); + if (!($2)) { + $10 = HEAP32[2012>>2]|0; + _free($10); + STACKTOP = sp;return; + } + $3 = HEAP32[2164>>2]|0; + $4 = ($3|0)>(0); + if ($4) { + $i$01 = 0; + while(1) { + $5 = (2168 + ($i$01<<2)|0); + $6 = HEAP32[$5>>2]|0; + _free($6); + $7 = (($i$01) + 1)|0; + $8 = HEAP32[2164>>2]|0; + $9 = ($7|0)<($8|0); + if ($9) { + $i$01 = $7; + } else { + break; + } + } + } + HEAP32[2164>>2] = 0; + $10 = HEAP32[2012>>2]|0; + _free($10); + STACKTOP = sp;return; +} +function _rlglDraw() { + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + _UpdateDefaultBuffers(); + $0 = HEAP32[2200>>2]|0; + $1 = ($0|0)!=(0); + $2 = HEAP32[2204>>2]|0; + $3 = ($2|0)!=(0); + $or$cond = $1 & $3; + if ($or$cond) { + _DrawDefaultBuffers(2); + return; + } else { + _DrawDefaultBuffers(1); + return; + } +} +function _rlglLoadMesh($mesh,$dynamic) { + $mesh = $mesh|0; + $dynamic = $dynamic|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; + var $80 = 0, $81 = 0, $9 = 0, $vaoId = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, $vboId = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $vaoId = sp + 48|0; + $vboId = sp + 20|0; + $0 = ((($mesh)) + 36|0); + $1 = ((($mesh)) + 40|0); + $2 = ((($mesh)) + 44|0); + $3 = ((($mesh)) + 48|0); + $4 = ((($mesh)) + 52|0); + $5 = ((($mesh)) + 56|0); + $6 = ((($mesh)) + 60|0); + $7 = ((($mesh)) + 64|0); + $8 = ($dynamic|0)!=(0); + $$ = $8 ? 35048 : 35044; + ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0;HEAP32[$0+16>>2]=0|0;HEAP32[$0+20>>2]=0|0;HEAP32[$0+24>>2]=0|0;HEAP32[$0+28>>2]=0|0; + HEAP32[$vaoId>>2] = 0; + ;HEAP32[$vboId>>2]=0|0;HEAP32[$vboId+4>>2]=0|0;HEAP32[$vboId+8>>2]=0|0;HEAP32[$vboId+12>>2]=0|0;HEAP32[$vboId+16>>2]=0|0;HEAP32[$vboId+20>>2]=0|0;HEAP32[$vboId+24>>2]=0|0; + $9 = HEAP32[2016>>2]|0; + $10 = ($9|0)==(0); + if (!($10)) { + $11 = HEAP32[2024>>2]|0; + FUNCTION_TABLE_vii[$11 & 63](1,$vaoId); + $12 = HEAP32[2028>>2]|0; + $13 = HEAP32[$vaoId>>2]|0; + FUNCTION_TABLE_vi[$12 & 31]($13); + } + _glGenBuffers(1,($vboId|0)); + $14 = HEAP32[$vboId>>2]|0; + _glBindBuffer(34962,($14|0)); + $15 = HEAP32[$mesh>>2]|0; + $16 = ($15*12)|0; + $17 = ((($mesh)) + 8|0); + $18 = HEAP32[$17>>2]|0; + _glBufferData(34962,($16|0),($18|0),($$|0)); + _glVertexAttribPointer(0,3,5126,0,0,(0|0)); + _glEnableVertexAttribArray(0); + $19 = ((($vboId)) + 4|0); + _glGenBuffers(1,($19|0)); + $20 = HEAP32[$19>>2]|0; + _glBindBuffer(34962,($20|0)); + $21 = HEAP32[$mesh>>2]|0; + $22 = $21 << 3; + $23 = ((($mesh)) + 12|0); + $24 = HEAP32[$23>>2]|0; + _glBufferData(34962,($22|0),($24|0),($$|0)); + _glVertexAttribPointer(1,2,5126,0,0,(0|0)); + _glEnableVertexAttribArray(1); + $25 = ((($mesh)) + 20|0); + $26 = HEAP32[$25>>2]|0; + $27 = ($26|0)==(0|0); + if ($27) { + _glVertexAttrib3f(2,1.0,1.0,1.0); + _glDisableVertexAttribArray(2); + } else { + $28 = ((($vboId)) + 8|0); + _glGenBuffers(1,($28|0)); + $29 = HEAP32[$28>>2]|0; + _glBindBuffer(34962,($29|0)); + $30 = HEAP32[$mesh>>2]|0; + $31 = ($30*12)|0; + $32 = HEAP32[$25>>2]|0; + _glBufferData(34962,($31|0),($32|0),($$|0)); + _glVertexAttribPointer(2,3,5126,0,0,(0|0)); + _glEnableVertexAttribArray(2); + } + $33 = ((($mesh)) + 28|0); + $34 = HEAP32[$33>>2]|0; + $35 = ($34|0)==(0|0); + if ($35) { + _glVertexAttrib4f(3,1.0,1.0,1.0,1.0); + _glDisableVertexAttribArray(3); + } else { + $36 = ((($vboId)) + 12|0); + _glGenBuffers(1,($36|0)); + $37 = HEAP32[$36>>2]|0; + _glBindBuffer(34962,($37|0)); + $38 = HEAP32[$mesh>>2]|0; + $39 = $38 << 2; + $40 = HEAP32[$33>>2]|0; + _glBufferData(34962,($39|0),($40|0),($$|0)); + _glVertexAttribPointer(3,4,5121,1,0,(0|0)); + _glEnableVertexAttribArray(3); + } + $41 = ((($mesh)) + 24|0); + $42 = HEAP32[$41>>2]|0; + $43 = ($42|0)==(0|0); + if ($43) { + _glVertexAttrib3f(4,0.0,0.0,0.0); + _glDisableVertexAttribArray(4); + } else { + $44 = ((($vboId)) + 16|0); + _glGenBuffers(1,($44|0)); + $45 = HEAP32[$44>>2]|0; + _glBindBuffer(34962,($45|0)); + $46 = HEAP32[$mesh>>2]|0; + $47 = ($46*12)|0; + $48 = HEAP32[$41>>2]|0; + _glBufferData(34962,($47|0),($48|0),($$|0)); + _glVertexAttribPointer(4,3,5126,0,0,(0|0)); + _glEnableVertexAttribArray(4); + } + $49 = ((($mesh)) + 16|0); + $50 = HEAP32[$49>>2]|0; + $51 = ($50|0)==(0|0); + if ($51) { + _glVertexAttrib2f(5,0.0,0.0); + _glDisableVertexAttribArray(5); + } else { + $52 = ((($vboId)) + 20|0); + _glGenBuffers(1,($52|0)); + $53 = HEAP32[$52>>2]|0; + _glBindBuffer(34962,($53|0)); + $54 = HEAP32[$mesh>>2]|0; + $55 = $54 << 3; + $56 = HEAP32[$49>>2]|0; + _glBufferData(34962,($55|0),($56|0),($$|0)); + _glVertexAttribPointer(5,2,5126,0,0,(0|0)); + _glEnableVertexAttribArray(5); + } + $57 = ((($mesh)) + 32|0); + $58 = HEAP32[$57>>2]|0; + $59 = ($58|0)==(0|0); + if (!($59)) { + $60 = ((($vboId)) + 24|0); + _glGenBuffers(1,($60|0)); + $61 = HEAP32[$60>>2]|0; + _glBindBuffer(34963,($61|0)); + $62 = ((($mesh)) + 4|0); + $63 = HEAP32[$62>>2]|0; + $64 = ($63*6)|0; + $65 = HEAP32[$57>>2]|0; + _glBufferData(34963,($64|0),($65|0),35044); + } + $66 = HEAP32[$vboId>>2]|0; + HEAP32[$1>>2] = $66; + $67 = HEAP32[$19>>2]|0; + HEAP32[$2>>2] = $67; + $68 = ((($vboId)) + 8|0); + $69 = HEAP32[$68>>2]|0; + HEAP32[$3>>2] = $69; + $70 = ((($vboId)) + 12|0); + $71 = HEAP32[$70>>2]|0; + HEAP32[$4>>2] = $71; + $72 = ((($vboId)) + 16|0); + $73 = HEAP32[$72>>2]|0; + HEAP32[$5>>2] = $73; + $74 = ((($vboId)) + 20|0); + $75 = HEAP32[$74>>2]|0; + HEAP32[$6>>2] = $75; + $76 = ((($vboId)) + 24|0); + $77 = HEAP32[$76>>2]|0; + HEAP32[$7>>2] = $77; + $78 = HEAP32[2016>>2]|0; + $79 = ($78|0)==(0); + if ($79) { + _TraceLog(0,10575,$vararg_buffer3); + STACKTOP = sp;return; + } + $80 = HEAP32[$vaoId>>2]|0; + $81 = ($80|0)==(0); + if ($81) { + _TraceLog(2,10534,$vararg_buffer1); + STACKTOP = sp;return; + } else { + HEAP32[$0>>2] = $80; + HEAP32[$vararg_buffer>>2] = $80; + _TraceLog(0,10481,$vararg_buffer); + STACKTOP = sp;return; + } +} +function _rlglDrawMesh($mesh,$material,$transform) { + $mesh = $mesh|0; + $material = $material|0; + $transform = $transform|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0; + var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0; + var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0.0, $150 = 0; + var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0.0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0; + var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0; + var $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0.0; + var $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0.0; + var $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0; + var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $eye$01 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $matModelView = 0, $matProjection = 0, $matView = 0; + var $modelview$byval_copy1 = 0, $vColorDiffuse = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 400|0; + $matMVP$byval_copy = sp + 336|0; + $modelview$byval_copy1 = sp + 272|0; + $vColorDiffuse = sp + 256|0; + $matView = sp + 192|0; + $matProjection = sp + 128|0; + $matModelView = sp + 64|0; + $matMVP = sp; + $0 = HEAP32[2200>>2]|0; + $1 = ($0|0)!=(0); + $$ = $1 ? 2 : 1; + $2 = HEAP32[$material>>2]|0; + _glUseProgram(($2|0)); + $3 = ((($material)) + 108|0); + $4 = HEAP8[$3>>0]|0; + $5 = (+($4&255)); + $6 = $5 / 255.0; + HEAPF32[$vColorDiffuse>>2] = $6; + $7 = ((($vColorDiffuse)) + 4|0); + $8 = ((($material)) + 109|0); + $9 = HEAP8[$8>>0]|0; + $10 = (+($9&255)); + $11 = $10 / 255.0; + HEAPF32[$7>>2] = $11; + $12 = ((($vColorDiffuse)) + 8|0); + $13 = ((($material)) + 110|0); + $14 = HEAP8[$13>>0]|0; + $15 = (+($14&255)); + $16 = $15 / 255.0; + HEAPF32[$12>>2] = $16; + $17 = ((($vColorDiffuse)) + 12|0); + $18 = ((($material)) + 111|0); + $19 = HEAP8[$18>>0]|0; + $20 = (+($19&255)); + $21 = $20 / 255.0; + HEAPF32[$17>>2] = $21; + $22 = ((($material)) + 32|0); + $23 = HEAP32[$22>>2]|0; + _glUniform4fv(($23|0),1,($vColorDiffuse|0)); + dest=$matView; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matProjection; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$modelview$byval_copy1; src=$transform; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matMVP$byval_copy; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($matModelView,$modelview$byval_copy1,$matMVP$byval_copy); + $24 = HEAP32[$material>>2]|0; + $25 = HEAP32[2208>>2]|0; + $26 = ($24|0)==($25|0); + if ($26) { + dest=$modelview$byval_copy1; src=$transform; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixTranspose($modelview$byval_copy1); + _MatrixInvert($modelview$byval_copy1); + $27 = HEAP32[$material>>2]|0; + $28 = (_glGetUniformLocation(($27|0),(10623|0))|0); + dest=$matMVP$byval_copy; src=$modelview$byval_copy1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $29 = (_MatrixToFloat($matMVP$byval_copy)|0); + _glUniformMatrix4fv(($28|0),1,0,($29|0)); + $30 = HEAP32[$material>>2]|0; + $31 = (_glGetUniformLocation(($30|0),(10635|0))|0); + $32 = ((($matView)) + 8|0); + $33 = +HEAPF32[$32>>2]; + $34 = ((($matView)) + 24|0); + $35 = +HEAPF32[$34>>2]; + $36 = ((($matView)) + 40|0); + $37 = +HEAPF32[$36>>2]; + _glUniform3f(($31|0),(+$33),(+$35),(+$37)); + dest=$matMVP$byval_copy; src=$material; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _SetShaderLights($matMVP$byval_copy); + $38 = HEAP32[$material>>2]|0; + $39 = (_glGetUniformLocation(($38|0),(10643|0))|0); + $40 = ((($material)) + 112|0); + $41 = HEAP8[$40>>0]|0; + $42 = (+($41&255)); + $43 = $42 / 255.0; + $44 = ((($material)) + 113|0); + $45 = HEAP8[$44>>0]|0; + $46 = (+($45&255)); + $47 = $46 / 255.0; + $48 = ((($material)) + 114|0); + $49 = HEAP8[$48>>0]|0; + $50 = (+($49&255)); + $51 = $50 / 255.0; + $52 = ((($material)) + 115|0); + $53 = HEAP8[$52>>0]|0; + $54 = (+($53&255)); + $55 = $54 / 255.0; + _glUniform4f(($39|0),(+$43),(+$47),(+$51),(+$55)); + $56 = HEAP32[$material>>2]|0; + $57 = (_glGetUniformLocation(($56|0),(10654|0))|0); + $58 = ((($material)) + 116|0); + $59 = HEAP8[$58>>0]|0; + $60 = (+($59&255)); + $61 = $60 / 255.0; + $62 = ((($material)) + 117|0); + $63 = HEAP8[$62>>0]|0; + $64 = (+($63&255)); + $65 = $64 / 255.0; + $66 = ((($material)) + 118|0); + $67 = HEAP8[$66>>0]|0; + $68 = (+($67&255)); + $69 = $68 / 255.0; + $70 = ((($material)) + 119|0); + $71 = HEAP8[$70>>0]|0; + $72 = (+($71&255)); + $73 = $72 / 255.0; + _glUniform4f(($57|0),(+$61),(+$65),(+$69),(+$73)); + $74 = HEAP32[$material>>2]|0; + $75 = (_glGetUniformLocation(($74|0),(10666|0))|0); + $76 = ((($material)) + 120|0); + $77 = +HEAPF32[$76>>2]; + _glUniform1f(($75|0),(+$77)); + } + _glActiveTexture(33984); + $78 = ((($material)) + 48|0); + $79 = HEAP32[$78>>2]|0; + _glBindTexture(3553,($79|0)); + $80 = ((($material)) + 36|0); + $81 = HEAP32[$80>>2]|0; + _glUniform1i(($81|0),0); + $82 = ((($material)) + 68|0); + $83 = HEAP32[$82>>2]|0; + $84 = ($83|0)==(0); + if (!($84)) { + $85 = ((($material)) + 40|0); + $86 = HEAP32[$85>>2]|0; + $87 = ($86|0)==(-1); + if (!($87)) { + $88 = HEAP32[$material>>2]|0; + $89 = (_glGetUniformLocation(($88|0),(10677|0))|0); + _glUniform1i(($89|0),1); + _glActiveTexture(33985); + $90 = HEAP32[$82>>2]|0; + _glBindTexture(3553,($90|0)); + $91 = HEAP32[$85>>2]|0; + _glUniform1i(($91|0),1); + } + } + $92 = ((($material)) + 88|0); + $93 = HEAP32[$92>>2]|0; + $94 = ($93|0)==(0); + if (!($94)) { + $95 = ((($material)) + 44|0); + $96 = HEAP32[$95>>2]|0; + $97 = ($96|0)==(-1); + if (!($97)) { + $98 = HEAP32[$material>>2]|0; + $99 = (_glGetUniformLocation(($98|0),(10687|0))|0); + _glUniform1i(($99|0),1); + _glActiveTexture(33986); + $100 = HEAP32[$92>>2]|0; + _glBindTexture(3553,($100|0)); + $101 = HEAP32[$95>>2]|0; + _glUniform1i(($101|0),2); + } + } + $102 = HEAP32[2016>>2]|0; + $103 = ($102|0)==(0); + if ($103) { + $107 = ((($mesh)) + 40|0); + $108 = HEAP32[$107>>2]|0; + _glBindBuffer(34962,($108|0)); + $109 = ((($material)) + 4|0); + $110 = HEAP32[$109>>2]|0; + _glVertexAttribPointer(($110|0),3,5126,0,0,(0|0)); + $111 = HEAP32[$109>>2]|0; + _glEnableVertexAttribArray(($111|0)); + $112 = ((($mesh)) + 44|0); + $113 = HEAP32[$112>>2]|0; + _glBindBuffer(34962,($113|0)); + $114 = ((($material)) + 8|0); + $115 = HEAP32[$114>>2]|0; + _glVertexAttribPointer(($115|0),2,5126,0,0,(0|0)); + $116 = HEAP32[$114>>2]|0; + _glEnableVertexAttribArray(($116|0)); + $117 = ((($material)) + 16|0); + $118 = HEAP32[$117>>2]|0; + $119 = ($118|0)==(-1); + if (!($119)) { + $120 = ((($mesh)) + 48|0); + $121 = HEAP32[$120>>2]|0; + _glBindBuffer(34962,($121|0)); + $122 = HEAP32[$117>>2]|0; + _glVertexAttribPointer(($122|0),3,5126,0,0,(0|0)); + $123 = HEAP32[$117>>2]|0; + _glEnableVertexAttribArray(($123|0)); + } + $124 = ((($material)) + 24|0); + $125 = HEAP32[$124>>2]|0; + $126 = ($125|0)==(-1); + do { + if (!($126)) { + $127 = ((($mesh)) + 52|0); + $128 = HEAP32[$127>>2]|0; + $129 = ($128|0)==(0); + if ($129) { + _glVertexAttrib4f(($125|0),1.0,1.0,1.0,1.0); + $132 = HEAP32[$124>>2]|0; + _glDisableVertexAttribArray(($132|0)); + break; + } else { + _glBindBuffer(34962,($128|0)); + $130 = HEAP32[$124>>2]|0; + _glVertexAttribPointer(($130|0),4,5121,1,0,(0|0)); + $131 = HEAP32[$124>>2]|0; + _glEnableVertexAttribArray(($131|0)); + break; + } + } + } while(0); + $133 = ((($material)) + 20|0); + $134 = HEAP32[$133>>2]|0; + $135 = ($134|0)==(-1); + if (!($135)) { + $136 = ((($mesh)) + 56|0); + $137 = HEAP32[$136>>2]|0; + _glBindBuffer(34962,($137|0)); + $138 = HEAP32[$133>>2]|0; + _glVertexAttribPointer(($138|0),3,5126,0,0,(0|0)); + $139 = HEAP32[$133>>2]|0; + _glEnableVertexAttribArray(($139|0)); + } + $140 = ((($material)) + 12|0); + $141 = HEAP32[$140>>2]|0; + $142 = ($141|0)==(-1); + if (!($142)) { + $143 = ((($mesh)) + 60|0); + $144 = HEAP32[$143>>2]|0; + _glBindBuffer(34962,($144|0)); + $145 = HEAP32[$140>>2]|0; + _glVertexAttribPointer(($145|0),2,5126,0,0,(0|0)); + $146 = HEAP32[$140>>2]|0; + _glEnableVertexAttribArray(($146|0)); + } + $147 = ((($mesh)) + 32|0); + $148 = HEAP32[$147>>2]|0; + $149 = ($148|0)==(0|0); + if (!($149)) { + $150 = HEAP32[(2000)>>2]|0; + _glBindBuffer(34963,($150|0)); + } + } else { + $104 = HEAP32[2028>>2]|0; + $105 = ((($mesh)) + 36|0); + $106 = HEAP32[$105>>2]|0; + FUNCTION_TABLE_vi[$104 & 31]($106); + } + $151 = ((($material)) + 28|0); + $152 = ((($mesh)) + 32|0); + $153 = HEAP32[$152>>2]|0; + $154 = ($153|0)==(0|0); + $155 = HEAP32[$mesh>>2]|0; + $156 = ((($mesh)) + 4|0); + $157 = HEAP32[$156>>2]|0; + $158 = ($157*3)|0; + $eye$01 = 0; + while(1) { + if ($1) { + dest=$modelview$byval_copy1; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matMVP$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _SetStereoView($eye$01,$modelview$byval_copy1,$matMVP$byval_copy); + } else { + dest=748; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + } + dest=$modelview$byval_copy1; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matMVP$byval_copy; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($matMVP,$modelview$byval_copy1,$matMVP$byval_copy); + $159 = HEAP32[$151>>2]|0; + dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $160 = (_MatrixToFloat($matMVP$byval_copy)|0); + _glUniformMatrix4fv(($159|0),1,0,($160|0)); + if ($154) { + _glDrawArrays(4,0,($155|0)); + } else { + _glDrawElements(4,($158|0),5123,(0|0)); + } + $161 = (($eye$01) + 1)|0; + $162 = ($161|0)<($$|0); + if ($162) { + $eye$01 = $161; + } else { + break; + } + } + $163 = HEAP32[$82>>2]|0; + $164 = ($163|0)==(0); + if (!($164)) { + _glActiveTexture(33985); + _glBindTexture(3553,0); + } + $165 = HEAP32[$92>>2]|0; + $166 = ($165|0)==(0); + if (!($166)) { + _glActiveTexture(33986); + _glBindTexture(3553,0); + } + _glActiveTexture(33984); + _glBindTexture(3553,0); + $167 = HEAP32[2016>>2]|0; + $168 = ($167|0)==(0); + if (!($168)) { + $169 = HEAP32[2028>>2]|0; + FUNCTION_TABLE_vi[$169 & 31](0); + _glUseProgram(0); + dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=748; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; + } + _glBindBuffer(34962,0); + $170 = ((($mesh)) + 32|0); + $171 = HEAP32[$170>>2]|0; + $172 = ($171|0)==(0|0); + if ($172) { + _glUseProgram(0); + dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=748; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; + } + _glBindBuffer(34963,0); + _glUseProgram(0); + dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=748; src=$matView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _rlglUnloadMesh($mesh) { + $mesh = $mesh|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($mesh)) + 8|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0|0); + if (!($2)) { + _free($1); + } + $3 = ((($mesh)) + 12|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)==(0|0); + if (!($5)) { + _free($4); + } + $6 = ((($mesh)) + 20|0); + $7 = HEAP32[$6>>2]|0; + $8 = ($7|0)==(0|0); + if (!($8)) { + _free($7); + } + $9 = ((($mesh)) + 28|0); + $10 = HEAP32[$9>>2]|0; + $11 = ($10|0)==(0|0); + if (!($11)) { + _free($10); + } + $12 = ((($mesh)) + 24|0); + $13 = HEAP32[$12>>2]|0; + $14 = ($13|0)==(0|0); + if (!($14)) { + _free($13); + } + $15 = ((($mesh)) + 16|0); + $16 = HEAP32[$15>>2]|0; + $17 = ($16|0)==(0|0); + if (!($17)) { + _free($16); + } + $18 = ((($mesh)) + 32|0); + $19 = HEAP32[$18>>2]|0; + $20 = ($19|0)==(0|0); + if (!($20)) { + _free($19); + } + $21 = ((($mesh)) + 40|0); + $22 = HEAP32[$21>>2]|0; + _rlDeleteBuffers($22); + $23 = ((($mesh)) + 44|0); + $24 = HEAP32[$23>>2]|0; + _rlDeleteBuffers($24); + $25 = ((($mesh)) + 48|0); + $26 = HEAP32[$25>>2]|0; + _rlDeleteBuffers($26); + $27 = ((($mesh)) + 52|0); + $28 = HEAP32[$27>>2]|0; + _rlDeleteBuffers($28); + $29 = ((($mesh)) + 56|0); + $30 = HEAP32[$29>>2]|0; + _rlDeleteBuffers($30); + $31 = ((($mesh)) + 60|0); + $32 = HEAP32[$31>>2]|0; + _rlDeleteBuffers($32); + $33 = ((($mesh)) + 64|0); + $34 = HEAP32[$33>>2]|0; + _rlDeleteBuffers($34); + $35 = ((($mesh)) + 36|0); + $36 = HEAP32[$35>>2]|0; + _rlDeleteVertexArrays($36); + return; +} +function _GetDefaultTexture($agg$result) { + $agg$result = $agg$result|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[2056>>2]|0; + HEAP32[$agg$result>>2] = $0; + $1 = ((($agg$result)) + 4|0); + HEAP32[$1>>2] = 1; + $2 = ((($agg$result)) + 8|0); + HEAP32[$2>>2] = 1; + $3 = ((($agg$result)) + 12|0); + HEAP32[$3>>2] = 1; + $4 = ((($agg$result)) + 16|0); + HEAP32[$4>>2] = 7; + return; +} +function _GetDefaultShader($agg$result) { + $agg$result = $agg$result|0; + var dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + dest=$agg$result; src=2060; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + return; +} +function _GetShaderLocation($shader,$uniformName) { + $shader = $shader|0; + $uniformName = $uniformName|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = HEAP32[$shader>>2]|0; + $1 = (_glGetUniformLocation(($0|0),($uniformName|0))|0); + $2 = ($1|0)==(-1); + if (!($2)) { + STACKTOP = sp;return ($1|0); + } + $3 = HEAP32[$shader>>2]|0; + HEAP32[$vararg_buffer>>2] = $3; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $uniformName; + _TraceLog(3,10699,$vararg_buffer); + STACKTOP = sp;return ($1|0); +} +function _SetMatrixProjection($proj) { + $proj = $proj|0; + var dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + dest=680; src=$proj; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + return; +} +function _SetMatrixModelview($view) { + $view = $view|0; + var dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + dest=748; src=$view; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + return; +} +function _IsVrDeviceReady() { + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[2604>>2]|0; + $1 = HEAP32[2200>>2]|0; + $2 = ($1|0)!=(0); + $not$ = ($0|0)!=(0); + $3 = $not$ & $2; + $4 = $3&1; + return ($4|0); +} +function _BeginVrDrawing() { + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[2256>>2]|0; + _rlEnableRenderTexture($0); + _rlClearScreenBuffers(); + HEAP32[2204>>2] = 1; + return; +} +function _EndVrDrawing() { + var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + _rlDisableRenderTexture(); + _rlClearScreenBuffers(); + $0 = HEAP32[2156>>2]|0; + $1 = HEAP32[2160>>2]|0; + _rlViewport(0,0,$0,$1); + _rlMatrixMode(0); + _rlLoadIdentity(); + $2 = HEAP32[2156>>2]|0; + $3 = (+($2|0)); + $4 = HEAP32[2160>>2]|0; + $5 = (+($4|0)); + _rlOrtho(0.0,$3,$5,0.0,0.0,1.0); + _rlMatrixMode(1); + _rlLoadIdentity(); + dest=2108; src=(2300); stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $6 = HEAP32[(2260)>>2]|0; + _rlEnableTexture($6); + _rlPushMatrix(); + _rlBegin(2); + _rlColor4ub(-1,-1,-1,-1); + _rlTexCoord2f(0.0,1.0); + _rlVertex2f(0.0,0.0); + _rlTexCoord2f(0.0,0.0); + $7 = HEAP32[(2268)>>2]|0; + $8 = (+($7|0)); + _rlVertex2f(0.0,$8); + _rlTexCoord2f(1.0,0.0); + $9 = HEAP32[(2264)>>2]|0; + $10 = (+($9|0)); + $11 = HEAP32[(2268)>>2]|0; + $12 = (+($11|0)); + _rlVertex2f($10,$12); + _rlTexCoord2f(1.0,1.0); + $13 = HEAP32[(2264)>>2]|0; + $14 = (+($13|0)); + _rlVertex2f($14,0.0); + _rlEnd(); + _rlPopMatrix(); + _UpdateDefaultBuffers(); + _DrawDefaultBuffers(1); + dest=2108; src=2060; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _rlDisableDepthTest(); + HEAP32[2204>>2] = 0; + return; +} +function _stbi_load($filename,$x,$y,$comp,$req_comp) { + $filename = $filename|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__fopen($filename)|0); + $1 = ($0|0)==(0|0); + if ($1) { + _stbi__err(10754); + $$0 = 0; + return ($$0|0); + } else { + $2 = (_stbi_load_from_file($0,$x,$y,$comp,$req_comp)|0); + (_fclose($0)|0); + $$0 = $2; + return ($$0|0); + } + return (0)|0; +} +function _stbi_load_from_file($f,$x,$y,$comp,$req_comp) { + $f = $f|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $s = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 192|0; + $s = sp; + _stbi__start_file($s,$f); + $0 = (_stbi__load_flip($s,$x,$y,$comp,$req_comp)|0); + $1 = ($0|0)==(0|0); + if ($1) { + STACKTOP = sp;return ($0|0); + } + $2 = ((($s)) + 172|0); + $3 = HEAP32[$2>>2]|0; + $4 = ((($s)) + 168|0); + $5 = HEAP32[$4>>2]|0; + $6 = $3; + $7 = $5; + $8 = (($7) - ($6))|0; + (_fseek($f,$8,1)|0); + STACKTOP = sp;return ($0|0); +} +function _stbi_zlib_decode_malloc_guesssize_headerflag($buffer,$len,$initial_size,$outlen,$parse_header) { + $buffer = $buffer|0; + $len = $len|0; + $initial_size = $initial_size|0; + $outlen = $outlen|0; + $parse_header = $parse_header|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $a = 0; + var label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 4080|0; + $a = sp; + $0 = (_stbi__malloc($initial_size)|0); + $1 = ($0|0)==(0|0); + if ($1) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + HEAP32[$a>>2] = $buffer; + $2 = (($buffer) + ($len)|0); + $3 = ((($a)) + 4|0); + HEAP32[$3>>2] = $2; + $4 = (_stbi__do_zlib($a,$0,$initial_size,1,$parse_header)|0); + $5 = ($4|0)==(0); + if ($5) { + $16 = ((($a)) + 20|0); + $17 = HEAP32[$16>>2]|0; + _free($17); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $6 = ($outlen|0)==(0|0); + if (!($6)) { + $7 = ((($a)) + 16|0); + $8 = HEAP32[$7>>2]|0; + $9 = ((($a)) + 20|0); + $10 = HEAP32[$9>>2]|0; + $11 = $8; + $12 = $10; + $13 = (($11) - ($12))|0; + HEAP32[$outlen>>2] = $13; + } + $14 = ((($a)) + 20|0); + $15 = HEAP32[$14>>2]|0; + $$0 = $15; + STACKTOP = sp;return ($$0|0); +} +function _stbi__tga_read_rgb16($s,$out) { + $s = $s|0; + $out = $out|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get16le($s)|0); + $1 = $0 >>> 10; + $2 = $1 & 31; + $3 = $0 >>> 5; + $4 = $3 & 31; + $5 = $0 & 31; + $6 = ($2*255)|0; + $7 = (($6>>>0) / 31)&-1; + $8 = $7&255; + HEAP8[$out>>0] = $8; + $9 = ($4*255)|0; + $10 = (($9>>>0) / 31)&-1; + $11 = $10&255; + $12 = ((($out)) + 1|0); + HEAP8[$12>>0] = $11; + $13 = ($5*255)|0; + $14 = (($13>>>0) / 31)&-1; + $15 = $14&255; + $16 = ((($out)) + 2|0); + HEAP8[$16>>0] = $15; + return; +} +function _LoadImage($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; + var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $image$sroa$0$0 = 0, $image$sroa$0$09 = 0, $image$sroa$12$0 = 0; + var $image$sroa$12$05 = 0, $image$sroa$12$06 = 0, $image$sroa$15$0 = 0, $image$sroa$15$03 = 0, $image$sroa$15$04 = 0, $image$sroa$17$0 = 0, $image$sroa$17$01 = 0, $image$sroa$17$02 = 0, $image$sroa$9$0 = 0, $image$sroa$9$07 = 0, $image$sroa$9$08 = 0, $imgBpp = 0, $imgHeight = 0, $imgWidth = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 144|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer = sp; + $imgWidth = sp + 128|0; + $imgHeight = sp + 124|0; + $imgBpp = sp + 120|0; + $0 = sp + 100|0; + $1 = sp + 80|0; + $2 = sp + 60|0; + $3 = sp + 40|0; + $4 = sp + 20|0; + $5 = (_GetExtension($fileName)|0); + $6 = (_strcmp($5,10766)|0); + $7 = ($6|0)==(0); + do { + if ($7) { + label = 8; + } else { + $8 = (_GetExtension($fileName)|0); + $9 = (_strcmp($8,10770)|0); + $10 = ($9|0)==(0); + if ($10) { + label = 8; + } else { + $11 = (_GetExtension($fileName)|0); + $12 = (_strcmp($11,10774)|0); + $13 = ($12|0)==(0); + if ($13) { + label = 8; + } else { + $14 = (_GetExtension($fileName)|0); + $15 = (_strcmp($14,10778)|0); + $16 = ($15|0)==(0); + if ($16) { + label = 8; + } else { + $17 = (_GetExtension($fileName)|0); + $18 = (_strcmp($17,10782)|0); + $19 = ($18|0)==(0); + if ($19) { + label = 8; + } else { + $20 = (_GetExtension($fileName)|0); + $21 = (_strcmp($20,10786)|0); + $22 = ($21|0)==(0); + if ($22) { + label = 8; + } else { + $23 = (_GetExtension($fileName)|0); + $24 = (_strcmp($23,10790)|0); + $25 = ($24|0)==(0); + if ($25) { + label = 8; + } else { + $31 = (_GetExtension($fileName)|0); + $32 = (_strcmp($31,10794)|0); + $33 = ($32|0)==(0); + if ($33) { + _LoadDDS($0,$fileName); + $34 = HEAP32[$0>>2]|0; + $35 = ((($0)) + 4|0); + $36 = HEAP32[$35>>2]|0; + $37 = ((($0)) + 8|0); + $38 = HEAP32[$37>>2]|0; + $39 = ((($0)) + 12|0); + $40 = HEAP32[$39>>2]|0; + $41 = ((($0)) + 16|0); + $42 = HEAP32[$41>>2]|0; + $image$sroa$0$0 = $34;$image$sroa$12$0 = $38;$image$sroa$15$0 = $40;$image$sroa$17$0 = $42;$image$sroa$9$0 = $36; + label = 22; + break; + } + $43 = (_GetExtension($fileName)|0); + $44 = (_strcmp($43,10798)|0); + $45 = ($44|0)==(0); + if ($45) { + _LoadPKM($1,$fileName); + $46 = HEAP32[$1>>2]|0; + $47 = ((($1)) + 4|0); + $48 = HEAP32[$47>>2]|0; + $49 = ((($1)) + 8|0); + $50 = HEAP32[$49>>2]|0; + $51 = ((($1)) + 12|0); + $52 = HEAP32[$51>>2]|0; + $53 = ((($1)) + 16|0); + $54 = HEAP32[$53>>2]|0; + $image$sroa$0$0 = $46;$image$sroa$12$0 = $50;$image$sroa$15$0 = $52;$image$sroa$17$0 = $54;$image$sroa$9$0 = $48; + label = 22; + break; + } + $55 = (_GetExtension($fileName)|0); + $56 = (_strcmp($55,10802)|0); + $57 = ($56|0)==(0); + if ($57) { + _LoadKTX($2,$fileName); + $58 = HEAP32[$2>>2]|0; + $59 = ((($2)) + 4|0); + $60 = HEAP32[$59>>2]|0; + $61 = ((($2)) + 8|0); + $62 = HEAP32[$61>>2]|0; + $63 = ((($2)) + 12|0); + $64 = HEAP32[$63>>2]|0; + $65 = ((($2)) + 16|0); + $66 = HEAP32[$65>>2]|0; + $image$sroa$0$0 = $58;$image$sroa$12$0 = $62;$image$sroa$15$0 = $64;$image$sroa$17$0 = $66;$image$sroa$9$0 = $60; + label = 22; + break; + } + $67 = (_GetExtension($fileName)|0); + $68 = (_strcmp($67,10806)|0); + $69 = ($68|0)==(0); + if ($69) { + _LoadPVR($3,$fileName); + $70 = HEAP32[$3>>2]|0; + $71 = ((($3)) + 4|0); + $72 = HEAP32[$71>>2]|0; + $73 = ((($3)) + 8|0); + $74 = HEAP32[$73>>2]|0; + $75 = ((($3)) + 12|0); + $76 = HEAP32[$75>>2]|0; + $77 = ((($3)) + 16|0); + $78 = HEAP32[$77>>2]|0; + $image$sroa$0$0 = $70;$image$sroa$12$0 = $74;$image$sroa$15$0 = $76;$image$sroa$17$0 = $78;$image$sroa$9$0 = $72; + label = 22; + break; + } + $79 = (_GetExtension($fileName)|0); + $80 = (_strcmp($79,10810)|0); + $81 = ($80|0)==(0); + if ($81) { + _LoadASTC($4,$fileName); + $82 = HEAP32[$4>>2]|0; + $83 = ((($4)) + 4|0); + $84 = HEAP32[$83>>2]|0; + $85 = ((($4)) + 8|0); + $86 = HEAP32[$85>>2]|0; + $87 = ((($4)) + 12|0); + $88 = HEAP32[$87>>2]|0; + $89 = ((($4)) + 16|0); + $90 = HEAP32[$89>>2]|0; + $image$sroa$0$0 = $82;$image$sroa$12$0 = $86;$image$sroa$15$0 = $88;$image$sroa$17$0 = $90;$image$sroa$9$0 = $84; + label = 22; + } else { + $image$sroa$12$06 = 0;$image$sroa$15$04 = 0;$image$sroa$17$02 = 0;$image$sroa$9$08 = 0; + } + } + } + } + } + } + } + } + } while(0); + L22: do { + if ((label|0) == 8) { + HEAP32[$imgWidth>>2] = 0; + HEAP32[$imgHeight>>2] = 0; + HEAP32[$imgBpp>>2] = 0; + $26 = (_stbi_load($fileName,$imgWidth,$imgHeight,$imgBpp,0)|0); + $27 = HEAP32[$imgWidth>>2]|0; + $28 = HEAP32[$imgHeight>>2]|0; + $29 = HEAP32[$imgBpp>>2]|0; + switch ($29|0) { + case 1: { + $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 1;$image$sroa$9$0 = $27; + label = 22; + break L22; + break; + } + case 2: { + $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 2;$image$sroa$9$0 = $27; + label = 22; + break L22; + break; + } + case 3: { + $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = 4;$image$sroa$9$0 = $27; + label = 22; + break L22; + break; + } + default: { + $30 = ($29|0)==(4); + $$ = $30 ? 7 : 0; + $image$sroa$0$0 = $26;$image$sroa$12$0 = $28;$image$sroa$15$0 = 1;$image$sroa$17$0 = $$;$image$sroa$9$0 = $27; + label = 22; + break L22; + } + } + } + } while(0); + if ((label|0) == 22) { + $91 = ($image$sroa$0$0|0)==(0|0); + if ($91) { + $image$sroa$12$06 = $image$sroa$12$0;$image$sroa$15$04 = $image$sroa$15$0;$image$sroa$17$02 = $image$sroa$17$0;$image$sroa$9$08 = $image$sroa$9$0; + } else { + HEAP32[$vararg_buffer>>2] = $fileName; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $image$sroa$9$0; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = $image$sroa$12$0; + _TraceLog(0,10815,$vararg_buffer); + $image$sroa$0$09 = $image$sroa$0$0;$image$sroa$12$05 = $image$sroa$12$0;$image$sroa$15$03 = $image$sroa$15$0;$image$sroa$17$01 = $image$sroa$17$0;$image$sroa$9$07 = $image$sroa$9$0; + HEAP32[$agg$result>>2] = $image$sroa$0$09; + $92 = ((($agg$result)) + 4|0); + HEAP32[$92>>2] = $image$sroa$9$07; + $93 = ((($agg$result)) + 8|0); + HEAP32[$93>>2] = $image$sroa$12$05; + $94 = ((($agg$result)) + 12|0); + HEAP32[$94>>2] = $image$sroa$15$03; + $95 = ((($agg$result)) + 16|0); + HEAP32[$95>>2] = $image$sroa$17$01; + STACKTOP = sp;return; + } + } + HEAP32[$vararg_buffer3>>2] = $fileName; + _TraceLog(2,10854,$vararg_buffer3); + $image$sroa$0$09 = 0;$image$sroa$12$05 = $image$sroa$12$06;$image$sroa$15$03 = $image$sroa$15$04;$image$sroa$17$01 = $image$sroa$17$02;$image$sroa$9$07 = $image$sroa$9$08; + HEAP32[$agg$result>>2] = $image$sroa$0$09; + $92 = ((($agg$result)) + 4|0); + HEAP32[$92>>2] = $image$sroa$9$07; + $93 = ((($agg$result)) + 8|0); + HEAP32[$93>>2] = $image$sroa$12$05; + $94 = ((($agg$result)) + 12|0); + HEAP32[$94>>2] = $image$sroa$15$03; + $95 = ((($agg$result)) + 16|0); + HEAP32[$95>>2] = $image$sroa$17$01; + STACKTOP = sp;return; +} +function _LoadImageEx($agg$result,$pixels,$width,$height) { + $agg$result = $agg$result|0; + $pixels = $pixels|0; + $width = $width|0; + $height = $height|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $width << 2; + $1 = Math_imul($0, $height)|0; + $2 = (_malloc($1)|0); + $3 = ($1|0)>(0); + if ($3) { + $4 = Math_imul($height, $width)|0; + $5 = $4 << 2; + $6 = (($5) + -1)|0; + $7 = $6 >>> 2; + $i$02 = 0;$k$01 = 0; + while(1) { + $8 = (($pixels) + ($k$01<<2)|0); + $9 = HEAP8[$8>>0]|0; + $10 = (($2) + ($i$02)|0); + HEAP8[$10>>0] = $9; + $11 = (((($pixels) + ($k$01<<2)|0)) + 1|0); + $12 = HEAP8[$11>>0]|0; + $13 = $i$02 | 1; + $14 = (($2) + ($13)|0); + HEAP8[$14>>0] = $12; + $15 = (((($pixels) + ($k$01<<2)|0)) + 2|0); + $16 = HEAP8[$15>>0]|0; + $17 = $i$02 | 2; + $18 = (($2) + ($17)|0); + HEAP8[$18>>0] = $16; + $19 = (((($pixels) + ($k$01<<2)|0)) + 3|0); + $20 = HEAP8[$19>>0]|0; + $21 = $i$02 | 3; + $22 = (($2) + ($21)|0); + HEAP8[$22>>0] = $20; + $23 = (($k$01) + 1)|0; + $24 = (($i$02) + 4)|0; + $exitcond = ($k$01|0)==($7|0); + if ($exitcond) { + break; + } else { + $i$02 = $24;$k$01 = $23; + } + } + } + HEAP32[$agg$result>>2] = $2; + $25 = ((($agg$result)) + 4|0); + HEAP32[$25>>2] = $width; + $26 = ((($agg$result)) + 8|0); + HEAP32[$26>>2] = $height; + $27 = ((($agg$result)) + 12|0); + HEAP32[$27>>2] = 1; + $28 = ((($agg$result)) + 16|0); + HEAP32[$28>>2] = 7; + return; +} +function _LoadTexture($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $image = 0, $image$byval_copy1 = 0, $texture$sroa$0$0 = 0, $texture$sroa$3 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 96|0; + $image$byval_copy1 = sp + 64|0; + $vararg_buffer = sp; + $texture$sroa$3 = sp + 8|0; + $image = sp + 44|0; + $0 = sp + 24|0; + _LoadImage($image,$fileName); + $1 = HEAP32[$image>>2]|0; + $2 = ($1|0)==(0|0); + if ($2) { + _TraceLog(2,10909,$vararg_buffer); + $texture$sroa$0$0 = 0; + } else { + ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; + _LoadTextureFromImage($0,$image$byval_copy1); + $3 = HEAP32[$0>>2]|0; + $4 = ((($0)) + 4|0); + ;HEAP32[$texture$sroa$3>>2]=HEAP32[$4>>2]|0;HEAP32[$texture$sroa$3+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$texture$sroa$3+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$texture$sroa$3+12>>2]=HEAP32[$4+12>>2]|0; + ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; + _UnloadImage($image$byval_copy1); + $texture$sroa$0$0 = $3; + } + HEAP32[$agg$result>>2] = $texture$sroa$0$0; + $5 = ((($agg$result)) + 4|0); + ;HEAP32[$5>>2]=HEAP32[$texture$sroa$3>>2]|0;HEAP32[$5+4>>2]=HEAP32[$texture$sroa$3+4>>2]|0;HEAP32[$5+8>>2]=HEAP32[$texture$sroa$3+8>>2]|0;HEAP32[$5+12>>2]=HEAP32[$texture$sroa$3+12>>2]|0; + STACKTOP = sp;return; +} +function _LoadTextureFromImage($agg$result,$image) { + $agg$result = $agg$result|0; + $image = $image|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$image>>2]|0; + $1 = ((($image)) + 4|0); + $2 = HEAP32[$1>>2]|0; + $3 = ((($image)) + 8|0); + $4 = HEAP32[$3>>2]|0; + $5 = ((($image)) + 16|0); + $6 = HEAP32[$5>>2]|0; + $7 = ((($image)) + 12|0); + $8 = HEAP32[$7>>2]|0; + $9 = (_rlglLoadTexture($0,$2,$4,$6,$8)|0); + $10 = HEAP32[$1>>2]|0; + $11 = HEAP32[$3>>2]|0; + $12 = HEAP32[$7>>2]|0; + $13 = HEAP32[$5>>2]|0; + HEAP32[$agg$result>>2] = $9; + $14 = ((($agg$result)) + 4|0); + HEAP32[$14>>2] = $10; + $15 = ((($agg$result)) + 8|0); + HEAP32[$15>>2] = $11; + $16 = ((($agg$result)) + 12|0); + HEAP32[$16>>2] = $12; + $17 = ((($agg$result)) + 16|0); + HEAP32[$17>>2] = $13; + return; +} +function _UnloadImage($image) { + $image = $image|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$image>>2]|0; + _free($0); + return; +} +function _UnloadTexture($texture) { + $texture = $texture|0; + var $0 = 0, $1 = 0, $2 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = HEAP32[$texture>>2]|0; + $1 = ($0|0)==(0); + if ($1) { + STACKTOP = sp;return; + } + _rlDeleteTextures($0); + $2 = HEAP32[$texture>>2]|0; + HEAP32[$vararg_buffer>>2] = $2; + _TraceLog(0,10938,$vararg_buffer); + STACKTOP = sp;return; +} +function _GetImageData($image) { + $image = $image|0; + var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; + var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; + var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; + var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; + var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0; + var $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0; + var $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0; + var $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$01 = 0, $k$02 = 0, $k$1 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = ((($image)) + 4|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($image)) + 8|0); + $3 = HEAP32[$2>>2]|0; + $4 = $1 << 2; + $5 = Math_imul($4, $3)|0; + $6 = (_malloc($5)|0); + $7 = HEAP32[$0>>2]|0; + $8 = HEAP32[$2>>2]|0; + $9 = Math_imul($8, $7)|0; + $10 = ($9|0)>(0); + if (!($10)) { + STACKTOP = sp;return ($6|0); + } + $11 = ((($image)) + 16|0); + $12 = HEAP32[$11>>2]|0; + $13 = HEAP32[$0>>2]|0; + $14 = HEAP32[$2>>2]|0; + $15 = Math_imul($14, $13)|0; + $16 = HEAP32[$image>>2]|0; + $i$01 = 0;$k$02 = 0; + while(1) { + switch ($12|0) { + case 1: { + $17 = (($16) + ($k$02)|0); + $18 = HEAP8[$17>>0]|0; + $19 = (($6) + ($i$01<<2)|0); + HEAP8[$19>>0] = $18; + $20 = (($16) + ($k$02)|0); + $21 = HEAP8[$20>>0]|0; + $22 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$22>>0] = $21; + $23 = (($16) + ($k$02)|0); + $24 = HEAP8[$23>>0]|0; + $25 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$25>>0] = $24; + $26 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$26>>0] = -1; + $27 = (($k$02) + 1)|0; + $k$1 = $27; + break; + } + case 2: { + $28 = (($16) + ($k$02)|0); + $29 = HEAP8[$28>>0]|0; + $30 = (($6) + ($i$01<<2)|0); + HEAP8[$30>>0] = $29; + $31 = (($16) + ($k$02)|0); + $32 = HEAP8[$31>>0]|0; + $33 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$33>>0] = $32; + $34 = (($16) + ($k$02)|0); + $35 = HEAP8[$34>>0]|0; + $36 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$36>>0] = $35; + $37 = (($k$02) + 1)|0; + $38 = (($16) + ($37)|0); + $39 = HEAP8[$38>>0]|0; + $40 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$40>>0] = $39; + $41 = (($k$02) + 2)|0; + $k$1 = $41; + break; + } + case 5: { + $42 = (($16) + ($k$02<<1)|0); + $43 = HEAP16[$42>>1]|0; + $44 = $43&65535; + $45 = $44 >>> 11; + $46 = (+($45|0)); + $47 = $46 * 8.0; + $48 = (~~(($47))&255); + $49 = (($6) + ($i$01<<2)|0); + HEAP8[$49>>0] = $48; + $50 = $44 >>> 6; + $51 = $50 & 31; + $52 = (+($51|0)); + $53 = $52 * 8.0; + $54 = (~~(($53))&255); + $55 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$55>>0] = $54; + $56 = $44 >>> 1; + $57 = $56 & 31; + $58 = (+($57|0)); + $59 = $58 * 8.0; + $60 = (~~(($59))&255); + $61 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$61>>0] = $60; + $62 = $44 & 1; + $63 = (0 - ($62))|0; + $64 = $63&255; + $65 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$65>>0] = $64; + $66 = (($k$02) + 1)|0; + $k$1 = $66; + break; + } + case 3: { + $67 = (($16) + ($k$02<<1)|0); + $68 = HEAP16[$67>>1]|0; + $69 = $68&65535; + $70 = $69 >>> 11; + $71 = (+($70|0)); + $72 = $71 * 8.0; + $73 = (~~(($72))&255); + $74 = (($6) + ($i$01<<2)|0); + HEAP8[$74>>0] = $73; + $75 = $69 >>> 5; + $76 = $75 & 63; + $77 = (+($76|0)); + $78 = $77 * 4.0; + $79 = (~~(($78))&255); + $80 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$80>>0] = $79; + $81 = $69 & 31; + $82 = (+($81|0)); + $83 = $82 * 8.0; + $84 = (~~(($83))&255); + $85 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$85>>0] = $84; + $86 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$86>>0] = -1; + $87 = (($k$02) + 1)|0; + $k$1 = $87; + break; + } + case 6: { + $88 = (($16) + ($k$02<<1)|0); + $89 = HEAP16[$88>>1]|0; + $90 = $89&65535; + $91 = $90 >>> 12; + $92 = (+($91|0)); + $93 = $92 * 17.0; + $94 = (~~(($93))&255); + $95 = (($6) + ($i$01<<2)|0); + HEAP8[$95>>0] = $94; + $96 = $90 >>> 8; + $97 = $96 & 15; + $98 = (+($97|0)); + $99 = $98 * 17.0; + $100 = (~~(($99))&255); + $101 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$101>>0] = $100; + $102 = $90 >>> 4; + $103 = $102 & 15; + $104 = (+($103|0)); + $105 = $104 * 17.0; + $106 = (~~(($105))&255); + $107 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$107>>0] = $106; + $108 = $90 & 15; + $109 = (+($108|0)); + $110 = $109 * 17.0; + $111 = (~~(($110))&255); + $112 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$112>>0] = $111; + $113 = (($k$02) + 1)|0; + $k$1 = $113; + break; + } + case 7: { + $114 = (($16) + ($k$02)|0); + $115 = HEAP8[$114>>0]|0; + $116 = (($6) + ($i$01<<2)|0); + HEAP8[$116>>0] = $115; + $117 = (($k$02) + 1)|0; + $118 = (($16) + ($117)|0); + $119 = HEAP8[$118>>0]|0; + $120 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$120>>0] = $119; + $121 = (($k$02) + 2)|0; + $122 = (($16) + ($121)|0); + $123 = HEAP8[$122>>0]|0; + $124 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$124>>0] = $123; + $125 = (($k$02) + 3)|0; + $126 = (($16) + ($125)|0); + $127 = HEAP8[$126>>0]|0; + $128 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$128>>0] = $127; + $129 = (($k$02) + 4)|0; + $k$1 = $129; + break; + } + case 4: { + $130 = (($16) + ($k$02)|0); + $131 = HEAP8[$130>>0]|0; + $132 = (($6) + ($i$01<<2)|0); + HEAP8[$132>>0] = $131; + $133 = (($k$02) + 1)|0; + $134 = (($16) + ($133)|0); + $135 = HEAP8[$134>>0]|0; + $136 = (((($6) + ($i$01<<2)|0)) + 1|0); + HEAP8[$136>>0] = $135; + $137 = (($k$02) + 2)|0; + $138 = (($16) + ($137)|0); + $139 = HEAP8[$138>>0]|0; + $140 = (((($6) + ($i$01<<2)|0)) + 2|0); + HEAP8[$140>>0] = $139; + $141 = (((($6) + ($i$01<<2)|0)) + 3|0); + HEAP8[$141>>0] = -1; + $142 = (($k$02) + 3)|0; + $k$1 = $142; + break; + } + default: { + _TraceLog(2,10988,$vararg_buffer); + $k$1 = $k$02; + } + } + $143 = (($i$01) + 1)|0; + $144 = ($143|0)<($15|0); + if ($144) { + $i$01 = $143;$k$02 = $k$1; + } else { + break; + } + } + STACKTOP = sp;return ($6|0); +} +function _ImageFormat($image,$newFormat) { + $image = $image|0; + $newFormat = $newFormat|0; + var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; + var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; + var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; + var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; + var $170 = 0, $171 = 0, $172 = 0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0, $177 = 0, $178 = 0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0; + var $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; + var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0.0; + var $224 = 0.0, $225 = 0.0, $226 = 0, $227 = 0, $228 = 0, $229 = 0.0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0.0; + var $242 = 0.0, $243 = 0.0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; + var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; + var $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0.0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; + var $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0; + var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0; + var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0; + var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0, $98 = 0.0, $99 = 0.0, $i$017 = 0, $i1$019 = 0, $i12$028 = 0; + var $i13$031 = 0, $i2$021 = 0, $i3$024 = 0, $i7$026 = 0, $image$byval_copy = 0, $k$018 = 0, $k$123 = 0, $k$230 = 0, $or$cond = 0, $roundf = 0.0, $roundf10 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $roundf4 = 0.0, $roundf5 = 0.0, $roundf6 = 0.0, $roundf7 = 0.0, $roundf8 = 0.0, $roundf9 = 0.0, $vararg_buffer = 0; + var label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $image$byval_copy = sp + 4|0; + $vararg_buffer = sp; + $0 = ((($image)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==($newFormat|0); + if ($2) { + STACKTOP = sp;return; + } + $3 = ($1|0)<(8); + $4 = ($newFormat|0)<(8); + $or$cond = $4 & $3; + if (!($or$cond)) { + _TraceLog(2,11034,$vararg_buffer); + STACKTOP = sp;return; + } + ;HEAP32[$image$byval_copy>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy+16>>2]=HEAP32[$image+16>>2]|0; + $5 = (_GetImageData($image$byval_copy)|0); + $6 = HEAP32[$image>>2]|0; + _free($6); + HEAP32[$0>>2] = $newFormat; + switch ($newFormat|0) { + case 1: { + $7 = ((($image)) + 4|0); + $8 = HEAP32[$7>>2]|0; + $9 = ((($image)) + 8|0); + $10 = HEAP32[$9>>2]|0; + $11 = Math_imul($10, $8)|0; + $12 = (_malloc($11)|0); + HEAP32[$image>>2] = $12; + $13 = HEAP32[$7>>2]|0; + $14 = HEAP32[$9>>2]|0; + $15 = Math_imul($14, $13)|0; + $16 = ($15|0)>(0); + if ($16) { + $i$017 = 0; + while(1) { + $17 = (($5) + ($i$017<<2)|0); + $18 = HEAP8[$17>>0]|0; + $19 = (+($18&255)); + $20 = $19 * 0.29899999499320984; + $21 = (((($5) + ($i$017<<2)|0)) + 1|0); + $22 = HEAP8[$21>>0]|0; + $23 = (+($22&255)); + $24 = $23 * 0.58700001239776611; + $25 = $20 + $24; + $26 = (((($5) + ($i$017<<2)|0)) + 2|0); + $27 = HEAP8[$26>>0]|0; + $28 = (+($27&255)); + $29 = $28 * 0.11400000005960464; + $30 = $25 + $29; + $31 = (~~(($30))&255); + $32 = HEAP32[$image>>2]|0; + $33 = (($32) + ($i$017)|0); + HEAP8[$33>>0] = $31; + $34 = (($i$017) + 1)|0; + $35 = HEAP32[$7>>2]|0; + $36 = HEAP32[$9>>2]|0; + $37 = Math_imul($36, $35)|0; + $38 = ($34|0)<($37|0); + if ($38) { + $i$017 = $34; + } else { + break; + } + } + } + break; + } + case 2: { + $39 = ((($image)) + 4|0); + $40 = HEAP32[$39>>2]|0; + $41 = ((($image)) + 8|0); + $42 = HEAP32[$41>>2]|0; + $43 = $40 << 1; + $44 = Math_imul($43, $42)|0; + $45 = (_malloc($44)|0); + HEAP32[$image>>2] = $45; + $46 = HEAP32[$39>>2]|0; + $47 = HEAP32[$41>>2]|0; + $48 = $46 << 1; + $49 = Math_imul($48, $47)|0; + $50 = ($49|0)>(0); + if ($50) { + $i1$019 = 0;$k$018 = 0; + while(1) { + $51 = (($5) + ($k$018<<2)|0); + $52 = HEAP8[$51>>0]|0; + $53 = (+($52&255)); + $54 = $53 * 0.29899999499320984; + $55 = (((($5) + ($k$018<<2)|0)) + 1|0); + $56 = HEAP8[$55>>0]|0; + $57 = (+($56&255)); + $58 = $57 * 0.58700001239776611; + $59 = $54 + $58; + $60 = (((($5) + ($k$018<<2)|0)) + 2|0); + $61 = HEAP8[$60>>0]|0; + $62 = (+($61&255)); + $63 = $62 * 0.11400000005960464; + $64 = $59 + $63; + $65 = (~~(($64))&255); + $66 = HEAP32[$image>>2]|0; + $67 = (($66) + ($i1$019)|0); + HEAP8[$67>>0] = $65; + $68 = (((($5) + ($k$018<<2)|0)) + 3|0); + $69 = HEAP8[$68>>0]|0; + $70 = $i1$019 | 1; + $71 = HEAP32[$image>>2]|0; + $72 = (($71) + ($70)|0); + HEAP8[$72>>0] = $69; + $73 = (($k$018) + 1)|0; + $74 = (($i1$019) + 2)|0; + $75 = HEAP32[$39>>2]|0; + $76 = HEAP32[$41>>2]|0; + $77 = $75 << 1; + $78 = Math_imul($77, $76)|0; + $79 = ($74|0)<($78|0); + if ($79) { + $i1$019 = $74;$k$018 = $73; + } else { + break; + } + } + } + break; + } + case 3: { + $80 = ((($image)) + 4|0); + $81 = HEAP32[$80>>2]|0; + $82 = ((($image)) + 8|0); + $83 = HEAP32[$82>>2]|0; + $84 = $81 << 1; + $85 = Math_imul($84, $83)|0; + $86 = (_malloc($85)|0); + HEAP32[$image>>2] = $86; + $87 = HEAP32[$80>>2]|0; + $88 = HEAP32[$82>>2]|0; + $89 = Math_imul($88, $87)|0; + $90 = ($89|0)>(0); + if ($90) { + $91 = HEAP8[$5>>0]|0; + $92 = (+($91&255)); + $93 = $92 * 31.0; + $94 = $93 / 255.0; + $roundf8 = (+_roundf($94)); + $95 = (~~(($roundf8))&255); + $96 = ((($5)) + 1|0); + $97 = HEAP8[$96>>0]|0; + $98 = (+($97&255)); + $99 = $98 * 63.0; + $100 = $99 / 255.0; + $roundf9 = (+_roundf($100)); + $101 = (~~(($roundf9))&255); + $102 = ((($5)) + 2|0); + $103 = HEAP8[$102>>0]|0; + $104 = (+($103&255)); + $105 = $104 * 31.0; + $106 = $105 / 255.0; + $roundf10 = (+_roundf($106)); + $107 = (~~(($roundf10))&255); + $108 = $95&255; + $109 = $108 << 11; + $110 = $101&255; + $111 = $110 << 5; + $112 = $111 | $109; + $113 = $107&255; + $114 = $112 | $113; + $115 = $114&65535; + $116 = HEAP32[$image>>2]|0; + $117 = HEAP32[$80>>2]|0; + $118 = HEAP32[$82>>2]|0; + $119 = Math_imul($118, $117)|0; + $i2$021 = 0; + while(1) { + $120 = (($116) + ($i2$021<<1)|0); + HEAP16[$120>>1] = $115; + $121 = (($i2$021) + 1)|0; + $122 = ($121|0)<($119|0); + if ($122) { + $i2$021 = $121; + } else { + break; + } + } + } + break; + } + case 4: { + $123 = ((($image)) + 4|0); + $124 = HEAP32[$123>>2]|0; + $125 = ((($image)) + 8|0); + $126 = HEAP32[$125>>2]|0; + $127 = ($124*3)|0; + $128 = Math_imul($127, $126)|0; + $129 = (_malloc($128)|0); + HEAP32[$image>>2] = $129; + $130 = HEAP32[$123>>2]|0; + $131 = HEAP32[$125>>2]|0; + $132 = ($130*3)|0; + $133 = Math_imul($132, $131)|0; + $134 = ($133|0)>(0); + if ($134) { + $i3$024 = 0;$k$123 = 0; + while(1) { + $135 = (($5) + ($k$123<<2)|0); + $136 = HEAP8[$135>>0]|0; + $137 = HEAP32[$image>>2]|0; + $138 = (($137) + ($i3$024)|0); + HEAP8[$138>>0] = $136; + $139 = (((($5) + ($k$123<<2)|0)) + 1|0); + $140 = HEAP8[$139>>0]|0; + $141 = (($i3$024) + 1)|0; + $142 = HEAP32[$image>>2]|0; + $143 = (($142) + ($141)|0); + HEAP8[$143>>0] = $140; + $144 = (((($5) + ($k$123<<2)|0)) + 2|0); + $145 = HEAP8[$144>>0]|0; + $146 = (($i3$024) + 2)|0; + $147 = HEAP32[$image>>2]|0; + $148 = (($147) + ($146)|0); + HEAP8[$148>>0] = $145; + $149 = (($k$123) + 1)|0; + $150 = (($i3$024) + 3)|0; + $151 = HEAP32[$123>>2]|0; + $152 = HEAP32[$125>>2]|0; + $153 = ($151*3)|0; + $154 = Math_imul($153, $152)|0; + $155 = ($150|0)<($154|0); + if ($155) { + $i3$024 = $150;$k$123 = $149; + } else { + break; + } + } + } + break; + } + case 5: { + $156 = ((($image)) + 4|0); + $157 = HEAP32[$156>>2]|0; + $158 = ((($image)) + 8|0); + $159 = HEAP32[$158>>2]|0; + $160 = $157 << 1; + $161 = Math_imul($160, $159)|0; + $162 = (_malloc($161)|0); + HEAP32[$image>>2] = $162; + $163 = HEAP32[$156>>2]|0; + $164 = HEAP32[$158>>2]|0; + $165 = Math_imul($164, $163)|0; + $166 = ($165|0)>(0); + if ($166) { + $167 = HEAP32[$image>>2]|0; + $168 = HEAP32[$156>>2]|0; + $169 = HEAP32[$158>>2]|0; + $170 = Math_imul($169, $168)|0; + $i7$026 = 0; + while(1) { + $171 = (($5) + ($i7$026<<2)|0); + $172 = HEAP8[$171>>0]|0; + $173 = (+($172&255)); + $174 = $173 * 31.0; + $175 = $174 / 255.0; + $roundf5 = (+_roundf($175)); + $176 = (~~(($roundf5))&255); + $177 = (((($5) + ($i7$026<<2)|0)) + 1|0); + $178 = HEAP8[$177>>0]|0; + $179 = (+($178&255)); + $180 = $179 * 31.0; + $181 = $180 / 255.0; + $roundf6 = (+_roundf($181)); + $182 = (~~(($roundf6))&255); + $183 = (((($5) + ($i7$026<<2)|0)) + 2|0); + $184 = HEAP8[$183>>0]|0; + $185 = (+($184&255)); + $186 = $185 * 31.0; + $187 = $186 / 255.0; + $roundf7 = (+_roundf($187)); + $188 = (~~(($roundf7))&255); + $189 = (((($5) + ($i7$026<<2)|0)) + 3|0); + $190 = HEAP8[$189>>0]|0; + $191 = ($190&255)>(50); + $192 = $176&255; + $193 = $192 << 11; + $194 = $182&255; + $195 = $194 << 6; + $196 = $195 | $193; + $197 = $188&255; + $198 = $197 << 1; + $199 = $196 | $198; + $200 = $191&1; + $201 = $199 | $200; + $202 = $201&65535; + $203 = (($167) + ($i7$026<<1)|0); + HEAP16[$203>>1] = $202; + $204 = (($i7$026) + 1)|0; + $205 = ($204|0)<($170|0); + if ($205) { + $i7$026 = $204; + } else { + break; + } + } + } + break; + } + case 6: { + $206 = ((($image)) + 4|0); + $207 = HEAP32[$206>>2]|0; + $208 = ((($image)) + 8|0); + $209 = HEAP32[$208>>2]|0; + $210 = $207 << 1; + $211 = Math_imul($210, $209)|0; + $212 = (_malloc($211)|0); + HEAP32[$image>>2] = $212; + $213 = HEAP32[$206>>2]|0; + $214 = HEAP32[$208>>2]|0; + $215 = Math_imul($214, $213)|0; + $216 = ($215|0)>(0); + if ($216) { + $217 = HEAP32[$image>>2]|0; + $218 = HEAP32[$206>>2]|0; + $219 = HEAP32[$208>>2]|0; + $220 = Math_imul($219, $218)|0; + $i12$028 = 0; + while(1) { + $221 = (($5) + ($i12$028<<2)|0); + $222 = HEAP8[$221>>0]|0; + $223 = (+($222&255)); + $224 = $223 * 15.0; + $225 = $224 / 255.0; + $roundf = (+_roundf($225)); + $226 = (~~(($roundf))&255); + $227 = (((($5) + ($i12$028<<2)|0)) + 1|0); + $228 = HEAP8[$227>>0]|0; + $229 = (+($228&255)); + $230 = $229 * 15.0; + $231 = $230 / 255.0; + $roundf2 = (+_roundf($231)); + $232 = (~~(($roundf2))&255); + $233 = (((($5) + ($i12$028<<2)|0)) + 2|0); + $234 = HEAP8[$233>>0]|0; + $235 = (+($234&255)); + $236 = $235 * 15.0; + $237 = $236 / 255.0; + $roundf3 = (+_roundf($237)); + $238 = (~~(($roundf3))&255); + $239 = (((($5) + ($i12$028<<2)|0)) + 3|0); + $240 = HEAP8[$239>>0]|0; + $241 = (+($240&255)); + $242 = $241 * 15.0; + $243 = $242 / 255.0; + $roundf4 = (+_roundf($243)); + $244 = (~~(($roundf4))&255); + $245 = $226&255; + $246 = $245 << 12; + $247 = $232&255; + $248 = $247 << 8; + $249 = $248 | $246; + $250 = $238&255; + $251 = $250 << 4; + $252 = $249 | $251; + $253 = $244&255; + $254 = $252 | $253; + $255 = $254&65535; + $256 = (($217) + ($i12$028<<1)|0); + HEAP16[$256>>1] = $255; + $257 = (($i12$028) + 1)|0; + $258 = ($257|0)<($220|0); + if ($258) { + $i12$028 = $257; + } else { + break; + } + } + } + break; + } + case 7: { + $259 = ((($image)) + 4|0); + $260 = HEAP32[$259>>2]|0; + $261 = ((($image)) + 8|0); + $262 = HEAP32[$261>>2]|0; + $263 = $260 << 2; + $264 = Math_imul($263, $262)|0; + $265 = (_malloc($264)|0); + HEAP32[$image>>2] = $265; + $266 = HEAP32[$259>>2]|0; + $267 = HEAP32[$261>>2]|0; + $268 = $266 << 2; + $269 = Math_imul($268, $267)|0; + $270 = ($269|0)>(0); + if ($270) { + $i13$031 = 0;$k$230 = 0; + while(1) { + $271 = (($5) + ($k$230<<2)|0); + $272 = HEAP8[$271>>0]|0; + $273 = HEAP32[$image>>2]|0; + $274 = (($273) + ($i13$031)|0); + HEAP8[$274>>0] = $272; + $275 = (((($5) + ($k$230<<2)|0)) + 1|0); + $276 = HEAP8[$275>>0]|0; + $277 = $i13$031 | 1; + $278 = HEAP32[$image>>2]|0; + $279 = (($278) + ($277)|0); + HEAP8[$279>>0] = $276; + $280 = (((($5) + ($k$230<<2)|0)) + 2|0); + $281 = HEAP8[$280>>0]|0; + $282 = $i13$031 | 2; + $283 = HEAP32[$image>>2]|0; + $284 = (($283) + ($282)|0); + HEAP8[$284>>0] = $281; + $285 = (((($5) + ($k$230<<2)|0)) + 3|0); + $286 = HEAP8[$285>>0]|0; + $287 = $i13$031 | 3; + $288 = HEAP32[$image>>2]|0; + $289 = (($288) + ($287)|0); + HEAP8[$289>>0] = $286; + $290 = (($k$230) + 1)|0; + $291 = (($i13$031) + 4)|0; + $292 = HEAP32[$259>>2]|0; + $293 = HEAP32[$261>>2]|0; + $294 = $292 << 2; + $295 = Math_imul($294, $293)|0; + $296 = ($291|0)<($295|0); + if ($296) { + $i13$031 = $291;$k$230 = $290; + } else { + break; + } + } + } + break; + } + default: { + } + } + _free($5); + STACKTOP = sp;return; +} +function _DrawTexturePro($texture,$sourceRec,$destRec,$origin,$rotation,$tint) { + $texture = $texture|0; + $sourceRec = $sourceRec|0; + $destRec = $destRec|0; + $origin = $origin|0; + $rotation = +$rotation; + $tint = $tint|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0; + var $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0; + var $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; + var $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0.0, $87 = 0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$texture>>2]|0; + $1 = ($0|0)==(0); + if ($1) { + return; + } + $2 = ((($sourceRec)) + 8|0); + $3 = HEAP32[$2>>2]|0; + $4 = ($3|0)<(0); + if ($4) { + $5 = HEAP32[$sourceRec>>2]|0; + $6 = (($5) - ($3))|0; + HEAP32[$sourceRec>>2] = $6; + } + $7 = ((($sourceRec)) + 12|0); + $8 = HEAP32[$7>>2]|0; + $9 = ($8|0)<(0); + if ($9) { + $10 = ((($sourceRec)) + 4|0); + $11 = HEAP32[$10>>2]|0; + $12 = (($11) - ($8))|0; + HEAP32[$10>>2] = $12; + } + $13 = HEAP32[$texture>>2]|0; + _rlEnableTexture($13); + _rlPushMatrix(); + $14 = HEAP32[$destRec>>2]|0; + $15 = (+($14|0)); + $16 = ((($destRec)) + 4|0); + $17 = HEAP32[$16>>2]|0; + $18 = (+($17|0)); + _rlTranslatef($15,$18,0.0); + _rlRotatef($rotation,0.0,0.0,1.0); + $19 = +HEAPF32[$origin>>2]; + $20 = -$19; + $21 = ((($origin)) + 4|0); + $22 = +HEAPF32[$21>>2]; + $23 = -$22; + _rlTranslatef($20,$23,0.0); + _rlBegin(2); + $24 = HEAP8[$tint>>0]|0; + $25 = ((($tint)) + 1|0); + $26 = HEAP8[$25>>0]|0; + $27 = ((($tint)) + 2|0); + $28 = HEAP8[$27>>0]|0; + $29 = ((($tint)) + 3|0); + $30 = HEAP8[$29>>0]|0; + _rlColor4ub($24,$26,$28,$30); + $31 = HEAP32[$sourceRec>>2]|0; + $32 = (+($31|0)); + $33 = ((($texture)) + 4|0); + $34 = HEAP32[$33>>2]|0; + $35 = (+($34|0)); + $36 = $32 / $35; + $37 = ((($sourceRec)) + 4|0); + $38 = HEAP32[$37>>2]|0; + $39 = (+($38|0)); + $40 = ((($texture)) + 8|0); + $41 = HEAP32[$40>>2]|0; + $42 = (+($41|0)); + $43 = $39 / $42; + _rlTexCoord2f($36,$43); + _rlVertex2f(0.0,0.0); + $44 = HEAP32[$sourceRec>>2]|0; + $45 = (+($44|0)); + $46 = HEAP32[$33>>2]|0; + $47 = (+($46|0)); + $48 = $45 / $47; + $49 = HEAP32[$37>>2]|0; + $50 = HEAP32[$7>>2]|0; + $51 = (($50) + ($49))|0; + $52 = (+($51|0)); + $53 = HEAP32[$40>>2]|0; + $54 = (+($53|0)); + $55 = $52 / $54; + _rlTexCoord2f($48,$55); + $56 = ((($destRec)) + 12|0); + $57 = HEAP32[$56>>2]|0; + $58 = (+($57|0)); + _rlVertex2f(0.0,$58); + $59 = HEAP32[$sourceRec>>2]|0; + $60 = HEAP32[$2>>2]|0; + $61 = (($60) + ($59))|0; + $62 = (+($61|0)); + $63 = HEAP32[$33>>2]|0; + $64 = (+($63|0)); + $65 = $62 / $64; + $66 = HEAP32[$37>>2]|0; + $67 = HEAP32[$7>>2]|0; + $68 = (($67) + ($66))|0; + $69 = (+($68|0)); + $70 = HEAP32[$40>>2]|0; + $71 = (+($70|0)); + $72 = $69 / $71; + _rlTexCoord2f($65,$72); + $73 = ((($destRec)) + 8|0); + $74 = HEAP32[$73>>2]|0; + $75 = (+($74|0)); + $76 = HEAP32[$56>>2]|0; + $77 = (+($76|0)); + _rlVertex2f($75,$77); + $78 = HEAP32[$sourceRec>>2]|0; + $79 = HEAP32[$2>>2]|0; + $80 = (($79) + ($78))|0; + $81 = (+($80|0)); + $82 = HEAP32[$33>>2]|0; + $83 = (+($82|0)); + $84 = $81 / $83; + $85 = HEAP32[$37>>2]|0; + $86 = (+($85|0)); + $87 = HEAP32[$40>>2]|0; + $88 = (+($87|0)); + $89 = $86 / $88; + _rlTexCoord2f($84,$89); + $90 = HEAP32[$73>>2]|0; + $91 = (+($90|0)); + _rlVertex2f($91,0.0); + _rlEnd(); + _rlPopMatrix(); + return; +} +function _LoadDefaultFont() { + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $counter$013 = 0, $currentLine$08 = 0, $currentLine$1 = 0, $currentPosX$09 = 0, $currentPosX$1 = 0, $exitcond = 0; + var $i$014 = 0, $i1$012 = 0, $i2$010 = 0, $image = 0, $image$byval_copy1 = 0, $j$011 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $image$byval_copy1 = sp + 44|0; + $vararg_buffer = sp; + $image = sp + 24|0; + $0 = sp + 4|0; + HEAP32[(2648)>>2] = 224; + $1 = (_malloc(65536)|0); + $i$014 = 0; + while(1) { + $2 = (($1) + ($i$014<<2)|0); + $3 = (($i$014) + 1)|0; + $exitcond = ($3|0)==(16384); + HEAP8[$2>>0]=0&255;HEAP8[$2+1>>0]=(0>>8)&255;HEAP8[$2+2>>0]=(0>>16)&255;HEAP8[$2+3>>0]=0>>24; + if ($exitcond) { + $counter$013 = 0;$i1$012 = 0; + break; + } else { + $i$014 = $3; + } + } + while(1) { + $4 = (2668 + ($counter$013<<2)|0); + $5 = HEAP32[$4>>2]|0; + $j$011 = 31; + while(1) { + $6 = 1 << $j$011; + $7 = $5 & $6; + $8 = ($7|0)==(0); + if (!($8)) { + $9 = (($j$011) + ($i1$012))|0; + $10 = (($1) + ($9<<2)|0); + HEAP8[$10>>0]=-1&255;HEAP8[$10+1>>0]=(-1>>8)&255;HEAP8[$10+2>>0]=(-1>>16)&255;HEAP8[$10+3>>0]=-1>>24; + } + $11 = (($j$011) + -1)|0; + $12 = ($j$011|0)>(0); + if ($12) { + $j$011 = $11; + } else { + break; + } + } + $13 = (($counter$013) + 1)|0; + $14 = ($counter$013|0)>(511); + $$ = $14 ? 0 : $13; + $15 = (($i1$012) + 32)|0; + $16 = ($15|0)<(16384); + if ($16) { + $counter$013 = $$;$i1$012 = $15; + } else { + break; + } + } + _LoadImageEx($image,$1,128,128); + _ImageFormat($image,2); + _free($1); + ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; + _LoadTextureFromImage($0,$image$byval_copy1); + ;HEAP32[2624>>2]=HEAP32[$0>>2]|0;HEAP32[2624+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[2624+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[2624+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[2624+16>>2]=HEAP32[$0+16>>2]|0; + ;HEAP32[$image$byval_copy1>>2]=HEAP32[$image>>2]|0;HEAP32[$image$byval_copy1+4>>2]=HEAP32[$image+4>>2]|0;HEAP32[$image$byval_copy1+8>>2]=HEAP32[$image+8>>2]|0;HEAP32[$image$byval_copy1+12>>2]=HEAP32[$image+12>>2]|0;HEAP32[$image$byval_copy1+16>>2]=HEAP32[$image+16>>2]|0; + _UnloadImage($image$byval_copy1); + $17 = HEAP32[(2648)>>2]|0; + $18 = $17 << 2; + $19 = (_malloc($18)|0); + HEAP32[(2652)>>2] = $19; + $20 = HEAP32[(2648)>>2]|0; + $21 = $20 << 4; + $22 = (_malloc($21)|0); + HEAP32[(2656)>>2] = $22; + $23 = HEAP32[(2648)>>2]|0; + $24 = $23 << 3; + $25 = (_malloc($24)|0); + HEAP32[(2660)>>2] = $25; + $26 = HEAP32[(2648)>>2]|0; + $27 = $26 << 2; + $28 = (_malloc($27)|0); + HEAP32[(2664)>>2] = $28; + $29 = HEAP32[(2648)>>2]|0; + $30 = ($29|0)>(0); + if ($30) { + $currentLine$08 = 0;$currentPosX$09 = 1;$i2$010 = 0; + } else { + $69 = HEAP32[(2656)>>2]|0; + $70 = ((($69)) + 12|0); + $71 = HEAP32[$70>>2]|0; + HEAP32[(2644)>>2] = $71; + $72 = HEAP32[2624>>2]|0; + HEAP32[$vararg_buffer>>2] = $72; + _TraceLog(0,11088,$vararg_buffer); + STACKTOP = sp;return; + } + while(1) { + $31 = (($i2$010) + 32)|0; + $32 = HEAP32[(2652)>>2]|0; + $33 = (($32) + ($i2$010<<2)|0); + HEAP32[$33>>2] = $31; + $34 = HEAP32[(2656)>>2]|0; + $35 = (($34) + ($i2$010<<4)|0); + HEAP32[$35>>2] = $currentPosX$09; + $36 = ($currentLine$08*11)|0; + $37 = (($36) + 1)|0; + $38 = HEAP32[(2656)>>2]|0; + $39 = (((($38) + ($i2$010<<4)|0)) + 4|0); + HEAP32[$39>>2] = $37; + $40 = (4716 + ($i2$010<<2)|0); + $41 = HEAP32[$40>>2]|0; + $42 = HEAP32[(2656)>>2]|0; + $43 = (((($42) + ($i2$010<<4)|0)) + 8|0); + HEAP32[$43>>2] = $41; + $44 = HEAP32[(2656)>>2]|0; + $45 = (((($44) + ($i2$010<<4)|0)) + 12|0); + HEAP32[$45>>2] = 10; + $46 = HEAP32[(2656)>>2]|0; + $47 = (((($46) + ($i2$010<<4)|0)) + 8|0); + $48 = HEAP32[$47>>2]|0; + $49 = (($currentPosX$09) + 1)|0; + $50 = (($49) + ($48))|0; + $51 = HEAP32[(2628)>>2]|0; + $52 = ($50|0)<($51|0); + if ($52) { + $currentLine$1 = $currentLine$08;$currentPosX$1 = $50; + } else { + $53 = (($currentLine$08) + 1)|0; + $54 = HEAP32[$40>>2]|0; + $55 = (($54) + 2)|0; + $56 = (($46) + ($i2$010<<4)|0); + HEAP32[$56>>2] = 1; + $57 = ($53*11)|0; + $58 = (($57) + 1)|0; + $59 = HEAP32[(2656)>>2]|0; + $60 = (((($59) + ($i2$010<<4)|0)) + 4|0); + HEAP32[$60>>2] = $58; + $currentLine$1 = $53;$currentPosX$1 = $55; + } + $61 = HEAP32[(2660)>>2]|0; + $62 = (($61) + ($i2$010<<3)|0); + HEAPF32[$62>>2] = 0.0; + $63 = (((($61) + ($i2$010<<3)|0)) + 4|0); + HEAPF32[$63>>2] = 0.0; + $64 = HEAP32[(2664)>>2]|0; + $65 = (($64) + ($i2$010<<2)|0); + HEAP32[$65>>2] = 0; + $66 = (($i2$010) + 1)|0; + $67 = HEAP32[(2648)>>2]|0; + $68 = ($66|0)<($67|0); + if ($68) { + $currentLine$08 = $currentLine$1;$currentPosX$09 = $currentPosX$1;$i2$010 = $66; + } else { + break; + } + } + $69 = HEAP32[(2656)>>2]|0; + $70 = ((($69)) + 12|0); + $71 = HEAP32[$70>>2]|0; + HEAP32[(2644)>>2] = $71; + $72 = HEAP32[2624>>2]|0; + HEAP32[$vararg_buffer>>2] = $72; + _TraceLog(0,11088,$vararg_buffer); + STACKTOP = sp;return; +} +function _UnloadDefaultFont() { + var $$byval_copy = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $$byval_copy = sp; + ;HEAP32[$$byval_copy>>2]=HEAP32[2624>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[2624+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[2624+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[2624+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[2624+16>>2]|0; + _UnloadTexture($$byval_copy); + $0 = HEAP32[(2652)>>2]|0; + _free($0); + $1 = HEAP32[(2656)>>2]|0; + _free($1); + $2 = HEAP32[(2660)>>2]|0; + _free($2); + $3 = HEAP32[(2664)>>2]|0; + _free($3); + STACKTOP = sp;return; +} +function _DrawText($text,$posX,$posY,$fontSize,$color) { + $text = $text|0; + $posX = $posX|0; + $posY = $posY|0; + $fontSize = $fontSize|0; + $color = $color|0; + var $$fontSize = 0, $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0, $color$byval_copy = 0, $defaultFont$byval_copy = 0, $position = 0, $position$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 80|0; + $color$byval_copy = sp + 64|0; + $position$byval_copy = sp + 56|0; + $defaultFont$byval_copy = sp + 8|0; + $position = sp; + $0 = (+($posX|0)); + HEAPF32[$position>>2] = $0; + $1 = ((($position)) + 4|0); + $2 = (+($posY|0)); + HEAPF32[$1>>2] = $2; + $3 = ($fontSize|0)<(10); + $$fontSize = $3 ? 10 : $fontSize; + $4 = (($$fontSize|0) / 10)&-1; + dest=$defaultFont$byval_copy; src=2624; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0; + ;HEAP8[$color$byval_copy>>0]=HEAP8[$color>>0]|0;HEAP8[$color$byval_copy+1>>0]=HEAP8[$color+1>>0]|0;HEAP8[$color$byval_copy+2>>0]=HEAP8[$color+2>>0]|0;HEAP8[$color$byval_copy+3>>0]=HEAP8[$color+3>>0]|0; + _DrawTextEx($defaultFont$byval_copy,$text,$position$byval_copy,$$fontSize,$4,$color$byval_copy); + STACKTOP = sp;return; +} +function _DrawTextEx($spriteFont,$text,$position,$fontSize,$spacing,$tint) { + $spriteFont = $spriteFont|0; + $text = $text|0; + $position = $position|0; + $fontSize = $fontSize|0; + $spacing = $spacing|0; + $tint = $tint|0; + var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0.0, $100 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0; + var $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; + var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0; + var $59 = 0, $6 = 0.0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0; + var $77 = 0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0.0; + var $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0, $99 = 0, $i$03 = 0, $i$1$ph = 0, $i$16 = 0, $rec = 0, $rec$byval_copy = 0, $textOffsetX$05 = 0, $textOffsetX$2 = 0, $textOffsetY$04 = 0, $textOffsetY$17 = 0, $tint$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 112|0; + $tint$byval_copy = sp + 104|0; + $$byval_copy2 = sp + 96|0; + $$byval_copy1 = sp + 80|0; + $rec$byval_copy = sp + 64|0; + $$byval_copy = sp + 40|0; + $rec = sp + 24|0; + $0 = sp + 8|0; + $1 = sp; + $2 = (_strlen($text)|0); + $3 = (+($fontSize|0)); + $4 = ((($spriteFont)) + 20|0); + $5 = HEAP32[$4>>2]|0; + $6 = (+($5|0)); + $7 = $3 / $6; + $8 = ($2|0)>(0); + if (!($8)) { + STACKTOP = sp;return; + } + $9 = ((($spriteFont)) + 32|0); + $10 = +HEAPF32[$position>>2]; + $11 = ((($spriteFont)) + 36|0); + $12 = ((($position)) + 4|0); + $13 = +HEAPF32[$12>>2]; + $14 = ((($rec)) + 8|0); + $15 = ((($rec)) + 12|0); + $16 = ((($0)) + 4|0); + $17 = ((($0)) + 8|0); + $18 = ((($0)) + 12|0); + $19 = ((($1)) + 4|0); + $20 = ((($spriteFont)) + 40|0); + $21 = (+($spacing|0)); + $22 = (+($spacing|0)); + $23 = ((($spriteFont)) + 32|0); + $24 = ((($spriteFont)) + 32|0); + $i$03 = 0;$textOffsetX$05 = 0;$textOffsetY$04 = 0; + while(1) { + $25 = (($text) + ($i$03)|0); + $26 = HEAP8[$25>>0]|0; + switch ($26<<24>>24) { + case -62: { + $27 = (($i$03) + 1)|0; + $28 = (($text) + ($27)|0); + $29 = HEAP8[$28>>0]|0; + $30 = $29&255; + $31 = (($30) + -32)|0; + $32 = HEAP32[$23>>2]|0; + $33 = (($32) + ($31<<4)|0); + ;HEAP32[$rec>>2]=HEAP32[$33>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$33+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$33+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$33+12>>2]|0; + $i$1$ph = $27; + label = 8; + break; + } + case -61: { + $34 = (($i$03) + 1)|0; + $35 = (($text) + ($34)|0); + $36 = HEAP8[$35>>0]|0; + $37 = $36&255; + $38 = (($37) + 32)|0; + $39 = HEAP32[$24>>2]|0; + $40 = (($39) + ($38<<4)|0); + ;HEAP32[$rec>>2]=HEAP32[$40>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$40+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$40+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$40+12>>2]|0; + $i$1$ph = $34; + label = 8; + break; + } + case 10: { + $41 = HEAP32[$4>>2]|0; + $42 = (($41|0) / 2)&-1; + $43 = (($42) + ($41))|0; + $44 = (+($43|0)); + $45 = $7 * $44; + $46 = (+($textOffsetY$04|0)); + $47 = $46 + $45; + $48 = (~~(($47))); + HEAP32[$rec>>2] = -1; + $i$16 = $i$03;$textOffsetX$2 = 0;$textOffsetY$17 = $48; + break; + } + default: { + $49 = $26 << 24 >> 24; + $50 = (($49) + -32)|0; + $51 = HEAP32[$9>>2]|0; + $52 = (($51) + ($50<<4)|0); + ;HEAP32[$rec>>2]=HEAP32[$52>>2]|0;HEAP32[$rec+4>>2]=HEAP32[$52+4>>2]|0;HEAP32[$rec+8>>2]=HEAP32[$52+8>>2]|0;HEAP32[$rec+12>>2]=HEAP32[$52+12>>2]|0; + $i$1$ph = $i$03; + label = 8; + } + } + do { + if ((label|0) == 8) { + label = 0; + $$pr = HEAP32[$rec>>2]|0; + $53 = ($$pr|0)>(0); + if ($53) { + $54 = (+($textOffsetX$05|0)); + $55 = $54 + $10; + $56 = (($text) + ($i$1$ph)|0); + $57 = HEAP8[$56>>0]|0; + $58 = $57 << 24 >> 24; + $59 = (($58) + -32)|0; + $60 = HEAP32[$11>>2]|0; + $61 = (($60) + ($59<<3)|0); + $62 = +HEAPF32[$61>>2]; + $63 = $7 * $62; + $64 = $55 + $63; + $65 = (~~(($64))); + $66 = (+($textOffsetY$04|0)); + $67 = $66 + $13; + $68 = (((($60) + ($59<<3)|0)) + 4|0); + $69 = +HEAPF32[$68>>2]; + $70 = $7 * $69; + $71 = $67 + $70; + $72 = (~~(($71))); + $73 = HEAP32[$14>>2]|0; + $74 = (+($73|0)); + $75 = $7 * $74; + $76 = (~~(($75))); + $77 = HEAP32[$15>>2]|0; + $78 = (+($77|0)); + $79 = $7 * $78; + $80 = (~~(($79))); + HEAP32[$0>>2] = $65; + HEAP32[$16>>2] = $72; + HEAP32[$17>>2] = $76; + HEAP32[$18>>2] = $80; + HEAPF32[$1>>2] = 0.0; + HEAPF32[$19>>2] = 0.0; + ;HEAP32[$$byval_copy>>2]=HEAP32[$spriteFont>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$spriteFont+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$spriteFont+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$spriteFont+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$spriteFont+16>>2]|0; + ;HEAP32[$rec$byval_copy>>2]=HEAP32[$rec>>2]|0;HEAP32[$rec$byval_copy+4>>2]=HEAP32[$rec+4>>2]|0;HEAP32[$rec$byval_copy+8>>2]=HEAP32[$rec+8>>2]|0;HEAP32[$rec$byval_copy+12>>2]=HEAP32[$rec+12>>2]|0; + ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0; + ;HEAP32[$$byval_copy2>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$1+4>>2]|0; + ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; + _DrawTexturePro($$byval_copy,$rec$byval_copy,$$byval_copy1,$$byval_copy2,0.0,$tint$byval_copy); + $81 = HEAP8[$56>>0]|0; + $82 = $81 << 24 >> 24; + $83 = (($82) + -32)|0; + $84 = HEAP32[$20>>2]|0; + $85 = (($84) + ($83<<2)|0); + $86 = HEAP32[$85>>2]|0; + $87 = ($86|0)==(0); + if ($87) { + $88 = HEAP32[$14>>2]|0; + $89 = (+($88|0)); + $90 = $7 * $89; + $91 = $21 + $90; + $92 = $54 + $91; + $93 = (~~(($92))); + $i$16 = $i$1$ph;$textOffsetX$2 = $93;$textOffsetY$17 = $textOffsetY$04; + break; + } else { + $94 = (+($86|0)); + $95 = $7 * $94; + $96 = $22 + $95; + $97 = $54 + $96; + $98 = (~~(($97))); + $i$16 = $i$1$ph;$textOffsetX$2 = $98;$textOffsetY$17 = $textOffsetY$04; + break; + } + } else { + $i$16 = $i$1$ph;$textOffsetX$2 = $textOffsetX$05;$textOffsetY$17 = $textOffsetY$04; + } + } + } while(0); + $99 = (($i$16) + 1)|0; + $100 = ($99|0)<($2|0); + if ($100) { + $i$03 = $99;$textOffsetX$05 = $textOffsetX$2;$textOffsetY$04 = $textOffsetY$17; + } else { + break; + } + } + STACKTOP = sp;return; +} +function _DrawFPS($posX,$posY) { + $posX = $posX|0; + $posY = $posY|0; + var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, $buffer = 0, $storemerge = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $$byval_copy = sp; + $buffer = sp + 12|0; + $0 = sp + 8|0; + $1 = HEAP32[5612>>2]|0; + $2 = HEAP32[5616>>2]|0; + $3 = ($1|0)<($2|0); + if ($3) { + $4 = (($1) + 1)|0; + $storemerge = $4; + } else { + $5 = (+_GetFPS()); + HEAPF32[5620>>2] = $5; + $6 = (~~(($5))); + HEAP32[5616>>2] = $6; + $storemerge = 0; + } + HEAP32[5612>>2] = $storemerge; + $7 = +HEAPF32[5620>>2]; + $8 = $7; + HEAPF64[$$byval_copy>>3] = $8; + (_sprintf($buffer,11133,$$byval_copy)|0); + HEAP8[$0>>0] = 0; + $9 = ((($0)) + 1|0); + HEAP8[$9>>0] = -98; + $10 = ((($0)) + 2|0); + HEAP8[$10>>0] = 47; + $11 = ((($0)) + 3|0); + HEAP8[$11>>0] = -1; + ;HEAP8[$$byval_copy>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$0+3>>0]|0; + _DrawText($buffer,$posX,$posY,20,$$byval_copy); + STACKTOP = sp;return; +} +function _DrawGrid($slices,$spacing) { + $slices = $slices|0; + $spacing = +$spacing; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, $i$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (($slices|0) / 2)&-1; + _rlBegin(0); + $1 = (0 - ($0))|0; + $2 = ($0|0)<($1|0); + if ($2) { + _rlEnd(); + return; + } + $3 = (+($1|0)); + $4 = $3 * $spacing; + $5 = (+($0|0)); + $6 = $5 * $spacing; + $i$01 = $1; + while(1) { + $7 = ($i$01|0)==(0); + if ($7) { + _rlColor3f(0.5,0.5,0.5); + _rlColor3f(0.5,0.5,0.5); + _rlColor3f(0.5,0.5,0.5); + _rlColor3f(0.5,0.5,0.5); + } else { + _rlColor3f(0.75,0.75,0.75); + _rlColor3f(0.75,0.75,0.75); + _rlColor3f(0.75,0.75,0.75); + _rlColor3f(0.75,0.75,0.75); + } + $8 = (+($i$01|0)); + $9 = $8 * $spacing; + _rlVertex3f($9,0.0,$4); + _rlVertex3f($9,0.0,$6); + _rlVertex3f($4,0.0,$9); + _rlVertex3f($6,0.0,$9); + $10 = (($i$01) + 1)|0; + $11 = ($i$01|0)<($0|0); + if ($11) { + $i$01 = $10; + } else { + break; + } + } + _rlEnd(); + return; +} +function _DrawGizmo($position) { + $position = $position|0; + var $0 = 0.0, $1 = 0, $2 = 0.0, $3 = 0, $4 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + _rlPushMatrix(); + $0 = +HEAPF32[$position>>2]; + $1 = ((($position)) + 4|0); + $2 = +HEAPF32[$1>>2]; + $3 = ((($position)) + 8|0); + $4 = +HEAPF32[$3>>2]; + _rlTranslatef($0,$2,$4); + _rlScalef(1.0,1.0,1.0); + _rlBegin(0); + _rlColor3f(1.0,0.0,0.0); + _rlVertex3f(0.0,0.0,0.0); + _rlColor3f(1.0,0.0,0.0); + _rlVertex3f(1.0,0.0,0.0); + _rlColor3f(0.0,1.0,0.0); + _rlVertex3f(0.0,0.0,0.0); + _rlColor3f(0.0,1.0,0.0); + _rlVertex3f(0.0,1.0,0.0); + _rlColor3f(0.0,0.0,1.0); + _rlVertex3f(0.0,0.0,0.0); + _rlColor3f(0.0,0.0,1.0); + _rlVertex3f(0.0,0.0,1.0); + _rlEnd(); + _rlPopMatrix(); + return; +} +function _LoadModel($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $model = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 528|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $model = sp + 272|0; + $0 = sp + 200|0; + $1 = sp + 136|0; + $2 = sp + 12|0; + _memset(($model|0),0,256)|0; + $3 = (_GetExtension($fileName)|0); + $4 = (_strcmp($3,11143)|0); + $5 = ($4|0)==(0); + if ($5) { + _LoadOBJ($0,$fileName); + dest=$model; src=$0; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + } else { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,11147,$vararg_buffer); + } + $6 = HEAP32[$model>>2]|0; + $7 = ($6|0)==(0); + if ($7) { + _TraceLog(2,11203,$vararg_buffer1); + _memcpy(($agg$result|0),($model|0),256)|0; + STACKTOP = sp;return; + } else { + _rlglLoadMesh($model,0); + $8 = ((($model)) + 68|0); + _MatrixIdentity($1); + dest=$8; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $9 = ((($model)) + 132|0); + _LoadDefaultMaterial($2); + dest=$9; src=$2; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _memcpy(($agg$result|0),($model|0),256)|0; + STACKTOP = sp;return; + } +} +function _LoadDefaultMaterial($agg$result) { + $agg$result = $agg$result|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $material$sroa$0 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 176|0; + $material$sroa$0 = sp; + $0 = sp + 128|0; + $1 = sp + 108|0; + dest=$material$sroa$0; stop=dest+108|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); + _GetDefaultShader($0); + dest=$material$sroa$0; src=$0; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _GetDefaultTexture($1); + $2 = ((($material$sroa$0)) + 48|0); + ;HEAP32[$2>>2]=HEAP32[$1>>2]|0;HEAP32[$2+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$2+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$2+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[$2+16>>2]=HEAP32[$1+16>>2]|0; + dest=$agg$result; src=$material$sroa$0; stop=dest+108|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $3 = ((($agg$result)) + 108|0); + $4 = ((($agg$result)) + 120|0); + ;HEAP32[$3>>2]=4294967295|0;HEAP32[$3+4>>2]=4294967295|0;HEAP32[$3+8>>2]=4294967295|0; + HEAPF32[$4>>2] = 100.0; + STACKTOP = sp;return; +} +function _UnloadModel($model) { + $model = $model|0; + var $$byval_copy = 0, $0 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 128|0; + $$byval_copy = sp + 4|0; + $vararg_buffer = sp; + _rlglUnloadMesh($model); + $0 = ((($model)) + 132|0); + dest=$$byval_copy; src=$0; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _UnloadMaterial($$byval_copy); + _TraceLog(0,11229,$vararg_buffer); + STACKTOP = sp;return; +} +function _UnloadMaterial($material) { + $material = $material|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($material)) + 48|0); + $1 = HEAP32[$0>>2]|0; + _rlDeleteTextures($1); + $2 = ((($material)) + 68|0); + $3 = HEAP32[$2>>2]|0; + _rlDeleteTextures($3); + $4 = ((($material)) + 88|0); + $5 = HEAP32[$4>>2]|0; + _rlDeleteTextures($5); + return; +} +function _DrawModel($model,$position,$scale,$tint) { + $model = $model|0; + $position = $position|0; + $scale = +$scale; + $tint = $tint|0; + var $0 = 0, $1 = 0, $model$byval_copy = 0, $position$byval_copy = 0, $rotationAxis = 0, $rotationAxis$byval_copy = 0, $tint$byval_copy = 0, $vScale = 0, $vScale$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 320|0; + $tint$byval_copy = sp + 316|0; + $vScale$byval_copy = sp + 304|0; + $rotationAxis$byval_copy = sp + 292|0; + $position$byval_copy = sp + 280|0; + $model$byval_copy = sp + 24|0; + $vScale = sp + 12|0; + $rotationAxis = sp; + HEAPF32[$vScale>>2] = $scale; + $0 = ((($vScale)) + 4|0); + HEAPF32[$0>>2] = $scale; + $1 = ((($vScale)) + 8|0); + HEAPF32[$1>>2] = $scale; + ;HEAP32[$rotationAxis>>2]=0|0;HEAP32[$rotationAxis+4>>2]=0|0;HEAP32[$rotationAxis+8>>2]=0|0; + _memcpy(($model$byval_copy|0),($model|0),256)|0; + ;HEAP32[$position$byval_copy>>2]=HEAP32[$position>>2]|0;HEAP32[$position$byval_copy+4>>2]=HEAP32[$position+4>>2]|0;HEAP32[$position$byval_copy+8>>2]=HEAP32[$position+8>>2]|0; + ;HEAP32[$rotationAxis$byval_copy>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$rotationAxis$byval_copy+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$rotationAxis$byval_copy+8>>2]=HEAP32[$rotationAxis+8>>2]|0; + ;HEAP32[$vScale$byval_copy>>2]=HEAP32[$vScale>>2]|0;HEAP32[$vScale$byval_copy+4>>2]=HEAP32[$vScale+4>>2]|0;HEAP32[$vScale$byval_copy+8>>2]=HEAP32[$vScale+8>>2]|0; + ;HEAP8[$tint$byval_copy>>0]=HEAP8[$tint>>0]|0;HEAP8[$tint$byval_copy+1>>0]=HEAP8[$tint+1>>0]|0;HEAP8[$tint$byval_copy+2>>0]=HEAP8[$tint+2>>0]|0;HEAP8[$tint$byval_copy+3>>0]=HEAP8[$tint+3>>0]|0; + _DrawModelEx($model$byval_copy,$position$byval_copy,$rotationAxis$byval_copy,0.0,$vScale$byval_copy,$tint$byval_copy); + STACKTOP = sp;return; +} +function _DrawModelEx($model,$position,$rotationAxis,$rotationAngle,$scale,$tint) { + $model = $model|0; + $position = $position|0; + $rotationAxis = $rotationAxis|0; + $rotationAngle = +$rotationAngle; + $scale = $scale|0; + $tint = $tint|0; + var $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0; + var $8 = 0, $9 = 0.0, $matRotation = 0, $matScale = 0, $matTranslation = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 576|0; + $$byval_copy3 = sp + 512|0; + $$byval_copy2 = sp + 388|0; + $$byval_copy1 = sp + 320|0; + $matRotation = sp + 128|0; + $matScale = sp + 64|0; + $matTranslation = sp; + $0 = sp + 256|0; + $1 = sp + 192|0; + $2 = $rotationAngle; + $3 = $2 * 0.017453292519943295; + $4 = $3; + ;HEAP32[$$byval_copy3>>2]=HEAP32[$rotationAxis>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$rotationAxis+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$rotationAxis+8>>2]|0; + _MatrixRotate($matRotation,$$byval_copy3,$4); + $5 = +HEAPF32[$scale>>2]; + $6 = ((($scale)) + 4|0); + $7 = +HEAPF32[$6>>2]; + $8 = ((($scale)) + 8|0); + $9 = +HEAPF32[$8>>2]; + _MatrixScale($matScale,$5,$7,$9); + $10 = +HEAPF32[$position>>2]; + $11 = ((($position)) + 4|0); + $12 = +HEAPF32[$11>>2]; + $13 = ((($position)) + 8|0); + $14 = +HEAPF32[$13>>2]; + _MatrixTranslate($matTranslation,$10,$12,$14); + $15 = ((($model)) + 68|0); + dest=$$byval_copy2; src=$matScale; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$$byval_copy3; src=$matRotation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$$byval_copy2,$$byval_copy3); + dest=$$byval_copy2; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$$byval_copy3; src=$matTranslation; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($1,$$byval_copy2,$$byval_copy3); + dest=$15; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $16 = ((($model)) + 132|0); + $17 = ((($model)) + 240|0); + $18 = HEAPU8[$tint>>0]|(HEAPU8[$tint+1>>0]<<8)|(HEAPU8[$tint+2>>0]<<16)|(HEAPU8[$tint+3>>0]<<24); + HEAP32[$17>>2] = $18; + dest=$$byval_copy1; src=$model; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$$byval_copy2; src=$16; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$$byval_copy3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _rlglDrawMesh($$byval_copy1,$$byval_copy2,$$byval_copy3); + STACKTOP = sp;return; +} +function _TraceLog($msgType,$text,$varargs) { + $msgType = $msgType|0; + $text = $text|0; + $varargs = $varargs|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $args = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $args = sp; + switch ($msgType|0) { + case 0: { + $0 = HEAP32[6676>>2]|0; + (_fwrite(11267,6,1,$0)|0); + break; + } + case 1: { + $1 = HEAP32[6676>>2]|0; + (_fwrite(11274,7,1,$1)|0); + break; + } + case 2: { + $2 = HEAP32[6676>>2]|0; + (_fwrite(11282,9,1,$2)|0); + break; + } + case 3: { + STACKTOP = sp;return; + break; + } + default: { + } + } + HEAP32[$args>>2] = $varargs; + $3 = HEAP32[6676>>2]|0; + (_vfprintf($3,$text,$args)|0); + $4 = HEAP32[6676>>2]|0; + (_fputc(10,$4)|0); + $5 = ($msgType|0)==(1); + if ($5) { + _exit(1); + // unreachable; + } else { + STACKTOP = sp;return; + } +} +function _GetExtension($fileName) { + $fileName = $fileName|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_strrchr($fileName,46)|0); + $1 = ($0|0)==(0|0); + $2 = ($0|0)==($fileName|0); + $or$cond = $1 | $2; + $3 = ((($0)) + 1|0); + $$0 = $or$cond ? 12661 : $3; + return ($$0|0); +} +function _ProcessGestureEvent($event) { + $event = $event|0; + var $0 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0.0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; + var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0; + var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; + var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; + var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0.0, $183 = 0, $184 = 0.0, $185 = 0, $186 = 0.0, $187 = 0.0, $188 = 0.0; + var $189 = 0, $19 = 0, $190 = 0.0, $191 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; + var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; + var $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; + var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; + var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0.0, $98 = 0, $99 = 0.0, $moveDownPosition$byval_copy11 = 0, $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0; + var sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $moveDownPosition2$byval_copy12 = sp + 8|0; + $moveDownPosition$byval_copy11 = sp; + $0 = ((($event)) + 4|0); + $1 = HEAP32[$0>>2]|0; + HEAP32[5628>>2] = $1; + $2 = ($1|0)<(2); + $3 = HEAP32[$event>>2]|0; + $4 = ($3|0)==(1); + if (!($2)) { + if ($4) { + $105 = ((($event)) + 16|0); + $106 = $105; + $107 = $106; + $108 = HEAP32[$107>>2]|0; + $109 = (($106) + 4)|0; + $110 = $109; + $111 = HEAP32[$110>>2]|0; + $112 = 80; + $113 = $112; + HEAP32[$113>>2] = $108; + $114 = (($112) + 4)|0; + $115 = $114; + HEAP32[$115>>2] = $111; + $116 = ((($event)) + 24|0); + $117 = $116; + $118 = $117; + $119 = HEAP32[$118>>2]|0; + $120 = (($117) + 4)|0; + $121 = $120; + $122 = HEAP32[$121>>2]|0; + $123 = 120; + $124 = $123; + HEAP32[$124>>2] = $119; + $125 = (($123) + 4)|0; + $126 = $125; + HEAP32[$126>>2] = $122; + $127 = +HEAPF32[120>>2]; + $128 = +HEAPF32[80>>2]; + $129 = $127 - $128; + HEAPF32[128>>2] = $129; + $130 = +HEAPF32[(124)>>2]; + $131 = +HEAPF32[(84)>>2]; + $132 = $130 - $131; + HEAPF32[(132)>>2] = $132; + HEAP32[5624>>2] = 4; + STACKTOP = sp;return; + } + switch ($3|0) { + case 2: { + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; + $133 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + HEAPF32[5656>>2] = $133; + $134 = 112; + $135 = $134; + $136 = HEAP32[$135>>2]|0; + $137 = (($134) + 4)|0; + $138 = $137; + $139 = HEAP32[$138>>2]|0; + $140 = 80; + $141 = $140; + HEAP32[$141>>2] = $136; + $142 = (($140) + 4)|0; + $143 = $142; + HEAP32[$143>>2] = $139; + $144 = 136; + $145 = $144; + $146 = HEAP32[$145>>2]|0; + $147 = (($144) + 4)|0; + $148 = $147; + $149 = HEAP32[$148>>2]|0; + $150 = 120; + $151 = $150; + HEAP32[$151>>2] = $146; + $152 = (($150) + 4)|0; + $153 = $152; + HEAP32[$153>>2] = $149; + $154 = ((($event)) + 16|0); + $155 = $154; + $156 = $155; + $157 = HEAP32[$156>>2]|0; + $158 = (($155) + 4)|0; + $159 = $158; + $160 = HEAP32[$159>>2]|0; + $161 = 112; + $162 = $161; + HEAP32[$162>>2] = $157; + $163 = (($161) + 4)|0; + $164 = $163; + HEAP32[$164>>2] = $160; + $165 = ((($event)) + 24|0); + $166 = $165; + $167 = $166; + $168 = HEAP32[$167>>2]|0; + $169 = (($166) + 4)|0; + $170 = $169; + $171 = HEAP32[$170>>2]|0; + $172 = 136; + $173 = $172; + HEAP32[$173>>2] = $168; + $174 = (($172) + 4)|0; + $175 = $174; + HEAP32[$175>>2] = $171; + $176 = +HEAPF32[136>>2]; + $177 = +HEAPF32[112>>2]; + $178 = $176 - $177; + HEAPF32[128>>2] = $178; + $179 = +HEAPF32[(140)>>2]; + $180 = +HEAPF32[(116)>>2]; + $181 = $179 - $180; + HEAPF32[(132)>>2] = $181; + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0; + $182 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $183 = !($182 >= 0.004999999888241291); + if ($183) { + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[120>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[120+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; + $184 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $185 = !($184 >= 0.004999999888241291); + if ($185) { + HEAP32[5624>>2] = 4; + } else { + label = 37; + } + } else { + label = 37; + } + do { + if ((label|0) == 37) { + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; + $186 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $187 = +HEAPF32[5656>>2]; + $188 = $186 - $187; + $189 = $188 < 0.0; + if ($189) { + HEAP32[5624>>2] = 256; + break; + } else { + HEAP32[5624>>2] = 512; + break; + } + } + } while(0); + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[112+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[136>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[136+4>>2]|0; + $190 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $191 = 360.0 - $190; + HEAPF32[5660>>2] = $191; + STACKTOP = sp;return; + break; + } + case 0: { + HEAPF32[5656>>2] = 0.0; + HEAPF32[5660>>2] = 0.0; + HEAPF32[128>>2] = 0.0; + HEAPF32[(132)>>2] = 0.0; + HEAP32[5628>>2] = 0; + HEAP32[5624>>2] = 0; + STACKTOP = sp;return; + break; + } + default: { + STACKTOP = sp;return; + } + } + } + if ($4) { + $5 = HEAP32[5632>>2]|0; + $6 = (($5) + 1)|0; + HEAP32[5632>>2] = $6; + $7 = HEAP32[5624>>2]|0; + $8 = ($7|0)==(0); + $9 = ($5|0)>(0); + $or$cond = $9 & $8; + if ($or$cond) { + $10 = ((($event)) + 16|0); + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$10>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$10+4>>2]|0; + $11 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $12 = $11 < 0.029999999329447746; + if ($12) { + HEAP32[5624>>2] = 2; + HEAP32[5632>>2] = 0; + } else { + label = 6; + } + } else { + label = 6; + } + if ((label|0) == 6) { + HEAP32[5632>>2] = 1; + HEAP32[5624>>2] = 1; + } + $13 = ((($event)) + 16|0); + $14 = $13; + $15 = $14; + $16 = HEAP32[$15>>2]|0; + $17 = (($14) + 4)|0; + $18 = $17; + $19 = HEAP32[$18>>2]|0; + $20 = 80; + $21 = $20; + HEAP32[$21>>2] = $16; + $22 = (($20) + 4)|0; + $23 = $22; + HEAP32[$23>>2] = $19; + $24 = $13; + $25 = $24; + $26 = HEAP32[$25>>2]|0; + $27 = (($24) + 4)|0; + $28 = $27; + $29 = HEAP32[$28>>2]|0; + $30 = 88; + $31 = $30; + HEAP32[$31>>2] = $26; + $32 = (($30) + 4)|0; + $33 = $32; + HEAP32[$33>>2] = $29; + $34 = 96; + $35 = $34; + HEAP32[$35>>2] = $16; + $36 = (($34) + 4)|0; + $37 = $36; + HEAP32[$37>>2] = $19; + $38 = ((($event)) + 8|0); + $39 = HEAP32[$38>>2]|0; + HEAP32[5636>>2] = $39; + HEAPF32[104>>2] = 0.0; + HEAPF32[(108)>>2] = 0.0; + STACKTOP = sp;return; + } + switch ($3|0) { + case 0: { + $40 = HEAP32[5624>>2]|0; + $41 = ($40|0)==(8); + if ($41) { + $42 = ((($event)) + 16|0); + $43 = $42; + $44 = $43; + $45 = HEAP32[$44>>2]|0; + $46 = (($43) + 4)|0; + $47 = $46; + $48 = HEAP32[$47>>2]|0; + $49 = 96; + $50 = $49; + HEAP32[$50>>2] = $45; + $51 = (($49) + 4)|0; + $52 = $51; + HEAP32[$52>>2] = $48; + } + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0; + $53 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $54 = $53 / 0.0; + HEAPF32[5640>>2] = $54; + HEAP32[5644>>2] = 0; + $55 = $54 > 5.0000002374872565E-4; + do { + if ($55) { + $56 = HEAP32[5636>>2]|0; + $57 = ((($event)) + 8|0); + $58 = HEAP32[$57>>2]|0; + $59 = ($56|0)==($58|0); + if ($59) { + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[96>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[96+4>>2]|0; + $60 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $61 = 360.0 - $60; + HEAPF32[5648>>2] = $61; + $62 = $61 < 30.0; + $63 = $61 > 330.0; + $or$cond3 = $62 | $63; + if ($or$cond3) { + HEAP32[5624>>2] = 16; + break; + } + $64 = $61 > 30.0; + $65 = $61 < 120.0; + $or$cond5 = $64 & $65; + if ($or$cond5) { + HEAP32[5624>>2] = 64; + break; + } + $66 = $61 > 120.0; + $67 = $61 < 210.0; + $or$cond7 = $66 & $67; + if ($or$cond7) { + HEAP32[5624>>2] = 32; + break; + } + $68 = $61 > 210.0; + $69 = $61 < 300.0; + $or$cond9 = $68 & $69; + if ($or$cond9) { + HEAP32[5624>>2] = 128; + break; + } else { + HEAP32[5624>>2] = 0; + break; + } + } else { + label = 22; + } + } else { + label = 22; + } + } while(0); + if ((label|0) == 22) { + HEAPF32[5640>>2] = 0.0; + HEAPF32[5648>>2] = 0.0; + HEAP32[5624>>2] = 0; + } + HEAPF32[88>>2] = 0.0; + HEAPF32[(92)>>2] = 0.0; + HEAP32[5628>>2] = 0; + STACKTOP = sp;return; + break; + } + case 2: { + $70 = HEAP32[5644>>2]|0; + $71 = ($70|0)==(0); + if ($71) { + HEAP32[5644>>2] = 1; + } + $72 = ((($event)) + 16|0); + $73 = $72; + $74 = $73; + $75 = HEAP32[$74>>2]|0; + $76 = (($73) + 4)|0; + $77 = $76; + $78 = HEAP32[$77>>2]|0; + $79 = 112; + $80 = $79; + HEAP32[$80>>2] = $75; + $81 = (($79) + 4)|0; + $82 = $81; + HEAP32[$82>>2] = $78; + $83 = HEAP32[5624>>2]|0; + $84 = ($83|0)==(4); + if ($84) { + $85 = HEAP32[5652>>2]|0; + $86 = ($85|0)==(1); + if ($86) { + $87 = $72; + $88 = $87; + $89 = HEAP32[$88>>2]|0; + $90 = (($87) + 4)|0; + $91 = $90; + $92 = HEAP32[$91>>2]|0; + $93 = 80; + $94 = $93; + HEAP32[$94>>2] = $89; + $95 = (($93) + 4)|0; + $96 = $95; + HEAP32[$96>>2] = $92; + } + HEAP32[5652>>2] = 2; + ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[80>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[80+4>>2]|0; + ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[112>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[112+4>>2]|0; + $97 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12)); + $98 = !($97 >= 0.014999999664723873); + if (!($98)) { + HEAP32[5624>>2] = 8; + } + } + $99 = +HEAPF32[112>>2]; + $100 = +HEAPF32[88>>2]; + $101 = $99 - $100; + HEAPF32[104>>2] = $101; + $102 = +HEAPF32[(116)>>2]; + $103 = +HEAPF32[(92)>>2]; + $104 = $102 - $103; + HEAPF32[(108)>>2] = $104; + STACKTOP = sp;return; + break; + } + default: { + STACKTOP = sp;return; + } + } +} +function _UpdateGestures() { + var $$off = 0, $$pr = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $or$cond3 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[5624>>2]|0; + $$off = (($0) + -1)|0; + $1 = ($$off>>>0)<(2); + $2 = HEAP32[5628>>2]|0; + $3 = ($2|0)<(2); + $or$cond3 = $1 & $3; + if ($or$cond3) { + HEAP32[5624>>2] = 4; + return; + } + $$pr = HEAP32[5624>>2]|0; + switch ($$pr|0) { + case 16: case 32: case 64: case 128: { + break; + } + default: { + return; + } + } + HEAP32[5624>>2] = 0; + return; +} +function _InitGraphicsDevice($width,$height) { + $width = $width|0; + $height = $height|0; + var $$byval_copy = 0, $$lcssa = 0, $$lcssa12 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; + var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; + var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; + var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; + var $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $count = 0, $i$02 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer3 = 0, $vararg_buffer6 = 0; + var $vararg_buffer8 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 144|0; + $$byval_copy = sp + 140|0; + $vararg_buffer22 = sp + 64|0; + $vararg_buffer18 = sp + 56|0; + $vararg_buffer14 = sp + 48|0; + $vararg_buffer10 = sp + 40|0; + $vararg_buffer8 = sp + 32|0; + $vararg_buffer6 = sp + 24|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $0 = sp + 72|0; + $count = sp + 68|0; + $1 = sp + 136|0; + HEAP32[492>>2] = $width; + HEAP32[496>>2] = $height; + _MatrixIdentity($0); + dest=512; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + (_glfwSetErrorCallback((2|0))|0); + $2 = (_glfwInit()|0); + $3 = ($2|0)==(0); + if ($3) { + _TraceLog(1,17116,$vararg_buffer); + } + $4 = HEAP32[492>>2]|0; + HEAP32[656>>2] = $4; + $5 = HEAP32[496>>2]|0; + HEAP32[660>>2] = $5; + _glfwDefaultWindowHints(); + _glfwWindowHint(131075,0); + $6 = HEAP8[7695>>0]|0; + $7 = $6 & 16; + $8 = ($7<<24>>24)==(0); + if (!($8)) { + _glfwWindowHint(135181,4); + _TraceLog(0,17142,$vararg_buffer1); + } + $9 = (_rlGetVersion()|0); + $10 = ($9|0)==(2); + if ($10) { + _glfwWindowHint(139266,2); + _glfwWindowHint(139267,1); + } else { + $11 = (_rlGetVersion()|0); + $12 = ($11|0)==(3); + if ($12) { + _glfwWindowHint(139266,3); + _glfwWindowHint(139267,3); + _glfwWindowHint(139272,204801); + _glfwWindowHint(139270,0); + } + } + $13 = HEAP32[640>>2]|0; + $14 = ($13|0)==(0); + if ($14) { + $40 = HEAP32[492>>2]|0; + $41 = HEAP32[496>>2]|0; + $42 = HEAP32[488>>2]|0; + $43 = (_glfwCreateWindow(($40|0),($41|0),($42|0),(0|0),(0|0))|0); + HEAP32[504>>2] = $43; + $44 = HEAP32[492>>2]|0; + HEAP32[672>>2] = $44; + $45 = HEAP32[496>>2]|0; + HEAP32[676>>2] = $45; + $46 = $43; + } else { + $15 = (_glfwGetPrimaryMonitor()|0); + $16 = (_glfwGetVideoModes(($15|0),($count|0))|0); + $17 = HEAP32[$count>>2]|0; + $18 = ($17|0)>(0); + L15: do { + if ($18) { + $19 = HEAP32[492>>2]|0; + $20 = HEAP32[$count>>2]|0; + $21 = HEAP32[496>>2]|0; + $i$02 = 0; + while(1) { + $22 = (($16) + (($i$02*24)|0)|0); + $23 = HEAP32[$22>>2]|0; + $24 = ($23|0)<($19|0); + if (!($24)) { + $25 = (((($16) + (($i$02*24)|0)|0)) + 4|0); + $26 = HEAP32[$25>>2]|0; + $27 = ($26|0)<($21|0); + if (!($27)) { + $$lcssa = $23;$$lcssa12 = $25; + break; + } + } + $29 = (($i$02) + 1)|0; + $30 = ($29|0)<($20|0); + if ($30) { + $i$02 = $29; + } else { + break L15; + } + } + HEAP32[656>>2] = $$lcssa; + $28 = HEAP32[$$lcssa12>>2]|0; + HEAP32[660>>2] = $28; + } + } while(0); + $31 = HEAP32[656>>2]|0; + $32 = HEAP32[660>>2]|0; + HEAP32[$vararg_buffer3>>2] = $31; + $vararg_ptr5 = ((($vararg_buffer3)) + 4|0); + HEAP32[$vararg_ptr5>>2] = $32; + _TraceLog(2,17167,$vararg_buffer3); + $33 = HEAP32[656>>2]|0; + $34 = HEAP32[660>>2]|0; + _SetupFramebufferSize($33,$34); + $35 = HEAP32[656>>2]|0; + $36 = HEAP32[660>>2]|0; + $37 = HEAP32[488>>2]|0; + $38 = (_glfwGetPrimaryMonitor()|0); + $39 = (_glfwCreateWindow(($35|0),($36|0),($37|0),($38|0),(0|0))|0); + HEAP32[504>>2] = $39; + $46 = $39; + } + $47 = ($46|0)==(0|0); + if ($47) { + _glfwTerminate(); + _TraceLog(1,17205,$vararg_buffer6); + } else { + _TraceLog(0,17238,$vararg_buffer8); + $48 = HEAP32[672>>2]|0; + $49 = HEAP32[676>>2]|0; + HEAP32[$vararg_buffer10>>2] = $48; + $vararg_ptr13 = ((($vararg_buffer10)) + 4|0); + HEAP32[$vararg_ptr13>>2] = $49; + _TraceLog(0,17278,$vararg_buffer10); + $50 = HEAP32[492>>2]|0; + $51 = HEAP32[496>>2]|0; + HEAP32[$vararg_buffer14>>2] = $50; + $vararg_ptr17 = ((($vararg_buffer14)) + 4|0); + HEAP32[$vararg_ptr17>>2] = $51; + _TraceLog(0,17299,$vararg_buffer14); + $52 = HEAP32[664>>2]|0; + $53 = HEAP32[668>>2]|0; + HEAP32[$vararg_buffer18>>2] = $52; + $vararg_ptr21 = ((($vararg_buffer18)) + 4|0); + HEAP32[$vararg_ptr21>>2] = $53; + _TraceLog(0,17320,$vararg_buffer18); + } + $54 = HEAP32[504>>2]|0; + (_glfwSetWindowSizeCallback(($54|0),(1|0))|0); + $55 = HEAP32[504>>2]|0; + (_glfwSetCursorEnterCallback(($55|0),(3|0))|0); + $56 = HEAP32[504>>2]|0; + (_glfwSetKeyCallback(($56|0),(1|0))|0); + $57 = HEAP32[504>>2]|0; + (_glfwSetMouseButtonCallback(($57|0),(1|0))|0); + $58 = HEAP32[504>>2]|0; + (_glfwSetCursorPosCallback(($58|0),(1|0))|0); + $59 = HEAP32[504>>2]|0; + (_glfwSetCharCallback(($59|0),(4|0))|0); + $60 = HEAP32[504>>2]|0; + (_glfwSetScrollCallback(($60|0),(2|0))|0); + $61 = HEAP32[504>>2]|0; + (_glfwSetWindowIconifyCallback(($61|0),(5|0))|0); + $62 = HEAP32[504>>2]|0; + _glfwMakeContextCurrent(($62|0)); + _glfwSwapInterval(0); + $63 = HEAP8[7695>>0]|0; + $64 = $63 & 32; + $65 = ($64<<24>>24)==(0); + if ($65) { + $66 = HEAP32[492>>2]|0; + $67 = HEAP32[496>>2]|0; + _rlglInit($66,$67); + $68 = HEAP32[664>>2]|0; + $69 = (($68|0) / 2)&-1; + $70 = HEAP32[668>>2]|0; + $71 = (($70|0) / 2)&-1; + $72 = HEAP32[672>>2]|0; + $73 = (($72) - ($68))|0; + $74 = HEAP32[676>>2]|0; + $75 = (($74) - ($70))|0; + _rlViewport($69,$71,$73,$75); + _rlMatrixMode(0); + _rlLoadIdentity(); + $76 = HEAP32[672>>2]|0; + $77 = HEAP32[664>>2]|0; + $78 = (($76) - ($77))|0; + $79 = (+($78|0)); + $80 = HEAP32[676>>2]|0; + $81 = HEAP32[668>>2]|0; + $82 = (($80) - ($81))|0; + $83 = (+($82|0)); + _rlOrtho(0.0,$79,$83,0.0,0.0,1.0); + _rlMatrixMode(1); + _rlLoadIdentity(); + HEAP8[$1>>0] = -11; + $84 = ((($1)) + 1|0); + HEAP8[$84>>0] = -11; + $85 = ((($1)) + 2|0); + HEAP8[$85>>0] = -11; + $86 = ((($1)) + 3|0); + HEAP8[$86>>0] = -1; + ;HEAP8[$$byval_copy>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$1+3>>0]|0; + _ClearBackground($$byval_copy); + STACKTOP = sp;return; + } + _glfwSwapInterval(1); + _TraceLog(0,17345,$vararg_buffer22); + $66 = HEAP32[492>>2]|0; + $67 = HEAP32[496>>2]|0; + _rlglInit($66,$67); + $68 = HEAP32[664>>2]|0; + $69 = (($68|0) / 2)&-1; + $70 = HEAP32[668>>2]|0; + $71 = (($70|0) / 2)&-1; + $72 = HEAP32[672>>2]|0; + $73 = (($72) - ($68))|0; + $74 = HEAP32[676>>2]|0; + $75 = (($74) - ($70))|0; + _rlViewport($69,$71,$73,$75); + _rlMatrixMode(0); + _rlLoadIdentity(); + $76 = HEAP32[672>>2]|0; + $77 = HEAP32[664>>2]|0; + $78 = (($76) - ($77))|0; + $79 = (+($78|0)); + $80 = HEAP32[676>>2]|0; + $81 = HEAP32[668>>2]|0; + $82 = (($80) - ($81))|0; + $83 = (+($82|0)); + _rlOrtho(0.0,$79,$83,0.0,0.0,1.0); + _rlMatrixMode(1); + _rlLoadIdentity(); + HEAP8[$1>>0] = -11; + $84 = ((($1)) + 1|0); + HEAP8[$84>>0] = -11; + $85 = ((($1)) + 2|0); + HEAP8[$85>>0] = -11; + $86 = ((($1)) + 3|0); + HEAP8[$86>>0] = -1; + ;HEAP8[$$byval_copy>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$1+3>>0]|0; + _ClearBackground($$byval_copy); + STACKTOP = sp;return; +} +function _InitTimer() { + var $0 = 0, $1 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_time((0|0))|0); + _srand($0); + $1 = (+_GetTime()); + HEAPF64[32>>3] = $1; + return; +} +function _EmscriptenFullscreenChangeCallback($eventType,$e,$userData) { + $eventType = $eventType|0; + $e = $e|0; + $userData = $userData|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer = sp; + $0 = HEAP32[$e>>2]|0; + $1 = ($0|0)==(0); + $2 = ((($e)) + 264|0); + $3 = HEAP32[$2>>2]|0; + $4 = ((($e)) + 268|0); + $5 = HEAP32[$4>>2]|0; + $6 = ((($e)) + 272|0); + $7 = HEAP32[$6>>2]|0; + $8 = ((($e)) + 276|0); + $9 = HEAP32[$8>>2]|0; + if ($1) { + HEAP32[$vararg_buffer4>>2] = $3; + $vararg_ptr7 = ((($vararg_buffer4)) + 4|0); + HEAP32[$vararg_ptr7>>2] = $5; + $vararg_ptr8 = ((($vararg_buffer4)) + 8|0); + HEAP32[$vararg_ptr8>>2] = $7; + $vararg_ptr9 = ((($vararg_buffer4)) + 12|0); + HEAP32[$vararg_ptr9>>2] = $9; + _TraceLog(0,17049,$vararg_buffer4); + STACKTOP = sp;return 0; + } else { + HEAP32[$vararg_buffer>>2] = $3; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $5; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = $7; + $vararg_ptr3 = ((($vararg_buffer)) + 12|0); + HEAP32[$vararg_ptr3>>2] = $9; + _TraceLog(0,16980,$vararg_buffer); + STACKTOP = sp;return 0; + } + return (0)|0; +} +function _EmscriptenInputCallback($eventType,$touchEvent,$userData) { + $eventType = $eventType|0; + $touchEvent = $touchEvent|0; + $userData = $userData|0; + var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $7 = 0; + var $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $gestureEvent$byval_copy = sp + 32|0; + $gestureEvent = sp; + switch ($eventType|0) { + case 22: { + HEAP32[$gestureEvent>>2] = 1; + break; + } + case 23: { + HEAP32[$gestureEvent>>2] = 0; + break; + } + case 24: { + HEAP32[$gestureEvent>>2] = 2; + break; + } + default: { + } + } + $0 = HEAP32[$touchEvent>>2]|0; + $1 = ((($gestureEvent)) + 4|0); + HEAP32[$1>>2] = $0; + $2 = ((($touchEvent)) + 20|0); + $3 = HEAP32[$2>>2]|0; + $4 = ((($gestureEvent)) + 8|0); + HEAP32[$4>>2] = $3; + $5 = ((($touchEvent)) + 72|0); + $6 = HEAP32[$5>>2]|0; + $7 = ((($gestureEvent)) + 12|0); + HEAP32[$7>>2] = $6; + $8 = ((($touchEvent)) + 56|0); + $9 = HEAP32[$8>>2]|0; + $10 = (+($9|0)); + $11 = ((($touchEvent)) + 60|0); + $12 = HEAP32[$11>>2]|0; + $13 = (+($12|0)); + $14 = ((($gestureEvent)) + 16|0); + HEAPF32[$14>>2] = $10; + $15 = ((($gestureEvent)) + 20|0); + HEAPF32[$15>>2] = $13; + $16 = ((($touchEvent)) + 108|0); + $17 = HEAP32[$16>>2]|0; + $18 = (+($17|0)); + $19 = ((($touchEvent)) + 112|0); + $20 = HEAP32[$19>>2]|0; + $21 = (+($20|0)); + $22 = ((($gestureEvent)) + 24|0); + HEAPF32[$22>>2] = $18; + $23 = ((($gestureEvent)) + 28|0); + HEAPF32[$23>>2] = $21; + $24 = ((($gestureEvent)) + 16|0); + $25 = $24; + $26 = $25; + $27 = HEAP32[$26>>2]|0; + $28 = (($25) + 4)|0; + $29 = $28; + $30 = HEAP32[$29>>2]|0; + $31 = 64; + $32 = $31; + HEAP32[$32>>2] = $27; + $33 = (($31) + 4)|0; + $34 = $33; + HEAP32[$34>>2] = $30; + $35 = ((($gestureEvent)) + 24|0); + $36 = $35; + $37 = $36; + $38 = HEAP32[$37>>2]|0; + $39 = (($36) + 4)|0; + $40 = $39; + $41 = HEAP32[$40>>2]|0; + $42 = (72); + $43 = $42; + HEAP32[$43>>2] = $38; + $44 = (($42) + 4)|0; + $45 = $44; + HEAP32[$45>>2] = $41; + $46 = (_GetScreenWidth()|0); + $47 = (+($46|0)); + $48 = +HEAPF32[$24>>2]; + $49 = $48 / $47; + HEAPF32[$24>>2] = $49; + $50 = (_GetScreenHeight()|0); + $51 = (+($50|0)); + $52 = +HEAPF32[$15>>2]; + $53 = $52 / $51; + HEAPF32[$15>>2] = $53; + $54 = (_GetScreenWidth()|0); + $55 = (+($54|0)); + $56 = +HEAPF32[$35>>2]; + $57 = $56 / $55; + HEAPF32[$35>>2] = $57; + $58 = (_GetScreenHeight()|0); + $59 = (+($58|0)); + $60 = +HEAPF32[$23>>2]; + $61 = $60 / $59; + HEAPF32[$23>>2] = $61; + ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0; + _ProcessGestureEvent($gestureEvent$byval_copy); + STACKTOP = sp;return 1; +} +function _LogoAnimation() { + var label = 0, sp = 0; + sp = STACKTOP; + HEAP32[500>>2] = 0; + return; +} +function _GetTime() { + var $0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (+_glfwGetTime()); + return (+$0); +} +function _SwapBuffers() { + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[504>>2]|0; + _glfwSwapBuffers(($0|0)); + return; +} +function _PollInputEvents() { + var $0 = 0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $mouseX = 0, $mouseY = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $mouseX = sp + 8|0; + $mouseY = sp; + _UpdateGestures(); + $0 = HEAP32[504>>2]|0; + _glfwGetCursorPos(($0|0),($mouseX|0),($mouseY|0)); + $1 = +HEAPF64[$mouseX>>3]; + $2 = $1; + HEAPF32[8>>2] = $2; + $3 = +HEAPF64[$mouseY>>3]; + $4 = $3; + HEAPF32[(12)>>2] = $4; + HEAP32[644>>2] = -1; + _memcpy((8208|0),(7696|0),512)|0; + ;HEAP8[8723>>0]=HEAP8[8720>>0]|0;HEAP8[8723+1>>0]=HEAP8[8720+1>>0]|0;HEAP8[8723+2>>0]=HEAP8[8720+2>>0]|0; + $5 = HEAP32[6424>>2]|0; + HEAP32[652>>2] = $5; + HEAP32[6424>>2] = 0; + _glfwPollEvents(); + STACKTOP = sp;return; +} +function _LoadDefaultShader($agg$result) { + $agg$result = $agg$result|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $fDefaultShaderStr = 0, $shader = 0, $vDefaultShaderStr = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 1008|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $shader = sp + 16|0; + $vDefaultShaderStr = sp + 505|0; + $fDefaultShaderStr = sp + 64|0; + _memcpy(($vDefaultShaderStr|0),(15954|0),489)|0; + _memcpy(($fDefaultShaderStr|0),(16443|0),441)|0; + $0 = (_LoadShaderProgram($vDefaultShaderStr,$fDefaultShaderStr)|0); + HEAP32[$shader>>2] = $0; + $1 = ($0|0)==(0); + if ($1) { + HEAP32[$vararg_buffer1>>2] = $0; + _TraceLog(2,16932,$vararg_buffer1); + } else { + HEAP32[$vararg_buffer>>2] = $0; + _TraceLog(0,16884,$vararg_buffer); + } + $2 = HEAP32[$shader>>2]|0; + $3 = ($2|0)==(0); + if (!($3)) { + _LoadDefaultShaderLocations($shader); + } + dest=$agg$result; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _LoadDefaultBuffers() { + var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; + var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; + var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; + var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0; + var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0; + var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond14 = 0, $exitcond17 = 0, $exitcond19 = 0, $i1$012 = 0, $i3$010 = 0, $i6$07 = 0, $i7$06 = 0, $k$05 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0; + var $vararg_buffer14 = 0, $vararg_buffer17 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr6 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $vararg_buffer17 = sp + 48|0; + $vararg_buffer14 = sp + 40|0; + $vararg_buffer10 = sp + 32|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $0 = (_malloc(24576)|0); + HEAP32[(1872)>>2] = $0; + $1 = (_malloc(8192)|0); + HEAP32[(1880)>>2] = $1; + HEAP32[(1876)>>2] = 0; + HEAP32[(1884)>>2] = 0; + $2 = HEAP32[(1872)>>2]|0; + _memset(($2|0),0,24576)|0; + $i1$012 = 0; + while(1) { + $3 = HEAP32[(1880)>>2]|0; + $4 = (($3) + ($i1$012)|0); + HEAP8[$4>>0] = 0; + $5 = (($i1$012) + 1)|0; + $exitcond19 = ($5|0)==(8192); + if ($exitcond19) { + break; + } else { + $i1$012 = $5; + } + } + HEAP32[1860>>2] = 0; + HEAP32[(1868)>>2] = 0; + HEAP32[(1864)>>2] = 0; + $6 = (_malloc(73728)|0); + HEAP32[(1920)>>2] = $6; + $7 = (_malloc(24576)|0); + HEAP32[(1928)>>2] = $7; + HEAP32[(1924)>>2] = 0; + HEAP32[(1932)>>2] = 0; + $8 = HEAP32[(1920)>>2]|0; + _memset(($8|0),0,73728)|0; + $i3$010 = 0; + while(1) { + $9 = HEAP32[(1928)>>2]|0; + $10 = (($9) + ($i3$010)|0); + HEAP8[$10>>0] = 0; + $11 = (($i3$010) + 1)|0; + $exitcond17 = ($11|0)==(24576); + if ($exitcond17) { + break; + } else { + $i3$010 = $11; + } + } + HEAP32[1908>>2] = 0; + HEAP32[(1916)>>2] = 0; + HEAP32[(1912)>>2] = 0; + $12 = (_malloc(49152)|0); + HEAP32[(1968)>>2] = $12; + $13 = (_malloc(32768)|0); + HEAP32[(1972)>>2] = $13; + $14 = (_malloc(16384)|0); + HEAP32[(1976)>>2] = $14; + $15 = (_malloc(12288)|0); + HEAP32[(1980)>>2] = $15; + $16 = HEAP32[(1968)>>2]|0; + _memset(($16|0),0,49152)|0; + $17 = HEAP32[(1972)>>2]|0; + _memset(($17|0),0,32768)|0; + $i6$07 = 0; + while(1) { + $19 = HEAP32[(1976)>>2]|0; + $20 = (($19) + ($i6$07)|0); + HEAP8[$20>>0] = 0; + $21 = (($i6$07) + 1)|0; + $exitcond14 = ($21|0)==(16384); + if ($exitcond14) { + break; + } else { + $i6$07 = $21; + } + } + $18 = HEAP32[(1980)>>2]|0; + $i7$06 = 0;$k$05 = 0; + while(1) { + $22 = $k$05 << 2; + $23 = $22&65535; + $24 = (($18) + ($i7$06<<1)|0); + HEAP16[$24>>1] = $23; + $25 = $22 | 1; + $26 = $25&65535; + $27 = $i7$06 | 1; + $28 = (($18) + ($27<<1)|0); + HEAP16[$28>>1] = $26; + $29 = $22 | 2; + $30 = $29&65535; + $31 = (($i7$06) + 2)|0; + $32 = (($18) + ($31<<1)|0); + HEAP16[$32>>1] = $30; + $33 = (($i7$06) + 3)|0; + $34 = (($18) + ($33<<1)|0); + HEAP16[$34>>1] = $23; + $35 = (($i7$06) + 4)|0; + $36 = (($18) + ($35<<1)|0); + HEAP16[$36>>1] = $30; + $37 = $22 | 3; + $38 = $37&65535; + $39 = (($i7$06) + 5)|0; + $40 = (($18) + ($39<<1)|0); + HEAP16[$40>>1] = $38; + $41 = (($k$05) + 1)|0; + $42 = (($i7$06) + 6)|0; + $exitcond = ($41|0)==(1024); + if ($exitcond) { + break; + } else { + $i7$06 = $42;$k$05 = $41; + } + } + HEAP32[1956>>2] = 0; + HEAP32[(1960)>>2] = 0; + HEAP32[(1964)>>2] = 0; + _TraceLog(0,15425,$vararg_buffer); + $43 = HEAP32[2016>>2]|0; + $44 = ($43|0)==(0); + if (!($44)) { + $45 = HEAP32[2024>>2]|0; + FUNCTION_TABLE_vii[$45 & 63](1,(1888)); + $46 = HEAP32[2028>>2]|0; + $47 = HEAP32[(1888)>>2]|0; + FUNCTION_TABLE_vi[$46 & 31]($47); + } + _glGenBuffers(2,((1892)|0)); + $48 = HEAP32[(1892)>>2]|0; + _glBindBuffer(34962,($48|0)); + $49 = HEAP32[(1872)>>2]|0; + _glBufferData(34962,24576,($49|0),35048); + $50 = HEAP32[(2112)>>2]|0; + _glEnableVertexAttribArray(($50|0)); + $51 = HEAP32[(2112)>>2]|0; + _glVertexAttribPointer(($51|0),3,5126,0,0,(0|0)); + _glGenBuffers(2,((1896)|0)); + $52 = HEAP32[(1896)>>2]|0; + _glBindBuffer(34962,($52|0)); + $53 = HEAP32[(1880)>>2]|0; + _glBufferData(34962,8192,($53|0),35048); + $54 = HEAP32[(2132)>>2]|0; + _glEnableVertexAttribArray(($54|0)); + $55 = HEAP32[(2132)>>2]|0; + _glVertexAttribPointer(($55|0),4,5121,1,0,(0|0)); + $56 = HEAP32[2016>>2]|0; + $57 = ($56|0)==(0); + if ($57) { + $59 = HEAP32[(1892)>>2]|0; + $60 = HEAP32[(1896)>>2]|0; + HEAP32[$vararg_buffer3>>2] = $59; + $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); + HEAP32[$vararg_ptr6>>2] = $60; + _TraceLog(0,15563,$vararg_buffer3); + } else { + $58 = HEAP32[(1888)>>2]|0; + HEAP32[$vararg_buffer1>>2] = $58; + _TraceLog(0,15498,$vararg_buffer1); + } + $61 = HEAP32[2016>>2]|0; + $62 = ($61|0)==(0); + if (!($62)) { + $63 = HEAP32[2024>>2]|0; + FUNCTION_TABLE_vii[$63 & 63](1,(1936)); + $64 = HEAP32[2028>>2]|0; + $65 = HEAP32[(1936)>>2]|0; + FUNCTION_TABLE_vi[$64 & 31]($65); + } + _glGenBuffers(1,((1940)|0)); + $66 = HEAP32[(1940)>>2]|0; + _glBindBuffer(34962,($66|0)); + $67 = HEAP32[(1920)>>2]|0; + _glBufferData(34962,73728,($67|0),35048); + $68 = HEAP32[(2112)>>2]|0; + _glEnableVertexAttribArray(($68|0)); + $69 = HEAP32[(2112)>>2]|0; + _glVertexAttribPointer(($69|0),3,5126,0,0,(0|0)); + _glGenBuffers(1,((1944)|0)); + $70 = HEAP32[(1944)>>2]|0; + _glBindBuffer(34962,($70|0)); + $71 = HEAP32[(1928)>>2]|0; + _glBufferData(34962,24576,($71|0),35048); + $72 = HEAP32[(2132)>>2]|0; + _glEnableVertexAttribArray(($72|0)); + $73 = HEAP32[(2132)>>2]|0; + _glVertexAttribPointer(($73|0),4,5121,1,0,(0|0)); + $74 = HEAP32[2016>>2]|0; + $75 = ($74|0)==(0); + if ($75) { + $77 = HEAP32[(1940)>>2]|0; + $78 = HEAP32[(1944)>>2]|0; + HEAP32[$vararg_buffer10>>2] = $77; + $vararg_ptr13 = ((($vararg_buffer10)) + 4|0); + HEAP32[$vararg_ptr13>>2] = $78; + _TraceLog(0,15709,$vararg_buffer10); + } else { + $76 = HEAP32[(1936)>>2]|0; + HEAP32[$vararg_buffer7>>2] = $76; + _TraceLog(0,15640,$vararg_buffer7); + } + $79 = HEAP32[2016>>2]|0; + $80 = ($79|0)==(0); + if (!($80)) { + $81 = HEAP32[2024>>2]|0; + FUNCTION_TABLE_vii[$81 & 63](1,(1984)); + $82 = HEAP32[2028>>2]|0; + $83 = HEAP32[(1984)>>2]|0; + FUNCTION_TABLE_vi[$82 & 31]($83); + } + _glGenBuffers(1,((1988)|0)); + $84 = HEAP32[(1988)>>2]|0; + _glBindBuffer(34962,($84|0)); + $85 = HEAP32[(1968)>>2]|0; + _glBufferData(34962,49152,($85|0),35048); + $86 = HEAP32[(2112)>>2]|0; + _glEnableVertexAttribArray(($86|0)); + $87 = HEAP32[(2112)>>2]|0; + _glVertexAttribPointer(($87|0),3,5126,0,0,(0|0)); + _glGenBuffers(1,((1992)|0)); + $88 = HEAP32[(1992)>>2]|0; + _glBindBuffer(34962,($88|0)); + $89 = HEAP32[(1972)>>2]|0; + _glBufferData(34962,32768,($89|0),35048); + $90 = HEAP32[(2116)>>2]|0; + _glEnableVertexAttribArray(($90|0)); + $91 = HEAP32[(2116)>>2]|0; + _glVertexAttribPointer(($91|0),2,5126,0,0,(0|0)); + _glGenBuffers(1,((1996)|0)); + $92 = HEAP32[(1996)>>2]|0; + _glBindBuffer(34962,($92|0)); + $93 = HEAP32[(1976)>>2]|0; + _glBufferData(34962,16384,($93|0),35048); + $94 = HEAP32[(2132)>>2]|0; + _glEnableVertexAttribArray(($94|0)); + $95 = HEAP32[(2132)>>2]|0; + _glVertexAttribPointer(($95|0),4,5121,1,0,(0|0)); + _glGenBuffers(1,((2000)|0)); + $96 = HEAP32[(2000)>>2]|0; + _glBindBuffer(34963,($96|0)); + $97 = HEAP32[(1980)>>2]|0; + _glBufferData(34963,12288,($97|0),35044); + $98 = HEAP32[2016>>2]|0; + $99 = ($98|0)==(0); + if ($99) { + $101 = HEAP32[(1988)>>2]|0; + $102 = HEAP32[(1992)>>2]|0; + $103 = HEAP32[(1996)>>2]|0; + $104 = HEAP32[(2000)>>2]|0; + HEAP32[$vararg_buffer17>>2] = $101; + $vararg_ptr20 = ((($vararg_buffer17)) + 4|0); + HEAP32[$vararg_ptr20>>2] = $102; + $vararg_ptr21 = ((($vararg_buffer17)) + 8|0); + HEAP32[$vararg_ptr21>>2] = $103; + $vararg_ptr22 = ((($vararg_buffer17)) + 12|0); + HEAP32[$vararg_ptr22>>2] = $104; + _TraceLog(0,15855,$vararg_buffer17); + } else { + $100 = HEAP32[(1984)>>2]|0; + HEAP32[$vararg_buffer14>>2] = $100; + _TraceLog(0,15790,$vararg_buffer14); + } + $105 = HEAP32[2016>>2]|0; + $106 = ($105|0)==(0); + if ($106) { + STACKTOP = sp;return; + } + $107 = HEAP32[2028>>2]|0; + FUNCTION_TABLE_vi[$107 & 31](0); + STACKTOP = sp;return; +} +function _LoadCompressedTexture($data,$width,$height,$mipmapCount,$compressedFormat) { + $data = $data|0; + $width = $width|0; + $height = $height|0; + $mipmapCount = $mipmapCount|0; + $compressedFormat = $compressedFormat|0; + var $$ = 0, $$013 = 0, $$0610 = 0, $$17 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, $blockSize$0 = 0, $level$012 = 0, $offset$011 = 0, $or$cond = 0, $or$cond9 = 0, label = 0, sp = 0; + sp = STACKTOP; + _glPixelStorei(3317,1); + switch ($compressedFormat|0) { + case 33776: case 33777: case 36196: case 37492: { + $blockSize$0 = 8; + break; + } + default: { + $blockSize$0 = 16; + } + } + $0 = ($mipmapCount|0)<(1); + $1 = $width | $height; + $2 = ($1|0)==(0); + $or$cond9 = $0 | $2; + if ($or$cond9) { + return; + } else { + $$013 = $width;$$0610 = $height;$level$012 = 0;$offset$011 = 0; + } + while(1) { + $3 = (($$013) + 3)|0; + $4 = (($3|0) / 4)&-1; + $5 = (($$0610) + 3)|0; + $6 = (($5|0) / 4)&-1; + $7 = Math_imul($4, $blockSize$0)|0; + $8 = Math_imul($7, $6)|0; + $9 = (($data) + ($offset$011)|0); + _glCompressedTexImage2D(3553,($level$012|0),($compressedFormat|0),($$013|0),($$0610|0),0,($8|0),($9|0)); + $10 = (($8) + ($offset$011))|0; + $11 = (($$013|0) / 2)&-1; + $12 = (($$0610|0) / 2)&-1; + $13 = ($$013|0)<(2); + $$ = $13 ? 1 : $11; + $14 = ($$0610|0)<(2); + $$17 = $14 ? 1 : $12; + $15 = (($level$012) + 1)|0; + $16 = ($15|0)>=($mipmapCount|0); + $17 = $$ | $$17; + $18 = ($17|0)==(0); + $or$cond = $16 | $18; + if ($or$cond) { + break; + } else { + $$013 = $$;$$0610 = $$17;$level$012 = $15;$offset$011 = $10; + } + } + return; +} +function _UnloadDefaultShader() { + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + _glUseProgram(0); + $0 = HEAP32[2060>>2]|0; + _glDeleteProgram(($0|0)); + return; +} +function _UnloadStandardShader() { + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + _glUseProgram(0); + $0 = HEAP32[2208>>2]|0; + _glDeleteProgram(($0|0)); + return; +} +function _UnloadDefaultBuffers() { + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[2016>>2]|0; + $1 = ($0|0)==(0); + if (!($1)) { + $2 = HEAP32[2028>>2]|0; + FUNCTION_TABLE_vi[$2 & 31](0); + } + _glDisableVertexAttribArray(0); + _glDisableVertexAttribArray(1); + _glDisableVertexAttribArray(2); + _glDisableVertexAttribArray(3); + _glBindBuffer(34962,0); + _glBindBuffer(34963,0); + _glDeleteBuffers(1,((1892)|0)); + _glDeleteBuffers(1,((1896)|0)); + _glDeleteBuffers(1,((1940)|0)); + _glDeleteBuffers(1,((1944)|0)); + _glDeleteBuffers(1,((1988)|0)); + _glDeleteBuffers(1,((1992)|0)); + _glDeleteBuffers(1,((1996)|0)); + _glDeleteBuffers(1,((2000)|0)); + $3 = HEAP32[2016>>2]|0; + $4 = ($3|0)==(0); + if (!($4)) { + $5 = HEAP32[2020>>2]|0; + FUNCTION_TABLE_vii[$5 & 63](1,(1888)); + $6 = HEAP32[2020>>2]|0; + FUNCTION_TABLE_vii[$6 & 63](1,(1936)); + $7 = HEAP32[2020>>2]|0; + FUNCTION_TABLE_vii[$7 & 63](1,(1984)); + } + $8 = HEAP32[(1872)>>2]|0; + _free($8); + $9 = HEAP32[(1880)>>2]|0; + _free($9); + $10 = HEAP32[(1920)>>2]|0; + _free($10); + $11 = HEAP32[(1928)>>2]|0; + _free($11); + $12 = HEAP32[(1968)>>2]|0; + _free($12); + $13 = HEAP32[(1972)>>2]|0; + _free($13); + $14 = HEAP32[(1976)>>2]|0; + _free($14); + $15 = HEAP32[(1980)>>2]|0; + _free($15); + return; +} +function _UpdateDefaultBuffers() { + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[1860>>2]|0; + $1 = ($0|0)>(0); + if ($1) { + $2 = HEAP32[2016>>2]|0; + $3 = ($2|0)==(0); + if (!($3)) { + $4 = HEAP32[2028>>2]|0; + $5 = HEAP32[(1888)>>2]|0; + FUNCTION_TABLE_vi[$4 & 31]($5); + } + $6 = HEAP32[(1892)>>2]|0; + _glBindBuffer(34962,($6|0)); + $7 = HEAP32[1860>>2]|0; + $8 = ($7*12)|0; + $9 = HEAP32[(1872)>>2]|0; + _glBufferSubData(34962,0,($8|0),($9|0)); + $10 = HEAP32[(1896)>>2]|0; + _glBindBuffer(34962,($10|0)); + $11 = HEAP32[(1868)>>2]|0; + $12 = $11 << 2; + $13 = HEAP32[(1880)>>2]|0; + _glBufferSubData(34962,0,($12|0),($13|0)); + } + $14 = HEAP32[1908>>2]|0; + $15 = ($14|0)>(0); + if ($15) { + $16 = HEAP32[2016>>2]|0; + $17 = ($16|0)==(0); + if (!($17)) { + $18 = HEAP32[2028>>2]|0; + $19 = HEAP32[(1936)>>2]|0; + FUNCTION_TABLE_vi[$18 & 31]($19); + } + $20 = HEAP32[(1940)>>2]|0; + _glBindBuffer(34962,($20|0)); + $21 = HEAP32[1908>>2]|0; + $22 = ($21*12)|0; + $23 = HEAP32[(1920)>>2]|0; + _glBufferSubData(34962,0,($22|0),($23|0)); + $24 = HEAP32[(1944)>>2]|0; + _glBindBuffer(34962,($24|0)); + $25 = HEAP32[(1916)>>2]|0; + $26 = $25 << 2; + $27 = HEAP32[(1928)>>2]|0; + _glBufferSubData(34962,0,($26|0),($27|0)); + } + $28 = HEAP32[1956>>2]|0; + $29 = ($28|0)>(0); + if ($29) { + $30 = HEAP32[2016>>2]|0; + $31 = ($30|0)==(0); + if (!($31)) { + $32 = HEAP32[2028>>2]|0; + $33 = HEAP32[(1984)>>2]|0; + FUNCTION_TABLE_vi[$32 & 31]($33); + } + $34 = HEAP32[(1988)>>2]|0; + _glBindBuffer(34962,($34|0)); + $35 = HEAP32[1956>>2]|0; + $36 = ($35*12)|0; + $37 = HEAP32[(1968)>>2]|0; + _glBufferSubData(34962,0,($36|0),($37|0)); + $38 = HEAP32[(1992)>>2]|0; + _glBindBuffer(34962,($38|0)); + $39 = HEAP32[1956>>2]|0; + $40 = $39 << 3; + $41 = HEAP32[(1972)>>2]|0; + _glBufferSubData(34962,0,($40|0),($41|0)); + $42 = HEAP32[(1996)>>2]|0; + _glBindBuffer(34962,($42|0)); + $43 = HEAP32[1956>>2]|0; + $44 = $43 << 2; + $45 = HEAP32[(1976)>>2]|0; + _glBufferSubData(34962,0,($44|0),($45|0)); + } + $46 = HEAP32[2016>>2]|0; + $47 = ($46|0)==(0); + if ($47) { + return; + } + $48 = HEAP32[2028>>2]|0; + FUNCTION_TABLE_vi[$48 & 31](0); + return; +} +function _DrawDefaultBuffers($eyesCount) { + $eyesCount = $eyesCount|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; + var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; + var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $exitcond = 0, $eye$06 = 0, $i$05 = 0, $indicesOffset$04 = 0, $matMVP = 0, $matMVP$byval_copy = 0, $matModelView = 0, $matProjection = 0, $modelview$byval_copy = 0; + var $or$cond = 0, $or$cond3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 320|0; + $matMVP$byval_copy = sp + 256|0; + $modelview$byval_copy = sp + 192|0; + $matProjection = sp + 128|0; + $matModelView = sp + 64|0; + $matMVP = sp; + dest=$matProjection; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matModelView; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $0 = ($eyesCount|0)>(0); + if (!($0)) { + HEAP32[2008>>2] = 1; + $87 = HEAP32[2056>>2]|0; + $88 = HEAP32[2012>>2]|0; + $89 = ((($88)) + 8|0); + HEAP32[$89>>2] = $87; + $90 = HEAP32[2012>>2]|0; + HEAP32[$90>>2] = 0; + HEAP32[1860>>2] = 0; + HEAP32[(1868)>>2] = 0; + HEAP32[1908>>2] = 0; + HEAP32[(1916)>>2] = 0; + HEAP32[1956>>2] = 0; + HEAP32[(1960)>>2] = 0; + HEAP32[(1964)>>2] = 0; + HEAPF32[2004>>2] = -1.0; + dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=748; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; + } + $1 = ($eyesCount|0)==(2); + $eye$06 = 0; + while(1) { + if ($1) { + dest=$modelview$byval_copy; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matMVP$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _SetStereoView($eye$06,$modelview$byval_copy,$matMVP$byval_copy); + } + $2 = HEAP32[1860>>2]|0; + $3 = ($2|0)>(0); + $4 = HEAP32[1908>>2]|0; + $5 = ($4|0)>(0); + $or$cond = $3 | $5; + $6 = HEAP32[1956>>2]|0; + $7 = ($6|0)>(0); + $or$cond3 = $or$cond | $7; + if ($or$cond3) { + $8 = HEAP32[2108>>2]|0; + _glUseProgram(($8|0)); + dest=$modelview$byval_copy; src=748; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$matMVP$byval_copy; src=680; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($matMVP,$modelview$byval_copy,$matMVP$byval_copy); + $9 = HEAP32[(2136)>>2]|0; + dest=$matMVP$byval_copy; src=$matMVP; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $10 = (_MatrixToFloat($matMVP$byval_copy)|0); + _glUniformMatrix4fv(($9|0),1,0,($10|0)); + $11 = HEAP32[(2140)>>2]|0; + _glUniform4f(($11|0),1.0,1.0,1.0,1.0); + $12 = HEAP32[(2144)>>2]|0; + _glUniform1i(($12|0),0); + } + $13 = HEAP32[1860>>2]|0; + $14 = ($13|0)>(0); + if ($14) { + $15 = HEAP32[2056>>2]|0; + _glBindTexture(3553,($15|0)); + $16 = HEAP32[2016>>2]|0; + $17 = ($16|0)==(0); + if ($17) { + $20 = HEAP32[(1892)>>2]|0; + _glBindBuffer(34962,($20|0)); + $21 = HEAP32[(2112)>>2]|0; + _glVertexAttribPointer(($21|0),3,5126,0,0,(0|0)); + $22 = HEAP32[(2112)>>2]|0; + _glEnableVertexAttribArray(($22|0)); + $23 = HEAP32[(1896)>>2]|0; + _glBindBuffer(34962,($23|0)); + $24 = HEAP32[(2132)>>2]|0; + _glVertexAttribPointer(($24|0),4,5121,1,0,(0|0)); + $25 = HEAP32[(2132)>>2]|0; + _glEnableVertexAttribArray(($25|0)); + } else { + $18 = HEAP32[2028>>2]|0; + $19 = HEAP32[(1888)>>2]|0; + FUNCTION_TABLE_vi[$18 & 31]($19); + } + $26 = HEAP32[1860>>2]|0; + _glDrawArrays(1,0,($26|0)); + $27 = HEAP32[2016>>2]|0; + $28 = ($27|0)==(0); + if ($28) { + _glBindBuffer(34962,0); + } + _glBindTexture(3553,0); + } + $29 = HEAP32[1908>>2]|0; + $30 = ($29|0)>(0); + if ($30) { + $31 = HEAP32[2056>>2]|0; + _glBindTexture(3553,($31|0)); + $32 = HEAP32[2016>>2]|0; + $33 = ($32|0)==(0); + if ($33) { + $36 = HEAP32[(1940)>>2]|0; + _glBindBuffer(34962,($36|0)); + $37 = HEAP32[(2112)>>2]|0; + _glVertexAttribPointer(($37|0),3,5126,0,0,(0|0)); + $38 = HEAP32[(2112)>>2]|0; + _glEnableVertexAttribArray(($38|0)); + $39 = HEAP32[(1944)>>2]|0; + _glBindBuffer(34962,($39|0)); + $40 = HEAP32[(2132)>>2]|0; + _glVertexAttribPointer(($40|0),4,5121,1,0,(0|0)); + $41 = HEAP32[(2132)>>2]|0; + _glEnableVertexAttribArray(($41|0)); + } else { + $34 = HEAP32[2028>>2]|0; + $35 = HEAP32[(1936)>>2]|0; + FUNCTION_TABLE_vi[$34 & 31]($35); + } + $42 = HEAP32[1908>>2]|0; + _glDrawArrays(4,0,($42|0)); + $43 = HEAP32[2016>>2]|0; + $44 = ($43|0)==(0); + if ($44) { + _glBindBuffer(34962,0); + } + _glBindTexture(3553,0); + } + $45 = HEAP32[1956>>2]|0; + $46 = ($45|0)>(0); + if ($46) { + $47 = HEAP32[2016>>2]|0; + $48 = ($47|0)==(0); + if ($48) { + $51 = HEAP32[(1988)>>2]|0; + _glBindBuffer(34962,($51|0)); + $52 = HEAP32[(2112)>>2]|0; + _glVertexAttribPointer(($52|0),3,5126,0,0,(0|0)); + $53 = HEAP32[(2112)>>2]|0; + _glEnableVertexAttribArray(($53|0)); + $54 = HEAP32[(1992)>>2]|0; + _glBindBuffer(34962,($54|0)); + $55 = HEAP32[(2116)>>2]|0; + _glVertexAttribPointer(($55|0),2,5126,0,0,(0|0)); + $56 = HEAP32[(2116)>>2]|0; + _glEnableVertexAttribArray(($56|0)); + $57 = HEAP32[(1996)>>2]|0; + _glBindBuffer(34962,($57|0)); + $58 = HEAP32[(2132)>>2]|0; + _glVertexAttribPointer(($58|0),4,5121,1,0,(0|0)); + $59 = HEAP32[(2132)>>2]|0; + _glEnableVertexAttribArray(($59|0)); + $60 = HEAP32[(2000)>>2]|0; + _glBindBuffer(34963,($60|0)); + } else { + $49 = HEAP32[2028>>2]|0; + $50 = HEAP32[(1984)>>2]|0; + FUNCTION_TABLE_vi[$49 & 31]($50); + } + $61 = HEAP32[2008>>2]|0; + $62 = ($61|0)>(0); + if ($62) { + $i$05 = 0;$indicesOffset$04 = 0; + while(1) { + $63 = HEAP32[2012>>2]|0; + $64 = (($63) + (($i$05*144)|0)|0); + $65 = HEAP32[$64>>2]|0; + $66 = (($65|0) / 4)&-1; + $67 = ($66*6)|0; + $68 = (((($63) + (($i$05*144)|0)|0)) + 8|0); + $69 = HEAP32[$68>>2]|0; + _glBindTexture(3553,($69|0)); + $70 = $indicesOffset$04 << 1; + $71 = $70; + _glDrawElements(4,($67|0),5123,($71|0)); + $72 = HEAP32[2012>>2]|0; + $73 = (($72) + (($i$05*144)|0)|0); + $74 = HEAP32[$73>>2]|0; + $75 = (($74|0) / 4)&-1; + $76 = ($75*6)|0; + $77 = (($76) + ($indicesOffset$04))|0; + $78 = (($i$05) + 1)|0; + $79 = HEAP32[2008>>2]|0; + $80 = ($78|0)<($79|0); + if ($80) { + $i$05 = $78;$indicesOffset$04 = $77; + } else { + break; + } + } + } + $81 = HEAP32[2016>>2]|0; + $82 = ($81|0)==(0); + if ($82) { + _glBindBuffer(34962,0); + _glBindBuffer(34963,0); + } + _glBindTexture(3553,0); + } + $83 = HEAP32[2016>>2]|0; + $84 = ($83|0)==(0); + if (!($84)) { + $85 = HEAP32[2028>>2]|0; + FUNCTION_TABLE_vi[$85 & 31](0); + } + _glUseProgram(0); + $86 = (($eye$06) + 1)|0; + $exitcond = ($86|0)==($eyesCount|0); + if ($exitcond) { + break; + } else { + $eye$06 = $86; + } + } + HEAP32[2008>>2] = 1; + $87 = HEAP32[2056>>2]|0; + $88 = HEAP32[2012>>2]|0; + $89 = ((($88)) + 8|0); + HEAP32[$89>>2] = $87; + $90 = HEAP32[2012>>2]|0; + HEAP32[$90>>2] = 0; + HEAP32[1860>>2] = 0; + HEAP32[(1868)>>2] = 0; + HEAP32[1908>>2] = 0; + HEAP32[(1916)>>2] = 0; + HEAP32[1956>>2] = 0; + HEAP32[(1960)>>2] = 0; + HEAP32[(1964)>>2] = 0; + HEAPF32[2004>>2] = -1.0; + dest=680; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=748; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _SetShaderLights($shader) { + $shader = $shader|0; + var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0.0; + var $116 = 0.0, $117 = 0.0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0.0, $122 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; + var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0; + var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0; + var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0; + var $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0, $95 = 0.0, $96 = 0; + var $97 = 0, $98 = 0, $99 = 0.0, $direction = 0, $direction1 = 0, $exitcond = 0, $i$01 = 0, $locName = 0, $shader$byval_copy7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 112|0; + $shader$byval_copy7 = sp + 24|0; + $locName = sp + 72|0; + $direction = sp + 12|0; + $direction1 = sp; + dest=$locName; src=15335; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + $0 = ((($locName)) + 7|0); + $1 = ((($locName)) + 10|0); + $2 = ((($direction)) + 4|0); + $3 = ((($direction)) + 8|0); + $4 = ((($direction1)) + 4|0); + $5 = ((($direction1)) + 8|0); + $i$01 = 0; + while(1) { + $6 = (($i$01) + 48)|0; + $7 = $6&255; + HEAP8[$0>>0] = $7; + $8 = (2168 + ($i$01<<2)|0); + $9 = HEAP32[$8>>2]|0; + $10 = ($9|0)==(0|0); + $11 = $1; + $12 = $11; + HEAP8[$12>>0]=1650552421&255;HEAP8[$12+1>>0]=(1650552421>>8)&255;HEAP8[$12+2>>0]=(1650552421>>16)&255;HEAP8[$12+3>>0]=1650552421>>24; + $13 = (($11) + 4)|0; + $14 = $13; + HEAP8[$14>>0]=6579564&255;HEAP8[$14+1>>0]=(6579564>>8)&255;HEAP8[$14+2>>0]=(6579564>>16)&255;HEAP8[$14+3>>0]=6579564>>24; + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $15 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + L3: do { + if ($10) { + _glUniform1i(($15|0),0); + } else { + $16 = HEAP32[$8>>2]|0; + $17 = ((($16)) + 4|0); + $18 = HEAP32[$17>>2]|0; + _glUniform1i(($15|0),($18|0)); + ;HEAP8[$1>>0]=HEAP8[15367>>0]|0;HEAP8[$1+1>>0]=HEAP8[15367+1>>0]|0;HEAP8[$1+2>>0]=HEAP8[15367+2>>0]|0;HEAP8[$1+3>>0]=HEAP8[15367+3>>0]|0;HEAP8[$1+4>>0]=HEAP8[15367+4>>0]|0; + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $19 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $20 = HEAP32[$8>>2]|0; + $21 = ((($20)) + 8|0); + $22 = HEAP32[$21>>2]|0; + _glUniform1i(($19|0),($22|0)); + dest=$1; src=15373; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + $23 = HEAP32[$shader>>2]|0; + $24 = (_glGetUniformLocation(($23|0),($locName|0))|0); + $25 = HEAP32[$8>>2]|0; + $26 = ((($25)) + 40|0); + $27 = HEAP8[$26>>0]|0; + $28 = (+($27&255)); + $29 = $28 / 255.0; + $30 = ((($25)) + 41|0); + $31 = HEAP8[$30>>0]|0; + $32 = (+($31&255)); + $33 = $32 / 255.0; + $34 = ((($25)) + 42|0); + $35 = HEAP8[$34>>0]|0; + $36 = (+($35&255)); + $37 = $36 / 255.0; + $38 = ((($25)) + 43|0); + $39 = HEAP8[$38>>0]|0; + $40 = (+($39&255)); + $41 = $40 / 255.0; + _glUniform4f(($24|0),(+$29),(+$33),(+$37),(+$41)); + dest=$1; src=15382; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + $42 = HEAP32[$shader>>2]|0; + $43 = (_glGetUniformLocation(($42|0),($locName|0))|0); + $44 = HEAP32[$8>>2]|0; + $45 = ((($44)) + 44|0); + $46 = +HEAPF32[$45>>2]; + _glUniform1f(($43|0),(+$46)); + $47 = HEAP32[$8>>2]|0; + $48 = ((($47)) + 8|0); + $49 = HEAP32[$48>>2]|0; + switch ($49|0) { + case 0: { + dest=$1; src=15393; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $50 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $51 = HEAP32[$8>>2]|0; + $52 = ((($51)) + 12|0); + $53 = +HEAPF32[$52>>2]; + $54 = ((($51)) + 16|0); + $55 = +HEAPF32[$54>>2]; + $56 = ((($51)) + 20|0); + $57 = +HEAPF32[$56>>2]; + _glUniform3f(($50|0),(+$53),(+$55),(+$57)); + $58 = $1; + $59 = $58; + HEAP8[$59>>0]=1768186226&255;HEAP8[$59+1>>0]=(1768186226>>8)&255;HEAP8[$59+2>>0]=(1768186226>>16)&255;HEAP8[$59+3>>0]=1768186226>>24; + $60 = (($58) + 4)|0; + $61 = $60; + HEAP8[$61>>0]=29557&255;HEAP8[$61+1>>0]=(29557>>8)&255;HEAP8[$61+2>>0]=(29557>>16)&255;HEAP8[$61+3>>0]=29557>>24; + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $62 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $63 = HEAP32[$8>>2]|0; + $64 = ((($63)) + 36|0); + $65 = +HEAPF32[$64>>2]; + _glUniform1f(($62|0),(+$65)); + break L3; + break; + } + case 1: { + dest=$1; src=15403; stop=dest+11|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $66 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $67 = HEAP32[$8>>2]|0; + $68 = ((($67)) + 24|0); + $69 = +HEAPF32[$68>>2]; + $70 = ((($67)) + 12|0); + $71 = +HEAPF32[$70>>2]; + $72 = $69 - $71; + HEAPF32[$direction>>2] = $72; + $73 = HEAP32[$8>>2]|0; + $74 = ((($73)) + 28|0); + $75 = +HEAPF32[$74>>2]; + $76 = ((($73)) + 16|0); + $77 = +HEAPF32[$76>>2]; + $78 = $75 - $77; + HEAPF32[$2>>2] = $78; + $79 = HEAP32[$8>>2]|0; + $80 = ((($79)) + 32|0); + $81 = +HEAPF32[$80>>2]; + $82 = ((($79)) + 20|0); + $83 = +HEAPF32[$82>>2]; + $84 = $81 - $83; + HEAPF32[$3>>2] = $84; + _VectorNormalize($direction); + $85 = +HEAPF32[$direction>>2]; + $86 = +HEAPF32[$2>>2]; + $87 = +HEAPF32[$3>>2]; + _glUniform3f(($66|0),(+$85),(+$86),(+$87)); + break L3; + break; + } + case 2: { + dest=$1; src=15393; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $88 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $89 = HEAP32[$8>>2]|0; + $90 = ((($89)) + 12|0); + $91 = +HEAPF32[$90>>2]; + $92 = ((($89)) + 16|0); + $93 = +HEAPF32[$92>>2]; + $94 = ((($89)) + 20|0); + $95 = +HEAPF32[$94>>2]; + _glUniform3f(($88|0),(+$91),(+$93),(+$95)); + dest=$1; src=15403; stop=dest+11|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $96 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $97 = HEAP32[$8>>2]|0; + $98 = ((($97)) + 24|0); + $99 = +HEAPF32[$98>>2]; + $100 = ((($97)) + 12|0); + $101 = +HEAPF32[$100>>2]; + $102 = $99 - $101; + HEAPF32[$direction1>>2] = $102; + $103 = HEAP32[$8>>2]|0; + $104 = ((($103)) + 28|0); + $105 = +HEAPF32[$104>>2]; + $106 = ((($103)) + 16|0); + $107 = +HEAPF32[$106>>2]; + $108 = $105 - $107; + HEAPF32[$4>>2] = $108; + $109 = HEAP32[$8>>2]|0; + $110 = ((($109)) + 32|0); + $111 = +HEAPF32[$110>>2]; + $112 = ((($109)) + 20|0); + $113 = +HEAPF32[$112>>2]; + $114 = $111 - $113; + HEAPF32[$5>>2] = $114; + _VectorNormalize($direction1); + $115 = +HEAPF32[$direction1>>2]; + $116 = +HEAPF32[$4>>2]; + $117 = +HEAPF32[$5>>2]; + _glUniform3f(($96|0),(+$115),(+$116),(+$117)); + dest=$1; src=15414; stop=dest+9|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0)); + dest=$shader$byval_copy7; src=$shader; stop=dest+48|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $118 = (_GetShaderLocation($shader$byval_copy7,$locName)|0); + $119 = HEAP32[$8>>2]|0; + $120 = ((($119)) + 48|0); + $121 = +HEAPF32[$120>>2]; + _glUniform1f(($118|0),(+$121)); + break L3; + break; + } + default: { + break L3; + } + } + } + } while(0); + $122 = (($i$01) + 1)|0; + $exitcond = ($122|0)==(8); + if ($exitcond) { + break; + } else { + $i$01 = $122; + } + } + STACKTOP = sp;return; +} +function _SetStereoView($eye,$matProjection,$matModelView) { + $eye = $eye|0; + $matProjection = $matProjection|0; + $matModelView = $matModelView|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $eyeProjection = 0, $eyeProjection$byval_copy = 0, $matModelView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $eyeProjection$byval_copy = sp + 192|0; + $matModelView$byval_copy = sp + 64|0; + $eyeProjection = sp; + $0 = sp + 128|0; + $1 = HEAP32[2200>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + STACKTOP = sp;return; + } + dest=$eyeProjection; src=$matProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $3 = HEAP32[2156>>2]|0; + $4 = Math_imul($3, $eye)|0; + $5 = (($4|0) / 2)&-1; + $6 = (($3|0) / 2)&-1; + $7 = HEAP32[2160>>2]|0; + _rlViewport($5,0,$6,$7); + $8 = (2476 + ($eye<<6)|0); + dest=$matModelView$byval_copy; src=$matModelView; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$eyeProjection$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _MatrixMultiply($0,$matModelView$byval_copy,$eyeProjection$byval_copy); + $9 = (2348 + ($eye<<6)|0); + dest=$eyeProjection; src=$9; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + dest=$eyeProjection$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _SetMatrixModelview($eyeProjection$byval_copy); + dest=$eyeProjection$byval_copy; src=$eyeProjection; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + _SetMatrixProjection($eyeProjection$byval_copy); + STACKTOP = sp;return; +} +function _LoadShaderProgram($vShaderStr,$fShaderStr) { + $vShaderStr = $vShaderStr|0; + $fShaderStr = $fShaderStr|0; + var $$alloca_mul = 0, $$alloca_mul25 = 0, $$alloca_mul27 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $length = 0, $length2 = 0, $length4 = 0, $maxLength = 0, $maxLength1 = 0, $maxLength3 = 0, $pfs = 0, $program$0 = 0, $pvs = 0, $success = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0; + var $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 112|0; + $vararg_buffer22 = sp + 64|0; + $vararg_buffer19 = sp + 56|0; + $vararg_buffer16 = sp + 48|0; + $vararg_buffer13 = sp + 40|0; + $vararg_buffer10 = sp + 32|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $pvs = sp + 100|0; + $pfs = sp + 96|0; + $success = sp + 92|0; + $maxLength = sp + 88|0; + $length = sp + 84|0; + $maxLength1 = sp + 80|0; + $length2 = sp + 76|0; + $maxLength3 = sp + 72|0; + $length4 = sp + 68|0; + $0 = (_glCreateShader(35633)|0); + $1 = (_glCreateShader(35632)|0); + HEAP32[$pvs>>2] = $vShaderStr; + HEAP32[$pfs>>2] = $fShaderStr; + _glShaderSource(($0|0),1,($pvs|0),(0|0)); + _glShaderSource(($1|0),1,($pfs|0),(0|0)); + HEAP32[$success>>2] = 0; + _glCompileShader(($0|0)); + _glGetShaderiv(($0|0),35713,($success|0)); + $2 = HEAP32[$success>>2]|0; + $3 = ($2|0)==(1); + if ($3) { + HEAP32[$vararg_buffer4>>2] = $0; + _TraceLog(0,15088,$vararg_buffer4); + } else { + HEAP32[$vararg_buffer>>2] = $0; + _TraceLog(2,15036,$vararg_buffer); + HEAP32[$maxLength>>2] = 0; + _glGetShaderiv(($0|0),35716,($maxLength|0)); + $4 = HEAP32[$maxLength>>2]|0; + $5 = (_llvm_stacksave()|0); + $$alloca_mul = $4; + $6 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0;; + $7 = HEAP32[$maxLength>>2]|0; + _glGetShaderInfoLog(($0|0),($7|0),($length|0),($6|0)); + HEAP32[$vararg_buffer1>>2] = $6; + _TraceLog(0,15085,$vararg_buffer1); + _llvm_stackrestore(($5|0)); + } + _glCompileShader(($1|0)); + _glGetShaderiv(($1|0),35713,($success|0)); + $8 = HEAP32[$success>>2]|0; + $9 = ($8|0)==(1); + if ($9) { + HEAP32[$vararg_buffer13>>2] = $1; + _TraceLog(0,15189,$vararg_buffer13); + } else { + HEAP32[$vararg_buffer7>>2] = $1; + _TraceLog(2,15138,$vararg_buffer7); + HEAP32[$maxLength1>>2] = 0; + _glGetShaderiv(($1|0),35716,($maxLength1|0)); + $10 = HEAP32[$maxLength1>>2]|0; + $11 = (_llvm_stacksave()|0); + $$alloca_mul25 = $10; + $12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul25)|0)+15)&-16)|0;; + $13 = HEAP32[$maxLength1>>2]|0; + _glGetShaderInfoLog(($1|0),($13|0),($length2|0),($12|0)); + HEAP32[$vararg_buffer10>>2] = $12; + _TraceLog(0,15085,$vararg_buffer10); + _llvm_stackrestore(($11|0)); + } + $14 = (_glCreateProgram()|0); + _glAttachShader(($14|0),($0|0)); + _glAttachShader(($14|0),($1|0)); + _glBindAttribLocation(($14|0),0,(14903|0)); + _glBindAttribLocation(($14|0),1,(14918|0)); + _glBindAttribLocation(($14|0),2,(14949|0)); + _glBindAttribLocation(($14|0),3,(14976|0)); + _glBindAttribLocation(($14|0),4,(14962|0)); + _glBindAttribLocation(($14|0),5,(14933|0)); + _glLinkProgram(($14|0)); + _glGetProgramiv(($14|0),35714,($success|0)); + $15 = HEAP32[$success>>2]|0; + $16 = ($15|0)==(0); + if ($16) { + HEAP32[$vararg_buffer16>>2] = $14; + _TraceLog(2,15241,$vararg_buffer16); + HEAP32[$maxLength3>>2] = 0; + _glGetProgramiv(($14|0),35716,($maxLength3|0)); + $17 = HEAP32[$maxLength3>>2]|0; + $18 = (_llvm_stacksave()|0); + $$alloca_mul27 = $17; + $19 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul27)|0)+15)&-16)|0;; + $20 = HEAP32[$maxLength3>>2]|0; + _glGetProgramInfoLog(($14|0),($20|0),($length4|0),($19|0)); + HEAP32[$vararg_buffer19>>2] = $19; + _TraceLog(0,15085,$vararg_buffer19); + _glDeleteProgram(($14|0)); + _llvm_stackrestore(($18|0)); + $program$0 = 0; + _glDeleteShader(($0|0)); + _glDeleteShader(($1|0)); + STACKTOP = sp;return ($program$0|0); + } else { + HEAP32[$vararg_buffer22>>2] = $14; + _TraceLog(0,15287,$vararg_buffer22); + $program$0 = $14; + _glDeleteShader(($0|0)); + _glDeleteShader(($1|0)); + STACKTOP = sp;return ($program$0|0); + } + return (0)|0; +} +function _LoadDefaultShaderLocations($shader) { + $shader = $shader|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$shader>>2]|0; + $1 = (_glGetAttribLocation(($0|0),(14903|0))|0); + $2 = ((($shader)) + 4|0); + HEAP32[$2>>2] = $1; + $3 = HEAP32[$shader>>2]|0; + $4 = (_glGetAttribLocation(($3|0),(14918|0))|0); + $5 = ((($shader)) + 8|0); + HEAP32[$5>>2] = $4; + $6 = HEAP32[$shader>>2]|0; + $7 = (_glGetAttribLocation(($6|0),(14933|0))|0); + $8 = ((($shader)) + 12|0); + HEAP32[$8>>2] = $7; + $9 = HEAP32[$shader>>2]|0; + $10 = (_glGetAttribLocation(($9|0),(14949|0))|0); + $11 = ((($shader)) + 16|0); + HEAP32[$11>>2] = $10; + $12 = HEAP32[$shader>>2]|0; + $13 = (_glGetAttribLocation(($12|0),(14962|0))|0); + $14 = ((($shader)) + 20|0); + HEAP32[$14>>2] = $13; + $15 = HEAP32[$shader>>2]|0; + $16 = (_glGetAttribLocation(($15|0),(14976|0))|0); + $17 = ((($shader)) + 24|0); + HEAP32[$17>>2] = $16; + $18 = HEAP32[$shader>>2]|0; + $19 = (_glGetUniformLocation(($18|0),(14988|0))|0); + $20 = ((($shader)) + 28|0); + HEAP32[$20>>2] = $19; + $21 = HEAP32[$shader>>2]|0; + $22 = (_glGetUniformLocation(($21|0),(14998|0))|0); + $23 = ((($shader)) + 32|0); + HEAP32[$23>>2] = $22; + $24 = HEAP32[$shader>>2]|0; + $25 = (_glGetUniformLocation(($24|0),(15009|0))|0); + $26 = ((($shader)) + 36|0); + HEAP32[$26>>2] = $25; + $27 = HEAP32[$shader>>2]|0; + $28 = (_glGetUniformLocation(($27|0),(15018|0))|0); + $29 = ((($shader)) + 40|0); + HEAP32[$29>>2] = $28; + $30 = HEAP32[$shader>>2]|0; + $31 = (_glGetUniformLocation(($30|0),(15027|0))|0); + $32 = ((($shader)) + 44|0); + HEAP32[$32>>2] = $31; + return; +} +function _stbi__fopen($filename) { + $filename = $filename|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_fopen($filename,10906)|0); + return ($0|0); +} +function _stbi__err($str) { + $str = $str|0; + var label = 0, sp = 0; + sp = STACKTOP; + HEAP32[2608>>2] = $str; + return; +} +function _stbi__start_file($s,$f) { + $s = $s|0; + $f = $f|0; + var label = 0, sp = 0; + sp = STACKTOP; + _stbi__start_callbacks($s,6412,$f); + return; +} +function _stbi__load_flip($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $col$04 = 0, $exitcond = 0, $exitcond7 = 0, $exitcond8 = 0, $or$cond = 0, $row$06 = 0, $z$03 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__load_main($s,$x,$y,$comp,$req_comp)|0); + $1 = HEAP32[2612>>2]|0; + $2 = ($1|0)!=(0); + $3 = ($0|0)!=(0|0); + $or$cond = $3 & $2; + if (!($or$cond)) { + return ($0|0); + } + $4 = HEAP32[$x>>2]|0; + $5 = HEAP32[$y>>2]|0; + $6 = ($req_comp|0)==(0); + if ($6) { + $7 = HEAP32[$comp>>2]|0; + $11 = $7; + } else { + $11 = $req_comp; + } + $8 = $5 >> 1; + $9 = ($8|0)>(0); + if (!($9)) { + return ($0|0); + } + $10 = ($4|0)>(0); + $12 = ($11|0)>(0); + $13 = (($5) + -1)|0; + $row$06 = 0; + while(1) { + if ($10) { + $14 = Math_imul($row$06, $4)|0; + $15 = (($13) - ($row$06))|0; + $16 = Math_imul($15, $4)|0; + $col$04 = 0; + while(1) { + if ($12) { + $17 = (($col$04) + ($14))|0; + $18 = Math_imul($17, $11)|0; + $19 = (($col$04) + ($16))|0; + $20 = Math_imul($19, $11)|0; + $z$03 = 0; + while(1) { + $21 = (($z$03) + ($18))|0; + $22 = (($0) + ($21)|0); + $23 = HEAP8[$22>>0]|0; + $24 = (($z$03) + ($20))|0; + $25 = (($0) + ($24)|0); + $26 = HEAP8[$25>>0]|0; + HEAP8[$22>>0] = $26; + HEAP8[$25>>0] = $23; + $27 = (($z$03) + 1)|0; + $exitcond = ($27|0)==($11|0); + if ($exitcond) { + break; + } else { + $z$03 = $27; + } + } + } + $28 = (($col$04) + 1)|0; + $exitcond7 = ($28|0)==($4|0); + if ($exitcond7) { + break; + } else { + $col$04 = $28; + } + } + } + $29 = (($row$06) + 1)|0; + $exitcond8 = ($29|0)==($8|0); + if ($exitcond8) { + break; + } else { + $row$06 = $29; + } + } + return ($0|0); +} +function _stbi__start_callbacks($s,$c,$user) { + $s = $s|0; + $c = $c|0; + $user = $user|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 16|0); + ;HEAP32[$0>>2]=HEAP32[$c>>2]|0;HEAP32[$0+4>>2]=HEAP32[$c+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$c+8>>2]|0; + $1 = ((($s)) + 28|0); + HEAP32[$1>>2] = $user; + $2 = ((($s)) + 36|0); + HEAP32[$2>>2] = 128; + $3 = ((($s)) + 32|0); + HEAP32[$3>>2] = 1; + $4 = ((($s)) + 40|0); + $5 = ((($s)) + 176|0); + HEAP32[$5>>2] = $4; + _stbi__refill_buffer($s); + $6 = ((($s)) + 172|0); + $7 = HEAP32[$6>>2]|0; + $8 = ((($s)) + 180|0); + HEAP32[$8>>2] = $7; + return; +} +function _stbi__malloc($size) { + $size = $size|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_malloc($size)|0); + return ($0|0); +} +function _stbi__do_zlib($a,$obuf,$olen,$exp,$parse_header) { + $a = $a|0; + $obuf = $obuf|0; + $olen = $olen|0; + $exp = $exp|0; + $parse_header = $parse_header|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($a)) + 20|0); + HEAP32[$0>>2] = $obuf; + $1 = ((($a)) + 16|0); + HEAP32[$1>>2] = $obuf; + $2 = (($obuf) + ($olen)|0); + $3 = ((($a)) + 24|0); + HEAP32[$3>>2] = $2; + $4 = ((($a)) + 28|0); + HEAP32[$4>>2] = $exp; + $5 = (_stbi__parse_zlib($a,$parse_header)|0); + return ($5|0); +} +function _stbi__get16le($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = $0&255; + $2 = (_stbi__get8($s)|0); + $3 = $2&255; + $4 = $3 << 8; + $5 = $4 | $1; + return ($5|0); +} +function _LoadDDS($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; + var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $bufsize$0 = 0, $exitcond = 0, $exitcond13 = 0, $filecode = 0, $header = 0, $i$09 = 0, $i2$011 = 0, $i3$08 = 0, $image$sroa$0$0 = 0; + var $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$0$3 = 0, $image$sroa$26$0 = 0, $image$sroa$26$1 = 0, $image$sroa$41$0 = 0, $image$sroa$41$1 = 0, $image$sroa$56$0 = 0, $image$sroa$56$1 = 0, $image$sroa$56$2 = 0, $image$sroa$59$0 = 0, $image$sroa$59$1 = 0, $image$sroa$59$2 = 0, $image$sroa$59$3 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $switch = 0, $switch$split12D = 0, $switch$split2D = 0; + var $switch$split42D = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer12 = 0, $vararg_buffer16 = 0, $vararg_buffer20 = 0, $vararg_buffer24 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr19 = 0, $vararg_ptr23 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 192|0; + $vararg_buffer24 = sp + 56|0; + $vararg_buffer20 = sp + 48|0; + $vararg_buffer16 = sp + 40|0; + $vararg_buffer12 = sp + 32|0; + $vararg_buffer8 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $filecode = sp + 184|0; + $header = sp + 60|0; + $0 = (_fopen($fileName,10906)|0); + $1 = ($0|0)==(0|0); + if ($1) { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,12292,$vararg_buffer); + $image$sroa$0$3 = 0;$image$sroa$26$1 = 0;$image$sroa$41$1 = 0;$image$sroa$56$2 = 0;$image$sroa$59$3 = 0; + HEAP32[$agg$result>>2] = $image$sroa$0$3; + $86 = ((($agg$result)) + 4|0); + HEAP32[$86>>2] = $image$sroa$26$1; + $87 = ((($agg$result)) + 8|0); + HEAP32[$87>>2] = $image$sroa$41$1; + $88 = ((($agg$result)) + 12|0); + HEAP32[$88>>2] = $image$sroa$56$2; + $89 = ((($agg$result)) + 16|0); + HEAP32[$89>>2] = $image$sroa$59$3; + STACKTOP = sp;return; + } + (_fread($filecode,1,4,$0)|0); + $2 = (_strncmp($filecode,12326,4)|0); + $3 = ($2|0)==(0); + if ($3) { + (_fread($header,124,1,$0)|0); + HEAP32[$vararg_buffer4>>2] = $fileName; + $vararg_ptr7 = ((($vararg_buffer4)) + 4|0); + HEAP32[$vararg_ptr7>>2] = 124; + _TraceLog(3,12379,$vararg_buffer4); + $4 = ((($header)) + 72|0); + $5 = HEAP32[$4>>2]|0; + HEAP32[$vararg_buffer8>>2] = $fileName; + $vararg_ptr11 = ((($vararg_buffer8)) + 4|0); + HEAP32[$vararg_ptr11>>2] = $5; + _TraceLog(3,12409,$vararg_buffer8); + $6 = ((($header)) + 76|0); + $7 = HEAP32[$6>>2]|0; + HEAP32[$vararg_buffer12>>2] = $fileName; + $vararg_ptr15 = ((($vararg_buffer12)) + 4|0); + HEAP32[$vararg_ptr15>>2] = $7; + _TraceLog(3,12445,$vararg_buffer12); + $8 = ((($header)) + 80|0); + $9 = HEAP32[$8>>2]|0; + HEAP32[$vararg_buffer16>>2] = $fileName; + $vararg_ptr19 = ((($vararg_buffer16)) + 4|0); + HEAP32[$vararg_ptr19>>2] = $9; + _TraceLog(3,12484,$vararg_buffer16); + $10 = ((($header)) + 84|0); + $11 = HEAP32[$10>>2]|0; + HEAP32[$vararg_buffer20>>2] = $fileName; + $vararg_ptr23 = ((($vararg_buffer20)) + 4|0); + HEAP32[$vararg_ptr23>>2] = $11; + _TraceLog(3,12511,$vararg_buffer20); + $12 = ((($header)) + 12|0); + $13 = HEAP32[$12>>2]|0; + $14 = ((($header)) + 8|0); + $15 = HEAP32[$14>>2]|0; + $16 = HEAP32[$10>>2]|0; + $17 = ($16|0)==(16); + L7: do { + if ($17) { + $18 = HEAP32[$6>>2]|0; + switch ($18|0) { + case 64: { + $19 = $13 << 1; + $20 = Math_imul($19, $15)|0; + $21 = (_malloc($20)|0); + (_fread($21,$20,1,$0)|0); + $image$sroa$0$0 = $21;$image$sroa$59$0 = 3; + break L7; + break; + } + case 65: { + break; + } + default: { + $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; + break L7; + } + } + $22 = ((($header)) + 100|0); + $23 = HEAP32[$22>>2]|0; + $switch$split2D = ($23|0)<(61440); + if ($switch$split2D) { + switch ($23|0) { + case 32768: { + break; + } + default: { + $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; + break L7; + } + } + $24 = Math_imul($15, $13)|0; + $25 = $24 << 1; + $26 = (_malloc($25)|0); + (_fread($26,$25,1,$0)|0); + $27 = ($24|0)>(0); + if (!($27)) { + $image$sroa$0$0 = $26;$image$sroa$59$0 = 5; + break; + } + $28 = Math_imul($15, $13)|0; + $i$09 = 0; + while(1) { + $29 = (($26) + ($i$09<<1)|0); + $30 = HEAP16[$29>>1]|0; + $31 = $30&65535; + $32 = ($30&65535) >>> 15; + $33 = $32&65535; + $34 = $31 << 1; + $35 = $34 | $33; + $36 = $35&65535; + HEAP16[$29>>1] = $36; + $37 = (($i$09) + 1)|0; + $exitcond = ($37|0)==($28|0); + if ($exitcond) { + $image$sroa$0$0 = $26;$image$sroa$59$0 = 5; + break; + } else { + $i$09 = $37; + } + } + } else { + switch ($23|0) { + case 61440: { + break; + } + default: { + $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; + break L7; + } + } + $38 = Math_imul($15, $13)|0; + $39 = $38 << 1; + $40 = (_malloc($39)|0); + (_fread($40,$39,1,$0)|0); + $41 = ($38|0)>(0); + if (!($41)) { + $image$sroa$0$0 = $40;$image$sroa$59$0 = 6; + break; + } + $42 = Math_imul($15, $13)|0; + $i2$011 = 0; + while(1) { + $43 = (($40) + ($i2$011<<1)|0); + $44 = HEAP16[$43>>1]|0; + $45 = $44&65535; + $46 = ($44&65535) >>> 12; + $47 = $46&65535; + $48 = $45 << 4; + $49 = $48 | $47; + $50 = $49&65535; + HEAP16[$43>>1] = $50; + $51 = (($i2$011) + 1)|0; + $exitcond13 = ($51|0)==($42|0); + if ($exitcond13) { + $image$sroa$0$0 = $40;$image$sroa$59$0 = 6; + break; + } else { + $i2$011 = $51; + } + } + } + } else { + $image$sroa$0$0 = 0;$image$sroa$59$0 = 0; + } + } while(0); + $52 = HEAP32[$6>>2]|0; + $53 = ($52|0)==(64); + $54 = HEAP32[$10>>2]|0; + $55 = ($54|0)==(24); + $or$cond = $53 & $55; + L24: do { + if ($or$cond) { + $56 = ($13*3)|0; + $57 = Math_imul($56, $15)|0; + $58 = (_malloc($57)|0); + (_fread($58,$57,1,$0)|0); + $image$sroa$0$1 = $58;$image$sroa$56$0 = 1;$image$sroa$59$1 = 4; + } else { + $59 = ($52|0)==(65); + $60 = ($54|0)==(32); + $or$cond3 = $59 & $60; + if ($or$cond3) { + $61 = $13 << 2; + $62 = Math_imul($61, $15)|0; + $63 = (_malloc($62)|0); + (_fread($63,$62,1,$0)|0); + $64 = ($62|0)>(0); + if ($64) { + $i3$08 = 0; + } else { + $image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7; + break; + } + while(1) { + $65 = (($63) + ($i3$08)|0); + $66 = HEAP8[$65>>0]|0; + $67 = $i3$08 | 2; + $68 = (($63) + ($67)|0); + $69 = HEAP8[$68>>0]|0; + HEAP8[$65>>0] = $69; + HEAP8[$68>>0] = $66; + $70 = (($i3$08) + 4)|0; + $71 = ($70|0)<($62|0); + if ($71) { + $i3$08 = $70; + } else { + $image$sroa$0$1 = $63;$image$sroa$56$0 = 1;$image$sroa$59$1 = 7; + break L24; + } + } + } + $72 = $52 & -2; + $switch = ($72|0)!=(4); + $73 = HEAP32[$8>>2]|0; + $74 = ($73|0)==(0); + $or$cond5 = $switch | $74; + if ($or$cond5) { + $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$56$0 = 1;$image$sroa$59$1 = $image$sroa$59$0; + } else { + $75 = ((($header)) + 24|0); + $76 = HEAP32[$75>>2]|0; + $77 = ($76>>>0)>(1); + $78 = ((($header)) + 16|0); + $79 = HEAP32[$78>>2]|0; + $80 = $77&1; + $bufsize$0 = $79 << $80; + HEAP32[$vararg_buffer24>>2] = $79; + _TraceLog(3,12541,$vararg_buffer24); + $81 = (_malloc($bufsize$0)|0); + (_fread($81,1,$bufsize$0,$0)|0); + $82 = HEAP32[$75>>2]|0; + $83 = HEAP32[$8>>2]|0; + $switch$split12D = ($83|0)<(861165636); + if ($switch$split12D) { + switch ($83|0) { + case 827611204: { + break; + } + default: { + $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0; + break L24; + } + } + $84 = HEAP32[$6>>2]|0; + $85 = ($84|0)==(4); + $$ = $85 ? 8 : 9; + $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $$; + break; + } + $switch$split42D = ($83|0)<(894720068); + if ($switch$split42D) { + switch ($83|0) { + case 861165636: { + break; + } + default: { + $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0; + break L24; + } + } + $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 10; + break; + } else { + switch ($83|0) { + case 894720068: { + break; + } + default: { + $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = $image$sroa$59$0; + break L24; + } + } + $image$sroa$0$1 = $81;$image$sroa$56$0 = $82;$image$sroa$59$1 = 11; + break; + } + } + } + } while(0); + $image$sroa$0$2 = $image$sroa$0$1;$image$sroa$26$0 = $13;$image$sroa$41$0 = $15;$image$sroa$56$1 = $image$sroa$56$0;$image$sroa$59$2 = $image$sroa$59$1; + } else { + HEAP32[$vararg_buffer1>>2] = $fileName; + _TraceLog(2,12331,$vararg_buffer1); + $image$sroa$0$2 = 0;$image$sroa$26$0 = 0;$image$sroa$41$0 = 0;$image$sroa$56$1 = 0;$image$sroa$59$2 = 0; + } + (_fclose($0)|0); + $image$sroa$0$3 = $image$sroa$0$2;$image$sroa$26$1 = $image$sroa$26$0;$image$sroa$41$1 = $image$sroa$41$0;$image$sroa$56$2 = $image$sroa$56$1;$image$sroa$59$3 = $image$sroa$59$2; + HEAP32[$agg$result>>2] = $image$sroa$0$3; + $86 = ((($agg$result)) + 4|0); + HEAP32[$86>>2] = $image$sroa$26$1; + $87 = ((($agg$result)) + 8|0); + HEAP32[$87>>2] = $image$sroa$41$1; + $88 = ((($agg$result)) + 12|0); + HEAP32[$88>>2] = $image$sroa$56$2; + $89 = ((($agg$result)) + 16|0); + HEAP32[$89>>2] = $image$sroa$59$3; + STACKTOP = sp;return; +} +function _LoadPKM($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$ = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; + var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0; + var $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $vararg_buffer10 = sp + 32|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $header = sp + 40|0; + $0 = (_fopen($fileName,10906)|0); + $1 = ($0|0)==(0|0); + if ($1) { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,12125,$vararg_buffer); + $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$1 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0; + HEAP32[$agg$result>>2] = $image$sroa$0$1; + $43 = ((($agg$result)) + 4|0); + HEAP32[$43>>2] = $image$sroa$4$1; + $44 = ((($agg$result)) + 8|0); + HEAP32[$44>>2] = $image$sroa$7$1; + $45 = ((($agg$result)) + 12|0); + HEAP32[$45>>2] = $image$sroa$10$1; + $46 = ((($agg$result)) + 16|0); + HEAP32[$46>>2] = $image$sroa$12$1; + STACKTOP = sp;return; + } + (_fread($header,16,1,$0)|0); + $2 = (_strncmp($header,12159,4)|0); + $3 = ($2|0)==(0); + L5: do { + if ($3) { + $4 = ((($header)) + 6|0); + $5 = HEAP16[$4>>1]|0; + $6 = $5&65535; + $7 = $6 << 8; + $8 = $6 >>> 8; + $9 = $7 | $8; + $10 = $9&65535; + HEAP16[$4>>1] = $10; + $11 = ((($header)) + 8|0); + $12 = HEAP16[$11>>1]|0; + $13 = $12&65535; + $14 = $13 << 8; + $15 = $13 >>> 8; + $16 = $14 | $15; + $17 = $16&65535; + HEAP16[$11>>1] = $17; + $18 = ((($header)) + 10|0); + $19 = HEAP16[$18>>1]|0; + $20 = $19&65535; + $21 = $20 << 8; + $22 = $20 >>> 8; + $23 = $21 | $22; + $24 = $23&65535; + HEAP16[$18>>1] = $24; + $25 = HEAP16[$11>>1]|0; + $26 = $25&65535; + HEAP32[$vararg_buffer4>>2] = $26; + _TraceLog(3,12212,$vararg_buffer4); + $27 = HEAP16[$18>>1]|0; + $28 = $27&65535; + HEAP32[$vararg_buffer7>>2] = $28; + _TraceLog(3,12238,$vararg_buffer7); + $29 = HEAP16[$4>>1]|0; + $30 = $29&65535; + HEAP32[$vararg_buffer10>>2] = $30; + _TraceLog(3,12265,$vararg_buffer10); + $31 = HEAP16[$11>>1]|0; + $32 = $31&65535; + $33 = HEAP16[$18>>1]|0; + $34 = $33&65535; + $35 = HEAP16[$4>>1]|0; + $36 = ($35<<16>>16)==(3); + $$ = $36 ? 8 : 4; + $37 = Math_imul($34, $32)|0; + $38 = Math_imul($37, $$)|0; + $39 = $38 >>> 3; + $40 = (_malloc($39)|0); + (_fread($40,1,$39,$0)|0); + $41 = HEAP16[$4>>1]|0; + switch ($41<<16>>16) { + case 0: { + $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 12;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34; + break L5; + break; + } + case 1: { + $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = 13;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34; + break L5; + break; + } + default: { + $42 = ($41<<16>>16)==(3); + $$1 = $42 ? 14 : 0; + $image$sroa$0$0 = $40;$image$sroa$10$0 = 1;$image$sroa$12$0 = $$1;$image$sroa$4$0 = $32;$image$sroa$7$0 = $34; + break L5; + } + } + } else { + HEAP32[$vararg_buffer1>>2] = $fileName; + _TraceLog(2,12164,$vararg_buffer1); + $image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$0 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0; + } + } while(0); + (_fclose($0)|0); + $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0; + HEAP32[$agg$result>>2] = $image$sroa$0$1; + $43 = ((($agg$result)) + 4|0); + HEAP32[$43>>2] = $image$sroa$4$1; + $44 = ((($agg$result)) + 8|0); + HEAP32[$44>>2] = $image$sroa$7$1; + $45 = ((($agg$result)) + 12|0); + HEAP32[$45>>2] = $image$sroa$10$1; + $46 = ((($agg$result)) + 16|0); + HEAP32[$46>>2] = $image$sroa$12$1; + STACKTOP = sp;return; +} +function _LoadKTX($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dataSize = 0, $header = 0, $i$01 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$3$0 = 0, $image$sroa$3$1 = 0, $image$sroa$5$0 = 0, $image$sroa$5$1 = 0, $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$9$0 = 0, $image$sroa$9$1 = 0, $unused = 0, $vararg_buffer = 0; + var $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 112|0; + $vararg_buffer10 = sp + 32|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $header = sp + 40|0; + $unused = sp + 104|0; + $dataSize = sp + 36|0; + $0 = (_fopen($fileName,10906)|0); + $1 = ($0|0)==(0|0); + if ($1) { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,11956,$vararg_buffer); + $image$sroa$0$1 = 0;$image$sroa$3$1 = 0;$image$sroa$5$1 = 0;$image$sroa$7$1 = 0;$image$sroa$9$1 = 0; + HEAP32[$agg$result>>2] = $image$sroa$0$1; + $40 = ((($agg$result)) + 4|0); + HEAP32[$40>>2] = $image$sroa$3$1; + $41 = ((($agg$result)) + 8|0); + HEAP32[$41>>2] = $image$sroa$5$1; + $42 = ((($agg$result)) + 12|0); + HEAP32[$42>>2] = $image$sroa$7$1; + $43 = ((($agg$result)) + 16|0); + HEAP32[$43>>2] = $image$sroa$9$1; + STACKTOP = sp;return; + } + (_fread($header,64,1,$0)|0); + $2 = ((($header)) + 1|0); + $3 = HEAP8[$2>>0]|0; + $4 = ($3<<24>>24)==(75); + L5: do { + if ($4) { + $5 = ((($header)) + 2|0); + $6 = HEAP8[$5>>0]|0; + $7 = ($6<<24>>24)==(84); + if ($7) { + $8 = ((($header)) + 3|0); + $9 = HEAP8[$8>>0]|0; + $10 = ($9<<24>>24)==(88); + if ($10) { + $11 = ((($header)) + 4|0); + $12 = HEAP8[$11>>0]|0; + $13 = ($12<<24>>24)==(32); + if ($13) { + $14 = ((($header)) + 5|0); + $15 = HEAP8[$14>>0]|0; + $16 = ($15<<24>>24)==(49); + if ($16) { + $17 = ((($header)) + 6|0); + $18 = HEAP8[$17>>0]|0; + $19 = ($18<<24>>24)==(49); + if ($19) { + $20 = ((($header)) + 36|0); + $21 = HEAP32[$20>>2]|0; + $22 = ((($header)) + 40|0); + $23 = HEAP32[$22>>2]|0; + $24 = ((($header)) + 56|0); + $25 = HEAP32[$24>>2]|0; + HEAP32[$vararg_buffer4>>2] = $21; + _TraceLog(3,12043,$vararg_buffer4); + $26 = HEAP32[$22>>2]|0; + HEAP32[$vararg_buffer7>>2] = $26; + _TraceLog(3,12069,$vararg_buffer7); + $27 = ((($header)) + 28|0); + $28 = HEAP32[$27>>2]|0; + HEAP32[$vararg_buffer10>>2] = $28; + _TraceLog(3,12096,$vararg_buffer10); + $29 = ((($header)) + 60|0); + $30 = HEAP32[$29>>2]|0; + $31 = ($30|0)==(0); + if (!($31)) { + $32 = HEAP32[$29>>2]|0; + $i$01 = 0; + while(1) { + (_fread($unused,1,1,$0)|0); + $33 = (($i$01) + 1)|0; + $34 = ($33>>>0)<($32>>>0); + if ($34) { + $i$01 = $33; + } else { + break; + } + } + } + (_fread($dataSize,4,1,$0)|0); + $35 = HEAP32[$dataSize>>2]|0; + $36 = (_malloc($35)|0); + $37 = HEAP32[$dataSize>>2]|0; + (_fread($36,1,$37,$0)|0); + $38 = HEAP32[$27>>2]|0; + switch ($38|0) { + case 36196: { + $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 12; + break L5; + break; + } + case 37492: { + $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = 13; + break L5; + break; + } + default: { + $39 = ($38|0)==(37496); + $$ = $39 ? 14 : 0; + $image$sroa$0$0 = $36;$image$sroa$3$0 = $21;$image$sroa$5$0 = $23;$image$sroa$7$0 = $25;$image$sroa$9$0 = $$; + break L5; + } + } + } else { + label = 9; + } + } else { + label = 9; + } + } else { + label = 9; + } + } else { + label = 9; + } + } else { + label = 9; + } + } else { + label = 9; + } + } while(0); + if ((label|0) == 9) { + HEAP32[$vararg_buffer1>>2] = $fileName; + _TraceLog(2,11996,$vararg_buffer1); + $image$sroa$0$0 = 0;$image$sroa$3$0 = 0;$image$sroa$5$0 = 0;$image$sroa$7$0 = 0;$image$sroa$9$0 = 0; + } + (_fclose($0)|0); + $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$3$1 = $image$sroa$3$0;$image$sroa$5$1 = $image$sroa$5$0;$image$sroa$7$1 = $image$sroa$7$0;$image$sroa$9$1 = $image$sroa$9$0; + HEAP32[$agg$result>>2] = $image$sroa$0$1; + $40 = ((($agg$result)) + 4|0); + HEAP32[$40>>2] = $image$sroa$3$1; + $41 = ((($agg$result)) + 8|0); + HEAP32[$41>>2] = $image$sroa$5$1; + $42 = ((($agg$result)) + 12|0); + HEAP32[$42>>2] = $image$sroa$7$1; + $43 = ((($agg$result)) + 16|0); + HEAP32[$43>>2] = $image$sroa$9$1; + STACKTOP = sp;return; +} +function _LoadPVR($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$ = 0, $$1 = 0, $$2 = 0, $$pr = 0, $$pr3 = 0, $$pr5 = 0, $$pr7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0; + var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; + var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; + var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; + var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; + var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0; + var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $bpp$0 = 0, $header = 0, $i$08 = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$0$2 = 0, $image$sroa$10$0 = 0, $image$sroa$10$1 = 0, $image$sroa$10$2 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$12$2 = 0, $image$sroa$12$3 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$4$2 = 0; + var $image$sroa$7$0 = 0, $image$sroa$7$1 = 0, $image$sroa$7$2 = 0, $pvrVersion = 0, $unused = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 80|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $pvrVersion = sp + 73|0; + $header = sp + 20|0; + $unused = sp + 72|0; + $0 = (_fopen($fileName,10906)|0); + $1 = ($0|0)==(0|0); + if ($1) { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,11824,$vararg_buffer); + $image$sroa$0$2 = 0;$image$sroa$10$2 = 0;$image$sroa$12$3 = 0;$image$sroa$4$2 = 0;$image$sroa$7$2 = 0; + HEAP32[$agg$result>>2] = $image$sroa$0$2; + $113 = ((($agg$result)) + 4|0); + HEAP32[$113>>2] = $image$sroa$4$2; + $114 = ((($agg$result)) + 8|0); + HEAP32[$114>>2] = $image$sroa$7$2; + $115 = ((($agg$result)) + 12|0); + HEAP32[$115>>2] = $image$sroa$10$2; + $116 = ((($agg$result)) + 16|0); + HEAP32[$116>>2] = $image$sroa$12$3; + STACKTOP = sp;return; + } + HEAP8[$pvrVersion>>0] = 0; + (_fread($pvrVersion,1,1,$0)|0); + (_fseek($0,0,0)|0); + $2 = HEAP8[$pvrVersion>>0]|0; + switch ($2<<24>>24) { + case 80: { + (_fread($header,52,1,$0)|0); + $3 = HEAP8[$header>>0]|0; + $4 = ($3<<24>>24)==(80); + if ($4) { + $5 = ((($header)) + 1|0); + $6 = HEAP8[$5>>0]|0; + $7 = ($6<<24>>24)==(86); + if ($7) { + $8 = ((($header)) + 2|0); + $9 = HEAP8[$8>>0]|0; + $10 = ($9<<24>>24)==(82); + if ($10) { + $11 = ((($header)) + 3|0); + $12 = HEAP8[$11>>0]|0; + $13 = ($12<<24>>24)==(3); + if ($13) { + $14 = ((($header)) + 28|0); + $15 = HEAP32[$14>>2]|0; + $16 = ((($header)) + 24|0); + $17 = HEAP32[$16>>2]|0; + $18 = ((($header)) + 44|0); + $19 = HEAP32[$18>>2]|0; + $20 = ((($header)) + 8|0); + $21 = HEAP8[$20>>0]|0; + $22 = ($21<<24>>24)==(108); + do { + if ($22) { + $23 = ((($header)) + 9|0); + $24 = HEAP8[$23>>0]|0; + $25 = ($24<<24>>24)==(0); + if ($25) { + $26 = ((($header)) + 12|0); + $27 = HEAP8[$26>>0]|0; + $28 = ($27<<24>>24)==(8); + if ($28) { + $image$sroa$12$0 = 1; + break; + } + } + $$pr = HEAP8[$20>>0]|0; + $29 = ($$pr<<24>>24)==(108); + if ($29) { + $30 = ((($header)) + 9|0); + $31 = HEAP8[$30>>0]|0; + $32 = ($31<<24>>24)==(97); + if ($32) { + $33 = ((($header)) + 12|0); + $34 = HEAP8[$33>>0]|0; + $35 = ($34<<24>>24)==(8); + if ($35) { + $36 = ((($header)) + 13|0); + $37 = HEAP8[$36>>0]|0; + $38 = ($37<<24>>24)==(8); + if ($38) { + $image$sroa$12$0 = 2; + } else { + label = 16; + } + } else { + label = 16; + } + } else { + label = 16; + } + } else { + $39 = $$pr; + label = 17; + } + } else { + label = 16; + } + } while(0); + if ((label|0) == 16) { + $$pr3 = HEAP8[$20>>0]|0; + $39 = $$pr3; + label = 17; + } + L22: do { + if ((label|0) == 17) { + $40 = ($39<<24>>24)==(114); + if ($40) { + $41 = ((($header)) + 9|0); + $42 = HEAP8[$41>>0]|0; + $43 = ($42<<24>>24)==(103); + if ($43) { + $44 = ((($header)) + 10|0); + $45 = HEAP8[$44>>0]|0; + $46 = ($45<<24>>24)==(98); + if ($46) { + $47 = ((($header)) + 11|0); + $48 = HEAP8[$47>>0]|0; + switch ($48<<24>>24) { + case 97: { + break; + } + case 0: { + $83 = ((($header)) + 12|0); + $84 = HEAP8[$83>>0]|0; + $85 = ($84<<24>>24)==(5); + if ($85) { + $86 = ((($header)) + 13|0); + $87 = HEAP8[$86>>0]|0; + $88 = ($87<<24>>24)==(6); + if ($88) { + $89 = ((($header)) + 14|0); + $90 = HEAP8[$89>>0]|0; + $91 = ($90<<24>>24)==(5); + if ($91) { + $image$sroa$12$0 = 3; + break L22; + } + } + $$pr7 = HEAP8[$83>>0]|0; + $92 = $$pr7; + } else { + $92 = $84; + } + $93 = ($92<<24>>24)==(8); + if (!($93)) { + $image$sroa$12$0 = 0; + break L22; + } + $94 = ((($header)) + 13|0); + $95 = HEAP8[$94>>0]|0; + $96 = ($95<<24>>24)==(8); + if (!($96)) { + $image$sroa$12$0 = 0; + break L22; + } + $97 = ((($header)) + 14|0); + $98 = HEAP8[$97>>0]|0; + $99 = ($98<<24>>24)==(8); + $$1 = $99 ? 4 : 0; + $image$sroa$12$0 = $$1; + break L22; + break; + } + default: { + $image$sroa$12$0 = 0; + break L22; + } + } + $49 = ((($header)) + 12|0); + $50 = HEAP8[$49>>0]|0; + $51 = ($50<<24>>24)==(5); + if ($51) { + $52 = ((($header)) + 13|0); + $53 = HEAP8[$52>>0]|0; + $54 = ($53<<24>>24)==(5); + if ($54) { + $55 = ((($header)) + 14|0); + $56 = HEAP8[$55>>0]|0; + $57 = ($56<<24>>24)==(5); + if ($57) { + $58 = ((($header)) + 15|0); + $59 = HEAP8[$58>>0]|0; + $60 = ($59<<24>>24)==(1); + if ($60) { + $image$sroa$12$0 = 5; + break; + } + } + } + $$pr5 = HEAP8[$49>>0]|0; + $61 = $$pr5; + } else { + $61 = $50; + } + $62 = ($61<<24>>24)==(4); + if ($62) { + $63 = ((($header)) + 13|0); + $64 = HEAP8[$63>>0]|0; + $65 = ($64<<24>>24)==(4); + if ($65) { + $66 = ((($header)) + 14|0); + $67 = HEAP8[$66>>0]|0; + $68 = ($67<<24>>24)==(4); + if ($68) { + $69 = ((($header)) + 15|0); + $70 = HEAP8[$69>>0]|0; + $71 = ($70<<24>>24)==(4); + if ($71) { + $image$sroa$12$0 = 6; + break; + } + } + } + } + $72 = HEAP8[$49>>0]|0; + $73 = ($72<<24>>24)==(8); + if (!($73)) { + $image$sroa$12$0 = 0; + break; + } + $74 = ((($header)) + 13|0); + $75 = HEAP8[$74>>0]|0; + $76 = ($75<<24>>24)==(8); + if (!($76)) { + $image$sroa$12$0 = 0; + break; + } + $77 = ((($header)) + 14|0); + $78 = HEAP8[$77>>0]|0; + $79 = ($78<<24>>24)==(8); + if (!($79)) { + $image$sroa$12$0 = 0; + break; + } + $80 = ((($header)) + 15|0); + $81 = HEAP8[$80>>0]|0; + $82 = ($81<<24>>24)==(8); + $$ = $82 ? 7 : 0; + $image$sroa$12$0 = $$; + break; + } + } + } + $100 = HEAP8[$20>>0]|0; + $101 = ($100<<24>>24)==(2); + if ($101) { + $image$sroa$12$0 = 15; + } else { + $102 = ($100<<24>>24)==(3); + $$2 = $102 ? 16 : 0; + $image$sroa$12$0 = $$2; + } + } + } while(0); + HEAP8[$unused>>0] = 0; + $103 = ((($header)) + 48|0); + $104 = HEAP32[$103>>2]|0; + $105 = ($104|0)==(0); + if (!($105)) { + $i$08 = 0; + while(1) { + (_fread($unused,1,1,$0)|0); + $106 = (($i$08) + 1)|0; + $107 = HEAP32[$103>>2]|0; + $108 = ($106>>>0)<($107>>>0); + if ($108) { + $i$08 = $106; + } else { + break; + } + } + } + switch ($image$sroa$12$0|0) { + case 1: { + $bpp$0 = 8; + break; + } + case 6: case 3: case 5: case 2: { + $bpp$0 = 16; + break; + } + case 7: { + $bpp$0 = 32; + break; + } + case 4: { + $bpp$0 = 24; + break; + } + case 16: case 15: { + $bpp$0 = 4; + break; + } + default: { + $bpp$0 = 0; + } + } + $109 = Math_imul($17, $15)|0; + $110 = Math_imul($109, $bpp$0)|0; + $111 = (($110|0) / 8)&-1; + $112 = (_malloc($111)|0); + (_fread($112,$111,1,$0)|0); + $image$sroa$0$0 = $112;$image$sroa$10$0 = $19;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$4$0 = $15;$image$sroa$7$0 = $17; + } else { + label = 8; + } + } else { + label = 8; + } + } else { + label = 8; + } + } else { + label = 8; + } + if ((label|0) == 8) { + HEAP32[$vararg_buffer1>>2] = $fileName; + _TraceLog(2,11858,$vararg_buffer1); + $image$sroa$0$0 = 0;$image$sroa$10$0 = 0;$image$sroa$12$1 = 0;$image$sroa$4$0 = 0;$image$sroa$7$0 = 0; + } + $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$10$1 = $image$sroa$10$0;$image$sroa$12$2 = $image$sroa$12$1;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$7$1 = $image$sroa$7$0; + break; + } + case 52: { + _TraceLog(0,11906,$vararg_buffer4); + $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0; + break; + } + default: { + $image$sroa$0$1 = 0;$image$sroa$10$1 = 0;$image$sroa$12$2 = 0;$image$sroa$4$1 = 0;$image$sroa$7$1 = 0; + } + } + (_fclose($0)|0); + $image$sroa$0$2 = $image$sroa$0$1;$image$sroa$10$2 = $image$sroa$10$1;$image$sroa$12$3 = $image$sroa$12$2;$image$sroa$4$2 = $image$sroa$4$1;$image$sroa$7$2 = $image$sroa$7$1; + HEAP32[$agg$result>>2] = $image$sroa$0$2; + $113 = ((($agg$result)) + 4|0); + HEAP32[$113>>2] = $image$sroa$4$2; + $114 = ((($agg$result)) + 8|0); + HEAP32[$114>>2] = $image$sroa$7$2; + $115 = ((($agg$result)) + 12|0); + HEAP32[$115>>2] = $image$sroa$10$2; + $116 = ((($agg$result)) + 16|0); + HEAP32[$116>>2] = $image$sroa$12$3; + STACKTOP = sp;return; +} +function _LoadASTC($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $7 = 0, $8 = 0, $9 = 0, $header = 0, $image$sroa$0$0 = 0, $image$sroa$0$1 = 0, $image$sroa$12$0 = 0, $image$sroa$12$1 = 0, $image$sroa$14$0 = 0, $image$sroa$14$1 = 0, $image$sroa$4$0 = 0, $image$sroa$4$1 = 0, $image$sroa$8$0 = 0, $image$sroa$8$1 = 0, $or$cond = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer4 = 0; + var $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $vararg_buffer14 = sp + 40|0; + $vararg_buffer10 = sp + 32|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer1 = sp + 8|0; + $vararg_buffer = sp; + $header = sp + 48|0; + $0 = (_fopen($fileName,10906)|0); + $1 = ($0|0)==(0|0); + if ($1) { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,11623,$vararg_buffer); + $image$sroa$0$1 = 0;$image$sroa$12$1 = 0;$image$sroa$14$1 = 0;$image$sroa$4$1 = 0;$image$sroa$8$1 = 0; + HEAP32[$agg$result>>2] = $image$sroa$0$1; + $58 = ((($agg$result)) + 4|0); + HEAP32[$58>>2] = $image$sroa$4$1; + $59 = ((($agg$result)) + 8|0); + HEAP32[$59>>2] = $image$sroa$8$1; + $60 = ((($agg$result)) + 12|0); + HEAP32[$60>>2] = $image$sroa$12$1; + $61 = ((($agg$result)) + 16|0); + HEAP32[$61>>2] = $image$sroa$14$1; + STACKTOP = sp;return; + } + (_fread($header,16,1,$0)|0); + $2 = ((($header)) + 3|0); + $3 = HEAP8[$2>>0]|0; + $4 = ($3<<24>>24)==(92); + L5: do { + if ($4) { + $5 = ((($header)) + 2|0); + $6 = HEAP8[$5>>0]|0; + $7 = ($6<<24>>24)==(-95); + if ($7) { + $8 = ((($header)) + 1|0); + $9 = HEAP8[$8>>0]|0; + $10 = ($9<<24>>24)==(-85); + $11 = HEAP8[$header>>0]|0; + $12 = ($11<<24>>24)==(19); + $or$cond = $10 & $12; + if ($or$cond) { + $13 = ((($header)) + 9|0); + $14 = HEAP8[$13>>0]|0; + $15 = $14&255; + $16 = $15 << 16; + $17 = ((($header)) + 8|0); + $18 = HEAP8[$17>>0]|0; + $19 = $18&255; + $20 = $19 << 8; + $21 = $20 | $16; + $22 = ((($header)) + 7|0); + $23 = HEAP8[$22>>0]|0; + $24 = $23&255; + $25 = $21 | $24; + $26 = ((($header)) + 12|0); + $27 = HEAP8[$26>>0]|0; + $28 = $27&255; + $29 = $28 << 16; + $30 = ((($header)) + 11|0); + $31 = HEAP8[$30>>0]|0; + $32 = $31&255; + $33 = $32 << 8; + $34 = $33 | $29; + $35 = ((($header)) + 10|0); + $36 = HEAP8[$35>>0]|0; + $37 = $36&255; + $38 = $34 | $37; + HEAP32[$vararg_buffer4>>2] = $25; + _TraceLog(3,11707,$vararg_buffer4); + HEAP32[$vararg_buffer7>>2] = $38; + _TraceLog(3,11728,$vararg_buffer7); + $39 = ((($header)) + 4|0); + $40 = HEAP8[$39>>0]|0; + $41 = $40&255; + $42 = ((($header)) + 5|0); + $43 = HEAP8[$42>>0]|0; + $44 = $43&255; + HEAP32[$vararg_buffer10>>2] = $41; + $vararg_ptr13 = ((($vararg_buffer10)) + 4|0); + HEAP32[$vararg_ptr13>>2] = $44; + _TraceLog(3,11750,$vararg_buffer10); + $45 = HEAP8[$39>>0]|0; + $46 = $45&255; + $47 = HEAP8[$42>>0]|0; + $48 = $47&255; + $49 = Math_imul($48, $46)|0; + $50 = (128 / ($49>>>0))&-1; + $51 = ($50|0)==(8); + $52 = ($50|0)==(2); + switch ($50|0) { + case 2: case 8: { + $53 = Math_imul($38, $25)|0; + $54 = Math_imul($53, $50)|0; + $55 = $54 >>> 3; + $56 = (_malloc($55)|0); + (_fread($56,$55,1,$0)|0); + $57 = $51 | $52; + $$$ = $57 ? 17 : 0; + $image$sroa$0$0 = $56;$image$sroa$12$0 = 1;$image$sroa$14$0 = $$$;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38; + break L5; + break; + } + default: { + HEAP32[$vararg_buffer14>>2] = $fileName; + _TraceLog(2,11775,$vararg_buffer14); + $image$sroa$0$0 = 0;$image$sroa$12$0 = 1;$image$sroa$14$0 = 0;$image$sroa$4$0 = $25;$image$sroa$8$0 = $38; + break L5; + } + } + } else { + label = 6; + } + } else { + label = 6; + } + } else { + label = 6; + } + } while(0); + if ((label|0) == 6) { + HEAP32[$vararg_buffer1>>2] = $fileName; + _TraceLog(2,11658,$vararg_buffer1); + $image$sroa$0$0 = 0;$image$sroa$12$0 = 0;$image$sroa$14$0 = 0;$image$sroa$4$0 = 0;$image$sroa$8$0 = 0; + } + (_fclose($0)|0); + $image$sroa$0$1 = $image$sroa$0$0;$image$sroa$12$1 = $image$sroa$12$0;$image$sroa$14$1 = $image$sroa$14$0;$image$sroa$4$1 = $image$sroa$4$0;$image$sroa$8$1 = $image$sroa$8$0; + HEAP32[$agg$result>>2] = $image$sroa$0$1; + $58 = ((($agg$result)) + 4|0); + HEAP32[$58>>2] = $image$sroa$4$1; + $59 = ((($agg$result)) + 8|0); + HEAP32[$59>>2] = $image$sroa$8$1; + $60 = ((($agg$result)) + 12|0); + HEAP32[$60>>2] = $image$sroa$12$1; + $61 = ((($agg$result)) + 16|0); + HEAP32[$61>>2] = $image$sroa$14$1; + STACKTOP = sp;return; +} +function _LoadOBJ($agg$result,$fileName) { + $agg$result = $agg$result|0; + $fileName = $fileName|0; + var $$byval_copy89 = 0, $$byval_copy90 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; + var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; + var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; + var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0; + var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0; + var $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0; + var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0; + var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0; + var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0.0, $246 = 0.0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0; + var $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0.0, $272 = 0.0, $273 = 0, $274 = 0, $275 = 0; + var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0; + var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0; + var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0; + var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0; + var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $comments = 0, $countNormals$0$ph41 = 0, $countNormals$0$ph838 = 0, $countNormals$0$ph838$lcssa = 0, $countTexCoords$0$ph1137 = 0, $countTexCoords$0$ph1137$lcssa = 0, $countTexCoords$0$ph1137$lcssa218 = 0, $countTexCoords$0$ph42 = 0, $countTexCoords$0$ph939 = 0, $countVertex$0$ph40 = 0; + var $dataType = 0, $mesh$sroa$48 = 0, $midNormals$0 = 0, $midTexCoords$0 = 0, $nCounter$0$ph = 0, $nCounter$0$ph$ph = 0, $nCounter$1 = 0, $nCounter$1$lcssa = 0, $norm = 0, $numNormals$0$ph16$lcssa32 = 0, $numNormals$0$ph1671 = 0, $numNormals$0$ph1671$lcssa234 = 0, $numNormals$0$ph83 = 0, $numTexCoords$0$ph1772 = 0, $numTexCoords$0$ph20$lcssa31 = 0, $numTexCoords$0$ph2061 = 0, $numTexCoords$0$ph2061$lcssa229 = 0, $numTexCoords$0$ph2061$lcssa230 = 0, $numTexCoords$0$ph84 = 0, $numTriangles$0$ph1873 = 0; + var $numTriangles$0$ph2162 = 0, $numTriangles$0$ph23$lcssa28 = 0, $numTriangles$0$ph2352 = 0, $numTriangles$0$ph2352$lcssa = 0, $numTriangles$0$ph2352$lcssa$lcssa = 0, $numTriangles$0$ph2352$lcssa$lcssa226 = 0, $numTriangles$0$ph85 = 0, $numVertex$0$ph$lcssa = 0, $numVertex$0$ph82 = 0, $or$cond = 0, $tcCounter$0$ph$ph = 0, $useless = 0, $vCounter$0$ph = 0, $vCounter$0$ph$ph = 0, $vNum = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0; + var $vararg_buffer29 = 0, $vararg_buffer34 = 0, $vararg_buffer37 = 0, $vararg_buffer4 = 0, $vararg_buffer42 = 0, $vararg_buffer45 = 0, $vararg_buffer50 = 0, $vararg_buffer53 = 0, $vararg_buffer56 = 0, $vararg_buffer59 = 0, $vararg_buffer64 = 0, $vararg_buffer7 = 0, $vararg_buffer72 = 0, $vararg_buffer83 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0, $vararg_ptr18 = 0, $vararg_ptr22 = 0, $vararg_ptr32 = 0, $vararg_ptr33 = 0; + var $vararg_ptr40 = 0, $vararg_ptr41 = 0, $vararg_ptr48 = 0, $vararg_ptr49 = 0, $vararg_ptr62 = 0, $vararg_ptr63 = 0, $vararg_ptr67 = 0, $vararg_ptr68 = 0, $vararg_ptr69 = 0, $vararg_ptr70 = 0, $vararg_ptr71 = 0, $vararg_ptr75 = 0, $vararg_ptr76 = 0, $vararg_ptr77 = 0, $vararg_ptr78 = 0, $vararg_ptr79 = 0, $vararg_ptr80 = 0, $vararg_ptr81 = 0, $vararg_ptr82 = 0, $vnNum = 0; + var $vtNum = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 592|0; + $$byval_copy90 = sp + 288|0; + $$byval_copy89 = sp + 272|0; + $vararg_buffer83 = sp + 264|0; + $vararg_buffer72 = sp + 224|0; + $vararg_buffer64 = sp + 200|0; + $vararg_buffer59 = sp + 184|0; + $vararg_buffer56 = sp + 176|0; + $vararg_buffer53 = sp + 168|0; + $vararg_buffer50 = sp + 160|0; + $vararg_buffer45 = sp + 144|0; + $vararg_buffer42 = sp + 136|0; + $vararg_buffer37 = sp + 120|0; + $vararg_buffer34 = sp + 112|0; + $vararg_buffer29 = sp + 96|0; + $vararg_buffer26 = sp + 88|0; + $vararg_buffer23 = sp + 80|0; + $vararg_buffer11 = sp + 72|0; + $vararg_buffer7 = sp + 64|0; + $vararg_buffer4 = sp + 56|0; + $vararg_buffer1 = sp + 48|0; + $vararg_buffer = sp + 40|0; + $mesh$sroa$48 = sp; + $dataType = sp + 576|0; + $comments = sp + 376|0; + $useless = sp + 372|0; + $vNum = sp + 360|0; + $vtNum = sp + 348|0; + $vnNum = sp + 336|0; + $norm = sp + 324|0; + $0 = sp + 312|0; + $1 = sp + 300|0; + dest=$mesh$sroa$48; stop=dest+36|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); + $2 = (_fopen($fileName,11292)|0); + $3 = ($2|0)==(0|0); + if ($3) { + HEAP32[$vararg_buffer>>2] = $fileName; + _TraceLog(2,11295,$vararg_buffer); + $6 = ((($agg$result)) + 32|0); + ;HEAP32[$agg$result>>2]=0|0;HEAP32[$agg$result+4>>2]=0|0;HEAP32[$agg$result+8>>2]=0|0;HEAP32[$agg$result+12>>2]=0|0;HEAP32[$agg$result+16>>2]=0|0;HEAP32[$agg$result+20>>2]=0|0;HEAP32[$agg$result+24>>2]=0|0;HEAP32[$agg$result+28>>2]=0|0; + dest=$6; src=$mesh$sroa$48; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; + } + $4 = (_feof($2)|0); + $5 = ($4|0)==(0); + L5: do { + if ($5) { + $numNormals$0$ph83 = 0;$numTexCoords$0$ph84 = 0;$numTriangles$0$ph85 = 0;$numVertex$0$ph82 = 0; + while(1) { + $numNormals$0$ph1671 = $numNormals$0$ph83;$numTexCoords$0$ph1772 = $numTexCoords$0$ph84;$numTriangles$0$ph1873 = $numTriangles$0$ph85; + L8: while(1) { + $numTexCoords$0$ph2061 = $numTexCoords$0$ph1772;$numTriangles$0$ph2162 = $numTriangles$0$ph1873; + L10: while(1) { + $numTriangles$0$ph2352 = $numTriangles$0$ph2162; + L12: while(1) { + L14: while(1) { + HEAP32[$vararg_buffer1>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer1)|0); + $7 = HEAP8[$dataType>>0]|0; + $8 = $7 << 24 >> 24; + switch ($8|0) { + case 118: { + $numTriangles$0$ph2352$lcssa = $numTriangles$0$ph2352; + break L12; + break; + } + case 102: { + break L14; + break; + } + case 117: case 109: case 115: case 103: case 111: case 35: { + (_fgets($comments,200,$2)|0); + break; + } + default: { + } + } + $9 = (_feof($2)|0); + $10 = ($9|0)==(0); + if (!($10)) { + $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352;$numVertex$0$ph$lcssa = $numVertex$0$ph82; + break L5; + } + } + $21 = (($numTriangles$0$ph2352) + 1)|0; + (_fgets($comments,200,$2)|0); + $22 = (_feof($2)|0); + $23 = ($22|0)==(0); + if ($23) { + $numTriangles$0$ph2352 = $21; + } else { + $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061;$numTriangles$0$ph23$lcssa28 = $21;$numVertex$0$ph$lcssa = $numVertex$0$ph82; + break L5; + } + } + HEAP32[$vararg_buffer4>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer4)|0); + $11 = HEAP8[$dataType>>0]|0; + switch ($11<<24>>24) { + case 110: { + $numTexCoords$0$ph2061$lcssa230 = $numTexCoords$0$ph2061;$numTriangles$0$ph2352$lcssa$lcssa226 = $numTriangles$0$ph2352$lcssa; + break L10; + break; + } + case 116: { + break; + } + default: { + $numNormals$0$ph1671$lcssa234 = $numNormals$0$ph1671;$numTexCoords$0$ph2061$lcssa229 = $numTexCoords$0$ph2061;$numTriangles$0$ph2352$lcssa$lcssa = $numTriangles$0$ph2352$lcssa; + break L8; + } + } + $12 = (($numTexCoords$0$ph2061) + 1)|0; + (_fgets($comments,200,$2)|0); + $13 = (_feof($2)|0); + $14 = ($13|0)==(0); + if ($14) { + $numTexCoords$0$ph2061 = $12;$numTriangles$0$ph2162 = $numTriangles$0$ph2352$lcssa; + } else { + $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671;$numTexCoords$0$ph20$lcssa31 = $12;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352$lcssa;$numVertex$0$ph$lcssa = $numVertex$0$ph82; + break L5; + } + } + $15 = (($numNormals$0$ph1671) + 1)|0; + (_fgets($comments,200,$2)|0); + $16 = (_feof($2)|0); + $17 = ($16|0)==(0); + if ($17) { + $numNormals$0$ph1671 = $15;$numTexCoords$0$ph1772 = $numTexCoords$0$ph2061$lcssa230;$numTriangles$0$ph1873 = $numTriangles$0$ph2352$lcssa$lcssa226; + } else { + $numNormals$0$ph16$lcssa32 = $15;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061$lcssa230;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352$lcssa$lcssa226;$numVertex$0$ph$lcssa = $numVertex$0$ph82; + break L5; + } + } + $18 = (($numVertex$0$ph82) + 1)|0; + (_fgets($comments,200,$2)|0); + $19 = (_feof($2)|0); + $20 = ($19|0)==(0); + if ($20) { + $numNormals$0$ph83 = $numNormals$0$ph1671$lcssa234;$numTexCoords$0$ph84 = $numTexCoords$0$ph2061$lcssa229;$numTriangles$0$ph85 = $numTriangles$0$ph2352$lcssa$lcssa;$numVertex$0$ph82 = $18; + } else { + $numNormals$0$ph16$lcssa32 = $numNormals$0$ph1671$lcssa234;$numTexCoords$0$ph20$lcssa31 = $numTexCoords$0$ph2061$lcssa229;$numTriangles$0$ph23$lcssa28 = $numTriangles$0$ph2352$lcssa$lcssa;$numVertex$0$ph$lcssa = $18; + break; + } + } + } else { + $numNormals$0$ph16$lcssa32 = 0;$numTexCoords$0$ph20$lcssa31 = 0;$numTriangles$0$ph23$lcssa28 = 0;$numVertex$0$ph$lcssa = 0; + } + } while(0); + HEAP32[$vararg_buffer7>>2] = $fileName; + $vararg_ptr10 = ((($vararg_buffer7)) + 4|0); + HEAP32[$vararg_ptr10>>2] = $numVertex$0$ph$lcssa; + _TraceLog(3,11332,$vararg_buffer7); + HEAP32[$vararg_buffer11>>2] = $fileName; + $vararg_ptr14 = ((($vararg_buffer11)) + 4|0); + HEAP32[$vararg_ptr14>>2] = $numTexCoords$0$ph20$lcssa31; + _TraceLog(3,11360,$vararg_buffer11); + HEAP32[$$byval_copy89>>2] = $fileName; + $vararg_ptr18 = ((($$byval_copy89)) + 4|0); + HEAP32[$vararg_ptr18>>2] = $numNormals$0$ph16$lcssa32; + _TraceLog(3,11389,$$byval_copy89); + HEAP32[$$byval_copy90>>2] = $fileName; + $vararg_ptr22 = ((($$byval_copy90)) + 4|0); + HEAP32[$vararg_ptr22>>2] = $numTriangles$0$ph23$lcssa28; + _TraceLog(3,11416,$$byval_copy90); + $24 = ($numVertex$0$ph$lcssa*12)|0; + $25 = (_malloc($24)|0); + $26 = ($numNormals$0$ph16$lcssa32|0)>(0); + if ($26) { + $27 = ($numNormals$0$ph16$lcssa32*12)|0; + $28 = (_malloc($27)|0); + $midNormals$0 = $28; + } else { + $midNormals$0 = 0; + } + $29 = ($numTexCoords$0$ph20$lcssa31|0)>(0); + if ($29) { + $30 = $numTexCoords$0$ph20$lcssa31 << 3; + $31 = (_malloc($30)|0); + $midTexCoords$0 = $31; + } else { + $midTexCoords$0 = 0; + } + _rewind($2); + $32 = (_feof($2)|0); + $33 = ($32|0)==(0); + L31: do { + if ($33) { + $countNormals$0$ph41 = 0;$countTexCoords$0$ph42 = 0;$countVertex$0$ph40 = 0; + while(1) { + $countNormals$0$ph838 = $countNormals$0$ph41;$countTexCoords$0$ph939 = $countTexCoords$0$ph42; + L34: while(1) { + $countTexCoords$0$ph1137 = $countTexCoords$0$ph939; + L36: while(1) { + L38: while(1) { + HEAP32[$vararg_buffer23>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer23)|0); + $34 = HEAP8[$dataType>>0]|0; + $35 = $34 << 24 >> 24; + switch ($35|0) { + case 118: { + break L38; + break; + } + case 102: case 117: case 109: case 115: case 103: case 111: case 35: { + (_fgets($comments,200,$2)|0); + break; + } + default: { + } + } + $36 = (_feof($2)|0); + $37 = ($36|0)==(0); + if (!($37)) { + break L31; + } + } + HEAP32[$vararg_buffer26>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer26)|0); + $38 = HEAP8[$dataType>>0]|0; + switch ($38<<24>>24) { + case 110: { + $countTexCoords$0$ph1137$lcssa218 = $countTexCoords$0$ph1137; + break L36; + break; + } + case 116: { + break; + } + default: { + $countNormals$0$ph838$lcssa = $countNormals$0$ph838;$countTexCoords$0$ph1137$lcssa = $countTexCoords$0$ph1137; + break L34; + } + } + HEAPF32[$useless>>2] = 0.0; + $39 = (($midTexCoords$0) + ($countTexCoords$0$ph1137<<3)|0); + $40 = (((($midTexCoords$0) + ($countTexCoords$0$ph1137<<3)|0)) + 4|0); + HEAP32[$vararg_buffer29>>2] = $39; + $vararg_ptr32 = ((($vararg_buffer29)) + 4|0); + HEAP32[$vararg_ptr32>>2] = $40; + $vararg_ptr33 = ((($vararg_buffer29)) + 8|0); + HEAP32[$vararg_ptr33>>2] = $useless; + (_fscanf($2,11445,$vararg_buffer29)|0); + $41 = (($countTexCoords$0$ph1137) + 1)|0; + HEAP32[$vararg_buffer34>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer34)|0); + $42 = (_feof($2)|0); + $43 = ($42|0)==(0); + if ($43) { + $countTexCoords$0$ph1137 = $41; + } else { + break L31; + } + } + $44 = (($midNormals$0) + (($countNormals$0$ph838*12)|0)|0); + $45 = (((($midNormals$0) + (($countNormals$0$ph838*12)|0)|0)) + 4|0); + $46 = (((($midNormals$0) + (($countNormals$0$ph838*12)|0)|0)) + 8|0); + HEAP32[$vararg_buffer37>>2] = $44; + $vararg_ptr40 = ((($vararg_buffer37)) + 4|0); + HEAP32[$vararg_ptr40>>2] = $45; + $vararg_ptr41 = ((($vararg_buffer37)) + 8|0); + HEAP32[$vararg_ptr41>>2] = $46; + (_fscanf($2,11445,$vararg_buffer37)|0); + $47 = (($countNormals$0$ph838) + 1)|0; + HEAP32[$vararg_buffer42>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer42)|0); + $48 = (_feof($2)|0); + $49 = ($48|0)==(0); + if ($49) { + $countNormals$0$ph838 = $47;$countTexCoords$0$ph939 = $countTexCoords$0$ph1137$lcssa218; + } else { + break L31; + } + } + $50 = (($25) + (($countVertex$0$ph40*12)|0)|0); + $51 = (((($25) + (($countVertex$0$ph40*12)|0)|0)) + 4|0); + $52 = (((($25) + (($countVertex$0$ph40*12)|0)|0)) + 8|0); + HEAP32[$vararg_buffer45>>2] = $50; + $vararg_ptr48 = ((($vararg_buffer45)) + 4|0); + HEAP32[$vararg_ptr48>>2] = $51; + $vararg_ptr49 = ((($vararg_buffer45)) + 8|0); + HEAP32[$vararg_ptr49>>2] = $52; + (_fscanf($2,11445,$vararg_buffer45)|0); + $53 = (($countVertex$0$ph40) + 1)|0; + HEAP32[$vararg_buffer50>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer50)|0); + $54 = (_feof($2)|0); + $55 = ($54|0)==(0); + if ($55) { + $countNormals$0$ph41 = $countNormals$0$ph838$lcssa;$countTexCoords$0$ph42 = $countTexCoords$0$ph1137$lcssa;$countVertex$0$ph40 = $53; + } else { + break; + } + } + } + } while(0); + $56 = ($numTriangles$0$ph23$lcssa28*3)|0; + $57 = ($numTriangles$0$ph23$lcssa28*36)|0; + $58 = (_malloc($57)|0); + $59 = ($numTriangles$0$ph23$lcssa28*6)|0; + $60 = ($numTriangles$0$ph23$lcssa28*24)|0; + $61 = (_malloc($60)|0); + $62 = (_malloc($57)|0); + _rewind($2); + $63 = ($numNormals$0$ph16$lcssa32|0)==(0); + if ($63) { + HEAP32[$vararg_buffer53>>2] = $fileName; + _TraceLog(0,11454,$vararg_buffer53); + } + $64 = $numTexCoords$0$ph20$lcssa31 | $numNormals$0$ph16$lcssa32; + $65 = ($64|0)==(0); + $66 = ((($vNum)) + 4|0); + $67 = ((($vNum)) + 8|0); + $68 = ((($vNum)) + 4|0); + $69 = ((($vNum)) + 8|0); + $70 = ((($vnNum)) + 4|0); + $71 = ((($vnNum)) + 8|0); + $72 = ((($norm)) + 4|0); + $73 = ((($norm)) + 8|0); + $74 = ((($vNum)) + 4|0); + $75 = ((($vtNum)) + 4|0); + $76 = ((($vNum)) + 8|0); + $77 = ((($vtNum)) + 8|0); + $78 = ((($vNum)) + 4|0); + $79 = ((($vtNum)) + 4|0); + $80 = ((($vnNum)) + 4|0); + $81 = ((($vNum)) + 8|0); + $82 = ((($vtNum)) + 8|0); + $83 = ((($vnNum)) + 8|0); + $84 = ((($vtNum)) + 4|0); + $85 = ((($vtNum)) + 8|0); + $nCounter$0$ph$ph = 0;$tcCounter$0$ph$ph = 0;$vCounter$0$ph$ph = 0; + L51: while(1) { + $nCounter$0$ph = $nCounter$0$ph$ph;$vCounter$0$ph = $vCounter$0$ph$ph; + while(1) { + $86 = (_feof($2)|0); + $87 = ($86|0)==(0); + if (!($87)) { + break L51; + } + L55: while(1) { + HEAP32[$vararg_buffer56>>2] = $dataType; + (_fscanf($2,11329,$vararg_buffer56)|0); + $88 = HEAP8[$dataType>>0]|0; + $89 = $88 << 24 >> 24; + switch ($89|0) { + case 102: { + break L55; + break; + } + case 118: case 117: case 109: case 115: case 103: case 111: case 35: { + (_fgets($comments,200,$2)|0); + break; + } + default: { + } + } + $90 = (_feof($2)|0); + $91 = ($90|0)==(0); + if (!($91)) { + break L51; + } + } + do { + if ($65) { + HEAP32[$vararg_buffer59>>2] = $vNum; + $vararg_ptr62 = ((($vararg_buffer59)) + 4|0); + HEAP32[$vararg_ptr62>>2] = $66; + $vararg_ptr63 = ((($vararg_buffer59)) + 8|0); + HEAP32[$vararg_ptr63>>2] = $67; + (_fscanf($2,11525,$vararg_buffer59)|0); + } else { + if ($63) { + HEAP32[$vararg_buffer64>>2] = $vNum; + $vararg_ptr67 = ((($vararg_buffer64)) + 4|0); + HEAP32[$vararg_ptr67>>2] = $vtNum; + $vararg_ptr68 = ((($vararg_buffer64)) + 8|0); + HEAP32[$vararg_ptr68>>2] = $74; + $vararg_ptr69 = ((($vararg_buffer64)) + 12|0); + HEAP32[$vararg_ptr69>>2] = $75; + $vararg_ptr70 = ((($vararg_buffer64)) + 16|0); + HEAP32[$vararg_ptr70>>2] = $76; + $vararg_ptr71 = ((($vararg_buffer64)) + 20|0); + HEAP32[$vararg_ptr71>>2] = $77; + (_fscanf($2,11534,$vararg_buffer64)|0); + break; + } else { + HEAP32[$vararg_buffer72>>2] = $vNum; + $vararg_ptr75 = ((($vararg_buffer72)) + 4|0); + HEAP32[$vararg_ptr75>>2] = $vtNum; + $vararg_ptr76 = ((($vararg_buffer72)) + 8|0); + HEAP32[$vararg_ptr76>>2] = $vnNum; + $vararg_ptr77 = ((($vararg_buffer72)) + 12|0); + HEAP32[$vararg_ptr77>>2] = $78; + $vararg_ptr78 = ((($vararg_buffer72)) + 16|0); + HEAP32[$vararg_ptr78>>2] = $79; + $vararg_ptr79 = ((($vararg_buffer72)) + 20|0); + HEAP32[$vararg_ptr79>>2] = $80; + $vararg_ptr80 = ((($vararg_buffer72)) + 24|0); + HEAP32[$vararg_ptr80>>2] = $81; + $vararg_ptr81 = ((($vararg_buffer72)) + 28|0); + HEAP32[$vararg_ptr81>>2] = $82; + $vararg_ptr82 = ((($vararg_buffer72)) + 32|0); + HEAP32[$vararg_ptr82>>2] = $83; + (_fscanf($2,11552,$vararg_buffer72)|0); + break; + } + } + } while(0); + $92 = HEAP32[$vNum>>2]|0; + $93 = (($92) + -1)|0; + $94 = (($25) + (($93*12)|0)|0); + $95 = HEAP32[$94>>2]|0; + $96 = (($58) + ($vCounter$0$ph<<2)|0); + HEAP32[$96>>2] = $95; + $97 = HEAP32[$vNum>>2]|0; + $98 = (($97) + -1)|0; + $99 = (((($25) + (($98*12)|0)|0)) + 4|0); + $100 = HEAP32[$99>>2]|0; + $101 = (($vCounter$0$ph) + 1)|0; + $102 = (($58) + ($101<<2)|0); + HEAP32[$102>>2] = $100; + $103 = HEAP32[$vNum>>2]|0; + $104 = (($103) + -1)|0; + $105 = (((($25) + (($104*12)|0)|0)) + 8|0); + $106 = HEAP32[$105>>2]|0; + $107 = (($vCounter$0$ph) + 2)|0; + $108 = (($58) + ($107<<2)|0); + HEAP32[$108>>2] = $106; + $109 = (($vCounter$0$ph) + 3)|0; + $110 = HEAP32[$68>>2]|0; + $111 = (($110) + -1)|0; + $112 = (($25) + (($111*12)|0)|0); + $113 = HEAP32[$112>>2]|0; + $114 = (($58) + ($109<<2)|0); + HEAP32[$114>>2] = $113; + $115 = HEAP32[$68>>2]|0; + $116 = (($115) + -1)|0; + $117 = (((($25) + (($116*12)|0)|0)) + 4|0); + $118 = HEAP32[$117>>2]|0; + $119 = (($vCounter$0$ph) + 4)|0; + $120 = (($58) + ($119<<2)|0); + HEAP32[$120>>2] = $118; + $121 = HEAP32[$68>>2]|0; + $122 = (($121) + -1)|0; + $123 = (((($25) + (($122*12)|0)|0)) + 8|0); + $124 = HEAP32[$123>>2]|0; + $125 = (($vCounter$0$ph) + 5)|0; + $126 = (($58) + ($125<<2)|0); + HEAP32[$126>>2] = $124; + $127 = (($vCounter$0$ph) + 6)|0; + $128 = HEAP32[$69>>2]|0; + $129 = (($128) + -1)|0; + $130 = (($25) + (($129*12)|0)|0); + $131 = HEAP32[$130>>2]|0; + $132 = (($58) + ($127<<2)|0); + HEAP32[$132>>2] = $131; + $133 = HEAP32[$69>>2]|0; + $134 = (($133) + -1)|0; + $135 = (((($25) + (($134*12)|0)|0)) + 4|0); + $136 = HEAP32[$135>>2]|0; + $137 = (($vCounter$0$ph) + 7)|0; + $138 = (($58) + ($137<<2)|0); + HEAP32[$138>>2] = $136; + $139 = HEAP32[$69>>2]|0; + $140 = (($139) + -1)|0; + $141 = (((($25) + (($140*12)|0)|0)) + 8|0); + $142 = HEAP32[$141>>2]|0; + $143 = (($vCounter$0$ph) + 8)|0; + $144 = (($58) + ($143<<2)|0); + HEAP32[$144>>2] = $142; + $145 = (($vCounter$0$ph) + 9)|0; + if ($26) { + $146 = HEAP32[$vnNum>>2]|0; + $147 = (($146) + -1)|0; + $148 = (($midNormals$0) + (($147*12)|0)|0); + $149 = HEAP32[$148>>2]|0; + $150 = (($62) + ($nCounter$0$ph<<2)|0); + HEAP32[$150>>2] = $149; + $151 = HEAP32[$vnNum>>2]|0; + $152 = (($151) + -1)|0; + $153 = (((($midNormals$0) + (($152*12)|0)|0)) + 4|0); + $154 = HEAP32[$153>>2]|0; + $155 = (($nCounter$0$ph) + 1)|0; + $156 = (($62) + ($155<<2)|0); + HEAP32[$156>>2] = $154; + $157 = HEAP32[$vnNum>>2]|0; + $158 = (($157) + -1)|0; + $159 = (((($midNormals$0) + (($158*12)|0)|0)) + 8|0); + $160 = HEAP32[$159>>2]|0; + $161 = (($nCounter$0$ph) + 2)|0; + $162 = (($62) + ($161<<2)|0); + HEAP32[$162>>2] = $160; + $163 = (($nCounter$0$ph) + 3)|0; + $164 = HEAP32[$70>>2]|0; + $165 = (($164) + -1)|0; + $166 = (($midNormals$0) + (($165*12)|0)|0); + $167 = HEAP32[$166>>2]|0; + $168 = (($62) + ($163<<2)|0); + HEAP32[$168>>2] = $167; + $169 = HEAP32[$70>>2]|0; + $170 = (($169) + -1)|0; + $171 = (((($midNormals$0) + (($170*12)|0)|0)) + 4|0); + $172 = HEAP32[$171>>2]|0; + $173 = (($nCounter$0$ph) + 4)|0; + $174 = (($62) + ($173<<2)|0); + HEAP32[$174>>2] = $172; + $175 = HEAP32[$70>>2]|0; + $176 = (($175) + -1)|0; + $177 = (((($midNormals$0) + (($176*12)|0)|0)) + 8|0); + $178 = HEAP32[$177>>2]|0; + $179 = (($nCounter$0$ph) + 5)|0; + $180 = (($62) + ($179<<2)|0); + HEAP32[$180>>2] = $178; + $181 = (($nCounter$0$ph) + 6)|0; + $182 = HEAP32[$71>>2]|0; + $183 = (($182) + -1)|0; + $184 = (($midNormals$0) + (($183*12)|0)|0); + $185 = HEAP32[$184>>2]|0; + $186 = (($62) + ($181<<2)|0); + HEAP32[$186>>2] = $185; + $187 = HEAP32[$71>>2]|0; + $188 = (($187) + -1)|0; + $189 = (((($midNormals$0) + (($188*12)|0)|0)) + 4|0); + $190 = HEAP32[$189>>2]|0; + $191 = (($nCounter$0$ph) + 7)|0; + $192 = (($62) + ($191<<2)|0); + HEAP32[$192>>2] = $190; + $193 = HEAP32[$71>>2]|0; + $194 = (($193) + -1)|0; + $195 = (((($midNormals$0) + (($194*12)|0)|0)) + 8|0); + $196 = HEAP32[$195>>2]|0; + $197 = (($nCounter$0$ph) + 8)|0; + $198 = (($62) + ($197<<2)|0); + HEAP32[$198>>2] = $196; + } else { + $199 = HEAP32[$68>>2]|0; + $200 = (($199) + -1)|0; + $201 = (($25) + (($200*12)|0)|0); + $202 = HEAP32[$vNum>>2]|0; + $203 = (($202) + -1)|0; + $204 = (($25) + (($203*12)|0)|0); + ;HEAP32[$$byval_copy89>>2]=HEAP32[$201>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$201+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$201+8>>2]|0; + ;HEAP32[$$byval_copy90>>2]=HEAP32[$204>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$204+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$204+8>>2]|0; + _VectorSubtract($0,$$byval_copy89,$$byval_copy90); + $205 = HEAP32[$69>>2]|0; + $206 = (($205) + -1)|0; + $207 = (($25) + (($206*12)|0)|0); + $208 = HEAP32[$vNum>>2]|0; + $209 = (($208) + -1)|0; + $210 = (($25) + (($209*12)|0)|0); + ;HEAP32[$$byval_copy89>>2]=HEAP32[$207>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$207+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$207+8>>2]|0; + ;HEAP32[$$byval_copy90>>2]=HEAP32[$210>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$210+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$210+8>>2]|0; + _VectorSubtract($1,$$byval_copy89,$$byval_copy90); + ;HEAP32[$$byval_copy89>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy89+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy89+8>>2]=HEAP32[$0+8>>2]|0; + ;HEAP32[$$byval_copy90>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy90+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy90+8>>2]=HEAP32[$1+8>>2]|0; + _VectorCrossProduct($norm,$$byval_copy89,$$byval_copy90); + _VectorNormalize($norm); + $211 = HEAP32[$norm>>2]|0; + $212 = (($62) + ($nCounter$0$ph<<2)|0); + HEAP32[$212>>2] = $211; + $213 = HEAP32[$72>>2]|0; + $214 = (($nCounter$0$ph) + 1)|0; + $215 = (($62) + ($214<<2)|0); + HEAP32[$215>>2] = $213; + $216 = HEAP32[$73>>2]|0; + $217 = (($nCounter$0$ph) + 2)|0; + $218 = (($62) + ($217<<2)|0); + HEAP32[$218>>2] = $216; + $219 = (($nCounter$0$ph) + 3)|0; + $220 = HEAP32[$norm>>2]|0; + $221 = (($62) + ($219<<2)|0); + HEAP32[$221>>2] = $220; + $222 = HEAP32[$72>>2]|0; + $223 = (($nCounter$0$ph) + 4)|0; + $224 = (($62) + ($223<<2)|0); + HEAP32[$224>>2] = $222; + $225 = HEAP32[$73>>2]|0; + $226 = (($nCounter$0$ph) + 5)|0; + $227 = (($62) + ($226<<2)|0); + HEAP32[$227>>2] = $225; + $228 = (($nCounter$0$ph) + 6)|0; + $229 = HEAP32[$norm>>2]|0; + $230 = (($62) + ($228<<2)|0); + HEAP32[$230>>2] = $229; + $231 = HEAP32[$72>>2]|0; + $232 = (($nCounter$0$ph) + 7)|0; + $233 = (($62) + ($232<<2)|0); + HEAP32[$233>>2] = $231; + $234 = HEAP32[$73>>2]|0; + $235 = (($nCounter$0$ph) + 8)|0; + $236 = (($62) + ($235<<2)|0); + HEAP32[$236>>2] = $234; + } + $nCounter$1 = (($nCounter$0$ph) + 9)|0; + if ($29) { + $$lcssa = $145;$nCounter$1$lcssa = $nCounter$1; + break; + } else { + $nCounter$0$ph = $nCounter$1;$vCounter$0$ph = $145; + } + } + $237 = HEAP32[$vtNum>>2]|0; + $238 = (($237) + -1)|0; + $239 = (($midTexCoords$0) + ($238<<3)|0); + $240 = HEAP32[$239>>2]|0; + $241 = (($61) + ($tcCounter$0$ph$ph<<2)|0); + HEAP32[$241>>2] = $240; + $242 = HEAP32[$vtNum>>2]|0; + $243 = (($242) + -1)|0; + $244 = (((($midTexCoords$0) + ($243<<3)|0)) + 4|0); + $245 = +HEAPF32[$244>>2]; + $246 = 1.0 - $245; + $247 = $tcCounter$0$ph$ph | 1; + $248 = (($61) + ($247<<2)|0); + HEAPF32[$248>>2] = $246; + $249 = (($tcCounter$0$ph$ph) + 2)|0; + $250 = HEAP32[$84>>2]|0; + $251 = (($250) + -1)|0; + $252 = (($midTexCoords$0) + ($251<<3)|0); + $253 = HEAP32[$252>>2]|0; + $254 = (($61) + ($249<<2)|0); + HEAP32[$254>>2] = $253; + $255 = HEAP32[$84>>2]|0; + $256 = (($255) + -1)|0; + $257 = (((($midTexCoords$0) + ($256<<3)|0)) + 4|0); + $258 = +HEAPF32[$257>>2]; + $259 = 1.0 - $258; + $260 = (($tcCounter$0$ph$ph) + 3)|0; + $261 = (($61) + ($260<<2)|0); + HEAPF32[$261>>2] = $259; + $262 = (($tcCounter$0$ph$ph) + 4)|0; + $263 = HEAP32[$85>>2]|0; + $264 = (($263) + -1)|0; + $265 = (($midTexCoords$0) + ($264<<3)|0); + $266 = HEAP32[$265>>2]|0; + $267 = (($61) + ($262<<2)|0); + HEAP32[$267>>2] = $266; + $268 = HEAP32[$85>>2]|0; + $269 = (($268) + -1)|0; + $270 = (((($midTexCoords$0) + ($269<<3)|0)) + 4|0); + $271 = +HEAPF32[$270>>2]; + $272 = 1.0 - $271; + $273 = (($tcCounter$0$ph$ph) + 5)|0; + $274 = (($61) + ($273<<2)|0); + HEAPF32[$274>>2] = $272; + $275 = (($tcCounter$0$ph$ph) + 6)|0; + $nCounter$0$ph$ph = $nCounter$1$lcssa;$tcCounter$0$ph$ph = $275;$vCounter$0$ph$ph = $$lcssa; + } + (_fclose($2)|0); + $276 = ($numTexCoords$0$ph20$lcssa31|0)==(0); + $277 = ($59|0)>(0); + $or$cond = $276 & $277; + if ($or$cond) { + $278 = ($numTriangles$0$ph23$lcssa28*24)|0; + _memset(($61|0),0,($278|0))|0; + } + _free($25); + _free($midNormals$0); + _free($midTexCoords$0); + HEAP32[$vararg_buffer83>>2] = $fileName; + _TraceLog(0,11579,$vararg_buffer83); + HEAP32[$agg$result>>2] = $56; + $279 = ((($agg$result)) + 4|0); + HEAP32[$279>>2] = 0; + $280 = ((($agg$result)) + 8|0); + HEAP32[$280>>2] = $58; + $281 = ((($agg$result)) + 12|0); + HEAP32[$281>>2] = $61; + $282 = ((($agg$result)) + 16|0); + HEAP32[$282>>2] = 0; + $283 = ((($agg$result)) + 20|0); + HEAP32[$283>>2] = $62; + $284 = ((($agg$result)) + 24|0); + HEAP32[$284>>2] = 0; + $285 = ((($agg$result)) + 28|0); + HEAP32[$285>>2] = 0; + $286 = ((($agg$result)) + 32|0); + dest=$286; src=$mesh$sroa$48; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + STACKTOP = sp;return; +} +function _Vector2Distance($v1,$v2) { + $v1 = $v1|0; + $v2 = $v2|0; + var $0 = 0.0, $1 = 0.0, $10 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $sqrtf = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = +HEAPF32[$v2>>2]; + $1 = +HEAPF32[$v1>>2]; + $2 = $0 - $1; + $3 = ((($v2)) + 4|0); + $4 = +HEAPF32[$3>>2]; + $5 = ((($v1)) + 4|0); + $6 = +HEAPF32[$5>>2]; + $7 = $4 - $6; + $8 = $2 * $2; + $9 = $7 * $7; + $10 = $8 + $9; + $sqrtf = (+Math_sqrt((+$10))); + return (+$sqrtf); +} +function _Vector2Angle($initialPosition,$finalPosition) { + $initialPosition = $initialPosition|0; + $finalPosition = $finalPosition|0; + var $0 = 0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, $angle$0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($finalPosition)) + 4|0); + $1 = +HEAPF32[$0>>2]; + $2 = ((($initialPosition)) + 4|0); + $3 = +HEAPF32[$2>>2]; + $4 = $1 - $3; + $5 = $4; + $6 = +HEAPF32[$finalPosition>>2]; + $7 = +HEAPF32[$initialPosition>>2]; + $8 = $6 - $7; + $9 = $8; + $10 = (+Math_atan2((+$5),(+$9))); + $11 = $10; + $12 = $11; + $13 = $12 * 57.295779513082323; + $14 = $13; + $15 = $14 < 0.0; + $16 = $14 + 360.0; + $angle$0 = $15 ? $16 : $14; + return (+$angle$0); +} +function _stbi__pnm_info($s,$x,$y,$comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $c = sp; + _stbi__rewind($s); + $0 = (_stbi__get8($s)|0); + $1 = (_stbi__get8($s)|0); + $2 = ($0<<24>>24)==(80); + $$off = (($1) + -53)<<24>>24; + $switch = ($$off&255)<(2); + $or$cond = $2 & $switch; + if (!($or$cond)) { + _stbi__rewind($s); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $3 = ($1<<24>>24)==(54); + $4 = $3 ? 3 : 1; + HEAP32[$comp>>2] = $4; + $5 = (_stbi__get8($s)|0); + HEAP8[$c>>0] = $5; + _stbi__pnm_skip_whitespace($s,$c); + $6 = (_stbi__pnm_getinteger($s,$c)|0); + HEAP32[$x>>2] = $6; + _stbi__pnm_skip_whitespace($s,$c); + $7 = (_stbi__pnm_getinteger($s,$c)|0); + HEAP32[$y>>2] = $7; + _stbi__pnm_skip_whitespace($s,$c); + $8 = (_stbi__pnm_getinteger($s,$c)|0); + $9 = ($8|0)>(255); + if (!($9)) { + $$0 = 1; + STACKTOP = sp;return ($$0|0); + } + _stbi__err(12585); + $$0 = 0; + STACKTOP = sp;return ($$0|0); +} +function _stbi__get8($s) { + $s = $s|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 168|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($s)) + 172|0); + $3 = HEAP32[$2>>2]|0; + $4 = ($1>>>0)<($3>>>0); + if ($4) { + $5 = ((($1)) + 1|0); + HEAP32[$0>>2] = $5; + $6 = HEAP8[$1>>0]|0; + $$0 = $6; + return ($$0|0); + } + $7 = ((($s)) + 32|0); + $8 = HEAP32[$7>>2]|0; + $9 = ($8|0)==(0); + if ($9) { + $$0 = 0; + return ($$0|0); + } + _stbi__refill_buffer($s); + $10 = HEAP32[$0>>2]|0; + $11 = ((($10)) + 1|0); + HEAP32[$0>>2] = $11; + $12 = HEAP8[$10>>0]|0; + $$0 = $12; + return ($$0|0); +} +function _stbi__rewind($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 176|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($s)) + 168|0); + HEAP32[$2>>2] = $1; + $3 = ((($s)) + 180|0); + $4 = HEAP32[$3>>2]|0; + $5 = ((($s)) + 172|0); + HEAP32[$5>>2] = $4; + return; +} +function _stbi__skip($s,$n) { + $s = $s|0; + $n = $n|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($n|0)<(0); + if ($0) { + $1 = ((($s)) + 172|0); + $2 = HEAP32[$1>>2]|0; + $3 = ((($s)) + 168|0); + HEAP32[$3>>2] = $2; + return; + } + $4 = ((($s)) + 16|0); + $5 = HEAP32[$4>>2]|0; + $6 = ($5|0)==(0|0); + if (!($6)) { + $7 = ((($s)) + 172|0); + $8 = HEAP32[$7>>2]|0; + $9 = ((($s)) + 168|0); + $10 = HEAP32[$9>>2]|0; + $11 = $8; + $12 = $10; + $13 = (($11) - ($12))|0; + $14 = ($13|0)<($n|0); + if ($14) { + HEAP32[$9>>2] = $8; + $15 = ((($s)) + 20|0); + $16 = HEAP32[$15>>2]|0; + $17 = ((($s)) + 28|0); + $18 = HEAP32[$17>>2]|0; + $19 = (($n) - ($13))|0; + FUNCTION_TABLE_vii[$16 & 63]($18,$19); + return; + } + } + $20 = ((($s)) + 168|0); + $21 = HEAP32[$20>>2]|0; + $22 = (($21) + ($n)|0); + HEAP32[$20>>2] = $22; + return; +} +function _stbi__tga_get_comp($bits_per_pixel,$is_grey,$is_rgb16) { + $bits_per_pixel = $bits_per_pixel|0; + $is_grey = $is_grey|0; + $is_rgb16 = $is_rgb16|0; + var $$0 = 0, $$mux = 0, $$not = 0, $$not1 = 0, $0 = 0, $1 = 0, $brmerge = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($is_rgb16|0)!=(0|0); + if ($0) { + HEAP32[$is_rgb16>>2] = 0; + } + switch ($bits_per_pixel|0) { + case 8: { + $$0 = 1; + break; + } + case 16: { + $$not = ($is_grey|0)!=(0); + $$not1 = $0 ^ 1; + $brmerge = $$not | $$not1; + $$mux = $$not ? 2 : 3; + if ($brmerge) { + $$0 = $$mux; + } else { + label = 6; + } + break; + } + case 15: { + if ($0) { + label = 6; + } else { + $$0 = 3; + } + break; + } + case 32: case 24: { + $1 = (($bits_per_pixel|0) / 8)&-1; + $$0 = $1; + break; + } + default: { + $$0 = 0; + } + } + if ((label|0) == 6) { + HEAP32[$is_rgb16>>2] = 1; + $$0 = 3; + } + return ($$0|0); +} +function _stbi__refill_buffer($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($s)) + 28|0); + $3 = HEAP32[$2>>2]|0; + $4 = ((($s)) + 40|0); + $5 = ((($s)) + 36|0); + $6 = HEAP32[$5>>2]|0; + $7 = (FUNCTION_TABLE_iiii[$1 & 15]($3,$4,$6)|0); + $8 = ($7|0)==(0); + if ($8) { + $9 = ((($s)) + 32|0); + HEAP32[$9>>2] = 0; + $10 = ((($s)) + 168|0); + HEAP32[$10>>2] = $4; + $11 = ((($s)) + 41|0); + $12 = ((($s)) + 172|0); + HEAP32[$12>>2] = $11; + $13 = HEAP32[$10>>2]|0; + HEAP8[$13>>0] = 0; + return; + } else { + $14 = ((($s)) + 168|0); + HEAP32[$14>>2] = $4; + $15 = (((($s)) + 40|0) + ($7)|0); + $16 = ((($s)) + 172|0); + HEAP32[$16>>2] = $15; + return; + } +} +function _stbi__pnm_skip_whitespace($s,$c) { + $s = $s|0; + $c = $c|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + L1: while(1) { + $0 = (_stbi__at_eof($s)|0); + $1 = ($0|0)==(0); + if ($1) { + $2 = HEAP8[$c>>0]|0; + $3 = (_stbi__pnm_isspace($2)|0); + $4 = ($3|0)==(0); + if (!($4)) { + $5 = (_stbi__get8($s)|0); + HEAP8[$c>>0] = $5; + continue; + } + } + $6 = (_stbi__at_eof($s)|0); + $7 = ($6|0)==(0); + if (!($7)) { + label = 10; + break; + } + $8 = HEAP8[$c>>0]|0; + $9 = ($8<<24>>24)==(35); + if (!($9)) { + label = 10; + break; + } + $10 = (_stbi__at_eof($s)|0); + $11 = ($10|0)==(0); + if (!($11)) { + continue; + } + while(1) { + $12 = HEAP8[$c>>0]|0; + switch ($12<<24>>24) { + case 13: case 10: { + continue L1; + break; + } + default: { + } + } + $13 = (_stbi__get8($s)|0); + HEAP8[$c>>0] = $13; + $14 = (_stbi__at_eof($s)|0); + $15 = ($14|0)==(0); + if (!($15)) { + continue L1; + } + } + } + if ((label|0) == 10) { + return; + } +} +function _stbi__pnm_getinteger($s,$c) { + $s = $s|0; + $c = $c|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $value$0$lcssa = 0, $value$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__at_eof($s)|0); + $1 = ($0|0)==(0); + if ($1) { + $value$01 = 0; + } else { + $value$0$lcssa = 0; + return ($value$0$lcssa|0); + } + while(1) { + $2 = HEAP8[$c>>0]|0; + $3 = (_stbi__pnm_isdigit($2)|0); + $4 = ($3|0)==(0); + if ($4) { + $value$0$lcssa = $value$01; + label = 4; + break; + } + $5 = ($value$01*10)|0; + $6 = $2 << 24 >> 24; + $7 = (($5) + -48)|0; + $8 = (($7) + ($6))|0; + $9 = (_stbi__get8($s)|0); + HEAP8[$c>>0] = $9; + $10 = (_stbi__at_eof($s)|0); + $11 = ($10|0)==(0); + if ($11) { + $value$01 = $8; + } else { + $value$0$lcssa = $8; + label = 4; + break; + } + } + if ((label|0) == 4) { + return ($value$0$lcssa|0); + } + return (0)|0; +} +function _stbi__at_eof($s) { + $s = $s|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0; + var sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0|0); + if (!($2)) { + $3 = ((($s)) + 24|0); + $4 = HEAP32[$3>>2]|0; + $5 = ((($s)) + 28|0); + $6 = HEAP32[$5>>2]|0; + $7 = (FUNCTION_TABLE_ii[$4 & 15]($6)|0); + $8 = ($7|0)==(0); + if ($8) { + $$0 = 0; + return ($$0|0); + } + $9 = ((($s)) + 32|0); + $10 = HEAP32[$9>>2]|0; + $11 = ($10|0)==(0); + if ($11) { + $$0 = 1; + return ($$0|0); + } + } + $12 = ((($s)) + 168|0); + $13 = HEAP32[$12>>2]|0; + $14 = ((($s)) + 172|0); + $15 = HEAP32[$14>>2]|0; + $16 = ($13>>>0)>=($15>>>0); + $17 = $16&1; + $$0 = $17; + return ($$0|0); +} +function _stbi__pnm_isdigit($c) { + $c = $c|0; + var $0 = 0, $1 = 0, $c$off = 0, label = 0, sp = 0; + sp = STACKTOP; + $c$off = (($c) + -48)<<24>>24; + $0 = ($c$off&255)<(10); + $1 = $0&1; + return ($1|0); +} +function _stbi__pnm_isspace($c) { + $c = $c|0; + var $0 = 0, $1 = 0, $phitmp = 0, $switch$cast = 0, $switch$cast$clear = 0, $switch$downshift = 0, $switch$masked = 0, $switch$tableidx = 0, label = 0, sp = 0; + sp = STACKTOP; + $switch$tableidx = (($c) + -9)<<24>>24; + $0 = ($switch$tableidx&255)<(24); + if (!($0)) { + $1 = 0; + return ($1|0); + } + $switch$cast = $switch$tableidx&255; + $switch$cast$clear = $switch$cast & 16777215; + $switch$downshift = 8388639 >>> $switch$cast$clear; + $switch$masked = $switch$downshift & 16777215; + $phitmp = $switch$masked & 1; + $1 = $phitmp; + return ($1|0); +} +function _stbi__pic_is4($s,$str) { + $s = $s|0; + $str = $str|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = HEAP8[$str>>0]|0; + $2 = ($0<<24>>24)==($1<<24>>24); + if (!($2)) { + return 0; + } + $3 = (_stbi__get8($s)|0); + $4 = ((($str)) + 1|0); + $5 = HEAP8[$4>>0]|0; + $6 = ($3<<24>>24)==($5<<24>>24); + if (!($6)) { + return 0; + } + $7 = (_stbi__get8($s)|0); + $8 = ((($str)) + 2|0); + $9 = HEAP8[$8>>0]|0; + $10 = ($7<<24>>24)==($9<<24>>24); + if ($10) { + $11 = (_stbi__get8($s)|0); + $12 = ((($str)) + 3|0); + $13 = HEAP8[$12>>0]|0; + $14 = ($11<<24>>24)==($13<<24>>24); + $$ = $14&1; + return ($$|0); + } else { + return 0; + } + return (0)|0; +} +function _stbi__get16be($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = $0&255; + $2 = $1 << 8; + $3 = (_stbi__get8($s)|0); + $4 = $3&255; + $5 = $2 | $4; + return ($5|0); +} +function _stbi__get32be($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get16be($s)|0); + $1 = $0 << 16; + $2 = (_stbi__get16be($s)|0); + $3 = (($1) + ($2))|0; + return ($3|0); +} +function _stbi__bmp_parse_header($s,$info) { + $s = $s|0; + $info = $info|0; + var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; + var $43 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = ($0<<24>>24)==(66); + if ($1) { + $2 = (_stbi__get8($s)|0); + $3 = ($2<<24>>24)==(77); + if ($3) { + (_stbi__get32le($s)|0); + (_stbi__get16le($s)|0); + (_stbi__get16le($s)|0); + $4 = (_stbi__get32le($s)|0); + $5 = ((($info)) + 4|0); + HEAP32[$5>>2] = $4; + $6 = (_stbi__get32le($s)|0); + $7 = ((($info)) + 8|0); + HEAP32[$7>>2] = $6; + $8 = ((($info)) + 24|0); + $9 = ((($info)) + 20|0); + $10 = ((($info)) + 16|0); + $11 = ((($info)) + 12|0); + $12 = ($6|0)==(12); + ;HEAP32[$11>>2]=0|0;HEAP32[$11+4>>2]=0|0;HEAP32[$11+8>>2]=0|0;HEAP32[$11+12>>2]=0|0; + switch ($6|0) { + case 12: { + $13 = (_stbi__get16le($s)|0); + HEAP32[$s>>2] = $13; + $14 = (_stbi__get16le($s)|0); + $15 = ((($s)) + 4|0); + HEAP32[$15>>2] = $14; + break; + } + case 124: case 108: case 56: case 40: { + $16 = (_stbi__get32le($s)|0); + HEAP32[$s>>2] = $16; + $17 = (_stbi__get32le($s)|0); + $18 = ((($s)) + 4|0); + HEAP32[$18>>2] = $17; + break; + } + default: { + _stbi__err(12614); + $$0 = 0; + return ($$0|0); + } + } + $19 = (_stbi__get16le($s)|0); + $20 = ($19|0)==(1); + if (!($20)) { + _stbi__err(12626); + $$0 = 0; + return ($$0|0); + } + $21 = (_stbi__get16le($s)|0); + HEAP32[$info>>2] = $21; + $22 = ($21|0)==(1); + if ($22) { + _stbi__err(12634); + $$0 = 0; + return ($$0|0); + } + if ($12) { + $$0 = (1); + return ($$0|0); + } + $23 = (_stbi__get32le($s)|0); + $$off = (($23) + -1)|0; + $24 = ($$off>>>0)<(2); + if ($24) { + _stbi__err(12645); + $$0 = 0; + return ($$0|0); + } + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + $25 = $6 & -17; + $26 = ($25|0)==(40); + if (!($26)) { + switch ($6|0) { + case 108: case 124: { + break; + } + default: { + _stbi__err(12626); + $$0 = 0; + return ($$0|0); + } + } + $39 = (_stbi__get32le($s)|0); + HEAP32[$11>>2] = $39; + $40 = (_stbi__get32le($s)|0); + HEAP32[$10>>2] = $40; + $41 = (_stbi__get32le($s)|0); + HEAP32[$9>>2] = $41; + $42 = (_stbi__get32le($s)|0); + HEAP32[$8>>2] = $42; + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + $43 = ($6|0)==(124); + if (!($43)) { + $$0 = (1); + return ($$0|0); + } + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + $$0 = (1); + return ($$0|0); + } + $27 = ($6|0)==(56); + if ($27) { + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + (_stbi__get32le($s)|0); + } + $28 = HEAP32[$info>>2]|0; + switch ($28|0) { + case 32: case 16: { + break; + } + default: { + $$0 = (1); + return ($$0|0); + } + } + switch ($23|0) { + case 0: { + $29 = HEAP32[$info>>2]|0; + $30 = ($29|0)==(32); + if ($30) { + HEAP32[$11>>2] = 16711680; + HEAP32[$10>>2] = 65280; + HEAP32[$9>>2] = 255; + HEAP32[$8>>2] = -16777216; + $31 = ((($info)) + 28|0); + HEAP32[$31>>2] = 0; + $$0 = (1); + return ($$0|0); + } else { + HEAP32[$11>>2] = 31744; + HEAP32[$10>>2] = 992; + HEAP32[$9>>2] = 31; + $$0 = (1); + return ($$0|0); + } + break; + } + case 3: { + $32 = (_stbi__get32le($s)|0); + HEAP32[$11>>2] = $32; + $33 = (_stbi__get32le($s)|0); + HEAP32[$10>>2] = $33; + $34 = (_stbi__get32le($s)|0); + HEAP32[$9>>2] = $34; + $35 = HEAP32[$11>>2]|0; + $36 = HEAP32[$10>>2]|0; + $37 = ($35|0)==($36|0); + $38 = ($36|0)==($34|0); + $or$cond = $37 & $38; + if (!($or$cond)) { + $$0 = (1); + return ($$0|0); + } + _stbi__err(12626); + $$0 = 0; + return ($$0|0); + break; + } + default: { + _stbi__err(12626); + $$0 = 0; + return ($$0|0); + } + } + } + } + _stbi__err(12606); + $$0 = 0; + return ($$0|0); +} +function _stbi__get32le($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get16le($s)|0); + $1 = (_stbi__get16le($s)|0); + $2 = $1 << 16; + $3 = (($2) + ($0))|0; + return ($3|0); +} +function _stbi__gif_header($s,$g,$comp,$is_info) { + $s = $s|0; + $g = $g|0; + $comp = $comp|0; + $is_info = $is_info|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = ($0<<24>>24)==(71); + if ($1) { + $2 = (_stbi__get8($s)|0); + $3 = ($2<<24>>24)==(73); + if ($3) { + $4 = (_stbi__get8($s)|0); + $5 = ($4<<24>>24)==(70); + if ($5) { + $6 = (_stbi__get8($s)|0); + $7 = ($6<<24>>24)==(56); + if ($7) { + $8 = (_stbi__get8($s)|0); + switch ($8<<24>>24) { + case 57: case 55: { + break; + } + default: { + _stbi__err(12653); + $$0 = 0; + return ($$0|0); + } + } + $9 = (_stbi__get8($s)|0); + $10 = ($9<<24>>24)==(97); + if (!($10)) { + _stbi__err(12653); + $$0 = 0; + return ($$0|0); + } + HEAP32[2608>>2] = 12661; + $11 = (_stbi__get16le($s)|0); + HEAP32[$g>>2] = $11; + $12 = (_stbi__get16le($s)|0); + $13 = ((($g)) + 4|0); + HEAP32[$13>>2] = $12; + $14 = (_stbi__get8($s)|0); + $15 = $14&255; + $16 = ((($g)) + 16|0); + HEAP32[$16>>2] = $15; + $17 = (_stbi__get8($s)|0); + $18 = $17&255; + $19 = ((($g)) + 20|0); + HEAP32[$19>>2] = $18; + $20 = (_stbi__get8($s)|0); + $21 = $20&255; + $22 = ((($g)) + 24|0); + HEAP32[$22>>2] = $21; + $23 = ((($g)) + 28|0); + HEAP32[$23>>2] = -1; + $24 = ($comp|0)==(0|0); + if (!($24)) { + HEAP32[$comp>>2] = 4; + } + $25 = ($is_info|0)==(0); + if (!($25)) { + $$0 = 1; + return ($$0|0); + } + $26 = HEAP32[$16>>2]|0; + $27 = $26 & 128; + $28 = ($27|0)==(0); + if ($28) { + $$0 = 1; + return ($$0|0); + } + $29 = ((($g)) + 40|0); + $30 = $26 & 7; + $31 = 2 << $30; + _stbi__gif_parse_colortable($s,$29,$31,-1); + $$0 = 1; + return ($$0|0); + } + } + } + } + _stbi__err(12653); + $$0 = 0; + return ($$0|0); +} +function _stbi__gif_parse_colortable($s,$pal,$num_entries,$transp) { + $s = $s|0; + $pal = $pal|0; + $num_entries = $num_entries|0; + $transp = $transp|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($num_entries|0)>(0); + if ($0) { + $i$01 = 0; + } else { + return; + } + while(1) { + $1 = (_stbi__get8($s)|0); + $2 = (((($pal) + ($i$01<<2)|0)) + 2|0); + HEAP8[$2>>0] = $1; + $3 = (_stbi__get8($s)|0); + $4 = (((($pal) + ($i$01<<2)|0)) + 1|0); + HEAP8[$4>>0] = $3; + $5 = (_stbi__get8($s)|0); + $6 = (($pal) + ($i$01<<2)|0); + HEAP8[$6>>0] = $5; + $not$ = ($i$01|0)!=($transp|0); + $7 = $not$ << 31 >> 31; + $8 = (((($pal) + ($i$01<<2)|0)) + 3|0); + HEAP8[$8>>0] = $7; + $9 = (($i$01) + 1)|0; + $exitcond = ($9|0)==($num_entries|0); + if ($exitcond) { + break; + } else { + $i$01 = $9; + } + } + return; +} +function _stbi__parse_png_file($z,$scan,$req_comp) { + $z = $z|0; + $scan = $scan|0; + $req_comp = $req_comp|0; + var $$ = 0, $$0 = 0, $$lcssa1605 = 0, $$lobit = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; + var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; + var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; + var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; + var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0; + var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0; + var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0; + var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0; + var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0; + var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0; + var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c = 0; + var $color$0 = 0, $color$0$lcssa = 0, $color$1 = 0, $first$0 = 0, $first$0$lcssa = 0, $first$1 = 0, $has_trans$0 = 0, $has_trans$0$lcssa = 0, $has_trans$1 = 0, $i$0314 = 0, $i$1309 = 0, $idata_limit$0 = 0, $idata_limit$1 = 0, $idata_limit$1$lcssa = 0, $idata_limit$1$ph = 0, $idata_limit$2 = 0, $idata_limit$3 = 0, $interlace$0 = 0, $interlace$0$lcssa = 0, $interlace$1 = 0; + var $ioff$0 = 0, $ioff$0$lcssa = 0, $ioff$1 = 0, $is_iphone$0 = 0, $is_iphone$0$lcssa = 0, $is_iphone$1 = 0, $k$0312 = 0, $k$1310 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond8 = 0, $pal_img_n$0 = 0, $pal_img_n$0$lcssa = 0, $pal_img_n$0$lcssa1544 = 0, $pal_img_n$1 = 0, $pal_img_n$2 = 0; + var $pal_len$0 = 0, $pal_len$1 = 0, $palette = 0, $raw_len = 0, $req_comp$ = 0, $switch$split102D = 0, $switch$split12D = 0, $switch$split2D = 0, $switch$split42D = 0, $switch$split72D = 0, $tc = 0, $tc16 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 1056|0; + $palette = sp + 32|0; + $tc = sp + 22|0; + $tc16 = sp + 16|0; + $c = sp + 8|0; + $raw_len = sp; + $0 = HEAP32[$z>>2]|0; + $1 = ((($z)) + 8|0); + HEAP32[$1>>2] = 0; + $2 = ((($z)) + 4|0); + HEAP32[$2>>2] = 0; + $3 = ((($z)) + 12|0); + HEAP32[$3>>2] = 0; + $4 = (_stbi__check_png_header($0)|0); + $5 = ($4|0)==(0); + if ($5) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $6 = ($scan|0)==(1); + if ($6) { + $$0 = 1; + STACKTOP = sp;return ($$0|0); + } + $7 = ((($c)) + 4|0); + $8 = ((($0)) + 4|0); + $9 = ((($z)) + 16|0); + $10 = ((($0)) + 8|0); + $11 = ($scan|0)==(2); + $12 = ((($0)) + 8|0); + $13 = ((($0)) + 8|0); + $14 = ((($z)) + 16|0); + $15 = ($scan|0)==(2); + $16 = ($scan|0)==(2); + $color$0 = 0;$first$0 = 1;$has_trans$0 = 0;$idata_limit$0 = 0;$interlace$0 = 0;$ioff$0 = 0;$is_iphone$0 = 0;$pal_img_n$0 = 0;$pal_len$0 = 0; + L7: while(1) { + _stbi__get_chunk_header($c,$0); + $17 = HEAP32[$7>>2]|0; + $switch$split2D = ($17|0)<(1229472850); + L9: do { + if ($switch$split2D) { + $switch$split12D = ($17|0)<(1229209940); + if ($switch$split12D) { + switch ($17|0) { + case 1130840649: { + break; + } + default: { + label = 102; + break L9; + } + } + $18 = HEAP32[$c>>2]|0; + _stbi__skip($0,$18); + $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = 1;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; + break; + } + $switch$split72D = ($17|0)<(1229278788); + if (!($switch$split72D)) { + switch ($17|0) { + case 1229278788: { + $color$0$lcssa = $color$0;$first$0$lcssa = $first$0;$has_trans$0$lcssa = $has_trans$0;$interlace$0$lcssa = $interlace$0;$ioff$0$lcssa = $ioff$0;$is_iphone$0$lcssa = $is_iphone$0;$pal_img_n$0$lcssa = $pal_img_n$0; + label = 85; + break L7; + break; + } + default: { + label = 102; + break L9; + } + } + } + switch ($17|0) { + case 1229209940: { + break; + } + default: { + label = 102; + break L9; + } + } + $127 = ($first$0|0)==(0); + if (!($127)) { + label = 70; + break L7; + } + $128 = ($pal_img_n$0<<24>>24)==(0); + $129 = ($pal_len$0|0)!=(0); + $or$cond = $129 | $128; + if (!($or$cond)) { + label = 72; + break L7; + } + if ($16) { + $pal_img_n$0$lcssa1544 = $pal_img_n$0; + label = 74; + break L7; + } + $132 = HEAP32[$c>>2]|0; + $133 = (($132) + ($ioff$0))|0; + $134 = ($133|0)<($ioff$0|0); + if ($134) { + $$0 = 0; + label = 108; + break L7; + } + $135 = ($133>>>0)>($idata_limit$0>>>0); + if ($135) { + $136 = ($idata_limit$0|0)==(0); + $137 = ($132>>>0)>(4096); + $138 = $137 ? $132 : 4096; + $idata_limit$1$ph = $136 ? $138 : $idata_limit$0; + $139 = HEAP32[$c>>2]|0; + $140 = (($139) + ($ioff$0))|0; + $idata_limit$1 = $idata_limit$1$ph; + while(1) { + $141 = ($140>>>0)>($idata_limit$1>>>0); + $142 = $idata_limit$1 << 1; + if ($141) { + $idata_limit$1 = $142; + } else { + $idata_limit$1$lcssa = $idata_limit$1; + break; + } + } + $143 = HEAP32[$2>>2]|0; + $144 = (_realloc($143,$idata_limit$1$lcssa)|0); + $145 = ($144|0)==(0|0); + if ($145) { + label = 80; + break L7; + } + HEAP32[$2>>2] = $144; + $idata_limit$2 = $idata_limit$1$lcssa; + } else { + $idata_limit$2 = $idata_limit$0; + } + $146 = HEAP32[$2>>2]|0; + $147 = (($146) + ($ioff$0)|0); + $148 = HEAP32[$c>>2]|0; + $149 = (_stbi__getn($0,$147,$148)|0); + $150 = ($149|0)==(0); + if ($150) { + label = 83; + break L7; + } + $151 = HEAP32[$c>>2]|0; + $152 = (($151) + ($ioff$0))|0; + $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$2;$interlace$1 = $interlace$0;$ioff$1 = $152;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; + } else { + $switch$split42D = ($17|0)<(1347179589); + if ($switch$split42D) { + switch ($17|0) { + case 1229472850: { + break; + } + default: { + label = 102; + break L9; + } + } + $19 = ($first$0|0)==(0); + if ($19) { + label = 7; + break L7; + } + $20 = HEAP32[$c>>2]|0; + $21 = ($20|0)==(13); + if (!($21)) { + label = 9; + break L7; + } + $22 = (_stbi__get32be($0)|0); + HEAP32[$0>>2] = $22; + $23 = ($22>>>0)>(16777216); + if ($23) { + label = 11; + break L7; + } + $24 = (_stbi__get32be($0)|0); + HEAP32[$8>>2] = $24; + $25 = ($24>>>0)>(16777216); + if ($25) { + label = 13; + break L7; + } + $26 = (_stbi__get8($0)|0); + $27 = $26&255; + HEAP32[$9>>2] = $27; + switch ($26<<24>>24) { + case 16: case 8: case 4: case 2: case 1: { + break; + } + default: { + label = 15; + break L7; + } + } + $28 = (_stbi__get8($0)|0); + $29 = $28&255; + $30 = ($28&255)>(6); + if ($30) { + label = 17; + break L7; + } + $31 = ($28<<24>>24)==(3); + if ($31) { + $32 = HEAP32[$9>>2]|0; + $33 = ($32|0)==(16); + if ($33) { + label = 20; + break L7; + } else { + $pal_img_n$1 = 3; + } + } else { + $34 = $29 & 1; + $35 = ($34|0)==(0); + if ($35) { + $pal_img_n$1 = $pal_img_n$0; + } else { + label = 22; + break L7; + } + } + $36 = (_stbi__get8($0)|0); + $37 = ($36<<24>>24)==(0); + if (!($37)) { + label = 24; + break L7; + } + $38 = (_stbi__get8($0)|0); + $39 = ($38<<24>>24)==(0); + if (!($39)) { + label = 26; + break L7; + } + $40 = (_stbi__get8($0)|0); + $41 = $40&255; + $42 = ($40&255)>(1); + if ($42) { + label = 28; + break L7; + } + $43 = HEAP32[$0>>2]|0; + $44 = ($43|0)==(0); + if ($44) { + label = 31; + break L7; + } + $45 = HEAP32[$8>>2]|0; + $46 = ($45|0)==(0); + if ($46) { + label = 31; + break L7; + } + $47 = ($pal_img_n$1<<24>>24)==(0); + if (!($47)) { + HEAP32[$12>>2] = 1; + $57 = HEAP32[$0>>2]|0; + $58 = (1073741824 / ($57>>>0))&-1; + $59 = $58 >>> 2; + $60 = HEAP32[$8>>2]|0; + $61 = ($59>>>0)<($60>>>0); + if ($61) { + label = 37; + break L7; + } else { + $color$1 = $29;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $41;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$1;$pal_len$1 = $pal_len$0; + break; + } + } + $48 = $29 & 2; + $49 = $48 | 1; + $50 = $29 >>> 2; + $$lobit = $50 & 1; + $51 = (($49) + ($$lobit))|0; + HEAP32[$10>>2] = $51; + $52 = HEAP32[$0>>2]|0; + $53 = (1073741824 / ($52>>>0))&-1; + $54 = (($53>>>0) / ($51>>>0))&-1; + $55 = HEAP32[$8>>2]|0; + $56 = ($54>>>0)<($55>>>0); + if ($56) { + label = 34; + break L7; + } + if ($11) { + $$0 = 1; + label = 108; + break L7; + } else { + $color$1 = $29;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $41;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0; + break; + } + } + $switch$split102D = ($17|0)<(1951551059); + if ($switch$split102D) { + switch ($17|0) { + case 1347179589: { + break; + } + default: { + label = 102; + break L9; + } + } + $62 = ($first$0|0)==(0); + if (!($62)) { + label = 39; + break L7; + } + $63 = HEAP32[$c>>2]|0; + $64 = ($63>>>0)>(768); + if ($64) { + label = 41; + break L7; + } + $65 = (($63>>>0) / 3)&-1; + $66 = ($65*3)|0; + $67 = ($66|0)==($63|0); + if (!($67)) { + label = 44; + break L7; + } + $68 = ($63>>>0)>(2); + if ($68) { + $i$0314 = 0; + } else { + $color$1 = $color$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $65; + break; + } + while(1) { + $69 = (_stbi__get8($0)|0); + $70 = $i$0314 << 2; + $71 = (($palette) + ($70)|0); + HEAP8[$71>>0] = $69; + $72 = (_stbi__get8($0)|0); + $73 = $70 | 1; + $74 = (($palette) + ($73)|0); + HEAP8[$74>>0] = $72; + $75 = (_stbi__get8($0)|0); + $76 = $70 | 2; + $77 = (($palette) + ($76)|0); + HEAP8[$77>>0] = $75; + $78 = $70 | 3; + $79 = (($palette) + ($78)|0); + HEAP8[$79>>0] = -1; + $80 = (($i$0314) + 1)|0; + $81 = ($80>>>0)<($65>>>0); + if ($81) { + $i$0314 = $80; + } else { + $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $65; + break L9; + } + } + } + switch ($17|0) { + case 1951551059: { + break; + } + default: { + label = 102; + break L9; + } + } + $82 = ($first$0|0)==(0); + if (!($82)) { + label = 47; + break L7; + } + $83 = HEAP32[$2>>2]|0; + $84 = ($83|0)==(0|0); + if (!($84)) { + label = 49; + break L7; + } + $85 = ($pal_img_n$0<<24>>24)==(0); + if (!($85)) { + if ($15) { + label = 52; + break L7; + } + $87 = ($pal_len$0|0)==(0); + if ($87) { + label = 54; + break L7; + } + $88 = HEAP32[$c>>2]|0; + $89 = ($88>>>0)>($pal_len$0>>>0); + if ($89) { + label = 58; + break L7; + } + $90 = HEAP32[$c>>2]|0; + $91 = ($90|0)==(0); + if ($91) { + $color$1 = $color$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0; + break; + } + $92 = HEAP32[$c>>2]|0; + $i$1309 = 0; + while(1) { + $93 = (_stbi__get8($0)|0); + $94 = $i$1309 << 2; + $95 = $94 | 3; + $96 = (($palette) + ($95)|0); + HEAP8[$96>>0] = $93; + $97 = (($i$1309) + 1)|0; + $98 = ($97>>>0)<($92>>>0); + if ($98) { + $i$1309 = $97; + } else { + $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 4;$pal_len$1 = $pal_len$0; + break L9; + } + } + } + $99 = HEAP32[$13>>2]|0; + $100 = $99 & 1; + $101 = ($100|0)==(0); + if ($101) { + label = 61; + break L7; + } + $102 = HEAP32[$c>>2]|0; + $103 = $99 << 1; + $104 = ($102|0)==($103|0); + if (!($104)) { + label = 63; + break L7; + } + $105 = HEAP32[$14>>2]|0; + $106 = ($105|0)==(16); + $107 = HEAP32[$13>>2]|0; + $108 = ($107|0)>(0); + if ($106) { + if ($108) { + $k$0312 = 0; + } else { + $color$1 = $color$0;$first$1 = 0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0; + break; + } + while(1) { + $109 = (_stbi__get16be($0)|0); + $110 = $109&65535; + $111 = (($tc16) + ($k$0312<<1)|0); + HEAP16[$111>>1] = $110; + $112 = (($k$0312) + 1)|0; + $113 = HEAP32[$13>>2]|0; + $114 = ($112|0)<($113|0); + if ($114) { + $k$0312 = $112; + } else { + $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; + break; + } + } + } else { + if ($108) { + $k$1310 = 0; + } else { + $color$1 = $color$0;$first$1 = 0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = 0;$pal_len$1 = $pal_len$0; + break; + } + while(1) { + $115 = (_stbi__get16be($0)|0); + $116 = $115 & 255; + $117 = HEAP32[$14>>2]|0; + $118 = (12888 + ($117)|0); + $119 = HEAP8[$118>>0]|0; + $120 = $119&255; + $121 = Math_imul($120, $116)|0; + $122 = $121&255; + $123 = (($tc) + ($k$1310)|0); + HEAP8[$123>>0] = $122; + $124 = (($k$1310) + 1)|0; + $125 = HEAP32[$13>>2]|0; + $126 = ($124|0)<($125|0); + if ($126) { + $k$1310 = $124; + } else { + $color$1 = $color$0;$first$1 = $first$0;$has_trans$1 = 1;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; + break; + } + } + } + } + } while(0); + if ((label|0) == 102) { + label = 0; + $201 = ($first$0|0)==(0); + if (!($201)) { + label = 103; + break; + } + $202 = $17 & 536870912; + $203 = ($202|0)==(0); + if ($203) { + $$lcssa1605 = $17; + label = 105; + break; + } + $214 = HEAP32[$c>>2]|0; + _stbi__skip($0,$214); + $color$1 = $color$0;$first$1 = 0;$has_trans$1 = $has_trans$0;$idata_limit$3 = $idata_limit$0;$interlace$1 = $interlace$0;$ioff$1 = $ioff$0;$is_iphone$1 = $is_iphone$0;$pal_img_n$2 = $pal_img_n$0;$pal_len$1 = $pal_len$0; + } + (_stbi__get32be($0)|0); + $color$0 = $color$1;$first$0 = $first$1;$has_trans$0 = $has_trans$1;$idata_limit$0 = $idata_limit$3;$interlace$0 = $interlace$1;$ioff$0 = $ioff$1;$is_iphone$0 = $is_iphone$1;$pal_img_n$0 = $pal_img_n$2;$pal_len$0 = $pal_len$1; + } + switch (label|0) { + case 7: { + _stbi__err(12662); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 9: { + _stbi__err(12676); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 11: { + _stbi__err(12689); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 13: { + _stbi__err(12689); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 15: { + _stbi__err(12699); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 17: { + _stbi__err(12719); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 20: { + _stbi__err(12719); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 22: { + _stbi__err(12719); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 24: { + _stbi__err(12729); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 26: { + _stbi__err(12745); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 28: { + _stbi__err(12763); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 31: { + _stbi__err(12784); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 34: { + _stbi__err(12689); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 37: { + _stbi__err(12689); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 39: { + _stbi__err(12798); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 41: { + _stbi__err(12813); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 44: { + _stbi__err(12813); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 47: { + _stbi__err(12798); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 49: { + _stbi__err(12826); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 52: { + $86 = ((($0)) + 8|0); + HEAP32[$86>>2] = 4; + $$0 = 1; + STACKTOP = sp;return ($$0|0); + break; + } + case 54: { + _stbi__err(12842); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 58: { + _stbi__err(12859); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 61: { + _stbi__err(12872); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 63: { + _stbi__err(12859); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 70: { + _stbi__err(12798); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 72: { + _stbi__err(12897); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 74: { + $130 = $pal_img_n$0$lcssa1544&255; + $131 = ((($0)) + 8|0); + HEAP32[$131>>2] = $130; + $$0 = 1; + STACKTOP = sp;return ($$0|0); + break; + } + case 80: { + _stbi__err(12905); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 83: { + _stbi__err(12914); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 85: { + $153 = ($first$0$lcssa|0)==(0); + if (!($153)) { + _stbi__err(12798); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $154 = ($scan|0)==(0); + if (!($154)) { + $$0 = 1; + STACKTOP = sp;return ($$0|0); + } + $155 = HEAP32[$2>>2]|0; + $156 = ($155|0)==(0|0); + if ($156) { + _stbi__err(12924); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $157 = HEAP32[$0>>2]|0; + $158 = ((($z)) + 16|0); + $159 = HEAP32[$158>>2]|0; + $160 = Math_imul($159, $157)|0; + $161 = (($160) + 7)|0; + $162 = $161 >>> 3; + $163 = ((($0)) + 4|0); + $164 = HEAP32[$163>>2]|0; + $165 = ((($0)) + 8|0); + $166 = HEAP32[$165>>2]|0; + $167 = Math_imul($166, $164)|0; + $168 = Math_imul($167, $162)|0; + $169 = (($168) + ($164))|0; + HEAP32[$raw_len>>2] = $169; + $170 = HEAP32[$2>>2]|0; + $171 = ($is_iphone$0$lcssa|0)!=(0); + $172 = $171&1; + $173 = $172 ^ 1; + $174 = (_stbi_zlib_decode_malloc_guesssize_headerflag($170,$ioff$0$lcssa,$169,$raw_len,$173)|0); + HEAP32[$1>>2] = $174; + $175 = ($174|0)==(0|0); + if ($175) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $176 = HEAP32[$2>>2]|0; + _free($176); + HEAP32[$2>>2] = 0; + $177 = HEAP32[$165>>2]|0; + $178 = (($177) + 1)|0; + $notlhs = ($178|0)!=($req_comp|0); + $notrhs = ($req_comp|0)==(3); + $or$cond3$not = $notrhs | $notlhs; + $179 = ($pal_img_n$0$lcssa<<24>>24)!=(0); + $or$cond5 = $179 | $or$cond3$not; + $180 = ($has_trans$0$lcssa<<24>>24)==(0); + $or$cond8 = $180 & $or$cond5; + $181 = ((($0)) + 12|0); + $$ = $or$cond8 ? $177 : $178; + HEAP32[$181>>2] = $$; + $182 = HEAP32[$1>>2]|0; + $183 = HEAP32[$raw_len>>2]|0; + $184 = ((($0)) + 12|0); + $185 = HEAP32[$158>>2]|0; + $186 = (_stbi__create_png_image($z,$182,$183,$$,$185,$color$0$lcssa,$interlace$0$lcssa)|0); + $187 = ($186|0)==(0); + if ($187) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + do { + if (!($180)) { + $188 = HEAP32[$158>>2]|0; + $189 = ($188|0)==(16); + if ($189) { + $190 = HEAP32[$184>>2]|0; + _stbi__compute_transparency16($z,$tc16,$190); + break; + } else { + $191 = HEAP32[$184>>2]|0; + _stbi__compute_transparency($z,$tc,$191); + break; + } + } + } while(0); + $192 = HEAP32[2620>>2]|0; + $193 = ($192|0)!=(0); + $or$cond7 = $171 & $193; + if ($or$cond7) { + $194 = HEAP32[$184>>2]|0; + $195 = ($194|0)>(2); + if ($195) { + _stbi__de_iphone($z); + } + } + if ($179) { + $196 = $pal_img_n$0$lcssa&255; + HEAP32[$165>>2] = $196; + $197 = ($req_comp|0)>(2); + $req_comp$ = $197 ? $req_comp : $196; + HEAP32[$184>>2] = $req_comp$; + $198 = (_stbi__expand_png_palette($z,$palette,$req_comp$)|0); + $199 = ($198|0)==(0); + if ($199) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + } + $200 = HEAP32[$1>>2]|0; + _free($200); + HEAP32[$1>>2] = 0; + $$0 = 1; + STACKTOP = sp;return ($$0|0); + break; + } + case 103: { + _stbi__err(12798); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 105: { + $204 = $$lcssa1605 >>> 24; + $205 = $204&255; + HEAP8[12932>>0] = $205; + $206 = HEAP32[$7>>2]|0; + $207 = $206 >>> 16; + $208 = $207&255; + HEAP8[(12933)>>0] = $208; + $209 = HEAP32[$7>>2]|0; + $210 = $209 >>> 8; + $211 = $210&255; + HEAP8[(12934)>>0] = $211; + $212 = HEAP32[$7>>2]|0; + $213 = $212&255; + HEAP8[(12935)>>0] = $213; + _stbi__err(12932); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + break; + } + case 108: { + STACKTOP = sp;return ($$0|0); + break; + } + } + return (0)|0; +} +function _stbi__check_png_header($s) { + $s = $s|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = ($0<<24>>24)==(-119); + if ($1) { + $2 = (_stbi__get8($s)|0); + $3 = ($2<<24>>24)==(80); + if ($3) { + $4 = (_stbi__get8($s)|0); + $5 = ($4<<24>>24)==(78); + if ($5) { + $6 = (_stbi__get8($s)|0); + $7 = ($6<<24>>24)==(71); + if ($7) { + $8 = (_stbi__get8($s)|0); + $9 = ($8<<24>>24)==(13); + if ($9) { + $10 = (_stbi__get8($s)|0); + $11 = ($10<<24>>24)==(10); + if ($11) { + $12 = (_stbi__get8($s)|0); + $13 = ($12<<24>>24)==(26); + if ($13) { + $14 = (_stbi__get8($s)|0); + $15 = ($14<<24>>24)==(10); + if ($15) { + $$0 = 1; + return ($$0|0); + } + } + } + } + } + } + } + } + _stbi__err(13250); + $$0 = 0; + return ($$0|0); +} +function _stbi__get_chunk_header($agg$result,$s) { + $agg$result = $agg$result|0; + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get32be($s)|0); + $1 = (_stbi__get32be($s)|0); + HEAP32[$agg$result>>2] = $0; + $2 = ((($agg$result)) + 4|0); + HEAP32[$2>>2] = $1; + return; +} +function _stbi__getn($s,$buffer,$n) { + $s = $s|0; + $buffer = $buffer|0; + $n = $n|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0|0); + if (!($2)) { + $3 = ((($s)) + 172|0); + $4 = HEAP32[$3>>2]|0; + $5 = ((($s)) + 168|0); + $6 = HEAP32[$5>>2]|0; + $7 = $4; + $8 = $6; + $9 = (($7) - ($8))|0; + $10 = ($9|0)<($n|0); + if ($10) { + _memcpy(($buffer|0),($6|0),($9|0))|0; + $11 = HEAP32[$0>>2]|0; + $12 = ((($s)) + 28|0); + $13 = HEAP32[$12>>2]|0; + $14 = (($buffer) + ($9)|0); + $15 = (($n) - ($9))|0; + $16 = (FUNCTION_TABLE_iiii[$11 & 15]($13,$14,$15)|0); + $17 = ($16|0)==($15|0); + $18 = $17&1; + $19 = HEAP32[$3>>2]|0; + HEAP32[$5>>2] = $19; + $$0 = $18; + return ($$0|0); + } + } + $20 = ((($s)) + 168|0); + $21 = HEAP32[$20>>2]|0; + $22 = (($21) + ($n)|0); + $23 = ((($s)) + 172|0); + $24 = HEAP32[$23>>2]|0; + $25 = ($22>>>0)>($24>>>0); + if ($25) { + $$0 = 0; + return ($$0|0); + } + _memcpy(($buffer|0),($21|0),($n|0))|0; + $26 = HEAP32[$20>>2]|0; + $27 = (($26) + ($n)|0); + HEAP32[$20>>2] = $27; + $$0 = 1; + return ($$0|0); +} +function _stbi__create_png_image($a,$image_data,$image_data_len,$out_n,$depth,$color,$interlaced) { + $a = $a|0; + $image_data = $image_data|0; + $image_data_len = $image_data_len|0; + $out_n = $out_n|0; + $depth = $depth|0; + $color = $color|0; + $interlaced = $interlaced|0; + var $$0 = 0, $$0212 = 0, $$0311 = 0, $$1 = 0, $$14 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; + var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; + var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; + var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $8 = 0, $9 = 0, $i$07 = 0; + var $j$08 = 0, $or$cond = 0, $p$010 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($interlaced|0)==(0); + $1 = HEAP32[$a>>2]|0; + $2 = HEAP32[$1>>2]|0; + $3 = ((($1)) + 4|0); + $4 = HEAP32[$3>>2]|0; + if ($0) { + $5 = (_stbi__create_png_image_raw($a,$image_data,$image_data_len,$out_n,$2,$4,$depth,$color)|0); + $$0 = $5; + return ($$0|0); + } + $6 = Math_imul($2, $out_n)|0; + $7 = Math_imul($6, $4)|0; + $8 = (_stbi__malloc($7)|0); + $9 = ((($a)) + 12|0); + $10 = ((($a)) + 12|0); + $$0212 = $image_data;$$0311 = $image_data_len;$p$010 = 0; + while(1) { + $11 = HEAP32[$a>>2]|0; + $12 = HEAP32[$11>>2]|0; + $13 = (5664 + ($p$010<<2)|0); + $14 = HEAP32[$13>>2]|0; + $15 = (5692 + ($p$010<<2)|0); + $16 = HEAP32[$15>>2]|0; + $17 = (($12) + -1)|0; + $18 = (($17) - ($14))|0; + $19 = (($18) + ($16))|0; + $20 = (($19>>>0) / ($16>>>0))&-1; + $21 = ((($11)) + 4|0); + $22 = HEAP32[$21>>2]|0; + $23 = (5720 + ($p$010<<2)|0); + $24 = HEAP32[$23>>2]|0; + $25 = (5748 + ($p$010<<2)|0); + $26 = HEAP32[$25>>2]|0; + $27 = (($22) + -1)|0; + $28 = (($27) - ($24))|0; + $29 = (($28) + ($26))|0; + $30 = (($29>>>0) / ($26>>>0))&-1; + $31 = ($20|0)!=(0); + $32 = ($30|0)!=(0); + $or$cond = $31 & $32; + if ($or$cond) { + $33 = ((($11)) + 8|0); + $34 = HEAP32[$33>>2]|0; + $35 = Math_imul($20, $depth)|0; + $36 = Math_imul($35, $34)|0; + $37 = (($36) + 7)|0; + $38 = $37 >> 3; + $39 = (($38) + 1)|0; + $40 = Math_imul($39, $30)|0; + $41 = (_stbi__create_png_image_raw($a,$$0212,$$0311,$out_n,$20,$30,$depth,$color)|0); + $42 = ($41|0)==(0); + if ($42) { + label = 8; + break; + } + $43 = ($30|0)>(0); + if ($43) { + $44 = ($20|0)>(0); + $j$08 = 0; + while(1) { + if ($44) { + $45 = HEAP32[$25>>2]|0; + $46 = Math_imul($45, $j$08)|0; + $47 = HEAP32[$23>>2]|0; + $48 = (($46) + ($47))|0; + $49 = HEAP32[$15>>2]|0; + $50 = HEAP32[$13>>2]|0; + $51 = Math_imul($j$08, $20)|0; + $i$07 = 0; + while(1) { + $52 = Math_imul($49, $i$07)|0; + $53 = (($52) + ($50))|0; + $54 = HEAP32[$a>>2]|0; + $55 = HEAP32[$54>>2]|0; + $56 = Math_imul($55, $48)|0; + $57 = (($53) + ($56))|0; + $$sum = Math_imul($57, $out_n)|0; + $58 = (($8) + ($$sum)|0); + $59 = HEAP32[$10>>2]|0; + $60 = (($i$07) + ($51))|0; + $61 = Math_imul($60, $out_n)|0; + $62 = (($59) + ($61)|0); + _memcpy(($58|0),($62|0),($out_n|0))|0; + $63 = (($i$07) + 1)|0; + $64 = ($63|0)<($20|0); + if ($64) { + $i$07 = $63; + } else { + break; + } + } + } + $65 = (($j$08) + 1)|0; + $66 = ($65|0)<($30|0); + if ($66) { + $j$08 = $65; + } else { + break; + } + } + } + $67 = HEAP32[$9>>2]|0; + _free($67); + $68 = (($$0212) + ($40)|0); + $69 = (($$0311) - ($40))|0; + $$1 = $68;$$14 = $69; + } else { + $$1 = $$0212;$$14 = $$0311; + } + $70 = (($p$010) + 1)|0; + $71 = ($70|0)<(7); + if ($71) { + $$0212 = $$1;$$0311 = $$14;$p$010 = $70; + } else { + label = 15; + break; + } + } + if ((label|0) == 8) { + _free($8); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 15) { + $72 = ((($a)) + 12|0); + HEAP32[$72>>2] = $8; + $$0 = 1; + return ($$0|0); + } + return (0)|0; +} +function _stbi__compute_transparency16($z,$tc,$out_n) { + $z = $z|0; + $tc = $tc|0; + $out_n = $out_n|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$03 = 0, $i$15 = 0, $not$ = 0, $p$04 = 0, $p$16 = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$z>>2]|0; + $1 = HEAP32[$0>>2]|0; + $2 = ((($0)) + 4|0); + $3 = HEAP32[$2>>2]|0; + $4 = Math_imul($3, $1)|0; + $5 = ((($z)) + 12|0); + $6 = HEAP32[$5>>2]|0; + switch ($out_n|0) { + case 2: { + $11 = ($4|0)==(0); + if ($11) { + return; + } + $12 = Math_imul($3, $1)|0; + $i$03 = 0;$p$04 = $6; + while(1) { + $13 = HEAP16[$p$04>>1]|0; + $14 = HEAP16[$tc>>1]|0; + $not$ = ($13<<16>>16)!=($14<<16>>16); + $15 = $not$ << 31 >> 31; + $16 = ((($p$04)) + 2|0); + HEAP16[$16>>1] = $15; + $17 = ((($p$04)) + 4|0); + $18 = (($i$03) + 1)|0; + $exitcond = ($18|0)==($12|0); + if ($exitcond) { + break; + } else { + $i$03 = $18;$p$04 = $17; + } + } + return; + break; + } + case 4: { + $7 = ($4|0)==(0); + if ($7) { + return; + } + $8 = ((($tc)) + 2|0); + $9 = ((($tc)) + 4|0); + $10 = Math_imul($3, $1)|0; + $i$15 = 0;$p$16 = $6; + while(1) { + $19 = HEAP16[$p$16>>1]|0; + $20 = HEAP16[$tc>>1]|0; + $21 = ($19<<16>>16)==($20<<16>>16); + if ($21) { + $22 = ((($p$16)) + 2|0); + $23 = HEAP16[$22>>1]|0; + $24 = HEAP16[$8>>1]|0; + $25 = ($23<<16>>16)==($24<<16>>16); + if ($25) { + $26 = ((($p$16)) + 4|0); + $27 = HEAP16[$26>>1]|0; + $28 = HEAP16[$9>>1]|0; + $29 = ($27<<16>>16)==($28<<16>>16); + if ($29) { + $30 = ((($p$16)) + 6|0); + HEAP16[$30>>1] = 0; + } + } + } + $31 = ((($p$16)) + 8|0); + $32 = (($i$15) + 1)|0; + $exitcond8 = ($32|0)==($10|0); + if ($exitcond8) { + break; + } else { + $i$15 = $32;$p$16 = $31; + } + } + return; + break; + } + default: { + ___assert_fail((13014|0),(12975|0),4298,(13066|0)); + // unreachable; + } + } +} +function _stbi__compute_transparency($z,$tc,$out_n) { + $z = $z|0; + $tc = $tc|0; + $out_n = $out_n|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$03 = 0, $i$15 = 0, $not$ = 0, $p$04 = 0, $p$16 = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$z>>2]|0; + $1 = HEAP32[$0>>2]|0; + $2 = ((($0)) + 4|0); + $3 = HEAP32[$2>>2]|0; + $4 = Math_imul($3, $1)|0; + $5 = ((($z)) + 12|0); + $6 = HEAP32[$5>>2]|0; + switch ($out_n|0) { + case 2: { + $11 = ($4|0)==(0); + if ($11) { + return; + } + $12 = Math_imul($3, $1)|0; + $i$03 = 0;$p$04 = $6; + while(1) { + $13 = HEAP8[$p$04>>0]|0; + $14 = HEAP8[$tc>>0]|0; + $not$ = ($13<<24>>24)!=($14<<24>>24); + $15 = $not$ << 31 >> 31; + $16 = ((($p$04)) + 1|0); + HEAP8[$16>>0] = $15; + $17 = ((($p$04)) + 2|0); + $18 = (($i$03) + 1)|0; + $exitcond = ($18|0)==($12|0); + if ($exitcond) { + break; + } else { + $i$03 = $18;$p$04 = $17; + } + } + return; + break; + } + case 4: { + $7 = ($4|0)==(0); + if ($7) { + return; + } + $8 = ((($tc)) + 1|0); + $9 = ((($tc)) + 2|0); + $10 = Math_imul($3, $1)|0; + $i$15 = 0;$p$16 = $6; + while(1) { + $19 = HEAP8[$p$16>>0]|0; + $20 = HEAP8[$tc>>0]|0; + $21 = ($19<<24>>24)==($20<<24>>24); + if ($21) { + $22 = ((($p$16)) + 1|0); + $23 = HEAP8[$22>>0]|0; + $24 = HEAP8[$8>>0]|0; + $25 = ($23<<24>>24)==($24<<24>>24); + if ($25) { + $26 = ((($p$16)) + 2|0); + $27 = HEAP8[$26>>0]|0; + $28 = HEAP8[$9>>0]|0; + $29 = ($27<<24>>24)==($28<<24>>24); + if ($29) { + $30 = ((($p$16)) + 3|0); + HEAP8[$30>>0] = 0; + } + } + } + $31 = ((($p$16)) + 4|0); + $32 = (($i$15) + 1)|0; + $exitcond8 = ($32|0)==($10|0); + if ($exitcond8) { + break; + } else { + $i$15 = $32;$p$16 = $31; + } + } + return; + break; + } + default: { + ___assert_fail((13014|0),(12975|0),4273,(13039|0)); + // unreachable; + } + } +} +function _stbi__de_iphone($z) { + $z = $z|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $exitcond14 = 0, $i$06 = 0, $i$111 = 0, $i$28 = 0, $p$05 = 0, $p$110 = 0, $p$27 = 0, $storemerge = 0, label = 0; + var sp = 0; + sp = STACKTOP; + $0 = HEAP32[$z>>2]|0; + $1 = HEAP32[$0>>2]|0; + $2 = ((($0)) + 4|0); + $3 = HEAP32[$2>>2]|0; + $4 = Math_imul($3, $1)|0; + $5 = ((($z)) + 12|0); + $6 = HEAP32[$5>>2]|0; + $7 = ((($0)) + 12|0); + $8 = HEAP32[$7>>2]|0; + switch ($8|0) { + case 3: { + $9 = ($4|0)==(0); + if ($9) { + return; + } + $10 = Math_imul($3, $1)|0; + $i$06 = 0;$p$05 = $6; + while(1) { + $11 = HEAP8[$p$05>>0]|0; + $12 = ((($p$05)) + 2|0); + $13 = HEAP8[$12>>0]|0; + HEAP8[$p$05>>0] = $13; + HEAP8[$12>>0] = $11; + $14 = ((($p$05)) + 3|0); + $15 = (($i$06) + 1)|0; + $exitcond = ($15|0)==($10|0); + if ($exitcond) { + break; + } else { + $i$06 = $15;$p$05 = $14; + } + } + return; + break; + } + case 4: { + $16 = HEAP32[2616>>2]|0; + $17 = ($16|0)==(0); + $18 = ($4|0)==(0); + if ($17) { + if ($18) { + return; + } + $20 = Math_imul($3, $1)|0; + $i$28 = 0;$p$27 = $6; + while(1) { + $44 = HEAP8[$p$27>>0]|0; + $45 = ((($p$27)) + 2|0); + $46 = HEAP8[$45>>0]|0; + HEAP8[$p$27>>0] = $46; + HEAP8[$45>>0] = $44; + $47 = ((($p$27)) + 4|0); + $48 = (($i$28) + 1)|0; + $exitcond13 = ($48|0)==($20|0); + if ($exitcond13) { + break; + } else { + $i$28 = $48;$p$27 = $47; + } + } + return; + } + if ($18) { + return; + } + $19 = Math_imul($3, $1)|0; + $i$111 = 0;$p$110 = $6; + while(1) { + $21 = ((($p$110)) + 3|0); + $22 = HEAP8[$21>>0]|0; + $23 = HEAP8[$p$110>>0]|0; + $24 = ($22<<24>>24)==(0); + $25 = ((($p$110)) + 2|0); + $26 = HEAP8[$25>>0]|0; + if ($24) { + HEAP8[$p$110>>0] = $26; + $storemerge = $23; + } else { + $27 = $26&255; + $28 = ($27*255)|0; + $29 = $22&255; + $30 = (($28>>>0) / ($29>>>0))&-1; + $31 = $30&255; + HEAP8[$p$110>>0] = $31; + $32 = ((($p$110)) + 1|0); + $33 = HEAP8[$32>>0]|0; + $34 = $33&255; + $35 = ($34*255)|0; + $36 = (($35>>>0) / ($29>>>0))&-1; + $37 = $36&255; + HEAP8[$32>>0] = $37; + $38 = $23&255; + $39 = ($38*255)|0; + $40 = (($39>>>0) / ($29>>>0))&-1; + $41 = $40&255; + $storemerge = $41; + } + HEAP8[$25>>0] = $storemerge; + $42 = ((($p$110)) + 4|0); + $43 = (($i$111) + 1)|0; + $exitcond14 = ($43|0)==($19|0); + if ($exitcond14) { + break; + } else { + $i$111 = $43;$p$110 = $42; + } + } + return; + break; + } + default: { + ___assert_fail((12957|0),(12975|0),4399,(12998|0)); + // unreachable; + } + } +} +function _stbi__expand_png_palette($a,$palette,$pal_img_n) { + $a = $a|0; + $palette = $palette|0; + $pal_img_n = $pal_img_n|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$04 = 0, $i$16 = 0, $p$03 = 0, $p$15 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$a>>2]|0; + $1 = HEAP32[$0>>2]|0; + $2 = ((($0)) + 4|0); + $3 = HEAP32[$2>>2]|0; + $4 = Math_imul($3, $1)|0; + $5 = ((($a)) + 12|0); + $6 = HEAP32[$5>>2]|0; + $7 = Math_imul($4, $pal_img_n)|0; + $8 = (_stbi__malloc($7)|0); + $9 = ($8|0)==(0|0); + if ($9) { + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + $10 = ($pal_img_n|0)==(3); + $11 = ($4|0)==(0); + if ($10) { + if (!($11)) { + $13 = Math_imul($3, $1)|0; + $i$04 = 0;$p$03 = $8; + while(1) { + $14 = (($6) + ($i$04)|0); + $15 = HEAP8[$14>>0]|0; + $16 = $15&255; + $17 = $16 << 2; + $18 = (($palette) + ($17)|0); + $19 = HEAP8[$18>>0]|0; + HEAP8[$p$03>>0] = $19; + $20 = $17 | 1; + $21 = (($palette) + ($20)|0); + $22 = HEAP8[$21>>0]|0; + $23 = ((($p$03)) + 1|0); + HEAP8[$23>>0] = $22; + $24 = $17 | 2; + $25 = (($palette) + ($24)|0); + $26 = HEAP8[$25>>0]|0; + $27 = ((($p$03)) + 2|0); + HEAP8[$27>>0] = $26; + $28 = ((($p$03)) + 3|0); + $29 = (($i$04) + 1)|0; + $exitcond = ($29|0)==($13|0); + if ($exitcond) { + break; + } else { + $i$04 = $29;$p$03 = $28; + } + } + } + } else { + if (!($11)) { + $12 = Math_imul($3, $1)|0; + $i$16 = 0;$p$15 = $8; + while(1) { + $30 = (($6) + ($i$16)|0); + $31 = HEAP8[$30>>0]|0; + $32 = $31&255; + $33 = $32 << 2; + $34 = (($palette) + ($33)|0); + $35 = HEAP8[$34>>0]|0; + HEAP8[$p$15>>0] = $35; + $36 = $33 | 1; + $37 = (($palette) + ($36)|0); + $38 = HEAP8[$37>>0]|0; + $39 = ((($p$15)) + 1|0); + HEAP8[$39>>0] = $38; + $40 = $33 | 2; + $41 = (($palette) + ($40)|0); + $42 = HEAP8[$41>>0]|0; + $43 = ((($p$15)) + 2|0); + HEAP8[$43>>0] = $42; + $44 = $33 | 3; + $45 = (($palette) + ($44)|0); + $46 = HEAP8[$45>>0]|0; + $47 = ((($p$15)) + 3|0); + HEAP8[$47>>0] = $46; + $48 = ((($p$15)) + 4|0); + $49 = (($i$16) + 1)|0; + $exitcond8 = ($49|0)==($12|0); + if ($exitcond8) { + break; + } else { + $i$16 = $49;$p$15 = $48; + } + } + } + } + $50 = HEAP32[$5>>2]|0; + _free($50); + HEAP32[$5>>2] = $8; + $$0 = 1; + return ($$0|0); +} +function _stbi__create_png_image_raw($a,$raw,$raw_len,$out_n,$x,$y,$depth,$color) { + $a = $a|0; + $raw = $raw|0; + $raw_len = $raw_len|0; + $out_n = $out_n|0; + $x = $x|0; + $y = $y|0; + $depth = $depth|0; + $color = $color|0; + var $$0 = 0, $$01214 = 0, $$1 = 0, $$10 = 0, $$2192 = 0, $$3184 = 0, $$4176 = 0, $$5167 = 0, $$6158 = 0, $$7149 = 0, $$8141 = 0, $$9 = 0, $$not = 0, $$not288 = 0, $$sum = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0; + var $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum272 = 0, $$sum273 = 0, $$sum274 = 0, $$sum275 = 0, $$sum276 = 0, $$sum277 = 0; + var $$sum278 = 0, $$sum279 = 0, $$sum28 = 0, $$sum29 = 0, $$sum29$pn = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum6 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0; + var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0; + var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0; + var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0; + var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0; + var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0; + var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0; + var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0; + var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0; + var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0; + var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0; + var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0; + var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0; + var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0; + var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0; + var $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0; + var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0; + var $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0; + var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0; + var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0; + var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0; + var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0; + var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0; + var $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0; + var $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0; + var $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0; + var $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0; + var $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0; + var $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0; + var $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0; + var $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0; + var $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; + var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; + var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $brmerge287 = 0, $cur$0$sum = 0, $cur$0$sum30 = 0, $cur$0$sum31 = 0, $cur$0$sum32 = 0, $cur$0$sum33 = 0, $cur$0$sum34 = 0, $cur$0$sum35 = 0, $cur$0$sum36 = 0, $cur$0$sum37 = 0, $cur$0$sum38 = 0, $cur$0$sum39 = 0, $cur$0$sum40 = 0; + var $cur$0$sum41 = 0, $cur$1 = 0, $cur$2191 = 0, $cur$3183 = 0, $cur$4174 = 0, $cur$5165 = 0, $cur$6156 = 0, $cur$7148 = 0, $cur$8140 = 0, $cur$9196 = 0, $cur1$0$lcssa = 0, $cur1$0112 = 0, $cur1$1$lcssa = 0, $cur1$1104 = 0, $cur1$4$lcssa = 0, $cur1$499 = 0, $cur16$0129 = 0, $exitcond = 0, $exitcond249 = 0, $exitcond250 = 0; + var $exitcond252 = 0, $exitcond254 = 0, $exitcond256 = 0, $exitcond258 = 0, $exitcond260 = 0, $exitcond262 = 0, $exitcond265 = 0, $exitcond266 = 0, $exitcond267 = 0, $exitcond268 = 0, $exitcond269 = 0, $exitcond270 = 0, $exitcond271 = 0, $filter$0 = 0, $filter_bytes$0212 = 0, $filter_bytes$1 = 0, $i$0 = 0, $i$0190 = 0, $i$0193 = 0, $i$1 = 0; + var $i$1182 = 0, $i$1185 = 0, $i$2 = 0, $i$2173 = 0, $i$2177 = 0, $i$3 = 0, $i$3164 = 0, $i$3168 = 0, $i$4 = 0, $i$4155 = 0, $i$4159 = 0, $i$5 = 0, $i$5147 = 0, $i$5150 = 0, $i$6 = 0, $i$6139 = 0, $i$6142 = 0, $i$7195 = 0, $i$8127 = 0, $in$0$lcssa = 0; + var $in$0113 = 0, $in$1$lcssa = 0, $in$1105 = 0, $in$2$lcssa = 0, $in$2100 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next234 = 0, $indvars$iv$next237 = 0, $indvars$iv$next240 = 0, $indvars$iv$next243 = 0, $indvars$iv$next246 = 0, $indvars$iv233 = 0, $indvars$iv236 = 0, $indvars$iv239 = 0, $indvars$iv242 = 0, $indvars$iv245 = 0, $j$0211 = 0, $j$1125 = 0, $k$0132 = 0; + var $k$10161 = 0, $k$11152 = 0, $k$1209 = 0, $k$12144 = 0, $k$13136 = 0, $k$14$lcssa = 0, $k$14111 = 0, $k$15$lcssa = 0, $k$15103 = 0, $k$16$lcssa = 0, $k$1698 = 0, $k$2207 = 0, $k$3205 = 0, $k$4203 = 0, $k$5201 = 0, $k$6199 = 0, $k$7187 = 0, $k$8179 = 0, $k$9170 = 0, $or$cond = 0; + var $or$cond290 = 0, $prior$0 = 0, $prior$3175 = 0, $prior$4166 = 0, $prior$5157 = 0, $q$0 = 0, $q$0122 = 0, $q$0123 = 0, $q$1 = 0, $q$1119 = 0, $q$1120 = 0, $scevgep = 0, $scevgep235 = 0, $scevgep238 = 0, $scevgep241 = 0, $scevgep244 = 0, $scevgep247 = 0, $scevgep251 = 0, $scevgep253 = 0, $scevgep255 = 0; + var $scevgep257 = 0, $scevgep259 = 0, $scevgep261 = 0, $scevgep264 = 0, $width$0213 = 0, $width$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($depth|0)==(16); + $1 = $0 ? 2 : 1; + $2 = HEAP32[$a>>2]|0; + $3 = Math_imul($x, $out_n)|0; + $4 = Math_imul($1, $3)|0; + $5 = ((($2)) + 8|0); + $6 = HEAP32[$5>>2]|0; + $7 = Math_imul($1, $out_n)|0; + $8 = Math_imul($6, $1)|0; + $9 = ($6|0)==($out_n|0); + $10 = (($6) + 1)|0; + $11 = ($10|0)==($out_n|0); + $or$cond = $9 | $11; + if (!($or$cond)) { + ___assert_fail((13095|0),(12975|0),4026,(13136|0)); + // unreachable; + } + $12 = Math_imul($y, $x)|0; + $13 = Math_imul($7, $12)|0; + $14 = (_stbi__malloc($13)|0); + $15 = ((($a)) + 12|0); + HEAP32[$15>>2] = $14; + $16 = ($14|0)==(0|0); + if ($16) { + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + $17 = Math_imul($6, $x)|0; + $18 = Math_imul($17, $depth)|0; + $19 = (($18) + 7)|0; + $20 = $19 >>> 3; + $21 = (($20) + 1)|0; + $22 = Math_imul($21, $y)|0; + $23 = HEAP32[$2>>2]|0; + $24 = ($23|0)==($x|0); + if ($24) { + $25 = ((($2)) + 4|0); + $26 = HEAP32[$25>>2]|0; + $27 = ($26|0)==($y|0); + if ($27) { + $28 = ($22|0)==($raw_len|0); + if (!($28)) { + _stbi__err(13163); + $$0 = 0; + return ($$0|0); + } + } else { + label = 9; + } + } else { + label = 9; + } + if ((label|0) == 9) { + $29 = ($22>>>0)>($raw_len>>>0); + if ($29) { + _stbi__err(13163); + $$0 = 0; + return ($$0|0); + } + } + $30 = ($y|0)==(0); + L18: do { + if (!($30)) { + $31 = ($depth|0)<(8); + $32 = ($20>>>0)>($x>>>0); + $33 = (($3) - ($20))|0; + $34 = ($depth|0)==(8); + $$sum17 = (($6) + 1)|0; + $brmerge = $31 | $9; + $35 = ($x|0)==(0); + $i$0190 = (($x) + -1)|0; + $36 = ($i$0190|0)==(0); + $i$1182 = (($x) + -1)|0; + $37 = ($i$1182|0)==(0); + $i$2173 = (($x) + -1)|0; + $38 = ($i$2173|0)==(0); + $i$3164 = (($x) + -1)|0; + $39 = ($i$3164|0)==(0); + $i$4155 = (($x) + -1)|0; + $40 = ($i$4155|0)==(0); + $i$5147 = (($x) + -1)|0; + $41 = ($i$5147|0)==(0); + $i$6139 = (($x) + -1)|0; + $42 = ($i$6139|0)==(0); + $$not = $0 ^ 1; + $brmerge287 = $35 | $$not; + $$01214 = $raw;$filter_bytes$0212 = $8;$j$0211 = 0;$width$0213 = $x; + while(1) { + $43 = HEAP32[$15>>2]|0; + $44 = Math_imul($j$0211, $4)|0; + $$sum13 = (($44) - ($4))|0; + $45 = HEAP8[$$01214>>0]|0; + $46 = $45&255; + $47 = ($45&255)>(4); + if ($47) { + label = 14; + break; + } + if ($31) { + if ($32) { + label = 17; + break; + } + $$sum29 = (($33) + ($44))|0; + $$sum29$pn = $$sum29;$filter_bytes$1 = 1;$width$1 = $20; + } else { + $$sum29$pn = $44;$filter_bytes$1 = $filter_bytes$0212;$width$1 = $width$0213; + } + $48 = ($j$0211|0)==(0); + if ($48) { + $49 = (13217 + ($46)|0); + $50 = HEAP8[$49>>0]|0; + $51 = $50&255; + $filter$0 = $51; + } else { + $filter$0 = $46; + } + $52 = ($filter_bytes$1|0)>(0); + L30: do { + if ($52) { + $k$0132 = 0; + while(1) { + switch ($filter$0|0) { + case 0: { + $$sum28 = (($k$0132) + 1)|0; + $53 = (($$01214) + ($$sum28)|0); + $54 = HEAP8[$53>>0]|0; + $cur$0$sum35 = (($k$0132) + ($$sum29$pn))|0; + $55 = (($43) + ($cur$0$sum35)|0); + HEAP8[$55>>0] = $54; + break; + } + case 1: { + $$sum27 = (($k$0132) + 1)|0; + $56 = (($$01214) + ($$sum27)|0); + $57 = HEAP8[$56>>0]|0; + $cur$0$sum36 = (($k$0132) + ($$sum29$pn))|0; + $58 = (($43) + ($cur$0$sum36)|0); + HEAP8[$58>>0] = $57; + break; + } + case 2: { + $$sum25 = (($k$0132) + 1)|0; + $59 = (($$01214) + ($$sum25)|0); + $60 = HEAP8[$59>>0]|0; + $61 = $60&255; + $$sum26 = (($k$0132) + ($$sum13))|0; + $62 = (($43) + ($$sum26)|0); + $63 = HEAP8[$62>>0]|0; + $64 = $63&255; + $65 = (($64) + ($61))|0; + $66 = $65&255; + $cur$0$sum37 = (($k$0132) + ($$sum29$pn))|0; + $67 = (($43) + ($cur$0$sum37)|0); + HEAP8[$67>>0] = $66; + break; + } + case 3: { + $$sum23 = (($k$0132) + 1)|0; + $68 = (($$01214) + ($$sum23)|0); + $69 = HEAP8[$68>>0]|0; + $70 = $69&255; + $$sum24 = (($k$0132) + ($$sum13))|0; + $71 = (($43) + ($$sum24)|0); + $72 = HEAP8[$71>>0]|0; + $73 = $72&255; + $74 = $73 >>> 1; + $75 = (($74) + ($70))|0; + $76 = $75&255; + $cur$0$sum38 = (($k$0132) + ($$sum29$pn))|0; + $77 = (($43) + ($cur$0$sum38)|0); + HEAP8[$77>>0] = $76; + break; + } + case 4: { + $$sum21 = (($k$0132) + 1)|0; + $78 = (($$01214) + ($$sum21)|0); + $79 = HEAP8[$78>>0]|0; + $80 = $79&255; + $$sum22 = (($k$0132) + ($$sum13))|0; + $81 = (($43) + ($$sum22)|0); + $82 = HEAP8[$81>>0]|0; + $83 = $82&255; + $84 = (_stbi__paeth(0,$83,0)|0); + $85 = (($84) + ($80))|0; + $86 = $85&255; + $cur$0$sum39 = (($k$0132) + ($$sum29$pn))|0; + $87 = (($43) + ($cur$0$sum39)|0); + HEAP8[$87>>0] = $86; + break; + } + case 5: { + $$sum20 = (($k$0132) + 1)|0; + $88 = (($$01214) + ($$sum20)|0); + $89 = HEAP8[$88>>0]|0; + $cur$0$sum40 = (($k$0132) + ($$sum29$pn))|0; + $90 = (($43) + ($cur$0$sum40)|0); + HEAP8[$90>>0] = $89; + break; + } + case 6: { + $$sum19 = (($k$0132) + 1)|0; + $91 = (($$01214) + ($$sum19)|0); + $92 = HEAP8[$91>>0]|0; + $cur$0$sum41 = (($k$0132) + ($$sum29$pn))|0; + $93 = (($43) + ($cur$0$sum41)|0); + HEAP8[$93>>0] = $92; + break; + } + default: { + } + } + $94 = (($k$0132) + 1)|0; + $exitcond249 = ($94|0)==($filter_bytes$1|0); + if ($exitcond249) { + break L30; + } else { + $k$0132 = $94; + } + } + } + } while(0); + do { + if ($34) { + if (!($9)) { + $cur$0$sum34 = (($$sum29$pn) + ($6))|0; + $95 = (($43) + ($cur$0$sum34)|0); + HEAP8[$95>>0] = -1; + } + $96 = (($$01214) + ($$sum17)|0); + $cur$0$sum33 = (($$sum29$pn) + ($out_n))|0; + $97 = (($43) + ($cur$0$sum33)|0); + $$sum18 = (($$sum13) + ($out_n))|0; + $98 = (($43) + ($$sum18)|0); + $$1 = $96;$cur$1 = $97;$prior$0 = $98; + } else { + if (!($0)) { + $105 = ((($$01214)) + 2|0); + $cur$0$sum = (($$sum29$pn) + 1)|0; + $106 = (($43) + ($cur$0$sum)|0); + $$sum14 = (($$sum13) + 1)|0; + $107 = (($43) + ($$sum14)|0); + $$1 = $105;$cur$1 = $106;$prior$0 = $107; + break; + } + if (!($9)) { + $cur$0$sum32 = (($$sum29$pn) + ($filter_bytes$1))|0; + $99 = (($43) + ($cur$0$sum32)|0); + HEAP8[$99>>0] = -1; + $100 = (($filter_bytes$1) + 1)|0; + $cur$0$sum31 = (($100) + ($$sum29$pn))|0; + $101 = (($43) + ($cur$0$sum31)|0); + HEAP8[$101>>0] = -1; + } + $$sum15 = (($filter_bytes$1) + 1)|0; + $102 = (($$01214) + ($$sum15)|0); + $cur$0$sum30 = (($$sum29$pn) + ($7))|0; + $103 = (($43) + ($cur$0$sum30)|0); + $$sum16 = (($$sum13) + ($7))|0; + $104 = (($43) + ($$sum16)|0); + $$1 = $102;$cur$1 = $103;$prior$0 = $104; + } + } while(0); + if ($brmerge) { + $108 = (($width$1) + -1)|0; + $109 = Math_imul($108, $filter_bytes$1)|0; + switch ($filter$0|0) { + case 0: { + _memcpy(($cur$1|0),($$1|0),($109|0))|0; + break; + } + case 1: { + $125 = ($109|0)>(0); + if ($125) { + $126 = (($width$1) + -1)|0; + $127 = Math_imul($filter_bytes$1, $126)|0; + $k$1209 = 0; + while(1) { + $128 = (($$1) + ($k$1209)|0); + $129 = HEAP8[$128>>0]|0; + $130 = $129&255; + $131 = (($k$1209) - ($filter_bytes$1))|0; + $132 = (($cur$1) + ($131)|0); + $133 = HEAP8[$132>>0]|0; + $134 = $133&255; + $135 = (($134) + ($130))|0; + $136 = $135&255; + $137 = (($cur$1) + ($k$1209)|0); + HEAP8[$137>>0] = $136; + $138 = (($k$1209) + 1)|0; + $exitcond271 = ($138|0)==($127|0); + if ($exitcond271) { + break; + } else { + $k$1209 = $138; + } + } + } + break; + } + case 2: { + $122 = ($109|0)>(0); + if ($122) { + $123 = (($width$1) + -1)|0; + $124 = Math_imul($filter_bytes$1, $123)|0; + $k$2207 = 0; + while(1) { + $139 = (($$1) + ($k$2207)|0); + $140 = HEAP8[$139>>0]|0; + $141 = $140&255; + $142 = (($prior$0) + ($k$2207)|0); + $143 = HEAP8[$142>>0]|0; + $144 = $143&255; + $145 = (($144) + ($141))|0; + $146 = $145&255; + $147 = (($cur$1) + ($k$2207)|0); + HEAP8[$147>>0] = $146; + $148 = (($k$2207) + 1)|0; + $exitcond270 = ($148|0)==($124|0); + if ($exitcond270) { + break; + } else { + $k$2207 = $148; + } + } + } + break; + } + case 3: { + $119 = ($109|0)>(0); + if ($119) { + $120 = (($width$1) + -1)|0; + $121 = Math_imul($filter_bytes$1, $120)|0; + $k$3205 = 0; + while(1) { + $149 = (($$1) + ($k$3205)|0); + $150 = HEAP8[$149>>0]|0; + $151 = $150&255; + $152 = (($prior$0) + ($k$3205)|0); + $153 = HEAP8[$152>>0]|0; + $154 = $153&255; + $155 = (($k$3205) - ($filter_bytes$1))|0; + $156 = (($cur$1) + ($155)|0); + $157 = HEAP8[$156>>0]|0; + $158 = $157&255; + $159 = (($158) + ($154))|0; + $160 = $159 >>> 1; + $161 = (($160) + ($151))|0; + $162 = $161&255; + $163 = (($cur$1) + ($k$3205)|0); + HEAP8[$163>>0] = $162; + $164 = (($k$3205) + 1)|0; + $exitcond269 = ($164|0)==($121|0); + if ($exitcond269) { + break; + } else { + $k$3205 = $164; + } + } + } + break; + } + case 4: { + $116 = ($109|0)>(0); + if ($116) { + $117 = (($width$1) + -1)|0; + $118 = Math_imul($filter_bytes$1, $117)|0; + $k$4203 = 0; + while(1) { + $165 = (($$1) + ($k$4203)|0); + $166 = HEAP8[$165>>0]|0; + $167 = $166&255; + $168 = (($k$4203) - ($filter_bytes$1))|0; + $169 = (($cur$1) + ($168)|0); + $170 = HEAP8[$169>>0]|0; + $171 = $170&255; + $172 = (($prior$0) + ($k$4203)|0); + $173 = HEAP8[$172>>0]|0; + $174 = $173&255; + $175 = (($prior$0) + ($168)|0); + $176 = HEAP8[$175>>0]|0; + $177 = $176&255; + $178 = (_stbi__paeth($171,$174,$177)|0); + $179 = (($178) + ($167))|0; + $180 = $179&255; + $181 = (($cur$1) + ($k$4203)|0); + HEAP8[$181>>0] = $180; + $182 = (($k$4203) + 1)|0; + $exitcond268 = ($182|0)==($118|0); + if ($exitcond268) { + break; + } else { + $k$4203 = $182; + } + } + } + break; + } + case 5: { + $113 = ($109|0)>(0); + if ($113) { + $114 = (($width$1) + -1)|0; + $115 = Math_imul($filter_bytes$1, $114)|0; + $k$5201 = 0; + while(1) { + $183 = (($$1) + ($k$5201)|0); + $184 = HEAP8[$183>>0]|0; + $185 = $184&255; + $186 = (($k$5201) - ($filter_bytes$1))|0; + $187 = (($cur$1) + ($186)|0); + $188 = HEAP8[$187>>0]|0; + $189 = $188&255; + $190 = $189 >>> 1; + $191 = (($190) + ($185))|0; + $192 = $191&255; + $193 = (($cur$1) + ($k$5201)|0); + HEAP8[$193>>0] = $192; + $194 = (($k$5201) + 1)|0; + $exitcond267 = ($194|0)==($115|0); + if ($exitcond267) { + break; + } else { + $k$5201 = $194; + } + } + } + break; + } + case 6: { + $110 = ($109|0)>(0); + if ($110) { + $111 = (($width$1) + -1)|0; + $112 = Math_imul($filter_bytes$1, $111)|0; + $k$6199 = 0; + while(1) { + $195 = (($$1) + ($k$6199)|0); + $196 = HEAP8[$195>>0]|0; + $197 = $196&255; + $198 = (($k$6199) - ($filter_bytes$1))|0; + $199 = (($cur$1) + ($198)|0); + $200 = HEAP8[$199>>0]|0; + $201 = $200&255; + $202 = (_stbi__paeth($201,0,0)|0); + $203 = (($202) + ($197))|0; + $204 = $203&255; + $205 = (($cur$1) + ($k$6199)|0); + HEAP8[$205>>0] = $204; + $206 = (($k$6199) + 1)|0; + $exitcond266 = ($206|0)==($112|0); + if ($exitcond266) { + break; + } else { + $k$6199 = $206; + } + } + } + break; + } + default: { + } + } + $207 = (($$1) + ($109)|0); + $$10 = $207; + } else { + if (!($11)) { + label = 63; + break; + } + switch ($filter$0|0) { + case 0: { + if ($36) { + $$9 = $$1; + } else { + $220 = ($filter_bytes$1|0)>(0); + $221 = Math_imul($i$6139, $filter_bytes$1)|0; + $$2192 = $$1;$cur$2191 = $cur$1;$i$0193 = $i$0190; + while(1) { + if ($220) { + $k$7187 = 0; + while(1) { + $222 = (($$2192) + ($k$7187)|0); + $223 = HEAP8[$222>>0]|0; + $224 = (($cur$2191) + ($k$7187)|0); + HEAP8[$224>>0] = $223; + $225 = (($k$7187) + 1)|0; + $exitcond262 = ($225|0)==($filter_bytes$1|0); + if ($exitcond262) { + break; + } else { + $k$7187 = $225; + } + } + } + $226 = (($cur$2191) + ($filter_bytes$1)|0); + HEAP8[$226>>0] = -1; + $227 = (($$2192) + ($filter_bytes$1)|0); + $228 = (($cur$2191) + ($7)|0); + $i$0 = (($i$0193) + -1)|0; + $229 = ($i$0|0)==(0); + if ($229) { + break; + } else { + $$2192 = $227;$cur$2191 = $228;$i$0193 = $i$0; + } + } + $scevgep264 = (($$1) + ($221)|0); + $$9 = $scevgep264; + } + break; + } + case 1: { + if ($37) { + $$9 = $$1; + } else { + $218 = ($filter_bytes$1|0)>(0); + $219 = Math_imul($i$6139, $filter_bytes$1)|0; + $$3184 = $$1;$cur$3183 = $cur$1;$i$1185 = $i$1182; + while(1) { + if ($218) { + $k$8179 = 0; + while(1) { + $230 = (($$3184) + ($k$8179)|0); + $231 = HEAP8[$230>>0]|0; + $232 = $231&255; + $233 = (($k$8179) - ($7))|0; + $234 = (($cur$3183) + ($233)|0); + $235 = HEAP8[$234>>0]|0; + $236 = $235&255; + $237 = (($236) + ($232))|0; + $238 = $237&255; + $239 = (($cur$3183) + ($k$8179)|0); + HEAP8[$239>>0] = $238; + $240 = (($k$8179) + 1)|0; + $exitcond260 = ($240|0)==($filter_bytes$1|0); + if ($exitcond260) { + break; + } else { + $k$8179 = $240; + } + } + } + $241 = (($cur$3183) + ($filter_bytes$1)|0); + HEAP8[$241>>0] = -1; + $242 = (($$3184) + ($filter_bytes$1)|0); + $243 = (($cur$3183) + ($7)|0); + $i$1 = (($i$1185) + -1)|0; + $244 = ($i$1|0)==(0); + if ($244) { + break; + } else { + $$3184 = $242;$cur$3183 = $243;$i$1185 = $i$1; + } + } + $scevgep261 = (($$1) + ($219)|0); + $$9 = $scevgep261; + } + break; + } + case 2: { + if ($38) { + $$9 = $$1; + } else { + $216 = ($filter_bytes$1|0)>(0); + $217 = Math_imul($i$6139, $filter_bytes$1)|0; + $$4176 = $$1;$cur$4174 = $cur$1;$i$2177 = $i$2173;$prior$3175 = $prior$0; + while(1) { + if ($216) { + $k$9170 = 0; + while(1) { + $245 = (($$4176) + ($k$9170)|0); + $246 = HEAP8[$245>>0]|0; + $247 = $246&255; + $248 = (($prior$3175) + ($k$9170)|0); + $249 = HEAP8[$248>>0]|0; + $250 = $249&255; + $251 = (($250) + ($247))|0; + $252 = $251&255; + $253 = (($cur$4174) + ($k$9170)|0); + HEAP8[$253>>0] = $252; + $254 = (($k$9170) + 1)|0; + $exitcond258 = ($254|0)==($filter_bytes$1|0); + if ($exitcond258) { + break; + } else { + $k$9170 = $254; + } + } + } + $255 = (($cur$4174) + ($filter_bytes$1)|0); + HEAP8[$255>>0] = -1; + $256 = (($$4176) + ($filter_bytes$1)|0); + $257 = (($cur$4174) + ($7)|0); + $258 = (($prior$3175) + ($7)|0); + $i$2 = (($i$2177) + -1)|0; + $259 = ($i$2|0)==(0); + if ($259) { + break; + } else { + $$4176 = $256;$cur$4174 = $257;$i$2177 = $i$2;$prior$3175 = $258; + } + } + $scevgep259 = (($$1) + ($217)|0); + $$9 = $scevgep259; + } + break; + } + case 3: { + if ($39) { + $$9 = $$1; + } else { + $214 = ($filter_bytes$1|0)>(0); + $215 = Math_imul($i$6139, $filter_bytes$1)|0; + $$5167 = $$1;$cur$5165 = $cur$1;$i$3168 = $i$3164;$prior$4166 = $prior$0; + while(1) { + if ($214) { + $k$10161 = 0; + while(1) { + $260 = (($$5167) + ($k$10161)|0); + $261 = HEAP8[$260>>0]|0; + $262 = $261&255; + $263 = (($prior$4166) + ($k$10161)|0); + $264 = HEAP8[$263>>0]|0; + $265 = $264&255; + $266 = (($k$10161) - ($7))|0; + $267 = (($cur$5165) + ($266)|0); + $268 = HEAP8[$267>>0]|0; + $269 = $268&255; + $270 = (($269) + ($265))|0; + $271 = $270 >>> 1; + $272 = (($271) + ($262))|0; + $273 = $272&255; + $274 = (($cur$5165) + ($k$10161)|0); + HEAP8[$274>>0] = $273; + $275 = (($k$10161) + 1)|0; + $exitcond256 = ($275|0)==($filter_bytes$1|0); + if ($exitcond256) { + break; + } else { + $k$10161 = $275; + } + } + } + $276 = (($cur$5165) + ($filter_bytes$1)|0); + HEAP8[$276>>0] = -1; + $277 = (($$5167) + ($filter_bytes$1)|0); + $278 = (($cur$5165) + ($7)|0); + $279 = (($prior$4166) + ($7)|0); + $i$3 = (($i$3168) + -1)|0; + $280 = ($i$3|0)==(0); + if ($280) { + break; + } else { + $$5167 = $277;$cur$5165 = $278;$i$3168 = $i$3;$prior$4166 = $279; + } + } + $scevgep257 = (($$1) + ($215)|0); + $$9 = $scevgep257; + } + break; + } + case 4: { + if ($40) { + $$9 = $$1; + } else { + $212 = ($filter_bytes$1|0)>(0); + $213 = Math_imul($i$6139, $filter_bytes$1)|0; + $$6158 = $$1;$cur$6156 = $cur$1;$i$4159 = $i$4155;$prior$5157 = $prior$0; + while(1) { + if ($212) { + $k$11152 = 0; + while(1) { + $281 = (($$6158) + ($k$11152)|0); + $282 = HEAP8[$281>>0]|0; + $283 = $282&255; + $284 = (($k$11152) - ($7))|0; + $285 = (($cur$6156) + ($284)|0); + $286 = HEAP8[$285>>0]|0; + $287 = $286&255; + $288 = (($prior$5157) + ($k$11152)|0); + $289 = HEAP8[$288>>0]|0; + $290 = $289&255; + $291 = (($prior$5157) + ($284)|0); + $292 = HEAP8[$291>>0]|0; + $293 = $292&255; + $294 = (_stbi__paeth($287,$290,$293)|0); + $295 = (($294) + ($283))|0; + $296 = $295&255; + $297 = (($cur$6156) + ($k$11152)|0); + HEAP8[$297>>0] = $296; + $298 = (($k$11152) + 1)|0; + $exitcond254 = ($298|0)==($filter_bytes$1|0); + if ($exitcond254) { + break; + } else { + $k$11152 = $298; + } + } + } + $299 = (($cur$6156) + ($filter_bytes$1)|0); + HEAP8[$299>>0] = -1; + $300 = (($$6158) + ($filter_bytes$1)|0); + $301 = (($cur$6156) + ($7)|0); + $302 = (($prior$5157) + ($7)|0); + $i$4 = (($i$4159) + -1)|0; + $303 = ($i$4|0)==(0); + if ($303) { + break; + } else { + $$6158 = $300;$cur$6156 = $301;$i$4159 = $i$4;$prior$5157 = $302; + } + } + $scevgep255 = (($$1) + ($213)|0); + $$9 = $scevgep255; + } + break; + } + case 5: { + if ($41) { + $$9 = $$1; + } else { + $210 = ($filter_bytes$1|0)>(0); + $211 = Math_imul($i$6139, $filter_bytes$1)|0; + $$7149 = $$1;$cur$7148 = $cur$1;$i$5150 = $i$5147; + while(1) { + if ($210) { + $k$12144 = 0; + while(1) { + $304 = (($$7149) + ($k$12144)|0); + $305 = HEAP8[$304>>0]|0; + $306 = $305&255; + $307 = (($k$12144) - ($7))|0; + $308 = (($cur$7148) + ($307)|0); + $309 = HEAP8[$308>>0]|0; + $310 = $309&255; + $311 = $310 >>> 1; + $312 = (($311) + ($306))|0; + $313 = $312&255; + $314 = (($cur$7148) + ($k$12144)|0); + HEAP8[$314>>0] = $313; + $315 = (($k$12144) + 1)|0; + $exitcond252 = ($315|0)==($filter_bytes$1|0); + if ($exitcond252) { + break; + } else { + $k$12144 = $315; + } + } + } + $316 = (($cur$7148) + ($filter_bytes$1)|0); + HEAP8[$316>>0] = -1; + $317 = (($$7149) + ($filter_bytes$1)|0); + $318 = (($cur$7148) + ($7)|0); + $i$5 = (($i$5150) + -1)|0; + $319 = ($i$5|0)==(0); + if ($319) { + break; + } else { + $$7149 = $317;$cur$7148 = $318;$i$5150 = $i$5; + } + } + $scevgep253 = (($$1) + ($211)|0); + $$9 = $scevgep253; + } + break; + } + case 6: { + if ($42) { + $$9 = $$1; + } else { + $208 = ($filter_bytes$1|0)>(0); + $209 = Math_imul($i$6139, $filter_bytes$1)|0; + $$8141 = $$1;$cur$8140 = $cur$1;$i$6142 = $i$6139; + while(1) { + if ($208) { + $k$13136 = 0; + while(1) { + $320 = (($$8141) + ($k$13136)|0); + $321 = HEAP8[$320>>0]|0; + $322 = $321&255; + $323 = (($k$13136) - ($7))|0; + $324 = (($cur$8140) + ($323)|0); + $325 = HEAP8[$324>>0]|0; + $326 = $325&255; + $327 = (_stbi__paeth($326,0,0)|0); + $328 = (($327) + ($322))|0; + $329 = $328&255; + $330 = (($cur$8140) + ($k$13136)|0); + HEAP8[$330>>0] = $329; + $331 = (($k$13136) + 1)|0; + $exitcond250 = ($331|0)==($filter_bytes$1|0); + if ($exitcond250) { + break; + } else { + $k$13136 = $331; + } + } + } + $332 = (($cur$8140) + ($filter_bytes$1)|0); + HEAP8[$332>>0] = -1; + $333 = (($$8141) + ($filter_bytes$1)|0); + $334 = (($cur$8140) + ($7)|0); + $i$6 = (($i$6142) + -1)|0; + $335 = ($i$6|0)==(0); + if ($335) { + break; + } else { + $$8141 = $333;$cur$8140 = $334;$i$6142 = $i$6; + } + } + $scevgep251 = (($$1) + ($209)|0); + $$9 = $scevgep251; + } + break; + } + default: { + $$9 = $$1; + } + } + if ($brmerge287) { + $$10 = $$9; + } else { + $336 = HEAP32[$15>>2]|0; + $337 = (($336) + ($44)|0); + $338 = (($filter_bytes$1) + 1)|0; + $cur$9196 = $337;$i$7195 = 0; + while(1) { + $339 = (($cur$9196) + ($338)|0); + HEAP8[$339>>0] = -1; + $340 = (($i$7195) + 1)|0; + $341 = (($cur$9196) + ($7)|0); + $exitcond265 = ($340|0)==($x|0); + if ($exitcond265) { + $$10 = $$9; + break; + } else { + $cur$9196 = $341;$i$7195 = $340; + } + } + } + } + $342 = (($j$0211) + 1)|0; + $343 = ($342>>>0)<($y>>>0); + if ($343) { + $$01214 = $$10;$filter_bytes$0212 = $filter_bytes$1;$j$0211 = $342;$width$0213 = $width$1; + } else { + break L18; + } + } + if ((label|0) == 14) { + _stbi__err(13181); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 17) { + ___assert_fail((13196|0),(12975|0),4047,(13136|0)); + // unreachable; + } + else if ((label|0) == 63) { + ___assert_fail((13222|0),(12975|0),4108,(13136|0)); + // unreachable; + } + } + } while(0); + $344 = ($depth|0)<(8); + if (!($344)) { + $$not288 = $0 ^ 1; + $639 = Math_imul($12, $out_n)|0; + $640 = ($639|0)==(0); + $or$cond290 = $640 | $$not288; + if ($or$cond290) { + $$0 = 1; + return ($$0|0); + } + $641 = HEAP32[$15>>2]|0; + $642 = Math_imul($y, $x)|0; + $643 = Math_imul($642, $out_n)|0; + $cur16$0129 = $641;$i$8127 = 0; + while(1) { + $644 = HEAP8[$cur16$0129>>0]|0; + $645 = $644&255; + $646 = $645 << 8; + $647 = ((($cur16$0129)) + 1|0); + $648 = HEAP8[$647>>0]|0; + $649 = $648&255; + $650 = $646 | $649; + $651 = $650&65535; + HEAP16[$cur16$0129>>1] = $651; + $652 = (($i$8127) + 1)|0; + $653 = ((($cur16$0129)) + 2|0); + $exitcond = ($652|0)==($643|0); + if ($exitcond) { + $$0 = 1; + break; + } else { + $cur16$0129 = $653;$i$8127 = $652; + } + } + return ($$0|0); + } + $345 = ($y|0)==(0); + if ($345) { + $$0 = 1; + return ($$0|0); + } + $$sum = (($3) - ($20))|0; + $346 = ($color|0)==(0); + $347 = (12888 + ($depth)|0); + $q$0122 = (($x) + -1)|0; + $348 = ($q$0122|0)>(-1); + $q$1119 = (($x) + -1)|0; + $349 = ($q$1119|0)>(-1); + $350 = ($17|0)>(1); + $351 = ($17|0)>(3); + $352 = ($17|0)>(7); + $353 = Math_imul($6, $x)|0; + $354 = (($353) + -8)|0; + $355 = $354 >>> 3; + $356 = Math_imul($x, $out_n)|0; + $357 = (($355) + ($356))|0; + $358 = (($357) + 1)|0; + $359 = Math_imul($6, $depth)|0; + $360 = Math_imul($359, $x)|0; + $361 = (($360) + 7)|0; + $362 = $361 >>> 3; + $363 = (($358) - ($362))|0; + $364 = Math_imul($1, $x)|0; + $365 = Math_imul($364, $out_n)|0; + $366 = (($353) + -8)|0; + $367 = $355 << 3; + $368 = (($366) - ($367))|0; + $369 = (($367) + 8)|0; + $370 = Math_imul($6, $x)|0; + $371 = (($370) + -4)|0; + $372 = $371 >>> 2; + $373 = Math_imul($x, $out_n)|0; + $374 = (($372) + ($373))|0; + $375 = (($374) + 1)|0; + $376 = Math_imul($6, $depth)|0; + $377 = Math_imul($376, $x)|0; + $378 = (($377) + 7)|0; + $379 = $378 >>> 3; + $380 = (($375) - ($379))|0; + $381 = Math_imul($1, $x)|0; + $382 = Math_imul($381, $out_n)|0; + $383 = (($370) + -4)|0; + $384 = $372 << 2; + $385 = (($383) - ($384))|0; + $386 = (($384) + 4)|0; + $387 = Math_imul($6, $x)|0; + $388 = (($387) + -2)|0; + $389 = $388 >>> 1; + $390 = Math_imul($x, $out_n)|0; + $391 = (($389) + ($390))|0; + $392 = (($391) + 1)|0; + $393 = Math_imul($6, $depth)|0; + $394 = Math_imul($393, $x)|0; + $395 = (($394) + 7)|0; + $396 = $395 >>> 3; + $397 = (($392) - ($396))|0; + $398 = Math_imul($1, $x)|0; + $399 = Math_imul($398, $out_n)|0; + $400 = (($387) + -2)|0; + $401 = $389 << 1; + $402 = (($400) - ($401))|0; + $403 = (($401) + 2)|0; + $indvars$iv = $363;$indvars$iv233 = $369;$indvars$iv236 = $380;$indvars$iv239 = $386;$indvars$iv242 = $397;$indvars$iv245 = $403;$j$1125 = 0; + L174: while(1) { + $404 = HEAP32[$15>>2]|0; + $405 = Math_imul($j$1125, $4)|0; + $406 = (($404) + ($405)|0); + $$sum2 = (($$sum) + ($405))|0; + $407 = (($404) + ($$sum2)|0); + if ($346) { + $408 = HEAP8[$347>>0]|0; + $409 = $408&255; + $414 = $409; + } else { + $414 = 1; + } + switch ($depth|0) { + case 4: { + if ($350) { + $scevgep244 = (($404) + ($indvars$iv242)|0); + $cur1$0112 = $406;$in$0113 = $407;$k$14111 = $17; + while(1) { + $410 = HEAP8[$in$0113>>0]|0; + $411 = $410&255; + $412 = $411 >>> 4; + $413 = Math_imul($412, $414)|0; + $415 = $413&255; + $416 = ((($cur1$0112)) + 1|0); + HEAP8[$cur1$0112>>0] = $415; + $417 = HEAP8[$in$0113>>0]|0; + $418 = $417&255; + $419 = $418 & 15; + $420 = Math_imul($419, $414)|0; + $421 = $420&255; + $422 = ((($cur1$0112)) + 2|0); + HEAP8[$416>>0] = $421; + $423 = (($k$14111) + -2)|0; + $424 = ((($in$0113)) + 1|0); + $425 = ($423|0)>(1); + if ($425) { + $cur1$0112 = $422;$in$0113 = $424;$k$14111 = $423; + } else { + break; + } + } + $scevgep247 = (($404) + ($indvars$iv245)|0); + $cur1$0$lcssa = $scevgep247;$in$0$lcssa = $scevgep244;$k$14$lcssa = $402; + } else { + $cur1$0$lcssa = $406;$in$0$lcssa = $407;$k$14$lcssa = $17; + } + $426 = ($k$14$lcssa|0)>(0); + if ($426) { + $427 = HEAP8[$in$0$lcssa>>0]|0; + $428 = $427&255; + $429 = $428 >>> 4; + $430 = Math_imul($429, $414)|0; + $431 = $430&255; + HEAP8[$cur1$0$lcssa>>0] = $431; + } + break; + } + case 2: { + if ($351) { + $scevgep238 = (($404) + ($indvars$iv236)|0); + $cur1$1104 = $406;$in$1105 = $407;$k$15103 = $17; + while(1) { + $432 = HEAP8[$in$1105>>0]|0; + $433 = $432&255; + $434 = $433 >>> 6; + $435 = Math_imul($434, $414)|0; + $436 = $435&255; + $437 = ((($cur1$1104)) + 1|0); + HEAP8[$cur1$1104>>0] = $436; + $438 = HEAP8[$in$1105>>0]|0; + $439 = $438&255; + $440 = $439 >>> 4; + $441 = $440 & 3; + $442 = Math_imul($441, $414)|0; + $443 = $442&255; + $444 = ((($cur1$1104)) + 2|0); + HEAP8[$437>>0] = $443; + $445 = HEAP8[$in$1105>>0]|0; + $446 = $445&255; + $447 = $446 >>> 2; + $448 = $447 & 3; + $449 = Math_imul($448, $414)|0; + $450 = $449&255; + $451 = ((($cur1$1104)) + 3|0); + HEAP8[$444>>0] = $450; + $452 = HEAP8[$in$1105>>0]|0; + $453 = $452&255; + $454 = $453 & 3; + $455 = Math_imul($454, $414)|0; + $456 = $455&255; + $457 = ((($cur1$1104)) + 4|0); + HEAP8[$451>>0] = $456; + $458 = (($k$15103) + -4)|0; + $459 = ((($in$1105)) + 1|0); + $460 = ($458|0)>(3); + if ($460) { + $cur1$1104 = $457;$in$1105 = $459;$k$15103 = $458; + } else { + break; + } + } + $scevgep241 = (($404) + ($indvars$iv239)|0); + $468 = $indvars$iv239;$cur1$1$lcssa = $scevgep241;$in$1$lcssa = $scevgep238;$k$15$lcssa = $385; + } else { + $468 = $405;$cur1$1$lcssa = $406;$in$1$lcssa = $407;$k$15$lcssa = $17; + } + $461 = ($k$15$lcssa|0)>(0); + if ($461) { + $462 = HEAP8[$in$1$lcssa>>0]|0; + $463 = $462&255; + $464 = $463 >>> 6; + $465 = Math_imul($464, $414)|0; + $466 = $465&255; + HEAP8[$cur1$1$lcssa>>0] = $466; + $467 = ($k$15$lcssa|0)>(1); + if ($467) { + $$sum278 = (($468) + 1)|0; + $469 = (($404) + ($$sum278)|0); + $470 = HEAP8[$in$1$lcssa>>0]|0; + $471 = $470&255; + $472 = $471 >>> 4; + $473 = $472 & 3; + $474 = Math_imul($473, $414)|0; + $475 = $474&255; + HEAP8[$469>>0] = $475; + $476 = ($k$15$lcssa|0)>(2); + if ($476) { + $$sum279 = (($468) + 2)|0; + $477 = (($404) + ($$sum279)|0); + $478 = HEAP8[$in$1$lcssa>>0]|0; + $479 = $478&255; + $480 = $479 >>> 2; + $481 = $480 & 3; + $482 = Math_imul($481, $414)|0; + $483 = $482&255; + HEAP8[$477>>0] = $483; + } + } + } + break; + } + case 1: { + if ($352) { + $scevgep = (($404) + ($indvars$iv)|0); + $cur1$499 = $406;$in$2100 = $407;$k$1698 = $17; + while(1) { + $484 = HEAP8[$in$2100>>0]|0; + $485 = $484&255; + $486 = $485 >>> 7; + $487 = (0 - ($486))|0; + $488 = $414 & $487; + $489 = $488&255; + $490 = ((($cur1$499)) + 1|0); + HEAP8[$cur1$499>>0] = $489; + $491 = HEAP8[$in$2100>>0]|0; + $492 = $491&255; + $493 = $492 >>> 6; + $494 = $493 & 1; + $495 = (0 - ($494))|0; + $496 = $414 & $495; + $497 = $496&255; + $498 = ((($cur1$499)) + 2|0); + HEAP8[$490>>0] = $497; + $499 = HEAP8[$in$2100>>0]|0; + $500 = $499&255; + $501 = $500 >>> 5; + $502 = $501 & 1; + $503 = (0 - ($502))|0; + $504 = $414 & $503; + $505 = $504&255; + $506 = ((($cur1$499)) + 3|0); + HEAP8[$498>>0] = $505; + $507 = HEAP8[$in$2100>>0]|0; + $508 = $507&255; + $509 = $508 >>> 4; + $510 = $509 & 1; + $511 = (0 - ($510))|0; + $512 = $414 & $511; + $513 = $512&255; + $514 = ((($cur1$499)) + 4|0); + HEAP8[$506>>0] = $513; + $515 = HEAP8[$in$2100>>0]|0; + $516 = $515&255; + $517 = $516 >>> 3; + $518 = $517 & 1; + $519 = (0 - ($518))|0; + $520 = $414 & $519; + $521 = $520&255; + $522 = ((($cur1$499)) + 5|0); + HEAP8[$514>>0] = $521; + $523 = HEAP8[$in$2100>>0]|0; + $524 = $523&255; + $525 = $524 >>> 2; + $526 = $525 & 1; + $527 = (0 - ($526))|0; + $528 = $414 & $527; + $529 = $528&255; + $530 = ((($cur1$499)) + 6|0); + HEAP8[$522>>0] = $529; + $531 = HEAP8[$in$2100>>0]|0; + $532 = $531&255; + $533 = $532 >>> 1; + $534 = $533 & 1; + $535 = (0 - ($534))|0; + $536 = $414 & $535; + $537 = $536&255; + $538 = ((($cur1$499)) + 7|0); + HEAP8[$530>>0] = $537; + $539 = HEAP8[$in$2100>>0]|0; + $540 = $539&255; + $541 = $540 & 1; + $542 = (0 - ($541))|0; + $543 = $414 & $542; + $544 = $543&255; + $545 = ((($cur1$499)) + 8|0); + HEAP8[$538>>0] = $544; + $546 = (($k$1698) + -8)|0; + $547 = ((($in$2100)) + 1|0); + $548 = ($546|0)>(7); + if ($548) { + $cur1$499 = $545;$in$2100 = $547;$k$1698 = $546; + } else { + break; + } + } + $scevgep235 = (($404) + ($indvars$iv233)|0); + $557 = $indvars$iv233;$cur1$4$lcssa = $scevgep235;$in$2$lcssa = $scevgep;$k$16$lcssa = $368; + } else { + $557 = $405;$cur1$4$lcssa = $406;$in$2$lcssa = $407;$k$16$lcssa = $17; + } + $549 = ($k$16$lcssa|0)>(0); + if ($549) { + $550 = HEAP8[$in$2$lcssa>>0]|0; + $551 = $550&255; + $552 = $551 >>> 7; + $553 = (0 - ($552))|0; + $554 = $414 & $553; + $555 = $554&255; + HEAP8[$cur1$4$lcssa>>0] = $555; + $556 = ($k$16$lcssa|0)>(1); + if ($556) { + $$sum272 = (($557) + 1)|0; + $558 = (($404) + ($$sum272)|0); + $559 = HEAP8[$in$2$lcssa>>0]|0; + $560 = $559&255; + $561 = $560 >>> 6; + $562 = $561 & 1; + $563 = (0 - ($562))|0; + $564 = $414 & $563; + $565 = $564&255; + HEAP8[$558>>0] = $565; + $566 = ($k$16$lcssa|0)>(2); + if ($566) { + $$sum273 = (($557) + 2)|0; + $567 = (($404) + ($$sum273)|0); + $568 = HEAP8[$in$2$lcssa>>0]|0; + $569 = $568&255; + $570 = $569 >>> 5; + $571 = $570 & 1; + $572 = (0 - ($571))|0; + $573 = $414 & $572; + $574 = $573&255; + HEAP8[$567>>0] = $574; + $575 = ($k$16$lcssa|0)>(3); + if ($575) { + $$sum274 = (($557) + 3)|0; + $576 = (($404) + ($$sum274)|0); + $577 = HEAP8[$in$2$lcssa>>0]|0; + $578 = $577&255; + $579 = $578 >>> 4; + $580 = $579 & 1; + $581 = (0 - ($580))|0; + $582 = $414 & $581; + $583 = $582&255; + HEAP8[$576>>0] = $583; + $584 = ($k$16$lcssa|0)>(4); + if ($584) { + $$sum275 = (($557) + 4)|0; + $585 = (($404) + ($$sum275)|0); + $586 = HEAP8[$in$2$lcssa>>0]|0; + $587 = $586&255; + $588 = $587 >>> 3; + $589 = $588 & 1; + $590 = (0 - ($589))|0; + $591 = $414 & $590; + $592 = $591&255; + HEAP8[$585>>0] = $592; + $593 = ($k$16$lcssa|0)>(5); + if ($593) { + $$sum276 = (($557) + 5)|0; + $594 = (($404) + ($$sum276)|0); + $595 = HEAP8[$in$2$lcssa>>0]|0; + $596 = $595&255; + $597 = $596 >>> 2; + $598 = $597 & 1; + $599 = (0 - ($598))|0; + $600 = $414 & $599; + $601 = $600&255; + HEAP8[$594>>0] = $601; + $602 = ($k$16$lcssa|0)>(6); + if ($602) { + $$sum277 = (($557) + 6)|0; + $603 = (($404) + ($$sum277)|0); + $604 = HEAP8[$in$2$lcssa>>0]|0; + $605 = $604&255; + $606 = $605 >>> 1; + $607 = $606 & 1; + $608 = (0 - ($607))|0; + $609 = $414 & $608; + $610 = $609&255; + HEAP8[$603>>0] = $610; + } + } + } + } + } + } + } + break; + } + default: { + } + } + L213: do { + if (!($9)) { + $611 = HEAP32[$15>>2]|0; + switch ($6|0) { + case 1: { + if ($348) { + $q$0123 = $q$0122; + } else { + break L213; + } + while(1) { + $614 = $q$0123 << 1; + $615 = $614 | 1; + $$sum10 = (($615) + ($405))|0; + $616 = (($611) + ($$sum10)|0); + HEAP8[$616>>0] = -1; + $$sum11 = (($q$0123) + ($405))|0; + $617 = (($611) + ($$sum11)|0); + $618 = HEAP8[$617>>0]|0; + $$sum12 = (($614) + ($405))|0; + $619 = (($611) + ($$sum12)|0); + HEAP8[$619>>0] = $618; + $q$0 = (($q$0123) + -1)|0; + $620 = ($q$0|0)>(-1); + if ($620) { + $q$0123 = $q$0; + } else { + break L213; + } + } + break; + } + case 3: { + break; + } + default: { + label = 149; + break L174; + } + } + if ($349) { + $612 = (($405) + 2)|0; + $613 = (($405) + 1)|0; + $q$1120 = $q$1119; + while(1) { + $621 = $q$1120 << 2; + $622 = $621 | 3; + $$sum3 = (($622) + ($405))|0; + $623 = (($611) + ($$sum3)|0); + HEAP8[$623>>0] = -1; + $624 = ($q$1120*3)|0; + $$sum4 = (($612) + ($624))|0; + $625 = (($611) + ($$sum4)|0); + $626 = HEAP8[$625>>0]|0; + $627 = $621 | 2; + $$sum5 = (($627) + ($405))|0; + $628 = (($611) + ($$sum5)|0); + HEAP8[$628>>0] = $626; + $$sum6 = (($613) + ($624))|0; + $629 = (($611) + ($$sum6)|0); + $630 = HEAP8[$629>>0]|0; + $631 = $621 | 1; + $$sum7 = (($631) + ($405))|0; + $632 = (($611) + ($$sum7)|0); + HEAP8[$632>>0] = $630; + $$sum8 = (($624) + ($405))|0; + $633 = (($611) + ($$sum8)|0); + $634 = HEAP8[$633>>0]|0; + $$sum9 = (($621) + ($405))|0; + $635 = (($611) + ($$sum9)|0); + HEAP8[$635>>0] = $634; + $q$1 = (($q$1120) + -1)|0; + $636 = ($q$1|0)>(-1); + if ($636) { + $q$1120 = $q$1; + } else { + break; + } + } + } + } + } while(0); + $637 = (($j$1125) + 1)|0; + $638 = ($637>>>0)<($y>>>0); + $indvars$iv$next = (($indvars$iv) + ($365))|0; + $indvars$iv$next234 = (($indvars$iv233) + ($365))|0; + $indvars$iv$next237 = (($indvars$iv236) + ($382))|0; + $indvars$iv$next240 = (($indvars$iv239) + ($382))|0; + $indvars$iv$next243 = (($indvars$iv242) + ($399))|0; + $indvars$iv$next246 = (($indvars$iv245) + ($399))|0; + if ($638) { + $indvars$iv = $indvars$iv$next;$indvars$iv233 = $indvars$iv$next234;$indvars$iv236 = $indvars$iv$next237;$indvars$iv239 = $indvars$iv$next240;$indvars$iv242 = $indvars$iv$next243;$indvars$iv245 = $indvars$iv$next246;$j$1125 = $637; + } else { + $$0 = 1; + label = 155; + break; + } + } + if ((label|0) == 149) { + ___assert_fail((13239|0),(12975|0),4197,(13136|0)); + // unreachable; + } + else if ((label|0) == 155) { + return ($$0|0); + } + return (0)|0; +} +function _stbi__paeth($a,$b,$c) { + $a = $a|0; + $b = $b|0; + $c = $c|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$b = 0, $ispos = 0, $ispos1 = 0, $ispos3 = 0, $neg = 0, $neg2 = 0, $neg4 = 0, $or$cond = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = (($b) + ($a))|0; + $1 = (($0) - ($c))|0; + $2 = (($1) - ($a))|0; + $ispos = ($2|0)>(-1); + $neg = (0 - ($2))|0; + $3 = $ispos ? $2 : $neg; + $4 = (($1) - ($b))|0; + $ispos1 = ($4|0)>(-1); + $neg2 = (0 - ($4))|0; + $5 = $ispos1 ? $4 : $neg2; + $6 = (($1) - ($c))|0; + $ispos3 = ($6|0)>(-1); + $neg4 = (0 - ($6))|0; + $7 = $ispos3 ? $6 : $neg4; + $8 = ($3|0)>($5|0); + $9 = ($3|0)>($7|0); + $or$cond = $8 | $9; + $10 = ($5|0)>($7|0); + $c$b = $10 ? $c : $b; + $$0 = $or$cond ? $c$b : $a; + return ($$0|0); +} +function _stbi__decode_jpeg_header($z,$scan) { + $z = $z|0; + $scan = $scan|0; + var $$ = 0, $$0 = 0, $$2 = 0, $$9 = 0, $$lcssa = 0, $$lcssa20 = 0, $$lcssa5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; + var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $m$010 = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($z)) + 18116|0); + HEAP8[$0>>0] = -1; + $1 = (_stbi__get_marker($z)|0); + $2 = ($1<<24>>24)==(-40); + if (!($2)) { + _stbi__err(13262); + $$0 = 0; + return ($$0|0); + } + $3 = ($scan|0)==(1); + if ($3) { + $$0 = 1; + return ($$0|0); + } + $4 = (_stbi__get_marker($z)|0); + $5 = $4&255; + $6 = $5 & 254; + $7 = ($6|0)==(192); + $8 = ($4<<24>>24)==(-62); + $$9 = $8 | $7; + L8: do { + if ($$9) { + $$lcssa5 = $8; + } else { + $m$010 = $5; + L10: while(1) { + $13 = (_stbi__process_marker($z,$m$010)|0); + $14 = ($13|0)==(0); + if ($14) { + $$0 = 0; + label = 14; + break; + } + $15 = (_stbi__get_marker($z)|0); + $16 = $15&255; + $17 = ($15<<24>>24)==(-1); + if ($17) { + while(1) { + $18 = HEAP32[$z>>2]|0; + $19 = (_stbi__at_eof($18)|0); + $20 = ($19|0)==(0); + if (!($20)) { + break L10; + } + $21 = (_stbi__get_marker($z)|0); + $22 = ($21<<24>>24)==(-1); + if (!($22)) { + $$lcssa20 = $21; + break; + } + } + $9 = $$lcssa20&255; + $$lcssa = $9; + } else { + $$lcssa = $16; + } + $10 = $$lcssa & 254; + $11 = ($10|0)==(192); + $12 = ($$lcssa|0)==(194); + $$ = $12 | $11; + if ($$) { + $$lcssa5 = $12; + break L8; + } else { + $m$010 = $$lcssa; + } + } + if ((label|0) == 14) { + return ($$0|0); + } + _stbi__err(13269); + $$0 = 0; + return ($$0|0); + } + } while(0); + $23 = $$lcssa5&1; + $24 = ((($z)) + 18124|0); + HEAP32[$24>>2] = $23; + $25 = (_stbi__process_frame_header($z,$scan)|0); + $not$ = ($25|0)!=(0); + $$2 = $not$&1; + $$0 = $$2; + return ($$0|0); +} +function _stbi__get_marker($j) { + $j = $j|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18116|0); + $1 = HEAP8[$0>>0]|0; + $2 = ($1<<24>>24)==(-1); + if (!($2)) { + HEAP8[$0>>0] = -1; + $$0 = $1; + return ($$0|0); + } + $3 = HEAP32[$j>>2]|0; + $4 = (_stbi__get8($3)|0); + $5 = ($4<<24>>24)==(-1); + if (!($5)) { + $$0 = -1; + return ($$0|0); + } + while(1) { + $6 = HEAP32[$j>>2]|0; + $7 = (_stbi__get8($6)|0); + $8 = ($7<<24>>24)==(-1); + if (!($8)) { + $$0 = $7; + break; + } + } + return ($$0|0); +} +function _stbi__process_marker($z,$m) { + $z = $z|0; + $m = $m|0; + var $$2 = 0, $$mask = 0, $$mask7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; + var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; + var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; + var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0; + var $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; + var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; + var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; + var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; + var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $L$0$lcssa = 0, $L$015 = 0, $L$1$lcssa = 0, $L$122 = 0; + var $exitcond = 0, $exitcond30 = 0, $i$014 = 0, $i1$118 = 0, $or$cond = 0, $or$cond5 = 0, $sizes = 0, $v$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $sizes = sp; + switch ($m|0) { + case 255: { + _stbi__err(13383); + $$2 = 0; + STACKTOP = sp;return ($$2|0); + break; + } + case 221: { + $0 = HEAP32[$z>>2]|0; + $1 = (_stbi__get16be($0)|0); + $2 = ($1|0)==(4); + if ($2) { + $3 = HEAP32[$z>>2]|0; + $4 = (_stbi__get16be($3)|0); + $5 = ((($z)) + 18172|0); + HEAP32[$5>>2] = $4; + $$2 = 1; + STACKTOP = sp;return ($$2|0); + } else { + _stbi__err(13399); + $$2 = 0; + STACKTOP = sp;return ($$2|0); + } + break; + } + case 219: { + $6 = HEAP32[$z>>2]|0; + $7 = (_stbi__get16be($6)|0); + $8 = (($7) + -2)|0; + $9 = ($7|0)>(2); + L16: do { + if ($9) { + $L$015 = $8; + while(1) { + $10 = HEAP32[$z>>2]|0; + $11 = (_stbi__get8($10)|0); + $12 = $11&255; + $13 = $12 & 15; + $$mask = $12 & 240; + $14 = ($$mask|0)==(0); + if (!($14)) { + label = 8; + break; + } + $15 = ($13>>>0)>(3); + if ($15) { + label = 10; + break; + } else { + $i$014 = 0; + } + while(1) { + $16 = HEAP32[$z>>2]|0; + $17 = (_stbi__get8($16)|0); + $18 = (13438 + ($i$014)|0); + $19 = HEAP8[$18>>0]|0; + $20 = $19&255; + $21 = ((((($z)) + 13444|0) + ($13<<6)|0) + ($20)|0); + HEAP8[$21>>0] = $17; + $22 = (($i$014) + 1)|0; + $exitcond = ($22|0)==(64); + if ($exitcond) { + break; + } else { + $i$014 = $22; + } + } + $23 = (($L$015) + -65)|0; + $24 = ($L$015|0)>(65); + if ($24) { + $L$015 = $23; + } else { + $L$0$lcssa = $23; + break L16; + } + } + if ((label|0) == 8) { + _stbi__err(13411); + $$2 = 0; + STACKTOP = sp;return ($$2|0); + } + else if ((label|0) == 10) { + _stbi__err(13424); + $$2 = 0; + STACKTOP = sp;return ($$2|0); + } + } else { + $L$0$lcssa = $8; + } + } while(0); + $25 = ($L$0$lcssa|0)==(0); + $26 = $25&1; + $$2 = $26; + STACKTOP = sp;return ($$2|0); + break; + } + case 196: { + $27 = HEAP32[$z>>2]|0; + $28 = (_stbi__get16be($27)|0); + $29 = (($28) + -2)|0; + $30 = ($28|0)>(2); + L31: do { + if ($30) { + $31 = ((($sizes)) + 4|0); + $32 = ((($sizes)) + 8|0); + $33 = ((($sizes)) + 12|0); + $34 = ((($sizes)) + 16|0); + $35 = ((($sizes)) + 20|0); + $36 = ((($sizes)) + 24|0); + $37 = ((($sizes)) + 28|0); + $38 = ((($sizes)) + 32|0); + $39 = ((($sizes)) + 36|0); + $40 = ((($sizes)) + 40|0); + $41 = ((($sizes)) + 44|0); + $42 = ((($sizes)) + 48|0); + $43 = ((($sizes)) + 52|0); + $44 = ((($sizes)) + 56|0); + $45 = ((($sizes)) + 60|0); + $L$122 = $29; + while(1) { + $46 = HEAP32[$z>>2]|0; + $47 = (_stbi__get8($46)|0); + $48 = $47&255; + $49 = $48 & 15; + $50 = ($47&255)>(31); + $51 = ($49>>>0)>(3); + $or$cond = $50 | $51; + if ($or$cond) { + label = 17; + break; + } + $52 = HEAP32[$z>>2]|0; + $53 = (_stbi__get8($52)|0); + $54 = $53&255; + HEAP32[$sizes>>2] = $54; + $55 = HEAP32[$z>>2]|0; + $56 = (_stbi__get8($55)|0); + $57 = $56&255; + HEAP32[$31>>2] = $57; + $58 = (($57) + ($54))|0; + $59 = HEAP32[$z>>2]|0; + $60 = (_stbi__get8($59)|0); + $61 = $60&255; + HEAP32[$32>>2] = $61; + $62 = (($61) + ($58))|0; + $63 = HEAP32[$z>>2]|0; + $64 = (_stbi__get8($63)|0); + $65 = $64&255; + HEAP32[$33>>2] = $65; + $66 = (($65) + ($62))|0; + $67 = HEAP32[$z>>2]|0; + $68 = (_stbi__get8($67)|0); + $69 = $68&255; + HEAP32[$34>>2] = $69; + $70 = (($69) + ($66))|0; + $71 = HEAP32[$z>>2]|0; + $72 = (_stbi__get8($71)|0); + $73 = $72&255; + HEAP32[$35>>2] = $73; + $74 = (($73) + ($70))|0; + $75 = HEAP32[$z>>2]|0; + $76 = (_stbi__get8($75)|0); + $77 = $76&255; + HEAP32[$36>>2] = $77; + $78 = (($77) + ($74))|0; + $79 = HEAP32[$z>>2]|0; + $80 = (_stbi__get8($79)|0); + $81 = $80&255; + HEAP32[$37>>2] = $81; + $82 = (($81) + ($78))|0; + $83 = HEAP32[$z>>2]|0; + $84 = (_stbi__get8($83)|0); + $85 = $84&255; + HEAP32[$38>>2] = $85; + $86 = (($85) + ($82))|0; + $87 = HEAP32[$z>>2]|0; + $88 = (_stbi__get8($87)|0); + $89 = $88&255; + HEAP32[$39>>2] = $89; + $90 = (($89) + ($86))|0; + $91 = HEAP32[$z>>2]|0; + $92 = (_stbi__get8($91)|0); + $93 = $92&255; + HEAP32[$40>>2] = $93; + $94 = (($93) + ($90))|0; + $95 = HEAP32[$z>>2]|0; + $96 = (_stbi__get8($95)|0); + $97 = $96&255; + HEAP32[$41>>2] = $97; + $98 = (($97) + ($94))|0; + $99 = HEAP32[$z>>2]|0; + $100 = (_stbi__get8($99)|0); + $101 = $100&255; + HEAP32[$42>>2] = $101; + $102 = (($101) + ($98))|0; + $103 = HEAP32[$z>>2]|0; + $104 = (_stbi__get8($103)|0); + $105 = $104&255; + HEAP32[$43>>2] = $105; + $106 = (($105) + ($102))|0; + $107 = HEAP32[$z>>2]|0; + $108 = (_stbi__get8($107)|0); + $109 = $108&255; + HEAP32[$44>>2] = $109; + $110 = (($109) + ($106))|0; + $111 = HEAP32[$z>>2]|0; + $112 = (_stbi__get8($111)|0); + $113 = $112&255; + HEAP32[$45>>2] = $113; + $114 = (($113) + ($110))|0; + $115 = (($L$122) + -17)|0; + $$mask7 = $48 & 240; + $116 = ($$mask7|0)==(0); + if ($116) { + $117 = (((($z)) + 4|0) + (($49*1680)|0)|0); + $118 = (_stbi__build_huffman($117,$sizes)|0); + $119 = ($118|0)==(0); + if ($119) { + break; + } + $120 = (((((($z)) + 4|0) + (($49*1680)|0)|0)) + 1024|0); + $v$0 = $120; + } else { + $121 = (((($z)) + 6724|0) + (($49*1680)|0)|0); + $122 = (_stbi__build_huffman($121,$sizes)|0); + $123 = ($122|0)==(0); + if ($123) { + break; + } + $124 = (((((($z)) + 6724|0) + (($49*1680)|0)|0)) + 1024|0); + $v$0 = $124; + } + $125 = ($114|0)>(0); + if ($125) { + $126 = $56&255; + $127 = $53&255; + $128 = (($126) + ($127))|0; + $129 = $60&255; + $130 = (($128) + ($129))|0; + $131 = $64&255; + $132 = (($130) + ($131))|0; + $133 = $68&255; + $134 = (($132) + ($133))|0; + $135 = $72&255; + $136 = (($134) + ($135))|0; + $137 = $76&255; + $138 = (($136) + ($137))|0; + $139 = $80&255; + $140 = (($138) + ($139))|0; + $141 = $84&255; + $142 = (($140) + ($141))|0; + $143 = $88&255; + $144 = (($142) + ($143))|0; + $145 = $92&255; + $146 = (($144) + ($145))|0; + $147 = $96&255; + $148 = (($146) + ($147))|0; + $149 = $100&255; + $150 = (($148) + ($149))|0; + $151 = $104&255; + $152 = (($150) + ($151))|0; + $153 = $108&255; + $154 = (($152) + ($153))|0; + $155 = $112&255; + $156 = (($154) + ($155))|0; + $i1$118 = 0; + while(1) { + $157 = HEAP32[$z>>2]|0; + $158 = (_stbi__get8($157)|0); + $159 = (($v$0) + ($i1$118)|0); + HEAP8[$159>>0] = $158; + $160 = (($i1$118) + 1)|0; + $exitcond30 = ($160|0)==($156|0); + if ($exitcond30) { + break; + } else { + $i1$118 = $160; + } + } + } + if (!($116)) { + $161 = (((($z)) + 13700|0) + ($49<<10)|0); + $162 = (((($z)) + 6724|0) + (($49*1680)|0)|0); + _stbi__build_fast_ac($161,$162); + } + $163 = (($115) - ($114))|0; + $164 = ($163|0)>(0); + if ($164) { + $L$122 = $163; + } else { + $L$1$lcssa = $163; + break L31; + } + } + if ((label|0) == 17) { + _stbi__err(13517); + } + $$2 = 0; + STACKTOP = sp;return ($$2|0); + } else { + $L$1$lcssa = $29; + } + } while(0); + $165 = ($L$1$lcssa|0)==(0); + $166 = $165&1; + $$2 = $166; + STACKTOP = sp;return ($$2|0); + break; + } + default: { + $167 = $m & -16; + $168 = ($167|0)==(224); + $169 = ($m|0)==(254); + $or$cond5 = $169 | $168; + if (!($or$cond5)) { + $$2 = 0; + STACKTOP = sp;return ($$2|0); + } + $170 = HEAP32[$z>>2]|0; + $171 = (_stbi__get16be($170)|0); + $172 = (($171) + -2)|0; + _stbi__skip($170,$172); + $$2 = 1; + STACKTOP = sp;return ($$2|0); + } + } + return (0)|0; +} +function _stbi__process_frame_header($z,$scan) { + $z = $z|0; + $scan = $scan|0; + var $$0 = 0, $$h_max$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; + var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; + var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; + var $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0; + var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0; + var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0; + var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0; + var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $h_max$0$lcssa = 0; + var $h_max$016 = 0, $i$021 = 0, $i$1 = 0, $i$215 = 0, $i$312 = 0, $i$312$lcssa = 0, $i$411 = 0, $i$411$in = 0, $or$cond = 0, $or$cond2 = 0, $v_max$0$lcssa = 0, $v_max$017 = 0, $v_max$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$z>>2]|0; + $1 = (_stbi__get16be($0)|0); + $2 = ($1|0)<(11); + if ($2) { + _stbi__err(13276); + $$0 = 0; + return ($$0|0); + } + $3 = (_stbi__get8($0)|0); + $4 = ($3<<24>>24)==(8); + if (!($4)) { + _stbi__err(13288); + $$0 = 0; + return ($$0|0); + } + $5 = (_stbi__get16be($0)|0); + $6 = ((($0)) + 4|0); + HEAP32[$6>>2] = $5; + $7 = ($5|0)==(0); + if ($7) { + _stbi__err(13299); + $$0 = 0; + return ($$0|0); + } + $8 = (_stbi__get16be($0)|0); + HEAP32[$0>>2] = $8; + $9 = ($8|0)==(0); + if ($9) { + _stbi__err(13316); + $$0 = 0; + return ($$0|0); + } + $10 = (_stbi__get8($0)|0); + $11 = $10&255; + switch ($10<<24>>24) { + case 1: case 3: { + break; + } + default: { + _stbi__err(13324); + $$0 = 0; + return ($$0|0); + } + } + $12 = ((($0)) + 8|0); + HEAP32[$12>>2] = $11; + $13 = $10&255; + $i$021 = 0; + while(1) { + $14 = (((((($z)) + 17820|0) + (($i$021*72)|0)|0)) + 44|0); + HEAP32[$14>>2] = 0; + $15 = (((((($z)) + 17820|0) + (($i$021*72)|0)|0)) + 56|0); + HEAP32[$15>>2] = 0; + $16 = (($i$021) + 1)|0; + $exitcond = ($16|0)==($13|0); + if ($exitcond) { + break; + } else { + $i$021 = $16; + } + } + $17 = HEAP32[$12>>2]|0; + $18 = ($17*3)|0; + $19 = (($18) + 8)|0; + $20 = ($1|0)==($19|0); + if (!($20)) { + _stbi__err(13276); + $$0 = 0; + return ($$0|0); + } + $21 = ((($z)) + 18148|0); + HEAP32[$21>>2] = 0; + $i$1 = 0; + while(1) { + $22 = HEAP32[$12>>2]|0; + $23 = ($i$1|0)<($22|0); + if (!($23)) { + $$lcssa = $22; + label = 27; + break; + } + $24 = (_stbi__get8($0)|0); + $25 = $24&255; + $26 = (((($z)) + 17820|0) + (($i$1*72)|0)|0); + HEAP32[$26>>2] = $25; + $27 = (($i$1) + 1)|0; + $28 = ($25|0)==($27|0); + $29 = ($25|0)==($i$1|0); + $or$cond = $28 | $29; + if (!($or$cond)) { + $30 = (13344 + ($i$1)|0); + $31 = HEAP8[$30>>0]|0; + $32 = ($24<<24>>24)==($31<<24>>24); + if (!($32)) { + label = 19; + break; + } + $33 = HEAP32[$21>>2]|0; + $34 = (($33) + 1)|0; + HEAP32[$21>>2] = $34; + } + $35 = (_stbi__get8($0)|0); + $36 = $35&255; + $37 = $36 >>> 4; + $38 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 4|0); + HEAP32[$38>>2] = $37; + $39 = ($37|0)==(0); + $40 = ($35&255)>(79); + $or$cond2 = $40 | $39; + if ($or$cond2) { + label = 22; + break; + } + $41 = $36 & 15; + $42 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 8|0); + HEAP32[$42>>2] = $41; + $43 = (($41) + -1)|0; + $44 = ($43>>>0)>(3); + if ($44) { + label = 24; + break; + } + $45 = (_stbi__get8($0)|0); + $46 = $45&255; + $47 = (((((($z)) + 17820|0) + (($i$1*72)|0)|0)) + 12|0); + HEAP32[$47>>2] = $46; + $48 = ($45&255)>(3); + if ($48) { + label = 26; + break; + } else { + $i$1 = $27; + } + } + if ((label|0) == 19) { + _stbi__err(13347); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 22) { + _stbi__err(13364); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 24) { + _stbi__err(13370); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 26) { + _stbi__err(13376); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 27) { + $49 = ($scan|0)==(0); + if (!($49)) { + $$0 = 1; + return ($$0|0); + } + $50 = HEAP32[$0>>2]|0; + $51 = (1073741824 / ($50>>>0))&-1; + $52 = (($51>>>0) / ($$lcssa>>>0))&-1; + $53 = HEAP32[$6>>2]|0; + $54 = ($52>>>0)<($53>>>0); + if ($54) { + _stbi__err(12689); + $$0 = 0; + return ($$0|0); + } + $55 = HEAP32[$12>>2]|0; + $56 = ($55|0)>(0); + if ($56) { + $57 = HEAP32[$12>>2]|0; + $h_max$016 = 1;$i$215 = 0;$v_max$017 = 1; + while(1) { + $58 = (((((($z)) + 17820|0) + (($i$215*72)|0)|0)) + 4|0); + $59 = HEAP32[$58>>2]|0; + $60 = ($59|0)>($h_max$016|0); + $$h_max$0 = $60 ? $59 : $h_max$016; + $61 = (((((($z)) + 17820|0) + (($i$215*72)|0)|0)) + 8|0); + $62 = HEAP32[$61>>2]|0; + $63 = ($62|0)>($v_max$017|0); + $v_max$1 = $63 ? $62 : $v_max$017; + $64 = (($i$215) + 1)|0; + $65 = ($64|0)<($57|0); + if ($65) { + $h_max$016 = $$h_max$0;$i$215 = $64;$v_max$017 = $v_max$1; + } else { + $h_max$0$lcssa = $$h_max$0;$v_max$0$lcssa = $v_max$1; + break; + } + } + } else { + $h_max$0$lcssa = 1;$v_max$0$lcssa = 1; + } + $66 = ((($z)) + 17796|0); + HEAP32[$66>>2] = $h_max$0$lcssa; + $67 = ((($z)) + 17800|0); + HEAP32[$67>>2] = $v_max$0$lcssa; + $68 = $h_max$0$lcssa << 3; + $69 = ((($z)) + 17812|0); + HEAP32[$69>>2] = $68; + $70 = $v_max$0$lcssa << 3; + $71 = ((($z)) + 17816|0); + HEAP32[$71>>2] = $70; + $72 = HEAP32[$0>>2]|0; + $73 = HEAP32[$69>>2]|0; + $74 = (($72) + -1)|0; + $75 = (($74) + ($73))|0; + $76 = (($75>>>0) / ($73>>>0))&-1; + $77 = ((($z)) + 17804|0); + HEAP32[$77>>2] = $76; + $78 = HEAP32[$6>>2]|0; + $79 = HEAP32[$71>>2]|0; + $80 = (($78) + -1)|0; + $81 = (($80) + ($79))|0; + $82 = (($81>>>0) / ($79>>>0))&-1; + $83 = ((($z)) + 17808|0); + HEAP32[$83>>2] = $82; + $84 = HEAP32[$12>>2]|0; + $85 = ($84|0)>(0); + if (!($85)) { + $$0 = 1; + return ($$0|0); + } + $86 = (($h_max$0$lcssa) + -1)|0; + $87 = (($v_max$0$lcssa) + -1)|0; + $88 = ((($z)) + 18124|0); + $i$312 = 0; + while(1) { + $89 = HEAP32[$0>>2]|0; + $90 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 4|0); + $91 = HEAP32[$90>>2]|0; + $92 = Math_imul($91, $89)|0; + $93 = (($86) + ($92))|0; + $94 = (($93>>>0) / ($h_max$0$lcssa>>>0))&-1; + $95 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 28|0); + HEAP32[$95>>2] = $94; + $96 = HEAP32[$6>>2]|0; + $97 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 8|0); + $98 = HEAP32[$97>>2]|0; + $99 = Math_imul($98, $96)|0; + $100 = (($87) + ($99))|0; + $101 = (($100>>>0) / ($v_max$0$lcssa>>>0))&-1; + $102 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 32|0); + HEAP32[$102>>2] = $101; + $103 = HEAP32[$77>>2]|0; + $104 = HEAP32[$90>>2]|0; + $105 = $103 << 3; + $106 = Math_imul($105, $104)|0; + $107 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 36|0); + HEAP32[$107>>2] = $106; + $108 = HEAP32[$83>>2]|0; + $109 = HEAP32[$97>>2]|0; + $110 = $108 << 3; + $111 = Math_imul($110, $109)|0; + $112 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 40|0); + HEAP32[$112>>2] = $111; + $113 = HEAP32[$107>>2]|0; + $114 = Math_imul($111, $113)|0; + $115 = (($114) + 15)|0; + $116 = (_stbi__malloc($115)|0); + $117 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 48|0); + HEAP32[$117>>2] = $116; + $118 = ($116|0)==(0|0); + if ($118) { + $i$312$lcssa = $i$312; + break; + } + $123 = $116; + $124 = (($123) + 15)|0; + $125 = $124 & -16; + $126 = $125; + $127 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 44|0); + HEAP32[$127>>2] = $126; + $128 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 56|0); + HEAP32[$128>>2] = 0; + $129 = HEAP32[$88>>2]|0; + $130 = ($129|0)==(0); + if ($130) { + $150 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 60|0); + HEAP32[$150>>2] = 0; + $151 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 52|0); + HEAP32[$151>>2] = 0; + } else { + $131 = HEAP32[$107>>2]|0; + $132 = (($131) + 7)|0; + $133 = $132 >> 3; + $134 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 64|0); + HEAP32[$134>>2] = $133; + $135 = HEAP32[$112>>2]|0; + $136 = (($135) + 7)|0; + $137 = $136 >> 3; + $138 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 68|0); + HEAP32[$138>>2] = $137; + $139 = HEAP32[$134>>2]|0; + $140 = $139 << 7; + $141 = Math_imul($140, $137)|0; + $142 = $141 | 15; + $143 = (_malloc($142)|0); + $144 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 52|0); + HEAP32[$144>>2] = $143; + $145 = $143; + $146 = (($145) + 15)|0; + $147 = $146 & -16; + $148 = $147; + $149 = (((((($z)) + 17820|0) + (($i$312*72)|0)|0)) + 60|0); + HEAP32[$149>>2] = $148; + } + $152 = (($i$312) + 1)|0; + $153 = HEAP32[$12>>2]|0; + $154 = ($152|0)<($153|0); + if ($154) { + $i$312 = $152; + } else { + $$0 = 1; + label = 43; + break; + } + } + if ((label|0) == 43) { + return ($$0|0); + } + $119 = ($i$312$lcssa|0)>(0); + if ($119) { + $i$411$in = $i$312$lcssa; + while(1) { + $i$411 = (($i$411$in) + -1)|0; + $120 = (((((($z)) + 17820|0) + (($i$411*72)|0)|0)) + 48|0); + $121 = HEAP32[$120>>2]|0; + _free($121); + HEAP32[$120>>2] = 0; + $122 = ($i$411$in|0)>(1); + if ($122) { + $i$411$in = $i$411; + } else { + break; + } + } + } + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + return (0)|0; +} +function _stbi__build_huffman($h,$count) { + $h = $h|0; + $count = $count|0; + var $$0 = 0, $$lcssa37 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; + var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $code$014 = 0, $code$1$lcssa = 0, $code$110 = 0, $code$2 = 0, $exitcond = 0; + var $exitcond26 = 0, $i$022 = 0, $i$17 = 0, $j$017 = 0, $j$115 = 0, $k$021 = 0, $k$1$lcssa = 0, $k$1$lcssa$lcssa = 0, $k$116 = 0, $k$213 = 0, $k$3$lcssa = 0, $k$39 = 0, $k$4 = 0, $k$4$lcssa = 0, $scevgep = 0, $smax = 0, label = 0, sp = 0; + sp = STACKTOP; + $i$022 = 0;$k$021 = 0; + while(1) { + $1 = (($count) + ($i$022<<2)|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)>(0); + $0 = (($i$022) + 1)|0; + if ($3) { + $4 = $0&255; + $j$017 = 0;$k$116 = $k$021; + while(1) { + $5 = (($k$116) + 1)|0; + $6 = (((($h)) + 1280|0) + ($k$116)|0); + HEAP8[$6>>0] = $4; + $7 = (($j$017) + 1)|0; + $8 = HEAP32[$1>>2]|0; + $9 = ($7|0)<($8|0); + if ($9) { + $j$017 = $7;$k$116 = $5; + } else { + $k$1$lcssa = $5; + break; + } + } + } else { + $k$1$lcssa = $k$021; + } + $exitcond26 = ($0|0)==(16); + if ($exitcond26) { + $k$1$lcssa$lcssa = $k$1$lcssa; + break; + } else { + $i$022 = $0;$k$021 = $k$1$lcssa; + } + } + $10 = (((($h)) + 1280|0) + ($k$1$lcssa$lcssa)|0); + HEAP8[$10>>0] = 0; + $code$014 = 0;$j$115 = 1;$k$213 = 0; + while(1) { + $11 = (($k$213) - ($code$014))|0; + $12 = (((($h)) + 1612|0) + ($j$115<<2)|0); + HEAP32[$12>>2] = $11; + $13 = (((($h)) + 1280|0) + ($k$213)|0); + $14 = HEAP8[$13>>0]|0; + $15 = $14&255; + $16 = ($15|0)==($j$115|0); + if ($16) { + $17 = (((($h)) + 1280|0) + ($k$213)|0); + $18 = HEAP8[$17>>0]|0; + $19 = $18&255; + $20 = ($19|0)==($j$115|0); + if ($20) { + $code$110 = $code$014;$k$39 = $k$213; + while(1) { + $21 = (($code$110) + 1)|0; + $22 = $code$110&65535; + $23 = (($k$39) + 1)|0; + $24 = (((($h)) + 512|0) + ($k$39<<1)|0); + HEAP16[$24>>1] = $22; + $25 = (((($h)) + 1280|0) + ($23)|0); + $26 = HEAP8[$25>>0]|0; + $27 = $26&255; + $28 = ($27|0)==($j$115|0); + if ($28) { + $code$110 = $21;$k$39 = $23; + } else { + $code$1$lcssa = $21;$k$3$lcssa = $23; + break; + } + } + } else { + $code$1$lcssa = $code$014;$k$3$lcssa = $k$213; + } + $29 = 1 << $j$115; + $30 = ($code$1$lcssa|0)>($29|0); + if ($30) { + label = 11; + break; + } else { + $code$2 = $code$1$lcssa;$k$4 = $k$3$lcssa; + } + } else { + $code$2 = $code$014;$k$4 = $k$213; + } + $31 = (16 - ($j$115))|0; + $32 = $code$2 << $31; + $33 = (((($h)) + 1540|0) + ($j$115<<2)|0); + HEAP32[$33>>2] = $32; + $34 = $code$2 << 1; + $35 = (($j$115) + 1)|0; + $36 = ($35|0)<(17); + if ($36) { + $code$014 = $34;$j$115 = $35;$k$213 = $k$4; + } else { + $$lcssa37 = $35;$k$4$lcssa = $k$4; + break; + } + } + if ((label|0) == 11) { + _stbi__err(13532); + $$0 = 0; + return ($$0|0); + } + $37 = (((($h)) + 1540|0) + ($$lcssa37<<2)|0); + HEAP32[$37>>2] = -1; + _memset(($h|0),-1,512)|0; + $38 = ($k$4$lcssa|0)>(0); + if ($38) { + $i$17 = 0; + } else { + $$0 = 1; + return ($$0|0); + } + while(1) { + $39 = (((($h)) + 1280|0) + ($i$17)|0); + $40 = HEAP8[$39>>0]|0; + $41 = ($40&255)<(10); + if ($41) { + $42 = $40&255; + $43 = (9 - ($42))|0; + $44 = 1 << $43; + $45 = ($43|0)==(31); + if (!($45)) { + $46 = (((($h)) + 512|0) + ($i$17<<1)|0); + $47 = HEAP16[$46>>1]|0; + $48 = $47&65535; + $49 = $48 << $43; + $50 = $i$17&255; + $scevgep = (($h) + ($49)|0); + $51 = ($44|0)>(1); + $smax = $51 ? $44 : 1; + _memset(($scevgep|0),($50|0),($smax|0))|0; + } + } + $52 = (($i$17) + 1)|0; + $exitcond = ($52|0)==($k$4$lcssa|0); + if ($exitcond) { + $$0 = 1; + break; + } else { + $i$17 = $52; + } + } + return ($$0|0); +} +function _stbi__build_fast_ac($fast_ac,$h) { + $fast_ac = $fast_ac|0; + $h = $h|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $k$0 = 0, $k$0$off = 0, label = 0, sp = 0; + sp = STACKTOP; + $i$02 = 0; + while(1) { + $0 = (($h) + ($i$02)|0); + $1 = HEAP8[$0>>0]|0; + $2 = (($fast_ac) + ($i$02<<1)|0); + HEAP16[$2>>1] = 0; + $3 = $1&255; + $4 = ($1<<24>>24)==(-1); + if (!($4)) { + $5 = (((($h)) + 1024|0) + ($3)|0); + $6 = HEAP8[$5>>0]|0; + $7 = $6&255; + $8 = $7 & 240; + $9 = $7 & 15; + $10 = (((($h)) + 1280|0) + ($3)|0); + $11 = HEAP8[$10>>0]|0; + $12 = $11&255; + $13 = ($9|0)==(0); + if (!($13)) { + $14 = (($12) + ($9))|0; + $15 = ($14|0)<(10); + if ($15) { + $16 = $i$02 << $12; + $17 = $16 & 511; + $18 = (9 - ($9))|0; + $19 = $17 >>> $18; + $20 = (($9) + -1)|0; + $21 = 1 << $20; + $22 = ($19|0)<($21|0); + if ($22) { + $23 = -1 << $9; + $24 = (($23) + 1)|0; + $25 = (($24) + ($19))|0; + $k$0 = $25; + } else { + $k$0 = $19; + } + $k$0$off = (($k$0) + 128)|0; + $26 = ($k$0$off>>>0)<(256); + if ($26) { + $27 = $k$0 << 8; + $28 = $27 | $8; + $29 = (($28) + ($14))|0; + $30 = $29&65535; + HEAP16[$2>>1] = $30; + } + } + } + } + $31 = (($i$02) + 1)|0; + $exitcond = ($31|0)==(512); + if ($exitcond) { + break; + } else { + $i$02 = $31; + } + } + return; +} +function _stbi__parse_zlib($a,$parse_header) { + $a = $a|0; + $parse_header = $parse_header|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($parse_header|0)==(0); + if (!($0)) { + $1 = (_stbi__parse_zlib_header($a)|0); + $2 = ($1|0)==(0); + if ($2) { + $$0 = 0; + return ($$0|0); + } + } + $3 = ((($a)) + 8|0); + HEAP32[$3>>2] = 0; + $4 = ((($a)) + 12|0); + HEAP32[$4>>2] = 0; + $5 = ((($a)) + 2052|0); + $6 = ((($a)) + 32|0); + L5: while(1) { + $7 = (_stbi__zreceive($a,1)|0); + $8 = (_stbi__zreceive($a,2)|0); + switch ($8|0) { + case 3: { + $$0 = 0; + label = 13; + break L5; + break; + } + case 0: { + $9 = (_stbi__parse_uncompressed_block($a)|0); + $10 = ($9|0)==(0); + if ($10) { + $$0 = 0; + label = 13; + break L5; + } + break; + } + case 1: { + $11 = HEAP8[(13580)>>0]|0; + $12 = ($11<<24>>24)==(0); + if ($12) { + _stbi__init_zdefaults(); + } + $13 = (_stbi__zbuild_huffman($6,13581,288)|0); + $14 = ($13|0)==(0); + if ($14) { + $$0 = 0; + label = 13; + break L5; + } + $15 = (_stbi__zbuild_huffman($5,13549,32)|0); + $16 = ($15|0)==(0); + if ($16) { + $$0 = 0; + label = 13; + break L5; + } else { + label = 11; + } + break; + } + default: { + $17 = (_stbi__compute_huffman_codes($a)|0); + $18 = ($17|0)==(0); + if ($18) { + $$0 = 0; + label = 13; + break L5; + } else { + label = 11; + } + } + } + if ((label|0) == 11) { + label = 0; + $19 = (_stbi__parse_huffman_block($a)|0); + $20 = ($19|0)==(0); + if ($20) { + $$0 = 0; + label = 13; + break; + } + } + $21 = ($7|0)==(0); + if (!($21)) { + $$0 = 1; + label = 13; + break; + } + } + if ((label|0) == 13) { + return ($$0|0); + } + return (0)|0; +} +function _stbi__parse_zlib_header($a) { + $a = $a|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__zget8($a)|0); + $1 = $0&255; + $2 = $1 & 15; + $3 = (_stbi__zget8($a)|0); + $4 = $3&255; + $5 = $1 << 8; + $6 = $5 | $4; + $7 = (($6>>>0) % 31)&-1; + $8 = ($7|0)==(0); + if (!($8)) { + _stbi__err(14203); + $$0 = 0; + return ($$0|0); + } + $9 = $4 & 32; + $10 = ($9|0)==(0); + if (!($10)) { + _stbi__err(14219); + $$0 = 0; + return ($$0|0); + } + $11 = ($2|0)==(8); + if ($11) { + $$0 = 1; + return ($$0|0); + } + _stbi__err(14234); + $$0 = 0; + return ($$0|0); +} +function _stbi__zreceive($z,$n) { + $z = $z|0; + $n = $n|0; + var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($z)) + 8|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<($n|0); + if ($2) { + _stbi__fill_bits($z); + } + $3 = ((($z)) + 12|0); + $4 = HEAP32[$3>>2]|0; + $5 = 1 << $n; + $6 = (($5) + -1)|0; + $7 = $4 & $6; + $8 = $4 >>> $n; + HEAP32[$3>>2] = $8; + $9 = HEAP32[$0>>2]|0; + $10 = (($9) - ($n))|0; + HEAP32[$0>>2] = $10; + return ($7|0); +} +function _stbi__parse_uncompressed_block($a) { + $a = $a|0; + var $$0 = 0, $$lcssa = 0, $$lcssa17 = 0, $$op = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $$promoted8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; + var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; + var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0; + var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond13 = 0, $header = 0, $k$0$lcssa = 0, $k$03 = 0, $k$12 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $header = sp; + $0 = ((($a)) + 8|0); + $1 = HEAP32[$0>>2]|0; + $2 = $1 & 7; + $3 = ($2|0)==(0); + if ($3) { + $$ph = $1; + } else { + (_stbi__zreceive($a,$2)|0); + $$pr = HEAP32[$0>>2]|0; + $$ph = $$pr; + } + $4 = ($$ph|0)>(0); + if ($4) { + $5 = ((($a)) + 12|0); + $$promoted = HEAP32[$5>>2]|0; + $$promoted8 = HEAP32[$0>>2]|0; + $6 = ($$promoted8|0)<(8); + $$op = $$promoted8 ^ -1; + $7 = $6 ? $$op : -9; + $8 = (($$promoted8) + ($7))|0; + $9 = (($8) + 8)|0; + $10 = $9 >>> 3; + $11 = $10 << 3; + $12 = (($10) + 1)|0; + $14 = $$promoted;$k$03 = 0; + while(1) { + $13 = $14&255; + $15 = (($k$03) + 1)|0; + $16 = (($header) + ($k$03)|0); + HEAP8[$16>>0] = $13; + $17 = $14 >>> 8; + $exitcond13 = ($15|0)==($12|0); + if ($exitcond13) { + $$lcssa17 = $17; + break; + } else { + $14 = $17;$k$03 = $15; + } + } + $18 = (($$promoted8) + -8)|0; + $19 = (($18) - ($11))|0; + HEAP32[$5>>2] = $$lcssa17; + HEAP32[$0>>2] = $19; + $$lcssa = $19;$k$0$lcssa = $12; + } else { + $$lcssa = $$ph;$k$0$lcssa = 0; + } + $20 = ($$lcssa|0)==(0); + if (!($20)) { + ___assert_fail((14125|0),(12975|0),3780,(14142|0)); + // unreachable; + } + $21 = ($k$0$lcssa|0)<(4); + if ($21) { + $k$12 = $k$0$lcssa; + while(1) { + $22 = (_stbi__zget8($a)|0); + $23 = (($k$12) + 1)|0; + $24 = (($header) + ($k$12)|0); + HEAP8[$24>>0] = $22; + $exitcond = ($23|0)==(4); + if ($exitcond) { + break; + } else { + $k$12 = $23; + } + } + } + $25 = ((($header)) + 1|0); + $26 = HEAP8[$25>>0]|0; + $27 = $26&255; + $28 = $27 << 8; + $29 = HEAP8[$header>>0]|0; + $30 = $29&255; + $31 = $28 | $30; + $32 = ((($header)) + 3|0); + $33 = HEAP8[$32>>0]|0; + $34 = $33&255; + $35 = $34 << 8; + $36 = ((($header)) + 2|0); + $37 = HEAP8[$36>>0]|0; + $38 = $37&255; + $39 = $35 | $38; + $40 = $31 ^ 65535; + $41 = ($39|0)==($40|0); + if (!($41)) { + _stbi__err(14173); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $42 = HEAP32[$a>>2]|0; + $43 = (($42) + ($31)|0); + $44 = ((($a)) + 4|0); + $45 = HEAP32[$44>>2]|0; + $46 = ($43>>>0)>($45>>>0); + if ($46) { + _stbi__err(14186); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $47 = ((($a)) + 16|0); + $48 = HEAP32[$47>>2]|0; + $49 = (($48) + ($31)|0); + $50 = ((($a)) + 24|0); + $51 = HEAP32[$50>>2]|0; + $52 = ($49>>>0)>($51>>>0); + if ($52) { + $53 = (_stbi__zexpand($a,$48,$31)|0); + $54 = ($53|0)==(0); + if ($54) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + } + $55 = HEAP32[$47>>2]|0; + $56 = HEAP32[$a>>2]|0; + _memcpy(($55|0),($56|0),($31|0))|0; + $57 = HEAP32[$a>>2]|0; + $58 = (($57) + ($31)|0); + HEAP32[$a>>2] = $58; + $59 = HEAP32[$47>>2]|0; + $60 = (($59) + ($31)|0); + HEAP32[$47>>2] = $60; + $$0 = 1; + STACKTOP = sp;return ($$0|0); +} +function _stbi__init_zdefaults() { + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, dest = 0, label = 0, sp = 0, stop = 0; + sp = STACKTOP; + _memset((13581|0),8,144)|0; + dest=(13725); stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); + dest=(13837); stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); + $0 = (13861); + $1 = $0; + HEAP8[$1>>0]=134744072&255;HEAP8[$1+1>>0]=(134744072>>8)&255;HEAP8[$1+2>>0]=(134744072>>16)&255;HEAP8[$1+3>>0]=134744072>>24; + $2 = (($0) + 4)|0; + $3 = $2; + HEAP8[$3>>0]=134744072&255;HEAP8[$3+1>>0]=(134744072>>8)&255;HEAP8[$3+2>>0]=(134744072>>16)&255;HEAP8[$3+3>>0]=134744072>>24; + dest=13549; stop=dest+32|0; do { HEAP8[dest>>0]=5|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); + return; +} +function _stbi__zbuild_huffman($z,$sizelist,$num) { + $z = $z|0; + $sizelist = $sizelist|0; + $num = $num|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; + var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; + var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; + var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; + var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; + var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $code$06 = 0, $exitcond = 0, $exitcond13 = 0, $i$010 = 0, $i$28 = 0, $i$34 = 0, $j$03 = 0, $k$07 = 0, $next_code = 0, $or$cond = 0, $sizes = 0, dest = 0, label = 0, sp = 0; + var stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 144|0; + $next_code = sp + 72|0; + $sizes = sp; + dest=$sizes; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); + _memset(($z|0),0,1024)|0; + $0 = ($num|0)>(0); + if ($0) { + $i$010 = 0; + while(1) { + $1 = (($sizelist) + ($i$010)|0); + $2 = HEAP8[$1>>0]|0; + $3 = $2&255; + $4 = (($sizes) + ($3<<2)|0); + $5 = HEAP32[$4>>2]|0; + $6 = (($5) + 1)|0; + HEAP32[$4>>2] = $6; + $7 = (($i$010) + 1)|0; + $exitcond13 = ($7|0)==($num|0); + if ($exitcond13) { + break; + } else { + $i$010 = $7; + } + } + } + HEAP32[$sizes>>2] = 0; + $11 = ((($sizes)) + 4|0); + $12 = HEAP32[$11>>2]|0; + $13 = ($12|0)>(2); + if (!($13)) { + $8 = ((($sizes)) + 8|0); + $9 = HEAP32[$8>>2]|0; + $10 = ($9|0)>(4); + if (!($10)) { + $66 = ((($sizes)) + 12|0); + $67 = HEAP32[$66>>2]|0; + $68 = ($67|0)>(8); + if (!($68)) { + $69 = ((($sizes)) + 16|0); + $70 = HEAP32[$69>>2]|0; + $71 = ($70|0)>(16); + if (!($71)) { + $72 = ((($sizes)) + 20|0); + $73 = HEAP32[$72>>2]|0; + $74 = ($73|0)>(32); + if (!($74)) { + $75 = ((($sizes)) + 24|0); + $76 = HEAP32[$75>>2]|0; + $77 = ($76|0)>(64); + if (!($77)) { + $78 = ((($sizes)) + 28|0); + $79 = HEAP32[$78>>2]|0; + $80 = ($79|0)>(128); + if (!($80)) { + $81 = ((($sizes)) + 32|0); + $82 = HEAP32[$81>>2]|0; + $83 = ($82|0)>(256); + if (!($83)) { + $84 = ((($sizes)) + 36|0); + $85 = HEAP32[$84>>2]|0; + $86 = ($85|0)>(512); + if (!($86)) { + $87 = ((($sizes)) + 40|0); + $88 = HEAP32[$87>>2]|0; + $89 = ($88|0)>(1024); + if (!($89)) { + $90 = ((($sizes)) + 44|0); + $91 = HEAP32[$90>>2]|0; + $92 = ($91|0)>(2048); + if (!($92)) { + $93 = ((($sizes)) + 48|0); + $94 = HEAP32[$93>>2]|0; + $95 = ($94|0)>(4096); + if (!($95)) { + $96 = ((($sizes)) + 52|0); + $97 = HEAP32[$96>>2]|0; + $98 = ($97|0)>(8192); + if (!($98)) { + $99 = ((($sizes)) + 56|0); + $100 = HEAP32[$99>>2]|0; + $101 = ($100|0)>(16384); + if (!($101)) { + $102 = ((($sizes)) + 60|0); + $103 = HEAP32[$102>>2]|0; + $104 = ($103|0)>(32768); + if (!($104)) { + $code$06 = 0;$i$28 = 1;$k$07 = 0; + while(1) { + $14 = (($next_code) + ($i$28<<2)|0); + HEAP32[$14>>2] = $code$06; + $15 = $code$06&65535; + $16 = (((($z)) + 1024|0) + ($i$28<<1)|0); + HEAP16[$16>>1] = $15; + $17 = $k$07&65535; + $18 = (((($z)) + 1124|0) + ($i$28<<1)|0); + HEAP16[$18>>1] = $17; + $19 = (($sizes) + ($i$28<<2)|0); + $20 = HEAP32[$19>>2]|0; + $21 = (($20) + ($code$06))|0; + $22 = ($20|0)!=(0); + $23 = 1 << $i$28; + $24 = ($21|0)>($23|0); + $or$cond = $22 & $24; + if ($or$cond) { + label = 7; + break; + } + $25 = (16 - ($i$28))|0; + $26 = $21 << $25; + $27 = (((($z)) + 1056|0) + ($i$28<<2)|0); + HEAP32[$27>>2] = $26; + $28 = $21 << 1; + $29 = HEAP32[$19>>2]|0; + $30 = (($29) + ($k$07))|0; + $31 = (($i$28) + 1)|0; + $32 = ($31|0)<(16); + if ($32) { + $code$06 = $28;$i$28 = $31;$k$07 = $30; + } else { + break; + } + } + if ((label|0) == 7) { + _stbi__err(14063); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $33 = ((($z)) + 1120|0); + HEAP32[$33>>2] = 65536; + $34 = ($num|0)>(0); + if ($34) { + $i$34 = 0; + } else { + $$0 = 1; + STACKTOP = sp;return ($$0|0); + } + while(1) { + $35 = (($sizelist) + ($i$34)|0); + $36 = HEAP8[$35>>0]|0; + $37 = $36&255; + $38 = ($36<<24>>24)==(0); + if (!($38)) { + $39 = (($next_code) + ($37<<2)|0); + $40 = HEAP32[$39>>2]|0; + $41 = (((($z)) + 1024|0) + ($37<<1)|0); + $42 = HEAP16[$41>>1]|0; + $43 = $42&65535; + $44 = (($40) - ($43))|0; + $45 = (((($z)) + 1124|0) + ($37<<1)|0); + $46 = HEAP16[$45>>1]|0; + $47 = $46&65535; + $48 = (($44) + ($47))|0; + $49 = $37 << 9; + $50 = $49 | $i$34; + $51 = $50&65535; + $52 = (((($z)) + 1156|0) + ($48)|0); + HEAP8[$52>>0] = $36; + $53 = $i$34&65535; + $54 = (((($z)) + 1444|0) + ($48<<1)|0); + HEAP16[$54>>1] = $53; + $55 = ($36&255)<(10); + do { + if ($55) { + $56 = HEAP32[$39>>2]|0; + $57 = (_stbi__bit_reverse($56,$37)|0); + $58 = ($57|0)<(512); + if (!($58)) { + break; + } + $59 = 1 << $37; + $j$03 = $57; + while(1) { + $60 = (($z) + ($j$03<<1)|0); + HEAP16[$60>>1] = $51; + $61 = (($j$03) + ($59))|0; + $62 = ($61|0)<(512); + if ($62) { + $j$03 = $61; + } else { + break; + } + } + } + } while(0); + $63 = HEAP32[$39>>2]|0; + $64 = (($63) + 1)|0; + HEAP32[$39>>2] = $64; + } + $65 = (($i$34) + 1)|0; + $exitcond = ($65|0)==($num|0); + if ($exitcond) { + $$0 = 1; + break; + } else { + $i$34 = $65; + } + } + STACKTOP = sp;return ($$0|0); + } + } + } + } + } + } + } + } + } + } + } + } + } + } + } + _stbi__err(14115); + $$0 = 0; + STACKTOP = sp;return ($$0|0); +} +function _stbi__compute_huffman_codes($a) { + $a = $a|0; + var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; + var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $codelength_sizes = 0, $exitcond = 0, $i$08 = 0, $lencodes = 0, $n$0$be = 0, $n$0$lcssa = 0, $n$06 = 0, $not$ = 0, $z_codelength = 0, dest = 0; + var label = 0, sp = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 2496|0; + $z_codelength = sp; + $lencodes = sp + 2039|0; + $codelength_sizes = sp + 2020|0; + $0 = (_stbi__zreceive($a,5)|0); + $1 = (($0) + 257)|0; + $2 = (_stbi__zreceive($a,5)|0); + $3 = (($2) + 1)|0; + $4 = (_stbi__zreceive($a,4)|0); + $5 = (($4) + 4)|0; + dest=$codelength_sizes; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0)); + $6 = ($5|0)>(0); + if ($6) { + $7 = (($4) + 3)|0; + $i$08 = 0; + while(1) { + $8 = (_stbi__zreceive($a,3)|0); + $9 = $8&255; + $10 = (14044 + ($i$08)|0); + $11 = HEAP8[$10>>0]|0; + $12 = $11&255; + $13 = (($codelength_sizes) + ($12)|0); + HEAP8[$13>>0] = $9; + $14 = (($i$08) + 1)|0; + $exitcond = ($i$08|0)==($7|0); + if ($exitcond) { + break; + } else { + $i$08 = $14; + } + } + } + $15 = (_stbi__zbuild_huffman($z_codelength,$codelength_sizes,19)|0); + $16 = ($15|0)==(0); + if ($16) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $17 = (($3) + ($1))|0; + $18 = ($17|0)>(0); + L9: do { + if ($18) { + $n$06 = 0; + L10: while(1) { + $19 = (_stbi__zhuffman_decode($a,$z_codelength)|0); + $20 = ($19>>>0)>(18); + if ($20) { + break; + } + $21 = ($19|0)<(16); + L13: do { + if ($21) { + $22 = $19&255; + $23 = (($n$06) + 1)|0; + $24 = (($lencodes) + ($n$06)|0); + HEAP8[$24>>0] = $22; + $n$0$be = $23; + } else { + switch ($19|0) { + case 16: { + $25 = (_stbi__zreceive($a,2)|0); + $26 = (($25) + 3)|0; + $27 = (($lencodes) + ($n$06)|0); + $28 = (($n$06) + -1)|0; + $29 = (($lencodes) + ($28)|0); + $30 = HEAP8[$29>>0]|0; + _memset(($27|0),($30|0),($26|0))|0; + $31 = (($26) + ($n$06))|0; + $n$0$be = $31; + break L13; + break; + } + case 17: { + $33 = (_stbi__zreceive($a,3)|0); + $34 = (($33) + 3)|0; + $35 = (($lencodes) + ($n$06)|0); + _memset(($35|0),0,($34|0))|0; + $36 = (($34) + ($n$06))|0; + $n$0$be = $36; + break L13; + break; + } + case 18: { + $37 = (_stbi__zreceive($a,7)|0); + $38 = (($37) + 11)|0; + $39 = (($lencodes) + ($n$06)|0); + _memset(($39|0),0,($38|0))|0; + $40 = (($38) + ($n$06))|0; + $n$0$be = $40; + break L13; + break; + } + default: { + label = 14; + break L10; + } + } + } + } while(0); + $32 = ($n$0$be|0)<($17|0); + if ($32) { + $n$06 = $n$0$be; + } else { + $n$0$lcssa = $n$0$be; + break L9; + } + } + if ((label|0) == 14) { + ___assert_fail((14079|0),(12975|0),3755,(14087|0)); + // unreachable; + } + _stbi__err(14063); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } else { + $n$0$lcssa = 0; + } + } while(0); + $41 = ($n$0$lcssa|0)==($17|0); + if (!($41)) { + _stbi__err(14063); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $42 = ((($a)) + 32|0); + $43 = (_stbi__zbuild_huffman($42,$lencodes,$1)|0); + $44 = ($43|0)==(0); + if ($44) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $45 = ((($a)) + 2052|0); + $46 = (($lencodes) + ($1)|0); + $47 = (_stbi__zbuild_huffman($45,$46,$3)|0); + $not$ = ($47|0)!=(0); + $$ = $not$&1; + $$0 = $$; + STACKTOP = sp;return ($$0|0); +} +function _stbi__parse_huffman_block($a) { + $a = $a|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dist$0 = 0; + var $len$0 = 0, $len$2 = 0, $p$0 = 0, $scevgep = 0, $scevgep14 = 0, $zout$0 = 0, $zout$0$lcssa = 0, $zout$1 = 0, $zout$2 = 0, $zout$4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($a)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($a)) + 32|0); + $3 = ((($a)) + 24|0); + $4 = ((($a)) + 2052|0); + $5 = ((($a)) + 20|0); + $6 = ((($a)) + 24|0); + $zout$0 = $1; + while(1) { + $9 = (_stbi__zhuffman_decode($a,$2)|0); + $10 = ($9|0)<(256); + if ($10) { + $11 = ($9|0)<(0); + if ($11) { + label = 6; + break; + } + $12 = HEAP32[$3>>2]|0; + $13 = ($zout$0>>>0)<($12>>>0); + if ($13) { + $zout$1 = $zout$0; + } else { + $14 = (_stbi__zexpand($a,$zout$0,1)|0); + $15 = ($14|0)==(0); + if ($15) { + $$0 = 0; + label = 28; + break; + } + $16 = HEAP32[$0>>2]|0; + $zout$1 = $16; + } + $17 = $9&255; + $18 = ((($zout$1)) + 1|0); + HEAP8[$zout$1>>0] = $17; + $zout$0 = $18; + continue; + } + $19 = ($9|0)==(256); + if ($19) { + $zout$0$lcssa = $zout$0; + label = 12; + break; + } + $20 = (($9) + -257)|0; + $21 = (5776 + ($20<<2)|0); + $22 = HEAP32[$21>>2]|0; + $23 = (($9) + -265)|0; + $24 = ($23>>>0)<(20); + if ($24) { + $25 = (5900 + ($20<<2)|0); + $26 = HEAP32[$25>>2]|0; + $27 = (_stbi__zreceive($a,$26)|0); + $28 = (($27) + ($22))|0; + $len$0 = $28; + } else { + $len$0 = $22; + } + $29 = (_stbi__zhuffman_decode($a,$4)|0); + $30 = ($29|0)<(0); + if ($30) { + label = 16; + break; + } + $31 = (6024 + ($29<<2)|0); + $32 = HEAP32[$31>>2]|0; + $33 = (($29) + -4)|0; + $34 = ($33>>>0)<(26); + if ($34) { + $35 = (6152 + ($29<<2)|0); + $36 = HEAP32[$35>>2]|0; + $37 = (_stbi__zreceive($a,$36)|0); + $38 = (($37) + ($32))|0; + $dist$0 = $38; + } else { + $dist$0 = $32; + } + $39 = HEAP32[$5>>2]|0; + $40 = $zout$0; + $41 = $39; + $42 = (($40) - ($41))|0; + $43 = ($42|0)<($dist$0|0); + if ($43) { + label = 20; + break; + } + $44 = (($zout$0) + ($len$0)|0); + $45 = HEAP32[$6>>2]|0; + $46 = ($44>>>0)>($45>>>0); + if ($46) { + $47 = (_stbi__zexpand($a,$zout$0,$len$0)|0); + $48 = ($47|0)==(0); + if ($48) { + $$0 = 0; + label = 28; + break; + } + $49 = HEAP32[$0>>2]|0; + $zout$2 = $49; + } else { + $zout$2 = $zout$0; + } + $50 = (0 - ($dist$0))|0; + $8 = (($zout$2) + ($50)|0); + $51 = ($dist$0|0)==(1); + $52 = ($len$0|0)==(0); + if ($51) { + if ($52) { + $zout$0 = $zout$2; + continue; + } + $7 = HEAP8[$8>>0]|0; + _memset(($zout$2|0),($7|0),($len$0|0))|0; + $scevgep14 = (($zout$2) + ($len$0)|0); + $zout$0 = $scevgep14; + continue; + } + if ($52) { + $zout$0 = $zout$2; + continue; + } else { + $len$2 = $len$0;$p$0 = $8;$zout$4 = $zout$2; + } + while(1) { + $53 = ((($p$0)) + 1|0); + $54 = HEAP8[$p$0>>0]|0; + $55 = ((($zout$4)) + 1|0); + HEAP8[$zout$4>>0] = $54; + $56 = (($len$2) + -1)|0; + $57 = ($56|0)==(0); + if ($57) { + break; + } else { + $len$2 = $56;$p$0 = $53;$zout$4 = $55; + } + } + $scevgep = (($zout$2) + ($len$0)|0); + $zout$0 = $scevgep; + } + if ((label|0) == 6) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 12) { + HEAP32[$0>>2] = $zout$0$lcssa; + $$0 = 1; + return ($$0|0); + } + else if ((label|0) == 16) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 20) { + _stbi__err(13886); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 28) { + return ($$0|0); + } + return (0)|0; +} +function _stbi__zhuffman_decode($a,$z) { + $a = $a|0; + $z = $z|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($a)) + 8|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<(16); + if ($2) { + _stbi__fill_bits($a); + } + $3 = ((($a)) + 12|0); + $4 = HEAP32[$3>>2]|0; + $5 = $4 & 511; + $6 = (($z) + ($5<<1)|0); + $7 = HEAP16[$6>>1]|0; + $8 = $7&65535; + $9 = ($7<<16>>16)==(0); + if ($9) { + $15 = (_stbi__zhuffman_decode_slowpath($a,$z)|0); + $$0 = $15; + return ($$0|0); + } else { + $10 = $8 >>> 9; + $11 = $4 >>> $10; + HEAP32[$3>>2] = $11; + $12 = HEAP32[$0>>2]|0; + $13 = (($12) - ($10))|0; + HEAP32[$0>>2] = $13; + $14 = $8 & 511; + $$0 = $14; + return ($$0|0); + } + return (0)|0; +} +function _stbi__zexpand($z,$zout,$n) { + $z = $z|0; + $zout = $zout|0; + $n = $n|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; + var $8 = 0, $9 = 0, $limit$0 = 0, $limit$0$lcssa = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($z)) + 16|0); + HEAP32[$0>>2] = $zout; + $1 = ((($z)) + 28|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)==(0); + if ($3) { + _stbi__err(13895); + $$0 = 0; + return ($$0|0); + } + $4 = ((($z)) + 20|0); + $5 = HEAP32[$4>>2]|0; + $6 = $zout; + $7 = $5; + $8 = (($6) - ($7))|0; + $9 = ((($z)) + 24|0); + $10 = HEAP32[$9>>2]|0; + $11 = $10; + $12 = (($11) - ($7))|0; + $13 = (($8) + ($n))|0; + $limit$0 = $12; + while(1) { + $14 = ($13|0)>($limit$0|0); + $15 = $limit$0 << 1; + if ($14) { + $limit$0 = $15; + } else { + $limit$0$lcssa = $limit$0; + break; + } + } + $16 = HEAP32[$4>>2]|0; + $17 = (_realloc($16,$limit$0$lcssa)|0); + $18 = ($17|0)==(0|0); + if ($18) { + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } else { + HEAP32[$4>>2] = $17; + $19 = (($17) + ($8)|0); + HEAP32[$0>>2] = $19; + $20 = (($17) + ($limit$0$lcssa)|0); + HEAP32[$9>>2] = $20; + $$0 = 1; + return ($$0|0); + } + return (0)|0; +} +function _stbi__fill_bits($z) { + $z = $z|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($z)) + 12|0); + $1 = ((($z)) + 8|0); + while(1) { + $2 = HEAP32[$0>>2]|0; + $3 = HEAP32[$1>>2]|0; + $4 = 1 << $3; + $5 = ($2>>>0)<($4>>>0); + if (!($5)) { + label = 3; + break; + } + $6 = (_stbi__zget8($z)|0); + $7 = $6&255; + $8 = HEAP32[$1>>2]|0; + $9 = $7 << $8; + $10 = HEAP32[$0>>2]|0; + $11 = $10 | $9; + HEAP32[$0>>2] = $11; + $12 = HEAP32[$1>>2]|0; + $13 = (($12) + 8)|0; + HEAP32[$1>>2] = $13; + $14 = ($13|0)<(25); + if (!($14)) { + label = 5; + break; + } + } + if ((label|0) == 3) { + ___assert_fail((13991|0),(12975|0),3598,(14028|0)); + // unreachable; + } + else if ((label|0) == 5) { + return; + } +} +function _stbi__zhuffman_decode_slowpath($a,$z) { + $a = $a|0; + $z = $z|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $s$0 = 0, $s$0$lcssa = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($a)) + 12|0); + $1 = HEAP32[$0>>2]|0; + $2 = (_stbi__bit_reverse($1,16)|0); + $s$0 = 10; + while(1) { + $3 = (((($z)) + 1056|0) + ($s$0<<2)|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($2|0)<($4|0); + $6 = (($s$0) + 1)|0; + if ($5) { + $s$0$lcssa = $s$0; + break; + } else { + $s$0 = $6; + } + } + $7 = ($s$0$lcssa|0)==(16); + if ($7) { + $$0 = -1; + return ($$0|0); + } + $8 = (16 - ($s$0$lcssa))|0; + $9 = $2 >> $8; + $10 = (((($z)) + 1024|0) + ($s$0$lcssa<<1)|0); + $11 = HEAP16[$10>>1]|0; + $12 = $11&65535; + $13 = (($9) - ($12))|0; + $14 = (((($z)) + 1124|0) + ($s$0$lcssa<<1)|0); + $15 = HEAP16[$14>>1]|0; + $16 = $15&65535; + $17 = (($13) + ($16))|0; + $18 = (((($z)) + 1156|0) + ($17)|0); + $19 = HEAP8[$18>>0]|0; + $20 = $19&255; + $21 = ($20|0)==($s$0$lcssa|0); + if (!($21)) { + ___assert_fail((13915|0),(12975|0),3626,(13931|0)); + // unreachable; + } + $22 = HEAP32[$0>>2]|0; + $23 = $22 >>> $s$0$lcssa; + HEAP32[$0>>2] = $23; + $24 = ((($a)) + 8|0); + $25 = HEAP32[$24>>2]|0; + $26 = (($25) - ($s$0$lcssa))|0; + HEAP32[$24>>2] = $26; + $27 = (((($z)) + 1444|0) + ($17<<1)|0); + $28 = HEAP16[$27>>1]|0; + $29 = $28&65535; + $$0 = $29; + return ($$0|0); +} +function _stbi__bit_reverse($v,$bits) { + $v = $v|0; + $bits = $bits|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($bits|0)<(17); + if ($0) { + $1 = (_stbi__bitreverse16($v)|0); + $2 = (16 - ($bits))|0; + $3 = $1 >> $2; + return ($3|0); + } else { + ___assert_fail((13962|0),(12975|0),3516,(13973|0)); + // unreachable; + } + return (0)|0; +} +function _stbi__bitreverse16($n) { + $n = $n|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0; + var sp = 0; + sp = STACKTOP; + $0 = $n >>> 1; + $1 = $0 & 21845; + $2 = $n << 1; + $3 = $2 & 43690; + $4 = $1 | $3; + $5 = $4 >>> 2; + $6 = $5 & 13107; + $7 = $4 << 2; + $8 = $7 & 52428; + $9 = $6 | $8; + $10 = $9 >>> 4; + $11 = $10 & 3855; + $12 = $9 << 4; + $13 = $12 & 61680; + $14 = $11 | $13; + $15 = $14 >>> 8; + $16 = $14 << 8; + $17 = $16 & 65280; + $18 = $17 | $15; + return ($18|0); +} +function _stbi__zget8($z) { + $z = $z|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$z>>2]|0; + $1 = ((($z)) + 4|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($0>>>0)<($2>>>0); + if (!($3)) { + $$0 = 0; + return ($$0|0); + } + $4 = ((($0)) + 1|0); + HEAP32[$z>>2] = $4; + $5 = HEAP8[$0>>0]|0; + $$0 = $5; + return ($$0|0); +} +function _stbi__load_main($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__jpeg_test($s)|0); + $1 = ($0|0)==(0); + if (!($1)) { + $2 = (_stbi__jpeg_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $2; + return ($$0|0); + } + $3 = (_stbi__png_test($s)|0); + $4 = ($3|0)==(0); + if (!($4)) { + $5 = (_stbi__png_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $5; + return ($$0|0); + } + $6 = (_stbi__bmp_test($s)|0); + $7 = ($6|0)==(0); + if (!($7)) { + $8 = (_stbi__bmp_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $8; + return ($$0|0); + } + $9 = (_stbi__gif_test($s)|0); + $10 = ($9|0)==(0); + if (!($10)) { + $11 = (_stbi__gif_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $11; + return ($$0|0); + } + $12 = (_stbi__psd_test($s)|0); + $13 = ($12|0)==(0); + if (!($13)) { + $14 = (_stbi__psd_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $14; + return ($$0|0); + } + $15 = (_stbi__pic_test($s)|0); + $16 = ($15|0)==(0); + if (!($16)) { + $17 = (_stbi__pic_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $17; + return ($$0|0); + } + $18 = (_stbi__pnm_test($s)|0); + $19 = ($18|0)==(0); + if (!($19)) { + $20 = (_stbi__pnm_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $20; + return ($$0|0); + } + $21 = (_stbi__tga_test($s)|0); + $22 = ($21|0)==(0); + if ($22) { + _stbi__err(12566); + $$0 = 0; + return ($$0|0); + } else { + $23 = (_stbi__tga_load($s,$x,$y,$comp,$req_comp)|0); + $$0 = $23; + return ($$0|0); + } + return (0)|0; +} +function _stbi__jpeg_test($s) { + $s = $s|0; + var $0 = 0, $j = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 18192|0; + $j = sp; + HEAP32[$j>>2] = $s; + _stbi__setup_jpeg($j); + $0 = (_stbi__decode_jpeg_header($j,1)|0); + _stbi__rewind($s); + STACKTOP = sp;return ($0|0); +} +function _stbi__jpeg_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $0 = 0, $1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__malloc(18192)|0); + HEAP32[$0>>2] = $s; + _stbi__setup_jpeg($0); + $1 = (_load_jpeg_image($0,$x,$y,$comp,$req_comp)|0); + _free($0); + return ($1|0); +} +function _stbi__png_test($s) { + $s = $s|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__check_png_header($s)|0); + _stbi__rewind($s); + return ($0|0); +} +function _stbi__png_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $0 = 0, $p = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $p = sp; + HEAP32[$p>>2] = $s; + $0 = (_stbi__do_png($p,$x,$y,$comp,$req_comp)|0); + STACKTOP = sp;return ($0|0); +} +function _stbi__bmp_test($s) { + $s = $s|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__bmp_test_raw($s)|0); + _stbi__rewind($s); + return ($0|0); +} +function _stbi__bmp_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$0 = 0, $$pr = 0, $$sum = 0, $$sum16 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; + var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; + var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; + var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; + var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0; + var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0; + var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0; + var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0; + var $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0; + var $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; + var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; + var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; + var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; + var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $acount$0 = 0, $all_a$064 = 0, $all_a$158 = 0, $all_a$251 = 0, $all_a$3 = 0, $all_a$4 = 0, $ashift$0 = 0, $bcount$0 = 0, $bshift$0 = 0, $easy$017 = 0, $exitcond = 0, $gcount$0 = 0, $gshift$0 = 0, $i$046 = 0; + var $i$138 = 0, $i$256 = 0, $i$349 = 0, $i$435 = 0, $i$532 = 0, $info = 0, $ispos = 0, $j$044 = 0, $j$162 = 0, $j$233 = 0, $neg = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond15 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, $out$0 = 0; + var $pal = 0, $psize$0 = 0, $rcount$0 = 0, $req_comp$ = 0, $rshift$0 = 0, $v$0 = 0, $v2$0 = 0, $width$0 = 0, $width$1 = 0, $width$1$ph = 0, $z$045 = 0, $z$139 = 0, $z$2 = 0, $z$3 = 0, $z$4 = 0, $z1$063 = 0, $z1$157 = 0, $z1$2 = 0, $z1$350 = 0, $z1$4 = 0; + var $z1$5 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 1056|0; + $pal = sp + 32|0; + $info = sp; + $0 = ((($info)) + 28|0); + HEAP32[$0>>2] = 255; + $1 = (_stbi__bmp_parse_header($s,$info)|0); + $2 = ($1|0)==(0|0); + if ($2) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $3 = ((($s)) + 4|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)>(0); + $ispos = ($4|0)>(-1); + $neg = (0 - ($4))|0; + $6 = $ispos ? $4 : $neg; + HEAP32[$3>>2] = $6; + $7 = ((($info)) + 12|0); + $8 = HEAP32[$7>>2]|0; + $9 = ((($info)) + 16|0); + $10 = HEAP32[$9>>2]|0; + $11 = ((($info)) + 20|0); + $12 = HEAP32[$11>>2]|0; + $13 = ((($info)) + 24|0); + $14 = HEAP32[$13>>2]|0; + $15 = HEAP32[$0>>2]|0; + $16 = ((($info)) + 8|0); + $17 = HEAP32[$16>>2]|0; + $18 = ($17|0)==(12); + $19 = HEAP32[$info>>2]|0; + if ($18) { + $20 = ($19|0)<(24); + if ($20) { + $21 = ((($info)) + 4|0); + $22 = HEAP32[$21>>2]|0; + $23 = (($22) + -38)|0; + $24 = (($23|0) / 3)&-1; + $psize$0 = $24; + } else { + $psize$0 = 0; + } + } else { + $25 = ($19|0)<(16); + if ($25) { + $26 = ((($info)) + 4|0); + $27 = HEAP32[$26>>2]|0; + $28 = (-14 - ($17))|0; + $29 = (($28) + ($27))|0; + $30 = $29 >> 2; + $psize$0 = $30; + } else { + $psize$0 = 0; + } + } + $31 = ($14|0)!=(0); + $32 = $31 ? 4 : 3; + $33 = ((($s)) + 8|0); + HEAP32[$33>>2] = $32; + $34 = ($req_comp|0)==(0); + $35 = ($req_comp|0)>(2); + $req_comp$ = $35 ? $req_comp : $32; + $36 = HEAP32[$s>>2]|0; + $37 = Math_imul($36, $req_comp$)|0; + $38 = HEAP32[$3>>2]|0; + $39 = Math_imul($37, $38)|0; + $40 = (_stbi__malloc($39)|0); + $41 = ($40|0)==(0|0); + if ($41) { + _stbi__err(12905); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $42 = HEAP32[$info>>2]|0; + $43 = ($42|0)<(16); + if ($43) { + $44 = ($psize$0|0)==(0); + $45 = ($psize$0|0)>(256); + $or$cond3 = $44 | $45; + if ($or$cond3) { + _free($40); + _stbi__err(14566); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $46 = ($psize$0|0)>(0); + if ($46) { + $47 = HEAP32[$16>>2]|0; + $48 = ($47|0)==(12); + $i$046 = 0; + while(1) { + $49 = (_stbi__get8($s)|0); + $50 = (((($pal) + ($i$046<<2)|0)) + 2|0); + HEAP8[$50>>0] = $49; + $51 = (_stbi__get8($s)|0); + $52 = (((($pal) + ($i$046<<2)|0)) + 1|0); + HEAP8[$52>>0] = $51; + $53 = (_stbi__get8($s)|0); + $54 = (($pal) + ($i$046<<2)|0); + HEAP8[$54>>0] = $53; + if (!($48)) { + (_stbi__get8($s)|0); + } + $55 = (((($pal) + ($i$046<<2)|0)) + 3|0); + HEAP8[$55>>0] = -1; + $56 = (($i$046) + 1)|0; + $exitcond = ($56|0)==($psize$0|0); + if ($exitcond) { + break; + } else { + $i$046 = $56; + } + } + } + $57 = ((($info)) + 4|0); + $58 = HEAP32[$57>>2]|0; + $59 = (($58) + -14)|0; + $60 = HEAP32[$16>>2]|0; + $61 = (($59) - ($60))|0; + $62 = ($60|0)==(12); + $63 = $62 ? 3 : 4; + $64 = Math_imul($63, $psize$0)|0; + $65 = (($61) - ($64))|0; + _stbi__skip($s,$65); + $66 = HEAP32[$info>>2]|0; + switch ($66|0) { + case 4: { + $67 = HEAP32[$s>>2]|0; + $68 = (($67) + 1)|0; + $69 = $68 >>> 1; + $width$0 = $69; + break; + } + case 8: { + $70 = HEAP32[$s>>2]|0; + $width$0 = $70; + break; + } + default: { + _free($40); + _stbi__err(14574); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + } + $71 = (0 - ($width$0))|0; + $72 = $71 & 3; + $73 = HEAP32[$3>>2]|0; + $74 = ($73|0)>(0); + if ($74) { + $75 = HEAP32[$info>>2]|0; + $76 = ($75|0)==(4); + $77 = ($req_comp$|0)==(4); + $78 = ($75|0)==(8); + $j$044 = 0;$z$045 = 0; + while(1) { + $79 = HEAP32[$s>>2]|0; + $80 = ($79|0)>(0); + L37: do { + if ($80) { + $i$138 = 0;$z$139 = $z$045; + while(1) { + $81 = (_stbi__get8($s)|0); + $82 = $81&255; + $83 = $82 & 15; + $84 = $82 >>> 4; + $v$0 = $76 ? $84 : $82; + $v2$0 = $76 ? $83 : 0; + $85 = (($pal) + ($v$0<<2)|0); + $86 = HEAP8[$85>>0]|0; + $87 = (($z$139) + 1)|0; + $88 = (($40) + ($z$139)|0); + HEAP8[$88>>0] = $86; + $89 = (((($pal) + ($v$0<<2)|0)) + 1|0); + $90 = HEAP8[$89>>0]|0; + $91 = (($z$139) + 2)|0; + $92 = (($40) + ($87)|0); + HEAP8[$92>>0] = $90; + $93 = (((($pal) + ($v$0<<2)|0)) + 2|0); + $94 = HEAP8[$93>>0]|0; + $95 = (($z$139) + 3)|0; + $96 = (($40) + ($91)|0); + HEAP8[$96>>0] = $94; + if ($77) { + $97 = (($z$139) + 4)|0; + $98 = (($40) + ($95)|0); + HEAP8[$98>>0] = -1; + $z$2 = $97; + } else { + $z$2 = $95; + } + $99 = $i$138 | 1; + $100 = HEAP32[$s>>2]|0; + $101 = ($99|0)==($100|0); + if ($101) { + $z$4 = $z$2; + break L37; + } + if ($78) { + $102 = (_stbi__get8($s)|0); + $103 = $102&255; + $105 = $103; + } else { + $105 = $v2$0; + } + $104 = (($pal) + ($105<<2)|0); + $106 = HEAP8[$104>>0]|0; + $107 = (($z$2) + 1)|0; + $108 = (($40) + ($z$2)|0); + HEAP8[$108>>0] = $106; + $109 = (((($pal) + ($105<<2)|0)) + 1|0); + $110 = HEAP8[$109>>0]|0; + $111 = (($z$2) + 2)|0; + $112 = (($40) + ($107)|0); + HEAP8[$112>>0] = $110; + $113 = (((($pal) + ($105<<2)|0)) + 2|0); + $114 = HEAP8[$113>>0]|0; + $115 = (($z$2) + 3)|0; + $116 = (($40) + ($111)|0); + HEAP8[$116>>0] = $114; + if ($77) { + $117 = (($z$2) + 4)|0; + $118 = (($40) + ($115)|0); + HEAP8[$118>>0] = -1; + $z$3 = $117; + } else { + $z$3 = $115; + } + $119 = (($i$138) + 2)|0; + $120 = HEAP32[$s>>2]|0; + $121 = ($119|0)<($120|0); + if ($121) { + $i$138 = $119;$z$139 = $z$3; + } else { + $z$4 = $z$3; + break; + } + } + } else { + $z$4 = $z$045; + } + } while(0); + _stbi__skip($s,$72); + $122 = (($j$044) + 1)|0; + $123 = HEAP32[$3>>2]|0; + $124 = ($122|0)<($123|0); + if ($124) { + $j$044 = $122;$z$045 = $z$4; + } else { + $all_a$4 = $15; + break; + } + } + } else { + $all_a$4 = $15; + } + } else { + $125 = ((($info)) + 4|0); + $126 = HEAP32[$125>>2]|0; + $127 = (($126) + -14)|0; + $128 = HEAP32[$16>>2]|0; + $129 = (($127) - ($128))|0; + _stbi__skip($s,$129); + $130 = HEAP32[$info>>2]|0; + switch ($130|0) { + case 24: { + $131 = HEAP32[$s>>2]|0; + $132 = ($131*3)|0; + $width$1$ph = $132; + label = 36; + break; + } + case 16: { + $133 = HEAP32[$s>>2]|0; + $134 = $133 << 1; + $width$1$ph = $134; + label = 36; + break; + } + default: { + $137 = $130;$width$1 = 0; + } + } + if ((label|0) == 36) { + $$pr = HEAP32[$info>>2]|0; + $137 = $$pr;$width$1 = $width$1$ph; + } + $135 = (0 - ($width$1))|0; + $136 = $135 & 3; + switch ($137|0) { + case 24: { + $261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 1;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0; + break; + } + case 32: { + $138 = ($12|0)==(255); + $139 = ($10|0)==(65280); + $or$cond5 = $139 & $138; + $140 = ($8|0)==(16711680); + $or$cond7 = $140 & $or$cond5; + $141 = ($14|0)==(-16777216); + $or$cond9 = $141 & $or$cond7; + if ($or$cond9) { + $261 = 1;$acount$0 = 0;$ashift$0 = 0;$bcount$0 = 0;$bshift$0 = 0;$easy$017 = 2;$gcount$0 = 0;$gshift$0 = 0;$rcount$0 = 0;$rshift$0 = 0; + } else { + label = 39; + } + break; + } + default: { + label = 39; + } + } + do { + if ((label|0) == 39) { + $142 = ($8|0)!=(0); + $143 = ($10|0)!=(0); + $or$cond11 = $142 & $143; + $144 = ($12|0)!=(0); + $or$cond13 = $or$cond11 & $144; + if ($or$cond13) { + $145 = (_stbi__high_bit($8)|0); + $146 = (($145) + -7)|0; + $147 = (_stbi__bitcount($8)|0); + $148 = (_stbi__high_bit($10)|0); + $149 = (($148) + -7)|0; + $150 = (_stbi__bitcount($10)|0); + $151 = (_stbi__high_bit($12)|0); + $152 = (($151) + -7)|0; + $153 = (_stbi__bitcount($12)|0); + $154 = (_stbi__high_bit($14)|0); + $155 = (($154) + -7)|0; + $156 = (_stbi__bitcount($14)|0); + $261 = 0;$acount$0 = $156;$ashift$0 = $155;$bcount$0 = $153;$bshift$0 = $152;$easy$017 = 0;$gcount$0 = $150;$gshift$0 = $149;$rcount$0 = $147;$rshift$0 = $146; + break; + } + _free($40); + _stbi__err(14582); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + } while(0); + $157 = HEAP32[$3>>2]|0; + $158 = ($157|0)>(0); + if ($158) { + $159 = HEAP32[$info>>2]|0; + $160 = ($159|0)==(16); + $161 = ($req_comp$|0)==(4); + $162 = ($easy$017|0)==(2); + $163 = ($req_comp$|0)==(4); + $all_a$064 = $15;$j$162 = 0;$z1$063 = 0; + while(1) { + $164 = HEAP32[$s>>2]|0; + $165 = ($164|0)>(0); + if ($261) { + if ($165) { + $all_a$158 = $all_a$064;$i$256 = 0;$z1$157 = $z1$063; + while(1) { + $166 = (_stbi__get8($s)|0); + $167 = (($z1$157) + 2)|0; + $168 = (($40) + ($167)|0); + HEAP8[$168>>0] = $166; + $169 = (_stbi__get8($s)|0); + $170 = (($z1$157) + 1)|0; + $171 = (($40) + ($170)|0); + HEAP8[$171>>0] = $169; + $172 = (_stbi__get8($s)|0); + $173 = (($40) + ($z1$157)|0); + HEAP8[$173>>0] = $172; + $174 = (($z1$157) + 3)|0; + if ($162) { + $175 = (_stbi__get8($s)|0); + $176 = $175&255; + $178 = $176; + } else { + $178 = 255; + } + $177 = $178 | $all_a$158; + if ($163) { + $179 = $178&255; + $180 = (($z1$157) + 4)|0; + $181 = (($40) + ($174)|0); + HEAP8[$181>>0] = $179; + $z1$2 = $180; + } else { + $z1$2 = $174; + } + $182 = (($i$256) + 1)|0; + $183 = HEAP32[$s>>2]|0; + $184 = ($182|0)<($183|0); + if ($184) { + $all_a$158 = $177;$i$256 = $182;$z1$157 = $z1$2; + } else { + $all_a$3 = $177;$z1$5 = $z1$2; + break; + } + } + } else { + $all_a$3 = $all_a$064;$z1$5 = $z1$063; + } + } else { + if ($165) { + $all_a$251 = $all_a$064;$i$349 = 0;$z1$350 = $z1$063; + while(1) { + if ($160) { + $185 = (_stbi__get16le($s)|0); + $188 = $185; + } else { + $186 = (_stbi__get32le($s)|0); + $188 = $186; + } + $187 = $188 & $8; + $189 = (_stbi__shiftsigned($187,$rshift$0,$rcount$0)|0); + $190 = $189&255; + $191 = (($z1$350) + 1)|0; + $192 = (($40) + ($z1$350)|0); + HEAP8[$192>>0] = $190; + $193 = $188 & $10; + $194 = (_stbi__shiftsigned($193,$gshift$0,$gcount$0)|0); + $195 = $194&255; + $196 = (($z1$350) + 2)|0; + $197 = (($40) + ($191)|0); + HEAP8[$197>>0] = $195; + $198 = $188 & $12; + $199 = (_stbi__shiftsigned($198,$bshift$0,$bcount$0)|0); + $200 = $199&255; + $201 = (($z1$350) + 3)|0; + $202 = (($40) + ($196)|0); + HEAP8[$202>>0] = $200; + if ($31) { + $203 = $188 & $14; + $204 = (_stbi__shiftsigned($203,$ashift$0,$acount$0)|0); + $206 = $204; + } else { + $206 = 255; + } + $205 = $206 | $all_a$251; + if ($161) { + $207 = $206&255; + $208 = (($z1$350) + 4)|0; + $209 = (($40) + ($201)|0); + HEAP8[$209>>0] = $207; + $z1$4 = $208; + } else { + $z1$4 = $201; + } + $210 = (($i$349) + 1)|0; + $211 = HEAP32[$s>>2]|0; + $212 = ($210|0)<($211|0); + if ($212) { + $all_a$251 = $205;$i$349 = $210;$z1$350 = $z1$4; + } else { + $all_a$3 = $205;$z1$5 = $z1$4; + break; + } + } + } else { + $all_a$3 = $all_a$064;$z1$5 = $z1$063; + } + } + _stbi__skip($s,$136); + $213 = (($j$162) + 1)|0; + $214 = HEAP32[$3>>2]|0; + $215 = ($213|0)<($214|0); + if ($215) { + $all_a$064 = $all_a$3;$j$162 = $213;$z1$063 = $z1$5; + } else { + $all_a$4 = $all_a$3; + break; + } + } + } else { + $all_a$4 = $15; + } + } + $216 = ($req_comp$|0)==(4); + $217 = ($all_a$4|0)==(0); + $or$cond15 = $216 & $217; + if ($or$cond15) { + $218 = HEAP32[$s>>2]|0; + $219 = $218 << 2; + $220 = HEAP32[$3>>2]|0; + $221 = Math_imul($219, $220)|0; + $222 = (($221) + -1)|0; + $223 = ($222|0)>(-1); + if ($223) { + $i$435 = $222; + while(1) { + $224 = (($40) + ($i$435)|0); + HEAP8[$224>>0] = -1; + $225 = (($i$435) + -4)|0; + $226 = ($225|0)>(-1); + if ($226) { + $i$435 = $225; + } else { + break; + } + } + } + } + if ($5) { + $227 = HEAP32[$3>>2]|0; + $228 = $227 >> 1; + $229 = ($228|0)>(0); + if ($229) { + $230 = HEAP32[$s>>2]|0; + $231 = Math_imul($230, $req_comp$)|0; + $232 = ($231|0)>(0); + $233 = HEAP32[$3>>2]|0; + $234 = $233 >> 1; + $239 = $227;$j$233 = 0; + while(1) { + $235 = Math_imul($j$233, $req_comp$)|0; + $236 = Math_imul($235, $230)|0; + $237 = $j$233 ^ -1; + $238 = (($239) + ($237))|0; + $240 = Math_imul($238, $req_comp$)|0; + $241 = Math_imul($240, $230)|0; + if ($232) { + $242 = HEAP32[$s>>2]|0; + $243 = Math_imul($242, $req_comp$)|0; + $i$532 = 0; + while(1) { + $$sum = (($i$532) + ($236))|0; + $244 = (($40) + ($$sum)|0); + $245 = HEAP8[$244>>0]|0; + $$sum16 = (($i$532) + ($241))|0; + $246 = (($40) + ($$sum16)|0); + $247 = HEAP8[$246>>0]|0; + HEAP8[$244>>0] = $247; + HEAP8[$246>>0] = $245; + $248 = (($i$532) + 1)|0; + $249 = ($248|0)<($243|0); + if ($249) { + $i$532 = $248; + } else { + break; + } + } + } + $250 = (($j$233) + 1)|0; + $251 = ($250|0)<($234|0); + if ($251) { + $239 = $233;$j$233 = $250; + } else { + break; + } + } + } + } + $252 = ($req_comp$|0)==($req_comp|0); + $or$cond = $34 | $252; + if ($or$cond) { + $out$0 = $40; + } else { + $253 = HEAP32[$s>>2]|0; + $254 = HEAP32[$3>>2]|0; + $255 = (_stbi__convert_format($40,$req_comp$,$req_comp,$253,$254)|0); + $256 = ($255|0)==(0|0); + if ($256) { + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } else { + $out$0 = $255; + } + } + $257 = HEAP32[$s>>2]|0; + HEAP32[$x>>2] = $257; + $258 = HEAP32[$3>>2]|0; + HEAP32[$y>>2] = $258; + $259 = ($comp|0)==(0|0); + if ($259) { + $$0 = $out$0; + STACKTOP = sp;return ($$0|0); + } + $260 = HEAP32[$33>>2]|0; + HEAP32[$comp>>2] = $260; + $$0 = $out$0; + STACKTOP = sp;return ($$0|0); +} +function _stbi__gif_test($s) { + $s = $s|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__gif_test_raw($s)|0); + _stbi__rewind($s); + return ($0|0); +} +function _stbi__gif_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $u$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__malloc(18516)|0); + _memset(($0|0),0,18516)|0; + $1 = (_stbi__gif_load_next($s,$0,$comp)|0); + $2 = ($1|0)==($s|0); + $$ = $2 ? 0 : $1; + $3 = ($$|0)==(0|0); + if ($3) { + $10 = ((($0)) + 8|0); + $11 = HEAP32[$10>>2]|0; + $12 = ($11|0)==(0|0); + if ($12) { + $u$0 = 0; + _free($0); + return ($u$0|0); + } + _free($11); + $u$0 = 0; + _free($0); + return ($u$0|0); + } else { + $4 = HEAP32[$0>>2]|0; + HEAP32[$x>>2] = $4; + $5 = ((($0)) + 4|0); + $6 = HEAP32[$5>>2]|0; + HEAP32[$y>>2] = $6; + switch ($req_comp|0) { + case 0: case 4: { + $u$0 = $$; + _free($0); + return ($u$0|0); + break; + } + default: { + } + } + $7 = HEAP32[$0>>2]|0; + $8 = HEAP32[$5>>2]|0; + $9 = (_stbi__convert_format($$,4,$req_comp,$7,$8)|0); + $u$0 = $9; + _free($0); + return ($u$0|0); + } + return (0)|0; +} +function _stbi__psd_test($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get32be($s)|0); + $1 = ($0|0)==(943870035); + $2 = $1&1; + _stbi__rewind($s); + return ($2|0); +} +function _stbi__psd_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$0 = 0, $$lcssa = 0, $$pn = 0, $$sum6 = 0, $$sum7 = 0, $$sum8 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0; + var $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0; + var $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; + var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; + var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0; + var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0; + var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0; + var $91 = 0, $92 = 0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $channel$046 = 0, $count$0$ph$be = 0, $count$0$ph45 = 0, $exitcond = 0, $exitcond49 = 0, $exitcond49$1 = 0, $exitcond49$2 = 0, $exitcond49$3 = 0, $exitcond50 = 0, $exitcond50$1 = 0, $exitcond50$2 = 0; + var $exitcond50$3 = 0, $exitcond51 = 0, $exitcond51$1 = 0, $exitcond51$2 = 0, $exitcond51$3 = 0, $exitcond54 = 0, $exitcond58 = 0, $i$036 = 0, $i$126 = 0, $i$126$1 = 0, $i$126$2 = 0, $i$126$3 = 0, $i$232 = 0, $i$232$1 = 0, $i$232$2 = 0, $i$232$3 = 0, $i$329 = 0, $i$329$1 = 0, $i$329$2 = 0, $i$329$3 = 0; + var $i$424 = 0, $len$043 = 0, $len$140 = 0, $or$cond = 0, $out$0 = 0, $p$035 = 0, $p$1$ph$be = 0, $p$1$ph44 = 0, $p$242 = 0, $p$339 = 0, $p1$025 = 0, $p1$025$1 = 0, $p1$025$2 = 0, $p1$025$3 = 0, $p1$131 = 0, $p1$131$1 = 0, $p1$131$2 = 0, $p1$131$3 = 0, $p1$228 = 0, $p1$228$1 = 0; + var $p1$228$2 = 0, $p1$228$3 = 0, $scevgep$sum = 0, $scevgep55 = 0, $scevgep56$sum = 0, $scevgep57 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get32be($s)|0); + $1 = ($0|0)==(943870035); + if (!($1)) { + _stbi__err(14377); + $$0 = 0; + return ($$0|0); + } + $2 = (_stbi__get16be($s)|0); + $3 = ($2|0)==(1); + if (!($3)) { + _stbi__err(14385); + $$0 = 0; + return ($$0|0); + } + _stbi__skip($s,6); + $4 = (_stbi__get16be($s)|0); + $5 = ($4>>>0)>(16); + if ($5) { + _stbi__err(14399); + $$0 = 0; + return ($$0|0); + } + $6 = (_stbi__get32be($s)|0); + $7 = (_stbi__get32be($s)|0); + $8 = (_stbi__get16be($s)|0); + switch ($8|0) { + case 8: case 16: { + break; + } + default: { + _stbi__err(14419); + $$0 = 0; + return ($$0|0); + } + } + $9 = (_stbi__get16be($s)|0); + $10 = ($9|0)==(3); + if (!($10)) { + _stbi__err(14441); + $$0 = 0; + return ($$0|0); + } + $11 = (_stbi__get32be($s)|0); + _stbi__skip($s,$11); + $12 = (_stbi__get32be($s)|0); + _stbi__skip($s,$12); + $13 = (_stbi__get32be($s)|0); + _stbi__skip($s,$13); + $14 = (_stbi__get16be($s)|0); + $15 = ($14|0)>(1); + if ($15) { + _stbi__err(14234); + $$0 = 0; + return ($$0|0); + } + $16 = $6 << 2; + $17 = Math_imul($16, $7)|0; + $18 = (_stbi__malloc($17)|0); + $19 = ($18|0)==(0|0); + if ($19) { + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + $20 = Math_imul($7, $6)|0; + $21 = ($14|0)==(0); + L29: do { + if ($21) { + $54 = ($8|0)==(16); + $55 = ($20|0)>(0); + $56 = ($20|0)>(0); + $57 = ($20|0)>(0); + $58 = Math_imul($7, $6)|0; + $59 = ($4|0)>(0); + do { + if ($59) { + if ($54) { + if ($55) { + $i$232 = 0;$p1$131 = $18; + } else { + break; + } + while(1) { + $62 = (_stbi__get16be($s)|0); + $63 = $62 >>> 8; + $64 = $63&255; + HEAP8[$p1$131>>0] = $64; + $65 = (($i$232) + 1)|0; + $66 = ((($p1$131)) + 4|0); + $exitcond51 = ($65|0)==($58|0); + if ($exitcond51) { + break; + } else { + $i$232 = $65;$p1$131 = $66; + } + } + } else { + if ($56) { + $i$329 = 0;$p1$228 = $18; + } else { + break; + } + while(1) { + $67 = (_stbi__get8($s)|0); + HEAP8[$p1$228>>0] = $67; + $68 = (($i$329) + 1)|0; + $69 = ((($p1$228)) + 4|0); + $exitcond50 = ($68|0)==($58|0); + if ($exitcond50) { + break; + } else { + $i$329 = $68;$p1$228 = $69; + } + } + } + } else { + if ($57) { + $i$126 = 0;$p1$025 = $18; + } else { + break L29; + } + while(1) { + HEAP8[$p1$025>>0] = 0; + $60 = (($i$126) + 1)|0; + $61 = ((($p1$025)) + 4|0); + $exitcond49 = ($60|0)==($58|0); + if ($exitcond49) { + break; + } else { + $i$126 = $60;$p1$025 = $61; + } + } + } + } while(0); + $70 = ((($18)) + 1|0); + $71 = ($4|0)>(1); + do { + if ($71) { + if ($54) { + if ($55) { + $i$232$1 = 0;$p1$131$1 = $70; + } else { + break; + } + while(1) { + $114 = (_stbi__get16be($s)|0); + $115 = $114 >>> 8; + $116 = $115&255; + HEAP8[$p1$131$1>>0] = $116; + $117 = (($i$232$1) + 1)|0; + $118 = ((($p1$131$1)) + 4|0); + $exitcond51$1 = ($117|0)==($58|0); + if ($exitcond51$1) { + break; + } else { + $i$232$1 = $117;$p1$131$1 = $118; + } + } + } else { + if ($56) { + $i$329$1 = 0;$p1$228$1 = $70; + } else { + break; + } + while(1) { + $111 = (_stbi__get8($s)|0); + HEAP8[$p1$228$1>>0] = $111; + $112 = (($i$329$1) + 1)|0; + $113 = ((($p1$228$1)) + 4|0); + $exitcond50$1 = ($112|0)==($58|0); + if ($exitcond50$1) { + break; + } else { + $i$329$1 = $112;$p1$228$1 = $113; + } + } + } + } else { + if ($57) { + $i$126$1 = 0;$p1$025$1 = $70; + } else { + break L29; + } + while(1) { + HEAP8[$p1$025$1>>0] = 0; + $109 = (($i$126$1) + 1)|0; + $110 = ((($p1$025$1)) + 4|0); + $exitcond49$1 = ($109|0)==($58|0); + if ($exitcond49$1) { + break; + } else { + $i$126$1 = $109;$p1$025$1 = $110; + } + } + } + } while(0); + $119 = ((($18)) + 2|0); + $120 = ($4|0)>(2); + do { + if ($120) { + if ($54) { + if ($55) { + $i$232$2 = 0;$p1$131$2 = $119; + } else { + break; + } + while(1) { + $126 = (_stbi__get16be($s)|0); + $127 = $126 >>> 8; + $128 = $127&255; + HEAP8[$p1$131$2>>0] = $128; + $129 = (($i$232$2) + 1)|0; + $130 = ((($p1$131$2)) + 4|0); + $exitcond51$2 = ($129|0)==($58|0); + if ($exitcond51$2) { + break; + } else { + $i$232$2 = $129;$p1$131$2 = $130; + } + } + } else { + if ($56) { + $i$329$2 = 0;$p1$228$2 = $119; + } else { + break; + } + while(1) { + $123 = (_stbi__get8($s)|0); + HEAP8[$p1$228$2>>0] = $123; + $124 = (($i$329$2) + 1)|0; + $125 = ((($p1$228$2)) + 4|0); + $exitcond50$2 = ($124|0)==($58|0); + if ($exitcond50$2) { + break; + } else { + $i$329$2 = $124;$p1$228$2 = $125; + } + } + } + } else { + if ($57) { + $i$126$2 = 0;$p1$025$2 = $119; + } else { + break L29; + } + while(1) { + HEAP8[$p1$025$2>>0] = 0; + $121 = (($i$126$2) + 1)|0; + $122 = ((($p1$025$2)) + 4|0); + $exitcond49$2 = ($121|0)==($58|0); + if ($exitcond49$2) { + break; + } else { + $i$126$2 = $121;$p1$025$2 = $122; + } + } + } + } while(0); + $131 = ((($18)) + 3|0); + $132 = ($4|0)>(3); + if (!($132)) { + if ($57) { + $i$126$3 = 0;$p1$025$3 = $131; + } else { + break; + } + while(1) { + HEAP8[$p1$025$3>>0] = -1; + $133 = (($i$126$3) + 1)|0; + $134 = ((($p1$025$3)) + 4|0); + $exitcond49$3 = ($133|0)==($58|0); + if ($exitcond49$3) { + label = 43; + break L29; + } else { + $i$126$3 = $133;$p1$025$3 = $134; + } + } + } + if ($54) { + if ($55) { + $i$232$3 = 0;$p1$131$3 = $131; + } else { + break; + } + while(1) { + $138 = (_stbi__get16be($s)|0); + $139 = $138 >>> 8; + $140 = $139&255; + HEAP8[$p1$131$3>>0] = $140; + $141 = (($i$232$3) + 1)|0; + $142 = ((($p1$131$3)) + 4|0); + $exitcond51$3 = ($141|0)==($58|0); + if ($exitcond51$3) { + label = 43; + break; + } else { + $i$232$3 = $141;$p1$131$3 = $142; + } + } + } else { + if ($56) { + $i$329$3 = 0;$p1$228$3 = $131; + } else { + break; + } + while(1) { + $135 = (_stbi__get8($s)|0); + HEAP8[$p1$228$3>>0] = $135; + $136 = (($i$329$3) + 1)|0; + $137 = ((($p1$228$3)) + 4|0); + $exitcond50$3 = ($136|0)==($58|0); + if ($exitcond50$3) { + label = 43; + break; + } else { + $i$329$3 = $136;$p1$228$3 = $137; + } + } + } + } else { + $22 = $4 << 1; + $23 = Math_imul($22, $6)|0; + _stbi__skip($s,$23); + $24 = ($20|0)>(0); + $25 = ($20|0)>(0); + $26 = Math_imul($7, $6)|0; + $channel$046 = 0; + while(1) { + $27 = (($18) + ($channel$046)|0); + $28 = ($channel$046|0)<($4|0); + if ($28) { + if ($24) { + $count$0$ph45 = 0;$p$1$ph44 = $27; + while(1) { + while(1) { + $36 = (_stbi__get8($s)|0); + $37 = ($36<<24>>24)==(-128); + if (!($37)) { + $$lcssa = $36; + break; + } + } + $38 = $$lcssa&255; + $39 = ($$lcssa<<24>>24)>(-1); + if ($39) { + $40 = (($38) + 1)|0; + $41 = $$lcssa&255; + $33 = $41 << 2; + $len$043 = $40;$p$242 = $p$1$ph44; + while(1) { + $42 = (_stbi__get8($s)|0); + HEAP8[$p$242>>0] = $42; + $43 = ((($p$242)) + 4|0); + $44 = (($len$043) + -1)|0; + $45 = ($44|0)==(0); + if ($45) { + break; + } else { + $len$043 = $44;$p$242 = $43; + } + } + $scevgep56$sum = (($33) + 4)|0; + $scevgep57 = (($p$1$ph44) + ($scevgep56$sum)|0); + $$pn = $40;$p$1$ph$be = $scevgep57; + } else { + $46 = (257 - ($38))|0; + $47 = (_stbi__get8($s)|0); + $48 = ($46|0)==(0); + if ($48) { + $$pn = 0;$p$1$ph$be = $p$1$ph44; + } else { + $49 = $$lcssa&255; + $35 = Math_imul($49, -4)|0; + $len$140 = $46;$p$339 = $p$1$ph44; + while(1) { + HEAP8[$p$339>>0] = $47; + $50 = ((($p$339)) + 4|0); + $51 = (($len$140) + -1)|0; + $52 = ($51|0)==(0); + if ($52) { + break; + } else { + $len$140 = $51;$p$339 = $50; + } + } + $scevgep$sum = (($35) + 1028)|0; + $scevgep55 = (($p$1$ph44) + ($scevgep$sum)|0); + $$pn = $46;$p$1$ph$be = $scevgep55; + } + } + $count$0$ph$be = (($$pn) + ($count$0$ph45))|0; + $34 = ($count$0$ph$be|0)<($20|0); + if ($34) { + $count$0$ph45 = $count$0$ph$be;$p$1$ph44 = $p$1$ph$be; + } else { + break; + } + } + } + } else { + if ($25) { + $29 = ($channel$046|0)==(3); + $30 = $29 << 31 >> 31; + $i$036 = 0;$p$035 = $27; + while(1) { + HEAP8[$p$035>>0] = $30; + $31 = (($i$036) + 1)|0; + $32 = ((($p$035)) + 4|0); + $exitcond54 = ($31|0)==($26|0); + if ($exitcond54) { + break; + } else { + $i$036 = $31;$p$035 = $32; + } + } + } + } + $53 = (($channel$046) + 1)|0; + $exitcond58 = ($53|0)==(4); + if ($exitcond58) { + label = 43; + break; + } else { + $channel$046 = $53; + } + } + } + } while(0); + L108: do { + if ((label|0) == 43) { + $72 = ($4|0)>(3); + $73 = ($20|0)>(0); + $or$cond = $72 & $73; + if ($or$cond) { + $74 = Math_imul($7, $6)|0; + $i$424 = 0; + while(1) { + $75 = $i$424 << 2; + $76 = (($18) + ($75)|0); + $$sum6 = $75 | 3; + $77 = (($18) + ($$sum6)|0); + $78 = HEAP8[$77>>0]|0; + switch ($78<<24>>24) { + case -1: case 0: { + break; + } + default: { + $79 = $78&255; + $80 = (+($79|0)); + $81 = $80 / 255.0; + $82 = 1.0 / $81; + $83 = 1.0 - $82; + $84 = $83 * 255.0; + $85 = HEAP8[$76>>0]|0; + $86 = $85&255; + $87 = (+($86|0)); + $88 = $82 * $87; + $89 = $84 + $88; + $90 = (~~(($89))&255); + HEAP8[$76>>0] = $90; + $$sum7 = $75 | 1; + $91 = (($18) + ($$sum7)|0); + $92 = HEAP8[$91>>0]|0; + $93 = $92&255; + $94 = (+($93|0)); + $95 = $82 * $94; + $96 = $84 + $95; + $97 = (~~(($96))&255); + HEAP8[$91>>0] = $97; + $$sum8 = $75 | 2; + $98 = (($18) + ($$sum8)|0); + $99 = HEAP8[$98>>0]|0; + $100 = $99&255; + $101 = (+($100|0)); + $102 = $82 * $101; + $103 = $84 + $102; + $104 = (~~(($103))&255); + HEAP8[$98>>0] = $104; + } + } + $105 = (($i$424) + 1)|0; + $exitcond = ($105|0)==($74|0); + if ($exitcond) { + break L108; + } else { + $i$424 = $105; + } + } + } + } + } while(0); + switch ($req_comp|0) { + case 0: case 4: { + $out$0 = $18; + break; + } + default: { + $106 = (_stbi__convert_format($18,4,$req_comp,$7,$6)|0); + $107 = ($106|0)==(0|0); + if ($107) { + $$0 = 0; + return ($$0|0); + } else { + $out$0 = $106; + } + } + } + $108 = ($comp|0)==(0|0); + if (!($108)) { + HEAP32[$comp>>2] = 4; + } + HEAP32[$y>>2] = $6; + HEAP32[$x>>2] = $7; + $$0 = $out$0; + return ($$0|0); +} +function _stbi__pic_test($s) { + $s = $s|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__pic_test_core($s)|0); + _stbi__rewind($s); + return ($0|0); +} +function _stbi__pic_load($s,$px,$py,$comp,$req_comp) { + $s = $s|0; + $px = $px|0; + $py = $py|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$02 = 0, $result$0 = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $i$02 = 0; + while(1) { + (_stbi__get8($s)|0); + $0 = (($i$02) + 1)|0; + $exitcond = ($0|0)==(92); + if ($exitcond) { + break; + } else { + $i$02 = $0; + } + } + $1 = (_stbi__get16be($s)|0); + $2 = (_stbi__get16be($s)|0); + $3 = (_stbi__at_eof($s)|0); + $4 = ($3|0)==(0); + if (!($4)) { + _stbi__err(14363); + $$0 = 0; + return ($$0|0); + } + $5 = (268435456 / ($1|0))&-1; + $6 = ($5|0)<($2|0); + if ($6) { + _stbi__err(12689); + $$0 = 0; + return ($$0|0); + } + (_stbi__get32be($s)|0); + (_stbi__get16be($s)|0); + (_stbi__get16be($s)|0); + $7 = $1 << 2; + $8 = Math_imul($7, $2)|0; + $9 = (_stbi__malloc($8)|0); + _memset(($9|0),-1,($8|0))|0; + $10 = (_stbi__pic_load_core($s,$1,$2,$comp,$9)|0); + $11 = ($10|0)==(0|0); + if ($11) { + _free($9); + $result$0 = 0; + } else { + $result$0 = $9; + } + HEAP32[$px>>2] = $1; + HEAP32[$py>>2] = $2; + $12 = ($req_comp|0)==(0); + if ($12) { + $13 = HEAP32[$comp>>2]|0; + $$01 = $13; + } else { + $$01 = $req_comp; + } + $14 = (_stbi__convert_format($result$0,4,$$01,$1,$2)|0); + $$0 = $14; + return ($$0|0); +} +function _stbi__pnm_test($s) { + $s = $s|0; + var $$0 = 0, $$off = 0, $0 = 0, $1 = 0, $2 = 0, $or$cond = 0, $switch = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = (_stbi__get8($s)|0); + $2 = ($0<<24>>24)==(80); + $$off = (($1) + -53)<<24>>24; + $switch = ($$off&255)<(2); + $or$cond = $2 & $switch; + if ($or$cond) { + $$0 = 1; + return ($$0|0); + } + _stbi__rewind($s); + $$0 = 0; + return ($$0|0); +} +function _stbi__pnm_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0; + var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($s)) + 4|0); + $1 = ((($s)) + 8|0); + $2 = (_stbi__pnm_info($s,$s,$0,$1)|0); + $3 = ($2|0)==(0); + if ($3) { + $$0 = 0; + return ($$0|0); + } + $4 = HEAP32[$s>>2]|0; + HEAP32[$x>>2] = $4; + $5 = HEAP32[$0>>2]|0; + HEAP32[$y>>2] = $5; + $6 = HEAP32[$1>>2]|0; + HEAP32[$comp>>2] = $6; + $7 = HEAP32[$1>>2]|0; + $8 = HEAP32[$s>>2]|0; + $9 = Math_imul($8, $7)|0; + $10 = HEAP32[$0>>2]|0; + $11 = Math_imul($9, $10)|0; + $12 = (_stbi__malloc($11)|0); + $13 = ($12|0)==(0|0); + if ($13) { + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + $14 = HEAP32[$1>>2]|0; + $15 = HEAP32[$s>>2]|0; + $16 = Math_imul($15, $14)|0; + $17 = HEAP32[$0>>2]|0; + $18 = Math_imul($16, $17)|0; + (_stbi__getn($s,$12,$18)|0); + $19 = ($req_comp|0)==(0); + if ($19) { + $$0 = $12; + return ($$0|0); + } + $20 = HEAP32[$1>>2]|0; + $21 = ($20|0)==($req_comp|0); + if ($21) { + $$0 = $12; + return ($$0|0); + } else { + $22 = HEAP32[$s>>2]|0; + $23 = HEAP32[$0>>2]|0; + $24 = (_stbi__convert_format($12,$20,$req_comp,$22,$23)|0); + return ($24|0); + } + return (0)|0; +} +function _stbi__tga_test($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $res$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + (_stbi__get8($s)|0); + $0 = (_stbi__get8($s)|0); + $1 = ($0&255)>(1); + L1: do { + if ($1) { + $res$0 = 0; + } else { + $2 = (_stbi__get8($s)|0); + $3 = ($0<<24>>24)==(1); + if ($3) { + switch ($2<<24>>24) { + case 1: case 9: { + break; + } + default: { + $res$0 = 0; + break L1; + } + } + _stbi__skip($s,4); + $4 = (_stbi__get8($s)|0); + switch ($4<<24>>24) { + case 8: case 15: case 16: case 24: case 32: { + break; + } + default: { + $res$0 = 0; + break L1; + } + } + _stbi__skip($s,4); + } else { + switch ($2<<24>>24) { + case 2: case 3: case 10: case 11: { + break; + } + default: { + $res$0 = 0; + break L1; + } + } + _stbi__skip($s,9); + } + $5 = (_stbi__get16le($s)|0); + $6 = ($5|0)<(1); + if ($6) { + $res$0 = 0; + } else { + $7 = (_stbi__get16le($s)|0); + $8 = ($7|0)<(1); + if ($8) { + $res$0 = 0; + } else { + $9 = (_stbi__get8($s)|0); + if ($3) { + switch ($9<<24>>24) { + case 8: case 16: { + break; + } + default: { + $res$0 = 0; + break L1; + } + } + } else { + switch ($9<<24>>24) { + case 8: case 15: case 16: case 24: case 32: { + break; + } + default: { + $res$0 = 0; + break L1; + } + } + } + $res$0 = 1; + } + } + } + } while(0); + _stbi__rewind($s); + return ($res$0|0); +} +function _stbi__tga_load($s,$x,$y,$comp,$req_comp) { + $s = $s|0; + $x = $x|0; + $y = $y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$ = 0, $$0 = 0, $$6 = 0, $$7 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; + var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; + var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; + var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; + var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; + var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; + var $97 = 0, $98 = 0, $99 = 0, $RLE_count$039 = 0, $RLE_count$18 = 0, $RLE_count$19 = 0, $RLE_repeating$040 = 0, $RLE_repeating$110 = 0, $RLE_repeating$111 = 0, $exitcond = 0, $exitcond50 = 0, $exitcond55 = 0, $exitcond56 = 0, $i$048 = 0, $i$145 = 0, $i$238 = 0, $i$323 = 0, $i$421 = 0, $index1$024 = 0, $index2$025 = 0; + var $j$129 = 0, $j$327 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond5$not = 0, $or$cond57 = 0, $or$cond59 = 0, $pal_entry$046 = 0, $raw_data = 0, $read_next_pixel$041 = 0, $scevgep = 0, $scevgep54 = 0, $tga_comp$0 = 0, $tga_palette$0 = 0, $tga_pixel$022 = 0, $tga_rgb16 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $tga_rgb16 = sp; + $raw_data = sp + 4|0; + $0 = (_stbi__get8($s)|0); + $1 = $0&255; + $2 = (_stbi__get8($s)|0); + $3 = (_stbi__get8($s)|0); + $4 = $3&255; + $5 = (_stbi__get16le($s)|0); + $6 = (_stbi__get16le($s)|0); + $7 = (_stbi__get8($s)|0); + (_stbi__get16le($s)|0); + (_stbi__get16le($s)|0); + $8 = (_stbi__get16le($s)|0); + $9 = (_stbi__get16le($s)|0); + $10 = (_stbi__get8($s)|0); + HEAP32[$tga_rgb16>>2] = 0; + $11 = (_stbi__get8($s)|0); + $12 = $11&255; + $13 = ($3&255)>(7); + $$6 = $13&1; + $14 = $12 >>> 5; + $15 = $14 & 1; + $16 = ($2<<24>>24)!=(0); + if ($16) { + $17 = $7&255; + $18 = (_stbi__tga_get_comp($17,0,$tga_rgb16)|0); + $tga_comp$0 = $18; + } else { + $19 = (($4) + -8)|0; + $$7 = $13 ? $19 : $4; + $20 = $10&255; + $21 = ($$7|0)==(3); + $22 = $21&1; + $23 = (_stbi__tga_get_comp($20,$22,$tga_rgb16)|0); + $tga_comp$0 = $23; + } + $24 = ($tga_comp$0|0)==(0); + if ($24) { + _stbi__err(14250); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + HEAP32[$x>>2] = $8; + HEAP32[$y>>2] = $9; + $25 = ($comp|0)==(0|0); + if (!($25)) { + HEAP32[$comp>>2] = $tga_comp$0; + } + $26 = Math_imul($9, $8)|0; + $27 = Math_imul($26, $tga_comp$0)|0; + $28 = (_stbi__malloc($27)|0); + $29 = ($28|0)==(0|0); + if ($29) { + _stbi__err(12905); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + _stbi__skip($s,$1); + $30 = HEAP32[$tga_rgb16>>2]|0; + $31 = $30 | $$6; + $32 = ($31|0)!=(0); + $33 = $16 | $32; + if ($33) { + do { + if ($16) { + _stbi__skip($s,$5); + $44 = Math_imul($tga_comp$0, $6)|0; + $45 = (_stbi__malloc($44)|0); + $46 = ($45|0)==(0|0); + if ($46) { + _free($28); + _stbi__err(12905); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $47 = HEAP32[$tga_rgb16>>2]|0; + $48 = ($47|0)==(0); + if ($48) { + $53 = (_stbi__getn($s,$45,$44)|0); + $54 = ($53|0)==(0); + if (!($54)) { + $tga_palette$0 = $45; + break; + } + _free($28); + _free($45); + _stbi__err(14297); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + $49 = ($tga_comp$0|0)==(3); + if (!($49)) { + ___assert_fail((14261|0),(12975|0),5180,(14282|0)); + // unreachable; + } + $50 = ($6|0)>(0); + if ($50) { + $i$145 = 0;$pal_entry$046 = $45; + while(1) { + _stbi__tga_read_rgb16($s,$pal_entry$046); + $51 = (($pal_entry$046) + ($tga_comp$0)|0); + $52 = (($i$145) + 1)|0; + $exitcond55 = ($52|0)==($6|0); + if ($exitcond55) { + $tga_palette$0 = $45; + break; + } else { + $i$145 = $52;$pal_entry$046 = $51; + } + } + } else { + $tga_palette$0 = $45; + } + } else { + $tga_palette$0 = 0; + } + } while(0); + $55 = Math_imul($9, $8)|0; + $56 = ($55|0)>(0); + L35: do { + if ($56) { + $57 = ($10<<24>>24)==(8); + $58 = ($tga_comp$0|0)>(0); + $59 = ($tga_comp$0|0)==(3); + $60 = ($tga_comp$0|0)>(0); + $61 = ($tga_comp$0|0)>(0); + $RLE_count$039 = 0;$RLE_repeating$040 = 0;$i$238 = 0;$read_next_pixel$041 = 1; + L37: while(1) { + $62 = Math_imul($tga_comp$0, $i$238)|0; + $scevgep54 = (($28) + ($62)|0); + do { + if ($13) { + $63 = ($RLE_count$039|0)==(0); + if ($63) { + $64 = (_stbi__get8($s)|0); + $65 = $64&255; + $66 = $65 & 127; + $67 = (($66) + 1)|0; + $68 = $65 >>> 7; + $RLE_count$18 = $67;$RLE_repeating$110 = $68; + label = 31; + break; + } + $69 = ($RLE_repeating$040|0)==(0); + if ($69) { + $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = 0; + label = 31; + } else { + $70 = ($read_next_pixel$041|0)==(0); + if ($70) { + $RLE_count$19 = $RLE_count$039;$RLE_repeating$111 = $RLE_repeating$040; + } else { + $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040; + label = 31; + } + } + } else { + $RLE_count$18 = $RLE_count$039;$RLE_repeating$110 = $RLE_repeating$040; + label = 31; + } + } while(0); + do { + if ((label|0) == 31) { + label = 0; + if ($16) { + if ($57) { + $71 = (_stbi__get8($s)|0); + $72 = $71&255; + $79 = $72; + } else { + $73 = (_stbi__get16le($s)|0); + $79 = $73; + } + if (!($58)) { + $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; + break; + } + $80 = ($79|0)>=($6|0); + $$ = $80 ? 0 : $79; + $81 = Math_imul($tga_comp$0, $$)|0; + $scevgep = (($tga_palette$0) + ($81)|0); + _memcpy(($raw_data|0),($scevgep|0),($tga_comp$0|0))|0; + $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; + break; + } else { + $74 = HEAP32[$tga_rgb16>>2]|0; + $75 = ($74|0)==(0); + if ($75) { + if ($60) { + $j$129 = 0; + } else { + $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; + break; + } + while(1) { + $76 = (_stbi__get8($s)|0); + $77 = (($raw_data) + ($j$129)|0); + HEAP8[$77>>0] = $76; + $78 = (($j$129) + 1)|0; + $exitcond50 = ($78|0)==($tga_comp$0|0); + if ($exitcond50) { + $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; + break; + } else { + $j$129 = $78; + } + } + } else { + if (!($59)) { + break L37; + } + _stbi__tga_read_rgb16($s,$raw_data); + $RLE_count$19 = $RLE_count$18;$RLE_repeating$111 = $RLE_repeating$110; + break; + } + } + } + } while(0); + if ($61) { + _memcpy(($scevgep54|0),($raw_data|0),($tga_comp$0|0))|0; + } + $82 = (($RLE_count$19) + -1)|0; + $83 = (($i$238) + 1)|0; + $84 = ($83|0)<($55|0); + if ($84) { + $RLE_count$039 = $82;$RLE_repeating$040 = $RLE_repeating$111;$i$238 = $83;$read_next_pixel$041 = 0; + } else { + break L35; + } + } + ___assert_fail((14261|0),(12975|0),5229,(14282|0)); + // unreachable; + } + } while(0); + $85 = ($15|0)==(0); + $86 = ($9|0)>(0); + $or$cond57 = $85 & $86; + if ($or$cond57) { + $87 = Math_imul($tga_comp$0, $8)|0; + $88 = (($9) + -1)|0; + $89 = Math_imul($tga_comp$0, $8)|0; + $90 = Math_imul($tga_comp$0, $8)|0; + $91 = ($90|0)>(0); + $j$327 = 0; + while(1) { + if ($91) { + $92 = (($88) - ($j$327))|0; + $93 = Math_imul($89, $92)|0; + $94 = Math_imul($87, $j$327)|0; + $i$323 = $90;$index1$024 = $94;$index2$025 = $93; + while(1) { + $95 = (($28) + ($index1$024)|0); + $96 = HEAP8[$95>>0]|0; + $97 = (($28) + ($index2$025)|0); + $98 = HEAP8[$97>>0]|0; + HEAP8[$95>>0] = $98; + HEAP8[$97>>0] = $96; + $99 = (($index1$024) + 1)|0; + $100 = (($index2$025) + 1)|0; + $101 = (($i$323) + -1)|0; + $102 = ($i$323|0)>(1); + if ($102) { + $i$323 = $101;$index1$024 = $99;$index2$025 = $100; + } else { + break; + } + } + } + $103 = (($j$327) + 1)|0; + $104 = $103 << 1; + $105 = ($104|0)<($9|0); + if ($105) { + $j$327 = $103; + } else { + break; + } + } + } + $106 = ($tga_palette$0|0)==(0|0); + if (!($106)) { + _free($tga_palette$0); + } + } else { + $34 = ($9|0)>(0); + if ($34) { + $35 = ($15|0)==(0); + $36 = (($9) + -1)|0; + $37 = Math_imul($tga_comp$0, $8)|0; + $38 = Math_imul($tga_comp$0, $8)|0; + $i$048 = 0; + while(1) { + $39 = (($36) - ($i$048))|0; + $40 = $35 ? $39 : $i$048; + $41 = Math_imul($37, $40)|0; + $42 = (($28) + ($41)|0); + (_stbi__getn($s,$42,$38)|0); + $43 = (($i$048) + 1)|0; + $exitcond56 = ($43|0)==($9|0); + if ($exitcond56) { + break; + } else { + $i$048 = $43; + } + } + } + } + $107 = HEAP32[$tga_rgb16>>2]|0; + $notlhs = ($tga_comp$0|0)>(2); + $notrhs = ($107|0)==(0); + $or$cond5$not = $notrhs & $notlhs; + $108 = Math_imul($9, $8)|0; + $109 = ($108|0)>(0); + $or$cond59 = $or$cond5$not & $109; + if ($or$cond59) { + $110 = Math_imul($9, $8)|0; + $i$421 = 0;$tga_pixel$022 = $28; + while(1) { + $111 = HEAP8[$tga_pixel$022>>0]|0; + $112 = ((($tga_pixel$022)) + 2|0); + $113 = HEAP8[$112>>0]|0; + HEAP8[$tga_pixel$022>>0] = $113; + HEAP8[$112>>0] = $111; + $114 = (($tga_pixel$022) + ($tga_comp$0)|0); + $115 = (($i$421) + 1)|0; + $exitcond = ($115|0)==($110|0); + if ($exitcond) { + break; + } else { + $i$421 = $115;$tga_pixel$022 = $114; + } + } + } + $116 = ($req_comp|0)==(0); + $117 = ($tga_comp$0|0)==($req_comp|0); + $or$cond = $116 | $117; + if ($or$cond) { + $$0 = $28; + STACKTOP = sp;return ($$0|0); + } + $118 = (_stbi__convert_format($28,$tga_comp$0,$req_comp,$8,$9)|0); + $$0 = $118; + STACKTOP = sp;return ($$0|0); +} +function _stbi__convert_format($data,$img_n,$req_comp,$x,$y) { + $data = $data|0; + $img_n = $img_n|0; + $req_comp = $req_comp|0; + $x = $x|0; + $y = $y|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0; + var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0; + var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0; + var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0; + var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0; + var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0; + var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $dest$081 = 0; + var $dest$1031 = 0, $dest$1127 = 0, $dest$176 = 0, $dest$271 = 0, $dest$366 = 0, $dest$461 = 0, $dest$556 = 0, $dest$651 = 0, $dest$746 = 0, $dest$841 = 0, $dest$936 = 0, $i$0 = 0, $i$079 = 0, $i$082 = 0, $i$1 = 0, $i$10 = 0, $i$1029 = 0, $i$1032 = 0, $i$11 = 0, $i$1125 = 0; + var $i$1128 = 0, $i$174 = 0, $i$177 = 0, $i$2 = 0, $i$269 = 0, $i$272 = 0, $i$3 = 0, $i$364 = 0, $i$367 = 0, $i$4 = 0, $i$459 = 0, $i$462 = 0, $i$5 = 0, $i$554 = 0, $i$557 = 0, $i$6 = 0, $i$649 = 0, $i$652 = 0, $i$7 = 0, $i$744 = 0; + var $i$747 = 0, $i$8 = 0, $i$839 = 0, $i$842 = 0, $i$9 = 0, $i$934 = 0, $i$937 = 0, $j$084 = 0, $req_comp$off = 0, $src$080 = 0, $src$1030 = 0, $src$1126 = 0, $src$175 = 0, $src$270 = 0, $src$365 = 0, $src$460 = 0, $src$555 = 0, $src$650 = 0, $src$745 = 0, $src$840 = 0; + var $src$935 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($req_comp|0)==($img_n|0); + if ($0) { + $$0 = $data; + return ($$0|0); + } + $req_comp$off = (($req_comp) + -1)|0; + $1 = ($req_comp$off>>>0)<(4); + if (!($1)) { + ___assert_fail((14309|0),(12975|0),1355,(14340|0)); + // unreachable; + } + $2 = Math_imul($x, $req_comp)|0; + $3 = Math_imul($2, $y)|0; + $4 = (_stbi__malloc($3)|0); + $5 = ($4|0)==(0|0); + if ($5) { + _free($data); + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + $6 = ($y|0)>(0); + L11: do { + if ($6) { + $7 = $img_n << 3; + $8 = (($7) + ($req_comp))|0; + $i$079 = (($x) + -1)|0; + $9 = ($i$079|0)>(-1); + $i$174 = (($x) + -1)|0; + $10 = ($i$174|0)>(-1); + $i$269 = (($x) + -1)|0; + $11 = ($i$269|0)>(-1); + $i$364 = (($x) + -1)|0; + $12 = ($i$364|0)>(-1); + $i$459 = (($x) + -1)|0; + $13 = ($i$459|0)>(-1); + $i$554 = (($x) + -1)|0; + $14 = ($i$554|0)>(-1); + $i$649 = (($x) + -1)|0; + $15 = ($i$649|0)>(-1); + $i$744 = (($x) + -1)|0; + $16 = ($i$744|0)>(-1); + $i$839 = (($x) + -1)|0; + $17 = ($i$839|0)>(-1); + $i$934 = (($x) + -1)|0; + $18 = ($i$934|0)>(-1); + $i$1029 = (($x) + -1)|0; + $19 = ($i$1029|0)>(-1); + $i$1125 = (($x) + -1)|0; + $20 = ($i$1125|0)>(-1); + $j$084 = 0; + L13: while(1) { + $21 = Math_imul($j$084, $x)|0; + $22 = Math_imul($21, $img_n)|0; + $23 = (($data) + ($22)|0); + $24 = Math_imul($21, $req_comp)|0; + $25 = (($4) + ($24)|0); + do { + switch ($8|0) { + case 10: { + if ($9) { + $dest$081 = $25;$i$082 = $i$079;$src$080 = $23; + while(1) { + $26 = HEAP8[$src$080>>0]|0; + HEAP8[$dest$081>>0] = $26; + $27 = ((($dest$081)) + 1|0); + HEAP8[$27>>0] = -1; + $28 = ((($src$080)) + 1|0); + $29 = ((($dest$081)) + 2|0); + $i$0 = (($i$082) + -1)|0; + $30 = ($i$0|0)>(-1); + if ($30) { + $dest$081 = $29;$i$082 = $i$0;$src$080 = $28; + } else { + break; + } + } + } + break; + } + case 11: { + if ($10) { + $dest$176 = $25;$i$177 = $i$174;$src$175 = $23; + while(1) { + $31 = HEAP8[$src$175>>0]|0; + $32 = ((($dest$176)) + 2|0); + HEAP8[$32>>0] = $31; + $33 = ((($dest$176)) + 1|0); + HEAP8[$33>>0] = $31; + HEAP8[$dest$176>>0] = $31; + $34 = ((($src$175)) + 1|0); + $35 = ((($dest$176)) + 3|0); + $i$1 = (($i$177) + -1)|0; + $36 = ($i$1|0)>(-1); + if ($36) { + $dest$176 = $35;$i$177 = $i$1;$src$175 = $34; + } else { + break; + } + } + } + break; + } + case 12: { + if ($11) { + $dest$271 = $25;$i$272 = $i$269;$src$270 = $23; + while(1) { + $37 = HEAP8[$src$270>>0]|0; + $38 = ((($dest$271)) + 2|0); + HEAP8[$38>>0] = $37; + $39 = ((($dest$271)) + 1|0); + HEAP8[$39>>0] = $37; + HEAP8[$dest$271>>0] = $37; + $40 = ((($dest$271)) + 3|0); + HEAP8[$40>>0] = -1; + $41 = ((($src$270)) + 1|0); + $42 = ((($dest$271)) + 4|0); + $i$2 = (($i$272) + -1)|0; + $43 = ($i$2|0)>(-1); + if ($43) { + $dest$271 = $42;$i$272 = $i$2;$src$270 = $41; + } else { + break; + } + } + } + break; + } + case 17: { + if ($12) { + $dest$366 = $25;$i$367 = $i$364;$src$365 = $23; + while(1) { + $44 = HEAP8[$src$365>>0]|0; + HEAP8[$dest$366>>0] = $44; + $45 = ((($src$365)) + 2|0); + $46 = ((($dest$366)) + 1|0); + $i$3 = (($i$367) + -1)|0; + $47 = ($i$3|0)>(-1); + if ($47) { + $dest$366 = $46;$i$367 = $i$3;$src$365 = $45; + } else { + break; + } + } + } + break; + } + case 19: { + if ($13) { + $dest$461 = $25;$i$462 = $i$459;$src$460 = $23; + while(1) { + $48 = HEAP8[$src$460>>0]|0; + $49 = ((($dest$461)) + 2|0); + HEAP8[$49>>0] = $48; + $50 = ((($dest$461)) + 1|0); + HEAP8[$50>>0] = $48; + HEAP8[$dest$461>>0] = $48; + $51 = ((($src$460)) + 2|0); + $52 = ((($dest$461)) + 3|0); + $i$4 = (($i$462) + -1)|0; + $53 = ($i$4|0)>(-1); + if ($53) { + $dest$461 = $52;$i$462 = $i$4;$src$460 = $51; + } else { + break; + } + } + } + break; + } + case 20: { + if ($14) { + $dest$556 = $25;$i$557 = $i$554;$src$555 = $23; + while(1) { + $54 = HEAP8[$src$555>>0]|0; + $55 = ((($dest$556)) + 2|0); + HEAP8[$55>>0] = $54; + $56 = ((($dest$556)) + 1|0); + HEAP8[$56>>0] = $54; + HEAP8[$dest$556>>0] = $54; + $57 = ((($src$555)) + 1|0); + $58 = HEAP8[$57>>0]|0; + $59 = ((($dest$556)) + 3|0); + HEAP8[$59>>0] = $58; + $60 = ((($src$555)) + 2|0); + $61 = ((($dest$556)) + 4|0); + $i$5 = (($i$557) + -1)|0; + $62 = ($i$5|0)>(-1); + if ($62) { + $dest$556 = $61;$i$557 = $i$5;$src$555 = $60; + } else { + break; + } + } + } + break; + } + case 28: { + if ($15) { + $dest$651 = $25;$i$652 = $i$649;$src$650 = $23; + while(1) { + $63 = HEAP8[$src$650>>0]|0; + HEAP8[$dest$651>>0] = $63; + $64 = ((($src$650)) + 1|0); + $65 = HEAP8[$64>>0]|0; + $66 = ((($dest$651)) + 1|0); + HEAP8[$66>>0] = $65; + $67 = ((($src$650)) + 2|0); + $68 = HEAP8[$67>>0]|0; + $69 = ((($dest$651)) + 2|0); + HEAP8[$69>>0] = $68; + $70 = ((($dest$651)) + 3|0); + HEAP8[$70>>0] = -1; + $71 = ((($src$650)) + 3|0); + $72 = ((($dest$651)) + 4|0); + $i$6 = (($i$652) + -1)|0; + $73 = ($i$6|0)>(-1); + if ($73) { + $dest$651 = $72;$i$652 = $i$6;$src$650 = $71; + } else { + break; + } + } + } + break; + } + case 25: { + if ($16) { + $dest$746 = $25;$i$747 = $i$744;$src$745 = $23; + while(1) { + $74 = HEAP8[$src$745>>0]|0; + $75 = $74&255; + $76 = ((($src$745)) + 1|0); + $77 = HEAP8[$76>>0]|0; + $78 = $77&255; + $79 = ((($src$745)) + 2|0); + $80 = HEAP8[$79>>0]|0; + $81 = $80&255; + $82 = (_stbi__compute_y($75,$78,$81)|0); + HEAP8[$dest$746>>0] = $82; + $83 = ((($src$745)) + 3|0); + $84 = ((($dest$746)) + 1|0); + $i$7 = (($i$747) + -1)|0; + $85 = ($i$7|0)>(-1); + if ($85) { + $dest$746 = $84;$i$747 = $i$7;$src$745 = $83; + } else { + break; + } + } + } + break; + } + case 26: { + if ($17) { + $dest$841 = $25;$i$842 = $i$839;$src$840 = $23; + while(1) { + $86 = HEAP8[$src$840>>0]|0; + $87 = $86&255; + $88 = ((($src$840)) + 1|0); + $89 = HEAP8[$88>>0]|0; + $90 = $89&255; + $91 = ((($src$840)) + 2|0); + $92 = HEAP8[$91>>0]|0; + $93 = $92&255; + $94 = (_stbi__compute_y($87,$90,$93)|0); + HEAP8[$dest$841>>0] = $94; + $95 = ((($dest$841)) + 1|0); + HEAP8[$95>>0] = -1; + $96 = ((($src$840)) + 3|0); + $97 = ((($dest$841)) + 2|0); + $i$8 = (($i$842) + -1)|0; + $98 = ($i$8|0)>(-1); + if ($98) { + $dest$841 = $97;$i$842 = $i$8;$src$840 = $96; + } else { + break; + } + } + } + break; + } + case 33: { + if ($18) { + $dest$936 = $25;$i$937 = $i$934;$src$935 = $23; + while(1) { + $99 = HEAP8[$src$935>>0]|0; + $100 = $99&255; + $101 = ((($src$935)) + 1|0); + $102 = HEAP8[$101>>0]|0; + $103 = $102&255; + $104 = ((($src$935)) + 2|0); + $105 = HEAP8[$104>>0]|0; + $106 = $105&255; + $107 = (_stbi__compute_y($100,$103,$106)|0); + HEAP8[$dest$936>>0] = $107; + $108 = ((($src$935)) + 4|0); + $109 = ((($dest$936)) + 1|0); + $i$9 = (($i$937) + -1)|0; + $110 = ($i$9|0)>(-1); + if ($110) { + $dest$936 = $109;$i$937 = $i$9;$src$935 = $108; + } else { + break; + } + } + } + break; + } + case 34: { + if ($19) { + $dest$1031 = $25;$i$1032 = $i$1029;$src$1030 = $23; + while(1) { + $111 = HEAP8[$src$1030>>0]|0; + $112 = $111&255; + $113 = ((($src$1030)) + 1|0); + $114 = HEAP8[$113>>0]|0; + $115 = $114&255; + $116 = ((($src$1030)) + 2|0); + $117 = HEAP8[$116>>0]|0; + $118 = $117&255; + $119 = (_stbi__compute_y($112,$115,$118)|0); + HEAP8[$dest$1031>>0] = $119; + $120 = ((($src$1030)) + 3|0); + $121 = HEAP8[$120>>0]|0; + $122 = ((($dest$1031)) + 1|0); + HEAP8[$122>>0] = $121; + $123 = ((($src$1030)) + 4|0); + $124 = ((($dest$1031)) + 2|0); + $i$10 = (($i$1032) + -1)|0; + $125 = ($i$10|0)>(-1); + if ($125) { + $dest$1031 = $124;$i$1032 = $i$10;$src$1030 = $123; + } else { + break; + } + } + } + break; + } + case 35: { + if ($20) { + $dest$1127 = $25;$i$1128 = $i$1125;$src$1126 = $23; + while(1) { + $126 = HEAP8[$src$1126>>0]|0; + HEAP8[$dest$1127>>0] = $126; + $127 = ((($src$1126)) + 1|0); + $128 = HEAP8[$127>>0]|0; + $129 = ((($dest$1127)) + 1|0); + HEAP8[$129>>0] = $128; + $130 = ((($src$1126)) + 2|0); + $131 = HEAP8[$130>>0]|0; + $132 = ((($dest$1127)) + 2|0); + HEAP8[$132>>0] = $131; + $133 = ((($src$1126)) + 4|0); + $134 = ((($dest$1127)) + 3|0); + $i$11 = (($i$1128) + -1)|0; + $135 = ($i$11|0)>(-1); + if ($135) { + $dest$1127 = $134;$i$1128 = $i$11;$src$1126 = $133; + } else { + break; + } + } + } + break; + } + default: { + break L13; + } + } + } while(0); + $136 = (($j$084) + 1)|0; + $137 = ($136|0)<($y|0); + if ($137) { + $j$084 = $136; + } else { + break L11; + } + } + ___assert_fail((14361|0),(12975|0),1384,(14340|0)); + // unreachable; + } + } while(0); + _free($data); + $$0 = $4; + return ($$0|0); +} +function _stbi__compute_y($r,$g,$b) { + $r = $r|0; + $g = $g|0; + $b = $b|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($r*77)|0; + $1 = ($g*150)|0; + $2 = (($1) + ($0))|0; + $3 = ($b*29)|0; + $4 = (($2) + ($3))|0; + $5 = $4 >>> 8; + $6 = $5&255; + return ($6|0); +} +function _stbi__pic_load_core($s,$width,$height,$comp,$result) { + $s = $s|0; + $width = $width|0; + $height = $height|0; + $comp = $comp|0; + $result = $result|0; + var $$ = 0, $$0 = 0, $$lcssa108 = 0, $$lcssa111 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; + var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; + var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0; + var $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0; + var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $act_comp$0 = 0; + var $count3$0 = 0, $count3$1 = 0, $dest$038 = 0, $dest$135 = 0, $dest$2$lcssa = 0, $dest$230 = 0, $dest$327 = 0, $dest$425 = 0, $dest$523 = 0, $dest$6 = 0, $exitcond = 0, $exitcond57 = 0, $i$031 = 0, $i4$026 = 0, $i4$124 = 0, $left$036 = 0, $left2$028 = 0, $num_packets$0 = 0, $num_packets$0$lcssa105 = 0, $packet_idx$041 = 0; + var $packets = 0, $scevgep = 0, $scevgep56 = 0, $value = 0, $value5 = 0, $x$039 = 0, $y$044 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 48|0; + $packets = sp + 8|0; + $value = sp + 4|0; + $value5 = sp; + $act_comp$0 = 0;$num_packets$0 = 0; + while(1) { + $0 = ($num_packets$0|0)==(10); + if ($0) { + label = 3; + break; + } + $1 = (($num_packets$0) + 1)|0; + $2 = (_stbi__get8($s)|0); + $3 = (_stbi__get8($s)|0); + $4 = (($packets) + (($num_packets$0*3)|0)|0); + HEAP8[$4>>0] = $3; + $5 = (_stbi__get8($s)|0); + $6 = (((($packets) + (($num_packets$0*3)|0)|0)) + 1|0); + HEAP8[$6>>0] = $5; + $7 = (_stbi__get8($s)|0); + $8 = (((($packets) + (($num_packets$0*3)|0)|0)) + 2|0); + HEAP8[$8>>0] = $7; + $9 = $7&255; + $10 = $9 | $act_comp$0; + $11 = (_stbi__at_eof($s)|0); + $12 = ($11|0)==(0); + if (!($12)) { + label = 5; + break; + } + $13 = HEAP8[$4>>0]|0; + $14 = ($13<<24>>24)==(8); + if (!($14)) { + label = 7; + break; + } + $15 = ($2<<24>>24)==(0); + if ($15) { + $$lcssa108 = $1;$$lcssa111 = $10;$num_packets$0$lcssa105 = $num_packets$0; + label = 9; + break; + } else { + $act_comp$0 = $10;$num_packets$0 = $1; + } + } + if ((label|0) == 3) { + _stbi__err(14250); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 5) { + _stbi__err(14363); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 7) { + _stbi__err(14250); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 9) { + $16 = $$lcssa111 >>> 4; + $17 = $16 & 1; + $18 = (($17) + 3)|0; + HEAP32[$comp>>2] = $18; + $19 = ($height|0)>(0); + if (!($19)) { + $$0 = $result; + STACKTOP = sp;return ($$0|0); + } + $20 = ($num_packets$0$lcssa105|0)>(-1); + $21 = $width << 2; + $22 = ($width|0)>(0); + $23 = ($width|0)>(0); + $24 = ($width|0)>(0); + $y$044 = 0; + L13: while(1) { + L15: do { + if ($20) { + $25 = Math_imul($21, $y$044)|0; + $26 = (($result) + ($25)|0); + $packet_idx$041 = 0; + while(1) { + $27 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 1|0); + $28 = HEAP8[$27>>0]|0; + $29 = $28&255; + switch ($29|0) { + case 0: { + if ($22) { + $33 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); + $34 = HEAP8[$33>>0]|0; + $35 = $34&255; + $dest$038 = $26;$x$039 = 0; + while(1) { + $36 = (_stbi__readval($s,$35,$dest$038)|0); + $37 = ($36|0)==(0|0); + if ($37) { + $$0 = 0; + label = 52; + break L13; + } + $38 = (($x$039) + 1)|0; + $39 = ((($dest$038)) + 4|0); + $40 = ($38|0)<($width|0); + if ($40) { + $dest$038 = $39;$x$039 = $38; + } else { + break; + } + } + } + break; + } + case 1: { + if ($23) { + $32 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); + $dest$135 = $26;$left$036 = $width; + while(1) { + $41 = (_stbi__get8($s)|0); + $42 = (_stbi__at_eof($s)|0); + $43 = ($42|0)==(0); + if (!($43)) { + label = 24; + break L13; + } + $44 = HEAP8[$32>>0]|0; + $45 = $44&255; + $46 = (_stbi__readval($s,$45,$value)|0); + $47 = ($46|0)==(0|0); + if ($47) { + $$0 = 0; + label = 52; + break L13; + } + $48 = $41&255; + $49 = ($48|0)>($left$036|0); + $50 = $left$036&255; + $$ = $49 ? $50 : $41; + $51 = $$&255; + $52 = ($$<<24>>24)==(0); + if ($52) { + $dest$2$lcssa = $dest$135; + } else { + $53 = $$&255; + $54 = $53 << 2; + $dest$230 = $dest$135;$i$031 = 0; + while(1) { + $55 = HEAP8[$32>>0]|0; + $56 = $55&255; + _stbi__copyval($56,$dest$230,$value); + $57 = (($i$031) + 1)|0; + $58 = ((($dest$230)) + 4|0); + $exitcond57 = ($57|0)==($53|0); + if ($exitcond57) { + break; + } else { + $dest$230 = $58;$i$031 = $57; + } + } + $scevgep56 = (($dest$135) + ($54)|0); + $dest$2$lcssa = $scevgep56; + } + $59 = (($left$036) - ($51))|0; + $60 = ($59|0)>(0); + if ($60) { + $dest$135 = $dest$2$lcssa;$left$036 = $59; + } else { + break; + } + } + } + break; + } + case 2: { + if ($24) { + $30 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); + $31 = (((($packets) + (($packet_idx$041*3)|0)|0)) + 2|0); + $dest$327 = $26;$left2$028 = $width; + while(1) { + $61 = (_stbi__get8($s)|0); + $62 = $61&255; + $63 = (_stbi__at_eof($s)|0); + $64 = ($63|0)==(0); + if (!($64)) { + label = 32; + break L13; + } + $65 = ($61<<24>>24)<(0); + if ($65) { + $66 = ($61<<24>>24)==(-128); + if ($66) { + $67 = (_stbi__get16be($s)|0); + $count3$0 = $67; + } else { + $68 = (($62) + -127)|0; + $count3$0 = $68; + } + $69 = ($count3$0|0)>($left2$028|0); + if ($69) { + label = 38; + break L13; + } + $70 = HEAP8[$30>>0]|0; + $71 = $70&255; + $72 = (_stbi__readval($s,$71,$value5)|0); + $73 = ($72|0)==(0|0); + if ($73) { + $$0 = 0; + label = 52; + break L13; + } + $74 = ($count3$0|0)>(0); + if ($74) { + $75 = $count3$0 << 2; + $dest$425 = $dest$327;$i4$026 = 0; + while(1) { + $76 = HEAP8[$30>>0]|0; + $77 = $76&255; + _stbi__copyval($77,$dest$425,$value5); + $78 = (($i4$026) + 1)|0; + $79 = ((($dest$425)) + 4|0); + $exitcond = ($78|0)==($count3$0|0); + if ($exitcond) { + break; + } else { + $dest$425 = $79;$i4$026 = $78; + } + } + $scevgep = (($dest$327) + ($75)|0); + $count3$1 = $count3$0;$dest$6 = $scevgep; + } else { + $count3$1 = $count3$0;$dest$6 = $dest$327; + } + } else { + $80 = (($62) + 1)|0; + $81 = ($62|0)<($left2$028|0); + if (!($81)) { + label = 45; + break L13; + } + $82 = HEAP8[$31>>0]|0; + $83 = $82&255; + $dest$523 = $dest$327;$i4$124 = 0; + while(1) { + $84 = (_stbi__readval($s,$83,$dest$523)|0); + $85 = ($84|0)==(0|0); + if ($85) { + $$0 = 0; + label = 52; + break L13; + } + $86 = (($i4$124) + 1)|0; + $87 = ((($dest$523)) + 4|0); + $88 = ($86|0)<($80|0); + if ($88) { + $dest$523 = $87;$i4$124 = $86; + } else { + $count3$1 = $80;$dest$6 = $87; + break; + } + } + } + $89 = (($left2$028) - ($count3$1))|0; + $90 = ($89|0)>(0); + if ($90) { + $dest$327 = $dest$6;$left2$028 = $89; + } else { + break; + } + } + } + break; + } + default: { + label = 20; + break L13; + } + } + $91 = (($packet_idx$041) + 1)|0; + $92 = ($91|0)<($$lcssa108|0); + if ($92) { + $packet_idx$041 = $91; + } else { + break L15; + } + } + } + } while(0); + $93 = (($y$044) + 1)|0; + $94 = ($93|0)<($height|0); + if ($94) { + $y$044 = $93; + } else { + $$0 = $result; + label = 52; + break; + } + } + if ((label|0) == 20) { + _stbi__err(14250); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 24) { + _stbi__err(14363); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 32) { + _stbi__err(14363); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 38) { + _stbi__err(14363); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 45) { + _stbi__err(14363); + $$0 = 0; + STACKTOP = sp;return ($$0|0); + } + else if ((label|0) == 52) { + STACKTOP = sp;return ($$0|0); + } + } + return (0)|0; +} +function _stbi__readval($s,$channel,$dest) { + $s = $s|0; + $channel = $channel|0; + $dest = $dest|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $channel & 128; + $1 = ($0|0)==(0); + if ($1) { + label = 5; + } else { + $2 = (_stbi__at_eof($s)|0); + $3 = ($2|0)==(0); + if ($3) { + $4 = (_stbi__get8($s)|0); + HEAP8[$dest>>0] = $4; + label = 5; + } + } + do { + if ((label|0) == 5) { + $5 = $channel & 64; + $6 = ($5|0)==(0); + if (!($6)) { + $7 = (_stbi__at_eof($s)|0); + $8 = ($7|0)==(0); + if (!($8)) { + break; + } + $9 = (_stbi__get8($s)|0); + $10 = ((($dest)) + 1|0); + HEAP8[$10>>0] = $9; + } + $11 = $channel & 32; + $12 = ($11|0)==(0); + if (!($12)) { + $13 = (_stbi__at_eof($s)|0); + $14 = ($13|0)==(0); + if (!($14)) { + break; + } + $15 = (_stbi__get8($s)|0); + $16 = ((($dest)) + 2|0); + HEAP8[$16>>0] = $15; + } + $17 = $channel & 16; + $18 = ($17|0)==(0); + if ($18) { + $$0 = $dest; + return ($$0|0); + } + $19 = (_stbi__at_eof($s)|0); + $20 = ($19|0)==(0); + if ($20) { + $21 = (_stbi__get8($s)|0); + $22 = ((($dest)) + 3|0); + HEAP8[$22>>0] = $21; + $$0 = $dest; + return ($$0|0); + } + } + } while(0); + _stbi__err(14363); + $$0 = 0; + return ($$0|0); +} +function _stbi__copyval($channel,$dest,$src) { + $channel = $channel|0; + $dest = $dest|0; + $src = $src|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $channel & 128; + $1 = ($0|0)==(0); + if (!($1)) { + $2 = HEAP8[$src>>0]|0; + HEAP8[$dest>>0] = $2; + } + $3 = $channel & 64; + $4 = ($3|0)==(0); + if (!($4)) { + $5 = ((($src)) + 1|0); + $6 = HEAP8[$5>>0]|0; + $7 = ((($dest)) + 1|0); + HEAP8[$7>>0] = $6; + } + $8 = $channel & 32; + $9 = ($8|0)==(0); + if (!($9)) { + $10 = ((($src)) + 2|0); + $11 = HEAP8[$10>>0]|0; + $12 = ((($dest)) + 2|0); + HEAP8[$12>>0] = $11; + } + $13 = $channel & 16; + $14 = ($13|0)==(0); + if ($14) { + return; + } + $15 = ((($src)) + 3|0); + $16 = HEAP8[$15>>0]|0; + $17 = ((($dest)) + 3|0); + HEAP8[$17>>0] = $16; + return; +} +function _stbi__pic_test_core($s) { + $s = $s|0; + var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $exitcond = 0, $i$01 = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__pic_is4($s,12601)|0); + $1 = ($0|0)==(0); + if ($1) { + $$0 = 0; + return ($$0|0); + } else { + $i$01 = 0; + } + while(1) { + (_stbi__get8($s)|0); + $2 = (($i$01) + 1)|0; + $exitcond = ($2|0)==(84); + if ($exitcond) { + break; + } else { + $i$01 = $2; + } + } + $3 = (_stbi__pic_is4($s,14372)|0); + $not$ = ($3|0)!=(0); + $$ = $not$&1; + $$0 = $$; + return ($$0|0); +} +function _stbi__gif_load_next($s,$g,$comp) { + $s = $s|0; + $g = $g|0; + $comp = $comp|0; + var $$0 = 0, $$pr = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0; + var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; + var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0; + var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; + var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0; + var $99 = 0, $i$02 = 0, $prev_trans$0 = 0, $prev_trans$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($g)) + 8|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0|0); + do { + if ($2) { + $3 = (_stbi__gif_header($s,$g,$comp,0)|0); + $4 = ($3|0)==(0); + if ($4) { + $$0 = 0; + return ($$0|0); + } else { + $$pr = HEAP32[$0>>2]|0; + $20 = $$pr; + break; + } + } else { + $20 = $1; + } + } while(0); + $5 = HEAP32[$g>>2]|0; + $6 = $5 << 2; + $7 = ((($g)) + 4|0); + $8 = HEAP32[$7>>2]|0; + $9 = Math_imul($6, $8)|0; + $10 = (_stbi__malloc($9)|0); + HEAP32[$0>>2] = $10; + $11 = ($10|0)==(0|0); + if ($11) { + _stbi__err(12905); + $$0 = 0; + return ($$0|0); + } + $12 = ((($g)) + 32|0); + $13 = HEAP32[$12>>2]|0; + $14 = $13 >>> 2; + $15 = $14 & 7; + switch ($15|0) { + case 0: { + $16 = HEAP32[$g>>2]|0; + $17 = $16 << 2; + $18 = HEAP32[$7>>2]|0; + $19 = Math_imul($17, $18)|0; + _stbi__fill_gif_background($g,0,0,$17,$19); + break; + } + case 1: { + $21 = ($20|0)==(0|0); + if (!($21)) { + $22 = HEAP32[$g>>2]|0; + $23 = $22 << 2; + $24 = HEAP32[$7>>2]|0; + $25 = Math_imul($23, $24)|0; + _memcpy(($10|0),($20|0),($25|0))|0; + } + $26 = ((($g)) + 12|0); + HEAP32[$26>>2] = $20; + break; + } + case 2: { + $27 = ($20|0)==(0|0); + if (!($27)) { + $28 = HEAP32[$g>>2]|0; + $29 = $28 << 2; + $30 = HEAP32[$7>>2]|0; + $31 = Math_imul($29, $30)|0; + _memcpy(($10|0),($20|0),($31|0))|0; + } + $32 = ((($g)) + 18488|0); + $33 = HEAP32[$32>>2]|0; + $34 = ((($g)) + 18492|0); + $35 = HEAP32[$34>>2]|0; + $36 = ((($g)) + 18496|0); + $37 = HEAP32[$36>>2]|0; + $38 = ((($g)) + 18500|0); + $39 = HEAP32[$38>>2]|0; + _stbi__fill_gif_background($g,$33,$35,$37,$39); + break; + } + case 3: { + $40 = ((($g)) + 12|0); + $41 = HEAP32[$40>>2]|0; + $42 = ($41|0)==(0|0); + if (!($42)) { + $45 = ((($g)) + 18492|0); + $46 = HEAP32[$45>>2]|0; + $47 = ((($g)) + 18500|0); + $48 = HEAP32[$47>>2]|0; + $49 = ($46|0)<($48|0); + if ($49) { + $50 = ((($g)) + 18488|0); + $51 = ((($g)) + 18496|0); + $i$02 = $46; + while(1) { + $52 = HEAP32[$50>>2]|0; + $53 = (($52) + ($i$02))|0; + $54 = HEAP32[$0>>2]|0; + $55 = (($54) + ($53)|0); + $56 = HEAP32[$40>>2]|0; + $57 = (($56) + ($53)|0); + $58 = HEAP32[$51>>2]|0; + $59 = (($58) - ($52))|0; + _memcpy(($55|0),($57|0),($59|0))|0; + $60 = HEAP32[$g>>2]|0; + $61 = $60 << 2; + $62 = (($61) + ($i$02))|0; + $63 = HEAP32[$47>>2]|0; + $64 = ($62|0)<($63|0); + if ($64) { + $i$02 = $62; + } else { + break; + } + } + } + } + break; + } + default: { + } + } + $43 = ((($g)) + 36|0); + $44 = ((($g)) + 28|0); + L27: while(1) { + $65 = (_stbi__get8($s)|0); + $66 = $65&255; + switch ($66|0) { + case 44: { + label = 20; + break L27; + break; + } + case 59: { + label = 45; + break L27; + break; + } + case 33: { + break; + } + default: { + label = 46; + break L27; + } + } + $143 = (_stbi__get8($s)|0); + $144 = ($143<<24>>24)==(-7); + do { + if ($144) { + $147 = (_stbi__get8($s)|0); + $148 = ($147<<24>>24)==(4); + if ($148) { + $149 = (_stbi__get8($s)|0); + $150 = $149&255; + HEAP32[$12>>2] = $150; + $151 = (_stbi__get16le($s)|0); + HEAP32[$43>>2] = $151; + $152 = (_stbi__get8($s)|0); + $153 = $152&255; + HEAP32[$44>>2] = $153; + break; + } else { + $154 = $147&255; + _stbi__skip($s,$154); + continue L27; + } + } + } while(0); + $145 = (_stbi__get8($s)|0); + $146 = ($145<<24>>24)==(0); + if ($146) { + continue; + } else { + $156 = $145; + } + while(1) { + $155 = $156&255; + _stbi__skip($s,$155); + $157 = (_stbi__get8($s)|0); + $158 = ($157<<24>>24)==(0); + if ($158) { + continue L27; + } else { + $156 = $157; + } + } + } + if ((label|0) == 20) { + $67 = (_stbi__get16le($s)|0); + $68 = (_stbi__get16le($s)|0); + $69 = (_stbi__get16le($s)|0); + $70 = (_stbi__get16le($s)|0); + $71 = (($69) + ($67))|0; + $72 = HEAP32[$g>>2]|0; + $73 = ($71|0)>($72|0); + if (!($73)) { + $74 = (($70) + ($68))|0; + $75 = HEAP32[$7>>2]|0; + $76 = ($74|0)>($75|0); + if (!($76)) { + $77 = $72 << 2; + $78 = ((($g)) + 18512|0); + HEAP32[$78>>2] = $77; + $79 = $67 << 2; + $80 = ((($g)) + 18488|0); + HEAP32[$80>>2] = $79; + $81 = HEAP32[$78>>2]|0; + $82 = Math_imul($81, $68)|0; + $83 = ((($g)) + 18492|0); + HEAP32[$83>>2] = $82; + $84 = HEAP32[$80>>2]|0; + $85 = $69 << 2; + $86 = (($84) + ($85))|0; + $87 = ((($g)) + 18496|0); + HEAP32[$87>>2] = $86; + $88 = HEAP32[$83>>2]|0; + $89 = HEAP32[$78>>2]|0; + $90 = Math_imul($89, $70)|0; + $91 = (($90) + ($88))|0; + $92 = ((($g)) + 18500|0); + HEAP32[$92>>2] = $91; + $93 = HEAP32[$80>>2]|0; + $94 = ((($g)) + 18504|0); + HEAP32[$94>>2] = $93; + $95 = HEAP32[$83>>2]|0; + $96 = ((($g)) + 18508|0); + HEAP32[$96>>2] = $95; + $97 = (_stbi__get8($s)|0); + $98 = $97&255; + $99 = ((($g)) + 18484|0); + HEAP32[$99>>2] = $98; + $100 = $98 & 64; + $101 = ($100|0)==(0); + $102 = HEAP32[$78>>2]|0; + if ($101) { + $106 = ((($g)) + 18480|0); + HEAP32[$106>>2] = $102; + $107 = ((($g)) + 18476|0); + HEAP32[$107>>2] = 0; + } else { + $103 = $102 << 3; + $104 = ((($g)) + 18480|0); + HEAP32[$104>>2] = $103; + $105 = ((($g)) + 18476|0); + HEAP32[$105>>2] = 3; + } + $108 = HEAP32[$99>>2]|0; + $109 = $108 & 128; + $110 = ($109|0)==(0); + if ($110) { + $121 = ((($g)) + 16|0); + $122 = HEAP32[$121>>2]|0; + $123 = $122 & 128; + $124 = ($123|0)==(0); + if ($124) { + _stbi__err(14481); + $$0 = 0; + return ($$0|0); + } + $125 = ((($g)) + 28|0); + $126 = HEAP32[$125>>2]|0; + $127 = ($126|0)>(-1); + if ($127) { + $128 = HEAP32[$12>>2]|0; + $129 = $128 & 1; + $130 = ($129|0)==(0); + if ($130) { + $prev_trans$0 = -1; + } else { + $131 = (((((($g)) + 40|0) + ($126<<2)|0)) + 3|0); + $132 = HEAP8[$131>>0]|0; + $133 = $132&255; + HEAP8[$131>>0] = 0; + $prev_trans$0 = $133; + } + } else { + $prev_trans$0 = -1; + } + $134 = ((($g)) + 40|0); + $135 = ((($g)) + 18472|0); + HEAP32[$135>>2] = $134; + $prev_trans$1 = $prev_trans$0; + } else { + $111 = ((($g)) + 1064|0); + $112 = $108 & 7; + $113 = 2 << $112; + $114 = HEAP32[$12>>2]|0; + $115 = $114 & 1; + $116 = ($115|0)==(0); + if ($116) { + $119 = -1; + } else { + $117 = ((($g)) + 28|0); + $118 = HEAP32[$117>>2]|0; + $119 = $118; + } + _stbi__gif_parse_colortable($s,$111,$113,$119); + $120 = ((($g)) + 18472|0); + HEAP32[$120>>2] = $111; + $prev_trans$1 = -1; + } + $136 = (_stbi__process_gif_raster($s,$g)|0); + $137 = ($136|0)==(0|0); + if ($137) { + $$0 = 0; + return ($$0|0); + } + $138 = ($prev_trans$1|0)==(-1); + if ($138) { + $$0 = $136; + return ($$0|0); + } + $139 = $prev_trans$1&255; + $140 = ((($g)) + 28|0); + $141 = HEAP32[$140>>2]|0; + $142 = (((((($g)) + 40|0) + ($141<<2)|0)) + 3|0); + HEAP8[$142>>0] = $139; + $$0 = $136; + return ($$0|0); + } + } + _stbi__err(14460); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 45) { + $$0 = $s; + return ($$0|0); + } + else if ((label|0) == 46) { + _stbi__err(14501); + $$0 = 0; + return ($$0|0); + } + return (0)|0; +} +function _stbi__fill_gif_background($g,$x0,$y0,$x1,$y1) { + $g = $g|0; + $x0 = $x0|0; + $y0 = $y0|0; + $x1 = $x1|0; + $y1 = $y1|0; + var $$sum = 0, $$sum1 = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0; + var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $x$03 = 0, $y$04 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($g)) + 20|0); + $1 = HEAP32[$0>>2]|0; + $2 = (((($g)) + 40|0) + ($1<<2)|0); + $3 = ($y0|0)<($y1|0); + if (!($3)) { + return; + } + $4 = ($x0|0)<($x1|0); + $5 = ((($g)) + 8|0); + $6 = (((((($g)) + 40|0) + ($1<<2)|0)) + 2|0); + $7 = (((((($g)) + 40|0) + ($1<<2)|0)) + 1|0); + $y$04 = $y0; + while(1) { + if ($4) { + $x$03 = $x0; + while(1) { + $8 = (($x$03) + ($y$04))|0; + $9 = HEAP32[$5>>2]|0; + $10 = (($9) + ($8)|0); + $11 = HEAP8[$6>>0]|0; + HEAP8[$10>>0] = $11; + $12 = HEAP8[$7>>0]|0; + $$sum = (($8) + 1)|0; + $13 = (($9) + ($$sum)|0); + HEAP8[$13>>0] = $12; + $14 = HEAP8[$2>>0]|0; + $$sum1 = (($8) + 2)|0; + $15 = (($9) + ($$sum1)|0); + HEAP8[$15>>0] = $14; + $$sum2 = (($8) + 3)|0; + $16 = (($9) + ($$sum2)|0); + HEAP8[$16>>0] = 0; + $17 = (($x$03) + 4)|0; + $18 = ($17|0)<($x1|0); + if ($18) { + $x$03 = $17; + } else { + break; + } + } + } + $19 = HEAP32[$g>>2]|0; + $20 = $19 << 2; + $21 = (($20) + ($y$04))|0; + $22 = ($21|0)<($y1|0); + if ($22) { + $y$04 = $21; + } else { + break; + } + } + return; +} +function _stbi__process_gif_raster($s,$g) { + $s = $s|0; + $g = $g|0; + var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; + var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $avail$0$ph = 0; + var $avail$0$ph7 = 0, $avail$1 = 0, $bits$0$lcssa = 0, $bits$0$ph = 0, $bits$0$ph3 = 0, $bits$0$ph9 = 0, $bits$040 = 0, $codemask$0$ph = 0, $codemask$0$ph$in = 0, $codesize$0$ph = 0, $codesize$0$ph$in = 0, $first$0$ph = 0, $init_code$047 = 0, $len$0$lcssa = 0, $len$0$lcssa$lcssa169 = 0, $len$0$ph = 0, $len$0$ph11 = 0, $len$0$ph5 = 0, $len$042 = 0, $len$1 = 0; + var $oldcode$0$ph = 0, $oldcode$0$ph8 = 0, $or$cond = 0, $valid_bits$0$lcssa = 0, $valid_bits$0$ph = 0, $valid_bits$0$ph10 = 0, $valid_bits$0$ph4 = 0, $valid_bits$041 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = $0&255; + $2 = ($0&255)>(12); + if ($2) { + $$0 = 0; + return ($$0|0); + } + $3 = 1 << $1; + $init_code$047 = 0; + while(1) { + $4 = (((($g)) + 2088|0) + ($init_code$047<<2)|0); + HEAP16[$4>>1] = -1; + $5 = $init_code$047&255; + $6 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 2|0); + HEAP8[$6>>0] = $5; + $7 = (((((($g)) + 2088|0) + ($init_code$047<<2)|0)) + 3|0); + HEAP8[$7>>0] = $5; + $8 = (($init_code$047) + 1)|0; + $9 = ($8|0)<($3|0); + if ($9) { + $init_code$047 = $8; + } else { + break; + } + } + $10 = (($3) + 2)|0; + $11 = (($3) + 1)|0; + $bits$0$ph = 0;$first$0$ph = 0;$len$0$ph = 0;$valid_bits$0$ph = 0; + L7: while(1) { + $avail$0$ph = $10;$bits$0$ph3 = $bits$0$ph;$codesize$0$ph$in = $1;$len$0$ph5 = $len$0$ph;$oldcode$0$ph = -1;$valid_bits$0$ph4 = $valid_bits$0$ph; + L9: while(1) { + $codesize$0$ph = (($codesize$0$ph$in) + 1)|0; + $codemask$0$ph$in = 1 << $codesize$0$ph; + $codemask$0$ph = (($codemask$0$ph$in) + -1)|0; + $avail$0$ph7 = $avail$0$ph;$bits$0$ph9 = $bits$0$ph3;$len$0$ph11 = $len$0$ph5;$oldcode$0$ph8 = $oldcode$0$ph;$valid_bits$0$ph10 = $valid_bits$0$ph4; + while(1) { + $12 = ($valid_bits$0$ph10|0)<($codesize$0$ph|0); + if ($12) { + $bits$040 = $bits$0$ph9;$len$042 = $len$0$ph11;$valid_bits$041 = $valid_bits$0$ph10; + while(1) { + $13 = ($len$042|0)==(0); + if ($13) { + $14 = (_stbi__get8($s)|0); + $15 = $14&255; + $16 = ($14<<24>>24)==(0); + if ($16) { + label = 10; + break L7; + } else { + $len$1 = $15; + } + } else { + $len$1 = $len$042; + } + $19 = (($len$1) + -1)|0; + $20 = (_stbi__get8($s)|0); + $21 = $20&255; + $22 = $21 << $valid_bits$041; + $23 = $22 | $bits$040; + $24 = (($valid_bits$041) + 8)|0; + $25 = ($24|0)<($codesize$0$ph|0); + if ($25) { + $bits$040 = $23;$len$042 = $19;$valid_bits$041 = $24; + } else { + $bits$0$lcssa = $23;$len$0$lcssa = $19;$valid_bits$0$lcssa = $24; + break; + } + } + } else { + $bits$0$lcssa = $bits$0$ph9;$len$0$lcssa = $len$0$ph11;$valid_bits$0$lcssa = $valid_bits$0$ph10; + } + $26 = $bits$0$lcssa & $codemask$0$ph; + $27 = $bits$0$lcssa >> $codesize$0$ph; + $28 = (($valid_bits$0$lcssa) - ($codesize$0$ph))|0; + $29 = ($26|0)==($3|0); + if ($29) { + $bits$0$ph = $27;$first$0$ph = 1;$len$0$ph = $len$0$lcssa;$valid_bits$0$ph = $28; + continue L7; + } + $30 = ($26|0)==($11|0); + if ($30) { + $len$0$lcssa$lcssa169 = $len$0$lcssa; + label = 14; + break L7; + } + $39 = ($26|0)>($avail$0$ph7|0); + if ($39) { + label = 29; + break L7; + } + if (!($first$0$ph)) { + label = 19; + break L7; + } + $40 = ($oldcode$0$ph8|0)>(-1); + if ($40) { + $41 = (($avail$0$ph7) + 1)|0; + $42 = ($avail$0$ph7|0)>(4095); + if ($42) { + label = 22; + break L7; + } + $43 = $oldcode$0$ph8&65535; + $44 = (((($g)) + 2088|0) + ($avail$0$ph7<<2)|0); + HEAP16[$44>>1] = $43; + $45 = (((((($g)) + 2088|0) + ($oldcode$0$ph8<<2)|0)) + 2|0); + $46 = HEAP8[$45>>0]|0; + $47 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 2|0); + HEAP8[$47>>0] = $46; + $48 = ($26|0)==($41|0); + if ($48) { + $$sink = $46; + } else { + $49 = (((((($g)) + 2088|0) + ($26<<2)|0)) + 2|0); + $50 = HEAP8[$49>>0]|0; + $$sink = $50; + } + $51 = (((((($g)) + 2088|0) + ($avail$0$ph7<<2)|0)) + 3|0); + HEAP8[$51>>0] = $$sink; + $avail$1 = $41; + } else { + $52 = ($26|0)==($avail$0$ph7|0); + if ($52) { + label = 27; + break L7; + } else { + $avail$1 = $avail$0$ph7; + } + } + $53 = $26&65535; + _stbi__out_gif_code($g,$53); + $54 = $avail$1 & $codemask$0$ph; + $55 = ($54|0)==(0); + $56 = ($avail$1|0)<(4096); + $or$cond = $56 & $55; + if ($or$cond) { + $avail$0$ph = $avail$1;$bits$0$ph3 = $27;$codesize$0$ph$in = $codesize$0$ph;$len$0$ph5 = $len$0$lcssa;$oldcode$0$ph = $26;$valid_bits$0$ph4 = $28; + continue L9; + } else { + $avail$0$ph7 = $avail$1;$bits$0$ph9 = $27;$len$0$ph11 = $len$0$lcssa;$oldcode$0$ph8 = $26;$valid_bits$0$ph10 = $28; + } + } + } + } + if ((label|0) == 10) { + $17 = ((($g)) + 8|0); + $18 = HEAP32[$17>>2]|0; + $$0 = $18; + return ($$0|0); + } + else if ((label|0) == 14) { + _stbi__skip($s,$len$0$lcssa$lcssa169); + $31 = (_stbi__get8($s)|0); + $32 = ($31<<24>>24)==(0); + if (!($32)) { + $34 = $31; + while(1) { + $33 = $34&255; + _stbi__skip($s,$33); + $35 = (_stbi__get8($s)|0); + $36 = ($35<<24>>24)==(0); + if ($36) { + break; + } else { + $34 = $35; + } + } + } + $37 = ((($g)) + 8|0); + $38 = HEAP32[$37>>2]|0; + $$0 = $38; + return ($$0|0); + } + else if ((label|0) == 19) { + _stbi__err(14514); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 22) { + _stbi__err(14528); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 27) { + _stbi__err(14543); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 29) { + _stbi__err(14543); + $$0 = 0; + return ($$0|0); + } + return (0)|0; +} +function _stbi__out_gif_code($g,$code) { + $g = $g|0; + $code = $code|0; + var $$pr = 0, $$sum = 0, $$sum1 = 0, $$sum2 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0; + var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0; + var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0; + var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $code&65535; + $1 = (((($g)) + 2088|0) + ($0<<2)|0); + $2 = HEAP16[$1>>1]|0; + $3 = ($2<<16>>16)>(-1); + if ($3) { + _stbi__out_gif_code($g,$2); + } + $4 = ((($g)) + 18508|0); + $5 = HEAP32[$4>>2]|0; + $6 = ((($g)) + 18500|0); + $7 = HEAP32[$6>>2]|0; + $8 = ($5|0)<($7|0); + if (!($8)) { + return; + } + $9 = ((($g)) + 18504|0); + $10 = HEAP32[$9>>2]|0; + $11 = (($10) + ($5))|0; + $12 = ((($g)) + 8|0); + $13 = HEAP32[$12>>2]|0; + $14 = (((((($g)) + 2088|0) + ($0<<2)|0)) + 3|0); + $15 = HEAP8[$14>>0]|0; + $16 = $15&255; + $17 = $16 << 2; + $18 = ((($g)) + 18472|0); + $19 = HEAP32[$18>>2]|0; + $$sum1 = $17 | 3; + $20 = (($19) + ($$sum1)|0); + $21 = HEAP8[$20>>0]|0; + $22 = ($21<<24>>24)<(0); + if ($22) { + $23 = (($19) + ($17)|0); + $24 = (($13) + ($11)|0); + $$sum2 = $17 | 2; + $25 = (($19) + ($$sum2)|0); + $26 = HEAP8[$25>>0]|0; + HEAP8[$24>>0] = $26; + $$sum3 = $17 | 1; + $27 = (($19) + ($$sum3)|0); + $28 = HEAP8[$27>>0]|0; + $$sum = (($11) + 1)|0; + $29 = (($13) + ($$sum)|0); + HEAP8[$29>>0] = $28; + $30 = HEAP8[$23>>0]|0; + $$sum4 = (($11) + 2)|0; + $31 = (($13) + ($$sum4)|0); + HEAP8[$31>>0] = $30; + $32 = HEAP8[$20>>0]|0; + $$sum5 = (($11) + 3)|0; + $33 = (($13) + ($$sum5)|0); + HEAP8[$33>>0] = $32; + } + $34 = HEAP32[$9>>2]|0; + $35 = (($34) + 4)|0; + HEAP32[$9>>2] = $35; + $36 = ((($g)) + 18496|0); + $37 = HEAP32[$36>>2]|0; + $38 = ($35|0)<($37|0); + if ($38) { + return; + } + $39 = ((($g)) + 18488|0); + $40 = HEAP32[$39>>2]|0; + HEAP32[$9>>2] = $40; + $41 = ((($g)) + 18480|0); + $42 = HEAP32[$41>>2]|0; + $43 = HEAP32[$4>>2]|0; + $44 = (($43) + ($42))|0; + HEAP32[$4>>2] = $44; + $45 = ((($g)) + 18476|0); + $46 = HEAP32[$6>>2]|0; + $47 = ($44|0)<($46|0); + if ($47) { + return; + } + $48 = ((($g)) + 18512|0); + $49 = ((($g)) + 18492|0); + $$pr = HEAP32[$45>>2]|0; + $50 = $$pr; + while(1) { + $51 = ($50|0)>(0); + if (!($51)) { + label = 11; + break; + } + $52 = HEAP32[$48>>2]|0; + $53 = $52 << $50; + HEAP32[$41>>2] = $53; + $54 = HEAP32[$49>>2]|0; + $55 = $53 >> 1; + $56 = (($55) + ($54))|0; + HEAP32[$4>>2] = $56; + $57 = HEAP32[$45>>2]|0; + $58 = (($57) + -1)|0; + HEAP32[$45>>2] = $58; + $59 = HEAP32[$4>>2]|0; + $60 = HEAP32[$6>>2]|0; + $61 = ($59|0)<($60|0); + if ($61) { + label = 11; + break; + } else { + $50 = $58; + } + } + if ((label|0) == 11) { + return; + } +} +function _stbi__gif_test_raw($s) { + $s = $s|0; + var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = ($0<<24>>24)==(71); + L1: do { + if ($1) { + $2 = (_stbi__get8($s)|0); + $3 = ($2<<24>>24)==(73); + if ($3) { + $4 = (_stbi__get8($s)|0); + $5 = ($4<<24>>24)==(70); + if ($5) { + $6 = (_stbi__get8($s)|0); + $7 = ($6<<24>>24)==(56); + if ($7) { + $8 = (_stbi__get8($s)|0); + switch ($8<<24>>24) { + case 55: case 57: { + break; + } + default: { + $$0 = 0; + break L1; + } + } + $9 = (_stbi__get8($s)|0); + $10 = ($9<<24>>24)==(97); + $$ = $10&1; + $$0 = $$; + } else { + $$0 = 0; + } + } else { + $$0 = 0; + } + } else { + $$0 = 0; + } + } else { + $$0 = 0; + } + } while(0); + return ($$0|0); +} +function _stbi__high_bit($z) { + $z = $z|0; + var $$ = 0, $$01 = 0, $$1 = 0, $$2 = 0, $$3 = 0, $$n$3 = 0, $$z = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; + var $9 = 0, $n$1 = 0, $n$2 = 0, $n$3 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($z|0)==(0); + if ($0) { + $$01 = -1; + return ($$01|0); + } + $1 = ($z>>>0)>(65535); + $2 = $z >>> 16; + $$z = $1 ? $2 : $z; + $$ = $1 ? 16 : 0; + $3 = ($$z>>>0)>(255); + $4 = $$ | 8; + $5 = $$z >>> 8; + $$1 = $3 ? $5 : $$z; + $n$1 = $3 ? $4 : $$; + $6 = ($$1>>>0)>(15); + $7 = $n$1 | 4; + $8 = $$1 >>> 4; + $$2 = $6 ? $8 : $$1; + $n$2 = $6 ? $7 : $n$1; + $9 = ($$2>>>0)>(3); + $10 = $n$2 | 2; + $11 = $$2 >>> 2; + $$3 = $9 ? $11 : $$2; + $n$3 = $9 ? $10 : $n$2; + $12 = ($$3>>>0)>(1); + $13 = $12&1; + $$n$3 = (($13) + ($n$3))|0; + $$01 = $$n$3; + return ($$01|0); +} +function _stbi__bitcount($a) { + $a = $a|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $a & 1431655765; + $1 = $a >>> 1; + $2 = $1 & 1431655765; + $3 = (($2) + ($0))|0; + $4 = $3 & 858993459; + $5 = $3 >>> 2; + $6 = $5 & 858993459; + $7 = (($6) + ($4))|0; + $8 = $7 >>> 4; + $9 = (($8) + ($7))|0; + $10 = $9 & 252645135; + $11 = $10 >>> 8; + $12 = (($11) + ($10))|0; + $13 = $12 >>> 16; + $14 = (($13) + ($12))|0; + $15 = $14 & 255; + return ($15|0); +} +function _stbi__shiftsigned($v,$shift,$bits) { + $v = $v|0; + $shift = $shift|0; + $bits = $bits|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $result$0$lcssa = 0, $result$01 = 0, $z$02 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($shift|0)<(0); + $1 = (0 - ($shift))|0; + $2 = $v << $1; + $3 = $v >> $shift; + $$0 = $0 ? $2 : $3; + $4 = ($bits|0)<(8); + if ($4) { + $result$01 = $$0;$z$02 = $bits; + } else { + $result$0$lcssa = $$0; + return ($result$0$lcssa|0); + } + while(1) { + $5 = $$0 >> $z$02; + $6 = (($5) + ($result$01))|0; + $7 = (($z$02) + ($bits))|0; + $8 = ($7|0)<(8); + if ($8) { + $result$01 = $6;$z$02 = $7; + } else { + $result$0$lcssa = $6; + break; + } + } + return ($result$0$lcssa|0); +} +function _stbi__bmp_test_raw($s) { + $s = $s|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_stbi__get8($s)|0); + $1 = ($0<<24>>24)==(66); + if (!($1)) { + $$0 = 0; + return ($$0|0); + } + $2 = (_stbi__get8($s)|0); + $3 = ($2<<24>>24)==(77); + if (!($3)) { + $$0 = 0; + return ($$0|0); + } + (_stbi__get32le($s)|0); + (_stbi__get16le($s)|0); + (_stbi__get16le($s)|0); + (_stbi__get32le($s)|0); + $4 = (_stbi__get32le($s)|0); + switch ($4|0) { + case 124: case 12: case 40: case 56: case 108: { + $$0 = 1; + return ($$0|0); + break; + } + default: { + } + } + $$0 = 0; + return ($$0|0); +} +function _stbi__do_png($p,$x,$y,$n,$req_comp) { + $p = $p|0; + $x = $x|0; + $y = $y|0; + $n = $n|0; + $req_comp = $req_comp|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $result$0 = 0, $result$1 = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = ($req_comp>>>0)>(4); + if ($0) { + _stbi__err(14592); + $$0 = 0; + return ($$0|0); + } + $1 = (_stbi__parse_png_file($p,0,$req_comp)|0); + $2 = ($1|0)==(0); + if ($2) { + $result$1 = 0; + } else { + $3 = ((($p)) + 16|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)==(16); + if ($5) { + $6 = (_stbi__reduce_png($p)|0); + $7 = ($6|0)==(0); + if ($7) { + $$0 = 0; + return ($$0|0); + } + } + $8 = ((($p)) + 12|0); + $9 = HEAP32[$8>>2]|0; + HEAP32[$8>>2] = 0; + $10 = ($req_comp|0)==(0); + if ($10) { + $result$0 = $9; + } else { + $11 = HEAP32[$p>>2]|0; + $12 = ((($11)) + 12|0); + $13 = HEAP32[$12>>2]|0; + $14 = ($13|0)==($req_comp|0); + if ($14) { + $result$0 = $9; + } else { + $15 = HEAP32[$11>>2]|0; + $16 = ((($11)) + 4|0); + $17 = HEAP32[$16>>2]|0; + $18 = (_stbi__convert_format($9,$13,$req_comp,$15,$17)|0); + $19 = HEAP32[$p>>2]|0; + $20 = ((($19)) + 12|0); + HEAP32[$20>>2] = $req_comp; + $21 = ($18|0)==(0|0); + if ($21) { + $$0 = 0; + return ($$0|0); + } else { + $result$0 = $18; + } + } + } + $22 = HEAP32[$p>>2]|0; + $23 = HEAP32[$22>>2]|0; + HEAP32[$x>>2] = $23; + $24 = HEAP32[$p>>2]|0; + $25 = ((($24)) + 4|0); + $26 = HEAP32[$25>>2]|0; + HEAP32[$y>>2] = $26; + $27 = ($n|0)==(0|0); + if ($27) { + $result$1 = $result$0; + } else { + $28 = HEAP32[$p>>2]|0; + $29 = ((($28)) + 8|0); + $30 = HEAP32[$29>>2]|0; + HEAP32[$n>>2] = $30; + $result$1 = $result$0; + } + } + $31 = ((($p)) + 12|0); + $32 = HEAP32[$31>>2]|0; + _free($32); + HEAP32[$31>>2] = 0; + $33 = ((($p)) + 8|0); + $34 = HEAP32[$33>>2]|0; + _free($34); + HEAP32[$33>>2] = 0; + $35 = ((($p)) + 4|0); + $36 = HEAP32[$35>>2]|0; + _free($36); + HEAP32[$35>>2] = 0; + $$0 = $result$1; + return ($$0|0); +} +function _stbi__reduce_png($p) { + $p = $p|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$p>>2]|0; + $1 = HEAP32[$0>>2]|0; + $2 = ((($0)) + 4|0); + $3 = HEAP32[$2>>2]|0; + $4 = Math_imul($3, $1)|0; + $5 = ((($0)) + 12|0); + $6 = HEAP32[$5>>2]|0; + $7 = Math_imul($4, $6)|0; + $8 = ((($p)) + 12|0); + $9 = HEAP32[$8>>2]|0; + $10 = ((($p)) + 16|0); + $11 = HEAP32[$10>>2]|0; + $12 = ($11|0)==(16); + if (!($12)) { + return 1; + } + $13 = (_stbi__malloc($7)|0); + $14 = ($7|0)>(0); + if ($14) { + $15 = Math_imul($3, $1)|0; + $16 = Math_imul($15, $6)|0; + $i$01 = 0; + while(1) { + $17 = (($9) + ($i$01<<1)|0); + $18 = HEAP16[$17>>1]|0; + $19 = ($18&65535) >>> 8; + $20 = $19&255; + $21 = (($13) + ($i$01)|0); + HEAP8[$21>>0] = $20; + $22 = (($i$01) + 1)|0; + $exitcond = ($22|0)==($16|0); + if ($exitcond) { + break; + } else { + $i$01 = $22; + } + } + } + HEAP32[$8>>2] = $13; + _free($9); + return 1; +} +function _stbi__setup_jpeg($j) { + $j = $j|0; + var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18180|0); + HEAP32[$0>>2] = 2; + $1 = ((($j)) + 18184|0); + HEAP32[$1>>2] = 1; + $2 = ((($j)) + 18188|0); + HEAP32[$2>>2] = 1; + return; +} +function _load_jpeg_image($z,$out_x,$out_y,$comp,$req_comp) { + $z = $z|0; + $out_x = $out_x|0; + $out_y = $out_y|0; + $comp = $comp|0; + $req_comp = $req_comp|0; + var $$ = 0, $$0 = 0, $$1 = 0, $$in = 0, $$in4 = 0, $$pr = 0, $$pr5 = 0, $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0; + var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0; + var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0; + var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0; + var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0; + var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0; + var $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0; + var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0; + var $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0; + var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0; + var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $coutput = 0, $exitcond = 0, $i$023 = 0, $i$120 = 0, $i$217 = 0, $i$315 = 0, $j$025 = 0; + var $k$028 = 0, $k$113 = 0, $or$cond3 = 0, $out$022 = 0, $out$119 = 0, $out$214 = 0, $res_comp = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 144|0; + $coutput = sp + 128|0; + $res_comp = sp; + $0 = HEAP32[$z>>2]|0; + $1 = ((($0)) + 8|0); + HEAP32[$1>>2] = 0; + $2 = ($req_comp>>>0)>(4); + if ($2) { + _stbi__err(14592); + $$1 = 0; + STACKTOP = sp;return ($$1|0); + } + $3 = (_stbi__decode_jpeg_image($z)|0); + $4 = ($3|0)==(0); + if ($4) { + _stbi__cleanup_jpeg($z); + $$1 = 0; + STACKTOP = sp;return ($$1|0); + } + $5 = ($req_comp|0)==(0); + if ($5) { + $6 = HEAP32[$z>>2]|0; + $7 = ((($6)) + 8|0); + $8 = HEAP32[$7>>2]|0; + $13 = $8; + } else { + $13 = $req_comp; + } + $9 = HEAP32[$z>>2]|0; + $10 = ((($9)) + 8|0); + $11 = HEAP32[$10>>2]|0; + $12 = ($11|0)==(3); + $14 = ($13|0)<(3); + $or$cond3 = $14 & $12; + $$ = $or$cond3 ? 1 : $11; + $15 = ($$|0)>(0); + L12: do { + if ($15) { + $16 = ((($z)) + 17796|0); + $17 = ((($z)) + 17800|0); + $18 = ((($z)) + 18188|0); + $k$028 = 0; + while(1) { + $19 = (($res_comp) + ($k$028<<5)|0); + $20 = HEAP32[$z>>2]|0; + $21 = HEAP32[$20>>2]|0; + $22 = (($21) + 3)|0; + $23 = (_stbi__malloc($22)|0); + $24 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 56|0); + HEAP32[$24>>2] = $23; + $25 = ($23|0)==(0|0); + if ($25) { + break; + } + $26 = HEAP32[$16>>2]|0; + $27 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 4|0); + $28 = HEAP32[$27>>2]|0; + $29 = (($26|0) / ($28|0))&-1; + $30 = (((($res_comp) + ($k$028<<5)|0)) + 12|0); + HEAP32[$30>>2] = $29; + $31 = HEAP32[$17>>2]|0; + $32 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 8|0); + $33 = HEAP32[$32>>2]|0; + $34 = (($31|0) / ($33|0))&-1; + $35 = (((($res_comp) + ($k$028<<5)|0)) + 16|0); + HEAP32[$35>>2] = $34; + $36 = $34 >> 1; + $37 = (((($res_comp) + ($k$028<<5)|0)) + 24|0); + HEAP32[$37>>2] = $36; + $38 = HEAP32[$z>>2]|0; + $39 = HEAP32[$38>>2]|0; + $40 = HEAP32[$30>>2]|0; + $41 = (($39) + -1)|0; + $42 = (($41) + ($40))|0; + $43 = (($42>>>0) / ($40>>>0))&-1; + $44 = (((($res_comp) + ($k$028<<5)|0)) + 20|0); + HEAP32[$44>>2] = $43; + $45 = (((($res_comp) + ($k$028<<5)|0)) + 28|0); + HEAP32[$45>>2] = 0; + $46 = (((((($z)) + 17820|0) + (($k$028*72)|0)|0)) + 44|0); + $47 = HEAP32[$46>>2]|0; + $48 = (((($res_comp) + ($k$028<<5)|0)) + 8|0); + HEAP32[$48>>2] = $47; + $49 = (((($res_comp) + ($k$028<<5)|0)) + 4|0); + HEAP32[$49>>2] = $47; + $50 = HEAP32[$30>>2]|0; + $51 = ($50|0)==(1); + do { + if ($51) { + $52 = HEAP32[$35>>2]|0; + $53 = ($52|0)==(1); + if ($53) { + HEAP32[$19>>2] = 2; + break; + } + $$pr = HEAP32[$30>>2]|0; + $54 = ($$pr|0)==(1); + if ($54) { + $55 = HEAP32[$35>>2]|0; + $56 = ($55|0)==(2); + if ($56) { + HEAP32[$19>>2] = 3; + } else { + label = 17; + } + } else { + $57 = $$pr; + label = 18; + } + } else { + label = 17; + } + } while(0); + if ((label|0) == 17) { + label = 0; + $$pr5 = HEAP32[$30>>2]|0; + $57 = $$pr5; + label = 18; + } + do { + if ((label|0) == 18) { + label = 0; + $58 = ($57|0)==(2); + if ($58) { + $59 = HEAP32[$35>>2]|0; + $60 = ($59|0)==(1); + if ($60) { + HEAP32[$19>>2] = 4; + break; + } + } + $61 = HEAP32[$30>>2]|0; + $62 = ($61|0)==(2); + if ($62) { + $63 = HEAP32[$35>>2]|0; + $64 = ($63|0)==(2); + if ($64) { + $65 = HEAP32[$18>>2]|0; + HEAP32[$19>>2] = $65; + break; + } + } + HEAP32[$19>>2] = 5; + } + } while(0); + $66 = (($k$028) + 1)|0; + $67 = ($66|0)<($$|0); + if ($67) { + $k$028 = $66; + } else { + label = 26; + break L12; + } + } + _stbi__cleanup_jpeg($z); + _stbi__err(12905); + $$0 = 0; + } else { + label = 26; + } + } while(0); + do { + if ((label|0) == 26) { + $68 = HEAP32[$z>>2]|0; + $69 = HEAP32[$68>>2]|0; + $70 = Math_imul($69, $13)|0; + $71 = ((($68)) + 4|0); + $72 = HEAP32[$71>>2]|0; + $73 = Math_imul($70, $72)|0; + $74 = (($73) + 1)|0; + $75 = (_stbi__malloc($74)|0); + $76 = ($75|0)==(0|0); + if ($76) { + _stbi__cleanup_jpeg($z); + _stbi__err(12905); + $$0 = 0; + break; + } + $77 = HEAP32[$z>>2]|0; + $78 = ((($77)) + 4|0); + $79 = HEAP32[$78>>2]|0; + $80 = ($79|0)==(0); + if (!($80)) { + $81 = ($$|0)>(0); + $82 = ($13|0)>(2); + $83 = ((($z)) + 18148|0); + $84 = ((($z)) + 18184|0); + $85 = ((($coutput)) + 4|0); + $86 = ((($coutput)) + 8|0); + $87 = ((($coutput)) + 4|0); + $88 = ((($coutput)) + 8|0); + $89 = ($13|0)==(1); + $91 = $77;$j$025 = 0; + while(1) { + $90 = HEAP32[$91>>2]|0; + $92 = Math_imul($j$025, $13)|0; + $93 = Math_imul($92, $90)|0; + $94 = (($75) + ($93)|0); + if ($81) { + $k$113 = 0; + while(1) { + $95 = (((($res_comp) + ($k$113<<5)|0)) + 24|0); + $96 = HEAP32[$95>>2]|0; + $97 = (((($res_comp) + ($k$113<<5)|0)) + 16|0); + $98 = HEAP32[$97>>2]|0; + $99 = $98 >> 1; + $100 = ($96|0)>=($99|0); + $101 = (($res_comp) + ($k$113<<5)|0); + $102 = HEAP32[$101>>2]|0; + $103 = (((((($z)) + 17820|0) + (($k$113*72)|0)|0)) + 56|0); + $104 = HEAP32[$103>>2]|0; + $105 = (((($res_comp) + ($k$113<<5)|0)) + 8|0); + $106 = (((($res_comp) + ($k$113<<5)|0)) + 4|0); + $$in = $100 ? $105 : $106; + $107 = HEAP32[$$in>>2]|0; + $$in4 = $100 ? $106 : $105; + $108 = HEAP32[$$in4>>2]|0; + $109 = (((($res_comp) + ($k$113<<5)|0)) + 20|0); + $110 = HEAP32[$109>>2]|0; + $111 = (((($res_comp) + ($k$113<<5)|0)) + 12|0); + $112 = HEAP32[$111>>2]|0; + $113 = (FUNCTION_TABLE_iiiiii[$102 & 7]($104,$107,$108,$110,$112)|0); + $114 = (($coutput) + ($k$113<<2)|0); + HEAP32[$114>>2] = $113; + $115 = HEAP32[$95>>2]|0; + $116 = (($115) + 1)|0; + HEAP32[$95>>2] = $116; + $117 = HEAP32[$97>>2]|0; + $118 = ($116|0)<($117|0); + if (!($118)) { + HEAP32[$95>>2] = 0; + $119 = HEAP32[$105>>2]|0; + HEAP32[$106>>2] = $119; + $120 = (((($res_comp) + ($k$113<<5)|0)) + 28|0); + $121 = HEAP32[$120>>2]|0; + $122 = (($121) + 1)|0; + HEAP32[$120>>2] = $122; + $123 = (((((($z)) + 17820|0) + (($k$113*72)|0)|0)) + 32|0); + $124 = HEAP32[$123>>2]|0; + $125 = ($122|0)<($124|0); + if ($125) { + $126 = (((((($z)) + 17820|0) + (($k$113*72)|0)|0)) + 36|0); + $127 = HEAP32[$126>>2]|0; + $128 = HEAP32[$105>>2]|0; + $129 = (($128) + ($127)|0); + HEAP32[$105>>2] = $129; + } + } + $130 = (($k$113) + 1)|0; + $exitcond = ($130|0)==($$|0); + if ($exitcond) { + break; + } else { + $k$113 = $130; + } + } + } + $131 = HEAP32[$coutput>>2]|0; + $132 = HEAP32[$z>>2]|0; + L55: do { + if ($82) { + $133 = ((($132)) + 8|0); + $134 = HEAP32[$133>>2]|0; + $135 = ($134|0)==(3); + if (!($135)) { + $136 = HEAP32[$z>>2]|0; + $137 = HEAP32[$136>>2]|0; + $138 = ($137|0)==(0); + if ($138) { + break; + } else { + $i$120 = 0;$out$119 = $94; + } + while(1) { + $164 = (($131) + ($i$120)|0); + $165 = HEAP8[$164>>0]|0; + $166 = ((($out$119)) + 2|0); + HEAP8[$166>>0] = $165; + $167 = ((($out$119)) + 1|0); + HEAP8[$167>>0] = $165; + HEAP8[$out$119>>0] = $165; + $168 = ((($out$119)) + 3|0); + HEAP8[$168>>0] = -1; + $169 = (($out$119) + ($13)|0); + $170 = (($i$120) + 1)|0; + $171 = HEAP32[$z>>2]|0; + $172 = HEAP32[$171>>2]|0; + $173 = ($170>>>0)<($172>>>0); + if ($173) { + $i$120 = $170;$out$119 = $169; + } else { + break L55; + } + } + } + $139 = HEAP32[$83>>2]|0; + $140 = ($139|0)==(3); + if (!($140)) { + $160 = HEAP32[$84>>2]|0; + $161 = HEAP32[$85>>2]|0; + $162 = HEAP32[$86>>2]|0; + $163 = HEAP32[$132>>2]|0; + FUNCTION_TABLE_viiiiii[$160 & 3]($94,$131,$161,$162,$163,$13); + break; + } + $141 = HEAP32[$z>>2]|0; + $142 = HEAP32[$141>>2]|0; + $143 = ($142|0)==(0); + if (!($143)) { + $i$023 = 0;$out$022 = $94; + while(1) { + $144 = (($131) + ($i$023)|0); + $145 = HEAP8[$144>>0]|0; + HEAP8[$out$022>>0] = $145; + $146 = HEAP32[$87>>2]|0; + $147 = (($146) + ($i$023)|0); + $148 = HEAP8[$147>>0]|0; + $149 = ((($out$022)) + 1|0); + HEAP8[$149>>0] = $148; + $150 = HEAP32[$88>>2]|0; + $151 = (($150) + ($i$023)|0); + $152 = HEAP8[$151>>0]|0; + $153 = ((($out$022)) + 2|0); + HEAP8[$153>>0] = $152; + $154 = ((($out$022)) + 3|0); + HEAP8[$154>>0] = -1; + $155 = (($out$022) + ($13)|0); + $156 = (($i$023) + 1)|0; + $157 = HEAP32[$z>>2]|0; + $158 = HEAP32[$157>>2]|0; + $159 = ($156>>>0)<($158>>>0); + if ($159) { + $i$023 = $156;$out$022 = $155; + } else { + break; + } + } + } + } else { + $174 = HEAP32[$132>>2]|0; + $175 = ($174|0)==(0); + if ($89) { + if ($175) { + break; + } else { + $i$217 = 0; + } + while(1) { + $176 = (($131) + ($i$217)|0); + $177 = HEAP8[$176>>0]|0; + $$sum = (($i$217) + ($93))|0; + $178 = (($75) + ($$sum)|0); + HEAP8[$178>>0] = $177; + $179 = (($i$217) + 1)|0; + $180 = HEAP32[$z>>2]|0; + $181 = HEAP32[$180>>2]|0; + $182 = ($179>>>0)<($181>>>0); + if ($182) { + $i$217 = $179; + } else { + break; + } + } + } else { + if ($175) { + break; + } else { + $i$315 = 0;$out$214 = $94; + } + while(1) { + $183 = (($131) + ($i$315)|0); + $184 = HEAP8[$183>>0]|0; + $185 = ((($out$214)) + 1|0); + HEAP8[$out$214>>0] = $184; + $186 = ((($out$214)) + 2|0); + HEAP8[$185>>0] = -1; + $187 = (($i$315) + 1)|0; + $188 = HEAP32[$z>>2]|0; + $189 = HEAP32[$188>>2]|0; + $190 = ($187>>>0)<($189>>>0); + if ($190) { + $i$315 = $187;$out$214 = $186; + } else { + break; + } + } + } + } + } while(0); + $191 = (($j$025) + 1)|0; + $192 = HEAP32[$z>>2]|0; + $193 = ((($192)) + 4|0); + $194 = HEAP32[$193>>2]|0; + $195 = ($191>>>0)<($194>>>0); + if ($195) { + $91 = $192;$j$025 = $191; + } else { + break; + } + } + } + _stbi__cleanup_jpeg($z); + $196 = HEAP32[$z>>2]|0; + $197 = HEAP32[$196>>2]|0; + HEAP32[$out_x>>2] = $197; + $198 = HEAP32[$z>>2]|0; + $199 = ((($198)) + 4|0); + $200 = HEAP32[$199>>2]|0; + HEAP32[$out_y>>2] = $200; + $201 = ($comp|0)==(0|0); + if ($201) { + $$0 = $75; + } else { + $202 = HEAP32[$z>>2]|0; + $203 = ((($202)) + 8|0); + $204 = HEAP32[$203>>2]|0; + HEAP32[$comp>>2] = $204; + $$0 = $75; + } + } + } while(0); + $$1 = $$0; + STACKTOP = sp;return ($$1|0); +} +function _stbi__decode_jpeg_image($j) { + $j = $j|0; + var $$0 = 0, $$sink = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 17868|0); + HEAP32[$0>>2] = 0; + $1 = ((($j)) + 17872|0); + HEAP32[$1>>2] = 0; + $2 = ((($j)) + 17940|0); + HEAP32[$2>>2] = 0; + $3 = ((($j)) + 17944|0); + HEAP32[$3>>2] = 0; + $4 = ((($j)) + 18012|0); + HEAP32[$4>>2] = 0; + $5 = ((($j)) + 18016|0); + HEAP32[$5>>2] = 0; + $6 = ((($j)) + 18084|0); + HEAP32[$6>>2] = 0; + $7 = ((($j)) + 18088|0); + HEAP32[$7>>2] = 0; + $8 = ((($j)) + 18172|0); + HEAP32[$8>>2] = 0; + $9 = (_stbi__decode_jpeg_header($j,0)|0); + $10 = ($9|0)==(0); + if ($10) { + $$0 = 0; + return ($$0|0); + } + $11 = (_stbi__get_marker($j)|0); + $12 = ((($j)) + 18116|0); + $$sink = $11; + L4: while(1) { + $13 = $$sink&255; + L6: do { + switch ($13|0) { + case 217: { + label = 13; + break L4; + break; + } + case 218: { + $14 = (_stbi__process_scan_header($j)|0); + $15 = ($14|0)==(0); + if ($15) { + $$0 = 0; + label = 15; + break L4; + } + $16 = (_stbi__parse_entropy_coded_data($j)|0); + $17 = ($16|0)==(0); + if ($17) { + $$0 = 0; + label = 15; + break L4; + } + $18 = HEAP8[$12>>0]|0; + $19 = ($18<<24>>24)==(-1); + if ($19) { + L11: while(1) { + $20 = HEAP32[$j>>2]|0; + $21 = (_stbi__at_eof($20)|0); + $22 = ($21|0)==(0); + if (!($22)) { + break L6; + } + $23 = HEAP32[$j>>2]|0; + $24 = (_stbi__get8($23)|0); + switch ($24<<24>>24) { + case 0: { + break; + } + case -1: { + break L11; + break; + } + default: { + label = 10; + break L4; + } + } + } + $25 = HEAP32[$j>>2]|0; + $26 = (_stbi__get8($25)|0); + HEAP8[$12>>0] = $26; + } + break; + } + default: { + $27 = (_stbi__process_marker($j,$13)|0); + $28 = ($27|0)==(0); + if ($28) { + $$0 = 0; + label = 15; + break L4; + } + } + } + } while(0); + $29 = (_stbi__get_marker($j)|0); + $$sink = $29; + } + if ((label|0) == 10) { + _stbi__err(14605); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 13) { + $30 = ((($j)) + 18124|0); + $31 = HEAP32[$30>>2]|0; + $32 = ($31|0)==(0); + if ($32) { + $$0 = 1; + return ($$0|0); + } + _stbi__jpeg_finish($j); + $$0 = 1; + return ($$0|0); + } + else if ((label|0) == 15) { + return ($$0|0); + } + return (0)|0; +} +function _stbi__cleanup_jpeg($j) { + $j = $j|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; + var $i$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$j>>2]|0; + $1 = ((($0)) + 8|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)>(0); + if ($3) { + $i$01 = 0; + } else { + return; + } + while(1) { + $4 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 48|0); + $5 = HEAP32[$4>>2]|0; + $6 = ($5|0)==(0|0); + if (!($6)) { + _free($5); + HEAP32[$4>>2] = 0; + $7 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 44|0); + HEAP32[$7>>2] = 0; + } + $8 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 52|0); + $9 = HEAP32[$8>>2]|0; + $10 = ($9|0)==(0|0); + if (!($10)) { + _free($9); + HEAP32[$8>>2] = 0; + $11 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 60|0); + HEAP32[$11>>2] = 0; + } + $12 = (((((($j)) + 17820|0) + (($i$01*72)|0)|0)) + 56|0); + $13 = HEAP32[$12>>2]|0; + $14 = ($13|0)==(0|0); + if (!($14)) { + _free($13); + HEAP32[$12>>2] = 0; + } + $15 = (($i$01) + 1)|0; + $16 = HEAP32[$j>>2]|0; + $17 = ((($16)) + 8|0); + $18 = HEAP32[$17>>2]|0; + $19 = ($15|0)<($18|0); + if ($19) { + $i$01 = $15; + } else { + break; + } + } + return; +} +function _resample_row_1($out,$in_near,$in_far,$w,$hs) { + $out = $out|0; + $in_near = $in_near|0; + $in_far = $in_far|0; + $w = $w|0; + $hs = $hs|0; + var label = 0, sp = 0; + sp = STACKTOP; + return ($in_near|0); +} +function _stbi__resample_row_v_2($out,$in_near,$in_far,$w,$hs) { + $out = $out|0; + $in_near = $in_near|0; + $in_far = $in_far|0; + $w = $w|0; + $hs = $hs|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($w|0)>(0); + if ($0) { + $i$01 = 0; + } else { + return ($out|0); + } + while(1) { + $1 = (($in_near) + ($i$01)|0); + $2 = HEAP8[$1>>0]|0; + $3 = $2&255; + $4 = ($3*3)|0; + $5 = (($in_far) + ($i$01)|0); + $6 = HEAP8[$5>>0]|0; + $7 = $6&255; + $8 = (($7) + 2)|0; + $9 = (($8) + ($4))|0; + $10 = $9 >>> 2; + $11 = $10&255; + $12 = (($out) + ($i$01)|0); + HEAP8[$12>>0] = $11; + $13 = (($i$01) + 1)|0; + $exitcond = ($13|0)==($w|0); + if ($exitcond) { + break; + } else { + $i$01 = $13; + } + } + return ($out|0); +} +function _stbi__resample_row_h_2($out,$in_near,$in_far,$w,$hs) { + $out = $out|0; + $in_near = $in_near|0; + $in_far = $in_far|0; + $w = $w|0; + $hs = $hs|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $i$0$lcssa = 0, $i$01 = 0, $phitmp = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = ($w|0)==(1); + $1 = HEAP8[$in_near>>0]|0; + if ($0) { + $2 = ((($out)) + 1|0); + HEAP8[$2>>0] = $1; + HEAP8[$out>>0] = $1; + return ($out|0); + } + HEAP8[$out>>0] = $1; + $3 = HEAP8[$in_near>>0]|0; + $4 = $3&255; + $5 = ($4*3)|0; + $6 = ((($in_near)) + 1|0); + $7 = HEAP8[$6>>0]|0; + $8 = $7&255; + $9 = (($8) + 2)|0; + $10 = (($9) + ($5))|0; + $11 = $10 >>> 2; + $12 = $11&255; + $13 = ((($out)) + 1|0); + HEAP8[$13>>0] = $12; + $14 = (($w) + -1)|0; + $15 = ($14|0)>(1); + if ($15) { + $16 = (($w) + -1)|0; + $i$01 = 1; + while(1) { + $17 = (($in_near) + ($i$01)|0); + $18 = HEAP8[$17>>0]|0; + $19 = $18&255; + $20 = ($19*3)|0; + $21 = (($20) + 2)|0; + $22 = (($i$01) + -1)|0; + $23 = (($in_near) + ($22)|0); + $24 = HEAP8[$23>>0]|0; + $25 = $24&255; + $26 = (($21) + ($25))|0; + $27 = $26 >>> 2; + $28 = $27&255; + $29 = $i$01 << 1; + $30 = (($out) + ($29)|0); + HEAP8[$30>>0] = $28; + $31 = (($i$01) + 1)|0; + $32 = (($in_near) + ($31)|0); + $33 = HEAP8[$32>>0]|0; + $34 = $33&255; + $35 = (($21) + ($34))|0; + $36 = $35 >>> 2; + $37 = $36&255; + $38 = $29 | 1; + $39 = (($out) + ($38)|0); + HEAP8[$39>>0] = $37; + $exitcond = ($31|0)==($16|0); + if ($exitcond) { + break; + } else { + $i$01 = $31; + } + } + $phitmp = $16 << 1; + $i$0$lcssa = $phitmp; + } else { + $i$0$lcssa = 2; + } + $40 = (($w) + -2)|0; + $41 = (($in_near) + ($40)|0); + $42 = HEAP8[$41>>0]|0; + $43 = $42&255; + $44 = ($43*3)|0; + $45 = (($in_near) + ($14)|0); + $46 = HEAP8[$45>>0]|0; + $47 = $46&255; + $48 = (($47) + 2)|0; + $49 = (($48) + ($44))|0; + $50 = $49 >>> 2; + $51 = $50&255; + $52 = (($out) + ($i$0$lcssa)|0); + HEAP8[$52>>0] = $51; + $53 = HEAP8[$45>>0]|0; + $54 = $i$0$lcssa | 1; + $55 = (($out) + ($54)|0); + HEAP8[$55>>0] = $53; + return ($out|0); +} +function _stbi__resample_row_generic($out,$in_near,$in_far,$w,$hs) { + $out = $out|0; + $in_near = $in_near|0; + $in_far = $in_far|0; + $w = $w|0; + $hs = $hs|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $exitcond4 = 0, $i$02 = 0, $j$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($w|0)>(0); + if (!($0)) { + return ($out|0); + } + $1 = ($hs|0)>(0); + $i$02 = 0; + while(1) { + if ($1) { + $2 = (($in_near) + ($i$02)|0); + $3 = Math_imul($i$02, $hs)|0; + $j$01 = 0; + while(1) { + $4 = HEAP8[$2>>0]|0; + $5 = (($j$01) + ($3))|0; + $6 = (($out) + ($5)|0); + HEAP8[$6>>0] = $4; + $7 = (($j$01) + 1)|0; + $exitcond = ($7|0)==($hs|0); + if ($exitcond) { + break; + } else { + $j$01 = $7; + } + } + } + $8 = (($i$02) + 1)|0; + $exitcond4 = ($8|0)==($w|0); + if ($exitcond4) { + break; + } else { + $i$02 = $8; + } + } + return ($out|0); +} +function _stbi__process_scan_header($z) { + $z = $z|0; + var $$0 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0; + var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0; + var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; + var $8 = 0, $9 = 0, $i$010 = 0, $or$cond1 = 0, $or$cond2 = 0, $which$0$lcssa = 0, $which$07 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[$z>>2]|0; + $1 = (_stbi__get16be($0)|0); + $2 = HEAP32[$z>>2]|0; + $3 = (_stbi__get8($2)|0); + $4 = $3&255; + $5 = ((($z)) + 18152|0); + HEAP32[$5>>2] = $4; + $6 = (($3) + -1)<<24>>24; + $7 = ($6&255)>(3); + if (!($7)) { + $8 = HEAP32[$z>>2]|0; + $9 = ((($8)) + 8|0); + $10 = HEAP32[$9>>2]|0; + $11 = ($4|0)>($10|0); + if (!($11)) { + $12 = $4 << 1; + $13 = (($12) + 6)|0; + $14 = ($1|0)==($13|0); + if (!($14)) { + _stbi__err(14859); + $$0 = 0; + return ($$0|0); + } + $15 = HEAP32[$5>>2]|0; + $16 = ($15|0)>(0); + $17 = HEAP32[$z>>2]|0; + $18 = (_stbi__get8($17)|0); + $19 = $18&255; + L8: do { + if ($16) { + $30 = $19;$i$010 = 0; + while(1) { + $20 = HEAP32[$z>>2]|0; + $21 = (_stbi__get8($20)|0); + $22 = $21&255; + $23 = HEAP32[$z>>2]|0; + $24 = ((($23)) + 8|0); + $25 = HEAP32[$24>>2]|0; + $26 = ($25|0)>(0); + L11: do { + if ($26) { + $which$07 = 0; + while(1) { + $27 = (((($z)) + 17820|0) + (($which$07*72)|0)|0); + $28 = HEAP32[$27>>2]|0; + $29 = ($28|0)==($30|0); + if ($29) { + $which$0$lcssa = $which$07; + break L11; + } + $31 = (($which$07) + 1)|0; + $32 = HEAP32[$z>>2]|0; + $33 = ((($32)) + 8|0); + $34 = HEAP32[$33>>2]|0; + $35 = ($31|0)<($34|0); + if ($35) { + $which$07 = $31; + } else { + $which$0$lcssa = $31; + break; + } + } + } else { + $which$0$lcssa = 0; + } + } while(0); + $36 = HEAP32[$z>>2]|0; + $37 = ((($36)) + 8|0); + $38 = HEAP32[$37>>2]|0; + $39 = ($which$0$lcssa|0)==($38|0); + if ($39) { + $$0 = 0; + label = 26; + break; + } + $40 = $22 >>> 4; + $41 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 16|0); + HEAP32[$41>>2] = $40; + $42 = ($21&255)>(63); + if ($42) { + label = 12; + break; + } + $43 = $22 & 15; + $44 = (((((($z)) + 17820|0) + (($which$0$lcssa*72)|0)|0)) + 20|0); + HEAP32[$44>>2] = $43; + $45 = ($43>>>0)>(3); + if ($45) { + label = 14; + break; + } + $46 = (((($z)) + 18156|0) + ($i$010<<2)|0); + HEAP32[$46>>2] = $which$0$lcssa; + $47 = (($i$010) + 1)|0; + $48 = HEAP32[$5>>2]|0; + $49 = ($47|0)<($48|0); + $50 = HEAP32[$z>>2]|0; + $51 = (_stbi__get8($50)|0); + $52 = $51&255; + if ($49) { + $30 = $52;$i$010 = $47; + } else { + $$lcssa = $52; + break L8; + } + } + if ((label|0) == 12) { + _stbi__err(14871); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 14) { + _stbi__err(14883); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 26) { + return ($$0|0); + } + } else { + $$lcssa = $19; + } + } while(0); + $53 = ((($z)) + 18128|0); + HEAP32[$53>>2] = $$lcssa; + $54 = HEAP32[$z>>2]|0; + $55 = (_stbi__get8($54)|0); + $56 = $55&255; + $57 = ((($z)) + 18132|0); + HEAP32[$57>>2] = $56; + $58 = HEAP32[$z>>2]|0; + $59 = (_stbi__get8($58)|0); + $60 = $59&255; + $61 = $60 >>> 4; + $62 = ((($z)) + 18136|0); + HEAP32[$62>>2] = $61; + $63 = $60 & 15; + $64 = ((($z)) + 18140|0); + HEAP32[$64>>2] = $63; + $65 = ((($z)) + 18124|0); + $66 = HEAP32[$65>>2]|0; + $67 = ($66|0)==(0); + $68 = HEAP32[$53>>2]|0; + if (!($67)) { + $69 = ($68|0)>(63); + if (!($69)) { + $70 = HEAP32[$57>>2]|0; + $71 = ($70|0)>(63); + $72 = ($68|0)>($70|0); + $or$cond1 = $71 | $72; + if (!($or$cond1)) { + $73 = HEAP32[$62>>2]|0; + $74 = ($73|0)>(13); + $75 = ($63>>>0)>(13); + $or$cond2 = $75 | $74; + if (!($or$cond2)) { + $$0 = 1; + return ($$0|0); + } + } + } + _stbi__err(14895); + $$0 = 0; + return ($$0|0); + } + $76 = ($68|0)==(0); + if (!($76)) { + _stbi__err(14895); + $$0 = 0; + return ($$0|0); + } + $77 = HEAP32[$62>>2]|0; + $78 = $77 | $63; + $79 = ($78|0)==(0); + if ($79) { + HEAP32[$57>>2] = 63; + $$0 = 1; + return ($$0|0); + } else { + _stbi__err(14895); + $$0 = 0; + return ($$0|0); + } + } + } + _stbi__err(14835); + $$0 = 0; + return ($$0|0); +} +function _stbi__parse_entropy_coded_data($z) { + $z = $z|0; + var $$0 = 0, $$1 = 0, $$2 = 0, $$sum1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0; + var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0; + var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0; + var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0; + var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0; + var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0; + var $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0; + var $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; + var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; + var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; + var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; + var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $data = 0, $i$023 = 0, $i1$035 = 0, $i13$054 = 0; + var $i6$040 = 0, $j$024 = 0, $j14$057 = 0, $j2$038 = 0, $j7$043 = 0, $k$032 = 0, $k15$051 = 0, $tmp = 0, $tmp5 = 0, $x$026 = 0, $x16$045 = 0, $y$029 = 0, $y17$048 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 128|0; + $data = sp; + _stbi__jpeg_reset($z); + $0 = ((($z)) + 18124|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + $3 = ((($z)) + 18152|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)==(1); + if ($2) { + if ($5) { + $6 = ((($z)) + 18156|0); + $7 = HEAP32[$6>>2]|0; + $8 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 28|0); + $9 = HEAP32[$8>>2]|0; + $10 = (($9) + 7)|0; + $11 = $10 >> 3; + $12 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 32|0); + $13 = HEAP32[$12>>2]|0; + $14 = (($13) + 7)|0; + $15 = $14 >> 3; + $16 = ($15|0)>(0); + L5: do { + if ($16) { + $17 = ($11|0)>(0); + $18 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 20|0); + $19 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 16|0); + $20 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 12|0); + $21 = ((($z)) + 18180|0); + $22 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 44|0); + $23 = (((((($z)) + 17820|0) + (($7*72)|0)|0)) + 36|0); + $24 = ((($z)) + 18176|0); + $25 = ((($z)) + 18112|0); + $26 = ((($z)) + 18116|0); + $j$024 = 0; + while(1) { + if ($17) { + $i$023 = 0; + while(1) { + $27 = HEAP32[$18>>2]|0; + $28 = HEAP32[$19>>2]|0; + $29 = (((($z)) + 4|0) + (($28*1680)|0)|0); + $30 = (((($z)) + 6724|0) + (($27*1680)|0)|0); + $31 = (((($z)) + 13700|0) + ($27<<10)|0); + $32 = HEAP32[$20>>2]|0; + $33 = (((($z)) + 13444|0) + ($32<<6)|0); + $34 = (_stbi__jpeg_decode_block($z,$data,$29,$30,$31,$7,$33)|0); + $35 = ($34|0)==(0); + if ($35) { + $$0 = 0; + break L5; + } + $36 = HEAP32[$21>>2]|0; + $37 = HEAP32[$22>>2]|0; + $38 = HEAP32[$23>>2]|0; + $39 = Math_imul($38, $j$024)|0; + $40 = (($39) + ($i$023))|0; + $$sum1 = $40 << 3; + $41 = (($37) + ($$sum1)|0); + FUNCTION_TABLE_viii[$36 & 31]($41,$38,$data); + $42 = HEAP32[$24>>2]|0; + $43 = (($42) + -1)|0; + HEAP32[$24>>2] = $43; + $44 = ($42|0)<(2); + if ($44) { + $45 = HEAP32[$25>>2]|0; + $46 = ($45|0)<(24); + if ($46) { + _stbi__grow_buffer_unsafe($z); + } + $47 = HEAP8[$26>>0]|0; + $48 = $47 & -8; + $49 = ($48<<24>>24)==(-48); + if (!($49)) { + $$0 = 1; + break L5; + } + _stbi__jpeg_reset($z); + } + $50 = (($i$023) + 1)|0; + $51 = ($50|0)<($11|0); + if ($51) { + $i$023 = $50; + } else { + break; + } + } + } + $52 = (($j$024) + 1)|0; + $53 = ($52|0)<($15|0); + if ($53) { + $j$024 = $52; + } else { + $$0 = 1; + break; + } + } + } else { + $$0 = 1; + } + } while(0); + $$2 = $$0; + STACKTOP = sp;return ($$2|0); + } + $54 = ((($z)) + 17808|0); + $55 = HEAP32[$54>>2]|0; + $56 = ($55|0)>(0); + L24: do { + if ($56) { + $57 = ((($z)) + 17804|0); + $58 = ((($z)) + 18176|0); + $59 = ((($z)) + 18112|0); + $60 = ((($z)) + 18116|0); + $61 = ((($z)) + 18180|0); + $j2$038 = 0; + while(1) { + $62 = HEAP32[$57>>2]|0; + $63 = ($62|0)>(0); + if ($63) { + $i1$035 = 0; + while(1) { + $64 = HEAP32[$3>>2]|0; + $65 = ($64|0)>(0); + if ($65) { + $k$032 = 0; + while(1) { + $66 = (((($z)) + 18156|0) + ($k$032<<2)|0); + $67 = HEAP32[$66>>2]|0; + $68 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 8|0); + $69 = HEAP32[$68>>2]|0; + $70 = ($69|0)>(0); + if ($70) { + $71 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 4|0); + $72 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 20|0); + $73 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 16|0); + $74 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 12|0); + $75 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 44|0); + $76 = (((((($z)) + 17820|0) + (($67*72)|0)|0)) + 36|0); + $y$029 = 0; + while(1) { + $77 = HEAP32[$71>>2]|0; + $78 = ($77|0)>(0); + if ($78) { + $92 = $77;$x$026 = 0; + while(1) { + $79 = HEAP32[$68>>2]|0; + $80 = HEAP32[$72>>2]|0; + $81 = HEAP32[$73>>2]|0; + $82 = (((($z)) + 4|0) + (($81*1680)|0)|0); + $83 = (((($z)) + 6724|0) + (($80*1680)|0)|0); + $84 = (((($z)) + 13700|0) + ($80<<10)|0); + $85 = HEAP32[$74>>2]|0; + $86 = (((($z)) + 13444|0) + ($85<<6)|0); + $87 = (_stbi__jpeg_decode_block($z,$data,$82,$83,$84,$67,$86)|0); + $88 = ($87|0)==(0); + if ($88) { + $$1 = 0; + break L24; + } + $89 = Math_imul($79, $j2$038)|0; + $90 = (($89) + ($y$029))|0; + $91 = Math_imul($92, $i1$035)|0; + $93 = (($91) + ($x$026))|0; + $94 = HEAP32[$61>>2]|0; + $95 = HEAP32[$75>>2]|0; + $96 = HEAP32[$76>>2]|0; + $97 = Math_imul($96, $90)|0; + $tmp = (($93) + ($97))|0; + $tmp5 = $tmp << 3; + $98 = (($95) + ($tmp5)|0); + FUNCTION_TABLE_viii[$94 & 31]($98,$96,$data); + $99 = (($x$026) + 1)|0; + $100 = HEAP32[$71>>2]|0; + $101 = ($99|0)<($100|0); + if ($101) { + $92 = $100;$x$026 = $99; + } else { + break; + } + } + } + $102 = (($y$029) + 1)|0; + $103 = HEAP32[$68>>2]|0; + $104 = ($102|0)<($103|0); + if ($104) { + $y$029 = $102; + } else { + break; + } + } + } + $105 = (($k$032) + 1)|0; + $106 = HEAP32[$3>>2]|0; + $107 = ($105|0)<($106|0); + if ($107) { + $k$032 = $105; + } else { + break; + } + } + } + $108 = HEAP32[$58>>2]|0; + $109 = (($108) + -1)|0; + HEAP32[$58>>2] = $109; + $110 = ($108|0)<(2); + if ($110) { + $111 = HEAP32[$59>>2]|0; + $112 = ($111|0)<(24); + if ($112) { + _stbi__grow_buffer_unsafe($z); + } + $113 = HEAP8[$60>>0]|0; + $114 = $113 & -8; + $115 = ($114<<24>>24)==(-48); + if (!($115)) { + $$1 = 1; + break L24; + } + _stbi__jpeg_reset($z); + } + $116 = (($i1$035) + 1)|0; + $117 = HEAP32[$57>>2]|0; + $118 = ($116|0)<($117|0); + if ($118) { + $i1$035 = $116; + } else { + break; + } + } + } + $119 = (($j2$038) + 1)|0; + $120 = HEAP32[$54>>2]|0; + $121 = ($119|0)<($120|0); + if ($121) { + $j2$038 = $119; + } else { + $$1 = 1; + break; + } + } + } else { + $$1 = 1; + } + } while(0); + $$2 = $$1; + STACKTOP = sp;return ($$2|0); + } + if ($5) { + $129 = ((($z)) + 18156|0); + $130 = HEAP32[$129>>2]|0; + $131 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 28|0); + $132 = HEAP32[$131>>2]|0; + $133 = (($132) + 7)|0; + $134 = $133 >> 3; + $135 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 32|0); + $136 = HEAP32[$135>>2]|0; + $137 = (($136) + 7)|0; + $138 = $137 >> 3; + $139 = ($138|0)>(0); + if (!($139)) { + $$2 = 1; + STACKTOP = sp;return ($$2|0); + } + $140 = ($134|0)>(0); + $141 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 60|0); + $142 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 64|0); + $143 = ((($z)) + 18128|0); + $144 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 16|0); + $145 = ((($z)) + 18176|0); + $146 = ((($z)) + 18112|0); + $147 = ((($z)) + 18116|0); + $148 = (((((($z)) + 17820|0) + (($130*72)|0)|0)) + 20|0); + $j7$043 = 0; + L61: while(1) { + if ($140) { + $i6$040 = 0; + while(1) { + $149 = HEAP32[$141>>2]|0; + $150 = HEAP32[$142>>2]|0; + $151 = Math_imul($150, $j7$043)|0; + $152 = (($151) + ($i6$040))|0; + $153 = $152 << 6; + $154 = (($149) + ($153<<1)|0); + $155 = HEAP32[$143>>2]|0; + $156 = ($155|0)==(0); + if ($156) { + $157 = HEAP32[$144>>2]|0; + $158 = (((($z)) + 4|0) + (($157*1680)|0)|0); + $159 = (_stbi__jpeg_decode_block_prog_dc($z,$154,$158,$130)|0); + $160 = ($159|0)==(0); + if ($160) { + $$2 = 0; + label = 66; + break L61; + } + } else { + $161 = HEAP32[$148>>2]|0; + $162 = (((($z)) + 6724|0) + (($161*1680)|0)|0); + $163 = (((($z)) + 13700|0) + ($161<<10)|0); + $164 = (_stbi__jpeg_decode_block_prog_ac($z,$154,$162,$163)|0); + $165 = ($164|0)==(0); + if ($165) { + $$2 = 0; + label = 66; + break L61; + } + } + $166 = HEAP32[$145>>2]|0; + $167 = (($166) + -1)|0; + HEAP32[$145>>2] = $167; + $168 = ($166|0)<(2); + if ($168) { + $169 = HEAP32[$146>>2]|0; + $170 = ($169|0)<(24); + if ($170) { + _stbi__grow_buffer_unsafe($z); + } + $171 = HEAP8[$147>>0]|0; + $172 = $171 & -8; + $173 = ($172<<24>>24)==(-48); + if (!($173)) { + $$2 = 1; + label = 66; + break L61; + } + _stbi__jpeg_reset($z); + } + $174 = (($i6$040) + 1)|0; + $175 = ($174|0)<($134|0); + if ($175) { + $i6$040 = $174; + } else { + break; + } + } + } + $176 = (($j7$043) + 1)|0; + $177 = ($176|0)<($138|0); + if ($177) { + $j7$043 = $176; + } else { + $$2 = 1; + label = 66; + break; + } + } + if ((label|0) == 66) { + STACKTOP = sp;return ($$2|0); + } + } + $122 = ((($z)) + 17808|0); + $123 = HEAP32[$122>>2]|0; + $124 = ($123|0)>(0); + if (!($124)) { + $$2 = 1; + STACKTOP = sp;return ($$2|0); + } + $125 = ((($z)) + 17804|0); + $126 = ((($z)) + 18176|0); + $127 = ((($z)) + 18112|0); + $128 = ((($z)) + 18116|0); + $j14$057 = 0; + L87: while(1) { + $178 = HEAP32[$125>>2]|0; + $179 = ($178|0)>(0); + if ($179) { + $i13$054 = 0; + while(1) { + $180 = HEAP32[$3>>2]|0; + $181 = ($180|0)>(0); + if ($181) { + $k15$051 = 0; + while(1) { + $182 = (((($z)) + 18156|0) + ($k15$051<<2)|0); + $183 = HEAP32[$182>>2]|0; + $184 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 8|0); + $185 = HEAP32[$184>>2]|0; + $186 = ($185|0)>(0); + if ($186) { + $187 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 4|0); + $188 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 60|0); + $189 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 64|0); + $190 = (((((($z)) + 17820|0) + (($183*72)|0)|0)) + 16|0); + $y17$048 = 0; + while(1) { + $191 = HEAP32[$187>>2]|0; + $192 = ($191|0)>(0); + if ($192) { + $197 = $191;$x16$045 = 0; + while(1) { + $196 = Math_imul($197, $i13$054)|0; + $198 = (($196) + ($x16$045))|0; + $199 = HEAP32[$184>>2]|0; + $200 = Math_imul($199, $j14$057)|0; + $201 = (($200) + ($y17$048))|0; + $202 = HEAP32[$188>>2]|0; + $203 = HEAP32[$189>>2]|0; + $204 = Math_imul($201, $203)|0; + $205 = (($198) + ($204))|0; + $206 = $205 << 6; + $207 = (($202) + ($206<<1)|0); + $208 = HEAP32[$190>>2]|0; + $209 = (((($z)) + 4|0) + (($208*1680)|0)|0); + $210 = (_stbi__jpeg_decode_block_prog_dc($z,$207,$209,$183)|0); + $211 = ($210|0)==(0); + $194 = (($x16$045) + 1)|0; + if ($211) { + $$2 = 0; + label = 66; + break L87; + } + $193 = HEAP32[$187>>2]|0; + $195 = ($194|0)<($193|0); + if ($195) { + $197 = $193;$x16$045 = $194; + } else { + break; + } + } + } + $212 = (($y17$048) + 1)|0; + $213 = HEAP32[$184>>2]|0; + $214 = ($212|0)<($213|0); + if ($214) { + $y17$048 = $212; + } else { + break; + } + } + } + $215 = (($k15$051) + 1)|0; + $216 = HEAP32[$3>>2]|0; + $217 = ($215|0)<($216|0); + if ($217) { + $k15$051 = $215; + } else { + break; + } + } + } + $218 = HEAP32[$126>>2]|0; + $219 = (($218) + -1)|0; + HEAP32[$126>>2] = $219; + $220 = ($218|0)<(2); + if ($220) { + $221 = HEAP32[$127>>2]|0; + $222 = ($221|0)<(24); + if ($222) { + _stbi__grow_buffer_unsafe($z); + } + $223 = HEAP8[$128>>0]|0; + $224 = $223 & -8; + $225 = ($224<<24>>24)==(-48); + if (!($225)) { + $$2 = 1; + label = 66; + break L87; + } + _stbi__jpeg_reset($z); + } + $226 = (($i13$054) + 1)|0; + $227 = HEAP32[$125>>2]|0; + $228 = ($226|0)<($227|0); + if ($228) { + $i13$054 = $226; + } else { + break; + } + } + } + $229 = (($j14$057) + 1)|0; + $230 = HEAP32[$122>>2]|0; + $231 = ($229|0)<($230|0); + if ($231) { + $j14$057 = $229; + } else { + $$2 = 1; + label = 66; + break; + } + } + if ((label|0) == 66) { + STACKTOP = sp;return ($$2|0); + } + return (0)|0; +} +function _stbi__jpeg_finish($z) { + $z = $z|0; + var $$sum = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond8 = 0, $i$02 = 0, $j$03 = 0, $n$06 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($z)) + 18124|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + return; + } + $3 = HEAP32[$z>>2]|0; + $4 = ((($3)) + 8|0); + $5 = HEAP32[$4>>2]|0; + $6 = ($5|0)>(0); + if (!($6)) { + return; + } + $7 = ((($z)) + 18180|0); + $n$06 = 0; + while(1) { + $8 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 28|0); + $9 = HEAP32[$8>>2]|0; + $10 = (($9) + 7)|0; + $11 = $10 >> 3; + $12 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 32|0); + $13 = HEAP32[$12>>2]|0; + $14 = (($13) + 7)|0; + $15 = $14 >> 3; + $16 = ($15|0)>(0); + if ($16) { + $17 = ($11|0)>(0); + $18 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 60|0); + $19 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 64|0); + $20 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 12|0); + $21 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 44|0); + $22 = (((((($z)) + 17820|0) + (($n$06*72)|0)|0)) + 36|0); + $j$03 = 0; + while(1) { + if ($17) { + $i$02 = 0; + while(1) { + $23 = HEAP32[$18>>2]|0; + $24 = HEAP32[$19>>2]|0; + $25 = Math_imul($24, $j$03)|0; + $26 = (($25) + ($i$02))|0; + $27 = $26 << 6; + $28 = (($23) + ($27<<1)|0); + $29 = HEAP32[$20>>2]|0; + $30 = (((($z)) + 13444|0) + ($29<<6)|0); + _stbi__jpeg_dequantize($28,$30); + $31 = HEAP32[$7>>2]|0; + $32 = HEAP32[$21>>2]|0; + $33 = HEAP32[$22>>2]|0; + $34 = Math_imul($33, $j$03)|0; + $35 = (($34) + ($i$02))|0; + $$sum = $35 << 3; + $36 = (($32) + ($$sum)|0); + FUNCTION_TABLE_viii[$31 & 31]($36,$33,$28); + $37 = (($i$02) + 1)|0; + $exitcond = ($37|0)==($11|0); + if ($exitcond) { + break; + } else { + $i$02 = $37; + } + } + } + $38 = (($j$03) + 1)|0; + $exitcond8 = ($38|0)==($15|0); + if ($exitcond8) { + break; + } else { + $j$03 = $38; + } + } + } + $39 = (($n$06) + 1)|0; + $40 = HEAP32[$z>>2]|0; + $41 = ((($40)) + 8|0); + $42 = HEAP32[$41>>2]|0; + $43 = ($39|0)<($42|0); + if ($43) { + $n$06 = $39; + } else { + break; + } + } + return; +} +function _stbi__jpeg_dequantize($data,$dequant) { + $data = $data|0; + $dequant = $dequant|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $exitcond = 0, $i$01 = 0, label = 0, sp = 0; + sp = STACKTOP; + $i$01 = 0; + while(1) { + $0 = (($dequant) + ($i$01)|0); + $1 = HEAP8[$0>>0]|0; + $2 = $1&255; + $3 = (($data) + ($i$01<<1)|0); + $4 = HEAP16[$3>>1]|0; + $5 = $4 << 16 >> 16; + $6 = Math_imul($5, $2)|0; + $7 = $6&65535; + HEAP16[$3>>1] = $7; + $8 = (($i$01) + 1)|0; + $exitcond = ($8|0)==(64); + if ($exitcond) { + break; + } else { + $i$01 = $8; + } + } + return; +} +function _stbi__jpeg_reset($j) { + $j = $j|0; + var $$ = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18112|0); + HEAP32[$0>>2] = 0; + $1 = ((($j)) + 18108|0); + HEAP32[$1>>2] = 0; + $2 = ((($j)) + 18120|0); + HEAP32[$2>>2] = 0; + $3 = ((($j)) + 17988|0); + HEAP32[$3>>2] = 0; + $4 = ((($j)) + 17916|0); + HEAP32[$4>>2] = 0; + $5 = ((($j)) + 17844|0); + HEAP32[$5>>2] = 0; + $6 = ((($j)) + 18116|0); + HEAP8[$6>>0] = -1; + $7 = ((($j)) + 18172|0); + $8 = HEAP32[$7>>2]|0; + $9 = ($8|0)==(0); + $$ = $9 ? 2147483647 : $8; + $10 = ((($j)) + 18176|0); + HEAP32[$10>>2] = $$; + $11 = ((($j)) + 18144|0); + HEAP32[$11>>2] = 0; + return; +} +function _stbi__jpeg_decode_block($j,$data,$hdc,$hac,$fac,$b,$dequant) { + $j = $j|0; + $data = $data|0; + $hdc = $hdc|0; + $hac = $hac|0; + $fac = $fac|0; + $b = $b|0; + $dequant = $dequant|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$1 = 0, dest = 0, label = 0, sp = 0, stop = 0; + sp = STACKTOP; + $0 = ((($j)) + 18112|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<(16); + if ($2) { + _stbi__grow_buffer_unsafe($j); + } + $3 = (_stbi__jpeg_huff_decode($j,$hdc)|0); + $4 = ($3|0)<(0); + if ($4) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0)); + $5 = ($3|0)==(0); + if ($5) { + $10 = 0; + } else { + $6 = (_stbi__extend_receive($j,$3)|0); + $10 = $6; + } + $7 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0); + $8 = HEAP32[$7>>2]|0; + $9 = (($8) + ($10))|0; + HEAP32[$7>>2] = $9; + $11 = HEAP8[$dequant>>0]|0; + $12 = $11&255; + $13 = Math_imul($12, $9)|0; + $14 = $13&65535; + HEAP16[$data>>1] = $14; + $15 = ((($j)) + 18108|0); + $k$0 = 1; + L11: while(1) { + $16 = HEAP32[$0>>2]|0; + $17 = ($16|0)<(16); + if ($17) { + _stbi__grow_buffer_unsafe($j); + } + $18 = HEAP32[$15>>2]|0; + $19 = $18 >>> 23; + $20 = (($fac) + ($19<<1)|0); + $21 = HEAP16[$20>>1]|0; + $22 = $21 << 16 >> 16; + $23 = ($21<<16>>16)==(0); + do { + if ($23) { + $42 = (_stbi__jpeg_huff_decode($j,$hac)|0); + $43 = ($42|0)<(0); + if ($43) { + label = 13; + break L11; + } + $44 = $42 & 15; + $45 = ($44|0)==(0); + if (!($45)) { + $48 = $42 >> 4; + $49 = (($48) + ($k$0))|0; + $50 = (($49) + 1)|0; + $51 = (13438 + ($49)|0); + $52 = HEAP8[$51>>0]|0; + $53 = $52&255; + $54 = (_stbi__extend_receive($j,$44)|0); + $55 = (($dequant) + ($53)|0); + $56 = HEAP8[$55>>0]|0; + $57 = $56&255; + $58 = Math_imul($57, $54)|0; + $59 = $58&65535; + $60 = (($data) + ($53<<1)|0); + HEAP16[$60>>1] = $59; + $k$1 = $50; + break; + } + $46 = ($42|0)==(240); + if (!($46)) { + $$0 = 1; + label = 19; + break L11; + } + $47 = (($k$0) + 16)|0; + $k$1 = $47; + } else { + $24 = $22 >>> 4; + $25 = $24 & 15; + $26 = (($25) + ($k$0))|0; + $27 = $22 & 15; + $28 = $18 << $27; + HEAP32[$15>>2] = $28; + $29 = HEAP32[$0>>2]|0; + $30 = (($29) - ($27))|0; + HEAP32[$0>>2] = $30; + $31 = (($26) + 1)|0; + $32 = (13438 + ($26)|0); + $33 = HEAP8[$32>>0]|0; + $34 = $33&255; + $35 = $22 >> 8; + $36 = (($dequant) + ($34)|0); + $37 = HEAP8[$36>>0]|0; + $38 = $37&255; + $39 = Math_imul($38, $35)|0; + $40 = $39&65535; + $41 = (($data) + ($34<<1)|0); + HEAP16[$41>>1] = $40; + $k$1 = $31; + } + } while(0); + $61 = ($k$1|0)<(64); + if ($61) { + $k$0 = $k$1; + } else { + $$0 = 1; + label = 19; + break; + } + } + if ((label|0) == 13) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 19) { + return ($$0|0); + } + return (0)|0; +} +function _stbi__grow_buffer_unsafe($j) { + $j = $j|0; + var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18120|0); + $1 = ((($j)) + 18112|0); + $2 = ((($j)) + 18108|0); + while(1) { + $3 = HEAP32[$0>>2]|0; + $4 = ($3|0)==(0); + if ($4) { + $5 = HEAP32[$j>>2]|0; + $6 = (_stbi__get8($5)|0); + $7 = $6&255; + $8 = ($6<<24>>24)==(-1); + if ($8) { + $9 = HEAP32[$j>>2]|0; + $10 = (_stbi__get8($9)|0); + $11 = ($10<<24>>24)==(0); + if ($11) { + $16 = 255; + } else { + $$lcssa = $10; + break; + } + } else { + $16 = $7; + } + } else { + $16 = 0; + } + $13 = HEAP32[$1>>2]|0; + $14 = (24 - ($13))|0; + $15 = $16 << $14; + $17 = HEAP32[$2>>2]|0; + $18 = $15 | $17; + HEAP32[$2>>2] = $18; + $19 = HEAP32[$1>>2]|0; + $20 = (($19) + 8)|0; + HEAP32[$1>>2] = $20; + $21 = ($20|0)<(25); + if (!($21)) { + label = 7; + break; + } + } + if ((label|0) == 7) { + return; + } + $12 = ((($j)) + 18116|0); + HEAP8[$12>>0] = $$lcssa; + HEAP32[$0>>2] = 1; + return; +} +function _stbi__jpeg_decode_block_prog_dc($j,$data,$hdc,$b) { + $j = $j|0; + $data = $data|0; + $hdc = $hdc|0; + $b = $b|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, dest = 0, label = 0, sp = 0, stop = 0; + sp = STACKTOP; + $0 = ((($j)) + 18132|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + if (!($2)) { + _stbi__err(14624); + $$0 = 0; + return ($$0|0); + } + $3 = ((($j)) + 18112|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)<(16); + if ($5) { + _stbi__grow_buffer_unsafe($j); + } + $6 = ((($j)) + 18136|0); + $7 = HEAP32[$6>>2]|0; + $8 = ($7|0)==(0); + if ($8) { + dest=$data; stop=dest+128|0; do { HEAP16[dest>>1]=0|0; dest=dest+2|0; } while ((dest|0) < (stop|0)); + $9 = (_stbi__jpeg_huff_decode($j,$hdc)|0); + $10 = ($9|0)==(0); + if ($10) { + $15 = 0; + } else { + $11 = (_stbi__extend_receive($j,$9)|0); + $15 = $11; + } + $12 = (((((($j)) + 17820|0) + (($b*72)|0)|0)) + 24|0); + $13 = HEAP32[$12>>2]|0; + $14 = (($13) + ($15))|0; + HEAP32[$12>>2] = $14; + $16 = ((($j)) + 18140|0); + $17 = HEAP32[$16>>2]|0; + $18 = $14 << $17; + $19 = $18&65535; + HEAP16[$data>>1] = $19; + $$0 = 1; + return ($$0|0); + } else { + $20 = (_stbi__jpeg_get_bit($j)|0); + $21 = ($20|0)==(0); + if ($21) { + $$0 = 1; + return ($$0|0); + } + $22 = ((($j)) + 18140|0); + $23 = HEAP32[$22>>2]|0; + $sext = 65536 << $23; + $24 = $sext >>> 16; + $25 = HEAP16[$data>>1]|0; + $26 = $25&65535; + $27 = (($26) + ($24))|0; + $28 = $27&65535; + HEAP16[$data>>1] = $28; + $$0 = 1; + return ($$0|0); + } + return (0)|0; +} +function _stbi__jpeg_decode_block_prog_ac($j,$data,$hac,$fac) { + $j = $j|0; + $data = $data|0; + $hac = $hac|0; + $fac = $fac|0; + var $$ = 0, $$0 = 0, $$lcssa = 0, $$lcssa63 = 0, $$lcssa63$lcssa = 0, $$lcssa66 = 0, $$lcssa66$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0; + var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0; + var $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; + var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; + var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0; + var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0; + var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0; + var $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $k$0 = 0, $k$1 = 0, $k$223 = 0, $k$3 = 0, $k$4$ph20 = 0, $k$415 = 0, $k$415$lcssa = 0, $k$5 = 0, $r1$0$ph = 0, $r1$0$ph519 = 0, $s2$0$ph = 0, $sext = 0, $sext1 = 0, $sext2 = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18128|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + _stbi__err(14624); + $$0 = 0; + return ($$0|0); + } + $3 = ((($j)) + 18136|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)==(0); + $6 = ((($j)) + 18140|0); + $7 = HEAP32[$6>>2]|0; + if ($5) { + $8 = ((($j)) + 18144|0); + $9 = HEAP32[$8>>2]|0; + $10 = ($9|0)==(0); + if (!($10)) { + $14 = (($9) + -1)|0; + HEAP32[$8>>2] = $14; + $$0 = 1; + return ($$0|0); + } + $11 = ((($j)) + 18112|0); + $12 = ((($j)) + 18108|0); + $13 = ((($j)) + 18132|0); + $k$0 = $1; + L11: while(1) { + $15 = HEAP32[$11>>2]|0; + $16 = ($15|0)<(16); + if ($16) { + _stbi__grow_buffer_unsafe($j); + } + $17 = HEAP32[$12>>2]|0; + $18 = $17 >>> 23; + $19 = (($fac) + ($18<<1)|0); + $20 = HEAP16[$19>>1]|0; + $21 = $20 << 16 >> 16; + $22 = ($20<<16>>16)==(0); + do { + if ($22) { + $38 = (_stbi__jpeg_huff_decode($j,$hac)|0); + $39 = ($38|0)<(0); + if ($39) { + label = 12; + break L11; + } + $40 = $38 & 15; + $41 = $38 >> 4; + $42 = ($40|0)==(0); + if (!($42)) { + $52 = (($41) + ($k$0))|0; + $53 = (($52) + 1)|0; + $54 = (13438 + ($52)|0); + $55 = HEAP8[$54>>0]|0; + $56 = $55&255; + $57 = (_stbi__extend_receive($j,$40)|0); + $58 = $57 << $7; + $59 = $58&65535; + $60 = (($data) + ($56<<1)|0); + HEAP16[$60>>1] = $59; + $k$1 = $53; + break; + } + $43 = ($41|0)<(15); + if ($43) { + $$lcssa = $41; + label = 15; + break L11; + } + $51 = (($k$0) + 16)|0; + $k$1 = $51; + } else { + $23 = $21 >>> 4; + $24 = $23 & 15; + $25 = (($24) + ($k$0))|0; + $26 = $21 & 15; + $27 = $17 << $26; + HEAP32[$12>>2] = $27; + $28 = HEAP32[$11>>2]|0; + $29 = (($28) - ($26))|0; + HEAP32[$11>>2] = $29; + $30 = (($25) + 1)|0; + $31 = (13438 + ($25)|0); + $32 = HEAP8[$31>>0]|0; + $33 = $32&255; + $34 = $21 >> 8; + $35 = $34 << $7; + $36 = $35&65535; + $37 = (($data) + ($33<<1)|0); + HEAP16[$37>>1] = $36; + $k$1 = $30; + } + } while(0); + $61 = HEAP32[$13>>2]|0; + $62 = ($k$1|0)>($61|0); + if ($62) { + $$0 = 1; + label = 53; + break; + } else { + $k$0 = $k$1; + } + } + if ((label|0) == 12) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 15) { + $44 = 1 << $$lcssa; + HEAP32[$8>>2] = $44; + $45 = ($$lcssa|0)==(0); + if (!($45)) { + $46 = (_stbi__jpeg_get_bits($j,$$lcssa)|0); + $47 = HEAP32[$8>>2]|0; + $48 = (($47) + ($46))|0; + HEAP32[$8>>2] = $48; + } + $49 = HEAP32[$8>>2]|0; + $50 = (($49) + -1)|0; + HEAP32[$8>>2] = $50; + $$0 = 1; + return ($$0|0); + } + else if ((label|0) == 53) { + return ($$0|0); + } + } + $63 = 1 << $7; + $64 = ((($j)) + 18144|0); + $65 = HEAP32[$64>>2]|0; + $66 = ($65|0)==(0); + if (!($66)) { + $71 = (($65) + -1)|0; + HEAP32[$64>>2] = $71; + $72 = HEAP32[$0>>2]|0; + $73 = ((($j)) + 18132|0); + $74 = HEAP32[$73>>2]|0; + $75 = ($72|0)>($74|0); + if ($75) { + $$0 = 1; + return ($$0|0); + } + $sext2 = $63 << 16; + $76 = $sext2 >> 16; + $k$223 = $72; + while(1) { + $77 = (13438 + ($k$223)|0); + $78 = HEAP8[$77>>0]|0; + $79 = $78&255; + $80 = (($data) + ($79<<1)|0); + $81 = HEAP16[$80>>1]|0; + $82 = ($81<<16>>16)==(0); + do { + if (!($82)) { + $83 = (_stbi__jpeg_get_bit($j)|0); + $84 = ($83|0)==(0); + if (!($84)) { + $85 = HEAP16[$80>>1]|0; + $86 = $85 << 16 >> 16; + $87 = $86 & $76; + $88 = ($87|0)==(0); + if ($88) { + $89 = ($85<<16>>16)>(0); + if ($89) { + $90 = (($86) + ($76))|0; + $91 = $90&65535; + HEAP16[$80>>1] = $91; + break; + } else { + $92 = (($86) - ($76))|0; + $93 = $92&65535; + HEAP16[$80>>1] = $93; + break; + } + } + } + } + } while(0); + $94 = (($k$223) + 1)|0; + $95 = HEAP32[$73>>2]|0; + $96 = ($k$223|0)<($95|0); + if ($96) { + $k$223 = $94; + } else { + $$0 = 1; + break; + } + } + return ($$0|0); + } + $sext = $63 << 16; + $67 = $sext >> 16; + $68 = (0 - ($67))|0; + $69 = ((($j)) + 18132|0); + $sext1 = $63 << 16; + $70 = $sext1 >> 16; + $k$3 = $1; + L52: while(1) { + $97 = (_stbi__jpeg_huff_decode($j,$hac)|0); + $98 = ($97|0)<(0); + if ($98) { + label = 33; + break; + } + $99 = $97 & 15; + $100 = $97 >> 4; + switch ($99|0) { + case 0: { + $101 = ($100|0)<(15); + if ($101) { + $102 = 1 << $100; + $103 = (($102) + -1)|0; + HEAP32[$64>>2] = $103; + $104 = ($100|0)==(0); + if ($104) { + $r1$0$ph = 64;$s2$0$ph = 0; + } else { + $105 = (_stbi__jpeg_get_bits($j,$100)|0); + $106 = HEAP32[$64>>2]|0; + $107 = (($106) + ($105))|0; + HEAP32[$64>>2] = $107; + $r1$0$ph = 64;$s2$0$ph = 0; + } + } else { + $r1$0$ph = $100;$s2$0$ph = 0; + } + break; + } + case 1: { + $108 = (_stbi__jpeg_get_bit($j)|0); + $109 = ($108|0)==(0); + $$ = $109 ? $68 : $67; + $r1$0$ph = $100;$s2$0$ph = $$; + break; + } + default: { + label = 38; + break L52; + } + } + $110 = HEAP32[$69>>2]|0; + $111 = ($k$3|0)>($110|0); + L61: do { + if ($111) { + $k$5 = $k$3; + } else { + $k$4$ph20 = $k$3;$r1$0$ph519 = $r1$0$ph; + while(1) { + $k$415 = $k$4$ph20; + while(1) { + $115 = (($k$415) + 1)|0; + $116 = (13438 + ($k$415)|0); + $117 = HEAP8[$116>>0]|0; + $118 = $117&255; + $119 = (($data) + ($118<<1)|0); + $120 = HEAP16[$119>>1]|0; + $121 = ($120<<16>>16)==(0); + if ($121) { + $$lcssa63 = $115;$$lcssa66 = $119;$k$415$lcssa = $k$415; + break; + } + $122 = (_stbi__jpeg_get_bit($j)|0); + $123 = ($122|0)==(0); + do { + if (!($123)) { + $124 = HEAP16[$119>>1]|0; + $125 = $124 << 16 >> 16; + $126 = $125 & $70; + $127 = ($126|0)==(0); + if ($127) { + $128 = ($124<<16>>16)>(0); + if ($128) { + $129 = (($125) + ($70))|0; + $130 = $129&65535; + HEAP16[$119>>1] = $130; + break; + } else { + $133 = (($125) - ($70))|0; + $134 = $133&65535; + HEAP16[$119>>1] = $134; + break; + } + } + } + } while(0); + $131 = HEAP32[$69>>2]|0; + $132 = ($k$415|0)<($131|0); + if ($132) { + $k$415 = $115; + } else { + $k$5 = $115; + break L61; + } + } + $135 = ($r1$0$ph519|0)==(0); + if ($135) { + $$lcssa63$lcssa = $$lcssa63;$$lcssa66$lcssa = $$lcssa66; + break; + } + $112 = (($r1$0$ph519) + -1)|0; + $113 = HEAP32[$69>>2]|0; + $114 = ($k$415$lcssa|0)<($113|0); + if ($114) { + $k$4$ph20 = $$lcssa63;$r1$0$ph519 = $112; + } else { + $k$5 = $$lcssa63; + break L61; + } + } + $136 = $s2$0$ph&65535; + HEAP16[$$lcssa66$lcssa>>1] = $136; + $k$5 = $$lcssa63$lcssa; + } + } while(0); + $137 = HEAP32[$69>>2]|0; + $138 = ($k$5|0)>($137|0); + if ($138) { + $$0 = 1; + label = 53; + break; + } else { + $k$3 = $k$5; + } + } + if ((label|0) == 33) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 38) { + _stbi__err(13869); + $$0 = 0; + return ($$0|0); + } + else if ((label|0) == 53) { + return ($$0|0); + } + return (0)|0; +} +function _stbi__jpeg_huff_decode($j,$h) { + $j = $j|0; + $h = $h|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $k$0 = 0, $k$0$lcssa = 0; + var label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18112|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<(16); + if ($2) { + _stbi__grow_buffer_unsafe($j); + } + $3 = ((($j)) + 18108|0); + $4 = HEAP32[$3>>2]|0; + $5 = $4 >>> 23; + $6 = (($h) + ($5)|0); + $7 = HEAP8[$6>>0]|0; + $8 = $7&255; + $9 = ($7<<24>>24)==(-1); + if (!($9)) { + $10 = (((($h)) + 1280|0) + ($8)|0); + $11 = HEAP8[$10>>0]|0; + $12 = $11&255; + $13 = HEAP32[$0>>2]|0; + $14 = ($12|0)>($13|0); + if ($14) { + $$0 = -1; + return ($$0|0); + } + $15 = $4 << $12; + HEAP32[$3>>2] = $15; + $16 = HEAP32[$0>>2]|0; + $17 = (($16) - ($12))|0; + HEAP32[$0>>2] = $17; + $18 = (((($h)) + 1024|0) + ($8)|0); + $19 = HEAP8[$18>>0]|0; + $20 = $19&255; + $$0 = $20; + return ($$0|0); + } + $21 = $4 >>> 16; + $k$0 = 10; + while(1) { + $22 = (((($h)) + 1540|0) + ($k$0<<2)|0); + $23 = HEAP32[$22>>2]|0; + $24 = ($21>>>0)<($23>>>0); + $25 = (($k$0) + 1)|0; + if ($24) { + $k$0$lcssa = $k$0; + break; + } else { + $k$0 = $25; + } + } + $26 = ($k$0$lcssa|0)==(17); + $27 = HEAP32[$0>>2]|0; + if ($26) { + $28 = (($27) + -16)|0; + HEAP32[$0>>2] = $28; + $$0 = -1; + return ($$0|0); + } + $29 = ($27|0)<($k$0$lcssa|0); + if ($29) { + $$0 = -1; + return ($$0|0); + } + $30 = HEAP32[$3>>2]|0; + $31 = (32 - ($k$0$lcssa))|0; + $32 = $30 >>> $31; + $33 = (6280 + ($k$0$lcssa<<2)|0); + $34 = HEAP32[$33>>2]|0; + $35 = $32 & $34; + $36 = (((($h)) + 1612|0) + ($k$0$lcssa<<2)|0); + $37 = HEAP32[$36>>2]|0; + $38 = (($35) + ($37))|0; + $39 = (((($h)) + 1280|0) + ($38)|0); + $40 = HEAP8[$39>>0]|0; + $41 = $40&255; + $42 = (32 - ($41))|0; + $43 = $30 >>> $42; + $44 = (6280 + ($41<<2)|0); + $45 = HEAP32[$44>>2]|0; + $46 = $43 & $45; + $47 = (((($h)) + 512|0) + ($38<<1)|0); + $48 = HEAP16[$47>>1]|0; + $49 = $48&65535; + $50 = ($46|0)==($49|0); + if (!($50)) { + ___assert_fail((14730|0),(12975|0),1659,(14812|0)); + // unreachable; + } + $51 = (($27) - ($k$0$lcssa))|0; + HEAP32[$0>>2] = $51; + $52 = HEAP32[$3>>2]|0; + $53 = $52 << $k$0$lcssa; + HEAP32[$3>>2] = $53; + $54 = (((($h)) + 1024|0) + ($38)|0); + $55 = HEAP8[$54>>0]|0; + $56 = $55&255; + $$0 = $56; + return ($$0|0); +} +function _stbi__jpeg_get_bits($j,$n) { + $j = $j|0; + $n = $n|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18112|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<($n|0); + if ($2) { + _stbi__grow_buffer_unsafe($j); + } + $3 = ((($j)) + 18108|0); + $4 = HEAP32[$3>>2]|0; + $5 = $4 << $n; + $6 = (32 - ($n))|0; + $7 = $4 >>> $6; + $8 = $5 | $7; + $9 = (6280 + ($n<<2)|0); + $10 = HEAP32[$9>>2]|0; + $11 = $10 ^ -1; + $12 = $8 & $11; + HEAP32[$3>>2] = $12; + $13 = HEAP32[$9>>2]|0; + $14 = $8 & $13; + $15 = HEAP32[$0>>2]|0; + $16 = (($15) - ($n))|0; + HEAP32[$0>>2] = $16; + return ($14|0); +} +function _stbi__extend_receive($j,$n) { + $j = $j|0; + $n = $n|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18112|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<($n|0); + if ($2) { + _stbi__grow_buffer_unsafe($j); + } + $3 = ((($j)) + 18108|0); + $4 = HEAP32[$3>>2]|0; + $5 = $4 << $n; + $6 = (32 - ($n))|0; + $7 = $4 >>> $6; + $8 = $5 | $7; + $9 = ($n>>>0)<(17); + if ($9) { + $10 = $4 >> 31; + $11 = (6280 + ($n<<2)|0); + $12 = HEAP32[$11>>2]|0; + $13 = $12 ^ -1; + $14 = $8 & $13; + HEAP32[$3>>2] = $14; + $15 = HEAP32[$11>>2]|0; + $16 = $15 & $8; + $17 = HEAP32[$0>>2]|0; + $18 = (($17) - ($n))|0; + HEAP32[$0>>2] = $18; + $19 = (6348 + ($n<<2)|0); + $20 = HEAP32[$19>>2]|0; + $21 = $10 ^ -1; + $22 = $20 & $21; + $23 = (($22) + ($16))|0; + return ($23|0); + } else { + ___assert_fail((14646|0),(12975|0),1680,(14709|0)); + // unreachable; + } + return (0)|0; +} +function _stbi__jpeg_get_bit($j) { + $j = $j|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($j)) + 18112|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<(1); + if ($2) { + _stbi__grow_buffer_unsafe($j); + } + $3 = ((($j)) + 18108|0); + $4 = HEAP32[$3>>2]|0; + $5 = $4 << 1; + HEAP32[$3>>2] = $5; + $6 = HEAP32[$0>>2]|0; + $7 = (($6) + -1)|0; + HEAP32[$0>>2] = $7; + $8 = $4 & -2147483648; + return ($8|0); +} +function _stbi__idct_block($out,$out_stride,$data) { + $out = $out|0; + $out_stride = $out_stride|0; + $data = $data|0; + var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; + var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; + var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; + var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; + var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; + var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; + var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; + var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; + var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; + var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; + var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $d$04 = 0, $exitcond = 0, $exitcond9 = 0, $i$08 = 0, $i$13 = 0, $o$01 = 0, $v$06 = 0, $v$12 = 0; + var $val = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $val = sp; + $d$04 = $data;$i$08 = 0;$v$06 = $val; + while(1) { + $0 = ((($d$04)) + 16|0); + $1 = HEAP16[$0>>1]|0; + $2 = ($1<<16>>16)==(0); + if ($2) { + $3 = ((($d$04)) + 32|0); + $4 = HEAP16[$3>>1]|0; + $5 = ($4<<16>>16)==(0); + if ($5) { + $6 = ((($d$04)) + 48|0); + $7 = HEAP16[$6>>1]|0; + $8 = ($7<<16>>16)==(0); + if ($8) { + $9 = ((($d$04)) + 64|0); + $10 = HEAP16[$9>>1]|0; + $11 = ($10<<16>>16)==(0); + if ($11) { + $12 = ((($d$04)) + 80|0); + $13 = HEAP16[$12>>1]|0; + $14 = ($13<<16>>16)==(0); + if ($14) { + $15 = ((($d$04)) + 96|0); + $16 = HEAP16[$15>>1]|0; + $17 = ($16<<16>>16)==(0); + if ($17) { + $18 = ((($d$04)) + 112|0); + $19 = HEAP16[$18>>1]|0; + $20 = ($19<<16>>16)==(0); + if ($20) { + $21 = HEAP16[$d$04>>1]|0; + $22 = $21 << 16 >> 16; + $23 = $22 << 2; + $24 = ((($v$06)) + 224|0); + HEAP32[$24>>2] = $23; + $25 = ((($v$06)) + 192|0); + HEAP32[$25>>2] = $23; + $26 = ((($v$06)) + 160|0); + HEAP32[$26>>2] = $23; + $27 = ((($v$06)) + 128|0); + HEAP32[$27>>2] = $23; + $28 = ((($v$06)) + 96|0); + HEAP32[$28>>2] = $23; + $29 = ((($v$06)) + 64|0); + HEAP32[$29>>2] = $23; + $30 = ((($v$06)) + 32|0); + HEAP32[$30>>2] = $23; + HEAP32[$v$06>>2] = $23; + } else { + label = 10; + } + } else { + label = 10; + } + } else { + label = 10; + } + } else { + label = 10; + } + } else { + label = 10; + } + } else { + label = 10; + } + } else { + label = 10; + } + if ((label|0) == 10) { + label = 0; + $31 = ((($d$04)) + 32|0); + $32 = HEAP16[$31>>1]|0; + $33 = $32 << 16 >> 16; + $34 = ((($d$04)) + 96|0); + $35 = HEAP16[$34>>1]|0; + $36 = $35 << 16 >> 16; + $37 = (($36) + ($33))|0; + $38 = ($37*2217)|0; + $39 = Math_imul($36, -7567)|0; + $40 = (($38) + ($39))|0; + $41 = ($33*3135)|0; + $42 = (($38) + ($41))|0; + $43 = HEAP16[$d$04>>1]|0; + $44 = $43 << 16 >> 16; + $45 = ((($d$04)) + 64|0); + $46 = HEAP16[$45>>1]|0; + $47 = $46 << 16 >> 16; + $48 = (($47) + ($44))|0; + $49 = $48 << 12; + $50 = (($44) - ($47))|0; + $51 = $50 << 12; + $52 = (($49) - ($42))|0; + $53 = (($51) - ($40))|0; + $54 = ((($d$04)) + 112|0); + $55 = HEAP16[$54>>1]|0; + $56 = $55 << 16 >> 16; + $57 = ((($d$04)) + 80|0); + $58 = HEAP16[$57>>1]|0; + $59 = $58 << 16 >> 16; + $60 = ((($d$04)) + 48|0); + $61 = HEAP16[$60>>1]|0; + $62 = $61 << 16 >> 16; + $63 = HEAP16[$0>>1]|0; + $64 = $63 << 16 >> 16; + $65 = (($62) + ($56))|0; + $66 = (($64) + ($59))|0; + $67 = (($64) + ($56))|0; + $68 = (($62) + ($59))|0; + $69 = (($66) + ($65))|0; + $70 = ($69*4816)|0; + $71 = ($56*1223)|0; + $72 = ($59*8410)|0; + $73 = ($62*12586)|0; + $74 = ($64*6149)|0; + $75 = Math_imul($67, -3685)|0; + $76 = (($70) + ($75))|0; + $77 = Math_imul($68, -10497)|0; + $78 = (($70) + ($77))|0; + $79 = Math_imul($65, -8034)|0; + $80 = Math_imul($66, -1597)|0; + $81 = (($80) + ($74))|0; + $82 = (($81) + ($76))|0; + $83 = (($79) + ($73))|0; + $84 = (($83) + ($78))|0; + $85 = (($80) + ($72))|0; + $86 = (($85) + ($78))|0; + $87 = (($79) + ($71))|0; + $88 = (($87) + ($76))|0; + $89 = (($42) + 512)|0; + $90 = (($89) + ($49))|0; + $91 = (($40) + 512)|0; + $92 = (($91) + ($51))|0; + $93 = (($53) + 512)|0; + $94 = (($52) + 512)|0; + $95 = (($82) + ($90))|0; + $96 = $95 >> 10; + HEAP32[$v$06>>2] = $96; + $97 = (($90) - ($82))|0; + $98 = $97 >> 10; + $99 = ((($v$06)) + 224|0); + HEAP32[$99>>2] = $98; + $100 = (($84) + ($92))|0; + $101 = $100 >> 10; + $102 = ((($v$06)) + 32|0); + HEAP32[$102>>2] = $101; + $103 = (($92) - ($84))|0; + $104 = $103 >> 10; + $105 = ((($v$06)) + 192|0); + HEAP32[$105>>2] = $104; + $106 = (($86) + ($93))|0; + $107 = $106 >> 10; + $108 = ((($v$06)) + 64|0); + HEAP32[$108>>2] = $107; + $109 = (($93) - ($86))|0; + $110 = $109 >> 10; + $111 = ((($v$06)) + 160|0); + HEAP32[$111>>2] = $110; + $112 = (($88) + ($94))|0; + $113 = $112 >> 10; + $114 = ((($v$06)) + 96|0); + HEAP32[$114>>2] = $113; + $115 = (($94) - ($88))|0; + $116 = $115 >> 10; + $117 = ((($v$06)) + 128|0); + HEAP32[$117>>2] = $116; + } + $118 = (($i$08) + 1)|0; + $119 = ((($d$04)) + 2|0); + $120 = ((($v$06)) + 4|0); + $exitcond9 = ($118|0)==(8); + if ($exitcond9) { + $i$13 = 0;$o$01 = $out;$v$12 = $val; + break; + } else { + $d$04 = $119;$i$08 = $118;$v$06 = $120; + } + } + while(1) { + $121 = ((($v$12)) + 8|0); + $122 = HEAP32[$121>>2]|0; + $123 = ((($v$12)) + 24|0); + $124 = HEAP32[$123>>2]|0; + $125 = (($124) + ($122))|0; + $126 = ($125*2217)|0; + $127 = Math_imul($124, -7567)|0; + $128 = (($126) + ($127))|0; + $129 = ($122*3135)|0; + $130 = (($126) + ($129))|0; + $131 = HEAP32[$v$12>>2]|0; + $132 = ((($v$12)) + 16|0); + $133 = HEAP32[$132>>2]|0; + $134 = (($133) + ($131))|0; + $135 = $134 << 12; + $136 = (($131) - ($133))|0; + $137 = $136 << 12; + $138 = (($135) - ($130))|0; + $139 = (($137) - ($128))|0; + $140 = ((($v$12)) + 28|0); + $141 = HEAP32[$140>>2]|0; + $142 = ((($v$12)) + 20|0); + $143 = HEAP32[$142>>2]|0; + $144 = ((($v$12)) + 12|0); + $145 = HEAP32[$144>>2]|0; + $146 = ((($v$12)) + 4|0); + $147 = HEAP32[$146>>2]|0; + $148 = (($145) + ($141))|0; + $149 = (($147) + ($143))|0; + $150 = (($147) + ($141))|0; + $151 = (($145) + ($143))|0; + $152 = (($149) + ($148))|0; + $153 = ($152*4816)|0; + $154 = ($141*1223)|0; + $155 = ($143*8410)|0; + $156 = ($145*12586)|0; + $157 = ($147*6149)|0; + $158 = Math_imul($150, -3685)|0; + $159 = (($153) + ($158))|0; + $160 = Math_imul($151, -10497)|0; + $161 = (($153) + ($160))|0; + $162 = Math_imul($148, -8034)|0; + $163 = Math_imul($149, -1597)|0; + $164 = (($163) + ($157))|0; + $165 = (($164) + ($159))|0; + $166 = (($162) + ($156))|0; + $167 = (($166) + ($161))|0; + $168 = (($163) + ($155))|0; + $169 = (($168) + ($161))|0; + $170 = (($162) + ($154))|0; + $171 = (($170) + ($159))|0; + $172 = (($130) + 16842752)|0; + $173 = (($172) + ($135))|0; + $174 = (($128) + 16842752)|0; + $175 = (($174) + ($137))|0; + $176 = (($139) + 16842752)|0; + $177 = (($138) + 16842752)|0; + $178 = (($165) + ($173))|0; + $179 = $178 >> 17; + $180 = (_stbi__clamp($179)|0); + HEAP8[$o$01>>0] = $180; + $181 = (($173) - ($165))|0; + $182 = $181 >> 17; + $183 = (_stbi__clamp($182)|0); + $184 = ((($o$01)) + 7|0); + HEAP8[$184>>0] = $183; + $185 = (($167) + ($175))|0; + $186 = $185 >> 17; + $187 = (_stbi__clamp($186)|0); + $188 = ((($o$01)) + 1|0); + HEAP8[$188>>0] = $187; + $189 = (($175) - ($167))|0; + $190 = $189 >> 17; + $191 = (_stbi__clamp($190)|0); + $192 = ((($o$01)) + 6|0); + HEAP8[$192>>0] = $191; + $193 = (($169) + ($176))|0; + $194 = $193 >> 17; + $195 = (_stbi__clamp($194)|0); + $196 = ((($o$01)) + 2|0); + HEAP8[$196>>0] = $195; + $197 = (($176) - ($169))|0; + $198 = $197 >> 17; + $199 = (_stbi__clamp($198)|0); + $200 = ((($o$01)) + 5|0); + HEAP8[$200>>0] = $199; + $201 = (($171) + ($177))|0; + $202 = $201 >> 17; + $203 = (_stbi__clamp($202)|0); + $204 = ((($o$01)) + 3|0); + HEAP8[$204>>0] = $203; + $205 = (($177) - ($171))|0; + $206 = $205 >> 17; + $207 = (_stbi__clamp($206)|0); + $208 = ((($o$01)) + 4|0); + HEAP8[$208>>0] = $207; + $209 = (($i$13) + 1)|0; + $210 = ((($v$12)) + 32|0); + $211 = (($o$01) + ($out_stride)|0); + $exitcond = ($209|0)==(8); + if ($exitcond) { + break; + } else { + $i$13 = $209;$o$01 = $211;$v$12 = $210; + } + } + STACKTOP = sp;return; +} +function _stbi__YCbCr_to_RGB_row($out,$y,$pcb,$pcr,$count,$step) { + $out = $out|0; + $y = $y|0; + $pcb = $pcb|0; + $pcr = $pcr|0; + $count = $count|0; + $step = $step|0; + var $$04 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b$0 = 0, $exitcond = 0, $g$0 = 0, $i$03 = 0, $r$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($count|0)>(0); + if ($0) { + $$04 = $out;$i$03 = 0; + } else { + return; + } + while(1) { + $1 = (($y) + ($i$03)|0); + $2 = HEAP8[$1>>0]|0; + $3 = $2&255; + $4 = $3 << 20; + $5 = $4 | 524288; + $6 = (($pcr) + ($i$03)|0); + $7 = HEAP8[$6>>0]|0; + $8 = $7&255; + $9 = (($8) + -128)|0; + $10 = (($pcb) + ($i$03)|0); + $11 = HEAP8[$10>>0]|0; + $12 = $11&255; + $13 = (($12) + -128)|0; + $14 = Math_imul($9, 1470208)|0; + $15 = (($14) + ($5))|0; + $16 = Math_imul($9, -748800)|0; + $17 = (($5) + ($16))|0; + $18 = Math_imul($13, -360960)|0; + $19 = $18 & -65536; + $20 = (($19) + ($17))|0; + $21 = Math_imul($13, 1858048)|0; + $22 = (($21) + ($5))|0; + $23 = $15 >> 20; + $24 = $20 >> 20; + $25 = $22 >> 20; + $26 = ($23>>>0)>(255); + $27 = $15 >>> 31; + $28 = (($27) + 255)|0; + $r$0 = $26 ? $28 : $23; + $29 = ($24>>>0)>(255); + $30 = $20 >>> 31; + $31 = (($30) + 255)|0; + $g$0 = $29 ? $31 : $24; + $32 = ($25>>>0)>(255); + $33 = $22 >>> 31; + $34 = (($33) + 255)|0; + $b$0 = $32 ? $34 : $25; + $35 = $r$0&255; + HEAP8[$$04>>0] = $35; + $36 = $g$0&255; + $37 = ((($$04)) + 1|0); + HEAP8[$37>>0] = $36; + $38 = $b$0&255; + $39 = ((($$04)) + 2|0); + HEAP8[$39>>0] = $38; + $40 = ((($$04)) + 3|0); + HEAP8[$40>>0] = -1; + $41 = (($$04) + ($step)|0); + $42 = (($i$03) + 1)|0; + $exitcond = ($42|0)==($count|0); + if ($exitcond) { + break; + } else { + $$04 = $41;$i$03 = $42; + } + } + return; +} +function _stbi__resample_row_hv_2($out,$in_near,$in_far,$w,$hs) { + $out = $out|0; + $in_near = $in_near|0; + $in_far = $in_far|0; + $w = $w|0; + $hs = $hs|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; + var $9 = 0, $exitcond = 0, $i$01 = 0, $t1$0$lcssa = 0, $t1$02 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($w|0)==(1); + $1 = HEAP8[$in_near>>0]|0; + $2 = $1&255; + $3 = ($2*3)|0; + $4 = HEAP8[$in_far>>0]|0; + $5 = $4&255; + $6 = (($3) + ($5))|0; + $7 = (($6) + 2)|0; + $8 = $7 >>> 2; + $9 = $8&255; + if ($0) { + $10 = ((($out)) + 1|0); + HEAP8[$10>>0] = $9; + HEAP8[$out>>0] = $9; + return ($out|0); + } + HEAP8[$out>>0] = $9; + $11 = ($w|0)>(1); + if ($11) { + $i$01 = 1;$t1$02 = $6; + while(1) { + $12 = (($in_near) + ($i$01)|0); + $13 = HEAP8[$12>>0]|0; + $14 = $13&255; + $15 = ($14*3)|0; + $16 = (($in_far) + ($i$01)|0); + $17 = HEAP8[$16>>0]|0; + $18 = $17&255; + $19 = (($15) + ($18))|0; + $20 = ($t1$02*3)|0; + $21 = (($20) + 8)|0; + $22 = (($21) + ($19))|0; + $23 = $22 >>> 4; + $24 = $23&255; + $25 = $i$01 << 1; + $26 = (($25) + -1)|0; + $27 = (($out) + ($26)|0); + HEAP8[$27>>0] = $24; + $28 = ($19*3)|0; + $29 = (($t1$02) + 8)|0; + $30 = (($29) + ($28))|0; + $31 = $30 >>> 4; + $32 = $31&255; + $33 = (($out) + ($25)|0); + HEAP8[$33>>0] = $32; + $34 = (($i$01) + 1)|0; + $exitcond = ($34|0)==($w|0); + if ($exitcond) { + $t1$0$lcssa = $19; + break; + } else { + $i$01 = $34;$t1$02 = $19; + } + } + } else { + $t1$0$lcssa = $6; + } + $35 = (($t1$0$lcssa) + 2)|0; + $36 = $35 >>> 2; + $37 = $36&255; + $38 = $w << 1; + $39 = (($38) + -1)|0; + $40 = (($out) + ($39)|0); + HEAP8[$40>>0] = $37; + return ($out|0); +} +function _stbi__clamp($x) { + $x = $x|0; + var $$not = 0, $0 = 0, $1 = 0, $2 = 0, $x$lobit = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($x>>>0)>(255); + if ($0) { + $x$lobit = $x >> 31; + $1 = $x$lobit&255; + $$not = $1 ^ -1; + return ($$not|0); + } else { + $2 = $x&255; + return ($2|0); + } + return (0)|0; +} +function _stbi__stdio_read($user,$data,$size) { + $user = $user|0; + $data = $data|0; + $size = $size|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_fread($data,1,$size,$user)|0); + return ($0|0); +} +function _stbi__stdio_skip($user,$n) { + $user = $user|0; + $n = $n|0; + var label = 0, sp = 0; + sp = STACKTOP; + (_fseek($user,$n,1)|0); + return; +} +function _stbi__stdio_eof($user) { + $user = $user|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_feof($user)|0); + return ($0|0); +} +function _ErrorCallback($error,$description) { + $error = $error|0; + $description = $description|0; + var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + HEAP32[$vararg_buffer>>2] = $error; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $description; + _TraceLog(2,17577,$vararg_buffer); + STACKTOP = sp;return; +} +function _SetupFramebufferSize($displayWidth,$displayHeight) { + $displayWidth = $displayWidth|0; + $displayHeight = $displayHeight|0; + var $0 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0.0, $26 = 0; + var $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, $or$cond = 0, $roundf = 0.0, $roundf1 = 0.0, $roundf2 = 0.0, $roundf3 = 0.0, $storemerge = 0, $vararg_buffer = 0, $vararg_buffer4 = 0; + var $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 112|0; + $vararg_buffer8 = sp + 24|0; + $vararg_buffer4 = sp + 16|0; + $vararg_buffer = sp; + $0 = sp + 40|0; + $1 = HEAP32[492>>2]|0; + $2 = ($1|0)>($displayWidth|0); + if (!($2)) { + $3 = HEAP32[496>>2]|0; + $4 = ($3|0)>($displayHeight|0); + if (!($4)) { + $29 = ($1|0)<($displayWidth|0); + $30 = ($3|0)<($displayHeight|0); + $or$cond = $29 | $30; + if (!($or$cond)) { + HEAP32[672>>2] = $1; + $51 = HEAP32[496>>2]|0; + HEAP32[676>>2] = $51; + HEAP32[664>>2] = 0; + HEAP32[668>>2] = 0; + STACKTOP = sp;return; + } + HEAP32[$vararg_buffer8>>2] = $1; + $vararg_ptr11 = ((($vararg_buffer8)) + 4|0); + HEAP32[$vararg_ptr11>>2] = $3; + $vararg_ptr12 = ((($vararg_buffer8)) + 8|0); + HEAP32[$vararg_ptr12>>2] = $displayWidth; + $vararg_ptr13 = ((($vararg_buffer8)) + 12|0); + HEAP32[$vararg_ptr13>>2] = $displayHeight; + _TraceLog(0,17511,$vararg_buffer8); + $31 = (+($displayWidth|0)); + $32 = (+($displayHeight|0)); + $33 = $31 / $32; + $34 = HEAP32[492>>2]|0; + $35 = (+($34|0)); + $36 = HEAP32[496>>2]|0; + $37 = (+($36|0)); + $38 = $35 / $37; + $39 = !($33 <= $38); + if ($39) { + $46 = $33 * $37; + $roundf = (+_roundf($46)); + $47 = (~~(($roundf))); + HEAP32[672>>2] = $47; + $48 = HEAP32[496>>2]|0; + HEAP32[676>>2] = $48; + $49 = HEAP32[492>>2]|0; + $50 = (($47) - ($49))|0; + HEAP32[664>>2] = $50; + HEAP32[668>>2] = 0; + STACKTOP = sp;return; + } else { + HEAP32[672>>2] = $34; + $40 = HEAP32[492>>2]|0; + $41 = (+($40|0)); + $42 = $41 / $33; + $roundf1 = (+_roundf($42)); + $43 = (~~(($roundf1))); + HEAP32[676>>2] = $43; + HEAP32[664>>2] = 0; + $44 = HEAP32[496>>2]|0; + $45 = (($43) - ($44))|0; + HEAP32[668>>2] = $45; + STACKTOP = sp;return; + } + } + } + $5 = HEAP32[492>>2]|0; + $6 = HEAP32[496>>2]|0; + HEAP32[$vararg_buffer>>2] = $5; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $6; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = $displayWidth; + $vararg_ptr3 = ((($vararg_buffer)) + 12|0); + HEAP32[$vararg_ptr3>>2] = $displayHeight; + _TraceLog(2,17368,$vararg_buffer); + $7 = (+($displayWidth|0)); + $8 = HEAP32[492>>2]|0; + $9 = (+($8|0)); + $10 = $7 / $9; + $11 = (+($displayHeight|0)); + $12 = HEAP32[496>>2]|0; + $13 = (+($12|0)); + $14 = $11 / $13; + $15 = !($10 <= $14); + if ($15) { + $21 = $9 * $14; + $roundf2 = (+_roundf($21)); + $22 = (~~(($roundf2))); + HEAP32[672>>2] = $22; + HEAP32[676>>2] = $displayHeight; + $23 = (($displayWidth) - ($22))|0; + HEAP32[664>>2] = $23; + $storemerge = 0; + } else { + HEAP32[672>>2] = $displayWidth; + $16 = HEAP32[496>>2]|0; + $17 = (+($16|0)); + $18 = $10 * $17; + $roundf3 = (+_roundf($18)); + $19 = (~~(($roundf3))); + HEAP32[676>>2] = $19; + HEAP32[664>>2] = 0; + $20 = (($displayHeight) - ($19))|0; + $storemerge = $20; + } + HEAP32[668>>2] = $storemerge; + $24 = HEAP32[672>>2]|0; + $25 = (+($24|0)); + $26 = HEAP32[492>>2]|0; + $27 = (+($26|0)); + $28 = $25 / $27; + _MatrixScale($0,$28,$28,$28); + dest=512; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + HEAP32[672>>2] = $displayWidth; + HEAP32[676>>2] = $displayHeight; + HEAP32[$vararg_buffer4>>2] = $displayWidth; + $vararg_ptr7 = ((($vararg_buffer4)) + 4|0); + HEAP32[$vararg_ptr7>>2] = $displayHeight; + _TraceLog(2,17446,$vararg_buffer4); + STACKTOP = sp;return; +} +function _WindowSizeCallback($window,$width,$height) { + $window = $window|0; + $width = $width|0; + $height = $height|0; + var $0 = 0.0, $1 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + _rlViewport(0,0,$width,$height); + _rlMatrixMode(0); + _rlLoadIdentity(); + $0 = (+($width|0)); + $1 = (+($height|0)); + _rlOrtho(0.0,$0,$1,0.0,0.0,1.0); + _rlMatrixMode(1); + _rlLoadIdentity(); + _rlClearScreenBuffers(); + HEAP32[492>>2] = $width; + HEAP32[496>>2] = $height; + HEAP32[672>>2] = $width; + HEAP32[676>>2] = $height; + return; +} +function _CursorEnterCallback($window,$enter) { + $window = $window|0; + $enter = $enter|0; + var label = 0, sp = 0; + sp = STACKTOP; + return; +} +function _KeyCallback($window,$key,$scancode,$action,$mods) { + $window = $window|0; + $key = $key|0; + $scancode = $scancode|0; + $action = $action|0; + $mods = $mods|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[648>>2]|0; + $1 = ($0|0)==($key|0); + $2 = ($action|0)==(1); + $or$cond = $2 & $1; + if ($or$cond) { + _glfwSetWindowShouldClose(($window|0),1); + return; + } + $3 = $action&255; + $4 = (7696 + ($key)|0); + HEAP8[$4>>0] = $3; + if (!($2)) { + return; + } + HEAP32[644>>2] = $key; + return; +} +function _MouseButtonCallback($window,$button,$action,$mods) { + $window = $window|0; + $button = $button|0; + $action = $action|0; + $mods = $mods|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0; + var $27 = 0.0, $28 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 80|0; + $gestureEvent$byval_copy = sp + 40|0; + $gestureEvent = sp + 8|0; + $0 = sp; + $1 = $action&255; + $2 = (8720 + ($button)|0); + HEAP8[$2>>0] = $1; + $3 = (_IsMouseButtonPressed(0)|0); + $4 = ($3|0)==(0); + if ($4) { + $5 = (_IsMouseButtonReleased(0)|0); + $6 = ($5|0)==(0); + if (!($6)) { + HEAP32[$gestureEvent>>2] = 0; + } + } else { + HEAP32[$gestureEvent>>2] = 1; + } + $7 = ((($gestureEvent)) + 8|0); + HEAP32[$7>>2] = 0; + $8 = ((($gestureEvent)) + 4|0); + HEAP32[$8>>2] = 1; + $9 = ((($gestureEvent)) + 16|0); + _GetMousePosition($0); + $10 = $0; + $11 = $10; + $12 = HEAP32[$11>>2]|0; + $13 = (($10) + 4)|0; + $14 = $13; + $15 = HEAP32[$14>>2]|0; + $16 = $9; + $17 = $16; + HEAP32[$17>>2] = $12; + $18 = (($16) + 4)|0; + $19 = $18; + HEAP32[$19>>2] = $15; + $20 = (_GetScreenWidth()|0); + $21 = (+($20|0)); + $22 = +HEAPF32[$9>>2]; + $23 = $22 / $21; + HEAPF32[$9>>2] = $23; + $24 = (_GetScreenHeight()|0); + $25 = (+($24|0)); + $26 = ((($gestureEvent)) + 20|0); + $27 = +HEAPF32[$26>>2]; + $28 = $27 / $25; + HEAPF32[$26>>2] = $28; + ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0; + _ProcessGestureEvent($gestureEvent$byval_copy); + STACKTOP = sp;return; +} +function _MouseCursorPosCallback($window,$x,$y) { + $window = $window|0; + $x = +$x; + $y = +$y; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $3 = 0.0, $4 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $gestureEvent = 0, $gestureEvent$byval_copy = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 64|0; + $gestureEvent$byval_copy = sp + 32|0; + $gestureEvent = sp; + HEAP32[$gestureEvent>>2] = 2; + $0 = ((($gestureEvent)) + 8|0); + HEAP32[$0>>2] = 0; + $1 = ((($gestureEvent)) + 4|0); + HEAP32[$1>>2] = 1; + $2 = $x; + $3 = $y; + $4 = ((($gestureEvent)) + 16|0); + HEAPF32[$4>>2] = $2; + $5 = ((($gestureEvent)) + 20|0); + HEAPF32[$5>>2] = $3; + $6 = ((($gestureEvent)) + 16|0); + $7 = $6; + $8 = $7; + $9 = HEAP32[$8>>2]|0; + $10 = (($7) + 4)|0; + $11 = $10; + $12 = HEAP32[$11>>2]|0; + $13 = 64; + $14 = $13; + HEAP32[$14>>2] = $9; + $15 = (($13) + 4)|0; + $16 = $15; + HEAP32[$16>>2] = $12; + $17 = (_GetScreenWidth()|0); + $18 = (+($17|0)); + $19 = +HEAPF32[$6>>2]; + $20 = $19 / $18; + HEAPF32[$6>>2] = $20; + $21 = (_GetScreenHeight()|0); + $22 = (+($21|0)); + $23 = +HEAPF32[$5>>2]; + $24 = $23 / $22; + HEAPF32[$5>>2] = $24; + ;HEAP32[$gestureEvent$byval_copy>>2]=HEAP32[$gestureEvent>>2]|0;HEAP32[$gestureEvent$byval_copy+4>>2]=HEAP32[$gestureEvent+4>>2]|0;HEAP32[$gestureEvent$byval_copy+8>>2]=HEAP32[$gestureEvent+8>>2]|0;HEAP32[$gestureEvent$byval_copy+12>>2]=HEAP32[$gestureEvent+12>>2]|0;HEAP32[$gestureEvent$byval_copy+16>>2]=HEAP32[$gestureEvent+16>>2]|0;HEAP32[$gestureEvent$byval_copy+20>>2]=HEAP32[$gestureEvent+20>>2]|0;HEAP32[$gestureEvent$byval_copy+24>>2]=HEAP32[$gestureEvent+24>>2]|0;HEAP32[$gestureEvent$byval_copy+28>>2]=HEAP32[$gestureEvent+28>>2]|0; + _ProcessGestureEvent($gestureEvent$byval_copy); + STACKTOP = sp;return; +} +function _CharCallback($window,$key) { + $window = $window|0; + $key = $key|0; + var label = 0, sp = 0; + sp = STACKTOP; + HEAP32[644>>2] = $key; + return; +} +function _ScrollCallback($window,$xoffset,$yoffset) { + $window = $window|0; + $xoffset = +$xoffset; + $yoffset = +$yoffset; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (~~(($yoffset))); + HEAP32[6424>>2] = $0; + return; +} +function _WindowIconifyCallback($window,$iconified) { + $window = $window|0; + $iconified = $iconified|0; + var $$ = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $not$ = ($iconified|0)!=(0); + $$ = $not$&1; + HEAP32[508>>2] = $$; + return; +} +function _emscripten_GetProcAddress($name_) { + $name_ = $name_|0; + var $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0; + var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0; + var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0; + var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0; + var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0; + var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0; + var $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0; + var $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0; + var $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0; + var $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0; + var $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0; + var $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0; + var $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0; + var $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0; + var $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0; + var $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0; + var $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0; + var $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0; + var $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0; + var $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0; + var $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0; + var $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0; + var $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0; + var $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0; + var $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0; + var $549 = 0, $55 = 0, $550 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0; + var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0; + var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $end = 0, $name = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $0 = sp + 12|0; + $1 = sp + 8|0; + $name = sp + 4|0; + $end = sp; + HEAP32[$1>>2] = $name_; + $2 = HEAP32[$1>>2]|0; + $3 = (_strlen($2)|0); + $4 = (($3) + 1)|0; + $5 = (_malloc($4)|0); + HEAP32[$name>>2] = $5; + $6 = HEAP32[$name>>2]|0; + $7 = HEAP32[$1>>2]|0; + (_strcpy($6,$7)|0); + $8 = HEAP32[$name>>2]|0; + $9 = (_strstr($8,17615)|0); + HEAP32[$end>>2] = $9; + $10 = HEAP32[$end>>2]|0; + $11 = ($10|0)!=(0|0); + if ($11) { + $12 = HEAP32[$end>>2]|0; + HEAP8[$12>>0] = 0; + } + $13 = HEAP32[$name>>2]|0; + $14 = (_strstr($13,17619)|0); + HEAP32[$end>>2] = $14; + $15 = HEAP32[$end>>2]|0; + $16 = ($15|0)!=(0|0); + if ($16) { + $17 = HEAP32[$end>>2]|0; + HEAP8[$17>>0] = 0; + } + $18 = HEAP32[$name>>2]|0; + $19 = (_strstr($18,17623)|0); + HEAP32[$end>>2] = $19; + $20 = HEAP32[$end>>2]|0; + $21 = ($20|0)!=(0|0); + if ($21) { + $22 = HEAP32[$end>>2]|0; + HEAP8[$22>>0] = 0; + } + $23 = HEAP32[$name>>2]|0; + $24 = (_strstr($23,17627)|0); + HEAP32[$end>>2] = $24; + $25 = HEAP32[$end>>2]|0; + $26 = ($25|0)!=(0|0); + if ($26) { + $27 = HEAP32[$end>>2]|0; + HEAP8[$27>>0] = 0; + } + $28 = HEAP32[$name>>2]|0; + $29 = (_strcmp($28,17633)|0); + $30 = ($29|0)!=(0); + do { + if ($30) { + $31 = HEAP32[$name>>2]|0; + $32 = (_strcmp($31,17671)|0); + $33 = ($32|0)!=(0); + if (!($33)) { + HEAP32[$name>>2] = 17690; + break; + } + $34 = HEAP32[$name>>2]|0; + $35 = (_strcmp($34,17703)|0); + $36 = ($35|0)!=(0); + if (!($36)) { + HEAP32[$name>>2] = 17724; + break; + } + $37 = HEAP32[$name>>2]|0; + $38 = (_strcmp($37,17739)|0); + $39 = ($38|0)!=(0); + if (!($39)) { + HEAP32[$name>>2] = 17754; + break; + } + $40 = HEAP32[$name>>2]|0; + $41 = (_strcmp($40,17769)|0); + $42 = ($41|0)!=(0); + if (!($42)) { + HEAP32[$name>>2] = 17784; + } + } else { + HEAP32[$name>>2] = 17655; + } + } while(0); + $43 = HEAP32[$name>>2]|0; + $44 = (_strcmp($43,17799)|0); + $45 = ($44|0)!=(0); + do { + if ($45) { + $46 = HEAP32[$name>>2]|0; + $47 = (_strcmp($46,17813)|0); + $48 = ($47|0)!=(0); + if (!($48)) { + HEAP32[$0>>2] = 3; + break; + } + $49 = HEAP32[$name>>2]|0; + $50 = (_strcmp($49,17825)|0); + $51 = ($50|0)!=(0); + if (!($51)) { + HEAP32[$0>>2] = 7; + break; + } + $52 = HEAP32[$name>>2]|0; + $53 = (_strcmp($52,17839)|0); + $54 = ($53|0)!=(0); + if (!($54)) { + HEAP32[$0>>2] = 8; + break; + } + $55 = HEAP32[$name>>2]|0; + $56 = (_strcmp($55,17851)|0); + $57 = ($56|0)!=(0); + if (!($57)) { + HEAP32[$0>>2] = 9; + break; + } + $58 = HEAP32[$name>>2]|0; + $59 = (_strcmp($58,17865)|0); + $60 = ($59|0)!=(0); + if (!($60)) { + HEAP32[$0>>2] = 10; + break; + } + $61 = HEAP32[$name>>2]|0; + $62 = (_strcmp($61,17879)|0); + $63 = ($62|0)!=(0); + if (!($63)) { + HEAP32[$0>>2] = 11; + break; + } + $64 = HEAP32[$name>>2]|0; + $65 = (_strcmp($64,17896)|0); + $66 = ($65|0)!=(0); + if (!($66)) { + HEAP32[$0>>2] = 1; + break; + } + $67 = HEAP32[$name>>2]|0; + $68 = (_strcmp($67,17919)|0); + $69 = ($68|0)!=(0); + if (!($69)) { + HEAP32[$0>>2] = 1; + break; + } + $70 = HEAP32[$name>>2]|0; + $71 = (_strcmp($70,17945)|0); + $72 = ($71|0)!=(0); + if (!($72)) { + HEAP32[$0>>2] = 2; + break; + } + $73 = HEAP32[$name>>2]|0; + $74 = (_strcmp($73,17958)|0); + $75 = ($74|0)!=(0); + if (!($75)) { + HEAP32[$0>>2] = 3; + break; + } + $76 = HEAP32[$name>>2]|0; + $77 = (_strcmp($76,17974)|0); + $78 = ($77|0)!=(0); + if (!($78)) { + HEAP32[$0>>2] = 1; + break; + } + $79 = HEAP32[$name>>2]|0; + $80 = (_strcmp($79,17987)|0); + $81 = ($80|0)!=(0); + if (!($81)) { + HEAP32[$0>>2] = 12; + break; + } + $82 = HEAP32[$name>>2]|0; + $83 = (_strcmp($82,18001)|0); + $84 = ($83|0)!=(0); + if (!($84)) { + HEAP32[$0>>2] = 3; + break; + } + $85 = HEAP32[$name>>2]|0; + $86 = (_strcmp($85,18021)|0); + $87 = ($86|0)!=(0); + if (!($87)) { + HEAP32[$0>>2] = 4; + break; + } + $88 = HEAP32[$name>>2]|0; + $89 = (_strcmp($88,18041)|0); + $90 = ($89|0)!=(0); + if (!($90)) { + HEAP32[$0>>2] = 5; + break; + } + $91 = HEAP32[$name>>2]|0; + $92 = (_strcmp($91,18058)|0); + $93 = ($92|0)!=(0); + if (!($93)) { + HEAP32[$0>>2] = 6; + break; + } + $94 = HEAP32[$name>>2]|0; + $95 = (_strcmp($94,18075)|0); + $96 = ($95|0)!=(0); + if (!($96)) { + HEAP32[$0>>2] = 4; + break; + } + $97 = HEAP32[$name>>2]|0; + $98 = (_strcmp($97,18087)|0); + $99 = ($98|0)!=(0); + if (!($99)) { + HEAP32[$0>>2] = 13; + break; + } + $100 = HEAP32[$name>>2]|0; + $101 = (_strcmp($100,18100)|0); + $102 = ($101|0)!=(0); + if (!($102)) { + HEAP32[$0>>2] = 14; + break; + } + $103 = HEAP32[$name>>2]|0; + $104 = (_strcmp($103,18116)|0); + $105 = ($104|0)!=(0); + if (!($105)) { + HEAP32[$0>>2] = 7; + break; + } + $106 = HEAP32[$name>>2]|0; + $107 = (_strcmp($106,18139)|0); + $108 = ($107|0)!=(0); + if (!($108)) { + HEAP32[$0>>2] = 2; + break; + } + $109 = HEAP32[$name>>2]|0; + $110 = (_strcmp($109,18152)|0); + $111 = ($110|0)!=(0); + if (!($111)) { + HEAP32[$0>>2] = 3; + break; + } + $112 = HEAP32[$name>>2]|0; + $113 = (_strcmp($112,18168)|0); + $114 = ($113|0)!=(0); + if (!($114)) { + HEAP32[$0>>2] = 5; + break; + } + $115 = HEAP32[$name>>2]|0; + $116 = (_strcmp($115,18179)|0); + $117 = ($116|0)!=(0); + if (!($117)) { + HEAP32[$0>>2] = 15; + break; + } + $118 = HEAP32[$name>>2]|0; + $119 = (_strcmp($118,18198)|0); + $120 = ($119|0)!=(0); + if (!($120)) { + HEAP32[$0>>2] = 16; + break; + } + $121 = HEAP32[$name>>2]|0; + $122 = (_strcmp($121,18220)|0); + $123 = ($122|0)!=(0); + if (!($123)) { + HEAP32[$0>>2] = 17; + break; + } + $124 = HEAP32[$name>>2]|0; + $125 = (_strcmp($124,18239)|0); + $126 = ($125|0)!=(0); + if (!($126)) { + HEAP32[$0>>2] = 8; + break; + } + $127 = HEAP32[$name>>2]|0; + $128 = (_strcmp($127,18268)|0); + $129 = ($128|0)!=(0); + if (!($129)) { + HEAP32[$0>>2] = 6; + break; + } + $130 = HEAP32[$name>>2]|0; + $131 = (_strcmp($130,18285)|0); + $132 = ($131|0)!=(0); + if (!($132)) { + HEAP32[$0>>2] = 9; + break; + } + $133 = HEAP32[$name>>2]|0; + $134 = (_strcmp($133,18300)|0); + $135 = ($134|0)!=(0); + if (!($135)) { + HEAP32[$0>>2] = 10; + break; + } + $136 = HEAP32[$name>>2]|0; + $137 = (_strcmp($136,18315)|0); + $138 = ($137|0)!=(0); + if (!($138)) { + HEAP32[$0>>2] = 1; + break; + } + $139 = HEAP32[$name>>2]|0; + $140 = (_strcmp($139,18336)|0); + $141 = ($140|0)!=(0); + if (!($141)) { + HEAP32[$0>>2] = 11; + break; + } + $142 = HEAP32[$name>>2]|0; + $143 = (_strcmp($142,18356)|0); + $144 = ($143|0)!=(0); + if (!($144)) { + HEAP32[$0>>2] = 12; + break; + } + $145 = HEAP32[$name>>2]|0; + $146 = (_strcmp($145,18376)|0); + $147 = ($146|0)!=(0); + if (!($147)) { + HEAP32[$0>>2] = 13; + break; + } + $148 = HEAP32[$name>>2]|0; + $149 = (_strcmp($148,18402)|0); + $150 = ($149|0)!=(0); + if (!($150)) { + HEAP32[$0>>2] = 2; + break; + } + $151 = HEAP32[$name>>2]|0; + $152 = (_strcmp($151,18421)|0); + $153 = ($152|0)!=(0); + if (!($153)) { + HEAP32[$0>>2] = 1; + break; + } + $154 = HEAP32[$name>>2]|0; + $155 = (_strcmp($154,18433)|0); + $156 = ($155|0)!=(0); + if (!($156)) { + HEAP32[$0>>2] = 3; + break; + } + $157 = HEAP32[$name>>2]|0; + $158 = (_strcmp($157,18445)|0); + $159 = ($158|0)!=(0); + if (!($159)) { + HEAP32[$0>>2] = 1; + break; + } + $160 = HEAP32[$name>>2]|0; + $161 = (_strcmp($160,18457)|0); + $162 = ($161|0)!=(0); + if (!($162)) { + HEAP32[$0>>2] = 1; + break; + } + $163 = HEAP32[$name>>2]|0; + $164 = (_strcmp($163,18469)|0); + $165 = ($164|0)!=(0); + if (!($165)) { + HEAP32[$0>>2] = 18; + break; + } + $166 = HEAP32[$name>>2]|0; + $167 = (_strcmp($166,18481)|0); + $168 = ($167|0)!=(0); + if (!($168)) { + HEAP32[$0>>2] = 14; + break; + } + $169 = HEAP32[$name>>2]|0; + $170 = (_strcmp($169,18493)|0); + $171 = ($170|0)!=(0); + if (!($171)) { + HEAP32[$0>>2] = 4; + break; + } + $172 = HEAP32[$name>>2]|0; + $173 = (_strcmp($172,18505)|0); + $174 = ($173|0)!=(0); + if (!($174)) { + HEAP32[$0>>2] = 2; + break; + } + $175 = HEAP32[$name>>2]|0; + $176 = (_strcmp($175,18517)|0); + $177 = ($176|0)!=(0); + if (!($177)) { + HEAP32[$0>>2] = 15; + break; + } + $178 = HEAP32[$name>>2]|0; + $179 = (_strcmp($178,18530)|0); + $180 = ($179|0)!=(0); + if (!($180)) { + HEAP32[$0>>2] = 16; + break; + } + $181 = HEAP32[$name>>2]|0; + $182 = (_strcmp($181,18543)|0); + $183 = ($182|0)!=(0); + if (!($183)) { + HEAP32[$0>>2] = 17; + break; + } + $184 = HEAP32[$name>>2]|0; + $185 = (_strcmp($184,18556)|0); + $186 = ($185|0)!=(0); + if (!($186)) { + HEAP32[$0>>2] = 18; + break; + } + $187 = HEAP32[$name>>2]|0; + $188 = (_strcmp($187,18569)|0); + $189 = ($188|0)!=(0); + if (!($189)) { + HEAP32[$0>>2] = 19; + break; + } + $190 = HEAP32[$name>>2]|0; + $191 = (_strcmp($190,18582)|0); + $192 = ($191|0)!=(0); + if (!($192)) { + HEAP32[$0>>2] = 20; + break; + } + $193 = HEAP32[$name>>2]|0; + $194 = (_strcmp($193,18595)|0); + $195 = ($194|0)!=(0); + if (!($195)) { + HEAP32[$0>>2] = 21; + break; + } + $196 = HEAP32[$name>>2]|0; + $197 = (_strcmp($196,18608)|0); + $198 = ($197|0)!=(0); + if (!($198)) { + HEAP32[$0>>2] = 22; + break; + } + $199 = HEAP32[$name>>2]|0; + $200 = (_strcmp($199,18621)|0); + $201 = ($200|0)!=(0); + if (!($201)) { + HEAP32[$0>>2] = 5; + break; + } + $202 = HEAP32[$name>>2]|0; + $203 = (_strcmp($202,18640)|0); + $204 = ($203|0)!=(0); + if (!($204)) { + HEAP32[$0>>2] = 6; + break; + } + $205 = HEAP32[$name>>2]|0; + $206 = (_strcmp($205,18659)|0); + $207 = ($206|0)!=(0); + if (!($207)) { + HEAP32[$0>>2] = 7; + break; + } + $208 = HEAP32[$name>>2]|0; + $209 = (_strcmp($208,18678)|0); + $210 = ($209|0)!=(0); + if (!($210)) { + HEAP32[$0>>2] = 19; + break; + } + $211 = HEAP32[$name>>2]|0; + $212 = (_strcmp($211,18691)|0); + $213 = ($212|0)!=(0); + if (!($213)) { + HEAP32[$0>>2] = 20; + break; + } + $214 = HEAP32[$name>>2]|0; + $215 = (_strcmp($214,18709)|0); + $216 = ($215|0)!=(0); + if (!($216)) { + HEAP32[$0>>2] = 21; + break; + } + $217 = HEAP32[$name>>2]|0; + $218 = (_strcmp($217,18727)|0); + $219 = ($218|0)!=(0); + if (!($219)) { + HEAP32[$0>>2] = 22; + break; + } + $220 = HEAP32[$name>>2]|0; + $221 = (_strcmp($220,18745)|0); + $222 = ($221|0)!=(0); + if (!($222)) { + HEAP32[$0>>2] = 23; + break; + } + $223 = HEAP32[$name>>2]|0; + $224 = (_strcmp($223,18763)|0); + $225 = ($224|0)!=(0); + if (!($225)) { + HEAP32[$0>>2] = 2; + break; + } + $226 = HEAP32[$name>>2]|0; + $227 = (_strcmp($226,18783)|0); + $228 = ($227|0)!=(0); + if (!($228)) { + HEAP32[$0>>2] = 3; + break; + } + $229 = HEAP32[$name>>2]|0; + $230 = (_strcmp($229,17724)|0); + $231 = ($230|0)!=(0); + if (!($231)) { + HEAP32[$0>>2] = 7; + break; + } + $232 = HEAP32[$name>>2]|0; + $233 = (_strcmp($232,18801)|0); + $234 = ($233|0)!=(0); + if (!($234)) { + HEAP32[$0>>2] = 1; + break; + } + $235 = HEAP32[$name>>2]|0; + $236 = (_strcmp($235,18816)|0); + $237 = ($236|0)!=(0); + if (!($237)) { + HEAP32[$0>>2] = 8; + break; + } + $238 = HEAP32[$name>>2]|0; + $239 = (_strcmp($238,18837)|0); + $240 = ($239|0)!=(0); + if (!($240)) { + HEAP32[$0>>2] = 9; + break; + } + $241 = HEAP32[$name>>2]|0; + $242 = (_strcmp($241,18852)|0); + $243 = ($242|0)!=(0); + if (!($243)) { + HEAP32[$0>>2] = 10; + break; + } + $244 = HEAP32[$name>>2]|0; + $245 = (_strcmp($244,18870)|0); + $246 = ($245|0)!=(0); + if (!($246)) { + HEAP32[$0>>2] = 2; + break; + } + $247 = HEAP32[$name>>2]|0; + $248 = (_strcmp($247,18886)|0); + $249 = ($248|0)!=(0); + if (!($249)) { + HEAP32[$0>>2] = 11; + break; + } + $250 = HEAP32[$name>>2]|0; + $251 = (_strcmp($250,18905)|0); + $252 = ($251|0)!=(0); + if (!($252)) { + HEAP32[$0>>2] = 23; + break; + } + $253 = HEAP32[$name>>2]|0; + $254 = (_strcmp($253,18919)|0); + $255 = ($254|0)!=(0); + if (!($255)) { + HEAP32[$0>>2] = 24; + break; + } + $256 = HEAP32[$name>>2]|0; + $257 = (_strcmp($256,18934)|0); + $258 = ($257|0)!=(0); + if (!($258)) { + HEAP32[$0>>2] = 8; + break; + } + $259 = HEAP32[$name>>2]|0; + $260 = (_strcmp($259,17655)|0); + $261 = ($260|0)!=(0); + if (!($261)) { + HEAP32[$0>>2] = 1; + break; + } + $262 = HEAP32[$name>>2]|0; + $263 = (_strcmp($262,18945)|0); + $264 = ($263|0)!=(0); + if (!($264)) { + HEAP32[$0>>2] = 3; + break; + } + $265 = HEAP32[$name>>2]|0; + $266 = (_strcmp($265,17754)|0); + $267 = ($266|0)!=(0); + if (!($267)) { + HEAP32[$0>>2] = 24; + break; + } + $268 = HEAP32[$name>>2]|0; + $269 = (_strcmp($268,17784)|0); + $270 = ($269|0)!=(0); + if (!($270)) { + HEAP32[$0>>2] = 25; + break; + } + $271 = HEAP32[$name>>2]|0; + $272 = (_strcmp($271,18961)|0); + $273 = ($272|0)!=(0); + if (!($273)) { + HEAP32[$0>>2] = 12; + break; + } + $274 = HEAP32[$name>>2]|0; + $275 = (_strcmp($274,18988)|0); + $276 = ($275|0)!=(0); + if (!($276)) { + HEAP32[$0>>2] = 4; + break; + } + $277 = HEAP32[$name>>2]|0; + $278 = (_strcmp($277,19002)|0); + $279 = ($278|0)!=(0); + if (!($279)) { + HEAP32[$0>>2] = 13; + break; + } + $280 = HEAP32[$name>>2]|0; + $281 = (_strcmp($280,17690)|0); + $282 = ($281|0)!=(0); + if (!($282)) { + HEAP32[$0>>2] = 5; + break; + } + $283 = HEAP32[$name>>2]|0; + $284 = (_strcmp($283,19022)|0); + $285 = ($284|0)!=(0); + if (!($285)) { + HEAP32[$0>>2] = 6; + break; + } + $286 = HEAP32[$name>>2]|0; + $287 = (_strcmp($286,19040)|0); + $288 = ($287|0)!=(0); + if (!($288)) { + HEAP32[$0>>2] = 9; + break; + } + $289 = HEAP32[$name>>2]|0; + $290 = (_strcmp($289,19052)|0); + $291 = ($290|0)!=(0); + if (!($291)) { + HEAP32[$0>>2] = 25; + break; + } + $292 = HEAP32[$name>>2]|0; + $293 = (_strcmp($292,19073)|0); + $294 = ($293|0)!=(0); + if (!($294)) { + HEAP32[$0>>2] = 26; + break; + } + $295 = HEAP32[$name>>2]|0; + $296 = (_strcmp($295,19091)|0); + $297 = ($296|0)!=(0); + if (!($297)) { + HEAP32[$0>>2] = 27; + break; + } + $298 = HEAP32[$name>>2]|0; + $299 = (_strcmp($298,19109)|0); + $300 = ($299|0)!=(0); + if (!($300)) { + HEAP32[$0>>2] = 28; + break; + } + $301 = HEAP32[$name>>2]|0; + $302 = (_strcmp($301,19130)|0); + $303 = ($302|0)!=(0); + if (!($303)) { + HEAP32[$0>>2] = 14; + break; + } + $304 = HEAP32[$name>>2]|0; + $305 = (_strcmp($304,19156)|0); + $306 = ($305|0)!=(0); + if (!($306)) { + HEAP32[$0>>2] = 3; + break; + } + $307 = HEAP32[$name>>2]|0; + $308 = (_strcmp($307,19179)|0); + $309 = ($308|0)!=(0); + if (!($309)) { + HEAP32[$0>>2] = 15; + break; + } + $310 = HEAP32[$name>>2]|0; + $311 = (_strcmp($310,19217)|0); + $312 = ($311|0)!=(0); + if (!($312)) { + HEAP32[$0>>2] = 10; + break; + } + $313 = HEAP32[$name>>2]|0; + $314 = (_strcmp($313,19233)|0); + $315 = ($314|0)!=(0); + if (!($315)) { + HEAP32[$0>>2] = 7; + break; + } + $316 = HEAP32[$name>>2]|0; + $317 = (_strcmp($316,19248)|0); + $318 = ($317|0)!=(0); + if (!($318)) { + HEAP32[$0>>2] = 26; + break; + } + $319 = HEAP32[$name>>2]|0; + $320 = (_strcmp($319,19271)|0); + $321 = ($320|0)!=(0); + if (!($321)) { + HEAP32[$0>>2] = 16; + break; + } + $322 = HEAP32[$name>>2]|0; + $323 = (_strcmp($322,19284)|0); + $324 = ($323|0)!=(0); + if (!($324)) { + HEAP32[$0>>2] = 29; + break; + } + $325 = HEAP32[$name>>2]|0; + $326 = (_strcmp($325,19298)|0); + $327 = ($326|0)!=(0); + if (!($327)) { + HEAP32[$0>>2] = 30; + break; + } + $328 = HEAP32[$name>>2]|0; + $329 = (_strcmp($328,19312)|0); + $330 = ($329|0)!=(0); + if (!($330)) { + HEAP32[$0>>2] = 2; + break; + } + $331 = HEAP32[$name>>2]|0; + $332 = (_strcmp($331,19332)|0); + $333 = ($332|0)!=(0); + if (!($333)) { + HEAP32[$0>>2] = 8; + break; + } + $334 = HEAP32[$name>>2]|0; + $335 = (_strcmp($334,19352)|0); + $336 = ($335|0)!=(0); + if (!($336)) { + HEAP32[$0>>2] = 17; + break; + } + $337 = HEAP32[$name>>2]|0; + $338 = (_strcmp($337,19368)|0); + $339 = ($338|0)!=(0); + if (!($339)) { + HEAP32[$0>>2] = 18; + break; + } + $340 = HEAP32[$name>>2]|0; + $341 = (_strcmp($340,19386)|0); + $342 = ($341|0)!=(0); + if (!($342)) { + HEAP32[$0>>2] = 27; + break; + } + $343 = HEAP32[$name>>2]|0; + $344 = (_strcmp($343,19402)|0); + $345 = ($344|0)!=(0); + if (!($345)) { + HEAP32[$0>>2] = 19; + break; + } + $346 = HEAP32[$name>>2]|0; + $347 = (_strcmp($346,19417)|0); + $348 = ($347|0)!=(0); + if (!($348)) { + HEAP32[$0>>2] = 9; + break; + } + $349 = HEAP32[$name>>2]|0; + $350 = (_strcmp($349,19439)|0); + $351 = ($350|0)!=(0); + if (!($351)) { + HEAP32[$0>>2] = 31; + break; + } + $352 = HEAP32[$name>>2]|0; + $353 = (_strcmp($352,19457)|0); + $354 = ($353|0)!=(0); + if (!($354)) { + HEAP32[$0>>2] = 32; + break; + } + $355 = HEAP32[$name>>2]|0; + $356 = (_strcmp($355,19478)|0); + $357 = ($356|0)!=(0); + if (!($357)) { + HEAP32[$0>>2] = 10; + break; + } + $358 = HEAP32[$name>>2]|0; + $359 = (_strcmp($358,19496)|0); + $360 = ($359|0)!=(0); + if (!($360)) { + HEAP32[$0>>2] = 11; + break; + } + $361 = HEAP32[$name>>2]|0; + $362 = (_strcmp($361,19509)|0); + $363 = ($362|0)!=(0); + if (!($363)) { + HEAP32[$0>>2] = 2; + break; + } + $364 = HEAP32[$name>>2]|0; + $365 = (_strcmp($364,19524)|0); + $366 = ($365|0)!=(0); + if (!($366)) { + HEAP32[$0>>2] = 12; + break; + } + $367 = HEAP32[$name>>2]|0; + $368 = (_strcmp($367,19538)|0); + $369 = ($368|0)!=(0); + if (!($369)) { + HEAP32[$0>>2] = 1; + break; + } + $370 = HEAP32[$name>>2]|0; + $371 = (_strcmp($370,19548)|0); + $372 = ($371|0)!=(0); + if (!($372)) { + HEAP32[$0>>2] = 1; + break; + } + $373 = HEAP32[$name>>2]|0; + $374 = (_strcmp($373,19558)|0); + $375 = ($374|0)!=(0); + if (!($375)) { + HEAP32[$0>>2] = 3; + break; + } + $376 = HEAP32[$name>>2]|0; + $377 = (_strcmp($376,19580)|0); + $378 = ($377|0)!=(0); + if (!($378)) { + HEAP32[$0>>2] = 13; + break; + } + $379 = HEAP32[$name>>2]|0; + $380 = (_strcmp($379,19606)|0); + $381 = ($380|0)!=(0); + if (!($381)) { + HEAP32[$0>>2] = 14; + break; + } + $382 = HEAP32[$name>>2]|0; + $383 = (_strcmp($382,19633)|0); + $384 = ($383|0)!=(0); + if (!($384)) { + HEAP32[$0>>2] = 28; + break; + } + $385 = HEAP32[$name>>2]|0; + $386 = (_strcmp($385,19646)|0); + $387 = ($386|0)!=(0); + if (!($387)) { + HEAP32[$0>>2] = 20; + break; + } + $388 = HEAP32[$name>>2]|0; + $389 = (_strcmp($388,19661)|0); + $390 = ($389|0)!=(0); + if (!($390)) { + HEAP32[$0>>2] = 4; + break; + } + $391 = HEAP32[$name>>2]|0; + $392 = (_strcmp($391,19676)|0); + $393 = ($392|0)!=(0); + if (!($393)) { + HEAP32[$0>>2] = 3; + break; + } + $394 = HEAP32[$name>>2]|0; + $395 = (_strcmp($394,19700)|0); + $396 = ($395|0)!=(0); + if (!($396)) { + HEAP32[$0>>2] = 2; + break; + } + $397 = HEAP32[$name>>2]|0; + $398 = (_strcmp($397,19711)|0); + $399 = ($398|0)!=(0); + if (!($399)) { + HEAP32[$0>>2] = 33; + break; + } + $400 = HEAP32[$name>>2]|0; + $401 = (_strcmp($400,19733)|0); + $402 = ($401|0)!=(0); + if (!($402)) { + HEAP32[$0>>2] = 21; + break; + } + $403 = HEAP32[$name>>2]|0; + $404 = (_strcmp($403,19755)|0); + $405 = ($404|0)!=(0); + if (!($405)) { + HEAP32[$0>>2] = 5; + break; + } + $406 = HEAP32[$name>>2]|0; + $407 = (_strcmp($406,19779)|0); + $408 = ($407|0)!=(0); + if (!($408)) { + HEAP32[$0>>2] = 4; + break; + } + $409 = HEAP32[$name>>2]|0; + $410 = (_strcmp($409,19788)|0); + $411 = ($410|0)!=(0); + if (!($411)) { + HEAP32[$0>>2] = 5; + break; + } + $412 = HEAP32[$name>>2]|0; + $413 = (_strcmp($412,19796)|0); + $414 = ($413|0)!=(0); + if (!($414)) { + HEAP32[$0>>2] = 1; + break; + } + $415 = HEAP32[$name>>2]|0; + $416 = (_strcmp($415,19809)|0); + $417 = ($416|0)!=(0); + if (!($417)) { + HEAP32[$0>>2] = 2; + break; + } + $418 = HEAP32[$name>>2]|0; + $419 = (_strcmp($418,19823)|0); + $420 = ($419|0)!=(0); + if (!($420)) { + HEAP32[$0>>2] = 15; + break; + } + $421 = HEAP32[$name>>2]|0; + $422 = (_strcmp($421,19835)|0); + $423 = ($422|0)!=(0); + if (!($423)) { + HEAP32[$0>>2] = 16; + break; + } + $424 = HEAP32[$name>>2]|0; + $425 = (_strcmp($424,19844)|0); + $426 = ($425|0)!=(0); + if (!($426)) { + HEAP32[$0>>2] = 17; + break; + } + $427 = HEAP32[$name>>2]|0; + $428 = (_strcmp($427,19854)|0); + $429 = ($428|0)!=(0); + if (!($429)) { + HEAP32[$0>>2] = 18; + break; + } + $430 = HEAP32[$name>>2]|0; + $431 = (_strcmp($430,19866)|0); + $432 = ($431|0)!=(0); + if (!($432)) { + HEAP32[$0>>2] = 19; + break; + } + $433 = HEAP32[$name>>2]|0; + $434 = (_strcmp($433,19877)|0); + $435 = ($434|0)!=(0); + if (!($435)) { + HEAP32[$0>>2] = 20; + break; + } + $436 = HEAP32[$name>>2]|0; + $437 = (_strcmp($436,19885)|0); + $438 = ($437|0)!=(0); + if (!($438)) { + HEAP32[$0>>2] = 3; + break; + } + $439 = HEAP32[$name>>2]|0; + $440 = (_strcmp($439,19897)|0); + $441 = ($440|0)!=(0); + if (!($441)) { + HEAP32[$0>>2] = 21; + break; + } + $442 = HEAP32[$name>>2]|0; + $443 = (_strcmp($442,19912)|0); + $444 = ($443|0)!=(0); + if (!($444)) { + HEAP32[$0>>2] = 22; + break; + } + $445 = HEAP32[$name>>2]|0; + $446 = (_strcmp($445,19924)|0); + $447 = ($446|0)!=(0); + if (!($447)) { + HEAP32[$0>>2] = 23; + break; + } + $448 = HEAP32[$name>>2]|0; + $449 = (_strcmp($448,19938)|0); + $450 = ($449|0)!=(0); + if (!($450)) { + HEAP32[$0>>2] = 11; + break; + } + $451 = HEAP32[$name>>2]|0; + $452 = (_strcmp($451,19963)|0); + $453 = ($452|0)!=(0); + if (!($453)) { + HEAP32[$0>>2] = 24; + break; + } + $454 = HEAP32[$name>>2]|0; + $455 = (_strcmp($454,19980)|0); + $456 = ($455|0)!=(0); + if (!($456)) { + HEAP32[$0>>2] = 25; + break; + } + $457 = HEAP32[$name>>2]|0; + $458 = (_strcmp($457,19996)|0); + $459 = ($458|0)!=(0); + if (!($459)) { + HEAP32[$0>>2] = 26; + break; + } + $460 = HEAP32[$name>>2]|0; + $461 = (_strcmp($460,20012)|0); + $462 = ($461|0)!=(0); + if (!($462)) { + HEAP32[$0>>2] = 12; + break; + } + $463 = HEAP32[$name>>2]|0; + $464 = (_strcmp($463,20024)|0); + $465 = ($464|0)!=(0); + if (!($465)) { + HEAP32[$0>>2] = 34; + break; + } + $466 = HEAP32[$name>>2]|0; + $467 = (_strcmp($466,20036)|0); + $468 = ($467|0)!=(0); + if (!($468)) { + HEAP32[$0>>2] = 35; + break; + } + $469 = HEAP32[$name>>2]|0; + $470 = (_strcmp($469,20060)|0); + $471 = ($470|0)!=(0); + if (!($471)) { + HEAP32[$0>>2] = 1; + break; + } + $472 = HEAP32[$name>>2]|0; + $473 = (_strcmp($472,20073)|0); + $474 = ($473|0)!=(0); + if (!($474)) { + HEAP32[$0>>2] = 2; + break; + } + $475 = HEAP32[$name>>2]|0; + $476 = (_strcmp($475,20087)|0); + $477 = ($476|0)!=(0); + if (!($477)) { + HEAP32[$0>>2] = 36; + break; + } + $478 = HEAP32[$name>>2]|0; + $479 = (_strcmp($478,20109)|0); + $480 = ($479|0)!=(0); + if (!($480)) { + HEAP32[$0>>2] = 37; + break; + } + $481 = HEAP32[$name>>2]|0; + $482 = (_strcmp($481,20116)|0); + $483 = ($482|0)!=(0); + if (!($483)) { + HEAP32[$0>>2] = 3; + break; + } + $484 = HEAP32[$name>>2]|0; + $485 = (_strcmp($484,20132)|0); + $486 = ($485|0)!=(0); + if (!($486)) { + HEAP32[$0>>2] = 2; + break; + } + $487 = HEAP32[$name>>2]|0; + $488 = (_strcmp($487,20149)|0); + $489 = ($488|0)!=(0); + if (!($489)) { + HEAP32[$0>>2] = 1; + break; + } + $490 = HEAP32[$name>>2]|0; + $491 = (_strcmp($490,20166)|0); + $492 = ($491|0)!=(0); + if (!($492)) { + HEAP32[$0>>2] = 29; + break; + } + $493 = HEAP32[$name>>2]|0; + $494 = (_strcmp($493,20182)|0); + $495 = ($494|0)!=(0); + if (!($495)) { + HEAP32[$0>>2] = 1; + break; + } + $496 = HEAP32[$name>>2]|0; + $497 = (_strcmp($496,20198)|0); + $498 = ($497|0)!=(0); + if (!($498)) { + HEAP32[$0>>2] = 4; + break; + } + $499 = HEAP32[$name>>2]|0; + $500 = (_strcmp($499,20215)|0); + $501 = ($500|0)!=(0); + if (!($501)) { + HEAP32[$0>>2] = 30; + break; + } + $502 = HEAP32[$name>>2]|0; + $503 = (_strcmp($502,20229)|0); + $504 = ($503|0)!=(0); + if (!($504)) { + HEAP32[$0>>2] = 31; + break; + } + $505 = HEAP32[$name>>2]|0; + $506 = (_strcmp($505,20241)|0); + $507 = ($506|0)!=(0); + if (!($507)) { + HEAP32[$0>>2] = 22; + break; + } + $508 = HEAP32[$name>>2]|0; + $509 = (_strcmp($508,20252)|0); + $510 = ($509|0)!=(0); + if (!($510)) { + HEAP32[$0>>2] = 2; + break; + } + $511 = HEAP32[$name>>2]|0; + $512 = (_strcmp($511,20265)|0); + $513 = ($512|0)!=(0); + if (!($513)) { + HEAP32[$0>>2] = 23; + break; + } + $514 = HEAP32[$name>>2]|0; + $515 = (_strcmp($514,20275)|0); + $516 = ($515|0)!=(0); + if (!($516)) { + HEAP32[$0>>2] = 2; + break; + } + $517 = HEAP32[$name>>2]|0; + $518 = (_strcmp($517,20292)|0); + $519 = ($518|0)!=(0); + if (!($519)) { + HEAP32[$0>>2] = 24; + break; + } + $520 = HEAP32[$name>>2]|0; + $521 = (_strcmp($520,20304)|0); + $522 = ($521|0)!=(0); + if (!($522)) { + HEAP32[$0>>2] = 25; + break; + } + $523 = HEAP32[$name>>2]|0; + $524 = (_strcmp($523,20326)|0); + $525 = ($524|0)!=(0); + if (!($525)) { + HEAP32[$0>>2] = 26; + break; + } + $526 = HEAP32[$name>>2]|0; + $527 = (_strcmp($526,20346)|0); + $528 = ($527|0)!=(0); + if (!($528)) { + HEAP32[$0>>2] = 3; + break; + } + $529 = HEAP32[$name>>2]|0; + $530 = (_strcmp($529,20359)|0); + $531 = ($530|0)!=(0); + if (!($531)) { + HEAP32[$0>>2] = 27; + break; + } + $532 = HEAP32[$name>>2]|0; + $533 = (_strcmp($532,20381)|0); + $534 = ($533|0)!=(0); + if (!($534)) { + HEAP32[$0>>2] = 28; + break; + } + $535 = HEAP32[$name>>2]|0; + $536 = (_strcmp($535,20401)|0); + $537 = ($536|0)!=(0); + if (!($537)) { + HEAP32[$0>>2] = 2; + break; + } + $538 = HEAP32[$name>>2]|0; + $539 = (_strcmp($538,20418)|0); + $540 = ($539|0)!=(0); + if (!($540)) { + HEAP32[$0>>2] = 2; + break; + } + $541 = HEAP32[$name>>2]|0; + $542 = (_strcmp($541,20435)|0); + $543 = ($542|0)!=(0); + if (!($543)) { + HEAP32[$0>>2] = 3; + break; + } + $544 = HEAP32[$name>>2]|0; + $545 = (_strcmp($544,20455)|0); + $546 = ($545|0)!=(0); + if ($546) { + $547 = HEAP32[$1>>2]|0; + $548 = HEAP32[$name>>2]|0; + $549 = _emscripten_asm_const_2(0, ($547|0), ($548|0))|0; + HEAP32[$0>>2] = 0; + break; + } else { + HEAP32[$0>>2] = 38; + break; + } + } else { + HEAP32[$0>>2] = 6; + } + } while(0); + $550 = HEAP32[$0>>2]|0; + STACKTOP = sp;return ($550|0); +} +function _isspace($c) { + $c = $c|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($c|0)==(32); + $1 = (($c) + -9)|0; + $2 = ($1>>>0)<(5); + $3 = $0 | $2; + $4 = $3&1; + return ($4|0); +} +function _strerror($e) { + $e = $e|0; + var $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$03 = 0, $i$03$lcssa = 0, $i$12 = 0, $s$0$lcssa = 0, $s$01 = 0, $s$1 = 0, label = 0; + var sp = 0; + sp = STACKTOP; + $i$03 = 0; + while(1) { + $1 = (20571 + ($i$03)|0); + $2 = HEAP8[$1>>0]|0; + $3 = $2&255; + $4 = ($3|0)==($e|0); + if ($4) { + $i$03$lcssa = $i$03; + label = 2; + break; + } + $5 = (($i$03) + 1)|0; + $6 = ($5|0)==(87); + if ($6) { + $i$12 = 87;$s$01 = 20659; + label = 5; + break; + } else { + $i$03 = $5; + } + } + if ((label|0) == 2) { + $0 = ($i$03$lcssa|0)==(0); + if ($0) { + $s$0$lcssa = 20659; + } else { + $i$12 = $i$03$lcssa;$s$01 = 20659; + label = 5; + } + } + if ((label|0) == 5) { + while(1) { + label = 0; + $s$1 = $s$01; + while(1) { + $7 = HEAP8[$s$1>>0]|0; + $8 = ($7<<24>>24)==(0); + $9 = ((($s$1)) + 1|0); + if ($8) { + $$lcssa = $9; + break; + } else { + $s$1 = $9; + } + } + $10 = (($i$12) + -1)|0; + $11 = ($10|0)==(0); + if ($11) { + $s$0$lcssa = $$lcssa; + break; + } else { + $i$12 = $10;$s$01 = $$lcssa; + label = 5; + } + } + } + return ($s$0$lcssa|0); +} +function ___errno_location() { + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = HEAP32[6428>>2]|0; + $1 = ($0|0)==(0|0); + if ($1) { + $$0 = 6684; + } else { + $2 = (_pthread_self()|0); + $3 = ((($2)) + 60|0); + $4 = HEAP32[$3>>2]|0; + $$0 = $4; + } + return ($$0|0); +} +function ___floatscan($f,$prec,$pok) { + $f = $f|0; + $prec = $prec|0; + $pok = $pok|0; + var $$$i = 0, $$0 = 0.0, $$0$i27 = 0.0, $$010$i = 0, $$07$i = 0, $$0710$i = 0, $$0711$i = 0, $$09$i = 0, $$1$be$i = 0, $$1$ph$i = 0, $$11$i = 0, $$18$i = 0, $$2$i = 0, $$3$be$i = 0, $$3$lcssa$i = 0, $$3105$i = 0, $$in = 0, $$k$0$i = 0, $$lcssa = 0, $$lcssa256 = 0; + var $$lcssa256$lcssa = 0, $$lcssa257 = 0, $$lcssa257$lcssa = 0, $$lcssa263 = 0, $$lcssa264 = 0, $$lcssa265 = 0, $$lcssa275 = 0, $$lnz$0$i = 0, $$neg32$i = 0, $$not$i = 0, $$old8 = 0, $$pn$i = 0.0, $$pre$i = 0, $$pre$i17 = 0, $$pre$phi42$iZ2D = 0.0, $$pre41$i = 0.0, $$promoted$i = 0, $$sink$off0$i = 0, $0 = 0, $1 = 0; + var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0; + var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0; + var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0; + var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0; + var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0.0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0, $187 = 0, $188 = 0.0, $189 = 0.0, $19 = 0; + var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0; + var $208 = 0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0; + var $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0; + var $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0, $261 = 0; + var $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0.0, $268 = 0.0, $269 = 0.0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0; + var $280 = 0.0, $281 = 0.0, $282 = 0.0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0; + var $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0.0, $312 = 0, $313 = 0, $314 = 0, $315 = 0; + var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0.0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0, $324 = 0, $325 = 0.0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0; + var $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0; + var $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0; + var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0; + var $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0; + var $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0; + var $424 = 0.0, $425 = 0.0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0.0; + var $442 = 0.0, $443 = 0.0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0.0, $454 = 0.0, $455 = 0.0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0; + var $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0.0, $466 = 0.0, $467 = 0.0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0; + var $479 = 0.0, $48 = 0, $480 = 0, $481 = 0.0, $482 = 0.0, $483 = 0, $484 = 0.0, $485 = 0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0.0, $492 = 0.0, $493 = 0, $494 = 0, $495 = 0, $496 = 0; + var $497 = 0, $498 = 0.0, $499 = 0.0, $5 = 0, $50 = 0.0, $500 = 0.0, $501 = 0, $502 = 0, $503 = 0, $504 = 0.0, $505 = 0.0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0.0, $510 = 0, $511 = 0, $512 = 0, $513 = 0; + var $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0.0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0; + var $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0; + var $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0; + var $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0; + var $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0; + var $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0.0, $62 = 0, $620 = 0, $621 = 0; + var $622 = 0, $623 = 0, $624 = 0.0, $625 = 0.0, $626 = 0.0, $627 = 0, $628 = 0.0, $629 = 0.0, $63 = 0, $630 = 0.0, $631 = 0.0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0; + var $640 = 0, $641 = 0, $642 = 0.0, $643 = 0.0, $644 = 0.0, $645 = 0, $646 = 0.0, $647 = 0.0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0.0, $652 = 0.0, $653 = 0.0, $654 = 0.0, $655 = 0, $656 = 0, $657 = 0.0, $658 = 0; + var $659 = 0.0, $66 = 0, $660 = 0.0, $661 = 0.0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0.0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0.0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0; + var $677 = 0, $678 = 0.0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0.0, $684 = 0, $685 = 0, $686 = 0.0, $687 = 0.0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0; + var $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0; + var $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0; + var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; + var $98 = 0, $99 = 0, $a$0$lcssa151$i = 0, $a$085$i = 0, $a$1$i = 0, $a$1$i$lcssa = 0, $a$2$ph38$i = 0, $a$3$i = 0, $a$3$i$lcssa248 = 0, $a$3$i249 = 0, $a$3$ph$i = 0, $a$3$ph157$i = 0, $a$478$i = 0, $a$5$i = 0, $a$5$i$lcssa = 0, $a$5$i$lcssa$lcssa = 0, $bias$0$i = 0.0, $bias$0$i25 = 0.0, $bits$0$ph = 0, $brmerge$i28 = 0; + var $c$0 = 0, $c$0$i = 0, $c$1$lcssa = 0, $c$1$ph$i = 0, $c$179 = 0, $c$2 = 0, $c$2$i = 0, $c$2$lcssa$i = 0, $c$377 = 0, $c$4 = 0, $c$5 = 0, $c$6 = 0, $carry$087$i = 0, $carry1$0$i = 0, $carry1$1$i = 0, $carry1$1$i$lcssa = 0, $carry1$1$i$lcssa$lcssa = 0, $carry3$081$i = 0, $cond$i = 0, $d$0$i = 0; + var $denormal$0$i = 0, $denormal$1$i = 0, $denormal$2$i = 0, $e2$0$i19 = 0, $e2$0$ph$i = 0, $e2$1$i = 0, $e2$1$i246 = 0, $e2$1$ph$i = 0, $e2$1$ph156$i = 0, $e2$2$i = 0, $e2$3$i = 0, $emin$0$ph = 0, $exitcond$i = 0, $frac$0$i = 0.0, $frac$1$i = 0.0, $frac$2$i = 0.0, $gotdig$0$i = 0, $gotdig$0$i$lcssa242 = 0, $gotdig$0$i12 = 0, $gotdig$0$i12$lcssa273 = 0; + var $gotdig$2$i = 0, $gotdig$2$i$lcssa = 0, $gotdig$2$i13 = 0, $gotdig$3$i = 0, $gotdig$3$lcssa$i = 0, $gotdig$3101$i = 0, $gotdig$3101$i$lcssa = 0, $gotdig$4$i = 0, $gotrad$0$i = 0, $gotrad$0$i$lcssa = 0, $gotrad$0$i14 = 0, $gotrad$1$i = 0, $gotrad$1$lcssa$i = 0, $gotrad$1102$i = 0, $gotrad$2$i = 0, $gottail$0$i = 0, $gottail$1$i = 0, $gottail$2$i = 0, $i$0$lcssa = 0, $i$078 = 0; + var $i$1 = 0, $i$276 = 0, $i$3 = 0, $i$4 = 0, $i$4$lcssa = 0, $j$0$lcssa$i = 0, $j$0104$i = 0, $j$0104$i$lcssa = 0, $j$067$i = 0, $j$068$i = 0, $j$069$i = 0, $j$2$i = 0, $j$394$i = 0, $k$0$lcssa$i = 0, $k$0103$i = 0, $k$0103$i$lcssa = 0, $k$063$i = 0, $k$064$i = 0, $k$065$i = 0, $k$2$i = 0; + var $k$3$i = 0, $k$486$i = 0, $k$5$i = 0, $k$5$in$i = 0, $k$5$z$2$i = 0, $k$679$i = 0, $lnz$0$lcssa$i = 0, $lnz$0100$i = 0, $lnz$0100$i$lcssa = 0, $lnz$057$i = 0, $lnz$058$i = 0, $lnz$059$i = 0, $lnz$2$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond$i16 = 0, $or$cond13$i = 0, $or$cond15$i = 0, $or$cond16$i = 0, $or$cond17$i = 0; + var $or$cond182$i = 0, $or$cond19$i = 0, $or$cond20$i = 0, $or$cond3$i = 0, $or$cond4$i = 0, $or$cond5 = 0, $or$cond6$i = 0, $or$cond7 = 0, $or$cond8$i = 0, $or$cond9 = 0, $or$cond9$i = 0, $rp$0$lcssa152$i = 0, $rp$084$i = 0, $rp$1$i18 = 0, $rp$1$i18$lcssa = 0, $rp$2$ph36$i = 0, $rp$3$ph$i = 0, $rp$3$ph34$i = 0, $rp$477$i = 0, $rp$5$i = 0; + var $rp$5$i$lcssa = 0, $rp$5$i$lcssa$lcssa = 0, $scale$0$i = 0.0, $scale$1$i = 0.0, $scale$2$i = 0.0, $sign$0 = 0, $storemerge$i = 0, $sum$i = 0, $x$0$i = 0, $x$0$i$lcssa = 0, $x$1$i = 0, $x$2$i = 0, $x$3$lcssa$i = 0, $x$324$i = 0, $x$4$lcssa$i = 0, $x$419$i = 0, $x$5$i = 0, $x$6$i = 0, $x$i = 0, $y$0$i = 0.0; + var $y$0$i$lcssa = 0.0, $y$1$i = 0.0, $y$1$i24 = 0.0, $y$2$i = 0.0, $y$2$i26 = 0.0, $y$3$i = 0.0, $y$3$lcssa$i = 0.0, $y$320$i = 0.0, $y$4$i = 0.0, $y$5$i = 0.0, $z$0$i = 0, $z$1$i = 0, $z$1$ph37$i = 0, $z$2$i = 0, $z$3$i = 0, $z$3$i$lcssa = 0, $z$3$i$lcssa$lcssa = 0, $z$4$i = 0, $z$5$ph$i = 0, $z$7$1$i = 0; + var $z$7$i = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 512|0; + $x$i = sp; + switch ($prec|0) { + case 0: { + $bits$0$ph = 24;$emin$0$ph = -149; + label = 4; + break; + } + case 1: { + $bits$0$ph = 53;$emin$0$ph = -1074; + label = 4; + break; + } + case 2: { + $bits$0$ph = 53;$emin$0$ph = -1074; + label = 4; + break; + } + default: { + $$0 = 0.0; + } + } + L4: do { + if ((label|0) == 4) { + $0 = ((($f)) + 4|0); + $1 = ((($f)) + 100|0); + while(1) { + $2 = HEAP32[$0>>2]|0; + $3 = HEAP32[$1>>2]|0; + $4 = ($2>>>0)<($3>>>0); + if ($4) { + $5 = ((($2)) + 1|0); + HEAP32[$0>>2] = $5; + $6 = HEAP8[$2>>0]|0; + $7 = $6&255; + $9 = $7; + } else { + $8 = (___shgetc($f)|0); + $9 = $8; + } + $10 = (_isspace($9)|0); + $11 = ($10|0)==(0); + if ($11) { + $$lcssa275 = $9; + break; + } + } + $12 = ($$lcssa275|0)==(45); + L13: do { + switch ($$lcssa275|0) { + case 43: case 45: { + $13 = $12&1; + $14 = $13 << 1; + $15 = (1 - ($14))|0; + $16 = HEAP32[$0>>2]|0; + $17 = HEAP32[$1>>2]|0; + $18 = ($16>>>0)<($17>>>0); + if ($18) { + $19 = ((($16)) + 1|0); + HEAP32[$0>>2] = $19; + $20 = HEAP8[$16>>0]|0; + $21 = $20&255; + $c$0 = $21;$sign$0 = $15; + break L13; + } else { + $22 = (___shgetc($f)|0); + $c$0 = $22;$sign$0 = $15; + break L13; + } + break; + } + default: { + $c$0 = $$lcssa275;$sign$0 = 1; + } + } + } while(0); + $c$179 = $c$0;$i$078 = 0; + while(1) { + $23 = $c$179 | 32; + $24 = (22463 + ($i$078)|0); + $25 = HEAP8[$24>>0]|0; + $26 = $25 << 24 >> 24; + $27 = ($23|0)==($26|0); + if (!($27)) { + $c$1$lcssa = $c$179;$i$0$lcssa = $i$078; + break; + } + $28 = ($i$078>>>0)<(7); + do { + if ($28) { + $29 = HEAP32[$0>>2]|0; + $30 = HEAP32[$1>>2]|0; + $31 = ($29>>>0)<($30>>>0); + if ($31) { + $32 = ((($29)) + 1|0); + HEAP32[$0>>2] = $32; + $33 = HEAP8[$29>>0]|0; + $34 = $33&255; + $c$2 = $34; + break; + } else { + $35 = (___shgetc($f)|0); + $c$2 = $35; + break; + } + } else { + $c$2 = $c$179; + } + } while(0); + $36 = (($i$078) + 1)|0; + $37 = ($36>>>0)<(8); + if ($37) { + $c$179 = $c$2;$i$078 = $36; + } else { + $c$1$lcssa = $c$2;$i$0$lcssa = $36; + break; + } + } + L29: do { + switch ($i$0$lcssa|0) { + case 8: { + break; + } + case 3: { + label = 23; + break; + } + default: { + $38 = ($i$0$lcssa>>>0)>(3); + $39 = ($pok|0)!=(0); + $or$cond5 = $39 & $38; + if ($or$cond5) { + $40 = ($i$0$lcssa|0)==(8); + if ($40) { + break L29; + } else { + label = 23; + break L29; + } + } + $53 = ($i$0$lcssa|0)==(0); + L34: do { + if ($53) { + $c$377 = $c$1$lcssa;$i$276 = 0; + while(1) { + $54 = $c$377 | 32; + $55 = (24298 + ($i$276)|0); + $56 = HEAP8[$55>>0]|0; + $57 = $56 << 24 >> 24; + $58 = ($54|0)==($57|0); + if (!($58)) { + $c$5 = $c$377;$i$3 = $i$276; + break L34; + } + $59 = ($i$276>>>0)<(2); + do { + if ($59) { + $60 = HEAP32[$0>>2]|0; + $61 = HEAP32[$1>>2]|0; + $62 = ($60>>>0)<($61>>>0); + if ($62) { + $63 = ((($60)) + 1|0); + HEAP32[$0>>2] = $63; + $64 = HEAP8[$60>>0]|0; + $65 = $64&255; + $c$4 = $65; + break; + } else { + $66 = (___shgetc($f)|0); + $c$4 = $66; + break; + } + } else { + $c$4 = $c$377; + } + } while(0); + $67 = (($i$276) + 1)|0; + $68 = ($67>>>0)<(3); + if ($68) { + $c$377 = $c$4;$i$276 = $67; + } else { + $c$5 = $c$4;$i$3 = $67; + break; + } + } + } else { + $c$5 = $c$1$lcssa;$i$3 = $i$0$lcssa; + } + } while(0); + switch ($i$3|0) { + case 3: { + $69 = HEAP32[$0>>2]|0; + $70 = HEAP32[$1>>2]|0; + $71 = ($69>>>0)<($70>>>0); + if ($71) { + $72 = ((($69)) + 1|0); + HEAP32[$0>>2] = $72; + $73 = HEAP8[$69>>0]|0; + $74 = $73&255; + $76 = $74; + } else { + $75 = (___shgetc($f)|0); + $76 = $75; + } + $77 = ($76|0)==(40); + if ($77) { + $i$4 = 1; + } else { + $78 = HEAP32[$1>>2]|0; + $79 = ($78|0)==(0|0); + if ($79) { + $$0 = nan; + break L4; + } + $80 = HEAP32[$0>>2]|0; + $81 = ((($80)) + -1|0); + HEAP32[$0>>2] = $81; + $$0 = nan; + break L4; + } + while(1) { + $82 = HEAP32[$0>>2]|0; + $83 = HEAP32[$1>>2]|0; + $84 = ($82>>>0)<($83>>>0); + if ($84) { + $85 = ((($82)) + 1|0); + HEAP32[$0>>2] = $85; + $86 = HEAP8[$82>>0]|0; + $87 = $86&255; + $90 = $87; + } else { + $88 = (___shgetc($f)|0); + $90 = $88; + } + $89 = (($90) + -48)|0; + $91 = ($89>>>0)<(10); + $92 = (($90) + -65)|0; + $93 = ($92>>>0)<(26); + $or$cond = $91 | $93; + if (!($or$cond)) { + $94 = (($90) + -97)|0; + $95 = ($94>>>0)<(26); + $96 = ($90|0)==(95); + $or$cond7 = $96 | $95; + if (!($or$cond7)) { + $$lcssa = $90;$i$4$lcssa = $i$4; + break; + } + } + $108 = (($i$4) + 1)|0; + $i$4 = $108; + } + $97 = ($$lcssa|0)==(41); + if ($97) { + $$0 = nan; + break L4; + } + $98 = HEAP32[$1>>2]|0; + $99 = ($98|0)==(0|0); + if (!($99)) { + $100 = HEAP32[$0>>2]|0; + $101 = ((($100)) + -1|0); + HEAP32[$0>>2] = $101; + } + if (!($39)) { + $103 = (___errno_location()|0); + HEAP32[$103>>2] = 22; + ___shlim($f,0); + $$0 = 0.0; + break L4; + } + $102 = ($i$4$lcssa|0)==(0); + if ($102) { + $$0 = nan; + break L4; + } else { + $$in = $i$4$lcssa; + } + while(1) { + $104 = (($$in) + -1)|0; + if (!($99)) { + $105 = HEAP32[$0>>2]|0; + $106 = ((($105)) + -1|0); + HEAP32[$0>>2] = $106; + } + $107 = ($104|0)==(0); + if ($107) { + $$0 = nan; + break L4; + } else { + $$in = $104; + } + } + break; + } + case 0: { + $114 = ($c$5|0)==(48); + do { + if ($114) { + $115 = HEAP32[$0>>2]|0; + $116 = HEAP32[$1>>2]|0; + $117 = ($115>>>0)<($116>>>0); + if ($117) { + $118 = ((($115)) + 1|0); + HEAP32[$0>>2] = $118; + $119 = HEAP8[$115>>0]|0; + $120 = $119&255; + $123 = $120; + } else { + $121 = (___shgetc($f)|0); + $123 = $121; + } + $122 = $123 | 32; + $124 = ($122|0)==(120); + if (!($124)) { + $326 = HEAP32[$1>>2]|0; + $327 = ($326|0)==(0|0); + if ($327) { + $c$6 = 48; + break; + } + $328 = HEAP32[$0>>2]|0; + $329 = ((($328)) + -1|0); + HEAP32[$0>>2] = $329; + $c$6 = 48; + break; + } + $125 = HEAP32[$0>>2]|0; + $126 = HEAP32[$1>>2]|0; + $127 = ($125>>>0)<($126>>>0); + if ($127) { + $128 = ((($125)) + 1|0); + HEAP32[$0>>2] = $128; + $129 = HEAP8[$125>>0]|0; + $130 = $129&255; + $c$0$i = $130;$gotdig$0$i = 0; + } else { + $131 = (___shgetc($f)|0); + $c$0$i = $131;$gotdig$0$i = 0; + } + L94: while(1) { + switch ($c$0$i|0) { + case 46: { + $gotdig$0$i$lcssa242 = $gotdig$0$i; + label = 74; + break L94; + break; + } + case 48: { + break; + } + default: { + $168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$0$i;$gotdig$2$i = $gotdig$0$i;$gotrad$0$i = 0;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0; + break L94; + } + } + $132 = HEAP32[$0>>2]|0; + $133 = HEAP32[$1>>2]|0; + $134 = ($132>>>0)<($133>>>0); + if ($134) { + $135 = ((($132)) + 1|0); + HEAP32[$0>>2] = $135; + $136 = HEAP8[$132>>0]|0; + $137 = $136&255; + $c$0$i = $137;$gotdig$0$i = 1; + continue; + } else { + $138 = (___shgetc($f)|0); + $c$0$i = $138;$gotdig$0$i = 1; + continue; + } + } + if ((label|0) == 74) { + $139 = HEAP32[$0>>2]|0; + $140 = HEAP32[$1>>2]|0; + $141 = ($139>>>0)<($140>>>0); + if ($141) { + $142 = ((($139)) + 1|0); + HEAP32[$0>>2] = $142; + $143 = HEAP8[$139>>0]|0; + $144 = $143&255; + $c$1$ph$i = $144; + } else { + $145 = (___shgetc($f)|0); + $c$1$ph$i = $145; + } + $146 = ($c$1$ph$i|0)==(48); + if ($146) { + $154 = 0;$155 = 0; + while(1) { + $147 = HEAP32[$0>>2]|0; + $148 = HEAP32[$1>>2]|0; + $149 = ($147>>>0)<($148>>>0); + if ($149) { + $150 = ((($147)) + 1|0); + HEAP32[$0>>2] = $150; + $151 = HEAP8[$147>>0]|0; + $152 = $151&255; + $158 = $152; + } else { + $153 = (___shgetc($f)|0); + $158 = $153; + } + $156 = (_i64Add(($154|0),($155|0),-1,-1)|0); + $157 = tempRet0; + $159 = ($158|0)==(48); + if ($159) { + $154 = $156;$155 = $157; + } else { + $168 = 0;$170 = 0;$694 = $156;$695 = $157;$c$2$i = $158;$gotdig$2$i = 1;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0; + break; + } + } + } else { + $168 = 0;$170 = 0;$694 = 0;$695 = 0;$c$2$i = $c$1$ph$i;$gotdig$2$i = $gotdig$0$i$lcssa242;$gotrad$0$i = 1;$gottail$0$i = 0;$scale$0$i = 1.0;$x$0$i = 0;$y$0$i = 0.0; + } + } + while(1) { + $160 = (($c$2$i) + -48)|0; + $161 = ($160>>>0)<(10); + $$pre$i = $c$2$i | 32; + if ($161) { + label = 86; + } else { + $162 = (($$pre$i) + -97)|0; + $163 = ($162>>>0)<(6); + $164 = ($c$2$i|0)==(46); + $or$cond6$i = $164 | $163; + if (!($or$cond6$i)) { + $212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = $c$2$i;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i; + break; + } + if ($164) { + $165 = ($gotrad$0$i|0)==(0); + if ($165) { + $696 = $170;$697 = $168;$698 = $170;$699 = $168;$gotdig$3$i = $gotdig$2$i;$gotrad$1$i = 1;$gottail$2$i = $gottail$0$i;$scale$2$i = $scale$0$i;$x$2$i = $x$0$i;$y$2$i = $y$0$i; + } else { + $212 = $694;$213 = $170;$215 = $695;$216 = $168;$c$2$lcssa$i = 46;$gotdig$2$i$lcssa = $gotdig$2$i;$gotrad$0$i$lcssa = $gotrad$0$i;$x$0$i$lcssa = $x$0$i;$y$0$i$lcssa = $y$0$i; + break; + } + } else { + label = 86; + } + } + if ((label|0) == 86) { + label = 0; + $166 = ($c$2$i|0)>(57); + $167 = (($$pre$i) + -87)|0; + $d$0$i = $166 ? $167 : $160; + $169 = ($168|0)<(0); + $171 = ($170>>>0)<(8); + $172 = ($168|0)==(0); + $173 = $172 & $171; + $174 = $169 | $173; + do { + if ($174) { + $175 = $x$0$i << 4; + $176 = (($d$0$i) + ($175))|0; + $gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $176;$y$1$i = $y$0$i; + } else { + $177 = ($168|0)<(0); + $178 = ($170>>>0)<(14); + $179 = ($168|0)==(0); + $180 = $179 & $178; + $181 = $177 | $180; + if ($181) { + $182 = (+($d$0$i|0)); + $183 = $scale$0$i * 0.0625; + $184 = $183 * $182; + $185 = $y$0$i + $184; + $gottail$1$i = $gottail$0$i;$scale$1$i = $183;$x$1$i = $x$0$i;$y$1$i = $185; + break; + } + $186 = ($d$0$i|0)==(0); + $187 = ($gottail$0$i|0)!=(0); + $or$cond$i = $187 | $186; + if ($or$cond$i) { + $gottail$1$i = $gottail$0$i;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $y$0$i; + } else { + $188 = $scale$0$i * 0.5; + $189 = $y$0$i + $188; + $gottail$1$i = 1;$scale$1$i = $scale$0$i;$x$1$i = $x$0$i;$y$1$i = $189; + } + } + } while(0); + $190 = (_i64Add(($170|0),($168|0),1,0)|0); + $191 = tempRet0; + $696 = $694;$697 = $695;$698 = $190;$699 = $191;$gotdig$3$i = 1;$gotrad$1$i = $gotrad$0$i;$gottail$2$i = $gottail$1$i;$scale$2$i = $scale$1$i;$x$2$i = $x$1$i;$y$2$i = $y$1$i; + } + $192 = HEAP32[$0>>2]|0; + $193 = HEAP32[$1>>2]|0; + $194 = ($192>>>0)<($193>>>0); + if ($194) { + $195 = ((($192)) + 1|0); + HEAP32[$0>>2] = $195; + $196 = HEAP8[$192>>0]|0; + $197 = $196&255; + $168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $197;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i; + continue; + } else { + $198 = (___shgetc($f)|0); + $168 = $699;$170 = $698;$694 = $696;$695 = $697;$c$2$i = $198;$gotdig$2$i = $gotdig$3$i;$gotrad$0$i = $gotrad$1$i;$gottail$0$i = $gottail$2$i;$scale$0$i = $scale$2$i;$x$0$i = $x$2$i;$y$0$i = $y$2$i; + continue; + } + } + $199 = ($gotdig$2$i$lcssa|0)==(0); + if ($199) { + $200 = HEAP32[$1>>2]|0; + $201 = ($200|0)==(0|0); + if (!($201)) { + $202 = HEAP32[$0>>2]|0; + $203 = ((($202)) + -1|0); + HEAP32[$0>>2] = $203; + } + $204 = ($pok|0)==(0); + if ($204) { + ___shlim($f,0); + } else { + if (!($201)) { + $205 = HEAP32[$0>>2]|0; + $206 = ((($205)) + -1|0); + HEAP32[$0>>2] = $206; + $207 = ($gotrad$0$i$lcssa|0)==(0); + if (!($207)) { + $208 = ((($205)) + -2|0); + HEAP32[$0>>2] = $208; + } + } + } + $209 = (+($sign$0|0)); + $210 = $209 * 0.0; + $$0 = $210; + break L4; + } + $211 = ($gotrad$0$i$lcssa|0)==(0); + $214 = $211 ? $213 : $212; + $217 = $211 ? $216 : $215; + $218 = ($216|0)<(0); + $219 = ($213>>>0)<(8); + $220 = ($216|0)==(0); + $221 = $220 & $219; + $222 = $218 | $221; + if ($222) { + $224 = $213;$225 = $216;$x$324$i = $x$0$i$lcssa; + while(1) { + $223 = $x$324$i << 4; + $226 = (_i64Add(($224|0),($225|0),1,0)|0); + $227 = tempRet0; + $228 = ($227|0)<(0); + $229 = ($226>>>0)<(8); + $230 = ($227|0)==(0); + $231 = $230 & $229; + $232 = $228 | $231; + if ($232) { + $224 = $226;$225 = $227;$x$324$i = $223; + } else { + $x$3$lcssa$i = $223; + break; + } + } + } else { + $x$3$lcssa$i = $x$0$i$lcssa; + } + $233 = $c$2$lcssa$i | 32; + $234 = ($233|0)==(112); + if ($234) { + $235 = (_scanexp($f,$pok)|0); + $236 = tempRet0; + $237 = ($235|0)==(0); + $238 = ($236|0)==(-2147483648); + $239 = $237 & $238; + if ($239) { + $240 = ($pok|0)==(0); + if ($240) { + ___shlim($f,0); + $$0 = 0.0; + break L4; + } + $241 = HEAP32[$1>>2]|0; + $242 = ($241|0)==(0|0); + if ($242) { + $253 = 0;$254 = 0; + } else { + $243 = HEAP32[$0>>2]|0; + $244 = ((($243)) + -1|0); + HEAP32[$0>>2] = $244; + $253 = 0;$254 = 0; + } + } else { + $253 = $235;$254 = $236; + } + } else { + $245 = HEAP32[$1>>2]|0; + $246 = ($245|0)==(0|0); + if ($246) { + $253 = 0;$254 = 0; + } else { + $247 = HEAP32[$0>>2]|0; + $248 = ((($247)) + -1|0); + HEAP32[$0>>2] = $248; + $253 = 0;$254 = 0; + } + } + $249 = (_bitshift64Shl(($214|0),($217|0),2)|0); + $250 = tempRet0; + $251 = (_i64Add(($249|0),($250|0),-32,-1)|0); + $252 = tempRet0; + $255 = (_i64Add(($251|0),($252|0),($253|0),($254|0))|0); + $256 = tempRet0; + $257 = ($x$3$lcssa$i|0)==(0); + if ($257) { + $258 = (+($sign$0|0)); + $259 = $258 * 0.0; + $$0 = $259; + break L4; + } + $260 = (0 - ($emin$0$ph))|0; + $261 = ($256|0)>(0); + $262 = ($255>>>0)>($260>>>0); + $263 = ($256|0)==(0); + $264 = $263 & $262; + $265 = $261 | $264; + if ($265) { + $266 = (___errno_location()|0); + HEAP32[$266>>2] = 34; + $267 = (+($sign$0|0)); + $268 = $267 * 1.7976931348623157E+308; + $269 = $268 * 1.7976931348623157E+308; + $$0 = $269; + break L4; + } + $270 = (($emin$0$ph) + -106)|0; + $271 = ($270|0)<(0); + $272 = $271 << 31 >> 31; + $273 = ($256|0)<($272|0); + $274 = ($255>>>0)<($270>>>0); + $275 = ($256|0)==($272|0); + $276 = $275 & $274; + $277 = $273 | $276; + if ($277) { + $279 = (___errno_location()|0); + HEAP32[$279>>2] = 34; + $280 = (+($sign$0|0)); + $281 = $280 * 2.2250738585072014E-308; + $282 = $281 * 2.2250738585072014E-308; + $$0 = $282; + break L4; + } + $278 = ($x$3$lcssa$i|0)>(-1); + if ($278) { + $288 = $255;$289 = $256;$x$419$i = $x$3$lcssa$i;$y$320$i = $y$0$i$lcssa; + while(1) { + $283 = !($y$320$i >= 0.5); + $284 = $x$419$i << 1; + $285 = $y$320$i + -1.0; + $286 = $283&1; + $287 = $286 | $284; + $x$5$i = $287 ^ 1; + $$pn$i = $283 ? $y$320$i : $285; + $y$4$i = $y$320$i + $$pn$i; + $290 = (_i64Add(($288|0),($289|0),-1,-1)|0); + $291 = tempRet0; + $292 = ($287|0)>(-1); + if ($292) { + $288 = $290;$289 = $291;$x$419$i = $x$5$i;$y$320$i = $y$4$i; + } else { + $297 = $290;$298 = $291;$x$4$lcssa$i = $x$5$i;$y$3$lcssa$i = $y$4$i; + break; + } + } + } else { + $297 = $255;$298 = $256;$x$4$lcssa$i = $x$3$lcssa$i;$y$3$lcssa$i = $y$0$i$lcssa; + } + $293 = ($emin$0$ph|0)<(0); + $294 = $293 << 31 >> 31; + $295 = (_i64Subtract(32,0,($emin$0$ph|0),($294|0))|0); + $296 = tempRet0; + $299 = (_i64Add(($297|0),($298|0),($295|0),($296|0))|0); + $300 = tempRet0; + $301 = (0)>($300|0); + $302 = ($bits$0$ph>>>0)>($299>>>0); + $303 = (0)==($300|0); + $304 = $303 & $302; + $305 = $301 | $304; + if ($305) { + $306 = ($299|0)<(0); + if ($306) { + $$0710$i = 0; + label = 127; + } else { + $$07$i = $299; + label = 125; + } + } else { + $$07$i = $bits$0$ph; + label = 125; + } + if ((label|0) == 125) { + $307 = ($$07$i|0)<(53); + if ($307) { + $$0710$i = $$07$i; + label = 127; + } else { + $$pre41$i = (+($sign$0|0)); + $$0711$i = $$07$i;$$pre$phi42$iZ2D = $$pre41$i;$bias$0$i = 0.0; + } + } + if ((label|0) == 127) { + $308 = (84 - ($$0710$i))|0; + $309 = (+_scalbn(1.0,$308)); + $310 = (+($sign$0|0)); + $311 = (+_copysignl($309,$310)); + $$0711$i = $$0710$i;$$pre$phi42$iZ2D = $310;$bias$0$i = $311; + } + $312 = ($$0711$i|0)<(32); + $313 = $y$3$lcssa$i != 0.0; + $or$cond4$i = $313 & $312; + $314 = $x$4$lcssa$i & 1; + $315 = ($314|0)==(0); + $or$cond9$i = $315 & $or$cond4$i; + $316 = $or$cond9$i&1; + $x$6$i = (($316) + ($x$4$lcssa$i))|0; + $y$5$i = $or$cond9$i ? 0.0 : $y$3$lcssa$i; + $317 = (+($x$6$i>>>0)); + $318 = $$pre$phi42$iZ2D * $317; + $319 = $bias$0$i + $318; + $320 = $$pre$phi42$iZ2D * $y$5$i; + $321 = $320 + $319; + $322 = $321 - $bias$0$i; + $323 = $322 != 0.0; + if (!($323)) { + $324 = (___errno_location()|0); + HEAP32[$324>>2] = 34; + } + $325 = (+_scalbnl($322,$297)); + $$0 = $325; + break L4; + } else { + $c$6 = $c$5; + } + } while(0); + $sum$i = (($emin$0$ph) + ($bits$0$ph))|0; + $330 = (0 - ($sum$i))|0; + $$09$i = $c$6;$gotdig$0$i12 = 0; + L184: while(1) { + switch ($$09$i|0) { + case 46: { + $gotdig$0$i12$lcssa273 = $gotdig$0$i12; + label = 138; + break L184; + break; + } + case 48: { + break; + } + default: { + $$2$i = $$09$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12;$gotrad$0$i14 = 0; + break L184; + } + } + $331 = HEAP32[$0>>2]|0; + $332 = HEAP32[$1>>2]|0; + $333 = ($331>>>0)<($332>>>0); + if ($333) { + $334 = ((($331)) + 1|0); + HEAP32[$0>>2] = $334; + $335 = HEAP8[$331>>0]|0; + $336 = $335&255; + $$09$i = $336;$gotdig$0$i12 = 1; + continue; + } else { + $337 = (___shgetc($f)|0); + $$09$i = $337;$gotdig$0$i12 = 1; + continue; + } + } + if ((label|0) == 138) { + $338 = HEAP32[$0>>2]|0; + $339 = HEAP32[$1>>2]|0; + $340 = ($338>>>0)<($339>>>0); + if ($340) { + $341 = ((($338)) + 1|0); + HEAP32[$0>>2] = $341; + $342 = HEAP8[$338>>0]|0; + $343 = $342&255; + $$1$ph$i = $343; + } else { + $344 = (___shgetc($f)|0); + $$1$ph$i = $344; + } + $345 = ($$1$ph$i|0)==(48); + if ($345) { + $346 = 0;$347 = 0; + while(1) { + $348 = (_i64Add(($346|0),($347|0),-1,-1)|0); + $349 = tempRet0; + $350 = HEAP32[$0>>2]|0; + $351 = HEAP32[$1>>2]|0; + $352 = ($350>>>0)<($351>>>0); + if ($352) { + $353 = ((($350)) + 1|0); + HEAP32[$0>>2] = $353; + $354 = HEAP8[$350>>0]|0; + $355 = $354&255; + $$1$be$i = $355; + } else { + $356 = (___shgetc($f)|0); + $$1$be$i = $356; + } + $357 = ($$1$be$i|0)==(48); + if ($357) { + $346 = $348;$347 = $349; + } else { + $$2$i = $$1$be$i;$700 = $348;$701 = $349;$gotdig$2$i13 = 1;$gotrad$0$i14 = 1; + break; + } + } + } else { + $$2$i = $$1$ph$i;$700 = 0;$701 = 0;$gotdig$2$i13 = $gotdig$0$i12$lcssa273;$gotrad$0$i14 = 1; + } + } + HEAP32[$x$i>>2] = 0; + $358 = (($$2$i) + -48)|0; + $359 = ($358>>>0)<(10); + $360 = ($$2$i|0)==(46); + $361 = $360 | $359; + L203: do { + if ($361) { + $362 = ((($x$i)) + 496|0); + $$3105$i = $$2$i;$365 = 0;$366 = 0;$702 = $360;$703 = $358;$704 = $700;$705 = $701;$gotdig$3101$i = $gotdig$2$i13;$gotrad$1102$i = $gotrad$0$i14;$j$0104$i = 0;$k$0103$i = 0;$lnz$0100$i = 0; + L205: while(1) { + do { + if ($702) { + $cond$i = ($gotrad$1102$i|0)==(0); + if ($cond$i) { + $706 = $365;$707 = $366;$708 = $365;$709 = $366;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = 1;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i; + } else { + $710 = $704;$711 = $705;$712 = $365;$713 = $366;$gotdig$3101$i$lcssa = $gotdig$3101$i;$j$0104$i$lcssa = $j$0104$i;$k$0103$i$lcssa = $k$0103$i;$lnz$0100$i$lcssa = $lnz$0100$i; + break L205; + } + } else { + $364 = ($k$0103$i|0)<(125); + $367 = (_i64Add(($365|0),($366|0),1,0)|0); + $368 = tempRet0; + $369 = ($$3105$i|0)!=(48); + if (!($364)) { + if (!($369)) { + $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i; + break; + } + $379 = HEAP32[$362>>2]|0; + $380 = $379 | 1; + HEAP32[$362>>2] = $380; + $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = $gotdig$3101$i;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $j$0104$i;$k$2$i = $k$0103$i;$lnz$2$i = $lnz$0100$i; + break; + } + $$lnz$0$i = $369 ? $367 : $lnz$0100$i; + $370 = ($j$0104$i|0)==(0); + $371 = (($x$i) + ($k$0103$i<<2)|0); + if ($370) { + $storemerge$i = $703; + } else { + $372 = HEAP32[$371>>2]|0; + $373 = ($372*10)|0; + $374 = (($$3105$i) + -48)|0; + $375 = (($374) + ($373))|0; + $storemerge$i = $375; + } + HEAP32[$371>>2] = $storemerge$i; + $376 = (($j$0104$i) + 1)|0; + $377 = ($376|0)==(9); + $378 = $377&1; + $$k$0$i = (($378) + ($k$0103$i))|0; + $$11$i = $377 ? 0 : $376; + $706 = $704;$707 = $705;$708 = $367;$709 = $368;$gotdig$4$i = 1;$gotrad$2$i = $gotrad$1102$i;$j$2$i = $$11$i;$k$2$i = $$k$0$i;$lnz$2$i = $$lnz$0$i; + } + } while(0); + $381 = HEAP32[$0>>2]|0; + $382 = HEAP32[$1>>2]|0; + $383 = ($381>>>0)<($382>>>0); + if ($383) { + $384 = ((($381)) + 1|0); + HEAP32[$0>>2] = $384; + $385 = HEAP8[$381>>0]|0; + $386 = $385&255; + $$3$be$i = $386; + } else { + $387 = (___shgetc($f)|0); + $$3$be$i = $387; + } + $388 = (($$3$be$i) + -48)|0; + $389 = ($388>>>0)<(10); + $390 = ($$3$be$i|0)==(46); + $391 = $390 | $389; + if ($391) { + $$3105$i = $$3$be$i;$365 = $708;$366 = $709;$702 = $390;$703 = $388;$704 = $706;$705 = $707;$gotdig$3101$i = $gotdig$4$i;$gotrad$1102$i = $gotrad$2$i;$j$0104$i = $j$2$i;$k$0103$i = $k$2$i;$lnz$0100$i = $lnz$2$i; + } else { + $$3$lcssa$i = $$3$be$i;$393 = $706;$394 = $708;$396 = $707;$397 = $709;$gotdig$3$lcssa$i = $gotdig$4$i;$gotrad$1$lcssa$i = $gotrad$2$i;$j$0$lcssa$i = $j$2$i;$k$0$lcssa$i = $k$2$i;$lnz$0$lcssa$i = $lnz$2$i; + label = 161; + break L203; + } + } + $363 = ($gotdig$3101$i$lcssa|0)!=(0); + $714 = $712;$715 = $713;$716 = $710;$717 = $711;$718 = $363;$j$069$i = $j$0104$i$lcssa;$k$065$i = $k$0103$i$lcssa;$lnz$059$i = $lnz$0100$i$lcssa; + label = 169; + } else { + $$3$lcssa$i = $$2$i;$393 = $700;$394 = 0;$396 = $701;$397 = 0;$gotdig$3$lcssa$i = $gotdig$2$i13;$gotrad$1$lcssa$i = $gotrad$0$i14;$j$0$lcssa$i = 0;$k$0$lcssa$i = 0;$lnz$0$lcssa$i = 0; + label = 161; + } + } while(0); + do { + if ((label|0) == 161) { + $392 = ($gotrad$1$lcssa$i|0)==(0); + $395 = $392 ? $394 : $393; + $398 = $392 ? $397 : $396; + $399 = ($gotdig$3$lcssa$i|0)!=(0); + $400 = $$3$lcssa$i | 32; + $401 = ($400|0)==(101); + $or$cond13$i = $401 & $399; + if (!($or$cond13$i)) { + $416 = ($$3$lcssa$i|0)>(-1); + if ($416) { + $714 = $394;$715 = $397;$716 = $395;$717 = $398;$718 = $399;$j$069$i = $j$0$lcssa$i;$k$065$i = $k$0$lcssa$i;$lnz$059$i = $lnz$0$lcssa$i; + label = 169; + break; + } else { + $719 = $394;$720 = $397;$721 = $399;$722 = $395;$723 = $398;$j$068$i = $j$0$lcssa$i;$k$064$i = $k$0$lcssa$i;$lnz$058$i = $lnz$0$lcssa$i; + label = 171; + break; + } + } + $402 = (_scanexp($f,$pok)|0); + $403 = tempRet0; + $404 = ($402|0)==(0); + $405 = ($403|0)==(-2147483648); + $406 = $404 & $405; + if ($406) { + $407 = ($pok|0)==(0); + if ($407) { + ___shlim($f,0); + $$0$i27 = 0.0; + break; + } + $408 = HEAP32[$1>>2]|0; + $409 = ($408|0)==(0|0); + if ($409) { + $412 = 0;$413 = 0; + } else { + $410 = HEAP32[$0>>2]|0; + $411 = ((($410)) + -1|0); + HEAP32[$0>>2] = $411; + $412 = 0;$413 = 0; + } + } else { + $412 = $402;$413 = $403; + } + $414 = (_i64Add(($412|0),($413|0),($395|0),($398|0))|0); + $415 = tempRet0; + $426 = $414;$428 = $394;$429 = $415;$431 = $397;$j$067$i = $j$0$lcssa$i;$k$063$i = $k$0$lcssa$i;$lnz$057$i = $lnz$0$lcssa$i; + label = 173; + } + } while(0); + if ((label|0) == 169) { + $417 = HEAP32[$1>>2]|0; + $418 = ($417|0)==(0|0); + if ($418) { + $719 = $714;$720 = $715;$721 = $718;$722 = $716;$723 = $717;$j$068$i = $j$069$i;$k$064$i = $k$065$i;$lnz$058$i = $lnz$059$i; + label = 171; + } else { + $419 = HEAP32[$0>>2]|0; + $420 = ((($419)) + -1|0); + HEAP32[$0>>2] = $420; + if ($718) { + $426 = $716;$428 = $714;$429 = $717;$431 = $715;$j$067$i = $j$069$i;$k$063$i = $k$065$i;$lnz$057$i = $lnz$059$i; + label = 173; + } else { + label = 172; + } + } + } + if ((label|0) == 171) { + if ($721) { + $426 = $722;$428 = $719;$429 = $723;$431 = $720;$j$067$i = $j$068$i;$k$063$i = $k$064$i;$lnz$057$i = $lnz$058$i; + label = 173; + } else { + label = 172; + } + } + do { + if ((label|0) == 172) { + $421 = (___errno_location()|0); + HEAP32[$421>>2] = 22; + ___shlim($f,0); + $$0$i27 = 0.0; + } + else if ((label|0) == 173) { + $422 = HEAP32[$x$i>>2]|0; + $423 = ($422|0)==(0); + if ($423) { + $424 = (+($sign$0|0)); + $425 = $424 * 0.0; + $$0$i27 = $425; + break; + } + $427 = ($426|0)==($428|0); + $430 = ($429|0)==($431|0); + $432 = $427 & $430; + $433 = ($431|0)<(0); + $434 = ($428>>>0)<(10); + $435 = ($431|0)==(0); + $436 = $435 & $434; + $437 = $433 | $436; + $or$cond$i16 = $437 & $432; + if ($or$cond$i16) { + $438 = ($bits$0$ph>>>0)>(30); + $439 = $422 >>> $bits$0$ph; + $440 = ($439|0)==(0); + $or$cond15$i = $438 | $440; + if ($or$cond15$i) { + $441 = (+($sign$0|0)); + $442 = (+($422>>>0)); + $443 = $441 * $442; + $$0$i27 = $443; + break; + } + } + $444 = (($emin$0$ph|0) / -2)&-1; + $445 = ($444|0)<(0); + $446 = $445 << 31 >> 31; + $447 = ($429|0)>($446|0); + $448 = ($426>>>0)>($444>>>0); + $449 = ($429|0)==($446|0); + $450 = $449 & $448; + $451 = $447 | $450; + if ($451) { + $452 = (___errno_location()|0); + HEAP32[$452>>2] = 34; + $453 = (+($sign$0|0)); + $454 = $453 * 1.7976931348623157E+308; + $455 = $454 * 1.7976931348623157E+308; + $$0$i27 = $455; + break; + } + $456 = (($emin$0$ph) + -106)|0; + $457 = ($456|0)<(0); + $458 = $457 << 31 >> 31; + $459 = ($429|0)<($458|0); + $460 = ($426>>>0)<($456>>>0); + $461 = ($429|0)==($458|0); + $462 = $461 & $460; + $463 = $459 | $462; + if ($463) { + $464 = (___errno_location()|0); + HEAP32[$464>>2] = 34; + $465 = (+($sign$0|0)); + $466 = $465 * 2.2250738585072014E-308; + $467 = $466 * 2.2250738585072014E-308; + $$0$i27 = $467; + break; + } + $468 = ($j$067$i|0)==(0); + if ($468) { + $k$3$i = $k$063$i; + } else { + $469 = ($j$067$i|0)<(9); + if ($469) { + $470 = (($x$i) + ($k$063$i<<2)|0); + $$promoted$i = HEAP32[$470>>2]|0; + $472 = $$promoted$i;$j$394$i = $j$067$i; + while(1) { + $471 = ($472*10)|0; + $473 = (($j$394$i) + 1)|0; + $exitcond$i = ($473|0)==(9); + if ($exitcond$i) { + $$lcssa265 = $471; + break; + } else { + $472 = $471;$j$394$i = $473; + } + } + HEAP32[$470>>2] = $$lcssa265; + } + $474 = (($k$063$i) + 1)|0; + $k$3$i = $474; + } + $475 = ($lnz$057$i|0)<(9); + if ($475) { + $476 = ($lnz$057$i|0)<=($426|0); + $477 = ($426|0)<(18); + $or$cond3$i = $476 & $477; + if ($or$cond3$i) { + $478 = ($426|0)==(9); + if ($478) { + $479 = (+($sign$0|0)); + $480 = HEAP32[$x$i>>2]|0; + $481 = (+($480>>>0)); + $482 = $479 * $481; + $$0$i27 = $482; + break; + } + $483 = ($426|0)<(9); + if ($483) { + $484 = (+($sign$0|0)); + $485 = HEAP32[$x$i>>2]|0; + $486 = (+($485>>>0)); + $487 = $484 * $486; + $488 = (8 - ($426))|0; + $489 = (6688 + ($488<<2)|0); + $490 = HEAP32[$489>>2]|0; + $491 = (+($490|0)); + $492 = $487 / $491; + $$0$i27 = $492; + break; + } + $$neg32$i = (($bits$0$ph) + 27)|0; + $493 = Math_imul($426, -3)|0; + $494 = (($$neg32$i) + ($493))|0; + $495 = ($494|0)>(30); + $$pre$i17 = HEAP32[$x$i>>2]|0; + $496 = $$pre$i17 >>> $494; + $497 = ($496|0)==(0); + $or$cond182$i = $495 | $497; + if ($or$cond182$i) { + $498 = (+($sign$0|0)); + $499 = (+($$pre$i17>>>0)); + $500 = $498 * $499; + $501 = (($426) + -10)|0; + $502 = (6688 + ($501<<2)|0); + $503 = HEAP32[$502>>2]|0; + $504 = (+($503|0)); + $505 = $500 * $504; + $$0$i27 = $505; + break; + } + } + } + $506 = (($426|0) % 9)&-1; + $507 = ($506|0)==(0); + if ($507) { + $a$2$ph38$i = 0;$e2$0$ph$i = 0;$rp$2$ph36$i = $426;$z$1$ph37$i = $k$3$i; + } else { + $508 = ($426|0)>(-1); + $509 = (($506) + 9)|0; + $510 = $508 ? $506 : $509; + $511 = (8 - ($510))|0; + $512 = (6688 + ($511<<2)|0); + $513 = HEAP32[$512>>2]|0; + $514 = ($k$3$i|0)==(0); + if ($514) { + $a$0$lcssa151$i = 0;$rp$0$lcssa152$i = $426;$z$0$i = 0; + } else { + $515 = (1000000000 / ($513|0))&-1; + $a$085$i = 0;$carry$087$i = 0;$k$486$i = 0;$rp$084$i = $426; + while(1) { + $516 = (($x$i) + ($k$486$i<<2)|0); + $517 = HEAP32[$516>>2]|0; + $518 = (($517>>>0) % ($513>>>0))&-1; + $519 = (($517>>>0) / ($513>>>0))&-1; + $520 = (($519) + ($carry$087$i))|0; + HEAP32[$516>>2] = $520; + $521 = Math_imul($518, $515)|0; + $522 = ($k$486$i|0)==($a$085$i|0); + $523 = ($520|0)==(0); + $or$cond16$i = $522 & $523; + $524 = (($k$486$i) + 1)|0; + $525 = $524 & 127; + $526 = (($rp$084$i) + -9)|0; + $rp$1$i18 = $or$cond16$i ? $526 : $rp$084$i; + $a$1$i = $or$cond16$i ? $525 : $a$085$i; + $527 = ($524|0)==($k$3$i|0); + if ($527) { + $$lcssa264 = $521;$a$1$i$lcssa = $a$1$i;$rp$1$i18$lcssa = $rp$1$i18; + break; + } else { + $a$085$i = $a$1$i;$carry$087$i = $521;$k$486$i = $524;$rp$084$i = $rp$1$i18; + } + } + $528 = ($$lcssa264|0)==(0); + if ($528) { + $a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $k$3$i; + } else { + $529 = (($k$3$i) + 1)|0; + $530 = (($x$i) + ($k$3$i<<2)|0); + HEAP32[$530>>2] = $$lcssa264; + $a$0$lcssa151$i = $a$1$i$lcssa;$rp$0$lcssa152$i = $rp$1$i18$lcssa;$z$0$i = $529; + } + } + $531 = (9 - ($510))|0; + $532 = (($531) + ($rp$0$lcssa152$i))|0; + $a$2$ph38$i = $a$0$lcssa151$i;$e2$0$ph$i = 0;$rp$2$ph36$i = $532;$z$1$ph37$i = $z$0$i; + } + L284: while(1) { + $533 = ($rp$2$ph36$i|0)<(18); + $534 = ($rp$2$ph36$i|0)==(18); + $535 = (($x$i) + ($a$2$ph38$i<<2)|0); + $e2$0$i19 = $e2$0$ph$i;$z$1$i = $z$1$ph37$i; + while(1) { + if (!($533)) { + if (!($534)) { + $a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = $rp$2$ph36$i;$z$5$ph$i = $z$1$i; + break L284; + } + $536 = HEAP32[$535>>2]|0; + $537 = ($536>>>0)<(9007199); + if (!($537)) { + $a$3$ph$i = $a$2$ph38$i;$e2$1$ph$i = $e2$0$i19;$rp$3$ph34$i = 18;$z$5$ph$i = $z$1$i; + break L284; + } + } + $538 = (($z$1$i) + 127)|0; + $carry1$0$i = 0;$k$5$in$i = $538;$z$2$i = $z$1$i; + while(1) { + $k$5$i = $k$5$in$i & 127; + $539 = (($x$i) + ($k$5$i<<2)|0); + $540 = HEAP32[$539>>2]|0; + $541 = (_bitshift64Shl(($540|0),0,29)|0); + $542 = tempRet0; + $543 = (_i64Add(($541|0),($542|0),($carry1$0$i|0),0)|0); + $544 = tempRet0; + $545 = ($544>>>0)>(0); + $546 = ($543>>>0)>(1000000000); + $547 = ($544|0)==(0); + $548 = $547 & $546; + $549 = $545 | $548; + if ($549) { + $550 = (___udivdi3(($543|0),($544|0),1000000000,0)|0); + $551 = tempRet0; + $552 = (___uremdi3(($543|0),($544|0),1000000000,0)|0); + $553 = tempRet0; + $$sink$off0$i = $552;$carry1$1$i = $550; + } else { + $$sink$off0$i = $543;$carry1$1$i = 0; + } + HEAP32[$539>>2] = $$sink$off0$i; + $554 = (($z$2$i) + 127)|0; + $555 = $554 & 127; + $556 = ($k$5$i|0)!=($555|0); + $557 = ($k$5$i|0)==($a$2$ph38$i|0); + $or$cond17$i = $556 | $557; + $558 = ($$sink$off0$i|0)==(0); + $k$5$z$2$i = $558 ? $k$5$i : $z$2$i; + $z$3$i = $or$cond17$i ? $z$2$i : $k$5$z$2$i; + $559 = (($k$5$i) + -1)|0; + if ($557) { + $carry1$1$i$lcssa = $carry1$1$i;$z$3$i$lcssa = $z$3$i; + break; + } else { + $carry1$0$i = $carry1$1$i;$k$5$in$i = $559;$z$2$i = $z$3$i; + } + } + $560 = (($e2$0$i19) + -29)|0; + $561 = ($carry1$1$i$lcssa|0)==(0); + if ($561) { + $e2$0$i19 = $560;$z$1$i = $z$3$i$lcssa; + } else { + $$lcssa263 = $560;$carry1$1$i$lcssa$lcssa = $carry1$1$i$lcssa;$z$3$i$lcssa$lcssa = $z$3$i$lcssa; + break; + } + } + $562 = (($rp$2$ph36$i) + 9)|0; + $563 = (($a$2$ph38$i) + 127)|0; + $564 = $563 & 127; + $565 = ($564|0)==($z$3$i$lcssa$lcssa|0); + if ($565) { + $566 = (($z$3$i$lcssa$lcssa) + 127)|0; + $567 = $566 & 127; + $568 = (($x$i) + ($567<<2)|0); + $569 = HEAP32[$568>>2]|0; + $570 = (($z$3$i$lcssa$lcssa) + 126)|0; + $571 = $570 & 127; + $572 = (($x$i) + ($571<<2)|0); + $573 = HEAP32[$572>>2]|0; + $574 = $573 | $569; + HEAP32[$572>>2] = $574; + $z$4$i = $567; + } else { + $z$4$i = $z$3$i$lcssa$lcssa; + } + $575 = (($x$i) + ($564<<2)|0); + HEAP32[$575>>2] = $carry1$1$i$lcssa$lcssa; + $a$2$ph38$i = $564;$e2$0$ph$i = $$lcssa263;$rp$2$ph36$i = $562;$z$1$ph37$i = $z$4$i; + } + L302: while(1) { + $606 = (($z$5$ph$i) + 1)|0; + $603 = $606 & 127; + $607 = (($z$5$ph$i) + 127)|0; + $608 = $607 & 127; + $609 = (($x$i) + ($608<<2)|0); + $a$3$ph157$i = $a$3$ph$i;$e2$1$ph156$i = $e2$1$ph$i;$rp$3$ph$i = $rp$3$ph34$i; + while(1) { + $610 = ($rp$3$ph$i|0)==(18); + $611 = ($rp$3$ph$i|0)>(27); + $$18$i = $611 ? 9 : 1; + $$not$i = $610 ^ 1; + $a$3$i = $a$3$ph157$i;$e2$1$i = $e2$1$ph156$i; + while(1) { + $576 = $a$3$i & 127; + $577 = ($576|0)==($z$5$ph$i|0); + do { + if ($577) { + label = 219; + } else { + $578 = (($x$i) + ($576<<2)|0); + $579 = HEAP32[$578>>2]|0; + $580 = ($579>>>0)<(9007199); + if ($580) { + label = 219; + break; + } + $581 = ($579>>>0)>(9007199); + if ($581) { + break; + } + $582 = (($a$3$i) + 1)|0; + $583 = $582 & 127; + $584 = ($583|0)==($z$5$ph$i|0); + if ($584) { + label = 219; + break; + } + $690 = (($x$i) + ($583<<2)|0); + $691 = HEAP32[$690>>2]|0; + $692 = ($691>>>0)<(254740991); + if ($692) { + label = 219; + break; + } + $693 = ($691>>>0)>(254740991); + $brmerge$i28 = $693 | $$not$i; + if (!($brmerge$i28)) { + $617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i; + break L302; + } + } + } while(0); + if ((label|0) == 219) { + label = 0; + if ($610) { + label = 220; + break L302; + } + } + $585 = (($e2$1$i) + ($$18$i))|0; + $586 = ($a$3$i|0)==($z$5$ph$i|0); + if ($586) { + $a$3$i = $z$5$ph$i;$e2$1$i = $585; + } else { + $$lcssa256 = $585;$a$3$i$lcssa248 = $a$3$i; + break; + } + } + $587 = 1 << $$18$i; + $588 = (($587) + -1)|0; + $589 = 1000000000 >>> $$18$i; + $a$478$i = $a$3$i$lcssa248;$carry3$081$i = 0;$k$679$i = $a$3$i$lcssa248;$rp$477$i = $rp$3$ph$i; + while(1) { + $590 = (($x$i) + ($k$679$i<<2)|0); + $591 = HEAP32[$590>>2]|0; + $592 = $591 & $588; + $593 = $591 >>> $$18$i; + $594 = (($593) + ($carry3$081$i))|0; + HEAP32[$590>>2] = $594; + $595 = Math_imul($592, $589)|0; + $596 = ($k$679$i|0)==($a$478$i|0); + $597 = ($594|0)==(0); + $or$cond19$i = $596 & $597; + $598 = (($k$679$i) + 1)|0; + $599 = $598 & 127; + $600 = (($rp$477$i) + -9)|0; + $rp$5$i = $or$cond19$i ? $600 : $rp$477$i; + $a$5$i = $or$cond19$i ? $599 : $a$478$i; + $601 = ($599|0)==($z$5$ph$i|0); + if ($601) { + $$lcssa257 = $595;$a$5$i$lcssa = $a$5$i;$rp$5$i$lcssa = $rp$5$i; + break; + } else { + $a$478$i = $a$5$i;$carry3$081$i = $595;$k$679$i = $599;$rp$477$i = $rp$5$i; + } + } + $602 = ($$lcssa257|0)==(0); + if ($602) { + $a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa; + continue; + } + $604 = ($603|0)==($a$5$i$lcssa|0); + if (!($604)) { + $$lcssa256$lcssa = $$lcssa256;$$lcssa257$lcssa = $$lcssa257;$a$5$i$lcssa$lcssa = $a$5$i$lcssa;$rp$5$i$lcssa$lcssa = $rp$5$i$lcssa; + break; + } + $612 = HEAP32[$609>>2]|0; + $613 = $612 | 1; + HEAP32[$609>>2] = $613; + $a$3$ph157$i = $a$5$i$lcssa;$e2$1$ph156$i = $$lcssa256;$rp$3$ph$i = $rp$5$i$lcssa; + } + $605 = (($x$i) + ($z$5$ph$i<<2)|0); + HEAP32[$605>>2] = $$lcssa257$lcssa; + $a$3$ph$i = $a$5$i$lcssa$lcssa;$e2$1$ph$i = $$lcssa256$lcssa;$rp$3$ph34$i = $rp$5$i$lcssa$lcssa;$z$5$ph$i = $603; + } + if ((label|0) == 220) { + if ($577) { + $614 = (($603) + -1)|0; + $615 = (($x$i) + ($614<<2)|0); + HEAP32[$615>>2] = 0; + $617 = $z$5$ph$i;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $603; + } else { + $617 = $576;$a$3$i249 = $a$3$i;$e2$1$i246 = $e2$1$i;$z$7$i = $z$5$ph$i; + } + } + $616 = (($x$i) + ($617<<2)|0); + $618 = HEAP32[$616>>2]|0; + $619 = (+($618>>>0)); + $620 = (($a$3$i249) + 1)|0; + $621 = $620 & 127; + $622 = ($621|0)==($z$7$i|0); + if ($622) { + $679 = (($a$3$i249) + 2)|0; + $680 = $679 & 127; + $681 = (($680) + -1)|0; + $682 = (($x$i) + ($681<<2)|0); + HEAP32[$682>>2] = 0; + $z$7$1$i = $680; + } else { + $z$7$1$i = $z$7$i; + } + $683 = $619 * 1.0E+9; + $684 = (($x$i) + ($621<<2)|0); + $685 = HEAP32[$684>>2]|0; + $686 = (+($685>>>0)); + $687 = $683 + $686; + $643 = (+($sign$0|0)); + $625 = $643 * $687; + $663 = (($e2$1$i246) + 53)|0; + $669 = (($663) - ($emin$0$ph))|0; + $670 = ($669|0)<($bits$0$ph|0); + $688 = ($669|0)<(0); + $$$i = $688 ? 0 : $669; + $denormal$0$i = $670&1; + $$010$i = $670 ? $$$i : $bits$0$ph; + $689 = ($$010$i|0)<(53); + if ($689) { + $623 = (105 - ($$010$i))|0; + $624 = (+_scalbn(1.0,$623)); + $626 = (+_copysignl($624,$625)); + $627 = (53 - ($$010$i))|0; + $628 = (+_scalbn(1.0,$627)); + $629 = (+_fmodl($625,$628)); + $630 = $625 - $629; + $631 = $626 + $630; + $bias$0$i25 = $626;$frac$0$i = $629;$y$1$i24 = $631; + } else { + $bias$0$i25 = 0.0;$frac$0$i = 0.0;$y$1$i24 = $625; + } + $632 = (($a$3$i249) + 2)|0; + $633 = $632 & 127; + $634 = ($633|0)==($z$7$1$i|0); + do { + if ($634) { + $frac$2$i = $frac$0$i; + } else { + $635 = (($x$i) + ($633<<2)|0); + $636 = HEAP32[$635>>2]|0; + $637 = ($636>>>0)<(500000000); + do { + if ($637) { + $638 = ($636|0)==(0); + if ($638) { + $639 = (($a$3$i249) + 3)|0; + $640 = $639 & 127; + $641 = ($640|0)==($z$7$1$i|0); + if ($641) { + $frac$1$i = $frac$0$i; + break; + } + } + $642 = $643 * 0.25; + $644 = $642 + $frac$0$i; + $frac$1$i = $644; + } else { + $645 = ($636>>>0)>(500000000); + if ($645) { + $646 = $643 * 0.75; + $647 = $646 + $frac$0$i; + $frac$1$i = $647; + break; + } + $648 = (($a$3$i249) + 3)|0; + $649 = $648 & 127; + $650 = ($649|0)==($z$7$1$i|0); + if ($650) { + $651 = $643 * 0.5; + $652 = $651 + $frac$0$i; + $frac$1$i = $652; + break; + } else { + $653 = $643 * 0.75; + $654 = $653 + $frac$0$i; + $frac$1$i = $654; + break; + } + } + } while(0); + $655 = (53 - ($$010$i))|0; + $656 = ($655|0)>(1); + if (!($656)) { + $frac$2$i = $frac$1$i; + break; + } + $657 = (+_fmodl($frac$1$i,1.0)); + $658 = $657 != 0.0; + if ($658) { + $frac$2$i = $frac$1$i; + break; + } + $659 = $frac$1$i + 1.0; + $frac$2$i = $659; + } + } while(0); + $660 = $y$1$i24 + $frac$2$i; + $661 = $660 - $bias$0$i25; + $662 = $663 & 2147483647; + $664 = (-2 - ($sum$i))|0; + $665 = ($662|0)>($664|0); + do { + if ($665) { + $666 = (+Math_abs((+$661))); + $667 = !($666 >= 9007199254740992.0); + if ($667) { + $denormal$2$i = $denormal$0$i;$e2$2$i = $e2$1$i246;$y$2$i26 = $661; + } else { + $668 = ($$010$i|0)==($669|0); + $or$cond20$i = $670 & $668; + $denormal$1$i = $or$cond20$i ? 0 : $denormal$0$i; + $671 = $661 * 0.5; + $672 = (($e2$1$i246) + 1)|0; + $denormal$2$i = $denormal$1$i;$e2$2$i = $672;$y$2$i26 = $671; + } + $673 = (($e2$2$i) + 50)|0; + $674 = ($673|0)>($330|0); + if (!($674)) { + $675 = ($denormal$2$i|0)!=(0); + $676 = $frac$2$i != 0.0; + $or$cond8$i = $676 & $675; + if (!($or$cond8$i)) { + $e2$3$i = $e2$2$i;$y$3$i = $y$2$i26; + break; + } + } + $677 = (___errno_location()|0); + HEAP32[$677>>2] = 34; + $e2$3$i = $e2$2$i;$y$3$i = $y$2$i26; + } else { + $e2$3$i = $e2$1$i246;$y$3$i = $661; + } + } while(0); + $678 = (+_scalbnl($y$3$i,$e2$3$i)); + $$0$i27 = $678; + } + } while(0); + $$0 = $$0$i27; + break L4; + break; + } + default: { + $109 = HEAP32[$1>>2]|0; + $110 = ($109|0)==(0|0); + if (!($110)) { + $111 = HEAP32[$0>>2]|0; + $112 = ((($111)) + -1|0); + HEAP32[$0>>2] = $112; + } + $113 = (___errno_location()|0); + HEAP32[$113>>2] = 22; + ___shlim($f,0); + $$0 = 0.0; + break L4; + } + } + } + } + } while(0); + if ((label|0) == 23) { + $41 = HEAP32[$1>>2]|0; + $42 = ($41|0)==(0|0); + if (!($42)) { + $43 = HEAP32[$0>>2]|0; + $44 = ((($43)) + -1|0); + HEAP32[$0>>2] = $44; + } + $45 = ($pok|0)!=(0); + $46 = ($i$0$lcssa>>>0)>(3); + $or$cond9 = $45 & $46; + if ($or$cond9) { + $i$1 = $i$0$lcssa; + while(1) { + if (!($42)) { + $47 = HEAP32[$0>>2]|0; + $48 = ((($47)) + -1|0); + HEAP32[$0>>2] = $48; + } + $49 = (($i$1) + -1)|0; + $$old8 = ($49>>>0)>(3); + if ($$old8) { + $i$1 = $49; + } else { + break; + } + } + } + } + $50 = (+($sign$0|0)); + $51 = $50 * inf; + $52 = $51; + $$0 = $52; + } + } while(0); + STACKTOP = sp;return (+$$0); +} +function ___intscan($f,$base,$pok,$0,$1) { + $f = $f|0; + $base = $base|0; + $pok = $pok|0; + $0 = $0|0; + $1 = $1|0; + var $$1 = 0, $$122 = 0, $$123 = 0, $$base21 = 0, $$lcssa = 0, $$lcssa130 = 0, $$lcssa131 = 0, $$lcssa132 = 0, $$lcssa133 = 0, $$lcssa134 = 0, $$lcssa135 = 0, $$sum = 0, $$sum14 = 0, $$sum1445 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum18 = 0, $$sum1865 = 0, $$sum19 = 0; + var $$sum20 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0; + var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0; + var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0; + var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0; + var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0; + var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0; + var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0; + var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0; + var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0; + var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0; + var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $3 = 0, $30 = 0; + var $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0; + var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0; + var $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0; + var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $c$0 = 0, $c$1 = 0, $c$124 = 0, $c$2$be = 0, $c$2$be$lcssa = 0; + var $c$2$lcssa = 0, $c$3$be = 0, $c$3$lcssa = 0, $c$371 = 0, $c$4$be = 0, $c$4$be$lcssa = 0, $c$4$lcssa = 0, $c$5$be = 0, $c$6$be = 0, $c$6$be$lcssa = 0, $c$6$lcssa = 0, $c$7$be = 0, $c$753 = 0, $c$8 = 0, $c$9$be = 0, $neg$0 = 0, $neg$0$ = 0, $neg$1 = 0, $or$cond = 0, $or$cond12 = 0; + var $or$cond40 = 0, $or$cond5 = 0, $or$cond7 = 0, $x$082 = 0, $x$146 = 0, $x$266 = 0, label = 0, sp = 0; + sp = STACKTOP; + $2 = ($base>>>0)>(36); + L1: do { + if ($2) { + $5 = (___errno_location()|0); + HEAP32[$5>>2] = 22; + $286 = 0;$287 = 0; + } else { + $3 = ((($f)) + 4|0); + $4 = ((($f)) + 100|0); + while(1) { + $6 = HEAP32[$3>>2]|0; + $7 = HEAP32[$4>>2]|0; + $8 = ($6>>>0)<($7>>>0); + if ($8) { + $9 = ((($6)) + 1|0); + HEAP32[$3>>2] = $9; + $10 = HEAP8[$6>>0]|0; + $11 = $10&255; + $13 = $11; + } else { + $12 = (___shgetc($f)|0); + $13 = $12; + } + $14 = (_isspace($13)|0); + $15 = ($14|0)==(0); + if ($15) { + $$lcssa135 = $13; + break; + } + } + $16 = ($$lcssa135|0)==(45); + L11: do { + switch ($$lcssa135|0) { + case 43: case 45: { + $17 = $16 << 31 >> 31; + $18 = HEAP32[$3>>2]|0; + $19 = HEAP32[$4>>2]|0; + $20 = ($18>>>0)<($19>>>0); + if ($20) { + $21 = ((($18)) + 1|0); + HEAP32[$3>>2] = $21; + $22 = HEAP8[$18>>0]|0; + $23 = $22&255; + $c$0 = $23;$neg$0 = $17; + break L11; + } else { + $24 = (___shgetc($f)|0); + $c$0 = $24;$neg$0 = $17; + break L11; + } + break; + } + default: { + $c$0 = $$lcssa135;$neg$0 = 0; + } + } + } while(0); + $25 = ($base|0)==(0); + $26 = $base & -17; + $27 = ($26|0)==(0); + $28 = ($c$0|0)==(48); + $or$cond5 = $27 & $28; + do { + if ($or$cond5) { + $29 = HEAP32[$3>>2]|0; + $30 = HEAP32[$4>>2]|0; + $31 = ($29>>>0)<($30>>>0); + if ($31) { + $32 = ((($29)) + 1|0); + HEAP32[$3>>2] = $32; + $33 = HEAP8[$29>>0]|0; + $34 = $33&255; + $37 = $34; + } else { + $35 = (___shgetc($f)|0); + $37 = $35; + } + $36 = $37 | 32; + $38 = ($36|0)==(120); + if (!($38)) { + if ($25) { + $$123 = 8;$c$124 = $37; + label = 46; + break; + } else { + $$1 = $base;$c$1 = $37; + label = 32; + break; + } + } + $39 = HEAP32[$3>>2]|0; + $40 = HEAP32[$4>>2]|0; + $41 = ($39>>>0)<($40>>>0); + if ($41) { + $42 = ((($39)) + 1|0); + HEAP32[$3>>2] = $42; + $43 = HEAP8[$39>>0]|0; + $44 = $43&255; + $46 = $44; + } else { + $45 = (___shgetc($f)|0); + $46 = $45; + } + $$sum20 = (($46) + 1)|0; + $47 = (22472 + ($$sum20)|0); + $48 = HEAP8[$47>>0]|0; + $49 = ($48&255)>(15); + if ($49) { + $50 = HEAP32[$4>>2]|0; + $51 = ($50|0)==(0|0); + if (!($51)) { + $52 = HEAP32[$3>>2]|0; + $53 = ((($52)) + -1|0); + HEAP32[$3>>2] = $53; + } + $54 = ($pok|0)==(0); + if ($54) { + ___shlim($f,0); + $286 = 0;$287 = 0; + break L1; + } + if ($51) { + $286 = 0;$287 = 0; + break L1; + } + $55 = HEAP32[$3>>2]|0; + $56 = ((($55)) + -1|0); + HEAP32[$3>>2] = $56; + $286 = 0;$287 = 0; + break L1; + } else { + $$123 = 16;$c$124 = $46; + label = 46; + } + } else { + $$base21 = $25 ? 10 : $base; + $$sum = (($c$0) + 1)|0; + $57 = (22472 + ($$sum)|0); + $58 = HEAP8[$57>>0]|0; + $59 = $58&255; + $60 = ($59>>>0)<($$base21>>>0); + if ($60) { + $$1 = $$base21;$c$1 = $c$0; + label = 32; + } else { + $61 = HEAP32[$4>>2]|0; + $62 = ($61|0)==(0|0); + if (!($62)) { + $63 = HEAP32[$3>>2]|0; + $64 = ((($63)) + -1|0); + HEAP32[$3>>2] = $64; + } + ___shlim($f,0); + $65 = (___errno_location()|0); + HEAP32[$65>>2] = 22; + $286 = 0;$287 = 0; + break L1; + } + } + } while(0); + if ((label|0) == 32) { + $66 = ($$1|0)==(10); + if ($66) { + $67 = (($c$1) + -48)|0; + $68 = ($67>>>0)<(10); + if ($68) { + $71 = $67;$x$082 = 0; + while(1) { + $69 = ($x$082*10)|0; + $70 = (($69) + ($71))|0; + $72 = HEAP32[$3>>2]|0; + $73 = HEAP32[$4>>2]|0; + $74 = ($72>>>0)<($73>>>0); + if ($74) { + $75 = ((($72)) + 1|0); + HEAP32[$3>>2] = $75; + $76 = HEAP8[$72>>0]|0; + $77 = $76&255; + $c$2$be = $77; + } else { + $78 = (___shgetc($f)|0); + $c$2$be = $78; + } + $79 = (($c$2$be) + -48)|0; + $80 = ($79>>>0)<(10); + $81 = ($70>>>0)<(429496729); + $82 = $80 & $81; + if ($82) { + $71 = $79;$x$082 = $70; + } else { + $$lcssa134 = $70;$c$2$be$lcssa = $c$2$be; + break; + } + } + $288 = $$lcssa134;$289 = 0;$c$2$lcssa = $c$2$be$lcssa; + } else { + $288 = 0;$289 = 0;$c$2$lcssa = $c$1; + } + $83 = (($c$2$lcssa) + -48)|0; + $84 = ($83>>>0)<(10); + if ($84) { + $85 = $288;$86 = $289;$89 = $83;$c$371 = $c$2$lcssa; + while(1) { + $87 = (___muldi3(($85|0),($86|0),10,0)|0); + $88 = tempRet0; + $90 = ($89|0)<(0); + $91 = $90 << 31 >> 31; + $92 = $89 ^ -1; + $93 = $91 ^ -1; + $94 = ($88>>>0)>($93>>>0); + $95 = ($87>>>0)>($92>>>0); + $96 = ($88|0)==($93|0); + $97 = $96 & $95; + $98 = $94 | $97; + if ($98) { + $$lcssa = $89;$290 = $85;$291 = $86;$c$3$lcssa = $c$371; + break; + } + $99 = (_i64Add(($87|0),($88|0),($89|0),($91|0))|0); + $100 = tempRet0; + $101 = HEAP32[$3>>2]|0; + $102 = HEAP32[$4>>2]|0; + $103 = ($101>>>0)<($102>>>0); + if ($103) { + $104 = ((($101)) + 1|0); + HEAP32[$3>>2] = $104; + $105 = HEAP8[$101>>0]|0; + $106 = $105&255; + $c$3$be = $106; + } else { + $107 = (___shgetc($f)|0); + $c$3$be = $107; + } + $108 = (($c$3$be) + -48)|0; + $109 = ($108>>>0)<(10); + $110 = ($100>>>0)<(429496729); + $111 = ($99>>>0)<(2576980378); + $112 = ($100|0)==(429496729); + $113 = $112 & $111; + $114 = $110 | $113; + $or$cond7 = $109 & $114; + if ($or$cond7) { + $85 = $99;$86 = $100;$89 = $108;$c$371 = $c$3$be; + } else { + $$lcssa = $108;$290 = $99;$291 = $100;$c$3$lcssa = $c$3$be; + break; + } + } + $115 = ($$lcssa>>>0)>(9); + if ($115) { + $259 = $291;$261 = $290;$neg$1 = $neg$0; + } else { + $$122 = 10;$292 = $290;$293 = $291;$c$8 = $c$3$lcssa; + label = 72; + } + } else { + $259 = $289;$261 = $288;$neg$1 = $neg$0; + } + } else { + $$123 = $$1;$c$124 = $c$1; + label = 46; + } + } + L63: do { + if ((label|0) == 46) { + $116 = (($$123) + -1)|0; + $117 = $116 & $$123; + $118 = ($117|0)==(0); + if ($118) { + $123 = ($$123*23)|0; + $124 = $123 >>> 5; + $125 = $124 & 7; + $126 = (22729 + ($125)|0); + $127 = HEAP8[$126>>0]|0; + $128 = $127 << 24 >> 24; + $$sum1445 = (($c$124) + 1)|0; + $129 = (22472 + ($$sum1445)|0); + $130 = HEAP8[$129>>0]|0; + $131 = $130&255; + $132 = ($131>>>0)<($$123>>>0); + if ($132) { + $135 = $131;$x$146 = 0; + while(1) { + $133 = $x$146 << $128; + $134 = $135 | $133; + $136 = HEAP32[$3>>2]|0; + $137 = HEAP32[$4>>2]|0; + $138 = ($136>>>0)<($137>>>0); + if ($138) { + $139 = ((($136)) + 1|0); + HEAP32[$3>>2] = $139; + $140 = HEAP8[$136>>0]|0; + $141 = $140&255; + $c$4$be = $141; + } else { + $142 = (___shgetc($f)|0); + $c$4$be = $142; + } + $$sum14 = (($c$4$be) + 1)|0; + $143 = (22472 + ($$sum14)|0); + $144 = HEAP8[$143>>0]|0; + $145 = $144&255; + $146 = ($145>>>0)<($$123>>>0); + $147 = ($134>>>0)<(134217728); + $148 = $147 & $146; + if ($148) { + $135 = $145;$x$146 = $134; + } else { + $$lcssa130 = $134;$$lcssa131 = $144;$c$4$be$lcssa = $c$4$be; + break; + } + } + $152 = $$lcssa131;$154 = 0;$156 = $$lcssa130;$c$4$lcssa = $c$4$be$lcssa; + } else { + $152 = $130;$154 = 0;$156 = 0;$c$4$lcssa = $c$124; + } + $149 = (_bitshift64Lshr(-1,-1,($128|0))|0); + $150 = tempRet0; + $151 = $152&255; + $153 = ($151>>>0)>=($$123>>>0); + $155 = ($154>>>0)>($150>>>0); + $157 = ($156>>>0)>($149>>>0); + $158 = ($154|0)==($150|0); + $159 = $158 & $157; + $160 = $155 | $159; + $or$cond40 = $153 | $160; + if ($or$cond40) { + $$122 = $$123;$292 = $156;$293 = $154;$c$8 = $c$4$lcssa; + label = 72; + break; + } else { + $161 = $156;$162 = $154;$166 = $152; + } + while(1) { + $163 = (_bitshift64Shl(($161|0),($162|0),($128|0))|0); + $164 = tempRet0; + $165 = $166&255; + $167 = $165 | $163; + $168 = HEAP32[$3>>2]|0; + $169 = HEAP32[$4>>2]|0; + $170 = ($168>>>0)<($169>>>0); + if ($170) { + $171 = ((($168)) + 1|0); + HEAP32[$3>>2] = $171; + $172 = HEAP8[$168>>0]|0; + $173 = $172&255; + $c$5$be = $173; + } else { + $174 = (___shgetc($f)|0); + $c$5$be = $174; + } + $$sum15 = (($c$5$be) + 1)|0; + $175 = (22472 + ($$sum15)|0); + $176 = HEAP8[$175>>0]|0; + $177 = $176&255; + $178 = ($177>>>0)>=($$123>>>0); + $179 = ($164>>>0)>($150>>>0); + $180 = ($167>>>0)>($149>>>0); + $181 = ($164|0)==($150|0); + $182 = $181 & $180; + $183 = $179 | $182; + $or$cond = $178 | $183; + if ($or$cond) { + $$122 = $$123;$292 = $167;$293 = $164;$c$8 = $c$5$be; + label = 72; + break L63; + } else { + $161 = $167;$162 = $164;$166 = $176; + } + } + } + $$sum1865 = (($c$124) + 1)|0; + $119 = (22472 + ($$sum1865)|0); + $120 = HEAP8[$119>>0]|0; + $121 = $120&255; + $122 = ($121>>>0)<($$123>>>0); + if ($122) { + $186 = $121;$x$266 = 0; + while(1) { + $184 = Math_imul($x$266, $$123)|0; + $185 = (($186) + ($184))|0; + $187 = HEAP32[$3>>2]|0; + $188 = HEAP32[$4>>2]|0; + $189 = ($187>>>0)<($188>>>0); + if ($189) { + $190 = ((($187)) + 1|0); + HEAP32[$3>>2] = $190; + $191 = HEAP8[$187>>0]|0; + $192 = $191&255; + $c$6$be = $192; + } else { + $193 = (___shgetc($f)|0); + $c$6$be = $193; + } + $$sum18 = (($c$6$be) + 1)|0; + $194 = (22472 + ($$sum18)|0); + $195 = HEAP8[$194>>0]|0; + $196 = $195&255; + $197 = ($196>>>0)<($$123>>>0); + $198 = ($185>>>0)<(119304647); + $199 = $198 & $197; + if ($199) { + $186 = $196;$x$266 = $185; + } else { + $$lcssa132 = $185;$$lcssa133 = $195;$c$6$be$lcssa = $c$6$be; + break; + } + } + $201 = $$lcssa133;$294 = $$lcssa132;$295 = 0;$c$6$lcssa = $c$6$be$lcssa; + } else { + $201 = $120;$294 = 0;$295 = 0;$c$6$lcssa = $c$124; + } + $200 = $201&255; + $202 = ($200>>>0)<($$123>>>0); + if ($202) { + $203 = (___udivdi3(-1,-1,($$123|0),0)|0); + $204 = tempRet0; + $205 = $295;$207 = $294;$215 = $201;$c$753 = $c$6$lcssa; + while(1) { + $206 = ($205>>>0)>($204>>>0); + $208 = ($207>>>0)>($203>>>0); + $209 = ($205|0)==($204|0); + $210 = $209 & $208; + $211 = $206 | $210; + if ($211) { + $$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753; + label = 72; + break L63; + } + $212 = (___muldi3(($207|0),($205|0),($$123|0),0)|0); + $213 = tempRet0; + $214 = $215&255; + $216 = $214 ^ -1; + $217 = ($213>>>0)>(4294967295); + $218 = ($212>>>0)>($216>>>0); + $219 = ($213|0)==(-1); + $220 = $219 & $218; + $221 = $217 | $220; + if ($221) { + $$122 = $$123;$292 = $207;$293 = $205;$c$8 = $c$753; + label = 72; + break L63; + } + $222 = (_i64Add(($214|0),0,($212|0),($213|0))|0); + $223 = tempRet0; + $224 = HEAP32[$3>>2]|0; + $225 = HEAP32[$4>>2]|0; + $226 = ($224>>>0)<($225>>>0); + if ($226) { + $227 = ((($224)) + 1|0); + HEAP32[$3>>2] = $227; + $228 = HEAP8[$224>>0]|0; + $229 = $228&255; + $c$7$be = $229; + } else { + $230 = (___shgetc($f)|0); + $c$7$be = $230; + } + $$sum19 = (($c$7$be) + 1)|0; + $231 = (22472 + ($$sum19)|0); + $232 = HEAP8[$231>>0]|0; + $233 = $232&255; + $234 = ($233>>>0)<($$123>>>0); + if ($234) { + $205 = $223;$207 = $222;$215 = $232;$c$753 = $c$7$be; + } else { + $$122 = $$123;$292 = $222;$293 = $223;$c$8 = $c$7$be; + label = 72; + break; + } + } + } else { + $$122 = $$123;$292 = $294;$293 = $295;$c$8 = $c$6$lcssa; + label = 72; + } + } + } while(0); + if ((label|0) == 72) { + $$sum16 = (($c$8) + 1)|0; + $235 = (22472 + ($$sum16)|0); + $236 = HEAP8[$235>>0]|0; + $237 = $236&255; + $238 = ($237>>>0)<($$122>>>0); + if ($238) { + while(1) { + $239 = HEAP32[$3>>2]|0; + $240 = HEAP32[$4>>2]|0; + $241 = ($239>>>0)<($240>>>0); + if ($241) { + $242 = ((($239)) + 1|0); + HEAP32[$3>>2] = $242; + $243 = HEAP8[$239>>0]|0; + $244 = $243&255; + $c$9$be = $244; + } else { + $245 = (___shgetc($f)|0); + $c$9$be = $245; + } + $$sum17 = (($c$9$be) + 1)|0; + $246 = (22472 + ($$sum17)|0); + $247 = HEAP8[$246>>0]|0; + $248 = $247&255; + $249 = ($248>>>0)<($$122>>>0); + if (!($249)) { + break; + } + } + $250 = (___errno_location()|0); + HEAP32[$250>>2] = 34; + $251 = $0 & 1; + $252 = ($251|0)==(0); + $253 = (0)==(0); + $254 = $252 & $253; + $neg$0$ = $254 ? $neg$0 : 0; + $259 = $1;$261 = $0;$neg$1 = $neg$0$; + } else { + $259 = $293;$261 = $292;$neg$1 = $neg$0; + } + } + $255 = HEAP32[$4>>2]|0; + $256 = ($255|0)==(0|0); + if (!($256)) { + $257 = HEAP32[$3>>2]|0; + $258 = ((($257)) + -1|0); + HEAP32[$3>>2] = $258; + } + $260 = ($259>>>0)<($1>>>0); + $262 = ($261>>>0)<($0>>>0); + $263 = ($259|0)==($1|0); + $264 = $263 & $262; + $265 = $260 | $264; + if (!($265)) { + $266 = $0 & 1; + $267 = ($266|0)!=(0); + $268 = (0)!=(0); + $269 = $267 | $268; + $270 = ($neg$1|0)!=(0); + $or$cond12 = $269 | $270; + if (!($or$cond12)) { + $271 = (___errno_location()|0); + HEAP32[$271>>2] = 34; + $272 = (_i64Add(($0|0),($1|0),-1,-1)|0); + $273 = tempRet0; + $286 = $273;$287 = $272; + break; + } + $274 = ($259>>>0)>($1>>>0); + $275 = ($261>>>0)>($0>>>0); + $276 = ($259|0)==($1|0); + $277 = $276 & $275; + $278 = $274 | $277; + if ($278) { + $279 = (___errno_location()|0); + HEAP32[$279>>2] = 34; + $286 = $1;$287 = $0; + break; + } + } + $280 = ($neg$1|0)<(0); + $281 = $280 << 31 >> 31; + $282 = $261 ^ $neg$1; + $283 = $259 ^ $281; + $284 = (_i64Subtract(($282|0),($283|0),($neg$1|0),($281|0))|0); + $285 = tempRet0; + $286 = $285;$287 = $284; + } + } while(0); + tempRet0 = ($286); + return ($287|0); +} +function ___shlim($f,$lim) { + $f = $f|0; + $lim = $lim|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 104|0); + HEAP32[$0>>2] = $lim; + $1 = ((($f)) + 8|0); + $2 = HEAP32[$1>>2]|0; + $3 = ((($f)) + 4|0); + $4 = HEAP32[$3>>2]|0; + $5 = $2; + $6 = $4; + $7 = (($5) - ($6))|0; + $8 = ((($f)) + 108|0); + HEAP32[$8>>2] = $7; + $9 = ($lim|0)!=(0); + $10 = ($7|0)>($lim|0); + $or$cond = $9 & $10; + if ($or$cond) { + $11 = (($4) + ($lim)|0); + $12 = ((($f)) + 100|0); + HEAP32[$12>>2] = $11; + } else { + $13 = ((($f)) + 100|0); + HEAP32[$13>>2] = $5; + } + return; +} +function ___shgetc($f) { + $f = $f|0; + var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert3 = 0, $$pre = 0, $$pre4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; + var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0; + var $40 = 0, $41 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 104|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + label = 3; + } else { + $3 = ((($f)) + 108|0); + $4 = HEAP32[$3>>2]|0; + $5 = ($4|0)<($1|0); + if ($5) { + label = 3; + } else { + label = 4; + } + } + if ((label|0) == 3) { + $6 = (___uflow($f)|0); + $7 = ($6|0)<(0); + if ($7) { + label = 4; + } else { + $9 = HEAP32[$0>>2]|0; + $10 = ($9|0)==(0); + $$phi$trans$insert = ((($f)) + 8|0); + if ($10) { + $$pre = HEAP32[$$phi$trans$insert>>2]|0; + $11 = $$pre; + $26 = $$pre;$41 = $11; + label = 9; + } else { + $12 = HEAP32[$$phi$trans$insert>>2]|0; + $13 = ((($f)) + 4|0); + $14 = HEAP32[$13>>2]|0; + $15 = $12; + $16 = $14; + $17 = (($15) - ($16))|0; + $18 = ((($f)) + 108|0); + $19 = HEAP32[$18>>2]|0; + $20 = (($9) - ($19))|0; + $21 = (($20) + -1)|0; + $22 = ($17|0)>($21|0); + if ($22) { + $23 = (($14) + ($21)|0); + $24 = ((($f)) + 100|0); + HEAP32[$24>>2] = $23; + $27 = $12; + } else { + $26 = $15;$41 = $12; + label = 9; + } + } + if ((label|0) == 9) { + $25 = ((($f)) + 100|0); + HEAP32[$25>>2] = $26; + $27 = $41; + } + $28 = ($27|0)==(0|0); + $$phi$trans$insert3 = ((($f)) + 4|0); + $$pre4 = HEAP32[$$phi$trans$insert3>>2]|0; + if (!($28)) { + $29 = $27; + $30 = $$pre4; + $31 = ((($f)) + 108|0); + $32 = HEAP32[$31>>2]|0; + $33 = (($29) + 1)|0; + $34 = (($33) - ($30))|0; + $35 = (($34) + ($32))|0; + HEAP32[$31>>2] = $35; + } + $36 = ((($$pre4)) + -1|0); + $37 = HEAP8[$36>>0]|0; + $38 = $37&255; + $39 = ($38|0)==($6|0); + if ($39) { + $$0 = $6; + } else { + $40 = $6&255; + HEAP8[$36>>0] = $40; + $$0 = $6; + } + } + } + if ((label|0) == 4) { + $8 = ((($f)) + 100|0); + HEAP32[$8>>2] = 0; + $$0 = -1; + } + return ($$0|0); +} +function ___syscall_ret($r) { + $r = $r|0; + var $$0 = 0, $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($r>>>0)>(4294963200); + if ($0) { + $1 = (0 - ($r))|0; + $2 = (___errno_location()|0); + HEAP32[$2>>2] = $1; + $$0 = -1; + } else { + $$0 = $r; + } + return ($$0|0); +} +function _copysign($x,$y) { + $x = +$x; + $y = +$y; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; + $1 = HEAP32[tempDoublePtr+4>>2]|0; + HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0; + $3 = HEAP32[tempDoublePtr+4>>2]|0; + $4 = $1 & 2147483647; + $5 = $3 & -2147483648; + $6 = $5 | $4; + HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $6;$7 = +HEAPF64[tempDoublePtr>>3]; + return (+$7); +} +function _copysignl($x,$y) { + $x = +$x; + $y = +$y; + var $0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (+_copysign($x,$y)); + return (+$0); +} +function _fmod($x,$y) { + $x = +$x; + $y = +$y; + var $$0 = 0.0, $$lcssa7 = 0, $$x = 0.0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0; + var $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0.0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0; + var $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0; + var $15 = 0, $150 = 0.0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; + var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; + var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0.0; + var $ex$0$lcssa = 0, $ex$026 = 0, $ex$1 = 0, $ex$2$lcssa = 0, $ex$212 = 0, $ex$3$lcssa = 0, $ex$39 = 0, $ey$0$lcssa = 0, $ey$020 = 0, $ey$1$ph = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; + $1 = HEAP32[tempDoublePtr+4>>2]|0; + HEAPF64[tempDoublePtr>>3] = $y;$2 = HEAP32[tempDoublePtr>>2]|0; + $3 = HEAP32[tempDoublePtr+4>>2]|0; + $4 = (_bitshift64Lshr(($0|0),($1|0),52)|0); + $5 = tempRet0; + $6 = $4 & 2047; + $7 = (_bitshift64Lshr(($2|0),($3|0),52)|0); + $8 = tempRet0; + $9 = $7 & 2047; + $10 = $1 & -2147483648; + $11 = (_bitshift64Shl(($2|0),($3|0),1)|0); + $12 = tempRet0; + $13 = ($11|0)==(0); + $14 = ($12|0)==(0); + $15 = $13 & $14; + L1: do { + if ($15) { + label = 3; + } else { + $16 = $3 & 2147483647; + $17 = ($16>>>0)>(2146435072); + $18 = ($2>>>0)>(0); + $19 = ($16|0)==(2146435072); + $20 = $19 & $18; + $21 = $17 | $20; + $22 = ($6|0)==(2047); + $or$cond = $21 | $22; + if ($or$cond) { + label = 3; + } else { + $25 = (_bitshift64Shl(($0|0),($1|0),1)|0); + $26 = tempRet0; + $27 = ($26>>>0)>($12>>>0); + $28 = ($25>>>0)>($11>>>0); + $29 = ($26|0)==($12|0); + $30 = $29 & $28; + $31 = $27 | $30; + if (!($31)) { + $32 = ($25|0)==($11|0); + $33 = ($26|0)==($12|0); + $34 = $32 & $33; + $35 = $x * 0.0; + $$x = $34 ? $35 : $x; + return (+$$x); + } + $36 = ($6|0)==(0); + if ($36) { + $37 = (_bitshift64Shl(($0|0),($1|0),12)|0); + $38 = tempRet0; + $39 = ($38|0)>(-1); + $40 = ($37>>>0)>(4294967295); + $41 = ($38|0)==(-1); + $42 = $41 & $40; + $43 = $39 | $42; + if ($43) { + $45 = $37;$46 = $38;$ex$026 = 0; + while(1) { + $44 = (($ex$026) + -1)|0; + $47 = (_bitshift64Shl(($45|0),($46|0),1)|0); + $48 = tempRet0; + $49 = ($48|0)>(-1); + $50 = ($47>>>0)>(4294967295); + $51 = ($48|0)==(-1); + $52 = $51 & $50; + $53 = $49 | $52; + if ($53) { + $45 = $47;$46 = $48;$ex$026 = $44; + } else { + $ex$0$lcssa = $44; + break; + } + } + } else { + $ex$0$lcssa = 0; + } + $54 = (1 - ($ex$0$lcssa))|0; + $55 = (_bitshift64Shl(($0|0),($1|0),($54|0))|0); + $56 = tempRet0; + $83 = $55;$84 = $56;$ex$1 = $ex$0$lcssa; + } else { + $57 = $1 & 1048575; + $58 = $57 | 1048576; + $83 = $0;$84 = $58;$ex$1 = $6; + } + $59 = ($9|0)==(0); + if ($59) { + $60 = (_bitshift64Shl(($2|0),($3|0),12)|0); + $61 = tempRet0; + $62 = ($61|0)>(-1); + $63 = ($60>>>0)>(4294967295); + $64 = ($61|0)==(-1); + $65 = $64 & $63; + $66 = $62 | $65; + if ($66) { + $68 = $60;$69 = $61;$ey$020 = 0; + while(1) { + $67 = (($ey$020) + -1)|0; + $70 = (_bitshift64Shl(($68|0),($69|0),1)|0); + $71 = tempRet0; + $72 = ($71|0)>(-1); + $73 = ($70>>>0)>(4294967295); + $74 = ($71|0)==(-1); + $75 = $74 & $73; + $76 = $72 | $75; + if ($76) { + $68 = $70;$69 = $71;$ey$020 = $67; + } else { + $ey$0$lcssa = $67; + break; + } + } + } else { + $ey$0$lcssa = 0; + } + $77 = (1 - ($ey$0$lcssa))|0; + $78 = (_bitshift64Shl(($2|0),($3|0),($77|0))|0); + $79 = tempRet0; + $85 = $78;$86 = $79;$ey$1$ph = $ey$0$lcssa; + } else { + $80 = $3 & 1048575; + $81 = $80 | 1048576; + $85 = $2;$86 = $81;$ey$1$ph = $9; + } + $82 = ($ex$1|0)>($ey$1$ph|0); + $87 = (_i64Subtract(($83|0),($84|0),($85|0),($86|0))|0); + $88 = tempRet0; + $89 = ($88|0)>(-1); + $90 = ($87>>>0)>(4294967295); + $91 = ($88|0)==(-1); + $92 = $91 & $90; + $93 = $89 | $92; + L23: do { + if ($82) { + $152 = $93;$153 = $87;$154 = $88;$94 = $83;$96 = $84;$ex$212 = $ex$1; + while(1) { + if ($152) { + $95 = ($94|0)==($85|0); + $97 = ($96|0)==($86|0); + $98 = $95 & $97; + if ($98) { + break; + } else { + $100 = $153;$101 = $154; + } + } else { + $100 = $94;$101 = $96; + } + $102 = (_bitshift64Shl(($100|0),($101|0),1)|0); + $103 = tempRet0; + $104 = (($ex$212) + -1)|0; + $105 = ($104|0)>($ey$1$ph|0); + $106 = (_i64Subtract(($102|0),($103|0),($85|0),($86|0))|0); + $107 = tempRet0; + $108 = ($107|0)>(-1); + $109 = ($106>>>0)>(4294967295); + $110 = ($107|0)==(-1); + $111 = $110 & $109; + $112 = $108 | $111; + if ($105) { + $152 = $112;$153 = $106;$154 = $107;$94 = $102;$96 = $103;$ex$212 = $104; + } else { + $$lcssa7 = $112;$113 = $102;$115 = $103;$155 = $106;$156 = $107;$ex$2$lcssa = $104; + break L23; + } + } + $99 = $x * 0.0; + $$0 = $99; + break L1; + } else { + $$lcssa7 = $93;$113 = $83;$115 = $84;$155 = $87;$156 = $88;$ex$2$lcssa = $ex$1; + } + } while(0); + if ($$lcssa7) { + $114 = ($113|0)==($85|0); + $116 = ($115|0)==($86|0); + $117 = $114 & $116; + if ($117) { + $125 = $x * 0.0; + $$0 = $125; + break; + } else { + $118 = $156;$120 = $155; + } + } else { + $118 = $115;$120 = $113; + } + $119 = ($118>>>0)<(1048576); + $121 = ($120>>>0)<(0); + $122 = ($118|0)==(1048576); + $123 = $122 & $121; + $124 = $119 | $123; + if ($124) { + $126 = $120;$127 = $118;$ex$39 = $ex$2$lcssa; + while(1) { + $128 = (_bitshift64Shl(($126|0),($127|0),1)|0); + $129 = tempRet0; + $130 = (($ex$39) + -1)|0; + $131 = ($129>>>0)<(1048576); + $132 = ($128>>>0)<(0); + $133 = ($129|0)==(1048576); + $134 = $133 & $132; + $135 = $131 | $134; + if ($135) { + $126 = $128;$127 = $129;$ex$39 = $130; + } else { + $137 = $128;$138 = $129;$ex$3$lcssa = $130; + break; + } + } + } else { + $137 = $120;$138 = $118;$ex$3$lcssa = $ex$2$lcssa; + } + $136 = ($ex$3$lcssa|0)>(0); + if ($136) { + $139 = (_i64Add(($137|0),($138|0),0,-1048576)|0); + $140 = tempRet0; + $141 = (_bitshift64Shl(($ex$3$lcssa|0),0,52)|0); + $142 = tempRet0; + $143 = $139 | $141; + $144 = $140 | $142; + $149 = $144;$151 = $143; + } else { + $145 = (1 - ($ex$3$lcssa))|0; + $146 = (_bitshift64Lshr(($137|0),($138|0),($145|0))|0); + $147 = tempRet0; + $149 = $147;$151 = $146; + } + $148 = $149 | $10; + HEAP32[tempDoublePtr>>2] = $151;HEAP32[tempDoublePtr+4>>2] = $148;$150 = +HEAPF64[tempDoublePtr>>3]; + $$0 = $150; + } + } + } while(0); + if ((label|0) == 3) { + $23 = $x * $y; + $24 = $23 / $23; + $$0 = $24; + } + return (+$$0); +} +function _fmodl($x,$y) { + $x = +$x; + $y = +$y; + var $0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (+_fmod($x,$y)); + return (+$0); +} +function _frexp($x,$e) { + $x = +$x; + $e = $e|0; + var $$0 = 0.0, $$01 = 0.0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $storemerge = 0, label = 0, sp = 0; + sp = STACKTOP; + HEAPF64[tempDoublePtr>>3] = $x;$0 = HEAP32[tempDoublePtr>>2]|0; + $1 = HEAP32[tempDoublePtr+4>>2]|0; + $2 = (_bitshift64Lshr(($0|0),($1|0),52)|0); + $3 = tempRet0; + $4 = $2 & 2047; + switch ($4|0) { + case 0: { + $5 = $x != 0.0; + if ($5) { + $6 = $x * 1.8446744073709552E+19; + $7 = (+_frexp($6,$e)); + $8 = HEAP32[$e>>2]|0; + $9 = (($8) + -64)|0; + $$01 = $7;$storemerge = $9; + } else { + $$01 = $x;$storemerge = 0; + } + HEAP32[$e>>2] = $storemerge; + $$0 = $$01; + break; + } + case 2047: { + $$0 = $x; + break; + } + default: { + $10 = (($4) + -1022)|0; + HEAP32[$e>>2] = $10; + $11 = $1 & -2146435073; + $12 = $11 | 1071644672; + HEAP32[tempDoublePtr>>2] = $0;HEAP32[tempDoublePtr+4>>2] = $12;$13 = +HEAPF64[tempDoublePtr>>3]; + $$0 = $13; + } + } + return (+$$0); +} +function _frexpl($x,$e) { + $x = +$x; + $e = $e|0; + var $0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (+_frexp($x,$e)); + return (+$0); +} +function _roundf($x) { + $x = +$x; + var $$0 = 0.0, $$x = 0.0, $$y$0 = 0.0, $0 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0; + var $9 = 0.0, $y$0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (HEAPF32[tempDoublePtr>>2]=$x,HEAP32[tempDoublePtr>>2]|0); + $1 = $0 >>> 23; + $2 = $1 & 255; + $3 = ($2>>>0)>(149); + do { + if ($3) { + $$0 = $x; + } else { + $4 = ($0|0)<(0); + $5 = -$x; + $$x = $4 ? $5 : $x; + $6 = ($2>>>0)<(126); + if ($6) { + $7 = $x * 0.0; + $$0 = $7; + break; + } + $8 = $$x + 8388608.0; + $9 = $8 + -8388608.0; + $10 = $9 - $$x; + $11 = $10 > 0.5; + if ($11) { + $12 = $$x + $10; + $13 = $12 + -1.0; + $y$0 = $13; + } else { + $14 = !($10 <= -0.5); + $15 = $$x + $10; + if ($14) { + $y$0 = $15; + } else { + $16 = $15 + 1.0; + $y$0 = $16; + } + } + $17 = -$y$0; + $$y$0 = $4 ? $17 : $y$0; + $$0 = $$y$0; + } + } while(0); + return (+$$0); +} +function _scalbn($x,$n) { + $x = +$x; + $n = $n|0; + var $$ = 0, $$0 = 0, $$1 = 0, $0 = 0, $1 = 0.0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $2 = 0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0; + var $8 = 0.0, $9 = 0, $y$0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($n|0)>(1023); + if ($0) { + $1 = $x * 8.9884656743115795E+307; + $2 = (($n) + -1023)|0; + $3 = ($2|0)>(1023); + if ($3) { + $4 = $1 * 8.9884656743115795E+307; + $5 = (($n) + -2046)|0; + $6 = ($5|0)>(1023); + $$ = $6 ? 1023 : $5; + $$0 = $$;$y$0 = $4; + } else { + $$0 = $2;$y$0 = $1; + } + } else { + $7 = ($n|0)<(-1022); + if ($7) { + $8 = $x * 2.2250738585072014E-308; + $9 = (($n) + 1022)|0; + $10 = ($9|0)<(-1022); + if ($10) { + $11 = $8 * 2.2250738585072014E-308; + $12 = (($n) + 2044)|0; + $13 = ($12|0)<(-1022); + $$1 = $13 ? -1022 : $12; + $$0 = $$1;$y$0 = $11; + } else { + $$0 = $9;$y$0 = $8; + } + } else { + $$0 = $n;$y$0 = $x; + } + } + $14 = (($$0) + 1023)|0; + $15 = (_bitshift64Shl(($14|0),0,52)|0); + $16 = tempRet0; + HEAP32[tempDoublePtr>>2] = $15;HEAP32[tempDoublePtr+4>>2] = $16;$17 = +HEAPF64[tempDoublePtr>>3]; + $18 = $y$0 * $17; + return (+$18); +} +function _scalbnl($x,$n) { + $x = +$x; + $n = $n|0; + var $0 = 0.0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (+_scalbn($x,$n)); + return (+$0); +} +function _mbrtowc($wc,$src,$n,$st) { + $wc = $wc|0; + $src = $src|0; + $n = $n|0; + $st = $st|0; + var $$0 = 0, $$024 = 0, $$1 = 0, $$lcssa = 0, $$lcssa35 = 0, $$st = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; + var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0; + var $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c$05 = 0, $c$1 = 0, $c$2 = 0, $dummy = 0, $dummy$wc = 0, $s$06 = 0, $s$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $dummy = sp; + $0 = ($st|0)==(0|0); + $$st = $0 ? 6720 : $st; + $1 = HEAP32[$$st>>2]|0; + $2 = ($src|0)==(0|0); + L1: do { + if ($2) { + $3 = ($1|0)==(0); + if ($3) { + $$0 = 0; + } else { + label = 15; + } + } else { + $4 = ($wc|0)==(0|0); + $dummy$wc = $4 ? $dummy : $wc; + $5 = ($n|0)==(0); + if ($5) { + $$0 = -2; + } else { + $6 = ($1|0)==(0); + if ($6) { + $7 = HEAP8[$src>>0]|0; + $8 = $7&255; + $9 = ($7<<24>>24)>(-1); + if ($9) { + HEAP32[$dummy$wc>>2] = $8; + $10 = ($7<<24>>24)!=(0); + $11 = $10&1; + $$0 = $11; + break; + } + $12 = (($8) + -194)|0; + $13 = ($12>>>0)>(50); + if ($13) { + label = 15; + break; + } + $14 = ((($src)) + 1|0); + $15 = (6472 + ($12<<2)|0); + $16 = HEAP32[$15>>2]|0; + $17 = (($n) + -1)|0; + $18 = ($17|0)==(0); + if ($18) { + $c$2 = $16; + } else { + $$024 = $17;$c$05 = $16;$s$06 = $14; + label = 9; + } + } else { + $$024 = $n;$c$05 = $1;$s$06 = $src; + label = 9; + } + L11: do { + if ((label|0) == 9) { + $19 = HEAP8[$s$06>>0]|0; + $20 = $19&255; + $21 = $20 >>> 3; + $22 = (($21) + -16)|0; + $23 = $c$05 >> 26; + $24 = (($21) + ($23))|0; + $25 = $22 | $24; + $26 = ($25>>>0)>(7); + if ($26) { + label = 15; + break L1; + } else { + $$1 = $$024;$30 = $19;$c$1 = $c$05;$s$1 = $s$06; + } + while(1) { + $27 = $c$1 << 6; + $28 = ((($s$1)) + 1|0); + $29 = $30&255; + $31 = (($29) + -128)|0; + $32 = $31 | $27; + $33 = (($$1) + -1)|0; + $34 = ($32|0)<(0); + if (!($34)) { + $$lcssa = $32;$$lcssa35 = $33; + break; + } + $36 = ($33|0)==(0); + if ($36) { + $c$2 = $32; + break L11; + } + $37 = HEAP8[$28>>0]|0; + $38 = $37 & -64; + $39 = ($38<<24>>24)==(-128); + if ($39) { + $$1 = $33;$30 = $37;$c$1 = $32;$s$1 = $28; + } else { + label = 15; + break L1; + } + } + HEAP32[$$st>>2] = 0; + HEAP32[$dummy$wc>>2] = $$lcssa; + $35 = (($n) - ($$lcssa35))|0; + $$0 = $35; + break L1; + } + } while(0); + HEAP32[$$st>>2] = $c$2; + $$0 = -2; + } + } + } while(0); + if ((label|0) == 15) { + HEAP32[$$st>>2] = 0; + $40 = (___errno_location()|0); + HEAP32[$40>>2] = 84; + $$0 = -1; + } + STACKTOP = sp;return ($$0|0); +} +function _mbsinit($st) { + $st = $st|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($st|0)==(0|0); + if ($0) { + $4 = 1; + } else { + $1 = HEAP32[$st>>2]|0; + $2 = ($1|0)==(0); + $4 = $2; + } + $3 = $4&1; + return ($3|0); +} +function _wcrtomb($s,$wc,$st) { + $s = $s|0; + $wc = $wc|0; + $st = $st|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($s|0)==(0|0); + do { + if ($0) { + $$0 = 1; + } else { + $1 = ($wc>>>0)<(128); + if ($1) { + $2 = $wc&255; + HEAP8[$s>>0] = $2; + $$0 = 1; + break; + } + $3 = ($wc>>>0)<(2048); + if ($3) { + $4 = $wc >>> 6; + $5 = $4 | 192; + $6 = $5&255; + $7 = ((($s)) + 1|0); + HEAP8[$s>>0] = $6; + $8 = $wc & 63; + $9 = $8 | 128; + $10 = $9&255; + HEAP8[$7>>0] = $10; + $$0 = 2; + break; + } + $11 = ($wc>>>0)<(55296); + $12 = $wc & -8192; + $13 = ($12|0)==(57344); + $or$cond = $11 | $13; + if ($or$cond) { + $14 = $wc >>> 12; + $15 = $14 | 224; + $16 = $15&255; + $17 = ((($s)) + 1|0); + HEAP8[$s>>0] = $16; + $18 = $wc >>> 6; + $19 = $18 & 63; + $20 = $19 | 128; + $21 = $20&255; + $22 = ((($s)) + 2|0); + HEAP8[$17>>0] = $21; + $23 = $wc & 63; + $24 = $23 | 128; + $25 = $24&255; + HEAP8[$22>>0] = $25; + $$0 = 3; + break; + } + $26 = (($wc) + -65536)|0; + $27 = ($26>>>0)<(1048576); + if ($27) { + $28 = $wc >>> 18; + $29 = $28 | 240; + $30 = $29&255; + $31 = ((($s)) + 1|0); + HEAP8[$s>>0] = $30; + $32 = $wc >>> 12; + $33 = $32 & 63; + $34 = $33 | 128; + $35 = $34&255; + $36 = ((($s)) + 2|0); + HEAP8[$31>>0] = $35; + $37 = $wc >>> 6; + $38 = $37 & 63; + $39 = $38 | 128; + $40 = $39&255; + $41 = ((($s)) + 3|0); + HEAP8[$36>>0] = $40; + $42 = $wc & 63; + $43 = $42 | 128; + $44 = $43&255; + HEAP8[$41>>0] = $44; + $$0 = 4; + break; + } else { + $45 = (___errno_location()|0); + HEAP32[$45>>2] = 84; + $$0 = -1; + break; + } + } + } while(0); + return ($$0|0); +} +function _wctomb($s,$wc) { + $s = $s|0; + $wc = $wc|0; + var $$0 = 0, $0 = 0, $1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($s|0)==(0|0); + if ($0) { + $$0 = 0; + } else { + $1 = (_wcrtomb($s,$wc,0)|0); + $$0 = $1; + } + return ($$0|0); +} +function _srand($s) { + $s = $s|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (($s) + -1)|0; + $1 = 144; + $2 = $1; + HEAP32[$2>>2] = $0; + $3 = (($1) + 4)|0; + $4 = $3; + HEAP32[$4>>2] = 0; + return; +} +function _fclose($f) { + $f = $f|0; + var $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 76|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)>(-1); + if ($2) { + (___lockfile($f)|0); + } + $3 = HEAP32[$f>>2]|0; + $4 = $3 & 1; + $5 = ($4|0)!=(0); + if (!($5)) { + ___lock(((6456)|0)); + $6 = ((($f)) + 52|0); + $7 = HEAP32[$6>>2]|0; + $8 = ($7|0)==(0|0); + $9 = $7; + $$pre = ((($f)) + 56|0); + if (!($8)) { + $10 = HEAP32[$$pre>>2]|0; + $11 = ((($7)) + 56|0); + HEAP32[$11>>2] = $10; + } + $12 = HEAP32[$$pre>>2]|0; + $13 = ($12|0)==(0|0); + $14 = $12; + if (!($13)) { + $15 = ((($12)) + 52|0); + HEAP32[$15>>2] = $9; + } + $16 = HEAP32[(6452)>>2]|0; + $17 = ($16|0)==($f|0); + if ($17) { + HEAP32[(6452)>>2] = $14; + } + ___unlock(((6456)|0)); + } + $18 = (_fflush($f)|0); + $19 = ((($f)) + 12|0); + $20 = HEAP32[$19>>2]|0; + $21 = (FUNCTION_TABLE_ii[$20 & 15]($f)|0); + $22 = $21 | $18; + $23 = ((($f)) + 92|0); + $24 = HEAP32[$23>>2]|0; + $25 = ($24|0)==(0|0); + if (!($25)) { + _free($24); + } + if (!($5)) { + _free($f); + } + return ($22|0); +} +function _feof($f) { + $f = $f|0; + var $$lobit = 0, $$lobit1 = 0, $$lobit2 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 76|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)>(-1); + if ($2) { + $5 = (___lockfile($f)|0); + $phitmp = ($5|0)==(0); + $6 = HEAP32[$f>>2]|0; + $7 = $6 >>> 4; + $$lobit = $7 & 1; + if ($phitmp) { + $$lobit2 = $$lobit; + } else { + ___unlockfile($f); + $$lobit2 = $$lobit; + } + } else { + $3 = HEAP32[$f>>2]|0; + $4 = $3 >>> 4; + $$lobit1 = $4 & 1; + $$lobit2 = $$lobit1; + } + return ($$lobit2|0); +} +function _fflush($f) { + $f = $f|0; + var $$0 = 0, $$01 = 0, $$012 = 0, $$014 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; + var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, $r$0$lcssa = 0, $r$03 = 0, $r$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($f|0)==(0|0); + do { + if ($0) { + $7 = HEAP32[6680>>2]|0; + $8 = ($7|0)==(0|0); + if ($8) { + $27 = 0; + } else { + $9 = HEAP32[6680>>2]|0; + $10 = (_fflush($9)|0); + $27 = $10; + } + ___lock(((6456)|0)); + $$012 = HEAP32[(6452)>>2]|0; + $11 = ($$012|0)==(0|0); + if ($11) { + $r$0$lcssa = $27; + } else { + $$014 = $$012;$r$03 = $27; + while(1) { + $12 = ((($$014)) + 76|0); + $13 = HEAP32[$12>>2]|0; + $14 = ($13|0)>(-1); + if ($14) { + $15 = (___lockfile($$014)|0); + $23 = $15; + } else { + $23 = 0; + } + $16 = ((($$014)) + 20|0); + $17 = HEAP32[$16>>2]|0; + $18 = ((($$014)) + 28|0); + $19 = HEAP32[$18>>2]|0; + $20 = ($17>>>0)>($19>>>0); + if ($20) { + $21 = (___fflush_unlocked($$014)|0); + $22 = $21 | $r$03; + $r$1 = $22; + } else { + $r$1 = $r$03; + } + $24 = ($23|0)==(0); + if (!($24)) { + ___unlockfile($$014); + } + $25 = ((($$014)) + 56|0); + $$01 = HEAP32[$25>>2]|0; + $26 = ($$01|0)==(0|0); + if ($26) { + $r$0$lcssa = $r$1; + break; + } else { + $$014 = $$01;$r$03 = $r$1; + } + } + } + ___unlock(((6456)|0)); + $$0 = $r$0$lcssa; + } else { + $1 = ((($f)) + 76|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)>(-1); + if (!($3)) { + $4 = (___fflush_unlocked($f)|0); + $$0 = $4; + break; + } + $5 = (___lockfile($f)|0); + $phitmp = ($5|0)==(0); + $6 = (___fflush_unlocked($f)|0); + if ($phitmp) { + $$0 = $6; + } else { + ___unlockfile($f); + $$0 = $6; + } + } + } while(0); + return ($$0|0); +} +function _fgets($s,$n,$f) { + $s = $s|0; + $n = $n|0; + $f = $f|0; + var $$0 = 0, $$048 = 0, $$05 = 0, $$lcssa14 = 0, $$old2 = 0, $$pre = 0, $$sum$pre$phiZZ2D = 0, $$sum6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; + var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0; + var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0; + var $9 = 0, $or$cond = 0, $or$cond3 = 0, $p$0 = 0, $p$1 = 0, $sext$mask = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 76|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)>(-1); + if ($2) { + $3 = (___lockfile($f)|0); + $12 = $3; + } else { + $12 = 0; + } + $4 = (($n) + -1)|0; + $5 = ($n|0)<(2); + if ($5) { + $6 = ((($f)) + 74|0); + $7 = HEAP8[$6>>0]|0; + $8 = $7 << 24 >> 24; + $9 = (($8) + 255)|0; + $10 = $9 | $8; + $11 = $10&255; + HEAP8[$6>>0] = $11; + $13 = ($12|0)==(0); + if (!($13)) { + ___unlockfile($f); + } + $14 = ($4|0)==(0); + if ($14) { + HEAP8[$s>>0] = 0; + $$0 = $s; + } else { + $$0 = 0; + } + } else { + $$old2 = ($4|0)==(0); + L11: do { + if ($$old2) { + $p$1 = $s; + label = 18; + } else { + $15 = ((($f)) + 4|0); + $16 = ((($f)) + 8|0); + $$05 = $4;$p$0 = $s; + while(1) { + $17 = HEAP32[$15>>2]|0; + $18 = HEAP32[$16>>2]|0; + $19 = $18; + $20 = $17; + $21 = (($19) - ($20))|0; + $22 = (_memchr($17,10,$21)|0); + $23 = ($22|0)==(0|0); + $24 = $22; + $25 = (1 - ($20))|0; + $26 = (($25) + ($24))|0; + $27 = $23 ? $21 : $26; + $28 = ($27>>>0)<($$05>>>0); + $29 = $28 ? $27 : $$05; + _memcpy(($p$0|0),($17|0),($29|0))|0; + $30 = HEAP32[$15>>2]|0; + $31 = (($30) + ($29)|0); + HEAP32[$15>>2] = $31; + $32 = (($p$0) + ($29)|0); + $33 = (($$05) - ($29))|0; + $or$cond = $23 & $28; + if (!($or$cond)) { + $p$1 = $32; + label = 18; + break L11; + } + $34 = HEAP32[$16>>2]|0; + $35 = ($31>>>0)<($34>>>0); + if ($35) { + $$sum6 = (($29) + 1)|0; + $36 = (($30) + ($$sum6)|0); + HEAP32[$15>>2] = $36; + $37 = HEAP8[$31>>0]|0; + $38 = $37&255; + $$sum$pre$phiZZ2D = $$sum6;$47 = $38; + } else { + $39 = (___uflow($f)|0); + $40 = ($39|0)<(0); + if ($40) { + $$lcssa14 = $32; + break; + } + $$pre = (($29) + 1)|0; + $$sum$pre$phiZZ2D = $$pre;$47 = $39; + } + $45 = (($33) + -1)|0; + $46 = $47&255; + $48 = (($p$0) + ($$sum$pre$phiZZ2D)|0); + HEAP8[$32>>0] = $46; + $sext$mask = $47 & 255; + $49 = ($sext$mask|0)!=(10); + $50 = ($45|0)!=(0); + $or$cond3 = $50 & $49; + if ($or$cond3) { + $$05 = $45;$p$0 = $48; + } else { + $p$1 = $48; + label = 18; + break L11; + } + } + $41 = ($$lcssa14|0)==($s|0); + if ($41) { + $$048 = 0; + } else { + $42 = HEAP32[$f>>2]|0; + $43 = $42 & 16; + $44 = ($43|0)==(0); + if ($44) { + $$048 = 0; + } else { + $p$1 = $$lcssa14; + label = 18; + } + } + } + } while(0); + if ((label|0) == 18) { + $51 = ($s|0)==(0|0); + if ($51) { + $$048 = 0; + } else { + HEAP8[$p$1>>0] = 0; + $$048 = $s; + } + } + $52 = ($12|0)==(0); + if ($52) { + $$0 = $$048; + } else { + ___unlockfile($f); + $$0 = $$048; + } + } + return ($$0|0); +} +function _fopen($filename,$mode) { + $filename = $filename|0; + $mode = $mode|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer = sp; + $0 = HEAP8[$mode>>0]|0; + $1 = $0 << 24 >> 24; + $memchr = (_memchr(22738,$1,4)|0); + $2 = ($memchr|0)==(0|0); + if ($2) { + $3 = (___errno_location()|0); + HEAP32[$3>>2] = 22; + $$0 = 0; + } else { + $4 = (___fmodeflags($mode)|0); + $5 = $4 | 32768; + HEAP32[$vararg_buffer>>2] = $filename; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $5; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = 438; + $6 = (___syscall5(5,($vararg_buffer|0))|0); + $7 = (___syscall_ret($6)|0); + $8 = ($7|0)<(0); + if ($8) { + $$0 = 0; + } else { + $9 = (___fdopen($7,$mode)|0); + $10 = ($9|0)==(0|0); + if ($10) { + HEAP32[$vararg_buffer3>>2] = $7; + (___syscall6(6,($vararg_buffer3|0))|0); + $$0 = 0; + } else { + $$0 = $9; + } + } + } + STACKTOP = sp;return ($$0|0); +} +function _fputc($c,$f) { + $c = $c|0; + $f = $f|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 76|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)<(0); + if ($2) { + label = 3; + } else { + $3 = (___lockfile($f)|0); + $4 = ($3|0)==(0); + if ($4) { + label = 3; + } else { + $18 = ((($f)) + 75|0); + $19 = HEAP8[$18>>0]|0; + $20 = $19 << 24 >> 24; + $21 = ($20|0)==($c|0); + if ($21) { + label = 10; + } else { + $22 = ((($f)) + 20|0); + $23 = HEAP32[$22>>2]|0; + $24 = ((($f)) + 16|0); + $25 = HEAP32[$24>>2]|0; + $26 = ($23>>>0)<($25>>>0); + if ($26) { + $27 = $c&255; + $28 = ((($23)) + 1|0); + HEAP32[$22>>2] = $28; + HEAP8[$23>>0] = $27; + $29 = $c & 255; + $31 = $29; + } else { + label = 10; + } + } + if ((label|0) == 10) { + $30 = (___overflow($f,$c)|0); + $31 = $30; + } + ___unlockfile($f); + $$0 = $31; + } + } + do { + if ((label|0) == 3) { + $5 = ((($f)) + 75|0); + $6 = HEAP8[$5>>0]|0; + $7 = $6 << 24 >> 24; + $8 = ($7|0)==($c|0); + if (!($8)) { + $9 = ((($f)) + 20|0); + $10 = HEAP32[$9>>2]|0; + $11 = ((($f)) + 16|0); + $12 = HEAP32[$11>>2]|0; + $13 = ($10>>>0)<($12>>>0); + if ($13) { + $14 = $c&255; + $15 = ((($10)) + 1|0); + HEAP32[$9>>2] = $15; + HEAP8[$10>>0] = $14; + $16 = $c & 255; + $$0 = $16; + break; + } + } + $17 = (___overflow($f,$c)|0); + $$0 = $17; + } + } while(0); + return ($$0|0); +} +function _fread($destv,$size,$nmemb,$f) { + $destv = $destv|0; + $size = $size|0; + $nmemb = $nmemb|0; + $f = $f|0; + var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; + var $9 = 0, $dest$0$ph = 0, $dest$02 = 0, $l$0$ph = 0, $l$03 = 0, $l$03$lcssa = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = Math_imul($nmemb, $size)|0; + $1 = ((($f)) + 76|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)>(-1); + if ($3) { + $4 = (___lockfile($f)|0); + $31 = $4; + } else { + $31 = 0; + } + $5 = ((($f)) + 74|0); + $6 = HEAP8[$5>>0]|0; + $7 = $6 << 24 >> 24; + $8 = (($7) + 255)|0; + $9 = $8 | $7; + $10 = $9&255; + HEAP8[$5>>0] = $10; + $11 = ((($f)) + 8|0); + $12 = HEAP32[$11>>2]|0; + $13 = ((($f)) + 4|0); + $14 = HEAP32[$13>>2]|0; + $15 = $12; + $16 = $14; + $17 = (($15) - ($16))|0; + $18 = ($17|0)>(0); + if ($18) { + $19 = ($17>>>0)<($0>>>0); + $$ = $19 ? $17 : $0; + _memcpy(($destv|0),($14|0),($$|0))|0; + $20 = (($14) + ($$)|0); + HEAP32[$13>>2] = $20; + $21 = (($destv) + ($$)|0); + $22 = (($0) - ($$))|0; + $dest$0$ph = $21;$l$0$ph = $22; + } else { + $dest$0$ph = $destv;$l$0$ph = $0; + } + $23 = ($l$0$ph|0)==(0); + L7: do { + if ($23) { + label = 13; + } else { + $24 = ((($f)) + 32|0); + $dest$02 = $dest$0$ph;$l$03 = $l$0$ph; + while(1) { + $25 = (___toread($f)|0); + $26 = ($25|0)==(0); + if (!($26)) { + $l$03$lcssa = $l$03; + break; + } + $27 = HEAP32[$24>>2]|0; + $28 = (FUNCTION_TABLE_iiii[$27 & 15]($f,$dest$02,$l$03)|0); + $29 = (($28) + 1)|0; + $30 = ($29>>>0)<(2); + if ($30) { + $l$03$lcssa = $l$03; + break; + } + $35 = (($l$03) - ($28))|0; + $36 = (($dest$02) + ($28)|0); + $37 = ($l$03|0)==($28|0); + if ($37) { + label = 13; + break L7; + } else { + $dest$02 = $36;$l$03 = $35; + } + } + $32 = ($31|0)==(0); + if (!($32)) { + ___unlockfile($f); + } + $33 = (($0) - ($l$03$lcssa))|0; + $34 = (($33>>>0) / ($size>>>0))&-1; + $$0 = $34; + } + } while(0); + if ((label|0) == 13) { + $38 = ($31|0)==(0); + if ($38) { + $$0 = $nmemb; + } else { + ___unlockfile($f); + $$0 = $nmemb; + } + } + return ($$0|0); +} +function _fscanf($f,$fmt,$varargs) { + $f = $f|0; + $fmt = $fmt|0; + $varargs = $varargs|0; + var $0 = 0, $ap = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $ap = sp; + HEAP32[$ap>>2] = $varargs; + $0 = (_vfscanf($f,$fmt,$ap)|0); + STACKTOP = sp;return ($0|0); +} +function ___fseeko_unlocked($f,$off,$whence) { + $f = $f|0; + $off = $off|0; + $whence = $whence|0; + var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($whence|0)==(1); + if ($0) { + $1 = ((($f)) + 8|0); + $2 = HEAP32[$1>>2]|0; + $3 = ((($f)) + 4|0); + $4 = HEAP32[$3>>2]|0; + $5 = $2; + $6 = $4; + $7 = (($off) - ($5))|0; + $8 = (($7) + ($6))|0; + $$01 = $8; + } else { + $$01 = $off; + } + $9 = ((($f)) + 20|0); + $10 = HEAP32[$9>>2]|0; + $11 = ((($f)) + 28|0); + $12 = HEAP32[$11>>2]|0; + $13 = ($10>>>0)>($12>>>0); + if ($13) { + $14 = ((($f)) + 36|0); + $15 = HEAP32[$14>>2]|0; + (FUNCTION_TABLE_iiii[$15 & 15]($f,0,0)|0); + $16 = HEAP32[$9>>2]|0; + $17 = ($16|0)==(0|0); + if ($17) { + $$0 = -1; + } else { + label = 5; + } + } else { + label = 5; + } + if ((label|0) == 5) { + $18 = ((($f)) + 16|0); + HEAP32[$18>>2] = 0; + HEAP32[$11>>2] = 0; + HEAP32[$9>>2] = 0; + $19 = ((($f)) + 40|0); + $20 = HEAP32[$19>>2]|0; + $21 = (FUNCTION_TABLE_iiii[$20 & 15]($f,$$01,$whence)|0); + $22 = ($21|0)<(0); + if ($22) { + $$0 = -1; + } else { + $23 = ((($f)) + 8|0); + HEAP32[$23>>2] = 0; + $24 = ((($f)) + 4|0); + HEAP32[$24>>2] = 0; + $25 = HEAP32[$f>>2]|0; + $26 = $25 & -17; + HEAP32[$f>>2] = $26; + $$0 = 0; + } + } + return ($$0|0); +} +function ___fseeko($f,$off,$whence) { + $f = $f|0; + $off = $off|0; + $whence = $whence|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $phitmp = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 76|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)>(-1); + if ($2) { + $4 = (___lockfile($f)|0); + $phitmp = ($4|0)==(0); + $5 = (___fseeko_unlocked($f,$off,$whence)|0); + if ($phitmp) { + $6 = $5; + } else { + ___unlockfile($f); + $6 = $5; + } + } else { + $3 = (___fseeko_unlocked($f,$off,$whence)|0); + $6 = $3; + } + return ($6|0); +} +function _fseek($f,$off,$whence) { + $f = $f|0; + $off = $off|0; + $whence = $whence|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (___fseeko($f,$off,$whence)|0); + return ($0|0); +} +function ___fwritex($s,$l,$f) { + $s = $s|0; + $l = $l|0; + $f = $f|0; + var $$0 = 0, $$01 = 0, $$02 = 0, $$pre = 0, $$pre6 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0; + var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $i$0 = 0, $i$0$lcssa10 = 0; + var $i$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0|0); + if ($2) { + $3 = (___towrite($f)|0); + $4 = ($3|0)==(0); + if ($4) { + $$pre = HEAP32[$0>>2]|0; + $7 = $$pre; + label = 4; + } else { + $$0 = 0; + } + } else { + $7 = $1; + label = 4; + } + L4: do { + if ((label|0) == 4) { + $5 = ((($f)) + 20|0); + $6 = HEAP32[$5>>2]|0; + $8 = $7; + $9 = $6; + $10 = (($8) - ($9))|0; + $11 = ($10>>>0)<($l>>>0); + if ($11) { + $12 = ((($f)) + 36|0); + $13 = HEAP32[$12>>2]|0; + $14 = (FUNCTION_TABLE_iiii[$13 & 15]($f,$s,$l)|0); + $$0 = $14; + break; + } + $15 = ((($f)) + 75|0); + $16 = HEAP8[$15>>0]|0; + $17 = ($16<<24>>24)>(-1); + L9: do { + if ($17) { + $i$0 = $l; + while(1) { + $18 = ($i$0|0)==(0); + if ($18) { + $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0; + break L9; + } + $19 = (($i$0) + -1)|0; + $20 = (($s) + ($19)|0); + $21 = HEAP8[$20>>0]|0; + $22 = ($21<<24>>24)==(10); + if ($22) { + $i$0$lcssa10 = $i$0; + break; + } else { + $i$0 = $19; + } + } + $23 = ((($f)) + 36|0); + $24 = HEAP32[$23>>2]|0; + $25 = (FUNCTION_TABLE_iiii[$24 & 15]($f,$s,$i$0$lcssa10)|0); + $26 = ($25>>>0)<($i$0$lcssa10>>>0); + if ($26) { + $$0 = $i$0$lcssa10; + break L4; + } + $27 = (($s) + ($i$0$lcssa10)|0); + $28 = (($l) - ($i$0$lcssa10))|0; + $$pre6 = HEAP32[$5>>2]|0; + $$01 = $28;$$02 = $27;$29 = $$pre6;$i$1 = $i$0$lcssa10; + } else { + $$01 = $l;$$02 = $s;$29 = $6;$i$1 = 0; + } + } while(0); + _memcpy(($29|0),($$02|0),($$01|0))|0; + $30 = HEAP32[$5>>2]|0; + $31 = (($30) + ($$01)|0); + HEAP32[$5>>2] = $31; + $32 = (($i$1) + ($$01))|0; + $$0 = $32; + } + } while(0); + return ($$0|0); +} +function _fwrite($src,$size,$nmemb,$f) { + $src = $src|0; + $size = $size|0; + $nmemb = $nmemb|0; + $f = $f|0; + var $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = Math_imul($nmemb, $size)|0; + $1 = ((($f)) + 76|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)>(-1); + if ($3) { + $5 = (___lockfile($f)|0); + $phitmp = ($5|0)==(0); + $6 = (___fwritex($src,$0,$f)|0); + if ($phitmp) { + $7 = $6; + } else { + ___unlockfile($f); + $7 = $6; + } + } else { + $4 = (___fwritex($src,$0,$f)|0); + $7 = $4; + } + $8 = ($7|0)==($0|0); + if ($8) { + $10 = $nmemb; + } else { + $9 = (($7>>>0) / ($size>>>0))&-1; + $10 = $9; + } + return ($10|0); +} +function _rewind($f) { + $f = $f|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 76|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)>(-1); + if ($2) { + $3 = (___lockfile($f)|0); + $phitmp = ($3|0)==(0); + (___fseeko_unlocked($f,0,0)|0); + $4 = HEAP32[$f>>2]|0; + $5 = $4 & -33; + HEAP32[$f>>2] = $5; + if (!($phitmp)) { + ___unlockfile($f); + } + } else { + (___fseeko_unlocked($f,0,0)|0); + $6 = HEAP32[$f>>2]|0; + $7 = $6 & -33; + HEAP32[$f>>2] = $7; + } + return; +} +function _sprintf($s,$fmt,$varargs) { + $s = $s|0; + $fmt = $fmt|0; + $varargs = $varargs|0; + var $0 = 0, $ap = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $ap = sp; + HEAP32[$ap>>2] = $varargs; + $0 = (_vsprintf($s,$fmt,$ap)|0); + STACKTOP = sp;return ($0|0); +} +function _vfprintf($f,$fmt,$ap) { + $f = $f|0; + $fmt = $fmt|0; + $ap = $ap|0; + var $$ = 0, $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0; + var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ap2 = 0, $internal_buf = 0, $nl_arg = 0, $nl_type = 0; + var $ret$1 = 0, $ret$1$ = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 224|0; + $ap2 = sp + 120|0; + $nl_type = sp + 80|0; + $nl_arg = sp; + $internal_buf = sp + 136|0; + dest=$nl_type; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); + $vacopy_currentptr = HEAP32[$ap>>2]|0; + HEAP32[$ap2>>2] = $vacopy_currentptr; + $0 = (_printf_core(0,$fmt,$ap2,$nl_arg,$nl_type)|0); + $1 = ($0|0)<(0); + if ($1) { + $$0 = -1; + } else { + $2 = ((($f)) + 76|0); + $3 = HEAP32[$2>>2]|0; + $4 = ($3|0)>(-1); + if ($4) { + $5 = (___lockfile($f)|0); + $32 = $5; + } else { + $32 = 0; + } + $6 = HEAP32[$f>>2]|0; + $7 = $6 & 32; + $8 = ((($f)) + 74|0); + $9 = HEAP8[$8>>0]|0; + $10 = ($9<<24>>24)<(1); + if ($10) { + $11 = $6 & -33; + HEAP32[$f>>2] = $11; + } + $12 = ((($f)) + 48|0); + $13 = HEAP32[$12>>2]|0; + $14 = ($13|0)==(0); + if ($14) { + $16 = ((($f)) + 44|0); + $17 = HEAP32[$16>>2]|0; + HEAP32[$16>>2] = $internal_buf; + $18 = ((($f)) + 28|0); + HEAP32[$18>>2] = $internal_buf; + $19 = ((($f)) + 20|0); + HEAP32[$19>>2] = $internal_buf; + HEAP32[$12>>2] = 80; + $20 = ((($internal_buf)) + 80|0); + $21 = ((($f)) + 16|0); + HEAP32[$21>>2] = $20; + $22 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0); + $23 = ($17|0)==(0|0); + if ($23) { + $ret$1 = $22; + } else { + $24 = ((($f)) + 36|0); + $25 = HEAP32[$24>>2]|0; + (FUNCTION_TABLE_iiii[$25 & 15]($f,0,0)|0); + $26 = HEAP32[$19>>2]|0; + $27 = ($26|0)==(0|0); + $$ = $27 ? -1 : $22; + HEAP32[$16>>2] = $17; + HEAP32[$12>>2] = 0; + HEAP32[$21>>2] = 0; + HEAP32[$18>>2] = 0; + HEAP32[$19>>2] = 0; + $ret$1 = $$; + } + } else { + $15 = (_printf_core($f,$fmt,$ap2,$nl_arg,$nl_type)|0); + $ret$1 = $15; + } + $28 = HEAP32[$f>>2]|0; + $29 = $28 & 32; + $30 = ($29|0)==(0); + $ret$1$ = $30 ? $ret$1 : -1; + $31 = $28 | $7; + HEAP32[$f>>2] = $31; + $33 = ($32|0)==(0); + if (!($33)) { + ___unlockfile($f); + } + $$0 = $ret$1$; + } + STACKTOP = sp;return ($$0|0); +} +function _vfscanf($f,$fmt,$ap) { + $f = $f|0; + $fmt = $fmt|0; + $ap = $ap|0; + var $$ = 0, $$10 = 0, $$11 = 0, $$12 = 0, $$9 = 0, $$lcssa = 0, $$lcssa38 = 0, $$lcssa384 = 0, $$not = 0, $$old4 = 0, $$pre = 0, $$pre$phi182Z2D = 0, $$pre168 = 0, $$pre170 = 0, $$pre172 = 0, $$pre174 = 0, $$pre176 = 0, $$pre178 = 0, $$pre180 = 0, $$pre181 = 0; + var $$size$0 = 0, $$width$0 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0; + var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0; + var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0; + var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0; + var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0; + var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0; + var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0; + var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0; + var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0; + var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0; + var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0; + var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0.0, $311 = 0; + var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0; + var $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0; + var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0; + var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0; + var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $alloc$0 = 0, $alloc$0400 = 0, $alloc$1 = 0; + var $alloc$2 = 0, $ap2$i = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $base$0 = 0, $c$0100 = 0, $dest$0 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $factor = 0; + var $factor16 = 0, $i$0$i = 0, $i$0$ph = 0, $i$0$ph$phi = 0, $i$0$ph20 = 0, $i$0$ph20$lcssa = 0, $i$1 = 0, $i$2 = 0, $i$2$ph = 0, $i$2$ph$phi = 0, $i$3 = 0, $i$4 = 0, $invert$0 = 0, $isdigit = 0, $isdigit7 = 0, $isdigit795 = 0, $isdigittmp = 0, $isdigittmp6 = 0, $isdigittmp694 = 0, $k$0$ph = 0; + var $k$1$ph = 0, $matches$0$ = 0, $matches$0104 = 0, $matches$0104$lcssa = 0, $matches$0104376 = 0, $matches$1 = 0, $matches$2 = 0, $matches$3 = 0, $not$ = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond8 = 0, $p$0109 = 0, $p$1 = 0, $p$1$lcssa = 0, $p$10 = 0, $p$11 = 0, $p$2 = 0, $p$3$lcssa = 0; + var $p$396 = 0, $p$4 = 0, $p$5 = 0, $p$6 = 0, $p$7 = 0, $p$7$ph = 0, $p$8 = 0, $p$9 = 0, $pos$0108 = 0, $pos$1 = 0, $pos$2 = 0, $s$0107 = 0, $s$0107$lcssa = 0, $s$1 = 0, $s$2$ph = 0, $s$3 = 0, $s$4 = 0, $s$5 = 0, $s$6 = 0, $s$7 = 0; + var $s$8 = 0, $scanset = 0, $size$0 = 0, $st = 0, $vacopy_currentptr = 0, $wc = 0, $wcs$0103 = 0, $wcs$0103$lcssa = 0, $wcs$1 = 0, $wcs$2 = 0, $wcs$3$ph = 0, $wcs$3$ph$lcssa = 0, $wcs$4 = 0, $wcs$5 = 0, $wcs$6 = 0, $wcs$7 = 0, $wcs$8 = 0, $wcs$9 = 0, $width$0$lcssa = 0, $width$097 = 0; + var $width$1 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 304|0; + $ap2$i = sp + 16|0; + $st = sp + 8|0; + $scanset = sp + 33|0; + $wc = sp; + $0 = sp + 32|0; + $1 = ((($f)) + 76|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)>(-1); + if ($3) { + $4 = (___lockfile($f)|0); + $333 = $4; + } else { + $333 = 0; + } + $5 = HEAP8[$fmt>>0]|0; + $6 = ($5<<24>>24)==(0); + L4: do { + if ($6) { + $matches$3 = 0; + } else { + $7 = ((($f)) + 4|0); + $8 = ((($f)) + 100|0); + $9 = ((($f)) + 108|0); + $10 = ((($f)) + 8|0); + $11 = ((($scanset)) + 10|0); + $12 = ((($scanset)) + 33|0); + $13 = ((($st)) + 4|0); + $14 = ((($scanset)) + 46|0); + $15 = ((($scanset)) + 94|0); + $17 = $5;$matches$0104 = 0;$p$0109 = $fmt;$pos$0108 = 0;$s$0107 = 0;$wcs$0103 = 0; + L6: while(1) { + $16 = $17&255; + $18 = (_isspace($16)|0); + $19 = ($18|0)==(0); + L8: do { + if ($19) { + $46 = HEAP8[$p$0109>>0]|0; + $47 = ($46<<24>>24)==(37); + L10: do { + if ($47) { + $48 = ((($p$0109)) + 1|0); + $49 = HEAP8[$48>>0]|0; + L12: do { + switch ($49<<24>>24) { + case 37: { + break L10; + break; + } + case 42: { + $70 = ((($p$0109)) + 2|0); + $dest$0 = 0;$p$2 = $70; + break; + } + default: { + $71 = $49&255; + $isdigittmp = (($71) + -48)|0; + $isdigit = ($isdigittmp>>>0)<(10); + if ($isdigit) { + $72 = ((($p$0109)) + 2|0); + $73 = HEAP8[$72>>0]|0; + $74 = ($73<<24>>24)==(36); + if ($74) { + $vacopy_currentptr = HEAP32[$ap>>2]|0; + HEAP32[$ap2$i>>2] = $vacopy_currentptr; + $i$0$i = $isdigittmp; + while(1) { + $75 = ($i$0$i>>>0)>(1); + $arglist_current = HEAP32[$ap2$i>>2]|0; + $76 = $arglist_current; + $77 = ((0) + 4|0); + $expanded4 = $77; + $expanded = (($expanded4) - 1)|0; + $78 = (($76) + ($expanded))|0; + $79 = ((0) + 4|0); + $expanded8 = $79; + $expanded7 = (($expanded8) - 1)|0; + $expanded6 = $expanded7 ^ -1; + $80 = $78 & $expanded6; + $81 = $80; + $82 = HEAP32[$81>>2]|0; + $arglist_next = ((($81)) + 4|0); + HEAP32[$ap2$i>>2] = $arglist_next; + $83 = (($i$0$i) + -1)|0; + if ($75) { + $i$0$i = $83; + } else { + $$lcssa = $82; + break; + } + } + $84 = ((($p$0109)) + 3|0); + $dest$0 = $$lcssa;$p$2 = $84; + break L12; + } + } + $arglist_current2 = HEAP32[$ap>>2]|0; + $85 = $arglist_current2; + $86 = ((0) + 4|0); + $expanded11 = $86; + $expanded10 = (($expanded11) - 1)|0; + $87 = (($85) + ($expanded10))|0; + $88 = ((0) + 4|0); + $expanded15 = $88; + $expanded14 = (($expanded15) - 1)|0; + $expanded13 = $expanded14 ^ -1; + $89 = $87 & $expanded13; + $90 = $89; + $91 = HEAP32[$90>>2]|0; + $arglist_next3 = ((($90)) + 4|0); + HEAP32[$ap>>2] = $arglist_next3; + $dest$0 = $91;$p$2 = $48; + } + } + } while(0); + $92 = HEAP8[$p$2>>0]|0; + $93 = $92&255; + $isdigittmp694 = (($93) + -48)|0; + $isdigit795 = ($isdigittmp694>>>0)<(10); + if ($isdigit795) { + $97 = $93;$p$396 = $p$2;$width$097 = 0; + while(1) { + $94 = ($width$097*10)|0; + $95 = (($94) + -48)|0; + $96 = (($95) + ($97))|0; + $98 = ((($p$396)) + 1|0); + $99 = HEAP8[$98>>0]|0; + $100 = $99&255; + $isdigittmp6 = (($100) + -48)|0; + $isdigit7 = ($isdigittmp6>>>0)<(10); + if ($isdigit7) { + $97 = $100;$p$396 = $98;$width$097 = $96; + } else { + $$lcssa38 = $99;$p$3$lcssa = $98;$width$0$lcssa = $96; + break; + } + } + } else { + $$lcssa38 = $92;$p$3$lcssa = $p$2;$width$0$lcssa = 0; + } + $101 = ($$lcssa38<<24>>24)==(109); + if ($101) { + $102 = ($dest$0|0)!=(0|0); + $103 = $102&1; + $104 = ((($p$3$lcssa)) + 1|0); + $$pre168 = HEAP8[$104>>0]|0; + $107 = $$pre168;$alloc$0 = $103;$p$4 = $104;$s$1 = 0;$wcs$1 = 0; + } else { + $107 = $$lcssa38;$alloc$0 = 0;$p$4 = $p$3$lcssa;$s$1 = $s$0107;$wcs$1 = $wcs$0103; + } + $105 = ((($p$4)) + 1|0); + $106 = $107&255; + switch ($106|0) { + case 104: { + $108 = HEAP8[$105>>0]|0; + $109 = ($108<<24>>24)==(104); + $110 = ((($p$4)) + 2|0); + $$9 = $109 ? $110 : $105; + $$10 = $109 ? -2 : -1; + $p$5 = $$9;$size$0 = $$10; + break; + } + case 108: { + $111 = HEAP8[$105>>0]|0; + $112 = ($111<<24>>24)==(108); + $113 = ((($p$4)) + 2|0); + $$11 = $112 ? $113 : $105; + $$12 = $112 ? 3 : 1; + $p$5 = $$11;$size$0 = $$12; + break; + } + case 106: { + $p$5 = $105;$size$0 = 3; + break; + } + case 116: case 122: { + $p$5 = $105;$size$0 = 1; + break; + } + case 76: { + $p$5 = $105;$size$0 = 2; + break; + } + case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100: { + $p$5 = $p$4;$size$0 = 0; + break; + } + default: { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1; + label = 152; + break L6; + } + } + $114 = HEAP8[$p$5>>0]|0; + $115 = $114&255; + $116 = $115 & 47; + $117 = ($116|0)==(3); + $118 = $115 | 32; + $$ = $117 ? $118 : $115; + $$size$0 = $117 ? 1 : $size$0; + switch ($$|0) { + case 99: { + $119 = ($width$0$lcssa|0)<(1); + $$width$0 = $119 ? 1 : $width$0$lcssa; + $pos$1 = $pos$0108;$width$1 = $$width$0; + break; + } + case 91: { + $pos$1 = $pos$0108;$width$1 = $width$0$lcssa; + break; + } + case 110: { + $120 = ($pos$0108|0)<(0); + $121 = $120 << 31 >> 31; + $122 = ($dest$0|0)==(0|0); + if ($122) { + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + } + switch ($$size$0|0) { + case -2: { + $123 = $pos$0108&255; + HEAP8[$dest$0>>0] = $123; + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + break; + } + case -1: { + $124 = $pos$0108&65535; + HEAP16[$dest$0>>1] = $124; + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + break; + } + case 0: { + HEAP32[$dest$0>>2] = $pos$0108; + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + break; + } + case 1: { + HEAP32[$dest$0>>2] = $pos$0108; + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + break; + } + case 3: { + $125 = $dest$0; + $126 = $125; + HEAP32[$126>>2] = $pos$0108; + $127 = (($125) + 4)|0; + $128 = $127; + HEAP32[$128>>2] = $121; + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + break; + } + default: { + $matches$1 = $matches$0104;$p$11 = $p$5;$pos$2 = $pos$0108;$s$5 = $s$1;$wcs$6 = $wcs$1; + break L8; + } + } + break; + } + default: { + ___shlim($f,0); + while(1) { + $129 = HEAP32[$7>>2]|0; + $130 = HEAP32[$8>>2]|0; + $131 = ($129>>>0)<($130>>>0); + if ($131) { + $132 = ((($129)) + 1|0); + HEAP32[$7>>2] = $132; + $133 = HEAP8[$129>>0]|0; + $134 = $133&255; + $136 = $134; + } else { + $135 = (___shgetc($f)|0); + $136 = $135; + } + $137 = (_isspace($136)|0); + $138 = ($137|0)==(0); + if ($138) { + break; + } + } + $139 = HEAP32[$8>>2]|0; + $140 = ($139|0)==(0|0); + $$pre170 = HEAP32[$7>>2]|0; + if ($140) { + $144 = $$pre170; + } else { + $141 = ((($$pre170)) + -1|0); + HEAP32[$7>>2] = $141; + $144 = $141; + } + $142 = HEAP32[$9>>2]|0; + $143 = HEAP32[$10>>2]|0; + $145 = $144; + $146 = $143; + $147 = (($142) + ($pos$0108))|0; + $148 = (($147) + ($145))|0; + $149 = (($148) - ($146))|0; + $pos$1 = $149;$width$1 = $width$0$lcssa; + } + } + ___shlim($f,$width$1); + $150 = HEAP32[$7>>2]|0; + $151 = HEAP32[$8>>2]|0; + $152 = ($150>>>0)<($151>>>0); + if ($152) { + $153 = ((($150)) + 1|0); + HEAP32[$7>>2] = $153; + $156 = $151; + } else { + $154 = (___shgetc($f)|0); + $155 = ($154|0)<(0); + if ($155) { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1; + label = 152; + break L6; + } + $$pre172 = HEAP32[$8>>2]|0; + $156 = $$pre172; + } + $157 = ($156|0)==(0|0); + if (!($157)) { + $158 = HEAP32[$7>>2]|0; + $159 = ((($158)) + -1|0); + HEAP32[$7>>2] = $159; + } + L67: do { + switch ($$|0) { + case 91: case 99: case 115: { + $160 = ($$|0)==(99); + $161 = $$ & 239; + $162 = ($161|0)==(99); + L69: do { + if ($162) { + $163 = ($$|0)==(115); + _memset(($scanset|0),-1,257)|0; + HEAP8[$scanset>>0] = 0; + if ($163) { + HEAP8[$12>>0] = 0; + ;HEAP8[$11>>0]=0|0;HEAP8[$11+1>>0]=0|0;HEAP8[$11+2>>0]=0|0;HEAP8[$11+3>>0]=0|0;HEAP8[$11+4>>0]=0|0; + $p$9 = $p$5; + } else { + $p$9 = $p$5; + } + } else { + $164 = ((($p$5)) + 1|0); + $165 = HEAP8[$164>>0]|0; + $166 = ($165<<24>>24)==(94); + $167 = ((($p$5)) + 2|0); + $invert$0 = $166&1; + $168 = $166 ? $164 : $p$5; + $p$6 = $166 ? $167 : $164; + $169 = $166&1; + _memset(($scanset|0),($169|0),257)|0; + HEAP8[$scanset>>0] = 0; + $170 = HEAP8[$p$6>>0]|0; + switch ($170<<24>>24) { + case 45: { + $171 = ((($168)) + 2|0); + $172 = $invert$0 ^ 1; + $173 = $172&255; + HEAP8[$14>>0] = $173; + $$pre$phi182Z2D = $173;$p$7$ph = $171; + break; + } + case 93: { + $174 = ((($168)) + 2|0); + $175 = $invert$0 ^ 1; + $176 = $175&255; + HEAP8[$15>>0] = $176; + $$pre$phi182Z2D = $176;$p$7$ph = $174; + break; + } + default: { + $$pre180 = $invert$0 ^ 1; + $$pre181 = $$pre180&255; + $$pre$phi182Z2D = $$pre181;$p$7$ph = $p$6; + } + } + $p$7 = $p$7$ph; + while(1) { + $177 = HEAP8[$p$7>>0]|0; + L80: do { + switch ($177<<24>>24) { + case 0: { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$1;$wcs$7 = $wcs$1; + label = 152; + break L6; + break; + } + case 93: { + $p$9 = $p$7; + break L69; + break; + } + case 45: { + $178 = ((($p$7)) + 1|0); + $179 = HEAP8[$178>>0]|0; + switch ($179<<24>>24) { + case 93: case 0: { + $190 = 45;$p$8 = $p$7; + break L80; + break; + } + default: { + } + } + $180 = ((($p$7)) + -1|0); + $181 = HEAP8[$180>>0]|0; + $182 = ($181&255)<($179&255); + if ($182) { + $183 = $181&255; + $c$0100 = $183; + while(1) { + $184 = (($c$0100) + 1)|0; + $185 = (($scanset) + ($184)|0); + HEAP8[$185>>0] = $$pre$phi182Z2D; + $186 = HEAP8[$178>>0]|0; + $187 = $186&255; + $188 = ($184|0)<($187|0); + if ($188) { + $c$0100 = $184; + } else { + $190 = $186;$p$8 = $178; + break; + } + } + } else { + $190 = $179;$p$8 = $178; + } + break; + } + default: { + $190 = $177;$p$8 = $p$7; + } + } + } while(0); + $189 = $190&255; + $191 = (($189) + 1)|0; + $192 = (($scanset) + ($191)|0); + HEAP8[$192>>0] = $$pre$phi182Z2D; + $193 = ((($p$8)) + 1|0); + $p$7 = $193; + } + } + } while(0); + $194 = (($width$1) + 1)|0; + $195 = $160 ? $194 : 31; + $196 = ($$size$0|0)==(1); + $197 = ($alloc$0|0)!=(0); + L88: do { + if ($196) { + if ($197) { + $198 = $195 << 2; + $199 = (_malloc($198)|0); + $200 = ($199|0)==(0|0); + if ($200) { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $199; + label = 152; + break L6; + } else { + $wcs$2 = $199; + } + } else { + $wcs$2 = $dest$0; + } + HEAP32[$st>>2] = 0; + HEAP32[$13>>2] = 0; + $i$0$ph = 0;$k$0$ph = $195;$wcs$3$ph = $wcs$2; + L94: while(1) { + $201 = ($wcs$3$ph|0)==(0|0); + $i$0$ph20 = $i$0$ph; + while(1) { + L98: while(1) { + $202 = HEAP32[$7>>2]|0; + $203 = HEAP32[$8>>2]|0; + $204 = ($202>>>0)<($203>>>0); + if ($204) { + $205 = ((($202)) + 1|0); + HEAP32[$7>>2] = $205; + $206 = HEAP8[$202>>0]|0; + $207 = $206&255; + $210 = $207; + } else { + $208 = (___shgetc($f)|0); + $210 = $208; + } + $209 = (($210) + 1)|0; + $211 = (($scanset) + ($209)|0); + $212 = HEAP8[$211>>0]|0; + $213 = ($212<<24>>24)==(0); + if ($213) { + $i$0$ph20$lcssa = $i$0$ph20;$wcs$3$ph$lcssa = $wcs$3$ph; + break L94; + } + $214 = $210&255; + HEAP8[$0>>0] = $214; + $215 = (_mbrtowc($wc,$0,1,$st)|0); + switch ($215|0) { + case -1: { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph; + label = 152; + break L6; + break; + } + case -2: { + break; + } + default: { + break L98; + } + } + } + if ($201) { + $i$1 = $i$0$ph20; + } else { + $216 = HEAP32[$wc>>2]|0; + $217 = (($i$0$ph20) + 1)|0; + $218 = (($wcs$3$ph) + ($i$0$ph20<<2)|0); + HEAP32[$218>>2] = $216; + $i$1 = $217; + } + $219 = ($i$1|0)==($k$0$ph|0); + $or$cond = $197 & $219; + if ($or$cond) { + break; + } else { + $i$0$ph20 = $i$1; + } + } + $factor = $k$0$ph << 1; + $220 = $factor | 1; + $221 = $220 << 2; + $222 = (_realloc($wcs$3$ph,$221)|0); + $223 = ($222|0)==(0|0); + if ($223) { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph; + label = 152; + break L6; + } + $i$0$ph$phi = $k$0$ph;$k$0$ph = $220;$wcs$3$ph = $222;$i$0$ph = $i$0$ph$phi; + } + $224 = (_mbsinit($st)|0); + $225 = ($224|0)==(0); + if ($225) { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = $wcs$3$ph$lcssa; + label = 152; + break L6; + } else { + $i$4 = $i$0$ph20$lcssa;$s$3 = 0;$wcs$4 = $wcs$3$ph$lcssa; + } + } else { + if ($197) { + $226 = (_malloc($195)|0); + $227 = ($226|0)==(0|0); + if ($227) { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = 0;$wcs$7 = 0; + label = 152; + break L6; + } else { + $i$2$ph = 0;$k$1$ph = $195;$s$2$ph = $226; + } + while(1) { + $i$2 = $i$2$ph; + while(1) { + $228 = HEAP32[$7>>2]|0; + $229 = HEAP32[$8>>2]|0; + $230 = ($228>>>0)<($229>>>0); + if ($230) { + $231 = ((($228)) + 1|0); + HEAP32[$7>>2] = $231; + $232 = HEAP8[$228>>0]|0; + $233 = $232&255; + $236 = $233; + } else { + $234 = (___shgetc($f)|0); + $236 = $234; + } + $235 = (($236) + 1)|0; + $237 = (($scanset) + ($235)|0); + $238 = HEAP8[$237>>0]|0; + $239 = ($238<<24>>24)==(0); + if ($239) { + $i$4 = $i$2;$s$3 = $s$2$ph;$wcs$4 = 0; + break L88; + } + $240 = $236&255; + $241 = (($i$2) + 1)|0; + $242 = (($s$2$ph) + ($i$2)|0); + HEAP8[$242>>0] = $240; + $243 = ($241|0)==($k$1$ph|0); + if ($243) { + break; + } else { + $i$2 = $241; + } + } + $factor16 = $k$1$ph << 1; + $244 = $factor16 | 1; + $245 = (_realloc($s$2$ph,$244)|0); + $246 = ($245|0)==(0|0); + if ($246) { + $alloc$0400 = $alloc$0;$matches$0104376 = $matches$0104;$s$6 = $s$2$ph;$wcs$7 = 0; + label = 152; + break L6; + } else { + $i$2$ph$phi = $k$1$ph;$k$1$ph = $244;$s$2$ph = $245;$i$2$ph = $i$2$ph$phi; + } + } + } + $247 = ($dest$0|0)==(0|0); + if ($247) { + $265 = $156; + while(1) { + $263 = HEAP32[$7>>2]|0; + $264 = ($263>>>0)<($265>>>0); + if ($264) { + $266 = ((($263)) + 1|0); + HEAP32[$7>>2] = $266; + $267 = HEAP8[$263>>0]|0; + $268 = $267&255; + $271 = $268; + } else { + $269 = (___shgetc($f)|0); + $271 = $269; + } + $270 = (($271) + 1)|0; + $272 = (($scanset) + ($270)|0); + $273 = HEAP8[$272>>0]|0; + $274 = ($273<<24>>24)==(0); + if ($274) { + $i$4 = 0;$s$3 = 0;$wcs$4 = 0; + break L88; + } + $$pre176 = HEAP32[$8>>2]|0; + $265 = $$pre176; + } + } else { + $250 = $156;$i$3 = 0; + while(1) { + $248 = HEAP32[$7>>2]|0; + $249 = ($248>>>0)<($250>>>0); + if ($249) { + $251 = ((($248)) + 1|0); + HEAP32[$7>>2] = $251; + $252 = HEAP8[$248>>0]|0; + $253 = $252&255; + $256 = $253; + } else { + $254 = (___shgetc($f)|0); + $256 = $254; + } + $255 = (($256) + 1)|0; + $257 = (($scanset) + ($255)|0); + $258 = HEAP8[$257>>0]|0; + $259 = ($258<<24>>24)==(0); + if ($259) { + $i$4 = $i$3;$s$3 = $dest$0;$wcs$4 = 0; + break L88; + } + $260 = $256&255; + $261 = (($i$3) + 1)|0; + $262 = (($dest$0) + ($i$3)|0); + HEAP8[$262>>0] = $260; + $$pre174 = HEAP32[$8>>2]|0; + $250 = $$pre174;$i$3 = $261; + } + } + } + } while(0); + $275 = HEAP32[$8>>2]|0; + $276 = ($275|0)==(0|0); + $$pre178 = HEAP32[$7>>2]|0; + if ($276) { + $280 = $$pre178; + } else { + $277 = ((($$pre178)) + -1|0); + HEAP32[$7>>2] = $277; + $280 = $277; + } + $278 = HEAP32[$9>>2]|0; + $279 = HEAP32[$10>>2]|0; + $281 = $280; + $282 = $279; + $283 = (($281) - ($282))|0; + $284 = (($283) + ($278))|0; + $285 = ($284|0)==(0); + if ($285) { + $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4; + break L6; + } + $$not = $160 ^ 1; + $286 = ($284|0)==($width$1|0); + $or$cond8 = $286 | $$not; + if (!($or$cond8)) { + $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$3;$wcs$9 = $wcs$4; + break L6; + } + do { + if ($197) { + if ($196) { + HEAP32[$dest$0>>2] = $wcs$4; + break; + } else { + HEAP32[$dest$0>>2] = $s$3; + break; + } + } + } while(0); + if ($160) { + $p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4; + } else { + $287 = ($wcs$4|0)==(0|0); + if (!($287)) { + $288 = (($wcs$4) + ($i$4<<2)|0); + HEAP32[$288>>2] = 0; + } + $289 = ($s$3|0)==(0|0); + if ($289) { + $p$10 = $p$9;$s$4 = 0;$wcs$5 = $wcs$4; + break L67; + } + $290 = (($s$3) + ($i$4)|0); + HEAP8[$290>>0] = 0; + $p$10 = $p$9;$s$4 = $s$3;$wcs$5 = $wcs$4; + } + break; + } + case 120: case 88: case 112: { + $base$0 = 16; + label = 134; + break; + } + case 111: { + $base$0 = 8; + label = 134; + break; + } + case 117: case 100: { + $base$0 = 10; + label = 134; + break; + } + case 105: { + $base$0 = 0; + label = 134; + break; + } + case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97: { + $310 = (+___floatscan($f,$$size$0,0)); + $311 = HEAP32[$9>>2]|0; + $312 = HEAP32[$7>>2]|0; + $313 = HEAP32[$10>>2]|0; + $314 = $312; + $315 = $313; + $316 = (($315) - ($314))|0; + $317 = ($311|0)==($316|0); + if ($317) { + $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1; + break L6; + } + $318 = ($dest$0|0)==(0|0); + if ($318) { + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + } else { + switch ($$size$0|0) { + case 0: { + $319 = $310; + HEAPF32[$dest$0>>2] = $319; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L67; + break; + } + case 1: { + HEAPF64[$dest$0>>3] = $310; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L67; + break; + } + case 2: { + HEAPF64[$dest$0>>3] = $310; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L67; + break; + } + default: { + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L67; + } + } + } + break; + } + default: { + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + } + } + } while(0); + L168: do { + if ((label|0) == 134) { + label = 0; + $291 = (___intscan($f,$base$0,0,-1,-1)|0); + $292 = tempRet0; + $293 = HEAP32[$9>>2]|0; + $294 = HEAP32[$7>>2]|0; + $295 = HEAP32[$10>>2]|0; + $296 = $294; + $297 = $295; + $298 = (($297) - ($296))|0; + $299 = ($293|0)==($298|0); + if ($299) { + $alloc$2 = $alloc$0;$matches$2 = $matches$0104;$s$8 = $s$1;$wcs$9 = $wcs$1; + break L6; + } + $300 = ($$|0)==(112); + $301 = ($dest$0|0)!=(0|0); + $or$cond3 = $301 & $300; + if ($or$cond3) { + $302 = $291; + HEAP32[$dest$0>>2] = $302; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break; + } + $303 = ($dest$0|0)==(0|0); + if ($303) { + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + } else { + switch ($$size$0|0) { + case -2: { + $304 = $291&255; + HEAP8[$dest$0>>0] = $304; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L168; + break; + } + case -1: { + $305 = $291&65535; + HEAP16[$dest$0>>1] = $305; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L168; + break; + } + case 0: { + HEAP32[$dest$0>>2] = $291; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L168; + break; + } + case 1: { + HEAP32[$dest$0>>2] = $291; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L168; + break; + } + case 3: { + $306 = $dest$0; + $307 = $306; + HEAP32[$307>>2] = $291; + $308 = (($306) + 4)|0; + $309 = $308; + HEAP32[$309>>2] = $292; + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L168; + break; + } + default: { + $p$10 = $p$5;$s$4 = $s$1;$wcs$5 = $wcs$1; + break L168; + } + } + } + } + } while(0); + $320 = HEAP32[$9>>2]|0; + $321 = HEAP32[$7>>2]|0; + $322 = HEAP32[$10>>2]|0; + $323 = $321; + $324 = $322; + $325 = (($320) + ($pos$1))|0; + $326 = (($325) + ($323))|0; + $327 = (($326) - ($324))|0; + $not$ = ($dest$0|0)!=(0|0); + $328 = $not$&1; + $matches$0$ = (($328) + ($matches$0104))|0; + $matches$1 = $matches$0$;$p$11 = $p$10;$pos$2 = $327;$s$5 = $s$4;$wcs$6 = $wcs$5; + break L8; + } + } while(0); + $50 = $47&1; + $51 = (($p$0109) + ($50)|0); + ___shlim($f,0); + $52 = HEAP32[$7>>2]|0; + $53 = HEAP32[$8>>2]|0; + $54 = ($52>>>0)<($53>>>0); + if ($54) { + $55 = ((($52)) + 1|0); + HEAP32[$7>>2] = $55; + $56 = HEAP8[$52>>0]|0; + $57 = $56&255; + $61 = $57; + } else { + $58 = (___shgetc($f)|0); + $61 = $58; + } + $59 = HEAP8[$51>>0]|0; + $60 = $59&255; + $62 = ($61|0)==($60|0); + if (!($62)) { + $$lcssa384 = $61;$matches$0104$lcssa = $matches$0104;$s$0107$lcssa = $s$0107;$wcs$0103$lcssa = $wcs$0103; + label = 21; + break L6; + } + $69 = (($pos$0108) + 1)|0; + $matches$1 = $matches$0104;$p$11 = $51;$pos$2 = $69;$s$5 = $s$0107;$wcs$6 = $wcs$0103; + } else { + $p$1 = $p$0109; + while(1) { + $20 = ((($p$1)) + 1|0); + $21 = HEAP8[$20>>0]|0; + $22 = $21&255; + $23 = (_isspace($22)|0); + $24 = ($23|0)==(0); + if ($24) { + $p$1$lcssa = $p$1; + break; + } else { + $p$1 = $20; + } + } + ___shlim($f,0); + while(1) { + $25 = HEAP32[$7>>2]|0; + $26 = HEAP32[$8>>2]|0; + $27 = ($25>>>0)<($26>>>0); + if ($27) { + $28 = ((($25)) + 1|0); + HEAP32[$7>>2] = $28; + $29 = HEAP8[$25>>0]|0; + $30 = $29&255; + $32 = $30; + } else { + $31 = (___shgetc($f)|0); + $32 = $31; + } + $33 = (_isspace($32)|0); + $34 = ($33|0)==(0); + if ($34) { + break; + } + } + $35 = HEAP32[$8>>2]|0; + $36 = ($35|0)==(0|0); + $$pre = HEAP32[$7>>2]|0; + if ($36) { + $40 = $$pre; + } else { + $37 = ((($$pre)) + -1|0); + HEAP32[$7>>2] = $37; + $40 = $37; + } + $38 = HEAP32[$9>>2]|0; + $39 = HEAP32[$10>>2]|0; + $41 = $40; + $42 = $39; + $43 = (($38) + ($pos$0108))|0; + $44 = (($43) + ($41))|0; + $45 = (($44) - ($42))|0; + $matches$1 = $matches$0104;$p$11 = $p$1$lcssa;$pos$2 = $45;$s$5 = $s$0107;$wcs$6 = $wcs$0103; + } + } while(0); + $329 = ((($p$11)) + 1|0); + $330 = HEAP8[$329>>0]|0; + $331 = ($330<<24>>24)==(0); + if ($331) { + $matches$3 = $matches$1; + break L4; + } else { + $17 = $330;$matches$0104 = $matches$1;$p$0109 = $329;$pos$0108 = $pos$2;$s$0107 = $s$5;$wcs$0103 = $wcs$6; + } + } + if ((label|0) == 21) { + $63 = HEAP32[$8>>2]|0; + $64 = ($63|0)==(0|0); + if (!($64)) { + $65 = HEAP32[$7>>2]|0; + $66 = ((($65)) + -1|0); + HEAP32[$7>>2] = $66; + } + $67 = ($$lcssa384|0)>(-1); + $68 = ($matches$0104$lcssa|0)!=(0); + $or$cond5 = $68 | $67; + if ($or$cond5) { + $matches$3 = $matches$0104$lcssa; + break; + } else { + $alloc$1 = 0;$s$7 = $s$0107$lcssa;$wcs$8 = $wcs$0103$lcssa; + label = 153; + } + } + else if ((label|0) == 152) { + $$old4 = ($matches$0104376|0)==(0); + if ($$old4) { + $alloc$1 = $alloc$0400;$s$7 = $s$6;$wcs$8 = $wcs$7; + label = 153; + } else { + $alloc$2 = $alloc$0400;$matches$2 = $matches$0104376;$s$8 = $s$6;$wcs$9 = $wcs$7; + } + } + if ((label|0) == 153) { + $alloc$2 = $alloc$1;$matches$2 = -1;$s$8 = $s$7;$wcs$9 = $wcs$8; + } + $332 = ($alloc$2|0)==(0); + if ($332) { + $matches$3 = $matches$2; + } else { + _free($s$8); + _free($wcs$9); + $matches$3 = $matches$2; + } + } + } while(0); + $334 = ($333|0)==(0); + if (!($334)) { + ___unlockfile($f); + } + STACKTOP = sp;return ($matches$3|0); +} +function _vsnprintf($s,$n,$fmt,$ap) { + $s = $s|0; + $n = $n|0; + $fmt = $fmt|0; + $ap = $ap|0; + var $$$02 = 0, $$0 = 0, $$01 = 0, $$02 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $b = 0, $f = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 128|0; + $b = sp + 112|0; + $f = sp; + dest=$f; src=6724; stop=dest+112|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0)); + $0 = (($n) + -1)|0; + $1 = ($0>>>0)>(2147483646); + if ($1) { + $2 = ($n|0)==(0); + if ($2) { + $$01 = $b;$$02 = 1; + label = 4; + } else { + $3 = (___errno_location()|0); + HEAP32[$3>>2] = 75; + $$0 = -1; + } + } else { + $$01 = $s;$$02 = $n; + label = 4; + } + if ((label|0) == 4) { + $4 = $$01; + $5 = (-2 - ($4))|0; + $6 = ($$02>>>0)>($5>>>0); + $$$02 = $6 ? $5 : $$02; + $7 = ((($f)) + 48|0); + HEAP32[$7>>2] = $$$02; + $8 = ((($f)) + 20|0); + HEAP32[$8>>2] = $$01; + $9 = ((($f)) + 44|0); + HEAP32[$9>>2] = $$01; + $10 = (($$01) + ($$$02)|0); + $11 = ((($f)) + 16|0); + HEAP32[$11>>2] = $10; + $12 = ((($f)) + 28|0); + HEAP32[$12>>2] = $10; + $13 = (_vfprintf($f,$fmt,$ap)|0); + $14 = ($$$02|0)==(0); + if ($14) { + $$0 = $13; + } else { + $15 = HEAP32[$8>>2]|0; + $16 = HEAP32[$11>>2]|0; + $17 = ($15|0)==($16|0); + $18 = $17 << 31 >> 31; + $19 = (($15) + ($18)|0); + HEAP8[$19>>0] = 0; + $$0 = $13; + } + } + STACKTOP = sp;return ($$0|0); +} +function _vsprintf($s,$fmt,$ap) { + $s = $s|0; + $fmt = $fmt|0; + $ap = $ap|0; + var $0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_vsnprintf($s,2147483647,$fmt,$ap)|0); + return ($0|0); +} +function ___fdopen($fd,$mode) { + $fd = $fd|0; + $mode = $mode|0; + var $$0 = 0, $$pre = 0, $$pre1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; + var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $tio = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0; + var sp = 0, stop = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 112|0; + $vararg_buffer12 = sp + 40|0; + $vararg_buffer7 = sp + 24|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer = sp; + $tio = sp + 52|0; + $0 = HEAP8[$mode>>0]|0; + $1 = $0 << 24 >> 24; + $memchr = (_memchr(22738,$1,4)|0); + $2 = ($memchr|0)==(0|0); + if ($2) { + $3 = (___errno_location()|0); + HEAP32[$3>>2] = 22; + $$0 = 0; + } else { + $4 = (_malloc(1144)|0); + $5 = ($4|0)==(0|0); + if ($5) { + $$0 = 0; + } else { + dest=$4; stop=dest+112|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0)); + $6 = (_strchr($mode,43)|0); + $7 = ($6|0)==(0|0); + if ($7) { + $8 = ($0<<24>>24)==(114); + $9 = $8 ? 8 : 4; + HEAP32[$4>>2] = $9; + } + $10 = (_strchr($mode,101)|0); + $11 = ($10|0)==(0|0); + if ($11) { + $12 = $0; + } else { + HEAP32[$vararg_buffer>>2] = $fd; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = 2; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = 1; + (___syscall221(221,($vararg_buffer|0))|0); + $$pre = HEAP8[$mode>>0]|0; + $12 = $$pre; + } + $13 = ($12<<24>>24)==(97); + if ($13) { + HEAP32[$vararg_buffer3>>2] = $fd; + $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); + HEAP32[$vararg_ptr6>>2] = 3; + $14 = (___syscall221(221,($vararg_buffer3|0))|0); + $15 = $14 & 1024; + $16 = ($15|0)==(0); + if ($16) { + $17 = $14 | 1024; + HEAP32[$vararg_buffer7>>2] = $fd; + $vararg_ptr10 = ((($vararg_buffer7)) + 4|0); + HEAP32[$vararg_ptr10>>2] = 4; + $vararg_ptr11 = ((($vararg_buffer7)) + 8|0); + HEAP32[$vararg_ptr11>>2] = $17; + (___syscall221(221,($vararg_buffer7|0))|0); + } + $18 = HEAP32[$4>>2]|0; + $19 = $18 | 128; + HEAP32[$4>>2] = $19; + $26 = $19; + } else { + $$pre1 = HEAP32[$4>>2]|0; + $26 = $$pre1; + } + $20 = ((($4)) + 60|0); + HEAP32[$20>>2] = $fd; + $21 = ((($4)) + 120|0); + $22 = ((($4)) + 44|0); + HEAP32[$22>>2] = $21; + $23 = ((($4)) + 48|0); + HEAP32[$23>>2] = 1024; + $24 = ((($4)) + 75|0); + HEAP8[$24>>0] = -1; + $25 = $26 & 8; + $27 = ($25|0)==(0); + if ($27) { + HEAP32[$vararg_buffer12>>2] = $fd; + $vararg_ptr15 = ((($vararg_buffer12)) + 4|0); + HEAP32[$vararg_ptr15>>2] = 21505; + $vararg_ptr16 = ((($vararg_buffer12)) + 8|0); + HEAP32[$vararg_ptr16>>2] = $tio; + $28 = (___syscall54(54,($vararg_buffer12|0))|0); + $29 = ($28|0)==(0); + if ($29) { + HEAP8[$24>>0] = 10; + } + } + $30 = ((($4)) + 32|0); + HEAP32[$30>>2] = 7; + $31 = ((($4)) + 36|0); + HEAP32[$31>>2] = 8; + $32 = ((($4)) + 40|0); + HEAP32[$32>>2] = 4; + $33 = ((($4)) + 12|0); + HEAP32[$33>>2] = 2; + $34 = HEAP32[(6432)>>2]|0; + $35 = ($34|0)==(0); + if ($35) { + $36 = ((($4)) + 76|0); + HEAP32[$36>>2] = -1; + } + ___lock(((6456)|0)); + $37 = HEAP32[(6452)>>2]|0; + $38 = ((($4)) + 56|0); + HEAP32[$38>>2] = $37; + $39 = ($37|0)==(0); + if (!($39)) { + $40 = $37; + $41 = ((($40)) + 52|0); + HEAP32[$41>>2] = $4; + } + HEAP32[(6452)>>2] = $4; + ___unlock(((6456)|0)); + $$0 = $4; + } + } + STACKTOP = sp;return ($$0|0); +} +function ___fmodeflags($mode) { + $mode = $mode|0; + var $$ = 0, $$flags$4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $flags$0 = 0, $flags$0$ = 0, $flags$2 = 0; + var $flags$2$ = 0, $flags$4 = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_strchr($mode,43)|0); + $1 = ($0|0)==(0|0); + $2 = HEAP8[$mode>>0]|0; + $not$ = ($2<<24>>24)!=(114); + $$ = $not$&1; + $flags$0 = $1 ? $$ : 2; + $3 = (_strchr($mode,120)|0); + $4 = ($3|0)==(0|0); + $5 = $flags$0 | 128; + $flags$0$ = $4 ? $flags$0 : $5; + $6 = (_strchr($mode,101)|0); + $7 = ($6|0)==(0|0); + $8 = $flags$0$ | 524288; + $flags$2 = $7 ? $flags$0$ : $8; + $9 = ($2<<24>>24)==(114); + $10 = $flags$2 | 64; + $flags$2$ = $9 ? $flags$2 : $10; + $11 = ($2<<24>>24)==(119); + $12 = $flags$2$ | 512; + $flags$4 = $11 ? $12 : $flags$2$; + $13 = ($2<<24>>24)==(97); + $14 = $flags$4 | 1024; + $$flags$4 = $13 ? $14 : $flags$4; + return ($$flags$4|0); +} +function ___lockfile($f) { + $f = $f|0; + var label = 0, sp = 0; + sp = STACKTOP; + return 0; +} +function ___unlockfile($f) { + $f = $f|0; + var label = 0, sp = 0; + sp = STACKTOP; + return; +} +function ___overflow($f,$_c) { + $f = $f|0; + $_c = $_c|0; + var $$0 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $c = sp; + $0 = $_c&255; + HEAP8[$c>>0] = $0; + $1 = ((($f)) + 16|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)==(0|0); + if ($3) { + $4 = (___towrite($f)|0); + $5 = ($4|0)==(0); + if ($5) { + $$pre = HEAP32[$1>>2]|0; + $9 = $$pre; + label = 4; + } else { + $$0 = -1; + } + } else { + $9 = $2; + label = 4; + } + do { + if ((label|0) == 4) { + $6 = ((($f)) + 20|0); + $7 = HEAP32[$6>>2]|0; + $8 = ($7>>>0)<($9>>>0); + if ($8) { + $10 = $_c & 255; + $11 = ((($f)) + 75|0); + $12 = HEAP8[$11>>0]|0; + $13 = $12 << 24 >> 24; + $14 = ($10|0)==($13|0); + if (!($14)) { + $15 = ((($7)) + 1|0); + HEAP32[$6>>2] = $15; + HEAP8[$7>>0] = $0; + $$0 = $10; + break; + } + } + $16 = ((($f)) + 36|0); + $17 = HEAP32[$16>>2]|0; + $18 = (FUNCTION_TABLE_iiii[$17 & 15]($f,$c,1)|0); + $19 = ($18|0)==(1); + if ($19) { + $20 = HEAP8[$c>>0]|0; + $21 = $20&255; + $$0 = $21; + } else { + $$0 = -1; + } + } + } while(0); + STACKTOP = sp;return ($$0|0); +} +function ___stdio_close($f) { + $f = $f|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $vararg_buffer = sp; + $0 = ((($f)) + 60|0); + $1 = HEAP32[$0>>2]|0; + HEAP32[$vararg_buffer>>2] = $1; + $2 = (___syscall6(6,($vararg_buffer|0))|0); + $3 = (___syscall_ret($2)|0); + STACKTOP = sp;return ($3|0); +} +function ___stdio_read($f,$buf,$len) { + $f = $f|0; + $buf = $buf|0; + $len = $len|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0; + var $8 = 0, $9 = 0, $cnt$0 = 0, $iov = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 48|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer = sp; + $iov = sp + 32|0; + HEAP32[$iov>>2] = $buf; + $0 = ((($iov)) + 4|0); + $1 = ((($f)) + 48|0); + $2 = HEAP32[$1>>2]|0; + $3 = ($2|0)!=(0); + $4 = $3&1; + $5 = (($len) - ($4))|0; + HEAP32[$0>>2] = $5; + $6 = ((($iov)) + 8|0); + $7 = ((($f)) + 44|0); + $8 = HEAP32[$7>>2]|0; + HEAP32[$6>>2] = $8; + $9 = ((($iov)) + 12|0); + HEAP32[$9>>2] = $2; + $10 = HEAP32[6428>>2]|0; + $11 = ($10|0)==(0|0); + if ($11) { + $16 = ((($f)) + 60|0); + $17 = HEAP32[$16>>2]|0; + HEAP32[$vararg_buffer3>>2] = $17; + $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); + HEAP32[$vararg_ptr6>>2] = $iov; + $vararg_ptr7 = ((($vararg_buffer3)) + 8|0); + HEAP32[$vararg_ptr7>>2] = 2; + $18 = (___syscall145(145,($vararg_buffer3|0))|0); + $19 = (___syscall_ret($18)|0); + $cnt$0 = $19; + } else { + _pthread_cleanup_push((27|0),($f|0)); + $12 = ((($f)) + 60|0); + $13 = HEAP32[$12>>2]|0; + HEAP32[$vararg_buffer>>2] = $13; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $iov; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = 2; + $14 = (___syscall145(145,($vararg_buffer|0))|0); + $15 = (___syscall_ret($14)|0); + _pthread_cleanup_pop(0); + $cnt$0 = $15; + } + $20 = ($cnt$0|0)<(1); + if ($20) { + $21 = $cnt$0 & 48; + $22 = $21 ^ 16; + $23 = HEAP32[$f>>2]|0; + $24 = $23 | $22; + HEAP32[$f>>2] = $24; + $25 = ((($f)) + 8|0); + HEAP32[$25>>2] = 0; + $26 = ((($f)) + 4|0); + HEAP32[$26>>2] = 0; + $$0 = $cnt$0; + } else { + $27 = HEAP32[$0>>2]|0; + $28 = ($cnt$0>>>0)>($27>>>0); + if ($28) { + $29 = (($cnt$0) - ($27))|0; + $30 = HEAP32[$7>>2]|0; + $31 = ((($f)) + 4|0); + HEAP32[$31>>2] = $30; + $32 = $30; + $33 = (($32) + ($29)|0); + $34 = ((($f)) + 8|0); + HEAP32[$34>>2] = $33; + $35 = HEAP32[$1>>2]|0; + $36 = ($35|0)==(0); + if ($36) { + $$0 = $len; + } else { + $37 = ((($32)) + 1|0); + HEAP32[$31>>2] = $37; + $38 = HEAP8[$32>>0]|0; + $39 = (($len) + -1)|0; + $40 = (($buf) + ($39)|0); + HEAP8[$40>>0] = $38; + $$0 = $len; + } + } else { + $$0 = $cnt$0; + } + } + STACKTOP = sp;return ($$0|0); +} +function ___stdio_seek($f,$off,$whence) { + $f = $f|0; + $off = $off|0; + $whence = $whence|0; + var $$pre = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $ret = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $vararg_buffer = sp; + $ret = sp + 20|0; + $0 = ((($f)) + 60|0); + $1 = HEAP32[$0>>2]|0; + HEAP32[$vararg_buffer>>2] = $1; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = 0; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = $off; + $vararg_ptr3 = ((($vararg_buffer)) + 12|0); + HEAP32[$vararg_ptr3>>2] = $ret; + $vararg_ptr4 = ((($vararg_buffer)) + 16|0); + HEAP32[$vararg_ptr4>>2] = $whence; + $2 = (___syscall140(140,($vararg_buffer|0))|0); + $3 = (___syscall_ret($2)|0); + $4 = ($3|0)<(0); + if ($4) { + HEAP32[$ret>>2] = -1; + $5 = -1; + } else { + $$pre = HEAP32[$ret>>2]|0; + $5 = $$pre; + } + STACKTOP = sp;return ($5|0); +} +function ___stdio_write($f,$buf,$len) { + $f = $f|0; + $buf = $buf|0; + $len = $len|0; + var $$0 = 0, $$phi$trans$insert = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0; + var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; + var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $cnt$0 = 0, $cnt$1 = 0, $iov$0 = 0, $iov$0$lcssa11 = 0, $iov$1 = 0, $iovcnt$0 = 0; + var $iovcnt$0$lcssa12 = 0, $iovcnt$1 = 0, $iovs = 0, $rem$0 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 48|0; + $vararg_buffer3 = sp + 16|0; + $vararg_buffer = sp; + $iovs = sp + 32|0; + $0 = ((($f)) + 28|0); + $1 = HEAP32[$0>>2]|0; + HEAP32[$iovs>>2] = $1; + $2 = ((($iovs)) + 4|0); + $3 = ((($f)) + 20|0); + $4 = HEAP32[$3>>2]|0; + $5 = $4; + $6 = (($5) - ($1))|0; + HEAP32[$2>>2] = $6; + $7 = ((($iovs)) + 8|0); + HEAP32[$7>>2] = $buf; + $8 = ((($iovs)) + 12|0); + HEAP32[$8>>2] = $len; + $9 = (($6) + ($len))|0; + $10 = ((($f)) + 60|0); + $11 = ((($f)) + 44|0); + $iov$0 = $iovs;$iovcnt$0 = 2;$rem$0 = $9; + while(1) { + $12 = HEAP32[6428>>2]|0; + $13 = ($12|0)==(0|0); + if ($13) { + $17 = HEAP32[$10>>2]|0; + HEAP32[$vararg_buffer3>>2] = $17; + $vararg_ptr6 = ((($vararg_buffer3)) + 4|0); + HEAP32[$vararg_ptr6>>2] = $iov$0; + $vararg_ptr7 = ((($vararg_buffer3)) + 8|0); + HEAP32[$vararg_ptr7>>2] = $iovcnt$0; + $18 = (___syscall146(146,($vararg_buffer3|0))|0); + $19 = (___syscall_ret($18)|0); + $cnt$0 = $19; + } else { + _pthread_cleanup_push((28|0),($f|0)); + $14 = HEAP32[$10>>2]|0; + HEAP32[$vararg_buffer>>2] = $14; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = $iov$0; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = $iovcnt$0; + $15 = (___syscall146(146,($vararg_buffer|0))|0); + $16 = (___syscall_ret($15)|0); + _pthread_cleanup_pop(0); + $cnt$0 = $16; + } + $20 = ($rem$0|0)==($cnt$0|0); + if ($20) { + label = 6; + break; + } + $27 = ($cnt$0|0)<(0); + if ($27) { + $iov$0$lcssa11 = $iov$0;$iovcnt$0$lcssa12 = $iovcnt$0; + label = 8; + break; + } + $35 = (($rem$0) - ($cnt$0))|0; + $36 = ((($iov$0)) + 4|0); + $37 = HEAP32[$36>>2]|0; + $38 = ($cnt$0>>>0)>($37>>>0); + if ($38) { + $39 = HEAP32[$11>>2]|0; + HEAP32[$0>>2] = $39; + HEAP32[$3>>2] = $39; + $40 = (($cnt$0) - ($37))|0; + $41 = ((($iov$0)) + 8|0); + $42 = (($iovcnt$0) + -1)|0; + $$phi$trans$insert = ((($iov$0)) + 12|0); + $$pre = HEAP32[$$phi$trans$insert>>2]|0; + $50 = $$pre;$cnt$1 = $40;$iov$1 = $41;$iovcnt$1 = $42; + } else { + $43 = ($iovcnt$0|0)==(2); + if ($43) { + $44 = HEAP32[$0>>2]|0; + $45 = (($44) + ($cnt$0)|0); + HEAP32[$0>>2] = $45; + $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = 2; + } else { + $50 = $37;$cnt$1 = $cnt$0;$iov$1 = $iov$0;$iovcnt$1 = $iovcnt$0; + } + } + $46 = HEAP32[$iov$1>>2]|0; + $47 = (($46) + ($cnt$1)|0); + HEAP32[$iov$1>>2] = $47; + $48 = ((($iov$1)) + 4|0); + $49 = (($50) - ($cnt$1))|0; + HEAP32[$48>>2] = $49; + $iov$0 = $iov$1;$iovcnt$0 = $iovcnt$1;$rem$0 = $35; + } + if ((label|0) == 6) { + $21 = HEAP32[$11>>2]|0; + $22 = ((($f)) + 48|0); + $23 = HEAP32[$22>>2]|0; + $24 = (($21) + ($23)|0); + $25 = ((($f)) + 16|0); + HEAP32[$25>>2] = $24; + $26 = $21; + HEAP32[$0>>2] = $26; + HEAP32[$3>>2] = $26; + $$0 = $len; + } + else if ((label|0) == 8) { + $28 = ((($f)) + 16|0); + HEAP32[$28>>2] = 0; + HEAP32[$0>>2] = 0; + HEAP32[$3>>2] = 0; + $29 = HEAP32[$f>>2]|0; + $30 = $29 | 32; + HEAP32[$f>>2] = $30; + $31 = ($iovcnt$0$lcssa12|0)==(2); + if ($31) { + $$0 = 0; + } else { + $32 = ((($iov$0$lcssa11)) + 4|0); + $33 = HEAP32[$32>>2]|0; + $34 = (($len) - ($33))|0; + $$0 = $34; + } + } + STACKTOP = sp;return ($$0|0); +} +function ___stdout_write($f,$buf,$len) { + $f = $f|0; + $buf = $buf|0; + $len = $len|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tio = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 80|0; + $vararg_buffer = sp; + $tio = sp + 12|0; + $0 = ((($f)) + 36|0); + HEAP32[$0>>2] = 8; + $1 = HEAP32[$f>>2]|0; + $2 = $1 & 64; + $3 = ($2|0)==(0); + if ($3) { + $4 = ((($f)) + 60|0); + $5 = HEAP32[$4>>2]|0; + HEAP32[$vararg_buffer>>2] = $5; + $vararg_ptr1 = ((($vararg_buffer)) + 4|0); + HEAP32[$vararg_ptr1>>2] = 21505; + $vararg_ptr2 = ((($vararg_buffer)) + 8|0); + HEAP32[$vararg_ptr2>>2] = $tio; + $6 = (___syscall54(54,($vararg_buffer|0))|0); + $7 = ($6|0)==(0); + if (!($7)) { + $8 = ((($f)) + 75|0); + HEAP8[$8>>0] = -1; + } + } + $9 = (___stdio_write($f,$buf,$len)|0); + STACKTOP = sp;return ($9|0); +} +function ___toread($f) { + $f = $f|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 74|0); + $1 = HEAP8[$0>>0]|0; + $2 = $1 << 24 >> 24; + $3 = (($2) + 255)|0; + $4 = $3 | $2; + $5 = $4&255; + HEAP8[$0>>0] = $5; + $6 = ((($f)) + 20|0); + $7 = HEAP32[$6>>2]|0; + $8 = ((($f)) + 44|0); + $9 = HEAP32[$8>>2]|0; + $10 = ($7>>>0)>($9>>>0); + if ($10) { + $11 = ((($f)) + 36|0); + $12 = HEAP32[$11>>2]|0; + (FUNCTION_TABLE_iiii[$12 & 15]($f,0,0)|0); + } + $13 = ((($f)) + 16|0); + HEAP32[$13>>2] = 0; + $14 = ((($f)) + 28|0); + HEAP32[$14>>2] = 0; + HEAP32[$6>>2] = 0; + $15 = HEAP32[$f>>2]|0; + $16 = $15 & 20; + $17 = ($16|0)==(0); + if ($17) { + $21 = HEAP32[$8>>2]|0; + $22 = ((($f)) + 8|0); + HEAP32[$22>>2] = $21; + $23 = ((($f)) + 4|0); + HEAP32[$23>>2] = $21; + $$0 = 0; + } else { + $18 = $15 & 4; + $19 = ($18|0)==(0); + if ($19) { + $$0 = -1; + } else { + $20 = $15 | 32; + HEAP32[$f>>2] = $20; + $$0 = -1; + } + } + return ($$0|0); +} +function ___towrite($f) { + $f = $f|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; + var $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 74|0); + $1 = HEAP8[$0>>0]|0; + $2 = $1 << 24 >> 24; + $3 = (($2) + 255)|0; + $4 = $3 | $2; + $5 = $4&255; + HEAP8[$0>>0] = $5; + $6 = HEAP32[$f>>2]|0; + $7 = $6 & 8; + $8 = ($7|0)==(0); + if ($8) { + $10 = ((($f)) + 8|0); + HEAP32[$10>>2] = 0; + $11 = ((($f)) + 4|0); + HEAP32[$11>>2] = 0; + $12 = ((($f)) + 44|0); + $13 = HEAP32[$12>>2]|0; + $14 = ((($f)) + 28|0); + HEAP32[$14>>2] = $13; + $15 = ((($f)) + 20|0); + HEAP32[$15>>2] = $13; + $16 = $13; + $17 = ((($f)) + 48|0); + $18 = HEAP32[$17>>2]|0; + $19 = (($16) + ($18)|0); + $20 = ((($f)) + 16|0); + HEAP32[$20>>2] = $19; + $$0 = 0; + } else { + $9 = $6 | 32; + HEAP32[$f>>2] = $9; + $$0 = -1; + } + return ($$0|0); +} +function ___uflow($f) { + $f = $f|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $c = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 16|0; + $c = sp; + $0 = ((($f)) + 8|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0|0); + if ($2) { + $3 = (___toread($f)|0); + $4 = ($3|0)==(0); + if ($4) { + label = 3; + } else { + $$0 = -1; + } + } else { + label = 3; + } + if ((label|0) == 3) { + $5 = ((($f)) + 32|0); + $6 = HEAP32[$5>>2]|0; + $7 = (FUNCTION_TABLE_iiii[$6 & 15]($f,$c,1)|0); + $8 = ($7|0)==(1); + if ($8) { + $9 = HEAP8[$c>>0]|0; + $10 = $9&255; + $$0 = $10; + } else { + $$0 = -1; + } + } + STACKTOP = sp;return ($$0|0); +} +function _memchr($src,$c,$n) { + $src = $src|0; + $c = $c|0; + $n = $n|0; + var $$0$lcssa = 0, $$0$lcssa44 = 0, $$019 = 0, $$1$lcssa = 0, $$110 = 0, $$110$lcssa = 0, $$24 = 0, $$3 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; + var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0; + var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, $s$0$lcssa = 0, $s$0$lcssa43 = 0, $s$020 = 0, $s$15 = 0, $s$2 = 0, $w$0$lcssa = 0, $w$011 = 0, $w$011$lcssa = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $c & 255; + $1 = $src; + $2 = $1 & 3; + $3 = ($2|0)!=(0); + $4 = ($n|0)!=(0); + $or$cond18 = $4 & $3; + L1: do { + if ($or$cond18) { + $5 = $c&255; + $$019 = $n;$s$020 = $src; + while(1) { + $6 = HEAP8[$s$020>>0]|0; + $7 = ($6<<24>>24)==($5<<24>>24); + if ($7) { + $$0$lcssa44 = $$019;$s$0$lcssa43 = $s$020; + label = 6; + break L1; + } + $8 = ((($s$020)) + 1|0); + $9 = (($$019) + -1)|0; + $10 = $8; + $11 = $10 & 3; + $12 = ($11|0)!=(0); + $13 = ($9|0)!=(0); + $or$cond = $13 & $12; + if ($or$cond) { + $$019 = $9;$s$020 = $8; + } else { + $$0$lcssa = $9;$$lcssa = $13;$s$0$lcssa = $8; + label = 5; + break; + } + } + } else { + $$0$lcssa = $n;$$lcssa = $4;$s$0$lcssa = $src; + label = 5; + } + } while(0); + if ((label|0) == 5) { + if ($$lcssa) { + $$0$lcssa44 = $$0$lcssa;$s$0$lcssa43 = $s$0$lcssa; + label = 6; + } else { + $$3 = 0;$s$2 = $s$0$lcssa; + } + } + L8: do { + if ((label|0) == 6) { + $14 = HEAP8[$s$0$lcssa43>>0]|0; + $15 = $c&255; + $16 = ($14<<24>>24)==($15<<24>>24); + if ($16) { + $$3 = $$0$lcssa44;$s$2 = $s$0$lcssa43; + } else { + $17 = Math_imul($0, 16843009)|0; + $18 = ($$0$lcssa44>>>0)>(3); + L11: do { + if ($18) { + $$110 = $$0$lcssa44;$w$011 = $s$0$lcssa43; + while(1) { + $19 = HEAP32[$w$011>>2]|0; + $20 = $19 ^ $17; + $21 = (($20) + -16843009)|0; + $22 = $20 & -2139062144; + $23 = $22 ^ -2139062144; + $24 = $23 & $21; + $25 = ($24|0)==(0); + if (!($25)) { + $$110$lcssa = $$110;$w$011$lcssa = $w$011; + break; + } + $26 = ((($w$011)) + 4|0); + $27 = (($$110) + -4)|0; + $28 = ($27>>>0)>(3); + if ($28) { + $$110 = $27;$w$011 = $26; + } else { + $$1$lcssa = $27;$w$0$lcssa = $26; + label = 11; + break L11; + } + } + $$24 = $$110$lcssa;$s$15 = $w$011$lcssa; + } else { + $$1$lcssa = $$0$lcssa44;$w$0$lcssa = $s$0$lcssa43; + label = 11; + } + } while(0); + if ((label|0) == 11) { + $29 = ($$1$lcssa|0)==(0); + if ($29) { + $$3 = 0;$s$2 = $w$0$lcssa; + break; + } else { + $$24 = $$1$lcssa;$s$15 = $w$0$lcssa; + } + } + while(1) { + $30 = HEAP8[$s$15>>0]|0; + $31 = ($30<<24>>24)==($15<<24>>24); + if ($31) { + $$3 = $$24;$s$2 = $s$15; + break L8; + } + $32 = ((($s$15)) + 1|0); + $33 = (($$24) + -1)|0; + $34 = ($33|0)==(0); + if ($34) { + $$3 = 0;$s$2 = $32; + break; + } else { + $$24 = $33;$s$15 = $32; + } + } + } + } + } while(0); + $35 = ($$3|0)!=(0); + $36 = $35 ? $s$2 : 0; + return ($36|0); +} +function _memcmp($vl,$vr,$n) { + $vl = $vl|0; + $vr = $vr|0; + $n = $n|0; + var $$03 = 0, $$lcssa = 0, $$lcssa19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $l$04 = 0, $r$05 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($n|0)==(0); + L1: do { + if ($0) { + $11 = 0; + } else { + $$03 = $n;$l$04 = $vl;$r$05 = $vr; + while(1) { + $1 = HEAP8[$l$04>>0]|0; + $2 = HEAP8[$r$05>>0]|0; + $3 = ($1<<24>>24)==($2<<24>>24); + if (!($3)) { + $$lcssa = $1;$$lcssa19 = $2; + break; + } + $4 = (($$03) + -1)|0; + $5 = ((($l$04)) + 1|0); + $6 = ((($r$05)) + 1|0); + $7 = ($4|0)==(0); + if ($7) { + $11 = 0; + break L1; + } else { + $$03 = $4;$l$04 = $5;$r$05 = $6; + } + } + $8 = $$lcssa&255; + $9 = $$lcssa19&255; + $10 = (($8) - ($9))|0; + $11 = $10; + } + } while(0); + return ($11|0); +} +function ___memrchr($m,$c,$n) { + $m = $m|0; + $c = $c|0; + $n = $n|0; + var $$0 = 0, $$01 = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $c&255; + $$01 = $n; + while(1) { + $1 = (($$01) + -1)|0; + $2 = ($$01|0)==(0); + if ($2) { + $$0 = 0; + break; + } + $3 = (($m) + ($1)|0); + $4 = HEAP8[$3>>0]|0; + $5 = ($4<<24>>24)==($0<<24>>24); + if ($5) { + $$0 = $3; + break; + } else { + $$01 = $1; + } + } + return ($$0|0); +} +function ___stpcpy($d,$s) { + $d = $d|0; + $s = $s|0; + var $$0$lcssa = 0, $$01$lcssa = 0, $$0115 = 0, $$016 = 0, $$03 = 0, $$1$ph = 0, $$12$ph = 0, $$128 = 0, $$19 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0; + var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0; + var $6 = 0, $7 = 0, $8 = 0, $9 = 0, $wd$0$lcssa = 0, $wd$010 = 0, $ws$0$lcssa = 0, $ws$011 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $s; + $1 = $d; + $2 = $0 ^ $1; + $3 = $2 & 3; + $4 = ($3|0)==(0); + L1: do { + if ($4) { + $5 = $0 & 3; + $6 = ($5|0)==(0); + if ($6) { + $$0$lcssa = $s;$$01$lcssa = $d; + } else { + $$0115 = $d;$$016 = $s; + while(1) { + $7 = HEAP8[$$016>>0]|0; + HEAP8[$$0115>>0] = $7; + $8 = ($7<<24>>24)==(0); + if ($8) { + $$03 = $$0115; + break L1; + } + $9 = ((($$016)) + 1|0); + $10 = ((($$0115)) + 1|0); + $11 = $9; + $12 = $11 & 3; + $13 = ($12|0)==(0); + if ($13) { + $$0$lcssa = $9;$$01$lcssa = $10; + break; + } else { + $$0115 = $10;$$016 = $9; + } + } + } + $14 = HEAP32[$$0$lcssa>>2]|0; + $15 = (($14) + -16843009)|0; + $16 = $14 & -2139062144; + $17 = $16 ^ -2139062144; + $18 = $17 & $15; + $19 = ($18|0)==(0); + if ($19) { + $22 = $14;$wd$010 = $$01$lcssa;$ws$011 = $$0$lcssa; + while(1) { + $20 = ((($ws$011)) + 4|0); + $21 = ((($wd$010)) + 4|0); + HEAP32[$wd$010>>2] = $22; + $23 = HEAP32[$20>>2]|0; + $24 = (($23) + -16843009)|0; + $25 = $23 & -2139062144; + $26 = $25 ^ -2139062144; + $27 = $26 & $24; + $28 = ($27|0)==(0); + if ($28) { + $22 = $23;$wd$010 = $21;$ws$011 = $20; + } else { + $wd$0$lcssa = $21;$ws$0$lcssa = $20; + break; + } + } + } else { + $wd$0$lcssa = $$01$lcssa;$ws$0$lcssa = $$0$lcssa; + } + $$1$ph = $ws$0$lcssa;$$12$ph = $wd$0$lcssa; + label = 8; + } else { + $$1$ph = $s;$$12$ph = $d; + label = 8; + } + } while(0); + if ((label|0) == 8) { + $29 = HEAP8[$$1$ph>>0]|0; + HEAP8[$$12$ph>>0] = $29; + $30 = ($29<<24>>24)==(0); + if ($30) { + $$03 = $$12$ph; + } else { + $$128 = $$12$ph;$$19 = $$1$ph; + while(1) { + $31 = ((($$19)) + 1|0); + $32 = ((($$128)) + 1|0); + $33 = HEAP8[$31>>0]|0; + HEAP8[$32>>0] = $33; + $34 = ($33<<24>>24)==(0); + if ($34) { + $$03 = $32; + break; + } else { + $$128 = $32;$$19 = $31; + } + } + } + } + return ($$03|0); +} +function _strchr($s,$c) { + $s = $s|0; + $c = $c|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (___strchrnul($s,$c)|0); + $1 = HEAP8[$0>>0]|0; + $2 = $c&255; + $3 = ($1<<24>>24)==($2<<24>>24); + $4 = $3 ? $0 : 0; + return ($4|0); +} +function ___strchrnul($s,$c) { + $s = $s|0; + $c = $c|0; + var $$0 = 0, $$02$lcssa = 0, $$0211 = 0, $$1 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; + var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond5 = 0, $w$0$lcssa = 0, $w$08 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $c & 255; + $1 = ($0|0)==(0); + L1: do { + if ($1) { + $6 = (_strlen($s)|0); + $7 = (($s) + ($6)|0); + $$0 = $7; + } else { + $2 = $s; + $3 = $2 & 3; + $4 = ($3|0)==(0); + if ($4) { + $$02$lcssa = $s; + } else { + $5 = $c&255; + $$0211 = $s; + while(1) { + $8 = HEAP8[$$0211>>0]|0; + $9 = ($8<<24>>24)==(0); + $10 = ($8<<24>>24)==($5<<24>>24); + $or$cond = $9 | $10; + if ($or$cond) { + $$0 = $$0211; + break L1; + } + $11 = ((($$0211)) + 1|0); + $12 = $11; + $13 = $12 & 3; + $14 = ($13|0)==(0); + if ($14) { + $$02$lcssa = $11; + break; + } else { + $$0211 = $11; + } + } + } + $15 = Math_imul($0, 16843009)|0; + $16 = HEAP32[$$02$lcssa>>2]|0; + $17 = (($16) + -16843009)|0; + $18 = $16 & -2139062144; + $19 = $18 ^ -2139062144; + $20 = $19 & $17; + $21 = ($20|0)==(0); + L10: do { + if ($21) { + $23 = $16;$w$08 = $$02$lcssa; + while(1) { + $22 = $23 ^ $15; + $24 = (($22) + -16843009)|0; + $25 = $22 & -2139062144; + $26 = $25 ^ -2139062144; + $27 = $26 & $24; + $28 = ($27|0)==(0); + if (!($28)) { + $w$0$lcssa = $w$08; + break L10; + } + $29 = ((($w$08)) + 4|0); + $30 = HEAP32[$29>>2]|0; + $31 = (($30) + -16843009)|0; + $32 = $30 & -2139062144; + $33 = $32 ^ -2139062144; + $34 = $33 & $31; + $35 = ($34|0)==(0); + if ($35) { + $23 = $30;$w$08 = $29; + } else { + $w$0$lcssa = $29; + break; + } + } + } else { + $w$0$lcssa = $$02$lcssa; + } + } while(0); + $36 = $c&255; + $$1 = $w$0$lcssa; + while(1) { + $37 = HEAP8[$$1>>0]|0; + $38 = ($37<<24>>24)==(0); + $39 = ($37<<24>>24)==($36<<24>>24); + $or$cond5 = $38 | $39; + $40 = ((($$1)) + 1|0); + if ($or$cond5) { + $$0 = $$1; + break; + } else { + $$1 = $40; + } + } + } + } while(0); + return ($$0|0); +} +function _strcmp($l,$r) { + $l = $l|0; + $r = $r|0; + var $$014 = 0, $$05 = 0, $$lcssa = 0, $$lcssa2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0; + var sp = 0; + sp = STACKTOP; + $0 = HEAP8[$l>>0]|0; + $1 = HEAP8[$r>>0]|0; + $2 = ($0<<24>>24)!=($1<<24>>24); + $3 = ($0<<24>>24)==(0); + $or$cond3 = $3 | $2; + if ($or$cond3) { + $$lcssa = $0;$$lcssa2 = $1; + } else { + $$014 = $l;$$05 = $r; + while(1) { + $4 = ((($$014)) + 1|0); + $5 = ((($$05)) + 1|0); + $6 = HEAP8[$4>>0]|0; + $7 = HEAP8[$5>>0]|0; + $8 = ($6<<24>>24)!=($7<<24>>24); + $9 = ($6<<24>>24)==(0); + $or$cond = $9 | $8; + if ($or$cond) { + $$lcssa = $6;$$lcssa2 = $7; + break; + } else { + $$014 = $4;$$05 = $5; + } + } + } + $10 = $$lcssa&255; + $11 = $$lcssa2&255; + $12 = (($10) - ($11))|0; + return ($12|0); +} +function _strcpy($dest,$src) { + $dest = $dest|0; + $src = $src|0; + var label = 0, sp = 0; + sp = STACKTOP; + (___stpcpy($dest,$src)|0); + return ($dest|0); +} +function _strcspn($s,$c) { + $s = $s|0; + $c = $c|0; + var $$0 = 0, $$027 = 0, $$03$lcssa = 0, $$035 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; + var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; + var $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $byteset = sp; + $0 = HEAP8[$c>>0]|0; + $1 = ($0<<24>>24)==(0); + if ($1) { + label = 3; + } else { + $2 = ((($c)) + 1|0); + $3 = HEAP8[$2>>0]|0; + $4 = ($3<<24>>24)==(0); + if ($4) { + label = 3; + } else { + ;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0; + $$027 = $c;$13 = $0; + while(1) { + $12 = $13 & 31; + $14 = $12&255; + $15 = 1 << $14; + $div4 = ($13&255) >>> 5; + $16 = $div4&255; + $17 = (($byteset) + ($16<<2)|0); + $18 = HEAP32[$17>>2]|0; + $19 = $18 | $15; + HEAP32[$17>>2] = $19; + $20 = ((($$027)) + 1|0); + $21 = HEAP8[$20>>0]|0; + $22 = ($21<<24>>24)==(0); + if ($22) { + break; + } else { + $$027 = $20;$13 = $21; + } + } + $10 = HEAP8[$s>>0]|0; + $11 = ($10<<24>>24)==(0); + L7: do { + if ($11) { + $$03$lcssa = $s; + } else { + $$035 = $s;$23 = $10; + while(1) { + $div = ($23&255) >>> 5; + $24 = $div&255; + $25 = (($byteset) + ($24<<2)|0); + $26 = HEAP32[$25>>2]|0; + $27 = $23 & 31; + $28 = $27&255; + $29 = 1 << $28; + $30 = $26 & $29; + $31 = ($30|0)==(0); + if (!($31)) { + $$03$lcssa = $$035; + break L7; + } + $32 = ((($$035)) + 1|0); + $33 = HEAP8[$32>>0]|0; + $34 = ($33<<24>>24)==(0); + if ($34) { + $$03$lcssa = $32; + break; + } else { + $$035 = $32;$23 = $33; + } + } + } + } while(0); + $35 = $$03$lcssa; + $36 = $s; + $37 = (($35) - ($36))|0; + $$0 = $37; + } + } + if ((label|0) == 3) { + $5 = $0 << 24 >> 24; + $6 = (___strchrnul($s,$5)|0); + $7 = $6; + $8 = $s; + $9 = (($7) - ($8))|0; + $$0 = $9; + } + STACKTOP = sp;return ($$0|0); +} +function _strlen($s) { + $s = $s|0; + var $$0 = 0, $$01$lcssa = 0, $$014 = 0, $$1$lcssa = 0, $$lcssa20 = 0, $$pn = 0, $$pn15 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0; + var $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $w$0 = 0, $w$0$lcssa = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = $s; + $1 = $0 & 3; + $2 = ($1|0)==(0); + L1: do { + if ($2) { + $$01$lcssa = $s; + label = 4; + } else { + $$014 = $s;$21 = $0; + while(1) { + $3 = HEAP8[$$014>>0]|0; + $4 = ($3<<24>>24)==(0); + if ($4) { + $$pn = $21; + break L1; + } + $5 = ((($$014)) + 1|0); + $6 = $5; + $7 = $6 & 3; + $8 = ($7|0)==(0); + if ($8) { + $$01$lcssa = $5; + label = 4; + break; + } else { + $$014 = $5;$21 = $6; + } + } + } + } while(0); + if ((label|0) == 4) { + $w$0 = $$01$lcssa; + while(1) { + $9 = HEAP32[$w$0>>2]|0; + $10 = (($9) + -16843009)|0; + $11 = $9 & -2139062144; + $12 = $11 ^ -2139062144; + $13 = $12 & $10; + $14 = ($13|0)==(0); + $15 = ((($w$0)) + 4|0); + if ($14) { + $w$0 = $15; + } else { + $$lcssa20 = $9;$w$0$lcssa = $w$0; + break; + } + } + $16 = $$lcssa20&255; + $17 = ($16<<24>>24)==(0); + if ($17) { + $$1$lcssa = $w$0$lcssa; + } else { + $$pn15 = $w$0$lcssa; + while(1) { + $18 = ((($$pn15)) + 1|0); + $$pre = HEAP8[$18>>0]|0; + $19 = ($$pre<<24>>24)==(0); + if ($19) { + $$1$lcssa = $18; + break; + } else { + $$pn15 = $18; + } + } + } + $20 = $$1$lcssa; + $$pn = $20; + } + $$0 = (($$pn) - ($0))|0; + return ($$0|0); +} +function _strncmp($_l,$_r,$n) { + $_l = $_l|0; + $_r = $_r|0; + $n = $n|0; + var $$03 = 0, $$08 = 0, $$08$in = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0; + var $l$06 = 0, $or$cond = 0, $or$cond4 = 0, $r$0$lcssa = 0, $r$07 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($n|0)==(0); + if ($0) { + $$03 = 0; + } else { + $1 = HEAP8[$_l>>0]|0; + $2 = ($1<<24>>24)==(0); + L3: do { + if ($2) { + $13 = 0;$r$0$lcssa = $_r; + } else { + $$08$in = $n;$6 = $1;$l$06 = $_l;$r$07 = $_r; + while(1) { + $$08 = (($$08$in) + -1)|0; + $3 = HEAP8[$r$07>>0]|0; + $4 = ($3<<24>>24)!=(0); + $5 = ($$08|0)!=(0); + $or$cond = $5 & $4; + $7 = ($6<<24>>24)==($3<<24>>24); + $or$cond4 = $7 & $or$cond; + if (!($or$cond4)) { + $13 = $6;$r$0$lcssa = $r$07; + break L3; + } + $8 = ((($l$06)) + 1|0); + $9 = ((($r$07)) + 1|0); + $10 = HEAP8[$8>>0]|0; + $11 = ($10<<24>>24)==(0); + if ($11) { + $13 = 0;$r$0$lcssa = $9; + break; + } else { + $$08$in = $$08;$6 = $10;$l$06 = $8;$r$07 = $9; + } + } + } + } while(0); + $12 = $13&255; + $14 = HEAP8[$r$0$lcssa>>0]|0; + $15 = $14&255; + $16 = (($12) - ($15))|0; + $$03 = $16; + } + return ($$03|0); +} +function _strrchr($s,$c) { + $s = $s|0; + $c = $c|0; + var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (_strlen($s)|0); + $1 = (($0) + 1)|0; + $2 = (___memrchr($s,$c,$1)|0); + return ($2|0); +} +function _strspn($s,$c) { + $s = $s|0; + $c = $c|0; + var $$0 = 0, $$028 = 0, $$03 = 0, $$03$lcssa = 0, $$1$lcssa = 0, $$16 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0; + var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0; + var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $byteset = 0, $div = 0, $div4 = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 32|0; + $byteset = sp; + ;HEAP32[$byteset>>2]=0|0;HEAP32[$byteset+4>>2]=0|0;HEAP32[$byteset+8>>2]=0|0;HEAP32[$byteset+12>>2]=0|0;HEAP32[$byteset+16>>2]=0|0;HEAP32[$byteset+20>>2]=0|0;HEAP32[$byteset+24>>2]=0|0;HEAP32[$byteset+28>>2]=0|0; + $0 = HEAP8[$c>>0]|0; + $1 = ($0<<24>>24)==(0); + do { + if ($1) { + $$0 = 0; + } else { + $2 = ((($c)) + 1|0); + $3 = HEAP8[$2>>0]|0; + $4 = ($3<<24>>24)==(0); + if ($4) { + $$03 = $s; + while(1) { + $5 = HEAP8[$$03>>0]|0; + $6 = ($5<<24>>24)==($0<<24>>24); + $7 = ((($$03)) + 1|0); + if ($6) { + $$03 = $7; + } else { + $$03$lcssa = $$03; + break; + } + } + $8 = $$03$lcssa; + $9 = $s; + $10 = (($8) - ($9))|0; + $$0 = $10; + break; + } else { + $$028 = $c;$14 = $0; + } + while(1) { + $13 = $14 & 31; + $15 = $13&255; + $16 = 1 << $15; + $div4 = ($14&255) >>> 5; + $17 = $div4&255; + $18 = (($byteset) + ($17<<2)|0); + $19 = HEAP32[$18>>2]|0; + $20 = $19 | $16; + HEAP32[$18>>2] = $20; + $21 = ((($$028)) + 1|0); + $22 = HEAP8[$21>>0]|0; + $23 = ($22<<24>>24)==(0); + if ($23) { + break; + } else { + $$028 = $21;$14 = $22; + } + } + $11 = HEAP8[$s>>0]|0; + $12 = ($11<<24>>24)==(0); + L10: do { + if ($12) { + $$1$lcssa = $s; + } else { + $$16 = $s;$24 = $11; + while(1) { + $div = ($24&255) >>> 5; + $25 = $div&255; + $26 = (($byteset) + ($25<<2)|0); + $27 = HEAP32[$26>>2]|0; + $28 = $24 & 31; + $29 = $28&255; + $30 = 1 << $29; + $31 = $27 & $30; + $32 = ($31|0)==(0); + if ($32) { + $$1$lcssa = $$16; + break L10; + } + $33 = ((($$16)) + 1|0); + $34 = HEAP8[$33>>0]|0; + $35 = ($34<<24>>24)==(0); + if ($35) { + $$1$lcssa = $33; + break; + } else { + $$16 = $33;$24 = $34; + } + } + } + } while(0); + $36 = $$1$lcssa; + $37 = $s; + $38 = (($36) - ($37))|0; + $$0 = $38; + } + } while(0); + STACKTOP = sp;return ($$0|0); +} +function _strstr($h,$n) { + $h = $h|0; + $n = $n|0; + var $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$0$lcssa$i11 = 0, $$01$i = 0, $$02$i = 0, $$02$i7 = 0, $$03$i = 0, $$lcssa$i = 0, $$lcssa$i10 = 0, $$lcssa$i4 = 0, $$lcssa281 = 0, $$lcssa284 = 0, $$lcssa287 = 0, $$lcssa301 = 0, $$lcssa304 = 0, $$lcssa307 = 0, $$lcssa322 = 0, $$pr$i = 0, $0 = 0; + var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0; + var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0; + var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0; + var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0; + var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0; + var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0; + var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0; + var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $233$phi = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $25 = 0, $26 = 0; + var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0; + var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0; + var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0; + var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0; + var $byteset$i = 0, $div$i = 0, $div4$i = 0, $hw$0$in2$i = 0, $hw$03$i = 0, $hw$03$i6 = 0, $ip$0$ph$lcssa$i = 0, $ip$0$ph$lcssa143$i = 0, $ip$0$ph76$i = 0, $ip$1$ip$0$$i = 0, $ip$1$ip$0$i = 0, $ip$1$ph$lcssa$i = 0, $ip$1$ph55$i = 0, $jp$0$ph13$ph70$i = 0, $jp$0$ph1365$i = 0, $jp$0$ph1365$i$lcssa = 0, $jp$0$ph1365$i$lcssa$lcssa = 0, $jp$0$ph77$i = 0, $jp$1$ph56$i = 0, $jp$1$ph9$ph49$i = 0; + var $jp$1$ph944$i = 0, $jp$1$ph944$i$lcssa = 0, $jp$1$ph944$i$lcssa$lcssa = 0, $k$059$i = 0, $k$139$i = 0, $k$2$i = 0, $k$338$i = 0, $k$338$i$lcssa = 0, $k$4$i = 0, $l$080$i = 0, $l$080$i$lcssa321 = 0, $mem$0$i = 0, $mem0$0$i = 0, $or$cond$i = 0, $or$cond$i2 = 0, $or$cond$i8 = 0, $or$cond5$i = 0, $p$0$ph$ph$lcssa32$i = 0, $p$0$ph$ph$lcssa32147$i = 0, $p$0$ph$ph71$i = 0; + var $p$1$p$0$i = 0, $p$1$ph$ph$lcssa23$i = 0, $p$1$ph$ph50$i = 0, $p$3$i = 0, $shift$i = 0, $z$0$i = 0, $z$1$i = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 1056|0; + $byteset$i = sp + 1024|0; + $shift$i = sp; + $0 = HEAP8[$n>>0]|0; + $1 = ($0<<24>>24)==(0); + do { + if ($1) { + $$0 = $h; + } else { + $2 = $0 << 24 >> 24; + $3 = (_strchr($h,$2)|0); + $4 = ($3|0)==(0|0); + if ($4) { + $$0 = 0; + } else { + $5 = ((($n)) + 1|0); + $6 = HEAP8[$5>>0]|0; + $7 = ($6<<24>>24)==(0); + if ($7) { + $$0 = $3; + } else { + $8 = ((($3)) + 1|0); + $9 = HEAP8[$8>>0]|0; + $10 = ($9<<24>>24)==(0); + if ($10) { + $$0 = 0; + } else { + $11 = ((($n)) + 2|0); + $12 = HEAP8[$11>>0]|0; + $13 = ($12<<24>>24)==(0); + if ($13) { + $14 = $0&255; + $15 = $14 << 8; + $16 = $6&255; + $17 = $16 | $15; + $18 = HEAP8[$3>>0]|0; + $19 = $18&255; + $20 = $19 << 8; + $21 = $9&255; + $22 = $20 | $21; + $$01$i = $8;$232 = $9;$233 = $3;$hw$0$in2$i = $22; + while(1) { + $23 = $hw$0$in2$i & 65535; + $24 = ($23|0)==($17|0); + if ($24) { + $$lcssa$i = $233;$31 = $232; + break; + } + $25 = $23 << 8; + $26 = ((($$01$i)) + 1|0); + $27 = HEAP8[$26>>0]|0; + $28 = $27&255; + $29 = $28 | $25; + $30 = ($27<<24>>24)==(0); + if ($30) { + $$lcssa$i = $$01$i;$31 = 0; + break; + } else { + $233$phi = $$01$i;$$01$i = $26;$232 = $27;$hw$0$in2$i = $29;$233 = $233$phi; + } + } + $32 = ($31<<24>>24)!=(0); + $33 = $32 ? $$lcssa$i : 0; + $$0 = $33; + break; + } + $34 = ((($3)) + 2|0); + $35 = HEAP8[$34>>0]|0; + $36 = ($35<<24>>24)==(0); + if ($36) { + $$0 = 0; + } else { + $37 = ((($n)) + 3|0); + $38 = HEAP8[$37>>0]|0; + $39 = ($38<<24>>24)==(0); + if ($39) { + $40 = $0&255; + $41 = $40 << 24; + $42 = $6&255; + $43 = $42 << 16; + $44 = $43 | $41; + $45 = $12&255; + $46 = $45 << 8; + $47 = $44 | $46; + $48 = HEAP8[$3>>0]|0; + $49 = $48&255; + $50 = $49 << 24; + $51 = $9&255; + $52 = $51 << 16; + $53 = $35&255; + $54 = $53 << 8; + $55 = $54 | $52; + $56 = $55 | $50; + $57 = ($56|0)==($47|0); + if ($57) { + $$0$lcssa$i = $34;$$lcssa$i4 = $35; + } else { + $$02$i = $34;$hw$03$i = $56; + while(1) { + $58 = ((($$02$i)) + 1|0); + $59 = HEAP8[$58>>0]|0; + $60 = $59&255; + $61 = $60 | $hw$03$i; + $62 = $61 << 8; + $63 = ($59<<24>>24)==(0); + $64 = ($62|0)==($47|0); + $or$cond$i2 = $63 | $64; + if ($or$cond$i2) { + $$0$lcssa$i = $58;$$lcssa$i4 = $59; + break; + } else { + $$02$i = $58;$hw$03$i = $62; + } + } + } + $65 = ($$lcssa$i4<<24>>24)!=(0); + $66 = ((($$0$lcssa$i)) + -2|0); + $67 = $65 ? $66 : 0; + $$0 = $67; + break; + } + $68 = ((($3)) + 3|0); + $69 = HEAP8[$68>>0]|0; + $70 = ($69<<24>>24)==(0); + if ($70) { + $$0 = 0; + } else { + $71 = ((($n)) + 4|0); + $72 = HEAP8[$71>>0]|0; + $73 = ($72<<24>>24)==(0); + if ($73) { + $74 = $0&255; + $75 = $74 << 24; + $76 = $6&255; + $77 = $76 << 16; + $78 = $77 | $75; + $79 = $12&255; + $80 = $79 << 8; + $81 = $78 | $80; + $82 = $38&255; + $83 = $81 | $82; + $84 = HEAP8[$3>>0]|0; + $85 = $84&255; + $86 = $85 << 24; + $87 = $9&255; + $88 = $87 << 16; + $89 = $35&255; + $90 = $89 << 8; + $91 = $69&255; + $92 = $90 | $88; + $93 = $92 | $91; + $94 = $93 | $86; + $95 = ($94|0)==($83|0); + if ($95) { + $$0$lcssa$i11 = $68;$$lcssa$i10 = $69; + } else { + $$02$i7 = $68;$hw$03$i6 = $94; + while(1) { + $96 = $hw$03$i6 << 8; + $97 = ((($$02$i7)) + 1|0); + $98 = HEAP8[$97>>0]|0; + $99 = $98&255; + $100 = $99 | $96; + $101 = ($98<<24>>24)==(0); + $102 = ($100|0)==($83|0); + $or$cond$i8 = $101 | $102; + if ($or$cond$i8) { + $$0$lcssa$i11 = $97;$$lcssa$i10 = $98; + break; + } else { + $$02$i7 = $97;$hw$03$i6 = $100; + } + } + } + $103 = ($$lcssa$i10<<24>>24)!=(0); + $104 = ((($$0$lcssa$i11)) + -3|0); + $105 = $103 ? $104 : 0; + $$0 = $105; + break; + } + ;HEAP32[$byteset$i>>2]=0|0;HEAP32[$byteset$i+4>>2]=0|0;HEAP32[$byteset$i+8>>2]=0|0;HEAP32[$byteset$i+12>>2]=0|0;HEAP32[$byteset$i+16>>2]=0|0;HEAP32[$byteset$i+20>>2]=0|0;HEAP32[$byteset$i+24>>2]=0|0;HEAP32[$byteset$i+28>>2]=0|0; + $110 = $0;$l$080$i = 0; + while(1) { + $106 = (($3) + ($l$080$i)|0); + $107 = HEAP8[$106>>0]|0; + $108 = ($107<<24>>24)==(0); + if ($108) { + $$0$i = 0; + break; + } + $109 = $110 & 31; + $111 = $109&255; + $112 = 1 << $111; + $div4$i = ($110&255) >>> 5; + $113 = $div4$i&255; + $114 = (($byteset$i) + ($113<<2)|0); + $115 = HEAP32[$114>>2]|0; + $116 = $115 | $112; + HEAP32[$114>>2] = $116; + $117 = (($l$080$i) + 1)|0; + $118 = $110&255; + $119 = (($shift$i) + ($118<<2)|0); + HEAP32[$119>>2] = $117; + $120 = (($n) + ($117)|0); + $121 = HEAP8[$120>>0]|0; + $122 = ($121<<24>>24)==(0); + if ($122) { + $$lcssa322 = $117;$l$080$i$lcssa321 = $l$080$i; + label = 23; + break; + } else { + $110 = $121;$l$080$i = $117; + } + } + L32: do { + if ((label|0) == 23) { + $123 = ($$lcssa322>>>0)>(1); + L34: do { + if ($123) { + $234 = 1;$ip$0$ph76$i = -1;$jp$0$ph77$i = 0; + L35: while(1) { + $235 = $234;$jp$0$ph13$ph70$i = $jp$0$ph77$i;$p$0$ph$ph71$i = 1; + while(1) { + $236 = $235;$jp$0$ph1365$i = $jp$0$ph13$ph70$i; + L39: while(1) { + $133 = $236;$k$059$i = 1; + while(1) { + $129 = (($k$059$i) + ($ip$0$ph76$i))|0; + $130 = (($n) + ($129)|0); + $131 = HEAP8[$130>>0]|0; + $132 = (($n) + ($133)|0); + $134 = HEAP8[$132>>0]|0; + $135 = ($131<<24>>24)==($134<<24>>24); + if (!($135)) { + $$lcssa301 = $133;$$lcssa304 = $131;$$lcssa307 = $134;$jp$0$ph1365$i$lcssa = $jp$0$ph1365$i; + break L39; + } + $136 = ($k$059$i|0)==($p$0$ph$ph71$i|0); + $127 = (($k$059$i) + 1)|0; + if ($136) { + break; + } + $126 = (($127) + ($jp$0$ph1365$i))|0; + $128 = ($126>>>0)<($$lcssa322>>>0); + if ($128) { + $133 = $126;$k$059$i = $127; + } else { + $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i; + break L35; + } + } + $137 = (($jp$0$ph1365$i) + ($p$0$ph$ph71$i))|0; + $138 = (($137) + 1)|0; + $139 = ($138>>>0)<($$lcssa322>>>0); + if ($139) { + $236 = $138;$jp$0$ph1365$i = $137; + } else { + $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $p$0$ph$ph71$i; + break L35; + } + } + $140 = ($$lcssa304&255)>($$lcssa307&255); + $141 = (($$lcssa301) - ($ip$0$ph76$i))|0; + if (!($140)) { + $jp$0$ph1365$i$lcssa$lcssa = $jp$0$ph1365$i$lcssa; + break; + } + $124 = (($$lcssa301) + 1)|0; + $125 = ($124>>>0)<($$lcssa322>>>0); + if ($125) { + $235 = $124;$jp$0$ph13$ph70$i = $$lcssa301;$p$0$ph$ph71$i = $141; + } else { + $ip$0$ph$lcssa$i = $ip$0$ph76$i;$p$0$ph$ph$lcssa32$i = $141; + break L35; + } + } + $142 = (($jp$0$ph1365$i$lcssa$lcssa) + 1)|0; + $143 = (($jp$0$ph1365$i$lcssa$lcssa) + 2)|0; + $144 = ($143>>>0)<($$lcssa322>>>0); + if ($144) { + $234 = $143;$ip$0$ph76$i = $jp$0$ph1365$i$lcssa$lcssa;$jp$0$ph77$i = $142; + } else { + $ip$0$ph$lcssa$i = $jp$0$ph1365$i$lcssa$lcssa;$p$0$ph$ph$lcssa32$i = 1; + break; + } + } + $237 = 1;$ip$1$ph55$i = -1;$jp$1$ph56$i = 0; + while(1) { + $239 = $237;$jp$1$ph9$ph49$i = $jp$1$ph56$i;$p$1$ph$ph50$i = 1; + while(1) { + $238 = $239;$jp$1$ph944$i = $jp$1$ph9$ph49$i; + L54: while(1) { + $152 = $238;$k$139$i = 1; + while(1) { + $148 = (($k$139$i) + ($ip$1$ph55$i))|0; + $149 = (($n) + ($148)|0); + $150 = HEAP8[$149>>0]|0; + $151 = (($n) + ($152)|0); + $153 = HEAP8[$151>>0]|0; + $154 = ($150<<24>>24)==($153<<24>>24); + if (!($154)) { + $$lcssa281 = $152;$$lcssa284 = $150;$$lcssa287 = $153;$jp$1$ph944$i$lcssa = $jp$1$ph944$i; + break L54; + } + $155 = ($k$139$i|0)==($p$1$ph$ph50$i|0); + $146 = (($k$139$i) + 1)|0; + if ($155) { + break; + } + $145 = (($146) + ($jp$1$ph944$i))|0; + $147 = ($145>>>0)<($$lcssa322>>>0); + if ($147) { + $152 = $145;$k$139$i = $146; + } else { + $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i; + break L34; + } + } + $156 = (($jp$1$ph944$i) + ($p$1$ph$ph50$i))|0; + $157 = (($156) + 1)|0; + $158 = ($157>>>0)<($$lcssa322>>>0); + if ($158) { + $238 = $157;$jp$1$ph944$i = $156; + } else { + $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $p$1$ph$ph50$i; + break L34; + } + } + $159 = ($$lcssa284&255)<($$lcssa287&255); + $160 = (($$lcssa281) - ($ip$1$ph55$i))|0; + if (!($159)) { + $jp$1$ph944$i$lcssa$lcssa = $jp$1$ph944$i$lcssa; + break; + } + $164 = (($$lcssa281) + 1)|0; + $165 = ($164>>>0)<($$lcssa322>>>0); + if ($165) { + $239 = $164;$jp$1$ph9$ph49$i = $$lcssa281;$p$1$ph$ph50$i = $160; + } else { + $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $ip$1$ph55$i;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = $160; + break L34; + } + } + $161 = (($jp$1$ph944$i$lcssa$lcssa) + 1)|0; + $162 = (($jp$1$ph944$i$lcssa$lcssa) + 2)|0; + $163 = ($162>>>0)<($$lcssa322>>>0); + if ($163) { + $237 = $162;$ip$1$ph55$i = $jp$1$ph944$i$lcssa$lcssa;$jp$1$ph56$i = $161; + } else { + $ip$0$ph$lcssa143$i = $ip$0$ph$lcssa$i;$ip$1$ph$lcssa$i = $jp$1$ph944$i$lcssa$lcssa;$p$0$ph$ph$lcssa32147$i = $p$0$ph$ph$lcssa32$i;$p$1$ph$ph$lcssa23$i = 1; + break; + } + } + } else { + $ip$0$ph$lcssa143$i = -1;$ip$1$ph$lcssa$i = -1;$p$0$ph$ph$lcssa32147$i = 1;$p$1$ph$ph$lcssa23$i = 1; + } + } while(0); + $166 = (($ip$1$ph$lcssa$i) + 1)|0; + $167 = (($ip$0$ph$lcssa143$i) + 1)|0; + $168 = ($166>>>0)>($167>>>0); + $p$1$p$0$i = $168 ? $p$1$ph$ph$lcssa23$i : $p$0$ph$ph$lcssa32147$i; + $ip$1$ip$0$i = $168 ? $ip$1$ph$lcssa$i : $ip$0$ph$lcssa143$i; + $169 = (($n) + ($p$1$p$0$i)|0); + $170 = (($ip$1$ip$0$i) + 1)|0; + $171 = (_memcmp($n,$169,$170)|0); + $172 = ($171|0)==(0); + if ($172) { + $177 = (($$lcssa322) - ($p$1$p$0$i))|0; + $mem0$0$i = $177;$p$3$i = $p$1$p$0$i; + } else { + $173 = (($$lcssa322) - ($ip$1$ip$0$i))|0; + $174 = (($173) + -1)|0; + $175 = ($ip$1$ip$0$i>>>0)>($174>>>0); + $ip$1$ip$0$$i = $175 ? $ip$1$ip$0$i : $174; + $176 = (($ip$1$ip$0$$i) + 1)|0; + $mem0$0$i = 0;$p$3$i = $176; + } + $178 = $$lcssa322 | 63; + $179 = ($mem0$0$i|0)!=(0); + $180 = (($$lcssa322) - ($p$3$i))|0; + $$03$i = $3;$mem$0$i = 0;$z$0$i = $3; + L69: while(1) { + $181 = $z$0$i; + $182 = $$03$i; + $183 = (($181) - ($182))|0; + $184 = ($183>>>0)<($$lcssa322>>>0); + do { + if ($184) { + $185 = (_memchr($z$0$i,0,$178)|0); + $186 = ($185|0)==(0|0); + if ($186) { + $190 = (($z$0$i) + ($178)|0); + $z$1$i = $190; + break; + } else { + $187 = $185; + $188 = (($187) - ($182))|0; + $189 = ($188>>>0)<($$lcssa322>>>0); + if ($189) { + $$0$i = 0; + break L32; + } else { + $z$1$i = $185; + break; + } + } + } else { + $z$1$i = $z$0$i; + } + } while(0); + $191 = (($$03$i) + ($l$080$i$lcssa321)|0); + $192 = HEAP8[$191>>0]|0; + $div$i = ($192&255) >>> 5; + $193 = $div$i&255; + $194 = (($byteset$i) + ($193<<2)|0); + $195 = HEAP32[$194>>2]|0; + $196 = $192 & 31; + $197 = $196&255; + $198 = 1 << $197; + $199 = $198 & $195; + $200 = ($199|0)==(0); + if ($200) { + $209 = (($$03$i) + ($$lcssa322)|0); + $$03$i = $209;$mem$0$i = 0;$z$0$i = $z$1$i; + continue; + } + $201 = $192&255; + $202 = (($shift$i) + ($201<<2)|0); + $203 = HEAP32[$202>>2]|0; + $204 = (($$lcssa322) - ($203))|0; + $205 = ($$lcssa322|0)==($203|0); + if (!($205)) { + $206 = ($mem$0$i|0)!=(0); + $or$cond$i = $179 & $206; + $207 = ($204>>>0)<($p$3$i>>>0); + $or$cond5$i = $or$cond$i & $207; + $k$2$i = $or$cond5$i ? $180 : $204; + $208 = (($$03$i) + ($k$2$i)|0); + $$03$i = $208;$mem$0$i = 0;$z$0$i = $z$1$i; + continue; + } + $210 = ($170>>>0)>($mem$0$i>>>0); + $211 = $210 ? $170 : $mem$0$i; + $212 = (($n) + ($211)|0); + $213 = HEAP8[$212>>0]|0; + $214 = ($213<<24>>24)==(0); + L83: do { + if ($214) { + $k$4$i = $170; + } else { + $$pr$i = $213;$k$338$i = $211; + while(1) { + $215 = (($$03$i) + ($k$338$i)|0); + $216 = HEAP8[$215>>0]|0; + $217 = ($$pr$i<<24>>24)==($216<<24>>24); + if (!($217)) { + $k$338$i$lcssa = $k$338$i; + break; + } + $218 = (($k$338$i) + 1)|0; + $219 = (($n) + ($218)|0); + $220 = HEAP8[$219>>0]|0; + $221 = ($220<<24>>24)==(0); + if ($221) { + $k$4$i = $170; + break L83; + } else { + $$pr$i = $220;$k$338$i = $218; + } + } + $222 = (($k$338$i$lcssa) - ($ip$1$ip$0$i))|0; + $223 = (($$03$i) + ($222)|0); + $$03$i = $223;$mem$0$i = 0;$z$0$i = $z$1$i; + continue L69; + } + } while(0); + while(1) { + $224 = ($k$4$i>>>0)>($mem$0$i>>>0); + if (!($224)) { + $$0$i = $$03$i; + break L32; + } + $225 = (($k$4$i) + -1)|0; + $226 = (($n) + ($225)|0); + $227 = HEAP8[$226>>0]|0; + $228 = (($$03$i) + ($225)|0); + $229 = HEAP8[$228>>0]|0; + $230 = ($227<<24>>24)==($229<<24>>24); + if ($230) { + $k$4$i = $225; + } else { + break; + } + } + $231 = (($$03$i) + ($p$3$i)|0); + $$03$i = $231;$mem$0$i = $mem0$0$i;$z$0$i = $z$1$i; + } + } + } while(0); + $$0 = $$0$i; + } + } + } + } + } + } + } while(0); + STACKTOP = sp;return ($$0|0); +} +function _strtok($s,$sep) { + $s = $s|0; + $sep = $sep|0; + var $$0 = 0, $$01 = 0, $$sum = 0, $$sum2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($s|0)==(0|0); + if ($0) { + $1 = HEAP32[6836>>2]|0; + $2 = ($1|0)==(0|0); + if ($2) { + $$0 = 0; + } else { + $$01 = $1; + label = 3; + } + } else { + $$01 = $s; + label = 3; + } + do { + if ((label|0) == 3) { + $3 = (_strspn($$01,$sep)|0); + $4 = (($$01) + ($3)|0); + $5 = HEAP8[$4>>0]|0; + $6 = ($5<<24>>24)==(0); + if ($6) { + HEAP32[6836>>2] = 0; + $$0 = 0; + break; + } + $7 = (_strcspn($4,$sep)|0); + $$sum = (($7) + ($3))|0; + $8 = (($$01) + ($$sum)|0); + HEAP32[6836>>2] = $8; + $9 = HEAP8[$8>>0]|0; + $10 = ($9<<24>>24)==(0); + if ($10) { + HEAP32[6836>>2] = 0; + $$0 = $4; + break; + } else { + $$sum2 = (($$sum) + 1)|0; + $11 = (($$01) + ($$sum2)|0); + HEAP32[6836>>2] = $11; + HEAP8[$8>>0] = 0; + $$0 = $4; + break; + } + } + } while(0); + return ($$0|0); +} +function _scanexp($f,$pok) { + $f = $f|0; + $pok = $pok|0; + var $$lcssa22 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0; + var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0; + var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0; + var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0; + var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0; + var $99 = 0, $c$0 = 0, $c$1$be = 0, $c$1$be$lcssa = 0, $c$112 = 0, $c$2$be = 0, $c$2$lcssa = 0, $c$27 = 0, $c$3$be = 0, $neg$0 = 0, $or$cond3 = 0, $x$013 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 4|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($f)) + 100|0); + $3 = HEAP32[$2>>2]|0; + $4 = ($1>>>0)<($3>>>0); + if ($4) { + $5 = ((($1)) + 1|0); + HEAP32[$0>>2] = $5; + $6 = HEAP8[$1>>0]|0; + $7 = $6&255; + $9 = $7; + } else { + $8 = (___shgetc($f)|0); + $9 = $8; + } + $10 = ($9|0)==(45); + switch ($9|0) { + case 43: case 45: { + $11 = $10&1; + $12 = HEAP32[$0>>2]|0; + $13 = HEAP32[$2>>2]|0; + $14 = ($12>>>0)<($13>>>0); + if ($14) { + $15 = ((($12)) + 1|0); + HEAP32[$0>>2] = $15; + $16 = HEAP8[$12>>0]|0; + $17 = $16&255; + $20 = $17; + } else { + $18 = (___shgetc($f)|0); + $20 = $18; + } + $19 = (($20) + -48)|0; + $21 = ($19>>>0)>(9); + $22 = ($pok|0)!=(0); + $or$cond3 = $22 & $21; + if ($or$cond3) { + $23 = HEAP32[$2>>2]|0; + $24 = ($23|0)==(0|0); + if ($24) { + $c$0 = $20;$neg$0 = $11; + } else { + $25 = HEAP32[$0>>2]|0; + $26 = ((($25)) + -1|0); + HEAP32[$0>>2] = $26; + $c$0 = $20;$neg$0 = $11; + } + } else { + $c$0 = $20;$neg$0 = $11; + } + break; + } + default: { + $c$0 = $9;$neg$0 = 0; + } + } + $27 = (($c$0) + -48)|0; + $28 = ($27>>>0)>(9); + if ($28) { + $29 = HEAP32[$2>>2]|0; + $30 = ($29|0)==(0|0); + if ($30) { + $98 = -2147483648;$99 = 0; + } else { + $31 = HEAP32[$0>>2]|0; + $32 = ((($31)) + -1|0); + HEAP32[$0>>2] = $32; + $98 = -2147483648;$99 = 0; + } + } else { + $c$112 = $c$0;$x$013 = 0; + while(1) { + $33 = ($x$013*10)|0; + $34 = (($c$112) + -48)|0; + $35 = (($34) + ($33))|0; + $36 = HEAP32[$0>>2]|0; + $37 = HEAP32[$2>>2]|0; + $38 = ($36>>>0)<($37>>>0); + if ($38) { + $39 = ((($36)) + 1|0); + HEAP32[$0>>2] = $39; + $40 = HEAP8[$36>>0]|0; + $41 = $40&255; + $c$1$be = $41; + } else { + $42 = (___shgetc($f)|0); + $c$1$be = $42; + } + $43 = (($c$1$be) + -48)|0; + $44 = ($43>>>0)<(10); + $45 = ($35|0)<(214748364); + $46 = $44 & $45; + if ($46) { + $c$112 = $c$1$be;$x$013 = $35; + } else { + $$lcssa22 = $35;$c$1$be$lcssa = $c$1$be; + break; + } + } + $47 = ($$lcssa22|0)<(0); + $48 = $47 << 31 >> 31; + $49 = (($c$1$be$lcssa) + -48)|0; + $50 = ($49>>>0)<(10); + if ($50) { + $53 = $$lcssa22;$54 = $48;$c$27 = $c$1$be$lcssa; + while(1) { + $55 = (___muldi3(($53|0),($54|0),10,0)|0); + $56 = tempRet0; + $57 = ($c$27|0)<(0); + $58 = $57 << 31 >> 31; + $59 = (_i64Add(($c$27|0),($58|0),-48,-1)|0); + $60 = tempRet0; + $61 = (_i64Add(($59|0),($60|0),($55|0),($56|0))|0); + $62 = tempRet0; + $63 = HEAP32[$0>>2]|0; + $64 = HEAP32[$2>>2]|0; + $65 = ($63>>>0)<($64>>>0); + if ($65) { + $66 = ((($63)) + 1|0); + HEAP32[$0>>2] = $66; + $67 = HEAP8[$63>>0]|0; + $68 = $67&255; + $c$2$be = $68; + } else { + $69 = (___shgetc($f)|0); + $c$2$be = $69; + } + $70 = (($c$2$be) + -48)|0; + $71 = ($70>>>0)<(10); + $72 = ($62|0)<(21474836); + $73 = ($61>>>0)<(2061584302); + $74 = ($62|0)==(21474836); + $75 = $74 & $73; + $76 = $72 | $75; + $77 = $71 & $76; + if ($77) { + $53 = $61;$54 = $62;$c$27 = $c$2$be; + } else { + $92 = $61;$93 = $62;$c$2$lcssa = $c$2$be; + break; + } + } + } else { + $92 = $$lcssa22;$93 = $48;$c$2$lcssa = $c$1$be$lcssa; + } + $51 = (($c$2$lcssa) + -48)|0; + $52 = ($51>>>0)<(10); + if ($52) { + while(1) { + $78 = HEAP32[$0>>2]|0; + $79 = HEAP32[$2>>2]|0; + $80 = ($78>>>0)<($79>>>0); + if ($80) { + $81 = ((($78)) + 1|0); + HEAP32[$0>>2] = $81; + $82 = HEAP8[$78>>0]|0; + $83 = $82&255; + $c$3$be = $83; + } else { + $84 = (___shgetc($f)|0); + $c$3$be = $84; + } + $85 = (($c$3$be) + -48)|0; + $86 = ($85>>>0)<(10); + if (!($86)) { + break; + } + } + } + $87 = HEAP32[$2>>2]|0; + $88 = ($87|0)==(0|0); + if (!($88)) { + $89 = HEAP32[$0>>2]|0; + $90 = ((($89)) + -1|0); + HEAP32[$0>>2] = $90; + } + $91 = ($neg$0|0)!=(0); + $94 = (_i64Subtract(0,0,($92|0),($93|0))|0); + $95 = tempRet0; + $96 = $91 ? $94 : $92; + $97 = $91 ? $95 : $93; + $98 = $97;$99 = $96; + } + tempRet0 = ($98); + return ($99|0); +} +function ___fflush_unlocked($f) { + $f = $f|0; + var $$0 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0; + var $9 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 20|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($f)) + 28|0); + $3 = HEAP32[$2>>2]|0; + $4 = ($1>>>0)>($3>>>0); + if ($4) { + $5 = ((($f)) + 36|0); + $6 = HEAP32[$5>>2]|0; + (FUNCTION_TABLE_iiii[$6 & 15]($f,0,0)|0); + $7 = HEAP32[$0>>2]|0; + $8 = ($7|0)==(0|0); + if ($8) { + $$0 = -1; + } else { + label = 3; + } + } else { + label = 3; + } + if ((label|0) == 3) { + $9 = ((($f)) + 4|0); + $10 = HEAP32[$9>>2]|0; + $11 = ((($f)) + 8|0); + $12 = HEAP32[$11>>2]|0; + $13 = ($10>>>0)<($12>>>0); + if ($13) { + $14 = ((($f)) + 40|0); + $15 = HEAP32[$14>>2]|0; + $16 = $10; + $17 = $12; + $18 = (($16) - ($17))|0; + (FUNCTION_TABLE_iiii[$15 & 15]($f,$18,1)|0); + } + $19 = ((($f)) + 16|0); + HEAP32[$19>>2] = 0; + HEAP32[$2>>2] = 0; + HEAP32[$0>>2] = 0; + HEAP32[$11>>2] = 0; + HEAP32[$9>>2] = 0; + $$0 = 0; + } + return ($$0|0); +} +function _printf_core($f,$fmt,$ap,$nl_arg,$nl_type) { + $f = $f|0; + $fmt = $fmt|0; + $ap = $ap|0; + $nl_arg = $nl_arg|0; + $nl_type = $nl_type|0; + var $$ = 0, $$$i = 0, $$0 = 0, $$0$i = 0, $$0$lcssa$i = 0, $$012$i = 0, $$013$i = 0, $$03$i33 = 0, $$07$i = 0.0, $$1$i = 0.0, $$114$i = 0, $$2$i = 0.0, $$20$i = 0.0, $$21$i = 0, $$210$$22$i = 0, $$210$$24$i = 0, $$210$i = 0, $$23$i = 0, $$3$i = 0.0, $$31$i = 0; + var $$311$i = 0, $$4$i = 0.0, $$412$lcssa$i = 0, $$41276$i = 0, $$5$lcssa$i = 0, $$51 = 0, $$587$i = 0, $$a$3$i = 0, $$a$3185$i = 0, $$a$3186$i = 0, $$fl$4 = 0, $$l10n$0 = 0, $$lcssa = 0, $$lcssa159$i = 0, $$lcssa318 = 0, $$lcssa323 = 0, $$lcssa324 = 0, $$lcssa325 = 0, $$lcssa326 = 0, $$lcssa327 = 0; + var $$lcssa329 = 0, $$lcssa339 = 0, $$lcssa342 = 0.0, $$lcssa344 = 0, $$neg52$i = 0, $$neg53$i = 0, $$p$$i = 0, $$p$0 = 0, $$p$5 = 0, $$p$i = 0, $$pn$i = 0, $$pr$i = 0, $$pr47$i = 0, $$pre = 0, $$pre$i = 0, $$pre$phi184$iZ2D = 0, $$pre179$i = 0, $$pre182$i = 0, $$pre183$i = 0, $$pre193 = 0; + var $$sum$i = 0, $$sum15$i = 0, $$sum16$i = 0, $$z$3$i = 0, $$z$4$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0; + var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0; + var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0; + var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0; + var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0; + var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0; + var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0; + var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0; + var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0; + var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0; + var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0; + var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0; + var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0; + var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0; + var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0.0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0.0; + var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0; + var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0.0, $392 = 0.0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0; + var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0.0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0.0, $412 = 0.0, $413 = 0.0, $414 = 0.0, $415 = 0.0, $416 = 0.0, $417 = 0; + var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0; + var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0.0, $443 = 0.0, $444 = 0.0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0; + var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0; + var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0.0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0.0, $486 = 0.0, $487 = 0.0, $488 = 0, $489 = 0, $49 = 0; + var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0; + var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0; + var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0; + var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0; + var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0; + var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0.0, $597 = 0.0, $598 = 0; + var $599 = 0.0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0; + var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0; + var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0; + var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0; + var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0; + var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0; + var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0; + var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0; + var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0; + var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0; + var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0; + var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0; + var $98 = 0, $99 = 0, $a$0 = 0, $a$1 = 0, $a$1$lcssa$i = 0, $a$1147$i = 0, $a$2 = 0, $a$2$ph$i = 0, $a$3$lcssa$i = 0, $a$3134$i = 0, $a$5$lcssa$i = 0, $a$5109$i = 0, $a$6$i = 0, $a$7$i = 0, $a$8$ph$i = 0, $arg = 0, $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0; + var $argpos$0 = 0, $big$i = 0, $buf = 0, $buf$i = 0, $carry$0140$i = 0, $carry3$0128$i = 0, $cnt$0 = 0, $cnt$1 = 0, $cnt$1$lcssa = 0, $d$0$i = 0, $d$0139$i = 0, $d$0141$i = 0, $d$1127$i = 0, $d$2$lcssa$i = 0, $d$2108$i = 0, $d$3$i = 0, $d$482$i = 0, $d$575$i = 0, $d$686$i = 0, $e$0123$i = 0; + var $e$1$i = 0, $e$2104$i = 0, $e$3$i = 0, $e$4$ph$i = 0, $e2$i = 0, $ebuf0$i = 0, $estr$0$i = 0, $estr$1$lcssa$i = 0, $estr$193$i = 0, $estr$2$i = 0, $exitcond$i = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0; + var $expanded8 = 0, $fl$0109 = 0, $fl$062 = 0, $fl$1 = 0, $fl$1$ = 0, $fl$3 = 0, $fl$4 = 0, $fl$6 = 0, $fmt39$lcssa = 0, $fmt39101 = 0, $fmt40 = 0, $fmt41 = 0, $fmt42 = 0, $fmt44 = 0, $fmt44$lcssa321 = 0, $fmt45 = 0, $i$0$lcssa = 0, $i$0$lcssa200 = 0, $i$0114 = 0, $i$0122$i = 0; + var $i$03$i = 0, $i$03$i25 = 0, $i$1$lcssa$i = 0, $i$1116$i = 0, $i$1125 = 0, $i$2100 = 0, $i$2100$lcssa = 0, $i$2103$i = 0, $i$398 = 0, $i$399$i = 0, $isdigit = 0, $isdigit$i = 0, $isdigit$i27 = 0, $isdigit10 = 0, $isdigit12 = 0, $isdigit2$i = 0, $isdigit2$i23 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp$i = 0; + var $isdigittmp$i26 = 0, $isdigittmp1$i = 0, $isdigittmp1$i22 = 0, $isdigittmp11 = 0, $isdigittmp4$i = 0, $isdigittmp4$i24 = 0, $isdigittmp9 = 0, $j$0$i = 0, $j$0115$i = 0, $j$0117$i = 0, $j$1100$i = 0, $j$2$i = 0, $l$0 = 0, $l$0$i = 0, $l$1$i = 0, $l$1113 = 0, $l$2 = 0, $l10n$0 = 0, $l10n$0$lcssa = 0, $l10n$0$phi = 0; + var $l10n$1 = 0, $l10n$2 = 0, $l10n$3 = 0, $mb = 0, $notlhs$i = 0, $notrhs$i = 0, $or$cond = 0, $or$cond$i = 0, $or$cond15 = 0, $or$cond17 = 0, $or$cond20 = 0, $or$cond240 = 0, $or$cond29$i = 0, $or$cond3$not$i = 0, $or$cond6$i = 0, $p$0 = 0, $p$1 = 0, $p$2 = 0, $p$2$ = 0, $p$3 = 0; + var $p$4198 = 0, $p$5 = 0, $pl$0 = 0, $pl$0$i = 0, $pl$1 = 0, $pl$1$i = 0, $pl$2 = 0, $prefix$0 = 0, $prefix$0$$i = 0, $prefix$0$i = 0, $prefix$1 = 0, $prefix$2 = 0, $r$0$a$8$i = 0, $re$169$i = 0, $round$068$i = 0.0, $round6$1$i = 0.0, $s$0$i = 0, $s$1$i = 0, $s$1$i$lcssa = 0, $s1$0$i = 0; + var $s7$079$i = 0, $s7$1$i = 0, $s8$0$lcssa$i = 0, $s8$070$i = 0, $s9$0$i = 0, $s9$183$i = 0, $s9$2$i = 0, $small$0$i = 0.0, $small$1$i = 0.0, $st$0 = 0, $st$0$lcssa322 = 0, $storemerge = 0, $storemerge13 = 0, $storemerge8108 = 0, $storemerge860 = 0, $sum = 0, $t$0 = 0, $t$1 = 0, $w$$i = 0, $w$0 = 0; + var $w$1 = 0, $w$2 = 0, $w$30$i = 0, $wc = 0, $ws$0115 = 0, $ws$1126 = 0, $z$0$i = 0, $z$0$lcssa = 0, $z$0102 = 0, $z$1 = 0, $z$1$lcssa$i = 0, $z$1146$i = 0, $z$2 = 0, $z$2$i = 0, $z$2$i$lcssa = 0, $z$3$lcssa$i = 0, $z$3133$i = 0, $z$4$i = 0, $z$6$$i = 0, $z$6$i = 0; + var $z$6$i$lcssa = 0, $z$6$ph$i = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 624|0; + $big$i = sp + 24|0; + $e2$i = sp + 16|0; + $buf$i = sp + 588|0; + $ebuf0$i = sp + 576|0; + $arg = sp; + $buf = sp + 536|0; + $wc = sp + 8|0; + $mb = sp + 528|0; + $0 = ($f|0)!=(0|0); + $1 = ((($buf)) + 40|0); + $2 = $1; + $3 = ((($buf)) + 39|0); + $4 = ((($wc)) + 4|0); + $5 = ((($ebuf0$i)) + 12|0); + $6 = ((($ebuf0$i)) + 11|0); + $7 = $buf$i; + $8 = $5; + $9 = (($8) - ($7))|0; + $10 = (-2 - ($7))|0; + $11 = (($8) + 2)|0; + $12 = ((($big$i)) + 288|0); + $13 = ((($buf$i)) + 9|0); + $14 = $13; + $15 = ((($buf$i)) + 8|0); + $cnt$0 = 0;$fmt41 = $fmt;$l$0 = 0;$l10n$0 = 0; + L1: while(1) { + $16 = ($cnt$0|0)>(-1); + do { + if ($16) { + $17 = (2147483647 - ($cnt$0))|0; + $18 = ($l$0|0)>($17|0); + if ($18) { + $19 = (___errno_location()|0); + HEAP32[$19>>2] = 75; + $cnt$1 = -1; + break; + } else { + $20 = (($l$0) + ($cnt$0))|0; + $cnt$1 = $20; + break; + } + } else { + $cnt$1 = $cnt$0; + } + } while(0); + $21 = HEAP8[$fmt41>>0]|0; + $22 = ($21<<24>>24)==(0); + if ($22) { + $cnt$1$lcssa = $cnt$1;$l10n$0$lcssa = $l10n$0; + label = 245; + break; + } else { + $23 = $21;$fmt40 = $fmt41; + } + L9: while(1) { + switch ($23<<24>>24) { + case 37: { + $fmt39101 = $fmt40;$z$0102 = $fmt40; + label = 9; + break L9; + break; + } + case 0: { + $fmt39$lcssa = $fmt40;$z$0$lcssa = $fmt40; + break L9; + break; + } + default: { + } + } + $24 = ((($fmt40)) + 1|0); + $$pre = HEAP8[$24>>0]|0; + $23 = $$pre;$fmt40 = $24; + } + L12: do { + if ((label|0) == 9) { + while(1) { + label = 0; + $25 = ((($fmt39101)) + 1|0); + $26 = HEAP8[$25>>0]|0; + $27 = ($26<<24>>24)==(37); + if (!($27)) { + $fmt39$lcssa = $fmt39101;$z$0$lcssa = $z$0102; + break L12; + } + $28 = ((($z$0102)) + 1|0); + $29 = ((($fmt39101)) + 2|0); + $30 = HEAP8[$29>>0]|0; + $31 = ($30<<24>>24)==(37); + if ($31) { + $fmt39101 = $29;$z$0102 = $28; + label = 9; + } else { + $fmt39$lcssa = $29;$z$0$lcssa = $28; + break; + } + } + } + } while(0); + $32 = $z$0$lcssa; + $33 = $fmt41; + $34 = (($32) - ($33))|0; + if ($0) { + $35 = HEAP32[$f>>2]|0; + $36 = $35 & 32; + $37 = ($36|0)==(0); + if ($37) { + (___fwritex($fmt41,$34,$f)|0); + } + } + $38 = ($z$0$lcssa|0)==($fmt41|0); + if (!($38)) { + $l10n$0$phi = $l10n$0;$cnt$0 = $cnt$1;$fmt41 = $fmt39$lcssa;$l$0 = $34;$l10n$0 = $l10n$0$phi; + continue; + } + $39 = ((($fmt39$lcssa)) + 1|0); + $40 = HEAP8[$39>>0]|0; + $41 = $40 << 24 >> 24; + $isdigittmp = (($41) + -48)|0; + $isdigit = ($isdigittmp>>>0)<(10); + if ($isdigit) { + $42 = ((($fmt39$lcssa)) + 2|0); + $43 = HEAP8[$42>>0]|0; + $44 = ($43<<24>>24)==(36); + $45 = ((($fmt39$lcssa)) + 3|0); + $$51 = $44 ? $45 : $39; + $$l10n$0 = $44 ? 1 : $l10n$0; + $isdigittmp$ = $44 ? $isdigittmp : -1; + $$pre193 = HEAP8[$$51>>0]|0; + $47 = $$pre193;$argpos$0 = $isdigittmp$;$l10n$1 = $$l10n$0;$storemerge = $$51; + } else { + $47 = $40;$argpos$0 = -1;$l10n$1 = $l10n$0;$storemerge = $39; + } + $46 = $47 << 24 >> 24; + $48 = $46 & -32; + $49 = ($48|0)==(32); + L25: do { + if ($49) { + $51 = $46;$56 = $47;$fl$0109 = 0;$storemerge8108 = $storemerge; + while(1) { + $50 = (($51) + -32)|0; + $52 = 1 << $50; + $53 = $52 & 75913; + $54 = ($53|0)==(0); + if ($54) { + $65 = $56;$fl$062 = $fl$0109;$storemerge860 = $storemerge8108; + break L25; + } + $55 = $56 << 24 >> 24; + $57 = (($55) + -32)|0; + $58 = 1 << $57; + $59 = $58 | $fl$0109; + $60 = ((($storemerge8108)) + 1|0); + $61 = HEAP8[$60>>0]|0; + $62 = $61 << 24 >> 24; + $63 = $62 & -32; + $64 = ($63|0)==(32); + if ($64) { + $51 = $62;$56 = $61;$fl$0109 = $59;$storemerge8108 = $60; + } else { + $65 = $61;$fl$062 = $59;$storemerge860 = $60; + break; + } + } + } else { + $65 = $47;$fl$062 = 0;$storemerge860 = $storemerge; + } + } while(0); + $66 = ($65<<24>>24)==(42); + do { + if ($66) { + $67 = ((($storemerge860)) + 1|0); + $68 = HEAP8[$67>>0]|0; + $69 = $68 << 24 >> 24; + $isdigittmp11 = (($69) + -48)|0; + $isdigit12 = ($isdigittmp11>>>0)<(10); + if ($isdigit12) { + $70 = ((($storemerge860)) + 2|0); + $71 = HEAP8[$70>>0]|0; + $72 = ($71<<24>>24)==(36); + if ($72) { + $73 = (($nl_type) + ($isdigittmp11<<2)|0); + HEAP32[$73>>2] = 10; + $74 = HEAP8[$67>>0]|0; + $75 = $74 << 24 >> 24; + $76 = (($75) + -48)|0; + $77 = (($nl_arg) + ($76<<3)|0); + $78 = $77; + $79 = $78; + $80 = HEAP32[$79>>2]|0; + $81 = (($78) + 4)|0; + $82 = $81; + $83 = HEAP32[$82>>2]|0; + $84 = ((($storemerge860)) + 3|0); + $l10n$2 = 1;$storemerge13 = $84;$w$0 = $80; + } else { + label = 24; + } + } else { + label = 24; + } + if ((label|0) == 24) { + label = 0; + $85 = ($l10n$1|0)==(0); + if (!($85)) { + $$0 = -1; + break L1; + } + if (!($0)) { + $fl$1 = $fl$062;$fmt42 = $67;$l10n$3 = 0;$w$1 = 0; + break; + } + $arglist_current = HEAP32[$ap>>2]|0; + $86 = $arglist_current; + $87 = ((0) + 4|0); + $expanded4 = $87; + $expanded = (($expanded4) - 1)|0; + $88 = (($86) + ($expanded))|0; + $89 = ((0) + 4|0); + $expanded8 = $89; + $expanded7 = (($expanded8) - 1)|0; + $expanded6 = $expanded7 ^ -1; + $90 = $88 & $expanded6; + $91 = $90; + $92 = HEAP32[$91>>2]|0; + $arglist_next = ((($91)) + 4|0); + HEAP32[$ap>>2] = $arglist_next; + $l10n$2 = 0;$storemerge13 = $67;$w$0 = $92; + } + $93 = ($w$0|0)<(0); + if ($93) { + $94 = $fl$062 | 8192; + $95 = (0 - ($w$0))|0; + $fl$1 = $94;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $95; + } else { + $fl$1 = $fl$062;$fmt42 = $storemerge13;$l10n$3 = $l10n$2;$w$1 = $w$0; + } + } else { + $96 = $65 << 24 >> 24; + $isdigittmp1$i = (($96) + -48)|0; + $isdigit2$i = ($isdigittmp1$i>>>0)<(10); + if ($isdigit2$i) { + $100 = $storemerge860;$i$03$i = 0;$isdigittmp4$i = $isdigittmp1$i; + while(1) { + $97 = ($i$03$i*10)|0; + $98 = (($97) + ($isdigittmp4$i))|0; + $99 = ((($100)) + 1|0); + $101 = HEAP8[$99>>0]|0; + $102 = $101 << 24 >> 24; + $isdigittmp$i = (($102) + -48)|0; + $isdigit$i = ($isdigittmp$i>>>0)<(10); + if ($isdigit$i) { + $100 = $99;$i$03$i = $98;$isdigittmp4$i = $isdigittmp$i; + } else { + $$lcssa = $98;$$lcssa318 = $99; + break; + } + } + $103 = ($$lcssa|0)<(0); + if ($103) { + $$0 = -1; + break L1; + } else { + $fl$1 = $fl$062;$fmt42 = $$lcssa318;$l10n$3 = $l10n$1;$w$1 = $$lcssa; + } + } else { + $fl$1 = $fl$062;$fmt42 = $storemerge860;$l10n$3 = $l10n$1;$w$1 = 0; + } + } + } while(0); + $104 = HEAP8[$fmt42>>0]|0; + $105 = ($104<<24>>24)==(46); + L46: do { + if ($105) { + $106 = ((($fmt42)) + 1|0); + $107 = HEAP8[$106>>0]|0; + $108 = ($107<<24>>24)==(42); + if (!($108)) { + $135 = $107 << 24 >> 24; + $isdigittmp1$i22 = (($135) + -48)|0; + $isdigit2$i23 = ($isdigittmp1$i22>>>0)<(10); + if ($isdigit2$i23) { + $139 = $106;$i$03$i25 = 0;$isdigittmp4$i24 = $isdigittmp1$i22; + } else { + $fmt45 = $106;$p$0 = 0; + break; + } + while(1) { + $136 = ($i$03$i25*10)|0; + $137 = (($136) + ($isdigittmp4$i24))|0; + $138 = ((($139)) + 1|0); + $140 = HEAP8[$138>>0]|0; + $141 = $140 << 24 >> 24; + $isdigittmp$i26 = (($141) + -48)|0; + $isdigit$i27 = ($isdigittmp$i26>>>0)<(10); + if ($isdigit$i27) { + $139 = $138;$i$03$i25 = $137;$isdigittmp4$i24 = $isdigittmp$i26; + } else { + $fmt45 = $138;$p$0 = $137; + break L46; + } + } + } + $109 = ((($fmt42)) + 2|0); + $110 = HEAP8[$109>>0]|0; + $111 = $110 << 24 >> 24; + $isdigittmp9 = (($111) + -48)|0; + $isdigit10 = ($isdigittmp9>>>0)<(10); + if ($isdigit10) { + $112 = ((($fmt42)) + 3|0); + $113 = HEAP8[$112>>0]|0; + $114 = ($113<<24>>24)==(36); + if ($114) { + $115 = (($nl_type) + ($isdigittmp9<<2)|0); + HEAP32[$115>>2] = 10; + $116 = HEAP8[$109>>0]|0; + $117 = $116 << 24 >> 24; + $118 = (($117) + -48)|0; + $119 = (($nl_arg) + ($118<<3)|0); + $120 = $119; + $121 = $120; + $122 = HEAP32[$121>>2]|0; + $123 = (($120) + 4)|0; + $124 = $123; + $125 = HEAP32[$124>>2]|0; + $126 = ((($fmt42)) + 4|0); + $fmt45 = $126;$p$0 = $122; + break; + } + } + $127 = ($l10n$3|0)==(0); + if (!($127)) { + $$0 = -1; + break L1; + } + if ($0) { + $arglist_current2 = HEAP32[$ap>>2]|0; + $128 = $arglist_current2; + $129 = ((0) + 4|0); + $expanded11 = $129; + $expanded10 = (($expanded11) - 1)|0; + $130 = (($128) + ($expanded10))|0; + $131 = ((0) + 4|0); + $expanded15 = $131; + $expanded14 = (($expanded15) - 1)|0; + $expanded13 = $expanded14 ^ -1; + $132 = $130 & $expanded13; + $133 = $132; + $134 = HEAP32[$133>>2]|0; + $arglist_next3 = ((($133)) + 4|0); + HEAP32[$ap>>2] = $arglist_next3; + $fmt45 = $109;$p$0 = $134; + } else { + $fmt45 = $109;$p$0 = 0; + } + } else { + $fmt45 = $fmt42;$p$0 = -1; + } + } while(0); + $fmt44 = $fmt45;$st$0 = 0; + while(1) { + $142 = HEAP8[$fmt44>>0]|0; + $143 = $142 << 24 >> 24; + $144 = (($143) + -65)|0; + $145 = ($144>>>0)>(57); + if ($145) { + $$0 = -1; + break L1; + } + $146 = ((($fmt44)) + 1|0); + $147 = ((23774 + (($st$0*58)|0)|0) + ($144)|0); + $148 = HEAP8[$147>>0]|0; + $149 = $148&255; + $150 = (($149) + -1)|0; + $151 = ($150>>>0)<(8); + if ($151) { + $fmt44 = $146;$st$0 = $149; + } else { + $$lcssa323 = $146;$$lcssa324 = $148;$$lcssa325 = $149;$fmt44$lcssa321 = $fmt44;$st$0$lcssa322 = $st$0; + break; + } + } + $152 = ($$lcssa324<<24>>24)==(0); + if ($152) { + $$0 = -1; + break; + } + $153 = ($$lcssa324<<24>>24)==(19); + $154 = ($argpos$0|0)>(-1); + do { + if ($153) { + if ($154) { + $$0 = -1; + break L1; + } else { + label = 52; + } + } else { + if ($154) { + $155 = (($nl_type) + ($argpos$0<<2)|0); + HEAP32[$155>>2] = $$lcssa325; + $156 = (($nl_arg) + ($argpos$0<<3)|0); + $157 = $156; + $158 = $157; + $159 = HEAP32[$158>>2]|0; + $160 = (($157) + 4)|0; + $161 = $160; + $162 = HEAP32[$161>>2]|0; + $163 = $arg; + $164 = $163; + HEAP32[$164>>2] = $159; + $165 = (($163) + 4)|0; + $166 = $165; + HEAP32[$166>>2] = $162; + label = 52; + break; + } + if (!($0)) { + $$0 = 0; + break L1; + } + _pop_arg($arg,$$lcssa325,$ap); + } + } while(0); + if ((label|0) == 52) { + label = 0; + if (!($0)) { + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue; + } + } + $167 = HEAP8[$fmt44$lcssa321>>0]|0; + $168 = $167 << 24 >> 24; + $169 = ($st$0$lcssa322|0)!=(0); + $170 = $168 & 15; + $171 = ($170|0)==(3); + $or$cond15 = $169 & $171; + $172 = $168 & -33; + $t$0 = $or$cond15 ? $172 : $168; + $173 = $fl$1 & 8192; + $174 = ($173|0)==(0); + $175 = $fl$1 & -65537; + $fl$1$ = $174 ? $fl$1 : $175; + L75: do { + switch ($t$0|0) { + case 110: { + switch ($st$0$lcssa322|0) { + case 0: { + $182 = HEAP32[$arg>>2]|0; + HEAP32[$182>>2] = $cnt$1; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + case 1: { + $183 = HEAP32[$arg>>2]|0; + HEAP32[$183>>2] = $cnt$1; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + case 2: { + $184 = ($cnt$1|0)<(0); + $185 = $184 << 31 >> 31; + $186 = HEAP32[$arg>>2]|0; + $187 = $186; + $188 = $187; + HEAP32[$188>>2] = $cnt$1; + $189 = (($187) + 4)|0; + $190 = $189; + HEAP32[$190>>2] = $185; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + case 3: { + $191 = $cnt$1&65535; + $192 = HEAP32[$arg>>2]|0; + HEAP16[$192>>1] = $191; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + case 4: { + $193 = $cnt$1&255; + $194 = HEAP32[$arg>>2]|0; + HEAP8[$194>>0] = $193; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + case 6: { + $195 = HEAP32[$arg>>2]|0; + HEAP32[$195>>2] = $cnt$1; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + case 7: { + $196 = ($cnt$1|0)<(0); + $197 = $196 << 31 >> 31; + $198 = HEAP32[$arg>>2]|0; + $199 = $198; + $200 = $199; + HEAP32[$200>>2] = $cnt$1; + $201 = (($199) + 4)|0; + $202 = $201; + HEAP32[$202>>2] = $197; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + break; + } + default: { + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $34;$l10n$0 = $l10n$3; + continue L1; + } + } + break; + } + case 112: { + $203 = ($p$0>>>0)>(8); + $204 = $203 ? $p$0 : 8; + $205 = $fl$1$ | 8; + $fl$3 = $205;$p$1 = $204;$t$1 = 120; + label = 64; + break; + } + case 88: case 120: { + $fl$3 = $fl$1$;$p$1 = $p$0;$t$1 = $t$0; + label = 64; + break; + } + case 111: { + $243 = $arg; + $244 = $243; + $245 = HEAP32[$244>>2]|0; + $246 = (($243) + 4)|0; + $247 = $246; + $248 = HEAP32[$247>>2]|0; + $249 = ($245|0)==(0); + $250 = ($248|0)==(0); + $251 = $249 & $250; + if ($251) { + $$0$lcssa$i = $1; + } else { + $$03$i33 = $1;$253 = $245;$257 = $248; + while(1) { + $252 = $253 & 7; + $254 = $252 | 48; + $255 = $254&255; + $256 = ((($$03$i33)) + -1|0); + HEAP8[$256>>0] = $255; + $258 = (_bitshift64Lshr(($253|0),($257|0),3)|0); + $259 = tempRet0; + $260 = ($258|0)==(0); + $261 = ($259|0)==(0); + $262 = $260 & $261; + if ($262) { + $$0$lcssa$i = $256; + break; + } else { + $$03$i33 = $256;$253 = $258;$257 = $259; + } + } + } + $263 = $fl$1$ & 8; + $264 = ($263|0)==(0); + if ($264) { + $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = 0;$prefix$1 = 24254; + label = 77; + } else { + $265 = $$0$lcssa$i; + $266 = (($2) - ($265))|0; + $267 = (($266) + 1)|0; + $268 = ($p$0|0)<($267|0); + $$p$0 = $268 ? $267 : $p$0; + $a$0 = $$0$lcssa$i;$fl$4 = $fl$1$;$p$2 = $$p$0;$pl$1 = 0;$prefix$1 = 24254; + label = 77; + } + break; + } + case 105: case 100: { + $269 = $arg; + $270 = $269; + $271 = HEAP32[$270>>2]|0; + $272 = (($269) + 4)|0; + $273 = $272; + $274 = HEAP32[$273>>2]|0; + $275 = ($274|0)<(0); + if ($275) { + $276 = (_i64Subtract(0,0,($271|0),($274|0))|0); + $277 = tempRet0; + $278 = $arg; + $279 = $278; + HEAP32[$279>>2] = $276; + $280 = (($278) + 4)|0; + $281 = $280; + HEAP32[$281>>2] = $277; + $286 = $276;$287 = $277;$pl$0 = 1;$prefix$0 = 24254; + label = 76; + break L75; + } + $282 = $fl$1$ & 2048; + $283 = ($282|0)==(0); + if ($283) { + $284 = $fl$1$ & 1; + $285 = ($284|0)==(0); + $$ = $285 ? 24254 : (24256); + $286 = $271;$287 = $274;$pl$0 = $284;$prefix$0 = $$; + label = 76; + } else { + $286 = $271;$287 = $274;$pl$0 = 1;$prefix$0 = (24255); + label = 76; + } + break; + } + case 117: { + $176 = $arg; + $177 = $176; + $178 = HEAP32[$177>>2]|0; + $179 = (($176) + 4)|0; + $180 = $179; + $181 = HEAP32[$180>>2]|0; + $286 = $178;$287 = $181;$pl$0 = 0;$prefix$0 = 24254; + label = 76; + break; + } + case 99: { + $307 = $arg; + $308 = $307; + $309 = HEAP32[$308>>2]|0; + $310 = (($307) + 4)|0; + $311 = $310; + $312 = HEAP32[$311>>2]|0; + $313 = $309&255; + HEAP8[$3>>0] = $313; + $a$2 = $3;$fl$6 = $175;$p$5 = 1;$pl$2 = 0;$prefix$2 = 24254;$z$2 = $1; + break; + } + case 109: { + $314 = (___errno_location()|0); + $315 = HEAP32[$314>>2]|0; + $316 = (_strerror($315)|0); + $a$1 = $316; + label = 82; + break; + } + case 115: { + $317 = HEAP32[$arg>>2]|0; + $318 = ($317|0)!=(0|0); + $319 = $318 ? $317 : 24264; + $a$1 = $319; + label = 82; + break; + } + case 67: { + $326 = $arg; + $327 = $326; + $328 = HEAP32[$327>>2]|0; + $329 = (($326) + 4)|0; + $330 = $329; + $331 = HEAP32[$330>>2]|0; + HEAP32[$wc>>2] = $328; + HEAP32[$4>>2] = 0; + HEAP32[$arg>>2] = $wc; + $p$4198 = -1; + label = 86; + break; + } + case 83: { + $332 = ($p$0|0)==(0); + if ($332) { + _pad($f,32,$w$1,0,$fl$1$); + $i$0$lcssa200 = 0; + label = 98; + } else { + $p$4198 = $p$0; + label = 86; + } + break; + } + case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: { + $359 = +HEAPF64[$arg>>3]; + HEAP32[$e2$i>>2] = 0; + HEAPF64[tempDoublePtr>>3] = $359;$360 = HEAP32[tempDoublePtr>>2]|0; + $361 = HEAP32[tempDoublePtr+4>>2]|0; + $362 = ($361|0)<(0); + if ($362) { + $363 = -$359; + $$07$i = $363;$pl$0$i = 1;$prefix$0$i = 24271; + } else { + $364 = $fl$1$ & 2048; + $365 = ($364|0)==(0); + if ($365) { + $366 = $fl$1$ & 1; + $367 = ($366|0)==(0); + $$$i = $367 ? (24272) : (24277); + $$07$i = $359;$pl$0$i = $366;$prefix$0$i = $$$i; + } else { + $$07$i = $359;$pl$0$i = 1;$prefix$0$i = (24274); + } + } + HEAPF64[tempDoublePtr>>3] = $$07$i;$368 = HEAP32[tempDoublePtr>>2]|0; + $369 = HEAP32[tempDoublePtr+4>>2]|0; + $370 = $369 & 2146435072; + $371 = ($370>>>0)<(2146435072); + $372 = (0)<(0); + $373 = ($370|0)==(2146435072); + $374 = $373 & $372; + $375 = $371 | $374; + do { + if ($375) { + $391 = (+_frexpl($$07$i,$e2$i)); + $392 = $391 * 2.0; + $393 = $392 != 0.0; + if ($393) { + $394 = HEAP32[$e2$i>>2]|0; + $395 = (($394) + -1)|0; + HEAP32[$e2$i>>2] = $395; + } + $396 = $t$0 | 32; + $397 = ($396|0)==(97); + if ($397) { + $398 = $t$0 & 32; + $399 = ($398|0)==(0); + $400 = ((($prefix$0$i)) + 9|0); + $prefix$0$$i = $399 ? $prefix$0$i : $400; + $401 = $pl$0$i | 2; + $402 = ($p$0>>>0)>(11); + $403 = (12 - ($p$0))|0; + $404 = ($403|0)==(0); + $405 = $402 | $404; + do { + if ($405) { + $$1$i = $392; + } else { + $re$169$i = $403;$round$068$i = 8.0; + while(1) { + $406 = (($re$169$i) + -1)|0; + $407 = $round$068$i * 16.0; + $408 = ($406|0)==(0); + if ($408) { + $$lcssa342 = $407; + break; + } else { + $re$169$i = $406;$round$068$i = $407; + } + } + $409 = HEAP8[$prefix$0$$i>>0]|0; + $410 = ($409<<24>>24)==(45); + if ($410) { + $411 = -$392; + $412 = $411 - $$lcssa342; + $413 = $$lcssa342 + $412; + $414 = -$413; + $$1$i = $414; + break; + } else { + $415 = $392 + $$lcssa342; + $416 = $415 - $$lcssa342; + $$1$i = $416; + break; + } + } + } while(0); + $417 = HEAP32[$e2$i>>2]|0; + $418 = ($417|0)<(0); + $419 = (0 - ($417))|0; + $420 = $418 ? $419 : $417; + $421 = ($420|0)<(0); + $422 = $421 << 31 >> 31; + $423 = (_fmt_u($420,$422,$5)|0); + $424 = ($423|0)==($5|0); + if ($424) { + HEAP8[$6>>0] = 48; + $estr$0$i = $6; + } else { + $estr$0$i = $423; + } + $425 = $417 >> 31; + $426 = $425 & 2; + $427 = (($426) + 43)|0; + $428 = $427&255; + $429 = ((($estr$0$i)) + -1|0); + HEAP8[$429>>0] = $428; + $430 = (($t$0) + 15)|0; + $431 = $430&255; + $432 = ((($estr$0$i)) + -2|0); + HEAP8[$432>>0] = $431; + $notrhs$i = ($p$0|0)<(1); + $433 = $fl$1$ & 8; + $434 = ($433|0)==(0); + $$2$i = $$1$i;$s$0$i = $buf$i; + while(1) { + $435 = (~~(($$2$i))); + $436 = (24238 + ($435)|0); + $437 = HEAP8[$436>>0]|0; + $438 = $437&255; + $439 = $438 | $398; + $440 = $439&255; + $441 = ((($s$0$i)) + 1|0); + HEAP8[$s$0$i>>0] = $440; + $442 = (+($435|0)); + $443 = $$2$i - $442; + $444 = $443 * 16.0; + $445 = $441; + $446 = (($445) - ($7))|0; + $447 = ($446|0)==(1); + do { + if ($447) { + $notlhs$i = $444 == 0.0; + $or$cond3$not$i = $notrhs$i & $notlhs$i; + $or$cond$i = $434 & $or$cond3$not$i; + if ($or$cond$i) { + $s$1$i = $441; + break; + } + $448 = ((($s$0$i)) + 2|0); + HEAP8[$441>>0] = 46; + $s$1$i = $448; + } else { + $s$1$i = $441; + } + } while(0); + $449 = $444 != 0.0; + if ($449) { + $$2$i = $444;$s$0$i = $s$1$i; + } else { + $s$1$i$lcssa = $s$1$i; + break; + } + } + $450 = ($p$0|0)!=(0); + $$pre182$i = $s$1$i$lcssa; + $451 = (($10) + ($$pre182$i))|0; + $452 = ($451|0)<($p$0|0); + $or$cond240 = $450 & $452; + $453 = $432; + $454 = (($11) + ($p$0))|0; + $455 = (($454) - ($453))|0; + $456 = $432; + $457 = (($9) - ($456))|0; + $458 = (($457) + ($$pre182$i))|0; + $l$0$i = $or$cond240 ? $455 : $458; + $459 = (($l$0$i) + ($401))|0; + _pad($f,32,$w$1,$459,$fl$1$); + $460 = HEAP32[$f>>2]|0; + $461 = $460 & 32; + $462 = ($461|0)==(0); + if ($462) { + (___fwritex($prefix$0$$i,$401,$f)|0); + } + $463 = $fl$1$ ^ 65536; + _pad($f,48,$w$1,$459,$463); + $464 = (($$pre182$i) - ($7))|0; + $465 = HEAP32[$f>>2]|0; + $466 = $465 & 32; + $467 = ($466|0)==(0); + if ($467) { + (___fwritex($buf$i,$464,$f)|0); + } + $468 = $432; + $469 = (($8) - ($468))|0; + $sum = (($464) + ($469))|0; + $470 = (($l$0$i) - ($sum))|0; + _pad($f,48,$470,0,0); + $471 = HEAP32[$f>>2]|0; + $472 = $471 & 32; + $473 = ($472|0)==(0); + if ($473) { + (___fwritex($432,$469,$f)|0); + } + $474 = $fl$1$ ^ 8192; + _pad($f,32,$w$1,$459,$474); + $475 = ($459|0)<($w$1|0); + $w$$i = $475 ? $w$1 : $459; + $$0$i = $w$$i; + break; + } + $476 = ($p$0|0)<(0); + $$p$i = $476 ? 6 : $p$0; + if ($393) { + $477 = $392 * 268435456.0; + $478 = HEAP32[$e2$i>>2]|0; + $479 = (($478) + -28)|0; + HEAP32[$e2$i>>2] = $479; + $$3$i = $477;$480 = $479; + } else { + $$pre179$i = HEAP32[$e2$i>>2]|0; + $$3$i = $392;$480 = $$pre179$i; + } + $481 = ($480|0)<(0); + $$31$i = $481 ? $big$i : $12; + $482 = $$31$i; + $$4$i = $$3$i;$z$0$i = $$31$i; + while(1) { + $483 = (~~(($$4$i))>>>0); + HEAP32[$z$0$i>>2] = $483; + $484 = ((($z$0$i)) + 4|0); + $485 = (+($483>>>0)); + $486 = $$4$i - $485; + $487 = $486 * 1.0E+9; + $488 = $487 != 0.0; + if ($488) { + $$4$i = $487;$z$0$i = $484; + } else { + $$lcssa326 = $484; + break; + } + } + $$pr$i = HEAP32[$e2$i>>2]|0; + $489 = ($$pr$i|0)>(0); + if ($489) { + $490 = $$pr$i;$a$1147$i = $$31$i;$z$1146$i = $$lcssa326; + while(1) { + $491 = ($490|0)>(29); + $492 = $491 ? 29 : $490; + $d$0139$i = ((($z$1146$i)) + -4|0); + $493 = ($d$0139$i>>>0)<($a$1147$i>>>0); + do { + if ($493) { + $a$2$ph$i = $a$1147$i; + } else { + $carry$0140$i = 0;$d$0141$i = $d$0139$i; + while(1) { + $494 = HEAP32[$d$0141$i>>2]|0; + $495 = (_bitshift64Shl(($494|0),0,($492|0))|0); + $496 = tempRet0; + $497 = (_i64Add(($495|0),($496|0),($carry$0140$i|0),0)|0); + $498 = tempRet0; + $499 = (___uremdi3(($497|0),($498|0),1000000000,0)|0); + $500 = tempRet0; + HEAP32[$d$0141$i>>2] = $499; + $501 = (___udivdi3(($497|0),($498|0),1000000000,0)|0); + $502 = tempRet0; + $d$0$i = ((($d$0141$i)) + -4|0); + $503 = ($d$0$i>>>0)<($a$1147$i>>>0); + if ($503) { + $$lcssa327 = $501; + break; + } else { + $carry$0140$i = $501;$d$0141$i = $d$0$i; + } + } + $504 = ($$lcssa327|0)==(0); + if ($504) { + $a$2$ph$i = $a$1147$i; + break; + } + $505 = ((($a$1147$i)) + -4|0); + HEAP32[$505>>2] = $$lcssa327; + $a$2$ph$i = $505; + } + } while(0); + $z$2$i = $z$1146$i; + while(1) { + $506 = ($z$2$i>>>0)>($a$2$ph$i>>>0); + if (!($506)) { + $z$2$i$lcssa = $z$2$i; + break; + } + $507 = ((($z$2$i)) + -4|0); + $508 = HEAP32[$507>>2]|0; + $509 = ($508|0)==(0); + if ($509) { + $z$2$i = $507; + } else { + $z$2$i$lcssa = $z$2$i; + break; + } + } + $510 = HEAP32[$e2$i>>2]|0; + $511 = (($510) - ($492))|0; + HEAP32[$e2$i>>2] = $511; + $512 = ($511|0)>(0); + if ($512) { + $490 = $511;$a$1147$i = $a$2$ph$i;$z$1146$i = $z$2$i$lcssa; + } else { + $$pr47$i = $511;$a$1$lcssa$i = $a$2$ph$i;$z$1$lcssa$i = $z$2$i$lcssa; + break; + } + } + } else { + $$pr47$i = $$pr$i;$a$1$lcssa$i = $$31$i;$z$1$lcssa$i = $$lcssa326; + } + $513 = ($$pr47$i|0)<(0); + if ($513) { + $514 = (($$p$i) + 25)|0; + $515 = (($514|0) / 9)&-1; + $516 = (($515) + 1)|0; + $517 = ($396|0)==(102); + $519 = $$pr47$i;$a$3134$i = $a$1$lcssa$i;$z$3133$i = $z$1$lcssa$i; + while(1) { + $518 = (0 - ($519))|0; + $520 = ($518|0)>(9); + $521 = $520 ? 9 : $518; + $522 = ($a$3134$i>>>0)<($z$3133$i>>>0); + do { + if ($522) { + $526 = 1 << $521; + $527 = (($526) + -1)|0; + $528 = 1000000000 >>> $521; + $carry3$0128$i = 0;$d$1127$i = $a$3134$i; + while(1) { + $529 = HEAP32[$d$1127$i>>2]|0; + $530 = $529 & $527; + $531 = $529 >>> $521; + $532 = (($531) + ($carry3$0128$i))|0; + HEAP32[$d$1127$i>>2] = $532; + $533 = Math_imul($530, $528)|0; + $534 = ((($d$1127$i)) + 4|0); + $535 = ($534>>>0)<($z$3133$i>>>0); + if ($535) { + $carry3$0128$i = $533;$d$1127$i = $534; + } else { + $$lcssa329 = $533; + break; + } + } + $536 = HEAP32[$a$3134$i>>2]|0; + $537 = ($536|0)==(0); + $538 = ((($a$3134$i)) + 4|0); + $$a$3$i = $537 ? $538 : $a$3134$i; + $539 = ($$lcssa329|0)==(0); + if ($539) { + $$a$3186$i = $$a$3$i;$z$4$i = $z$3133$i; + break; + } + $540 = ((($z$3133$i)) + 4|0); + HEAP32[$z$3133$i>>2] = $$lcssa329; + $$a$3186$i = $$a$3$i;$z$4$i = $540; + } else { + $523 = HEAP32[$a$3134$i>>2]|0; + $524 = ($523|0)==(0); + $525 = ((($a$3134$i)) + 4|0); + $$a$3185$i = $524 ? $525 : $a$3134$i; + $$a$3186$i = $$a$3185$i;$z$4$i = $z$3133$i; + } + } while(0); + $541 = $517 ? $$31$i : $$a$3186$i; + $542 = $z$4$i; + $543 = $541; + $544 = (($542) - ($543))|0; + $545 = $544 >> 2; + $546 = ($545|0)>($516|0); + $547 = (($541) + ($516<<2)|0); + $$z$4$i = $546 ? $547 : $z$4$i; + $548 = HEAP32[$e2$i>>2]|0; + $549 = (($548) + ($521))|0; + HEAP32[$e2$i>>2] = $549; + $550 = ($549|0)<(0); + if ($550) { + $519 = $549;$a$3134$i = $$a$3186$i;$z$3133$i = $$z$4$i; + } else { + $a$3$lcssa$i = $$a$3186$i;$z$3$lcssa$i = $$z$4$i; + break; + } + } + } else { + $a$3$lcssa$i = $a$1$lcssa$i;$z$3$lcssa$i = $z$1$lcssa$i; + } + $551 = ($a$3$lcssa$i>>>0)<($z$3$lcssa$i>>>0); + do { + if ($551) { + $552 = $a$3$lcssa$i; + $553 = (($482) - ($552))|0; + $554 = $553 >> 2; + $555 = ($554*9)|0; + $556 = HEAP32[$a$3$lcssa$i>>2]|0; + $557 = ($556>>>0)<(10); + if ($557) { + $e$1$i = $555; + break; + } else { + $e$0123$i = $555;$i$0122$i = 10; + } + while(1) { + $558 = ($i$0122$i*10)|0; + $559 = (($e$0123$i) + 1)|0; + $560 = ($556>>>0)<($558>>>0); + if ($560) { + $e$1$i = $559; + break; + } else { + $e$0123$i = $559;$i$0122$i = $558; + } + } + } else { + $e$1$i = 0; + } + } while(0); + $561 = ($396|0)!=(102); + $562 = $561 ? $e$1$i : 0; + $563 = (($$p$i) - ($562))|0; + $564 = ($396|0)==(103); + $565 = ($$p$i|0)!=(0); + $566 = $565 & $564; + $$neg52$i = $566 << 31 >> 31; + $567 = (($563) + ($$neg52$i))|0; + $568 = $z$3$lcssa$i; + $569 = (($568) - ($482))|0; + $570 = $569 >> 2; + $571 = ($570*9)|0; + $572 = (($571) + -9)|0; + $573 = ($567|0)<($572|0); + if ($573) { + $574 = (($567) + 9216)|0; + $575 = (($574|0) / 9)&-1; + $$sum$i = (($575) + -1023)|0; + $576 = (($$31$i) + ($$sum$i<<2)|0); + $577 = (($574|0) % 9)&-1; + $j$0115$i = (($577) + 1)|0; + $578 = ($j$0115$i|0)<(9); + if ($578) { + $i$1116$i = 10;$j$0117$i = $j$0115$i; + while(1) { + $579 = ($i$1116$i*10)|0; + $j$0$i = (($j$0117$i) + 1)|0; + $exitcond$i = ($j$0$i|0)==(9); + if ($exitcond$i) { + $i$1$lcssa$i = $579; + break; + } else { + $i$1116$i = $579;$j$0117$i = $j$0$i; + } + } + } else { + $i$1$lcssa$i = 10; + } + $580 = HEAP32[$576>>2]|0; + $581 = (($580>>>0) % ($i$1$lcssa$i>>>0))&-1; + $582 = ($581|0)==(0); + if ($582) { + $$sum15$i = (($575) + -1022)|0; + $583 = (($$31$i) + ($$sum15$i<<2)|0); + $584 = ($583|0)==($z$3$lcssa$i|0); + if ($584) { + $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i; + } else { + label = 163; + } + } else { + label = 163; + } + do { + if ((label|0) == 163) { + label = 0; + $585 = (($580>>>0) / ($i$1$lcssa$i>>>0))&-1; + $586 = $585 & 1; + $587 = ($586|0)==(0); + $$20$i = $587 ? 9007199254740992.0 : 9007199254740994.0; + $588 = (($i$1$lcssa$i|0) / 2)&-1; + $589 = ($581>>>0)<($588>>>0); + do { + if ($589) { + $small$0$i = 0.5; + } else { + $590 = ($581|0)==($588|0); + if ($590) { + $$sum16$i = (($575) + -1022)|0; + $591 = (($$31$i) + ($$sum16$i<<2)|0); + $592 = ($591|0)==($z$3$lcssa$i|0); + if ($592) { + $small$0$i = 1.0; + break; + } + } + $small$0$i = 1.5; + } + } while(0); + $593 = ($pl$0$i|0)==(0); + do { + if ($593) { + $round6$1$i = $$20$i;$small$1$i = $small$0$i; + } else { + $594 = HEAP8[$prefix$0$i>>0]|0; + $595 = ($594<<24>>24)==(45); + if (!($595)) { + $round6$1$i = $$20$i;$small$1$i = $small$0$i; + break; + } + $596 = -$$20$i; + $597 = -$small$0$i; + $round6$1$i = $596;$small$1$i = $597; + } + } while(0); + $598 = (($580) - ($581))|0; + HEAP32[$576>>2] = $598; + $599 = $round6$1$i + $small$1$i; + $600 = $599 != $round6$1$i; + if (!($600)) { + $a$7$i = $a$3$lcssa$i;$d$3$i = $576;$e$3$i = $e$1$i; + break; + } + $601 = (($598) + ($i$1$lcssa$i))|0; + HEAP32[$576>>2] = $601; + $602 = ($601>>>0)>(999999999); + if ($602) { + $a$5109$i = $a$3$lcssa$i;$d$2108$i = $576; + while(1) { + $603 = ((($d$2108$i)) + -4|0); + HEAP32[$d$2108$i>>2] = 0; + $604 = ($603>>>0)<($a$5109$i>>>0); + if ($604) { + $605 = ((($a$5109$i)) + -4|0); + HEAP32[$605>>2] = 0; + $a$6$i = $605; + } else { + $a$6$i = $a$5109$i; + } + $606 = HEAP32[$603>>2]|0; + $607 = (($606) + 1)|0; + HEAP32[$603>>2] = $607; + $608 = ($607>>>0)>(999999999); + if ($608) { + $a$5109$i = $a$6$i;$d$2108$i = $603; + } else { + $a$5$lcssa$i = $a$6$i;$d$2$lcssa$i = $603; + break; + } + } + } else { + $a$5$lcssa$i = $a$3$lcssa$i;$d$2$lcssa$i = $576; + } + $609 = $a$5$lcssa$i; + $610 = (($482) - ($609))|0; + $611 = $610 >> 2; + $612 = ($611*9)|0; + $613 = HEAP32[$a$5$lcssa$i>>2]|0; + $614 = ($613>>>0)<(10); + if ($614) { + $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $612; + break; + } else { + $e$2104$i = $612;$i$2103$i = 10; + } + while(1) { + $615 = ($i$2103$i*10)|0; + $616 = (($e$2104$i) + 1)|0; + $617 = ($613>>>0)<($615>>>0); + if ($617) { + $a$7$i = $a$5$lcssa$i;$d$3$i = $d$2$lcssa$i;$e$3$i = $616; + break; + } else { + $e$2104$i = $616;$i$2103$i = $615; + } + } + } + } while(0); + $618 = ((($d$3$i)) + 4|0); + $619 = ($z$3$lcssa$i>>>0)>($618>>>0); + $$z$3$i = $619 ? $618 : $z$3$lcssa$i; + $a$8$ph$i = $a$7$i;$e$4$ph$i = $e$3$i;$z$6$ph$i = $$z$3$i; + } else { + $a$8$ph$i = $a$3$lcssa$i;$e$4$ph$i = $e$1$i;$z$6$ph$i = $z$3$lcssa$i; + } + $620 = (0 - ($e$4$ph$i))|0; + $z$6$i = $z$6$ph$i; + while(1) { + $621 = ($z$6$i>>>0)>($a$8$ph$i>>>0); + if (!($621)) { + $$lcssa159$i = 0;$z$6$i$lcssa = $z$6$i; + break; + } + $622 = ((($z$6$i)) + -4|0); + $623 = HEAP32[$622>>2]|0; + $624 = ($623|0)==(0); + if ($624) { + $z$6$i = $622; + } else { + $$lcssa159$i = 1;$z$6$i$lcssa = $z$6$i; + break; + } + } + do { + if ($564) { + $625 = $565&1; + $626 = $625 ^ 1; + $$p$$i = (($626) + ($$p$i))|0; + $627 = ($$p$$i|0)>($e$4$ph$i|0); + $628 = ($e$4$ph$i|0)>(-5); + $or$cond6$i = $627 & $628; + if ($or$cond6$i) { + $629 = (($t$0) + -1)|0; + $$neg53$i = (($$p$$i) + -1)|0; + $630 = (($$neg53$i) - ($e$4$ph$i))|0; + $$013$i = $629;$$210$i = $630; + } else { + $631 = (($t$0) + -2)|0; + $632 = (($$p$$i) + -1)|0; + $$013$i = $631;$$210$i = $632; + } + $633 = $fl$1$ & 8; + $634 = ($633|0)==(0); + if (!($634)) { + $$114$i = $$013$i;$$311$i = $$210$i;$$pre$phi184$iZ2D = $633; + break; + } + do { + if ($$lcssa159$i) { + $635 = ((($z$6$i$lcssa)) + -4|0); + $636 = HEAP32[$635>>2]|0; + $637 = ($636|0)==(0); + if ($637) { + $j$2$i = 9; + break; + } + $638 = (($636>>>0) % 10)&-1; + $639 = ($638|0)==(0); + if ($639) { + $i$399$i = 10;$j$1100$i = 0; + } else { + $j$2$i = 0; + break; + } + while(1) { + $640 = ($i$399$i*10)|0; + $641 = (($j$1100$i) + 1)|0; + $642 = (($636>>>0) % ($640>>>0))&-1; + $643 = ($642|0)==(0); + if ($643) { + $i$399$i = $640;$j$1100$i = $641; + } else { + $j$2$i = $641; + break; + } + } + } else { + $j$2$i = 9; + } + } while(0); + $644 = $$013$i | 32; + $645 = ($644|0)==(102); + $646 = $z$6$i$lcssa; + $647 = (($646) - ($482))|0; + $648 = $647 >> 2; + $649 = ($648*9)|0; + $650 = (($649) + -9)|0; + if ($645) { + $651 = (($650) - ($j$2$i))|0; + $652 = ($651|0)<(0); + $$21$i = $652 ? 0 : $651; + $653 = ($$210$i|0)<($$21$i|0); + $$210$$22$i = $653 ? $$210$i : $$21$i; + $$114$i = $$013$i;$$311$i = $$210$$22$i;$$pre$phi184$iZ2D = 0; + break; + } else { + $654 = (($650) + ($e$4$ph$i))|0; + $655 = (($654) - ($j$2$i))|0; + $656 = ($655|0)<(0); + $$23$i = $656 ? 0 : $655; + $657 = ($$210$i|0)<($$23$i|0); + $$210$$24$i = $657 ? $$210$i : $$23$i; + $$114$i = $$013$i;$$311$i = $$210$$24$i;$$pre$phi184$iZ2D = 0; + break; + } + } else { + $$pre183$i = $fl$1$ & 8; + $$114$i = $t$0;$$311$i = $$p$i;$$pre$phi184$iZ2D = $$pre183$i; + } + } while(0); + $658 = $$311$i | $$pre$phi184$iZ2D; + $659 = ($658|0)!=(0); + $660 = $659&1; + $661 = $$114$i | 32; + $662 = ($661|0)==(102); + if ($662) { + $663 = ($e$4$ph$i|0)>(0); + $664 = $663 ? $e$4$ph$i : 0; + $$pn$i = $664;$estr$2$i = 0; + } else { + $665 = ($e$4$ph$i|0)<(0); + $666 = $665 ? $620 : $e$4$ph$i; + $667 = ($666|0)<(0); + $668 = $667 << 31 >> 31; + $669 = (_fmt_u($666,$668,$5)|0); + $670 = $669; + $671 = (($8) - ($670))|0; + $672 = ($671|0)<(2); + if ($672) { + $estr$193$i = $669; + while(1) { + $673 = ((($estr$193$i)) + -1|0); + HEAP8[$673>>0] = 48; + $674 = $673; + $675 = (($8) - ($674))|0; + $676 = ($675|0)<(2); + if ($676) { + $estr$193$i = $673; + } else { + $estr$1$lcssa$i = $673; + break; + } + } + } else { + $estr$1$lcssa$i = $669; + } + $677 = $e$4$ph$i >> 31; + $678 = $677 & 2; + $679 = (($678) + 43)|0; + $680 = $679&255; + $681 = ((($estr$1$lcssa$i)) + -1|0); + HEAP8[$681>>0] = $680; + $682 = $$114$i&255; + $683 = ((($estr$1$lcssa$i)) + -2|0); + HEAP8[$683>>0] = $682; + $684 = $683; + $685 = (($8) - ($684))|0; + $$pn$i = $685;$estr$2$i = $683; + } + $686 = (($pl$0$i) + 1)|0; + $687 = (($686) + ($$311$i))|0; + $l$1$i = (($687) + ($660))|0; + $688 = (($l$1$i) + ($$pn$i))|0; + _pad($f,32,$w$1,$688,$fl$1$); + $689 = HEAP32[$f>>2]|0; + $690 = $689 & 32; + $691 = ($690|0)==(0); + if ($691) { + (___fwritex($prefix$0$i,$pl$0$i,$f)|0); + } + $692 = $fl$1$ ^ 65536; + _pad($f,48,$w$1,$688,$692); + do { + if ($662) { + $693 = ($a$8$ph$i>>>0)>($$31$i>>>0); + $r$0$a$8$i = $693 ? $$31$i : $a$8$ph$i; + $d$482$i = $r$0$a$8$i; + while(1) { + $694 = HEAP32[$d$482$i>>2]|0; + $695 = (_fmt_u($694,0,$13)|0); + $696 = ($d$482$i|0)==($r$0$a$8$i|0); + do { + if ($696) { + $700 = ($695|0)==($13|0); + if (!($700)) { + $s7$1$i = $695; + break; + } + HEAP8[$15>>0] = 48; + $s7$1$i = $15; + } else { + $697 = ($695>>>0)>($buf$i>>>0); + if ($697) { + $s7$079$i = $695; + } else { + $s7$1$i = $695; + break; + } + while(1) { + $698 = ((($s7$079$i)) + -1|0); + HEAP8[$698>>0] = 48; + $699 = ($698>>>0)>($buf$i>>>0); + if ($699) { + $s7$079$i = $698; + } else { + $s7$1$i = $698; + break; + } + } + } + } while(0); + $701 = HEAP32[$f>>2]|0; + $702 = $701 & 32; + $703 = ($702|0)==(0); + if ($703) { + $704 = $s7$1$i; + $705 = (($14) - ($704))|0; + (___fwritex($s7$1$i,$705,$f)|0); + } + $706 = ((($d$482$i)) + 4|0); + $707 = ($706>>>0)>($$31$i>>>0); + if ($707) { + $$lcssa339 = $706; + break; + } else { + $d$482$i = $706; + } + } + $708 = ($658|0)==(0); + do { + if (!($708)) { + $709 = HEAP32[$f>>2]|0; + $710 = $709 & 32; + $711 = ($710|0)==(0); + if (!($711)) { + break; + } + (___fwritex(24306,1,$f)|0); + } + } while(0); + $712 = ($$lcssa339>>>0)<($z$6$i$lcssa>>>0); + $713 = ($$311$i|0)>(0); + $714 = $713 & $712; + if ($714) { + $$41276$i = $$311$i;$d$575$i = $$lcssa339; + while(1) { + $715 = HEAP32[$d$575$i>>2]|0; + $716 = (_fmt_u($715,0,$13)|0); + $717 = ($716>>>0)>($buf$i>>>0); + if ($717) { + $s8$070$i = $716; + while(1) { + $718 = ((($s8$070$i)) + -1|0); + HEAP8[$718>>0] = 48; + $719 = ($718>>>0)>($buf$i>>>0); + if ($719) { + $s8$070$i = $718; + } else { + $s8$0$lcssa$i = $718; + break; + } + } + } else { + $s8$0$lcssa$i = $716; + } + $720 = HEAP32[$f>>2]|0; + $721 = $720 & 32; + $722 = ($721|0)==(0); + if ($722) { + $723 = ($$41276$i|0)>(9); + $724 = $723 ? 9 : $$41276$i; + (___fwritex($s8$0$lcssa$i,$724,$f)|0); + } + $725 = ((($d$575$i)) + 4|0); + $726 = (($$41276$i) + -9)|0; + $727 = ($725>>>0)<($z$6$i$lcssa>>>0); + $728 = ($$41276$i|0)>(9); + $729 = $728 & $727; + if ($729) { + $$41276$i = $726;$d$575$i = $725; + } else { + $$412$lcssa$i = $726; + break; + } + } + } else { + $$412$lcssa$i = $$311$i; + } + $730 = (($$412$lcssa$i) + 9)|0; + _pad($f,48,$730,9,0); + } else { + $731 = ((($a$8$ph$i)) + 4|0); + $z$6$$i = $$lcssa159$i ? $z$6$i$lcssa : $731; + $732 = ($$311$i|0)>(-1); + if ($732) { + $733 = ($$pre$phi184$iZ2D|0)==(0); + $$587$i = $$311$i;$d$686$i = $a$8$ph$i; + while(1) { + $734 = HEAP32[$d$686$i>>2]|0; + $735 = (_fmt_u($734,0,$13)|0); + $736 = ($735|0)==($13|0); + if ($736) { + HEAP8[$15>>0] = 48; + $s9$0$i = $15; + } else { + $s9$0$i = $735; + } + $737 = ($d$686$i|0)==($a$8$ph$i|0); + do { + if ($737) { + $741 = ((($s9$0$i)) + 1|0); + $742 = HEAP32[$f>>2]|0; + $743 = $742 & 32; + $744 = ($743|0)==(0); + if ($744) { + (___fwritex($s9$0$i,1,$f)|0); + } + $745 = ($$587$i|0)<(1); + $or$cond29$i = $733 & $745; + if ($or$cond29$i) { + $s9$2$i = $741; + break; + } + $746 = HEAP32[$f>>2]|0; + $747 = $746 & 32; + $748 = ($747|0)==(0); + if (!($748)) { + $s9$2$i = $741; + break; + } + (___fwritex(24306,1,$f)|0); + $s9$2$i = $741; + } else { + $738 = ($s9$0$i>>>0)>($buf$i>>>0); + if ($738) { + $s9$183$i = $s9$0$i; + } else { + $s9$2$i = $s9$0$i; + break; + } + while(1) { + $739 = ((($s9$183$i)) + -1|0); + HEAP8[$739>>0] = 48; + $740 = ($739>>>0)>($buf$i>>>0); + if ($740) { + $s9$183$i = $739; + } else { + $s9$2$i = $739; + break; + } + } + } + } while(0); + $749 = $s9$2$i; + $750 = (($14) - ($749))|0; + $751 = HEAP32[$f>>2]|0; + $752 = $751 & 32; + $753 = ($752|0)==(0); + if ($753) { + $754 = ($$587$i|0)>($750|0); + $755 = $754 ? $750 : $$587$i; + (___fwritex($s9$2$i,$755,$f)|0); + } + $756 = (($$587$i) - ($750))|0; + $757 = ((($d$686$i)) + 4|0); + $758 = ($757>>>0)<($z$6$$i>>>0); + $759 = ($756|0)>(-1); + $760 = $758 & $759; + if ($760) { + $$587$i = $756;$d$686$i = $757; + } else { + $$5$lcssa$i = $756; + break; + } + } + } else { + $$5$lcssa$i = $$311$i; + } + $761 = (($$5$lcssa$i) + 18)|0; + _pad($f,48,$761,18,0); + $762 = HEAP32[$f>>2]|0; + $763 = $762 & 32; + $764 = ($763|0)==(0); + if (!($764)) { + break; + } + $765 = $estr$2$i; + $766 = (($8) - ($765))|0; + (___fwritex($estr$2$i,$766,$f)|0); + } + } while(0); + $767 = $fl$1$ ^ 8192; + _pad($f,32,$w$1,$688,$767); + $768 = ($688|0)<($w$1|0); + $w$30$i = $768 ? $w$1 : $688; + $$0$i = $w$30$i; + } else { + $376 = $t$0 & 32; + $377 = ($376|0)!=(0); + $378 = $377 ? 24290 : 24294; + $379 = ($$07$i != $$07$i) | (0.0 != 0.0); + $380 = $377 ? 24298 : 24302; + $pl$1$i = $379 ? 0 : $pl$0$i; + $s1$0$i = $379 ? $380 : $378; + $381 = (($pl$1$i) + 3)|0; + _pad($f,32,$w$1,$381,$175); + $382 = HEAP32[$f>>2]|0; + $383 = $382 & 32; + $384 = ($383|0)==(0); + if ($384) { + (___fwritex($prefix$0$i,$pl$1$i,$f)|0); + $$pre$i = HEAP32[$f>>2]|0; + $386 = $$pre$i; + } else { + $386 = $382; + } + $385 = $386 & 32; + $387 = ($385|0)==(0); + if ($387) { + (___fwritex($s1$0$i,3,$f)|0); + } + $388 = $fl$1$ ^ 8192; + _pad($f,32,$w$1,$381,$388); + $389 = ($381|0)<($w$1|0); + $390 = $389 ? $w$1 : $381; + $$0$i = $390; + } + } while(0); + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $$0$i;$l10n$0 = $l10n$3; + continue L1; + break; + } + default: { + $a$2 = $fmt41;$fl$6 = $fl$1$;$p$5 = $p$0;$pl$2 = 0;$prefix$2 = 24254;$z$2 = $1; + } + } + } while(0); + L313: do { + if ((label|0) == 64) { + label = 0; + $206 = $arg; + $207 = $206; + $208 = HEAP32[$207>>2]|0; + $209 = (($206) + 4)|0; + $210 = $209; + $211 = HEAP32[$210>>2]|0; + $212 = $t$1 & 32; + $213 = ($208|0)==(0); + $214 = ($211|0)==(0); + $215 = $213 & $214; + if ($215) { + $a$0 = $1;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 24254; + label = 77; + } else { + $$012$i = $1;$217 = $208;$224 = $211; + while(1) { + $216 = $217 & 15; + $218 = (24238 + ($216)|0); + $219 = HEAP8[$218>>0]|0; + $220 = $219&255; + $221 = $220 | $212; + $222 = $221&255; + $223 = ((($$012$i)) + -1|0); + HEAP8[$223>>0] = $222; + $225 = (_bitshift64Lshr(($217|0),($224|0),4)|0); + $226 = tempRet0; + $227 = ($225|0)==(0); + $228 = ($226|0)==(0); + $229 = $227 & $228; + if ($229) { + $$lcssa344 = $223; + break; + } else { + $$012$i = $223;$217 = $225;$224 = $226; + } + } + $230 = $arg; + $231 = $230; + $232 = HEAP32[$231>>2]|0; + $233 = (($230) + 4)|0; + $234 = $233; + $235 = HEAP32[$234>>2]|0; + $236 = ($232|0)==(0); + $237 = ($235|0)==(0); + $238 = $236 & $237; + $239 = $fl$3 & 8; + $240 = ($239|0)==(0); + $or$cond17 = $240 | $238; + if ($or$cond17) { + $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 0;$prefix$1 = 24254; + label = 77; + } else { + $241 = $t$1 >> 4; + $242 = (24254 + ($241)|0); + $a$0 = $$lcssa344;$fl$4 = $fl$3;$p$2 = $p$1;$pl$1 = 2;$prefix$1 = $242; + label = 77; + } + } + } + else if ((label|0) == 76) { + label = 0; + $288 = (_fmt_u($286,$287,$1)|0); + $a$0 = $288;$fl$4 = $fl$1$;$p$2 = $p$0;$pl$1 = $pl$0;$prefix$1 = $prefix$0; + label = 77; + } + else if ((label|0) == 82) { + label = 0; + $320 = (_memchr($a$1,0,$p$0)|0); + $321 = ($320|0)==(0|0); + $322 = $320; + $323 = $a$1; + $324 = (($322) - ($323))|0; + $325 = (($a$1) + ($p$0)|0); + $z$1 = $321 ? $325 : $320; + $p$3 = $321 ? $p$0 : $324; + $a$2 = $a$1;$fl$6 = $175;$p$5 = $p$3;$pl$2 = 0;$prefix$2 = 24254;$z$2 = $z$1; + } + else if ((label|0) == 86) { + label = 0; + $333 = HEAP32[$arg>>2]|0; + $i$0114 = 0;$l$1113 = 0;$ws$0115 = $333; + while(1) { + $334 = HEAP32[$ws$0115>>2]|0; + $335 = ($334|0)==(0); + if ($335) { + $i$0$lcssa = $i$0114;$l$2 = $l$1113; + break; + } + $336 = (_wctomb($mb,$334)|0); + $337 = ($336|0)<(0); + $338 = (($p$4198) - ($i$0114))|0; + $339 = ($336>>>0)>($338>>>0); + $or$cond20 = $337 | $339; + if ($or$cond20) { + $i$0$lcssa = $i$0114;$l$2 = $336; + break; + } + $340 = ((($ws$0115)) + 4|0); + $341 = (($336) + ($i$0114))|0; + $342 = ($p$4198>>>0)>($341>>>0); + if ($342) { + $i$0114 = $341;$l$1113 = $336;$ws$0115 = $340; + } else { + $i$0$lcssa = $341;$l$2 = $336; + break; + } + } + $343 = ($l$2|0)<(0); + if ($343) { + $$0 = -1; + break L1; + } + _pad($f,32,$w$1,$i$0$lcssa,$fl$1$); + $344 = ($i$0$lcssa|0)==(0); + if ($344) { + $i$0$lcssa200 = 0; + label = 98; + } else { + $345 = HEAP32[$arg>>2]|0; + $i$1125 = 0;$ws$1126 = $345; + while(1) { + $346 = HEAP32[$ws$1126>>2]|0; + $347 = ($346|0)==(0); + if ($347) { + $i$0$lcssa200 = $i$0$lcssa; + label = 98; + break L313; + } + $348 = ((($ws$1126)) + 4|0); + $349 = (_wctomb($mb,$346)|0); + $350 = (($349) + ($i$1125))|0; + $351 = ($350|0)>($i$0$lcssa|0); + if ($351) { + $i$0$lcssa200 = $i$0$lcssa; + label = 98; + break L313; + } + $352 = HEAP32[$f>>2]|0; + $353 = $352 & 32; + $354 = ($353|0)==(0); + if ($354) { + (___fwritex($mb,$349,$f)|0); + } + $355 = ($350>>>0)<($i$0$lcssa>>>0); + if ($355) { + $i$1125 = $350;$ws$1126 = $348; + } else { + $i$0$lcssa200 = $i$0$lcssa; + label = 98; + break; + } + } + } + } + } while(0); + if ((label|0) == 98) { + label = 0; + $356 = $fl$1$ ^ 8192; + _pad($f,32,$w$1,$i$0$lcssa200,$356); + $357 = ($w$1|0)>($i$0$lcssa200|0); + $358 = $357 ? $w$1 : $i$0$lcssa200; + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $358;$l10n$0 = $l10n$3; + continue; + } + if ((label|0) == 77) { + label = 0; + $289 = ($p$2|0)>(-1); + $290 = $fl$4 & -65537; + $$fl$4 = $289 ? $290 : $fl$4; + $291 = $arg; + $292 = $291; + $293 = HEAP32[$292>>2]|0; + $294 = (($291) + 4)|0; + $295 = $294; + $296 = HEAP32[$295>>2]|0; + $297 = ($293|0)!=(0); + $298 = ($296|0)!=(0); + $299 = $297 | $298; + $300 = ($p$2|0)!=(0); + $or$cond = $300 | $299; + if ($or$cond) { + $301 = $a$0; + $302 = (($2) - ($301))|0; + $303 = $299&1; + $304 = $303 ^ 1; + $305 = (($304) + ($302))|0; + $306 = ($p$2|0)>($305|0); + $p$2$ = $306 ? $p$2 : $305; + $a$2 = $a$0;$fl$6 = $$fl$4;$p$5 = $p$2$;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1; + } else { + $a$2 = $1;$fl$6 = $$fl$4;$p$5 = 0;$pl$2 = $pl$1;$prefix$2 = $prefix$1;$z$2 = $1; + } + } + $769 = $z$2; + $770 = $a$2; + $771 = (($769) - ($770))|0; + $772 = ($p$5|0)<($771|0); + $$p$5 = $772 ? $771 : $p$5; + $773 = (($pl$2) + ($$p$5))|0; + $774 = ($w$1|0)<($773|0); + $w$2 = $774 ? $773 : $w$1; + _pad($f,32,$w$2,$773,$fl$6); + $775 = HEAP32[$f>>2]|0; + $776 = $775 & 32; + $777 = ($776|0)==(0); + if ($777) { + (___fwritex($prefix$2,$pl$2,$f)|0); + } + $778 = $fl$6 ^ 65536; + _pad($f,48,$w$2,$773,$778); + _pad($f,48,$$p$5,$771,0); + $779 = HEAP32[$f>>2]|0; + $780 = $779 & 32; + $781 = ($780|0)==(0); + if ($781) { + (___fwritex($a$2,$771,$f)|0); + } + $782 = $fl$6 ^ 8192; + _pad($f,32,$w$2,$773,$782); + $cnt$0 = $cnt$1;$fmt41 = $$lcssa323;$l$0 = $w$2;$l10n$0 = $l10n$3; + } + L348: do { + if ((label|0) == 245) { + $783 = ($f|0)==(0|0); + if ($783) { + $784 = ($l10n$0$lcssa|0)==(0); + if ($784) { + $$0 = 0; + } else { + $i$2100 = 1; + while(1) { + $785 = (($nl_type) + ($i$2100<<2)|0); + $786 = HEAP32[$785>>2]|0; + $787 = ($786|0)==(0); + if ($787) { + $i$2100$lcssa = $i$2100; + break; + } + $789 = (($nl_arg) + ($i$2100<<3)|0); + _pop_arg($789,$786,$ap); + $790 = (($i$2100) + 1)|0; + $791 = ($790|0)<(10); + if ($791) { + $i$2100 = $790; + } else { + $$0 = 1; + break L348; + } + } + $788 = ($i$2100$lcssa|0)<(10); + if ($788) { + $i$398 = $i$2100$lcssa; + while(1) { + $794 = (($nl_type) + ($i$398<<2)|0); + $795 = HEAP32[$794>>2]|0; + $796 = ($795|0)==(0); + $792 = (($i$398) + 1)|0; + if (!($796)) { + $$0 = -1; + break L348; + } + $793 = ($792|0)<(10); + if ($793) { + $i$398 = $792; + } else { + $$0 = 1; + break; + } + } + } else { + $$0 = 1; + } + } + } else { + $$0 = $cnt$1$lcssa; + } + } + } while(0); + STACKTOP = sp;return ($$0|0); +} +function _cleanup521($p) { + $p = $p|0; + var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($p)) + 68|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + ___unlockfile($p); + } + return; +} +function _cleanup526($p) { + $p = $p|0; + var $0 = 0, $1 = 0, $2 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($p)) + 68|0); + $1 = HEAP32[$0>>2]|0; + $2 = ($1|0)==(0); + if ($2) { + ___unlockfile($p); + } + return; +} +function _sn_write($f,$s,$l) { + $f = $f|0; + $s = $s|0; + $l = $l|0; + var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $l$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($f)) + 16|0); + $1 = HEAP32[$0>>2]|0; + $2 = ((($f)) + 20|0); + $3 = HEAP32[$2>>2]|0; + $4 = $1; + $5 = $3; + $6 = (($4) - ($5))|0; + $7 = ($6>>>0)>($l>>>0); + $l$ = $7 ? $l : $6; + _memcpy(($3|0),($s|0),($l$|0))|0; + $8 = HEAP32[$2>>2]|0; + $9 = (($8) + ($l$)|0); + HEAP32[$2>>2] = $9; + return ($l|0); +} +function _pop_arg($arg,$type,$ap) { + $arg = $arg|0; + $type = $type|0; + $ap = $ap|0; + var $$mask = 0, $$mask1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0.0; + var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0; + var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0; + var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0; + var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0; + var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0; + var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0; + var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0; + var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0; + var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($type>>>0)>(20); + L1: do { + if (!($0)) { + do { + switch ($type|0) { + case 9: { + $arglist_current = HEAP32[$ap>>2]|0; + $1 = $arglist_current; + $2 = ((0) + 4|0); + $expanded28 = $2; + $expanded = (($expanded28) - 1)|0; + $3 = (($1) + ($expanded))|0; + $4 = ((0) + 4|0); + $expanded32 = $4; + $expanded31 = (($expanded32) - 1)|0; + $expanded30 = $expanded31 ^ -1; + $5 = $3 & $expanded30; + $6 = $5; + $7 = HEAP32[$6>>2]|0; + $arglist_next = ((($6)) + 4|0); + HEAP32[$ap>>2] = $arglist_next; + HEAP32[$arg>>2] = $7; + break L1; + break; + } + case 10: { + $arglist_current2 = HEAP32[$ap>>2]|0; + $8 = $arglist_current2; + $9 = ((0) + 4|0); + $expanded35 = $9; + $expanded34 = (($expanded35) - 1)|0; + $10 = (($8) + ($expanded34))|0; + $11 = ((0) + 4|0); + $expanded39 = $11; + $expanded38 = (($expanded39) - 1)|0; + $expanded37 = $expanded38 ^ -1; + $12 = $10 & $expanded37; + $13 = $12; + $14 = HEAP32[$13>>2]|0; + $arglist_next3 = ((($13)) + 4|0); + HEAP32[$ap>>2] = $arglist_next3; + $15 = ($14|0)<(0); + $16 = $15 << 31 >> 31; + $17 = $arg; + $18 = $17; + HEAP32[$18>>2] = $14; + $19 = (($17) + 4)|0; + $20 = $19; + HEAP32[$20>>2] = $16; + break L1; + break; + } + case 11: { + $arglist_current5 = HEAP32[$ap>>2]|0; + $21 = $arglist_current5; + $22 = ((0) + 4|0); + $expanded42 = $22; + $expanded41 = (($expanded42) - 1)|0; + $23 = (($21) + ($expanded41))|0; + $24 = ((0) + 4|0); + $expanded46 = $24; + $expanded45 = (($expanded46) - 1)|0; + $expanded44 = $expanded45 ^ -1; + $25 = $23 & $expanded44; + $26 = $25; + $27 = HEAP32[$26>>2]|0; + $arglist_next6 = ((($26)) + 4|0); + HEAP32[$ap>>2] = $arglist_next6; + $28 = $arg; + $29 = $28; + HEAP32[$29>>2] = $27; + $30 = (($28) + 4)|0; + $31 = $30; + HEAP32[$31>>2] = 0; + break L1; + break; + } + case 12: { + $arglist_current8 = HEAP32[$ap>>2]|0; + $32 = $arglist_current8; + $33 = ((0) + 8|0); + $expanded49 = $33; + $expanded48 = (($expanded49) - 1)|0; + $34 = (($32) + ($expanded48))|0; + $35 = ((0) + 8|0); + $expanded53 = $35; + $expanded52 = (($expanded53) - 1)|0; + $expanded51 = $expanded52 ^ -1; + $36 = $34 & $expanded51; + $37 = $36; + $38 = $37; + $39 = $38; + $40 = HEAP32[$39>>2]|0; + $41 = (($38) + 4)|0; + $42 = $41; + $43 = HEAP32[$42>>2]|0; + $arglist_next9 = ((($37)) + 8|0); + HEAP32[$ap>>2] = $arglist_next9; + $44 = $arg; + $45 = $44; + HEAP32[$45>>2] = $40; + $46 = (($44) + 4)|0; + $47 = $46; + HEAP32[$47>>2] = $43; + break L1; + break; + } + case 13: { + $arglist_current11 = HEAP32[$ap>>2]|0; + $48 = $arglist_current11; + $49 = ((0) + 4|0); + $expanded56 = $49; + $expanded55 = (($expanded56) - 1)|0; + $50 = (($48) + ($expanded55))|0; + $51 = ((0) + 4|0); + $expanded60 = $51; + $expanded59 = (($expanded60) - 1)|0; + $expanded58 = $expanded59 ^ -1; + $52 = $50 & $expanded58; + $53 = $52; + $54 = HEAP32[$53>>2]|0; + $arglist_next12 = ((($53)) + 4|0); + HEAP32[$ap>>2] = $arglist_next12; + $55 = $54&65535; + $56 = $55 << 16 >> 16; + $57 = ($56|0)<(0); + $58 = $57 << 31 >> 31; + $59 = $arg; + $60 = $59; + HEAP32[$60>>2] = $56; + $61 = (($59) + 4)|0; + $62 = $61; + HEAP32[$62>>2] = $58; + break L1; + break; + } + case 14: { + $arglist_current14 = HEAP32[$ap>>2]|0; + $63 = $arglist_current14; + $64 = ((0) + 4|0); + $expanded63 = $64; + $expanded62 = (($expanded63) - 1)|0; + $65 = (($63) + ($expanded62))|0; + $66 = ((0) + 4|0); + $expanded67 = $66; + $expanded66 = (($expanded67) - 1)|0; + $expanded65 = $expanded66 ^ -1; + $67 = $65 & $expanded65; + $68 = $67; + $69 = HEAP32[$68>>2]|0; + $arglist_next15 = ((($68)) + 4|0); + HEAP32[$ap>>2] = $arglist_next15; + $$mask1 = $69 & 65535; + $70 = $arg; + $71 = $70; + HEAP32[$71>>2] = $$mask1; + $72 = (($70) + 4)|0; + $73 = $72; + HEAP32[$73>>2] = 0; + break L1; + break; + } + case 15: { + $arglist_current17 = HEAP32[$ap>>2]|0; + $74 = $arglist_current17; + $75 = ((0) + 4|0); + $expanded70 = $75; + $expanded69 = (($expanded70) - 1)|0; + $76 = (($74) + ($expanded69))|0; + $77 = ((0) + 4|0); + $expanded74 = $77; + $expanded73 = (($expanded74) - 1)|0; + $expanded72 = $expanded73 ^ -1; + $78 = $76 & $expanded72; + $79 = $78; + $80 = HEAP32[$79>>2]|0; + $arglist_next18 = ((($79)) + 4|0); + HEAP32[$ap>>2] = $arglist_next18; + $81 = $80&255; + $82 = $81 << 24 >> 24; + $83 = ($82|0)<(0); + $84 = $83 << 31 >> 31; + $85 = $arg; + $86 = $85; + HEAP32[$86>>2] = $82; + $87 = (($85) + 4)|0; + $88 = $87; + HEAP32[$88>>2] = $84; + break L1; + break; + } + case 16: { + $arglist_current20 = HEAP32[$ap>>2]|0; + $89 = $arglist_current20; + $90 = ((0) + 4|0); + $expanded77 = $90; + $expanded76 = (($expanded77) - 1)|0; + $91 = (($89) + ($expanded76))|0; + $92 = ((0) + 4|0); + $expanded81 = $92; + $expanded80 = (($expanded81) - 1)|0; + $expanded79 = $expanded80 ^ -1; + $93 = $91 & $expanded79; + $94 = $93; + $95 = HEAP32[$94>>2]|0; + $arglist_next21 = ((($94)) + 4|0); + HEAP32[$ap>>2] = $arglist_next21; + $$mask = $95 & 255; + $96 = $arg; + $97 = $96; + HEAP32[$97>>2] = $$mask; + $98 = (($96) + 4)|0; + $99 = $98; + HEAP32[$99>>2] = 0; + break L1; + break; + } + case 17: { + $arglist_current23 = HEAP32[$ap>>2]|0; + $100 = $arglist_current23; + $101 = ((0) + 8|0); + $expanded84 = $101; + $expanded83 = (($expanded84) - 1)|0; + $102 = (($100) + ($expanded83))|0; + $103 = ((0) + 8|0); + $expanded88 = $103; + $expanded87 = (($expanded88) - 1)|0; + $expanded86 = $expanded87 ^ -1; + $104 = $102 & $expanded86; + $105 = $104; + $106 = +HEAPF64[$105>>3]; + $arglist_next24 = ((($105)) + 8|0); + HEAP32[$ap>>2] = $arglist_next24; + HEAPF64[$arg>>3] = $106; + break L1; + break; + } + case 18: { + $arglist_current26 = HEAP32[$ap>>2]|0; + $107 = $arglist_current26; + $108 = ((0) + 8|0); + $expanded91 = $108; + $expanded90 = (($expanded91) - 1)|0; + $109 = (($107) + ($expanded90))|0; + $110 = ((0) + 8|0); + $expanded95 = $110; + $expanded94 = (($expanded95) - 1)|0; + $expanded93 = $expanded94 ^ -1; + $111 = $109 & $expanded93; + $112 = $111; + $113 = +HEAPF64[$112>>3]; + $arglist_next27 = ((($112)) + 8|0); + HEAP32[$ap>>2] = $arglist_next27; + HEAPF64[$arg>>3] = $113; + break L1; + break; + } + default: { + break L1; + } + } + } while(0); + } + } while(0); + return; +} +function _fmt_u($0,$1,$s) { + $0 = $0|0; + $1 = $1|0; + $s = $s|0; + var $$0$lcssa = 0, $$01$lcssa$off0 = 0, $$05 = 0, $$1$lcssa = 0, $$12 = 0, $$lcssa20 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0; + var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $y$03 = 0, label = 0, sp = 0; + sp = STACKTOP; + $2 = ($1>>>0)>(0); + $3 = ($0>>>0)>(4294967295); + $4 = ($1|0)==(0); + $5 = $4 & $3; + $6 = $2 | $5; + if ($6) { + $$05 = $s;$7 = $0;$8 = $1; + while(1) { + $9 = (___uremdi3(($7|0),($8|0),10,0)|0); + $10 = tempRet0; + $11 = $9 | 48; + $12 = $11&255; + $13 = ((($$05)) + -1|0); + HEAP8[$13>>0] = $12; + $14 = (___udivdi3(($7|0),($8|0),10,0)|0); + $15 = tempRet0; + $16 = ($8>>>0)>(9); + $17 = ($7>>>0)>(4294967295); + $18 = ($8|0)==(9); + $19 = $18 & $17; + $20 = $16 | $19; + if ($20) { + $$05 = $13;$7 = $14;$8 = $15; + } else { + $$lcssa20 = $13;$28 = $14;$29 = $15; + break; + } + } + $$0$lcssa = $$lcssa20;$$01$lcssa$off0 = $28; + } else { + $$0$lcssa = $s;$$01$lcssa$off0 = $0; + } + $21 = ($$01$lcssa$off0|0)==(0); + if ($21) { + $$1$lcssa = $$0$lcssa; + } else { + $$12 = $$0$lcssa;$y$03 = $$01$lcssa$off0; + while(1) { + $22 = (($y$03>>>0) % 10)&-1; + $23 = $22 | 48; + $24 = $23&255; + $25 = ((($$12)) + -1|0); + HEAP8[$25>>0] = $24; + $26 = (($y$03>>>0) / 10)&-1; + $27 = ($y$03>>>0)<(10); + if ($27) { + $$1$lcssa = $25; + break; + } else { + $$12 = $25;$y$03 = $26; + } + } + } + return ($$1$lcssa|0); +} +function _pad($f,$c,$w,$l,$fl) { + $f = $f|0; + $c = $c|0; + $w = $w|0; + $l = $l|0; + $fl = $fl|0; + var $$0$lcssa6 = 0, $$02 = 0, $$pre = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0; + var $8 = 0, $9 = 0, $or$cond = 0, $pad = 0, label = 0, sp = 0; + sp = STACKTOP; + STACKTOP = STACKTOP + 256|0; + $pad = sp; + $0 = $fl & 73728; + $1 = ($0|0)==(0); + $2 = ($w|0)>($l|0); + $or$cond = $2 & $1; + do { + if ($or$cond) { + $3 = (($w) - ($l))|0; + $4 = ($3>>>0)>(256); + $5 = $4 ? 256 : $3; + _memset(($pad|0),($c|0),($5|0))|0; + $6 = ($3>>>0)>(255); + $7 = HEAP32[$f>>2]|0; + $8 = $7 & 32; + $9 = ($8|0)==(0); + if ($6) { + $10 = (($w) - ($l))|0; + $$02 = $3;$17 = $7;$18 = $9; + while(1) { + if ($18) { + (___fwritex($pad,256,$f)|0); + $$pre = HEAP32[$f>>2]|0; + $14 = $$pre; + } else { + $14 = $17; + } + $11 = (($$02) + -256)|0; + $12 = ($11>>>0)>(255); + $13 = $14 & 32; + $15 = ($13|0)==(0); + if ($12) { + $$02 = $11;$17 = $14;$18 = $15; + } else { + break; + } + } + $16 = $10 & 255; + if ($15) { + $$0$lcssa6 = $16; + } else { + break; + } + } else { + if ($9) { + $$0$lcssa6 = $3; + } else { + break; + } + } + (___fwritex($pad,$$0$lcssa6,$f)|0); + } + } while(0); + STACKTOP = sp;return; +} +function _malloc($bytes) { + $bytes = $bytes|0; + var $$3$i = 0, $$lcssa = 0, $$lcssa211 = 0, $$lcssa215 = 0, $$lcssa216 = 0, $$lcssa217 = 0, $$lcssa219 = 0, $$lcssa222 = 0, $$lcssa224 = 0, $$lcssa226 = 0, $$lcssa228 = 0, $$lcssa230 = 0, $$lcssa232 = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i22$i = 0, $$pre$i25 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i23$iZ2D = 0; + var $$pre$phi$i26Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi58$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre105 = 0, $$pre106 = 0, $$pre14$i$i = 0, $$pre43$i = 0, $$pre56$i$i = 0, $$pre57$i$i = 0, $$pre8$i = 0, $$rsize$0$i = 0, $$rsize$3$i = 0, $$sum = 0, $$sum$i$i = 0, $$sum$i$i$i = 0, $$sum$i13$i = 0, $$sum$i14$i = 0, $$sum$i17$i = 0, $$sum$i19$i = 0; + var $$sum$i2334 = 0, $$sum$i32 = 0, $$sum$i35 = 0, $$sum1 = 0, $$sum1$i = 0, $$sum1$i$i = 0, $$sum1$i15$i = 0, $$sum1$i20$i = 0, $$sum1$i24 = 0, $$sum10 = 0, $$sum10$i = 0, $$sum10$i$i = 0, $$sum11$i = 0, $$sum11$i$i = 0, $$sum1112 = 0, $$sum112$i = 0, $$sum113$i = 0, $$sum114$i = 0, $$sum115$i = 0, $$sum116$i = 0; + var $$sum117$i = 0, $$sum118$i = 0, $$sum119$i = 0, $$sum12$i = 0, $$sum12$i$i = 0, $$sum120$i = 0, $$sum121$i = 0, $$sum122$i = 0, $$sum123$i = 0, $$sum124$i = 0, $$sum125$i = 0, $$sum13$i = 0, $$sum13$i$i = 0, $$sum14$i$i = 0, $$sum15$i = 0, $$sum15$i$i = 0, $$sum16$i = 0, $$sum16$i$i = 0, $$sum17$i = 0, $$sum17$i$i = 0; + var $$sum18$i = 0, $$sum1819$i$i = 0, $$sum2 = 0, $$sum2$i = 0, $$sum2$i$i = 0, $$sum2$i$i$i = 0, $$sum2$i16$i = 0, $$sum2$i18$i = 0, $$sum2$i21$i = 0, $$sum20$i$i = 0, $$sum21$i$i = 0, $$sum22$i$i = 0, $$sum23$i$i = 0, $$sum24$i$i = 0, $$sum25$i$i = 0, $$sum27$i$i = 0, $$sum28$i$i = 0, $$sum29$i$i = 0, $$sum3$i = 0, $$sum3$i27 = 0; + var $$sum30$i$i = 0, $$sum3132$i$i = 0, $$sum34$i$i = 0, $$sum3536$i$i = 0, $$sum3738$i$i = 0, $$sum39$i$i = 0, $$sum4 = 0, $$sum4$i = 0, $$sum4$i$i = 0, $$sum4$i28 = 0, $$sum40$i$i = 0, $$sum41$i$i = 0, $$sum42$i$i = 0, $$sum5$i = 0, $$sum5$i$i = 0, $$sum56 = 0, $$sum6$i = 0, $$sum67$i$i = 0, $$sum7$i = 0, $$sum8$i = 0; + var $$sum9 = 0, $$sum9$i = 0, $$sum9$i$i = 0, $$tsize$1$i = 0, $$v$0$i = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0; + var $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0; + var $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0; + var $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0, $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0; + var $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0; + var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0; + var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0; + var $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0; + var $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0; + var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0; + var $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0; + var $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0; + var $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0; + var $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0; + var $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0; + var $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0; + var $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0; + var $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0; + var $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0; + var $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0; + var $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0; + var $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0; + var $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0; + var $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0; + var $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0; + var $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0; + var $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0; + var $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0; + var $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0; + var $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0; + var $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0; + var $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0; + var $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0; + var $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0; + var $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0; + var $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0; + var $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0; + var $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0; + var $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0; + var $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0; + var $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0; + var $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0; + var $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0; + var $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0; + var $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0; + var $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0; + var $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0; + var $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0; + var $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0; + var $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0; + var $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0; + var $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0; + var $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0; + var $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $F$0$i$i = 0, $F1$0$i = 0, $F4$0 = 0, $F4$0$i$i = 0; + var $F5$0$i = 0, $I1$0$i$i = 0, $I7$0$i = 0, $I7$0$i$i = 0, $K12$029$i = 0, $K2$07$i$i = 0, $K8$051$i$i = 0, $R$0$i = 0, $R$0$i$i = 0, $R$0$i$i$lcssa = 0, $R$0$i$lcssa = 0, $R$0$i18 = 0, $R$0$i18$lcssa = 0, $R$1$i = 0, $R$1$i$i = 0, $R$1$i20 = 0, $RP$0$i = 0, $RP$0$i$i = 0, $RP$0$i$i$lcssa = 0, $RP$0$i$lcssa = 0; + var $RP$0$i17 = 0, $RP$0$i17$lcssa = 0, $T$0$lcssa$i = 0, $T$0$lcssa$i$i = 0, $T$0$lcssa$i25$i = 0, $T$028$i = 0, $T$028$i$lcssa = 0, $T$050$i$i = 0, $T$050$i$i$lcssa = 0, $T$06$i$i = 0, $T$06$i$i$lcssa = 0, $br$0$ph$i = 0, $cond$i = 0, $cond$i$i = 0, $cond$i21 = 0, $exitcond$i$i = 0, $i$02$i$i = 0, $idx$0$i = 0, $mem$0 = 0, $nb$0 = 0; + var $not$$i = 0, $not$$i$i = 0, $not$$i26$i = 0, $oldfirst$0$i$i = 0, $or$cond$i = 0, $or$cond$i30 = 0, $or$cond1$i = 0, $or$cond19$i = 0, $or$cond2$i = 0, $or$cond3$i = 0, $or$cond5$i = 0, $or$cond57$i = 0, $or$cond6$i = 0, $or$cond8$i = 0, $or$cond9$i = 0, $qsize$0$i$i = 0, $rsize$0$i = 0, $rsize$0$i$lcssa = 0, $rsize$0$i15 = 0, $rsize$1$i = 0; + var $rsize$2$i = 0, $rsize$3$lcssa$i = 0, $rsize$331$i = 0, $rst$0$i = 0, $rst$1$i = 0, $sizebits$0$i = 0, $sp$0$i$i = 0, $sp$0$i$i$i = 0, $sp$084$i = 0, $sp$084$i$lcssa = 0, $sp$183$i = 0, $sp$183$i$lcssa = 0, $ssize$0$$i = 0, $ssize$0$i = 0, $ssize$1$ph$i = 0, $ssize$2$i = 0, $t$0$i = 0, $t$0$i14 = 0, $t$1$i = 0, $t$2$ph$i = 0; + var $t$2$v$3$i = 0, $t$230$i = 0, $tbase$255$i = 0, $tsize$0$ph$i = 0, $tsize$0323944$i = 0, $tsize$1$i = 0, $tsize$254$i = 0, $v$0$i = 0, $v$0$i$lcssa = 0, $v$0$i16 = 0, $v$1$i = 0, $v$2$i = 0, $v$3$lcssa$i = 0, $v$3$ph$i = 0, $v$332$i = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($bytes>>>0)<(245); + do { + if ($0) { + $1 = ($bytes>>>0)<(11); + $2 = (($bytes) + 11)|0; + $3 = $2 & -8; + $4 = $1 ? 16 : $3; + $5 = $4 >>> 3; + $6 = HEAP32[6952>>2]|0; + $7 = $6 >>> $5; + $8 = $7 & 3; + $9 = ($8|0)==(0); + if (!($9)) { + $10 = $7 & 1; + $11 = $10 ^ 1; + $12 = (($11) + ($5))|0; + $13 = $12 << 1; + $14 = (6992 + ($13<<2)|0); + $$sum10 = (($13) + 2)|0; + $15 = (6992 + ($$sum10<<2)|0); + $16 = HEAP32[$15>>2]|0; + $17 = ((($16)) + 8|0); + $18 = HEAP32[$17>>2]|0; + $19 = ($14|0)==($18|0); + do { + if ($19) { + $20 = 1 << $12; + $21 = $20 ^ -1; + $22 = $6 & $21; + HEAP32[6952>>2] = $22; + } else { + $23 = HEAP32[(6968)>>2]|0; + $24 = ($18>>>0)<($23>>>0); + if ($24) { + _abort(); + // unreachable; + } + $25 = ((($18)) + 12|0); + $26 = HEAP32[$25>>2]|0; + $27 = ($26|0)==($16|0); + if ($27) { + HEAP32[$25>>2] = $14; + HEAP32[$15>>2] = $18; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $28 = $12 << 3; + $29 = $28 | 3; + $30 = ((($16)) + 4|0); + HEAP32[$30>>2] = $29; + $$sum1112 = $28 | 4; + $31 = (($16) + ($$sum1112)|0); + $32 = HEAP32[$31>>2]|0; + $33 = $32 | 1; + HEAP32[$31>>2] = $33; + $mem$0 = $17; + return ($mem$0|0); + } + $34 = HEAP32[(6960)>>2]|0; + $35 = ($4>>>0)>($34>>>0); + if ($35) { + $36 = ($7|0)==(0); + if (!($36)) { + $37 = $7 << $5; + $38 = 2 << $5; + $39 = (0 - ($38))|0; + $40 = $38 | $39; + $41 = $37 & $40; + $42 = (0 - ($41))|0; + $43 = $41 & $42; + $44 = (($43) + -1)|0; + $45 = $44 >>> 12; + $46 = $45 & 16; + $47 = $44 >>> $46; + $48 = $47 >>> 5; + $49 = $48 & 8; + $50 = $49 | $46; + $51 = $47 >>> $49; + $52 = $51 >>> 2; + $53 = $52 & 4; + $54 = $50 | $53; + $55 = $51 >>> $53; + $56 = $55 >>> 1; + $57 = $56 & 2; + $58 = $54 | $57; + $59 = $55 >>> $57; + $60 = $59 >>> 1; + $61 = $60 & 1; + $62 = $58 | $61; + $63 = $59 >>> $61; + $64 = (($62) + ($63))|0; + $65 = $64 << 1; + $66 = (6992 + ($65<<2)|0); + $$sum4 = (($65) + 2)|0; + $67 = (6992 + ($$sum4<<2)|0); + $68 = HEAP32[$67>>2]|0; + $69 = ((($68)) + 8|0); + $70 = HEAP32[$69>>2]|0; + $71 = ($66|0)==($70|0); + do { + if ($71) { + $72 = 1 << $64; + $73 = $72 ^ -1; + $74 = $6 & $73; + HEAP32[6952>>2] = $74; + $88 = $34; + } else { + $75 = HEAP32[(6968)>>2]|0; + $76 = ($70>>>0)<($75>>>0); + if ($76) { + _abort(); + // unreachable; + } + $77 = ((($70)) + 12|0); + $78 = HEAP32[$77>>2]|0; + $79 = ($78|0)==($68|0); + if ($79) { + HEAP32[$77>>2] = $66; + HEAP32[$67>>2] = $70; + $$pre = HEAP32[(6960)>>2]|0; + $88 = $$pre; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $80 = $64 << 3; + $81 = (($80) - ($4))|0; + $82 = $4 | 3; + $83 = ((($68)) + 4|0); + HEAP32[$83>>2] = $82; + $84 = (($68) + ($4)|0); + $85 = $81 | 1; + $$sum56 = $4 | 4; + $86 = (($68) + ($$sum56)|0); + HEAP32[$86>>2] = $85; + $87 = (($68) + ($80)|0); + HEAP32[$87>>2] = $81; + $89 = ($88|0)==(0); + if (!($89)) { + $90 = HEAP32[(6972)>>2]|0; + $91 = $88 >>> 3; + $92 = $91 << 1; + $93 = (6992 + ($92<<2)|0); + $94 = HEAP32[6952>>2]|0; + $95 = 1 << $91; + $96 = $94 & $95; + $97 = ($96|0)==(0); + if ($97) { + $98 = $94 | $95; + HEAP32[6952>>2] = $98; + $$pre105 = (($92) + 2)|0; + $$pre106 = (6992 + ($$pre105<<2)|0); + $$pre$phiZ2D = $$pre106;$F4$0 = $93; + } else { + $$sum9 = (($92) + 2)|0; + $99 = (6992 + ($$sum9<<2)|0); + $100 = HEAP32[$99>>2]|0; + $101 = HEAP32[(6968)>>2]|0; + $102 = ($100>>>0)<($101>>>0); + if ($102) { + _abort(); + // unreachable; + } else { + $$pre$phiZ2D = $99;$F4$0 = $100; + } + } + HEAP32[$$pre$phiZ2D>>2] = $90; + $103 = ((($F4$0)) + 12|0); + HEAP32[$103>>2] = $90; + $104 = ((($90)) + 8|0); + HEAP32[$104>>2] = $F4$0; + $105 = ((($90)) + 12|0); + HEAP32[$105>>2] = $93; + } + HEAP32[(6960)>>2] = $81; + HEAP32[(6972)>>2] = $84; + $mem$0 = $69; + return ($mem$0|0); + } + $106 = HEAP32[(6956)>>2]|0; + $107 = ($106|0)==(0); + if ($107) { + $nb$0 = $4; + } else { + $108 = (0 - ($106))|0; + $109 = $106 & $108; + $110 = (($109) + -1)|0; + $111 = $110 >>> 12; + $112 = $111 & 16; + $113 = $110 >>> $112; + $114 = $113 >>> 5; + $115 = $114 & 8; + $116 = $115 | $112; + $117 = $113 >>> $115; + $118 = $117 >>> 2; + $119 = $118 & 4; + $120 = $116 | $119; + $121 = $117 >>> $119; + $122 = $121 >>> 1; + $123 = $122 & 2; + $124 = $120 | $123; + $125 = $121 >>> $123; + $126 = $125 >>> 1; + $127 = $126 & 1; + $128 = $124 | $127; + $129 = $125 >>> $127; + $130 = (($128) + ($129))|0; + $131 = (7256 + ($130<<2)|0); + $132 = HEAP32[$131>>2]|0; + $133 = ((($132)) + 4|0); + $134 = HEAP32[$133>>2]|0; + $135 = $134 & -8; + $136 = (($135) - ($4))|0; + $rsize$0$i = $136;$t$0$i = $132;$v$0$i = $132; + while(1) { + $137 = ((($t$0$i)) + 16|0); + $138 = HEAP32[$137>>2]|0; + $139 = ($138|0)==(0|0); + if ($139) { + $140 = ((($t$0$i)) + 20|0); + $141 = HEAP32[$140>>2]|0; + $142 = ($141|0)==(0|0); + if ($142) { + $rsize$0$i$lcssa = $rsize$0$i;$v$0$i$lcssa = $v$0$i; + break; + } else { + $144 = $141; + } + } else { + $144 = $138; + } + $143 = ((($144)) + 4|0); + $145 = HEAP32[$143>>2]|0; + $146 = $145 & -8; + $147 = (($146) - ($4))|0; + $148 = ($147>>>0)<($rsize$0$i>>>0); + $$rsize$0$i = $148 ? $147 : $rsize$0$i; + $$v$0$i = $148 ? $144 : $v$0$i; + $rsize$0$i = $$rsize$0$i;$t$0$i = $144;$v$0$i = $$v$0$i; + } + $149 = HEAP32[(6968)>>2]|0; + $150 = ($v$0$i$lcssa>>>0)<($149>>>0); + if ($150) { + _abort(); + // unreachable; + } + $151 = (($v$0$i$lcssa) + ($4)|0); + $152 = ($v$0$i$lcssa>>>0)<($151>>>0); + if (!($152)) { + _abort(); + // unreachable; + } + $153 = ((($v$0$i$lcssa)) + 24|0); + $154 = HEAP32[$153>>2]|0; + $155 = ((($v$0$i$lcssa)) + 12|0); + $156 = HEAP32[$155>>2]|0; + $157 = ($156|0)==($v$0$i$lcssa|0); + do { + if ($157) { + $167 = ((($v$0$i$lcssa)) + 20|0); + $168 = HEAP32[$167>>2]|0; + $169 = ($168|0)==(0|0); + if ($169) { + $170 = ((($v$0$i$lcssa)) + 16|0); + $171 = HEAP32[$170>>2]|0; + $172 = ($171|0)==(0|0); + if ($172) { + $R$1$i = 0; + break; + } else { + $R$0$i = $171;$RP$0$i = $170; + } + } else { + $R$0$i = $168;$RP$0$i = $167; + } + while(1) { + $173 = ((($R$0$i)) + 20|0); + $174 = HEAP32[$173>>2]|0; + $175 = ($174|0)==(0|0); + if (!($175)) { + $R$0$i = $174;$RP$0$i = $173; + continue; + } + $176 = ((($R$0$i)) + 16|0); + $177 = HEAP32[$176>>2]|0; + $178 = ($177|0)==(0|0); + if ($178) { + $R$0$i$lcssa = $R$0$i;$RP$0$i$lcssa = $RP$0$i; + break; + } else { + $R$0$i = $177;$RP$0$i = $176; + } + } + $179 = ($RP$0$i$lcssa>>>0)<($149>>>0); + if ($179) { + _abort(); + // unreachable; + } else { + HEAP32[$RP$0$i$lcssa>>2] = 0; + $R$1$i = $R$0$i$lcssa; + break; + } + } else { + $158 = ((($v$0$i$lcssa)) + 8|0); + $159 = HEAP32[$158>>2]|0; + $160 = ($159>>>0)<($149>>>0); + if ($160) { + _abort(); + // unreachable; + } + $161 = ((($159)) + 12|0); + $162 = HEAP32[$161>>2]|0; + $163 = ($162|0)==($v$0$i$lcssa|0); + if (!($163)) { + _abort(); + // unreachable; + } + $164 = ((($156)) + 8|0); + $165 = HEAP32[$164>>2]|0; + $166 = ($165|0)==($v$0$i$lcssa|0); + if ($166) { + HEAP32[$161>>2] = $156; + HEAP32[$164>>2] = $159; + $R$1$i = $156; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $180 = ($154|0)==(0|0); + do { + if (!($180)) { + $181 = ((($v$0$i$lcssa)) + 28|0); + $182 = HEAP32[$181>>2]|0; + $183 = (7256 + ($182<<2)|0); + $184 = HEAP32[$183>>2]|0; + $185 = ($v$0$i$lcssa|0)==($184|0); + if ($185) { + HEAP32[$183>>2] = $R$1$i; + $cond$i = ($R$1$i|0)==(0|0); + if ($cond$i) { + $186 = 1 << $182; + $187 = $186 ^ -1; + $188 = HEAP32[(6956)>>2]|0; + $189 = $188 & $187; + HEAP32[(6956)>>2] = $189; + break; + } + } else { + $190 = HEAP32[(6968)>>2]|0; + $191 = ($154>>>0)<($190>>>0); + if ($191) { + _abort(); + // unreachable; + } + $192 = ((($154)) + 16|0); + $193 = HEAP32[$192>>2]|0; + $194 = ($193|0)==($v$0$i$lcssa|0); + if ($194) { + HEAP32[$192>>2] = $R$1$i; + } else { + $195 = ((($154)) + 20|0); + HEAP32[$195>>2] = $R$1$i; + } + $196 = ($R$1$i|0)==(0|0); + if ($196) { + break; + } + } + $197 = HEAP32[(6968)>>2]|0; + $198 = ($R$1$i>>>0)<($197>>>0); + if ($198) { + _abort(); + // unreachable; + } + $199 = ((($R$1$i)) + 24|0); + HEAP32[$199>>2] = $154; + $200 = ((($v$0$i$lcssa)) + 16|0); + $201 = HEAP32[$200>>2]|0; + $202 = ($201|0)==(0|0); + do { + if (!($202)) { + $203 = ($201>>>0)<($197>>>0); + if ($203) { + _abort(); + // unreachable; + } else { + $204 = ((($R$1$i)) + 16|0); + HEAP32[$204>>2] = $201; + $205 = ((($201)) + 24|0); + HEAP32[$205>>2] = $R$1$i; + break; + } + } + } while(0); + $206 = ((($v$0$i$lcssa)) + 20|0); + $207 = HEAP32[$206>>2]|0; + $208 = ($207|0)==(0|0); + if (!($208)) { + $209 = HEAP32[(6968)>>2]|0; + $210 = ($207>>>0)<($209>>>0); + if ($210) { + _abort(); + // unreachable; + } else { + $211 = ((($R$1$i)) + 20|0); + HEAP32[$211>>2] = $207; + $212 = ((($207)) + 24|0); + HEAP32[$212>>2] = $R$1$i; + break; + } + } + } + } while(0); + $213 = ($rsize$0$i$lcssa>>>0)<(16); + if ($213) { + $214 = (($rsize$0$i$lcssa) + ($4))|0; + $215 = $214 | 3; + $216 = ((($v$0$i$lcssa)) + 4|0); + HEAP32[$216>>2] = $215; + $$sum4$i = (($214) + 4)|0; + $217 = (($v$0$i$lcssa) + ($$sum4$i)|0); + $218 = HEAP32[$217>>2]|0; + $219 = $218 | 1; + HEAP32[$217>>2] = $219; + } else { + $220 = $4 | 3; + $221 = ((($v$0$i$lcssa)) + 4|0); + HEAP32[$221>>2] = $220; + $222 = $rsize$0$i$lcssa | 1; + $$sum$i35 = $4 | 4; + $223 = (($v$0$i$lcssa) + ($$sum$i35)|0); + HEAP32[$223>>2] = $222; + $$sum1$i = (($rsize$0$i$lcssa) + ($4))|0; + $224 = (($v$0$i$lcssa) + ($$sum1$i)|0); + HEAP32[$224>>2] = $rsize$0$i$lcssa; + $225 = HEAP32[(6960)>>2]|0; + $226 = ($225|0)==(0); + if (!($226)) { + $227 = HEAP32[(6972)>>2]|0; + $228 = $225 >>> 3; + $229 = $228 << 1; + $230 = (6992 + ($229<<2)|0); + $231 = HEAP32[6952>>2]|0; + $232 = 1 << $228; + $233 = $231 & $232; + $234 = ($233|0)==(0); + if ($234) { + $235 = $231 | $232; + HEAP32[6952>>2] = $235; + $$pre$i = (($229) + 2)|0; + $$pre8$i = (6992 + ($$pre$i<<2)|0); + $$pre$phi$iZ2D = $$pre8$i;$F1$0$i = $230; + } else { + $$sum3$i = (($229) + 2)|0; + $236 = (6992 + ($$sum3$i<<2)|0); + $237 = HEAP32[$236>>2]|0; + $238 = HEAP32[(6968)>>2]|0; + $239 = ($237>>>0)<($238>>>0); + if ($239) { + _abort(); + // unreachable; + } else { + $$pre$phi$iZ2D = $236;$F1$0$i = $237; + } + } + HEAP32[$$pre$phi$iZ2D>>2] = $227; + $240 = ((($F1$0$i)) + 12|0); + HEAP32[$240>>2] = $227; + $241 = ((($227)) + 8|0); + HEAP32[$241>>2] = $F1$0$i; + $242 = ((($227)) + 12|0); + HEAP32[$242>>2] = $230; + } + HEAP32[(6960)>>2] = $rsize$0$i$lcssa; + HEAP32[(6972)>>2] = $151; + } + $243 = ((($v$0$i$lcssa)) + 8|0); + $mem$0 = $243; + return ($mem$0|0); + } + } else { + $nb$0 = $4; + } + } else { + $244 = ($bytes>>>0)>(4294967231); + if ($244) { + $nb$0 = -1; + } else { + $245 = (($bytes) + 11)|0; + $246 = $245 & -8; + $247 = HEAP32[(6956)>>2]|0; + $248 = ($247|0)==(0); + if ($248) { + $nb$0 = $246; + } else { + $249 = (0 - ($246))|0; + $250 = $245 >>> 8; + $251 = ($250|0)==(0); + if ($251) { + $idx$0$i = 0; + } else { + $252 = ($246>>>0)>(16777215); + if ($252) { + $idx$0$i = 31; + } else { + $253 = (($250) + 1048320)|0; + $254 = $253 >>> 16; + $255 = $254 & 8; + $256 = $250 << $255; + $257 = (($256) + 520192)|0; + $258 = $257 >>> 16; + $259 = $258 & 4; + $260 = $259 | $255; + $261 = $256 << $259; + $262 = (($261) + 245760)|0; + $263 = $262 >>> 16; + $264 = $263 & 2; + $265 = $260 | $264; + $266 = (14 - ($265))|0; + $267 = $261 << $264; + $268 = $267 >>> 15; + $269 = (($266) + ($268))|0; + $270 = $269 << 1; + $271 = (($269) + 7)|0; + $272 = $246 >>> $271; + $273 = $272 & 1; + $274 = $273 | $270; + $idx$0$i = $274; + } + } + $275 = (7256 + ($idx$0$i<<2)|0); + $276 = HEAP32[$275>>2]|0; + $277 = ($276|0)==(0|0); + L123: do { + if ($277) { + $rsize$2$i = $249;$t$1$i = 0;$v$2$i = 0; + label = 86; + } else { + $278 = ($idx$0$i|0)==(31); + $279 = $idx$0$i >>> 1; + $280 = (25 - ($279))|0; + $281 = $278 ? 0 : $280; + $282 = $246 << $281; + $rsize$0$i15 = $249;$rst$0$i = 0;$sizebits$0$i = $282;$t$0$i14 = $276;$v$0$i16 = 0; + while(1) { + $283 = ((($t$0$i14)) + 4|0); + $284 = HEAP32[$283>>2]|0; + $285 = $284 & -8; + $286 = (($285) - ($246))|0; + $287 = ($286>>>0)<($rsize$0$i15>>>0); + if ($287) { + $288 = ($285|0)==($246|0); + if ($288) { + $rsize$331$i = $286;$t$230$i = $t$0$i14;$v$332$i = $t$0$i14; + label = 90; + break L123; + } else { + $rsize$1$i = $286;$v$1$i = $t$0$i14; + } + } else { + $rsize$1$i = $rsize$0$i15;$v$1$i = $v$0$i16; + } + $289 = ((($t$0$i14)) + 20|0); + $290 = HEAP32[$289>>2]|0; + $291 = $sizebits$0$i >>> 31; + $292 = (((($t$0$i14)) + 16|0) + ($291<<2)|0); + $293 = HEAP32[$292>>2]|0; + $294 = ($290|0)==(0|0); + $295 = ($290|0)==($293|0); + $or$cond19$i = $294 | $295; + $rst$1$i = $or$cond19$i ? $rst$0$i : $290; + $296 = ($293|0)==(0|0); + $297 = $sizebits$0$i << 1; + if ($296) { + $rsize$2$i = $rsize$1$i;$t$1$i = $rst$1$i;$v$2$i = $v$1$i; + label = 86; + break; + } else { + $rsize$0$i15 = $rsize$1$i;$rst$0$i = $rst$1$i;$sizebits$0$i = $297;$t$0$i14 = $293;$v$0$i16 = $v$1$i; + } + } + } + } while(0); + if ((label|0) == 86) { + $298 = ($t$1$i|0)==(0|0); + $299 = ($v$2$i|0)==(0|0); + $or$cond$i = $298 & $299; + if ($or$cond$i) { + $300 = 2 << $idx$0$i; + $301 = (0 - ($300))|0; + $302 = $300 | $301; + $303 = $247 & $302; + $304 = ($303|0)==(0); + if ($304) { + $nb$0 = $246; + break; + } + $305 = (0 - ($303))|0; + $306 = $303 & $305; + $307 = (($306) + -1)|0; + $308 = $307 >>> 12; + $309 = $308 & 16; + $310 = $307 >>> $309; + $311 = $310 >>> 5; + $312 = $311 & 8; + $313 = $312 | $309; + $314 = $310 >>> $312; + $315 = $314 >>> 2; + $316 = $315 & 4; + $317 = $313 | $316; + $318 = $314 >>> $316; + $319 = $318 >>> 1; + $320 = $319 & 2; + $321 = $317 | $320; + $322 = $318 >>> $320; + $323 = $322 >>> 1; + $324 = $323 & 1; + $325 = $321 | $324; + $326 = $322 >>> $324; + $327 = (($325) + ($326))|0; + $328 = (7256 + ($327<<2)|0); + $329 = HEAP32[$328>>2]|0; + $t$2$ph$i = $329;$v$3$ph$i = 0; + } else { + $t$2$ph$i = $t$1$i;$v$3$ph$i = $v$2$i; + } + $330 = ($t$2$ph$i|0)==(0|0); + if ($330) { + $rsize$3$lcssa$i = $rsize$2$i;$v$3$lcssa$i = $v$3$ph$i; + } else { + $rsize$331$i = $rsize$2$i;$t$230$i = $t$2$ph$i;$v$332$i = $v$3$ph$i; + label = 90; + } + } + if ((label|0) == 90) { + while(1) { + label = 0; + $331 = ((($t$230$i)) + 4|0); + $332 = HEAP32[$331>>2]|0; + $333 = $332 & -8; + $334 = (($333) - ($246))|0; + $335 = ($334>>>0)<($rsize$331$i>>>0); + $$rsize$3$i = $335 ? $334 : $rsize$331$i; + $t$2$v$3$i = $335 ? $t$230$i : $v$332$i; + $336 = ((($t$230$i)) + 16|0); + $337 = HEAP32[$336>>2]|0; + $338 = ($337|0)==(0|0); + if (!($338)) { + $rsize$331$i = $$rsize$3$i;$t$230$i = $337;$v$332$i = $t$2$v$3$i; + label = 90; + continue; + } + $339 = ((($t$230$i)) + 20|0); + $340 = HEAP32[$339>>2]|0; + $341 = ($340|0)==(0|0); + if ($341) { + $rsize$3$lcssa$i = $$rsize$3$i;$v$3$lcssa$i = $t$2$v$3$i; + break; + } else { + $rsize$331$i = $$rsize$3$i;$t$230$i = $340;$v$332$i = $t$2$v$3$i; + label = 90; + } + } + } + $342 = ($v$3$lcssa$i|0)==(0|0); + if ($342) { + $nb$0 = $246; + } else { + $343 = HEAP32[(6960)>>2]|0; + $344 = (($343) - ($246))|0; + $345 = ($rsize$3$lcssa$i>>>0)<($344>>>0); + if ($345) { + $346 = HEAP32[(6968)>>2]|0; + $347 = ($v$3$lcssa$i>>>0)<($346>>>0); + if ($347) { + _abort(); + // unreachable; + } + $348 = (($v$3$lcssa$i) + ($246)|0); + $349 = ($v$3$lcssa$i>>>0)<($348>>>0); + if (!($349)) { + _abort(); + // unreachable; + } + $350 = ((($v$3$lcssa$i)) + 24|0); + $351 = HEAP32[$350>>2]|0; + $352 = ((($v$3$lcssa$i)) + 12|0); + $353 = HEAP32[$352>>2]|0; + $354 = ($353|0)==($v$3$lcssa$i|0); + do { + if ($354) { + $364 = ((($v$3$lcssa$i)) + 20|0); + $365 = HEAP32[$364>>2]|0; + $366 = ($365|0)==(0|0); + if ($366) { + $367 = ((($v$3$lcssa$i)) + 16|0); + $368 = HEAP32[$367>>2]|0; + $369 = ($368|0)==(0|0); + if ($369) { + $R$1$i20 = 0; + break; + } else { + $R$0$i18 = $368;$RP$0$i17 = $367; + } + } else { + $R$0$i18 = $365;$RP$0$i17 = $364; + } + while(1) { + $370 = ((($R$0$i18)) + 20|0); + $371 = HEAP32[$370>>2]|0; + $372 = ($371|0)==(0|0); + if (!($372)) { + $R$0$i18 = $371;$RP$0$i17 = $370; + continue; + } + $373 = ((($R$0$i18)) + 16|0); + $374 = HEAP32[$373>>2]|0; + $375 = ($374|0)==(0|0); + if ($375) { + $R$0$i18$lcssa = $R$0$i18;$RP$0$i17$lcssa = $RP$0$i17; + break; + } else { + $R$0$i18 = $374;$RP$0$i17 = $373; + } + } + $376 = ($RP$0$i17$lcssa>>>0)<($346>>>0); + if ($376) { + _abort(); + // unreachable; + } else { + HEAP32[$RP$0$i17$lcssa>>2] = 0; + $R$1$i20 = $R$0$i18$lcssa; + break; + } + } else { + $355 = ((($v$3$lcssa$i)) + 8|0); + $356 = HEAP32[$355>>2]|0; + $357 = ($356>>>0)<($346>>>0); + if ($357) { + _abort(); + // unreachable; + } + $358 = ((($356)) + 12|0); + $359 = HEAP32[$358>>2]|0; + $360 = ($359|0)==($v$3$lcssa$i|0); + if (!($360)) { + _abort(); + // unreachable; + } + $361 = ((($353)) + 8|0); + $362 = HEAP32[$361>>2]|0; + $363 = ($362|0)==($v$3$lcssa$i|0); + if ($363) { + HEAP32[$358>>2] = $353; + HEAP32[$361>>2] = $356; + $R$1$i20 = $353; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $377 = ($351|0)==(0|0); + do { + if (!($377)) { + $378 = ((($v$3$lcssa$i)) + 28|0); + $379 = HEAP32[$378>>2]|0; + $380 = (7256 + ($379<<2)|0); + $381 = HEAP32[$380>>2]|0; + $382 = ($v$3$lcssa$i|0)==($381|0); + if ($382) { + HEAP32[$380>>2] = $R$1$i20; + $cond$i21 = ($R$1$i20|0)==(0|0); + if ($cond$i21) { + $383 = 1 << $379; + $384 = $383 ^ -1; + $385 = HEAP32[(6956)>>2]|0; + $386 = $385 & $384; + HEAP32[(6956)>>2] = $386; + break; + } + } else { + $387 = HEAP32[(6968)>>2]|0; + $388 = ($351>>>0)<($387>>>0); + if ($388) { + _abort(); + // unreachable; + } + $389 = ((($351)) + 16|0); + $390 = HEAP32[$389>>2]|0; + $391 = ($390|0)==($v$3$lcssa$i|0); + if ($391) { + HEAP32[$389>>2] = $R$1$i20; + } else { + $392 = ((($351)) + 20|0); + HEAP32[$392>>2] = $R$1$i20; + } + $393 = ($R$1$i20|0)==(0|0); + if ($393) { + break; + } + } + $394 = HEAP32[(6968)>>2]|0; + $395 = ($R$1$i20>>>0)<($394>>>0); + if ($395) { + _abort(); + // unreachable; + } + $396 = ((($R$1$i20)) + 24|0); + HEAP32[$396>>2] = $351; + $397 = ((($v$3$lcssa$i)) + 16|0); + $398 = HEAP32[$397>>2]|0; + $399 = ($398|0)==(0|0); + do { + if (!($399)) { + $400 = ($398>>>0)<($394>>>0); + if ($400) { + _abort(); + // unreachable; + } else { + $401 = ((($R$1$i20)) + 16|0); + HEAP32[$401>>2] = $398; + $402 = ((($398)) + 24|0); + HEAP32[$402>>2] = $R$1$i20; + break; + } + } + } while(0); + $403 = ((($v$3$lcssa$i)) + 20|0); + $404 = HEAP32[$403>>2]|0; + $405 = ($404|0)==(0|0); + if (!($405)) { + $406 = HEAP32[(6968)>>2]|0; + $407 = ($404>>>0)<($406>>>0); + if ($407) { + _abort(); + // unreachable; + } else { + $408 = ((($R$1$i20)) + 20|0); + HEAP32[$408>>2] = $404; + $409 = ((($404)) + 24|0); + HEAP32[$409>>2] = $R$1$i20; + break; + } + } + } + } while(0); + $410 = ($rsize$3$lcssa$i>>>0)<(16); + L199: do { + if ($410) { + $411 = (($rsize$3$lcssa$i) + ($246))|0; + $412 = $411 | 3; + $413 = ((($v$3$lcssa$i)) + 4|0); + HEAP32[$413>>2] = $412; + $$sum18$i = (($411) + 4)|0; + $414 = (($v$3$lcssa$i) + ($$sum18$i)|0); + $415 = HEAP32[$414>>2]|0; + $416 = $415 | 1; + HEAP32[$414>>2] = $416; + } else { + $417 = $246 | 3; + $418 = ((($v$3$lcssa$i)) + 4|0); + HEAP32[$418>>2] = $417; + $419 = $rsize$3$lcssa$i | 1; + $$sum$i2334 = $246 | 4; + $420 = (($v$3$lcssa$i) + ($$sum$i2334)|0); + HEAP32[$420>>2] = $419; + $$sum1$i24 = (($rsize$3$lcssa$i) + ($246))|0; + $421 = (($v$3$lcssa$i) + ($$sum1$i24)|0); + HEAP32[$421>>2] = $rsize$3$lcssa$i; + $422 = $rsize$3$lcssa$i >>> 3; + $423 = ($rsize$3$lcssa$i>>>0)<(256); + if ($423) { + $424 = $422 << 1; + $425 = (6992 + ($424<<2)|0); + $426 = HEAP32[6952>>2]|0; + $427 = 1 << $422; + $428 = $426 & $427; + $429 = ($428|0)==(0); + if ($429) { + $430 = $426 | $427; + HEAP32[6952>>2] = $430; + $$pre$i25 = (($424) + 2)|0; + $$pre43$i = (6992 + ($$pre$i25<<2)|0); + $$pre$phi$i26Z2D = $$pre43$i;$F5$0$i = $425; + } else { + $$sum17$i = (($424) + 2)|0; + $431 = (6992 + ($$sum17$i<<2)|0); + $432 = HEAP32[$431>>2]|0; + $433 = HEAP32[(6968)>>2]|0; + $434 = ($432>>>0)<($433>>>0); + if ($434) { + _abort(); + // unreachable; + } else { + $$pre$phi$i26Z2D = $431;$F5$0$i = $432; + } + } + HEAP32[$$pre$phi$i26Z2D>>2] = $348; + $435 = ((($F5$0$i)) + 12|0); + HEAP32[$435>>2] = $348; + $$sum15$i = (($246) + 8)|0; + $436 = (($v$3$lcssa$i) + ($$sum15$i)|0); + HEAP32[$436>>2] = $F5$0$i; + $$sum16$i = (($246) + 12)|0; + $437 = (($v$3$lcssa$i) + ($$sum16$i)|0); + HEAP32[$437>>2] = $425; + break; + } + $438 = $rsize$3$lcssa$i >>> 8; + $439 = ($438|0)==(0); + if ($439) { + $I7$0$i = 0; + } else { + $440 = ($rsize$3$lcssa$i>>>0)>(16777215); + if ($440) { + $I7$0$i = 31; + } else { + $441 = (($438) + 1048320)|0; + $442 = $441 >>> 16; + $443 = $442 & 8; + $444 = $438 << $443; + $445 = (($444) + 520192)|0; + $446 = $445 >>> 16; + $447 = $446 & 4; + $448 = $447 | $443; + $449 = $444 << $447; + $450 = (($449) + 245760)|0; + $451 = $450 >>> 16; + $452 = $451 & 2; + $453 = $448 | $452; + $454 = (14 - ($453))|0; + $455 = $449 << $452; + $456 = $455 >>> 15; + $457 = (($454) + ($456))|0; + $458 = $457 << 1; + $459 = (($457) + 7)|0; + $460 = $rsize$3$lcssa$i >>> $459; + $461 = $460 & 1; + $462 = $461 | $458; + $I7$0$i = $462; + } + } + $463 = (7256 + ($I7$0$i<<2)|0); + $$sum2$i = (($246) + 28)|0; + $464 = (($v$3$lcssa$i) + ($$sum2$i)|0); + HEAP32[$464>>2] = $I7$0$i; + $$sum3$i27 = (($246) + 16)|0; + $465 = (($v$3$lcssa$i) + ($$sum3$i27)|0); + $$sum4$i28 = (($246) + 20)|0; + $466 = (($v$3$lcssa$i) + ($$sum4$i28)|0); + HEAP32[$466>>2] = 0; + HEAP32[$465>>2] = 0; + $467 = HEAP32[(6956)>>2]|0; + $468 = 1 << $I7$0$i; + $469 = $467 & $468; + $470 = ($469|0)==(0); + if ($470) { + $471 = $467 | $468; + HEAP32[(6956)>>2] = $471; + HEAP32[$463>>2] = $348; + $$sum5$i = (($246) + 24)|0; + $472 = (($v$3$lcssa$i) + ($$sum5$i)|0); + HEAP32[$472>>2] = $463; + $$sum6$i = (($246) + 12)|0; + $473 = (($v$3$lcssa$i) + ($$sum6$i)|0); + HEAP32[$473>>2] = $348; + $$sum7$i = (($246) + 8)|0; + $474 = (($v$3$lcssa$i) + ($$sum7$i)|0); + HEAP32[$474>>2] = $348; + break; + } + $475 = HEAP32[$463>>2]|0; + $476 = ((($475)) + 4|0); + $477 = HEAP32[$476>>2]|0; + $478 = $477 & -8; + $479 = ($478|0)==($rsize$3$lcssa$i|0); + L217: do { + if ($479) { + $T$0$lcssa$i = $475; + } else { + $480 = ($I7$0$i|0)==(31); + $481 = $I7$0$i >>> 1; + $482 = (25 - ($481))|0; + $483 = $480 ? 0 : $482; + $484 = $rsize$3$lcssa$i << $483; + $K12$029$i = $484;$T$028$i = $475; + while(1) { + $491 = $K12$029$i >>> 31; + $492 = (((($T$028$i)) + 16|0) + ($491<<2)|0); + $487 = HEAP32[$492>>2]|0; + $493 = ($487|0)==(0|0); + if ($493) { + $$lcssa232 = $492;$T$028$i$lcssa = $T$028$i; + break; + } + $485 = $K12$029$i << 1; + $486 = ((($487)) + 4|0); + $488 = HEAP32[$486>>2]|0; + $489 = $488 & -8; + $490 = ($489|0)==($rsize$3$lcssa$i|0); + if ($490) { + $T$0$lcssa$i = $487; + break L217; + } else { + $K12$029$i = $485;$T$028$i = $487; + } + } + $494 = HEAP32[(6968)>>2]|0; + $495 = ($$lcssa232>>>0)<($494>>>0); + if ($495) { + _abort(); + // unreachable; + } else { + HEAP32[$$lcssa232>>2] = $348; + $$sum11$i = (($246) + 24)|0; + $496 = (($v$3$lcssa$i) + ($$sum11$i)|0); + HEAP32[$496>>2] = $T$028$i$lcssa; + $$sum12$i = (($246) + 12)|0; + $497 = (($v$3$lcssa$i) + ($$sum12$i)|0); + HEAP32[$497>>2] = $348; + $$sum13$i = (($246) + 8)|0; + $498 = (($v$3$lcssa$i) + ($$sum13$i)|0); + HEAP32[$498>>2] = $348; + break L199; + } + } + } while(0); + $499 = ((($T$0$lcssa$i)) + 8|0); + $500 = HEAP32[$499>>2]|0; + $501 = HEAP32[(6968)>>2]|0; + $502 = ($500>>>0)>=($501>>>0); + $not$$i = ($T$0$lcssa$i>>>0)>=($501>>>0); + $503 = $502 & $not$$i; + if ($503) { + $504 = ((($500)) + 12|0); + HEAP32[$504>>2] = $348; + HEAP32[$499>>2] = $348; + $$sum8$i = (($246) + 8)|0; + $505 = (($v$3$lcssa$i) + ($$sum8$i)|0); + HEAP32[$505>>2] = $500; + $$sum9$i = (($246) + 12)|0; + $506 = (($v$3$lcssa$i) + ($$sum9$i)|0); + HEAP32[$506>>2] = $T$0$lcssa$i; + $$sum10$i = (($246) + 24)|0; + $507 = (($v$3$lcssa$i) + ($$sum10$i)|0); + HEAP32[$507>>2] = 0; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $508 = ((($v$3$lcssa$i)) + 8|0); + $mem$0 = $508; + return ($mem$0|0); + } else { + $nb$0 = $246; + } + } + } + } + } + } while(0); + $509 = HEAP32[(6960)>>2]|0; + $510 = ($509>>>0)<($nb$0>>>0); + if (!($510)) { + $511 = (($509) - ($nb$0))|0; + $512 = HEAP32[(6972)>>2]|0; + $513 = ($511>>>0)>(15); + if ($513) { + $514 = (($512) + ($nb$0)|0); + HEAP32[(6972)>>2] = $514; + HEAP32[(6960)>>2] = $511; + $515 = $511 | 1; + $$sum2 = (($nb$0) + 4)|0; + $516 = (($512) + ($$sum2)|0); + HEAP32[$516>>2] = $515; + $517 = (($512) + ($509)|0); + HEAP32[$517>>2] = $511; + $518 = $nb$0 | 3; + $519 = ((($512)) + 4|0); + HEAP32[$519>>2] = $518; + } else { + HEAP32[(6960)>>2] = 0; + HEAP32[(6972)>>2] = 0; + $520 = $509 | 3; + $521 = ((($512)) + 4|0); + HEAP32[$521>>2] = $520; + $$sum1 = (($509) + 4)|0; + $522 = (($512) + ($$sum1)|0); + $523 = HEAP32[$522>>2]|0; + $524 = $523 | 1; + HEAP32[$522>>2] = $524; + } + $525 = ((($512)) + 8|0); + $mem$0 = $525; + return ($mem$0|0); + } + $526 = HEAP32[(6964)>>2]|0; + $527 = ($526>>>0)>($nb$0>>>0); + if ($527) { + $528 = (($526) - ($nb$0))|0; + HEAP32[(6964)>>2] = $528; + $529 = HEAP32[(6976)>>2]|0; + $530 = (($529) + ($nb$0)|0); + HEAP32[(6976)>>2] = $530; + $531 = $528 | 1; + $$sum = (($nb$0) + 4)|0; + $532 = (($529) + ($$sum)|0); + HEAP32[$532>>2] = $531; + $533 = $nb$0 | 3; + $534 = ((($529)) + 4|0); + HEAP32[$534>>2] = $533; + $535 = ((($529)) + 8|0); + $mem$0 = $535; + return ($mem$0|0); + } + $536 = HEAP32[7424>>2]|0; + $537 = ($536|0)==(0); + do { + if ($537) { + $538 = (_sysconf(30)|0); + $539 = (($538) + -1)|0; + $540 = $539 & $538; + $541 = ($540|0)==(0); + if ($541) { + HEAP32[(7432)>>2] = $538; + HEAP32[(7428)>>2] = $538; + HEAP32[(7436)>>2] = -1; + HEAP32[(7440)>>2] = -1; + HEAP32[(7444)>>2] = 0; + HEAP32[(7396)>>2] = 0; + $542 = (_time((0|0))|0); + $543 = $542 & -16; + $544 = $543 ^ 1431655768; + HEAP32[7424>>2] = $544; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $545 = (($nb$0) + 48)|0; + $546 = HEAP32[(7432)>>2]|0; + $547 = (($nb$0) + 47)|0; + $548 = (($546) + ($547))|0; + $549 = (0 - ($546))|0; + $550 = $548 & $549; + $551 = ($550>>>0)>($nb$0>>>0); + if (!($551)) { + $mem$0 = 0; + return ($mem$0|0); + } + $552 = HEAP32[(7392)>>2]|0; + $553 = ($552|0)==(0); + if (!($553)) { + $554 = HEAP32[(7384)>>2]|0; + $555 = (($554) + ($550))|0; + $556 = ($555>>>0)<=($554>>>0); + $557 = ($555>>>0)>($552>>>0); + $or$cond1$i = $556 | $557; + if ($or$cond1$i) { + $mem$0 = 0; + return ($mem$0|0); + } + } + $558 = HEAP32[(7396)>>2]|0; + $559 = $558 & 4; + $560 = ($559|0)==(0); + L258: do { + if ($560) { + $561 = HEAP32[(6976)>>2]|0; + $562 = ($561|0)==(0|0); + L260: do { + if ($562) { + label = 174; + } else { + $sp$0$i$i = (7400); + while(1) { + $563 = HEAP32[$sp$0$i$i>>2]|0; + $564 = ($563>>>0)>($561>>>0); + if (!($564)) { + $565 = ((($sp$0$i$i)) + 4|0); + $566 = HEAP32[$565>>2]|0; + $567 = (($563) + ($566)|0); + $568 = ($567>>>0)>($561>>>0); + if ($568) { + $$lcssa228 = $sp$0$i$i;$$lcssa230 = $565; + break; + } + } + $569 = ((($sp$0$i$i)) + 8|0); + $570 = HEAP32[$569>>2]|0; + $571 = ($570|0)==(0|0); + if ($571) { + label = 174; + break L260; + } else { + $sp$0$i$i = $570; + } + } + $594 = HEAP32[(6964)>>2]|0; + $595 = (($548) - ($594))|0; + $596 = $595 & $549; + $597 = ($596>>>0)<(2147483647); + if ($597) { + $598 = (_sbrk(($596|0))|0); + $599 = HEAP32[$$lcssa228>>2]|0; + $600 = HEAP32[$$lcssa230>>2]|0; + $601 = (($599) + ($600)|0); + $602 = ($598|0)==($601|0); + $$3$i = $602 ? $596 : 0; + if ($602) { + $603 = ($598|0)==((-1)|0); + if ($603) { + $tsize$0323944$i = $$3$i; + } else { + $tbase$255$i = $598;$tsize$254$i = $$3$i; + label = 194; + break L258; + } + } else { + $br$0$ph$i = $598;$ssize$1$ph$i = $596;$tsize$0$ph$i = $$3$i; + label = 184; + } + } else { + $tsize$0323944$i = 0; + } + } + } while(0); + do { + if ((label|0) == 174) { + $572 = (_sbrk(0)|0); + $573 = ($572|0)==((-1)|0); + if ($573) { + $tsize$0323944$i = 0; + } else { + $574 = $572; + $575 = HEAP32[(7428)>>2]|0; + $576 = (($575) + -1)|0; + $577 = $576 & $574; + $578 = ($577|0)==(0); + if ($578) { + $ssize$0$i = $550; + } else { + $579 = (($576) + ($574))|0; + $580 = (0 - ($575))|0; + $581 = $579 & $580; + $582 = (($550) - ($574))|0; + $583 = (($582) + ($581))|0; + $ssize$0$i = $583; + } + $584 = HEAP32[(7384)>>2]|0; + $585 = (($584) + ($ssize$0$i))|0; + $586 = ($ssize$0$i>>>0)>($nb$0>>>0); + $587 = ($ssize$0$i>>>0)<(2147483647); + $or$cond$i30 = $586 & $587; + if ($or$cond$i30) { + $588 = HEAP32[(7392)>>2]|0; + $589 = ($588|0)==(0); + if (!($589)) { + $590 = ($585>>>0)<=($584>>>0); + $591 = ($585>>>0)>($588>>>0); + $or$cond2$i = $590 | $591; + if ($or$cond2$i) { + $tsize$0323944$i = 0; + break; + } + } + $592 = (_sbrk(($ssize$0$i|0))|0); + $593 = ($592|0)==($572|0); + $ssize$0$$i = $593 ? $ssize$0$i : 0; + if ($593) { + $tbase$255$i = $572;$tsize$254$i = $ssize$0$$i; + label = 194; + break L258; + } else { + $br$0$ph$i = $592;$ssize$1$ph$i = $ssize$0$i;$tsize$0$ph$i = $ssize$0$$i; + label = 184; + } + } else { + $tsize$0323944$i = 0; + } + } + } + } while(0); + L280: do { + if ((label|0) == 184) { + $604 = (0 - ($ssize$1$ph$i))|0; + $605 = ($br$0$ph$i|0)!=((-1)|0); + $606 = ($ssize$1$ph$i>>>0)<(2147483647); + $or$cond5$i = $606 & $605; + $607 = ($545>>>0)>($ssize$1$ph$i>>>0); + $or$cond6$i = $607 & $or$cond5$i; + do { + if ($or$cond6$i) { + $608 = HEAP32[(7432)>>2]|0; + $609 = (($547) - ($ssize$1$ph$i))|0; + $610 = (($609) + ($608))|0; + $611 = (0 - ($608))|0; + $612 = $610 & $611; + $613 = ($612>>>0)<(2147483647); + if ($613) { + $614 = (_sbrk(($612|0))|0); + $615 = ($614|0)==((-1)|0); + if ($615) { + (_sbrk(($604|0))|0); + $tsize$0323944$i = $tsize$0$ph$i; + break L280; + } else { + $616 = (($612) + ($ssize$1$ph$i))|0; + $ssize$2$i = $616; + break; + } + } else { + $ssize$2$i = $ssize$1$ph$i; + } + } else { + $ssize$2$i = $ssize$1$ph$i; + } + } while(0); + $617 = ($br$0$ph$i|0)==((-1)|0); + if ($617) { + $tsize$0323944$i = $tsize$0$ph$i; + } else { + $tbase$255$i = $br$0$ph$i;$tsize$254$i = $ssize$2$i; + label = 194; + break L258; + } + } + } while(0); + $618 = HEAP32[(7396)>>2]|0; + $619 = $618 | 4; + HEAP32[(7396)>>2] = $619; + $tsize$1$i = $tsize$0323944$i; + label = 191; + } else { + $tsize$1$i = 0; + label = 191; + } + } while(0); + if ((label|0) == 191) { + $620 = ($550>>>0)<(2147483647); + if ($620) { + $621 = (_sbrk(($550|0))|0); + $622 = (_sbrk(0)|0); + $623 = ($621|0)!=((-1)|0); + $624 = ($622|0)!=((-1)|0); + $or$cond3$i = $623 & $624; + $625 = ($621>>>0)<($622>>>0); + $or$cond8$i = $625 & $or$cond3$i; + if ($or$cond8$i) { + $626 = $622; + $627 = $621; + $628 = (($626) - ($627))|0; + $629 = (($nb$0) + 40)|0; + $630 = ($628>>>0)>($629>>>0); + $$tsize$1$i = $630 ? $628 : $tsize$1$i; + if ($630) { + $tbase$255$i = $621;$tsize$254$i = $$tsize$1$i; + label = 194; + } + } + } + } + if ((label|0) == 194) { + $631 = HEAP32[(7384)>>2]|0; + $632 = (($631) + ($tsize$254$i))|0; + HEAP32[(7384)>>2] = $632; + $633 = HEAP32[(7388)>>2]|0; + $634 = ($632>>>0)>($633>>>0); + if ($634) { + HEAP32[(7388)>>2] = $632; + } + $635 = HEAP32[(6976)>>2]|0; + $636 = ($635|0)==(0|0); + L299: do { + if ($636) { + $637 = HEAP32[(6968)>>2]|0; + $638 = ($637|0)==(0|0); + $639 = ($tbase$255$i>>>0)<($637>>>0); + $or$cond9$i = $638 | $639; + if ($or$cond9$i) { + HEAP32[(6968)>>2] = $tbase$255$i; + } + HEAP32[(7400)>>2] = $tbase$255$i; + HEAP32[(7404)>>2] = $tsize$254$i; + HEAP32[(7412)>>2] = 0; + $640 = HEAP32[7424>>2]|0; + HEAP32[(6988)>>2] = $640; + HEAP32[(6984)>>2] = -1; + $i$02$i$i = 0; + while(1) { + $641 = $i$02$i$i << 1; + $642 = (6992 + ($641<<2)|0); + $$sum$i$i = (($641) + 3)|0; + $643 = (6992 + ($$sum$i$i<<2)|0); + HEAP32[$643>>2] = $642; + $$sum1$i$i = (($641) + 2)|0; + $644 = (6992 + ($$sum1$i$i<<2)|0); + HEAP32[$644>>2] = $642; + $645 = (($i$02$i$i) + 1)|0; + $exitcond$i$i = ($645|0)==(32); + if ($exitcond$i$i) { + break; + } else { + $i$02$i$i = $645; + } + } + $646 = (($tsize$254$i) + -40)|0; + $647 = ((($tbase$255$i)) + 8|0); + $648 = $647; + $649 = $648 & 7; + $650 = ($649|0)==(0); + $651 = (0 - ($648))|0; + $652 = $651 & 7; + $653 = $650 ? 0 : $652; + $654 = (($tbase$255$i) + ($653)|0); + $655 = (($646) - ($653))|0; + HEAP32[(6976)>>2] = $654; + HEAP32[(6964)>>2] = $655; + $656 = $655 | 1; + $$sum$i13$i = (($653) + 4)|0; + $657 = (($tbase$255$i) + ($$sum$i13$i)|0); + HEAP32[$657>>2] = $656; + $$sum2$i$i = (($tsize$254$i) + -36)|0; + $658 = (($tbase$255$i) + ($$sum2$i$i)|0); + HEAP32[$658>>2] = 40; + $659 = HEAP32[(7440)>>2]|0; + HEAP32[(6980)>>2] = $659; + } else { + $sp$084$i = (7400); + while(1) { + $660 = HEAP32[$sp$084$i>>2]|0; + $661 = ((($sp$084$i)) + 4|0); + $662 = HEAP32[$661>>2]|0; + $663 = (($660) + ($662)|0); + $664 = ($tbase$255$i|0)==($663|0); + if ($664) { + $$lcssa222 = $660;$$lcssa224 = $661;$$lcssa226 = $662;$sp$084$i$lcssa = $sp$084$i; + label = 204; + break; + } + $665 = ((($sp$084$i)) + 8|0); + $666 = HEAP32[$665>>2]|0; + $667 = ($666|0)==(0|0); + if ($667) { + break; + } else { + $sp$084$i = $666; + } + } + if ((label|0) == 204) { + $668 = ((($sp$084$i$lcssa)) + 12|0); + $669 = HEAP32[$668>>2]|0; + $670 = $669 & 8; + $671 = ($670|0)==(0); + if ($671) { + $672 = ($635>>>0)>=($$lcssa222>>>0); + $673 = ($635>>>0)<($tbase$255$i>>>0); + $or$cond57$i = $673 & $672; + if ($or$cond57$i) { + $674 = (($$lcssa226) + ($tsize$254$i))|0; + HEAP32[$$lcssa224>>2] = $674; + $675 = HEAP32[(6964)>>2]|0; + $676 = (($675) + ($tsize$254$i))|0; + $677 = ((($635)) + 8|0); + $678 = $677; + $679 = $678 & 7; + $680 = ($679|0)==(0); + $681 = (0 - ($678))|0; + $682 = $681 & 7; + $683 = $680 ? 0 : $682; + $684 = (($635) + ($683)|0); + $685 = (($676) - ($683))|0; + HEAP32[(6976)>>2] = $684; + HEAP32[(6964)>>2] = $685; + $686 = $685 | 1; + $$sum$i17$i = (($683) + 4)|0; + $687 = (($635) + ($$sum$i17$i)|0); + HEAP32[$687>>2] = $686; + $$sum2$i18$i = (($676) + 4)|0; + $688 = (($635) + ($$sum2$i18$i)|0); + HEAP32[$688>>2] = 40; + $689 = HEAP32[(7440)>>2]|0; + HEAP32[(6980)>>2] = $689; + break; + } + } + } + $690 = HEAP32[(6968)>>2]|0; + $691 = ($tbase$255$i>>>0)<($690>>>0); + if ($691) { + HEAP32[(6968)>>2] = $tbase$255$i; + $755 = $tbase$255$i; + } else { + $755 = $690; + } + $692 = (($tbase$255$i) + ($tsize$254$i)|0); + $sp$183$i = (7400); + while(1) { + $693 = HEAP32[$sp$183$i>>2]|0; + $694 = ($693|0)==($692|0); + if ($694) { + $$lcssa219 = $sp$183$i;$sp$183$i$lcssa = $sp$183$i; + label = 212; + break; + } + $695 = ((($sp$183$i)) + 8|0); + $696 = HEAP32[$695>>2]|0; + $697 = ($696|0)==(0|0); + if ($697) { + $sp$0$i$i$i = (7400); + break; + } else { + $sp$183$i = $696; + } + } + if ((label|0) == 212) { + $698 = ((($sp$183$i$lcssa)) + 12|0); + $699 = HEAP32[$698>>2]|0; + $700 = $699 & 8; + $701 = ($700|0)==(0); + if ($701) { + HEAP32[$$lcssa219>>2] = $tbase$255$i; + $702 = ((($sp$183$i$lcssa)) + 4|0); + $703 = HEAP32[$702>>2]|0; + $704 = (($703) + ($tsize$254$i))|0; + HEAP32[$702>>2] = $704; + $705 = ((($tbase$255$i)) + 8|0); + $706 = $705; + $707 = $706 & 7; + $708 = ($707|0)==(0); + $709 = (0 - ($706))|0; + $710 = $709 & 7; + $711 = $708 ? 0 : $710; + $712 = (($tbase$255$i) + ($711)|0); + $$sum112$i = (($tsize$254$i) + 8)|0; + $713 = (($tbase$255$i) + ($$sum112$i)|0); + $714 = $713; + $715 = $714 & 7; + $716 = ($715|0)==(0); + $717 = (0 - ($714))|0; + $718 = $717 & 7; + $719 = $716 ? 0 : $718; + $$sum113$i = (($719) + ($tsize$254$i))|0; + $720 = (($tbase$255$i) + ($$sum113$i)|0); + $721 = $720; + $722 = $712; + $723 = (($721) - ($722))|0; + $$sum$i19$i = (($711) + ($nb$0))|0; + $724 = (($tbase$255$i) + ($$sum$i19$i)|0); + $725 = (($723) - ($nb$0))|0; + $726 = $nb$0 | 3; + $$sum1$i20$i = (($711) + 4)|0; + $727 = (($tbase$255$i) + ($$sum1$i20$i)|0); + HEAP32[$727>>2] = $726; + $728 = ($720|0)==($635|0); + L324: do { + if ($728) { + $729 = HEAP32[(6964)>>2]|0; + $730 = (($729) + ($725))|0; + HEAP32[(6964)>>2] = $730; + HEAP32[(6976)>>2] = $724; + $731 = $730 | 1; + $$sum42$i$i = (($$sum$i19$i) + 4)|0; + $732 = (($tbase$255$i) + ($$sum42$i$i)|0); + HEAP32[$732>>2] = $731; + } else { + $733 = HEAP32[(6972)>>2]|0; + $734 = ($720|0)==($733|0); + if ($734) { + $735 = HEAP32[(6960)>>2]|0; + $736 = (($735) + ($725))|0; + HEAP32[(6960)>>2] = $736; + HEAP32[(6972)>>2] = $724; + $737 = $736 | 1; + $$sum40$i$i = (($$sum$i19$i) + 4)|0; + $738 = (($tbase$255$i) + ($$sum40$i$i)|0); + HEAP32[$738>>2] = $737; + $$sum41$i$i = (($736) + ($$sum$i19$i))|0; + $739 = (($tbase$255$i) + ($$sum41$i$i)|0); + HEAP32[$739>>2] = $736; + break; + } + $$sum2$i21$i = (($tsize$254$i) + 4)|0; + $$sum114$i = (($$sum2$i21$i) + ($719))|0; + $740 = (($tbase$255$i) + ($$sum114$i)|0); + $741 = HEAP32[$740>>2]|0; + $742 = $741 & 3; + $743 = ($742|0)==(1); + if ($743) { + $744 = $741 & -8; + $745 = $741 >>> 3; + $746 = ($741>>>0)<(256); + L332: do { + if ($746) { + $$sum3738$i$i = $719 | 8; + $$sum124$i = (($$sum3738$i$i) + ($tsize$254$i))|0; + $747 = (($tbase$255$i) + ($$sum124$i)|0); + $748 = HEAP32[$747>>2]|0; + $$sum39$i$i = (($tsize$254$i) + 12)|0; + $$sum125$i = (($$sum39$i$i) + ($719))|0; + $749 = (($tbase$255$i) + ($$sum125$i)|0); + $750 = HEAP32[$749>>2]|0; + $751 = $745 << 1; + $752 = (6992 + ($751<<2)|0); + $753 = ($748|0)==($752|0); + do { + if (!($753)) { + $754 = ($748>>>0)<($755>>>0); + if ($754) { + _abort(); + // unreachable; + } + $756 = ((($748)) + 12|0); + $757 = HEAP32[$756>>2]|0; + $758 = ($757|0)==($720|0); + if ($758) { + break; + } + _abort(); + // unreachable; + } + } while(0); + $759 = ($750|0)==($748|0); + if ($759) { + $760 = 1 << $745; + $761 = $760 ^ -1; + $762 = HEAP32[6952>>2]|0; + $763 = $762 & $761; + HEAP32[6952>>2] = $763; + break; + } + $764 = ($750|0)==($752|0); + do { + if ($764) { + $$pre57$i$i = ((($750)) + 8|0); + $$pre$phi58$i$iZ2D = $$pre57$i$i; + } else { + $765 = ($750>>>0)<($755>>>0); + if ($765) { + _abort(); + // unreachable; + } + $766 = ((($750)) + 8|0); + $767 = HEAP32[$766>>2]|0; + $768 = ($767|0)==($720|0); + if ($768) { + $$pre$phi58$i$iZ2D = $766; + break; + } + _abort(); + // unreachable; + } + } while(0); + $769 = ((($748)) + 12|0); + HEAP32[$769>>2] = $750; + HEAP32[$$pre$phi58$i$iZ2D>>2] = $748; + } else { + $$sum34$i$i = $719 | 24; + $$sum115$i = (($$sum34$i$i) + ($tsize$254$i))|0; + $770 = (($tbase$255$i) + ($$sum115$i)|0); + $771 = HEAP32[$770>>2]|0; + $$sum5$i$i = (($tsize$254$i) + 12)|0; + $$sum116$i = (($$sum5$i$i) + ($719))|0; + $772 = (($tbase$255$i) + ($$sum116$i)|0); + $773 = HEAP32[$772>>2]|0; + $774 = ($773|0)==($720|0); + do { + if ($774) { + $$sum67$i$i = $719 | 16; + $$sum122$i = (($$sum2$i21$i) + ($$sum67$i$i))|0; + $784 = (($tbase$255$i) + ($$sum122$i)|0); + $785 = HEAP32[$784>>2]|0; + $786 = ($785|0)==(0|0); + if ($786) { + $$sum123$i = (($$sum67$i$i) + ($tsize$254$i))|0; + $787 = (($tbase$255$i) + ($$sum123$i)|0); + $788 = HEAP32[$787>>2]|0; + $789 = ($788|0)==(0|0); + if ($789) { + $R$1$i$i = 0; + break; + } else { + $R$0$i$i = $788;$RP$0$i$i = $787; + } + } else { + $R$0$i$i = $785;$RP$0$i$i = $784; + } + while(1) { + $790 = ((($R$0$i$i)) + 20|0); + $791 = HEAP32[$790>>2]|0; + $792 = ($791|0)==(0|0); + if (!($792)) { + $R$0$i$i = $791;$RP$0$i$i = $790; + continue; + } + $793 = ((($R$0$i$i)) + 16|0); + $794 = HEAP32[$793>>2]|0; + $795 = ($794|0)==(0|0); + if ($795) { + $R$0$i$i$lcssa = $R$0$i$i;$RP$0$i$i$lcssa = $RP$0$i$i; + break; + } else { + $R$0$i$i = $794;$RP$0$i$i = $793; + } + } + $796 = ($RP$0$i$i$lcssa>>>0)<($755>>>0); + if ($796) { + _abort(); + // unreachable; + } else { + HEAP32[$RP$0$i$i$lcssa>>2] = 0; + $R$1$i$i = $R$0$i$i$lcssa; + break; + } + } else { + $$sum3536$i$i = $719 | 8; + $$sum117$i = (($$sum3536$i$i) + ($tsize$254$i))|0; + $775 = (($tbase$255$i) + ($$sum117$i)|0); + $776 = HEAP32[$775>>2]|0; + $777 = ($776>>>0)<($755>>>0); + if ($777) { + _abort(); + // unreachable; + } + $778 = ((($776)) + 12|0); + $779 = HEAP32[$778>>2]|0; + $780 = ($779|0)==($720|0); + if (!($780)) { + _abort(); + // unreachable; + } + $781 = ((($773)) + 8|0); + $782 = HEAP32[$781>>2]|0; + $783 = ($782|0)==($720|0); + if ($783) { + HEAP32[$778>>2] = $773; + HEAP32[$781>>2] = $776; + $R$1$i$i = $773; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $797 = ($771|0)==(0|0); + if ($797) { + break; + } + $$sum30$i$i = (($tsize$254$i) + 28)|0; + $$sum118$i = (($$sum30$i$i) + ($719))|0; + $798 = (($tbase$255$i) + ($$sum118$i)|0); + $799 = HEAP32[$798>>2]|0; + $800 = (7256 + ($799<<2)|0); + $801 = HEAP32[$800>>2]|0; + $802 = ($720|0)==($801|0); + do { + if ($802) { + HEAP32[$800>>2] = $R$1$i$i; + $cond$i$i = ($R$1$i$i|0)==(0|0); + if (!($cond$i$i)) { + break; + } + $803 = 1 << $799; + $804 = $803 ^ -1; + $805 = HEAP32[(6956)>>2]|0; + $806 = $805 & $804; + HEAP32[(6956)>>2] = $806; + break L332; + } else { + $807 = HEAP32[(6968)>>2]|0; + $808 = ($771>>>0)<($807>>>0); + if ($808) { + _abort(); + // unreachable; + } + $809 = ((($771)) + 16|0); + $810 = HEAP32[$809>>2]|0; + $811 = ($810|0)==($720|0); + if ($811) { + HEAP32[$809>>2] = $R$1$i$i; + } else { + $812 = ((($771)) + 20|0); + HEAP32[$812>>2] = $R$1$i$i; + } + $813 = ($R$1$i$i|0)==(0|0); + if ($813) { + break L332; + } + } + } while(0); + $814 = HEAP32[(6968)>>2]|0; + $815 = ($R$1$i$i>>>0)<($814>>>0); + if ($815) { + _abort(); + // unreachable; + } + $816 = ((($R$1$i$i)) + 24|0); + HEAP32[$816>>2] = $771; + $$sum3132$i$i = $719 | 16; + $$sum119$i = (($$sum3132$i$i) + ($tsize$254$i))|0; + $817 = (($tbase$255$i) + ($$sum119$i)|0); + $818 = HEAP32[$817>>2]|0; + $819 = ($818|0)==(0|0); + do { + if (!($819)) { + $820 = ($818>>>0)<($814>>>0); + if ($820) { + _abort(); + // unreachable; + } else { + $821 = ((($R$1$i$i)) + 16|0); + HEAP32[$821>>2] = $818; + $822 = ((($818)) + 24|0); + HEAP32[$822>>2] = $R$1$i$i; + break; + } + } + } while(0); + $$sum120$i = (($$sum2$i21$i) + ($$sum3132$i$i))|0; + $823 = (($tbase$255$i) + ($$sum120$i)|0); + $824 = HEAP32[$823>>2]|0; + $825 = ($824|0)==(0|0); + if ($825) { + break; + } + $826 = HEAP32[(6968)>>2]|0; + $827 = ($824>>>0)<($826>>>0); + if ($827) { + _abort(); + // unreachable; + } else { + $828 = ((($R$1$i$i)) + 20|0); + HEAP32[$828>>2] = $824; + $829 = ((($824)) + 24|0); + HEAP32[$829>>2] = $R$1$i$i; + break; + } + } + } while(0); + $$sum9$i$i = $744 | $719; + $$sum121$i = (($$sum9$i$i) + ($tsize$254$i))|0; + $830 = (($tbase$255$i) + ($$sum121$i)|0); + $831 = (($744) + ($725))|0; + $oldfirst$0$i$i = $830;$qsize$0$i$i = $831; + } else { + $oldfirst$0$i$i = $720;$qsize$0$i$i = $725; + } + $832 = ((($oldfirst$0$i$i)) + 4|0); + $833 = HEAP32[$832>>2]|0; + $834 = $833 & -2; + HEAP32[$832>>2] = $834; + $835 = $qsize$0$i$i | 1; + $$sum10$i$i = (($$sum$i19$i) + 4)|0; + $836 = (($tbase$255$i) + ($$sum10$i$i)|0); + HEAP32[$836>>2] = $835; + $$sum11$i$i = (($qsize$0$i$i) + ($$sum$i19$i))|0; + $837 = (($tbase$255$i) + ($$sum11$i$i)|0); + HEAP32[$837>>2] = $qsize$0$i$i; + $838 = $qsize$0$i$i >>> 3; + $839 = ($qsize$0$i$i>>>0)<(256); + if ($839) { + $840 = $838 << 1; + $841 = (6992 + ($840<<2)|0); + $842 = HEAP32[6952>>2]|0; + $843 = 1 << $838; + $844 = $842 & $843; + $845 = ($844|0)==(0); + do { + if ($845) { + $846 = $842 | $843; + HEAP32[6952>>2] = $846; + $$pre$i22$i = (($840) + 2)|0; + $$pre56$i$i = (6992 + ($$pre$i22$i<<2)|0); + $$pre$phi$i23$iZ2D = $$pre56$i$i;$F4$0$i$i = $841; + } else { + $$sum29$i$i = (($840) + 2)|0; + $847 = (6992 + ($$sum29$i$i<<2)|0); + $848 = HEAP32[$847>>2]|0; + $849 = HEAP32[(6968)>>2]|0; + $850 = ($848>>>0)<($849>>>0); + if (!($850)) { + $$pre$phi$i23$iZ2D = $847;$F4$0$i$i = $848; + break; + } + _abort(); + // unreachable; + } + } while(0); + HEAP32[$$pre$phi$i23$iZ2D>>2] = $724; + $851 = ((($F4$0$i$i)) + 12|0); + HEAP32[$851>>2] = $724; + $$sum27$i$i = (($$sum$i19$i) + 8)|0; + $852 = (($tbase$255$i) + ($$sum27$i$i)|0); + HEAP32[$852>>2] = $F4$0$i$i; + $$sum28$i$i = (($$sum$i19$i) + 12)|0; + $853 = (($tbase$255$i) + ($$sum28$i$i)|0); + HEAP32[$853>>2] = $841; + break; + } + $854 = $qsize$0$i$i >>> 8; + $855 = ($854|0)==(0); + do { + if ($855) { + $I7$0$i$i = 0; + } else { + $856 = ($qsize$0$i$i>>>0)>(16777215); + if ($856) { + $I7$0$i$i = 31; + break; + } + $857 = (($854) + 1048320)|0; + $858 = $857 >>> 16; + $859 = $858 & 8; + $860 = $854 << $859; + $861 = (($860) + 520192)|0; + $862 = $861 >>> 16; + $863 = $862 & 4; + $864 = $863 | $859; + $865 = $860 << $863; + $866 = (($865) + 245760)|0; + $867 = $866 >>> 16; + $868 = $867 & 2; + $869 = $864 | $868; + $870 = (14 - ($869))|0; + $871 = $865 << $868; + $872 = $871 >>> 15; + $873 = (($870) + ($872))|0; + $874 = $873 << 1; + $875 = (($873) + 7)|0; + $876 = $qsize$0$i$i >>> $875; + $877 = $876 & 1; + $878 = $877 | $874; + $I7$0$i$i = $878; + } + } while(0); + $879 = (7256 + ($I7$0$i$i<<2)|0); + $$sum12$i$i = (($$sum$i19$i) + 28)|0; + $880 = (($tbase$255$i) + ($$sum12$i$i)|0); + HEAP32[$880>>2] = $I7$0$i$i; + $$sum13$i$i = (($$sum$i19$i) + 16)|0; + $881 = (($tbase$255$i) + ($$sum13$i$i)|0); + $$sum14$i$i = (($$sum$i19$i) + 20)|0; + $882 = (($tbase$255$i) + ($$sum14$i$i)|0); + HEAP32[$882>>2] = 0; + HEAP32[$881>>2] = 0; + $883 = HEAP32[(6956)>>2]|0; + $884 = 1 << $I7$0$i$i; + $885 = $883 & $884; + $886 = ($885|0)==(0); + if ($886) { + $887 = $883 | $884; + HEAP32[(6956)>>2] = $887; + HEAP32[$879>>2] = $724; + $$sum15$i$i = (($$sum$i19$i) + 24)|0; + $888 = (($tbase$255$i) + ($$sum15$i$i)|0); + HEAP32[$888>>2] = $879; + $$sum16$i$i = (($$sum$i19$i) + 12)|0; + $889 = (($tbase$255$i) + ($$sum16$i$i)|0); + HEAP32[$889>>2] = $724; + $$sum17$i$i = (($$sum$i19$i) + 8)|0; + $890 = (($tbase$255$i) + ($$sum17$i$i)|0); + HEAP32[$890>>2] = $724; + break; + } + $891 = HEAP32[$879>>2]|0; + $892 = ((($891)) + 4|0); + $893 = HEAP32[$892>>2]|0; + $894 = $893 & -8; + $895 = ($894|0)==($qsize$0$i$i|0); + L418: do { + if ($895) { + $T$0$lcssa$i25$i = $891; + } else { + $896 = ($I7$0$i$i|0)==(31); + $897 = $I7$0$i$i >>> 1; + $898 = (25 - ($897))|0; + $899 = $896 ? 0 : $898; + $900 = $qsize$0$i$i << $899; + $K8$051$i$i = $900;$T$050$i$i = $891; + while(1) { + $907 = $K8$051$i$i >>> 31; + $908 = (((($T$050$i$i)) + 16|0) + ($907<<2)|0); + $903 = HEAP32[$908>>2]|0; + $909 = ($903|0)==(0|0); + if ($909) { + $$lcssa = $908;$T$050$i$i$lcssa = $T$050$i$i; + break; + } + $901 = $K8$051$i$i << 1; + $902 = ((($903)) + 4|0); + $904 = HEAP32[$902>>2]|0; + $905 = $904 & -8; + $906 = ($905|0)==($qsize$0$i$i|0); + if ($906) { + $T$0$lcssa$i25$i = $903; + break L418; + } else { + $K8$051$i$i = $901;$T$050$i$i = $903; + } + } + $910 = HEAP32[(6968)>>2]|0; + $911 = ($$lcssa>>>0)<($910>>>0); + if ($911) { + _abort(); + // unreachable; + } else { + HEAP32[$$lcssa>>2] = $724; + $$sum23$i$i = (($$sum$i19$i) + 24)|0; + $912 = (($tbase$255$i) + ($$sum23$i$i)|0); + HEAP32[$912>>2] = $T$050$i$i$lcssa; + $$sum24$i$i = (($$sum$i19$i) + 12)|0; + $913 = (($tbase$255$i) + ($$sum24$i$i)|0); + HEAP32[$913>>2] = $724; + $$sum25$i$i = (($$sum$i19$i) + 8)|0; + $914 = (($tbase$255$i) + ($$sum25$i$i)|0); + HEAP32[$914>>2] = $724; + break L324; + } + } + } while(0); + $915 = ((($T$0$lcssa$i25$i)) + 8|0); + $916 = HEAP32[$915>>2]|0; + $917 = HEAP32[(6968)>>2]|0; + $918 = ($916>>>0)>=($917>>>0); + $not$$i26$i = ($T$0$lcssa$i25$i>>>0)>=($917>>>0); + $919 = $918 & $not$$i26$i; + if ($919) { + $920 = ((($916)) + 12|0); + HEAP32[$920>>2] = $724; + HEAP32[$915>>2] = $724; + $$sum20$i$i = (($$sum$i19$i) + 8)|0; + $921 = (($tbase$255$i) + ($$sum20$i$i)|0); + HEAP32[$921>>2] = $916; + $$sum21$i$i = (($$sum$i19$i) + 12)|0; + $922 = (($tbase$255$i) + ($$sum21$i$i)|0); + HEAP32[$922>>2] = $T$0$lcssa$i25$i; + $$sum22$i$i = (($$sum$i19$i) + 24)|0; + $923 = (($tbase$255$i) + ($$sum22$i$i)|0); + HEAP32[$923>>2] = 0; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $$sum1819$i$i = $711 | 8; + $924 = (($tbase$255$i) + ($$sum1819$i$i)|0); + $mem$0 = $924; + return ($mem$0|0); + } else { + $sp$0$i$i$i = (7400); + } + } + while(1) { + $925 = HEAP32[$sp$0$i$i$i>>2]|0; + $926 = ($925>>>0)>($635>>>0); + if (!($926)) { + $927 = ((($sp$0$i$i$i)) + 4|0); + $928 = HEAP32[$927>>2]|0; + $929 = (($925) + ($928)|0); + $930 = ($929>>>0)>($635>>>0); + if ($930) { + $$lcssa215 = $925;$$lcssa216 = $928;$$lcssa217 = $929; + break; + } + } + $931 = ((($sp$0$i$i$i)) + 8|0); + $932 = HEAP32[$931>>2]|0; + $sp$0$i$i$i = $932; + } + $$sum$i14$i = (($$lcssa216) + -47)|0; + $$sum1$i15$i = (($$lcssa216) + -39)|0; + $933 = (($$lcssa215) + ($$sum1$i15$i)|0); + $934 = $933; + $935 = $934 & 7; + $936 = ($935|0)==(0); + $937 = (0 - ($934))|0; + $938 = $937 & 7; + $939 = $936 ? 0 : $938; + $$sum2$i16$i = (($$sum$i14$i) + ($939))|0; + $940 = (($$lcssa215) + ($$sum2$i16$i)|0); + $941 = ((($635)) + 16|0); + $942 = ($940>>>0)<($941>>>0); + $943 = $942 ? $635 : $940; + $944 = ((($943)) + 8|0); + $945 = (($tsize$254$i) + -40)|0; + $946 = ((($tbase$255$i)) + 8|0); + $947 = $946; + $948 = $947 & 7; + $949 = ($948|0)==(0); + $950 = (0 - ($947))|0; + $951 = $950 & 7; + $952 = $949 ? 0 : $951; + $953 = (($tbase$255$i) + ($952)|0); + $954 = (($945) - ($952))|0; + HEAP32[(6976)>>2] = $953; + HEAP32[(6964)>>2] = $954; + $955 = $954 | 1; + $$sum$i$i$i = (($952) + 4)|0; + $956 = (($tbase$255$i) + ($$sum$i$i$i)|0); + HEAP32[$956>>2] = $955; + $$sum2$i$i$i = (($tsize$254$i) + -36)|0; + $957 = (($tbase$255$i) + ($$sum2$i$i$i)|0); + HEAP32[$957>>2] = 40; + $958 = HEAP32[(7440)>>2]|0; + HEAP32[(6980)>>2] = $958; + $959 = ((($943)) + 4|0); + HEAP32[$959>>2] = 27; + ;HEAP32[$944>>2]=HEAP32[(7400)>>2]|0;HEAP32[$944+4>>2]=HEAP32[(7400)+4>>2]|0;HEAP32[$944+8>>2]=HEAP32[(7400)+8>>2]|0;HEAP32[$944+12>>2]=HEAP32[(7400)+12>>2]|0; + HEAP32[(7400)>>2] = $tbase$255$i; + HEAP32[(7404)>>2] = $tsize$254$i; + HEAP32[(7412)>>2] = 0; + HEAP32[(7408)>>2] = $944; + $960 = ((($943)) + 28|0); + HEAP32[$960>>2] = 7; + $961 = ((($943)) + 32|0); + $962 = ($961>>>0)<($$lcssa217>>>0); + if ($962) { + $964 = $960; + while(1) { + $963 = ((($964)) + 4|0); + HEAP32[$963>>2] = 7; + $965 = ((($964)) + 8|0); + $966 = ($965>>>0)<($$lcssa217>>>0); + if ($966) { + $964 = $963; + } else { + break; + } + } + } + $967 = ($943|0)==($635|0); + if (!($967)) { + $968 = $943; + $969 = $635; + $970 = (($968) - ($969))|0; + $971 = HEAP32[$959>>2]|0; + $972 = $971 & -2; + HEAP32[$959>>2] = $972; + $973 = $970 | 1; + $974 = ((($635)) + 4|0); + HEAP32[$974>>2] = $973; + HEAP32[$943>>2] = $970; + $975 = $970 >>> 3; + $976 = ($970>>>0)<(256); + if ($976) { + $977 = $975 << 1; + $978 = (6992 + ($977<<2)|0); + $979 = HEAP32[6952>>2]|0; + $980 = 1 << $975; + $981 = $979 & $980; + $982 = ($981|0)==(0); + if ($982) { + $983 = $979 | $980; + HEAP32[6952>>2] = $983; + $$pre$i$i = (($977) + 2)|0; + $$pre14$i$i = (6992 + ($$pre$i$i<<2)|0); + $$pre$phi$i$iZ2D = $$pre14$i$i;$F$0$i$i = $978; + } else { + $$sum4$i$i = (($977) + 2)|0; + $984 = (6992 + ($$sum4$i$i<<2)|0); + $985 = HEAP32[$984>>2]|0; + $986 = HEAP32[(6968)>>2]|0; + $987 = ($985>>>0)<($986>>>0); + if ($987) { + _abort(); + // unreachable; + } else { + $$pre$phi$i$iZ2D = $984;$F$0$i$i = $985; + } + } + HEAP32[$$pre$phi$i$iZ2D>>2] = $635; + $988 = ((($F$0$i$i)) + 12|0); + HEAP32[$988>>2] = $635; + $989 = ((($635)) + 8|0); + HEAP32[$989>>2] = $F$0$i$i; + $990 = ((($635)) + 12|0); + HEAP32[$990>>2] = $978; + break; + } + $991 = $970 >>> 8; + $992 = ($991|0)==(0); + if ($992) { + $I1$0$i$i = 0; + } else { + $993 = ($970>>>0)>(16777215); + if ($993) { + $I1$0$i$i = 31; + } else { + $994 = (($991) + 1048320)|0; + $995 = $994 >>> 16; + $996 = $995 & 8; + $997 = $991 << $996; + $998 = (($997) + 520192)|0; + $999 = $998 >>> 16; + $1000 = $999 & 4; + $1001 = $1000 | $996; + $1002 = $997 << $1000; + $1003 = (($1002) + 245760)|0; + $1004 = $1003 >>> 16; + $1005 = $1004 & 2; + $1006 = $1001 | $1005; + $1007 = (14 - ($1006))|0; + $1008 = $1002 << $1005; + $1009 = $1008 >>> 15; + $1010 = (($1007) + ($1009))|0; + $1011 = $1010 << 1; + $1012 = (($1010) + 7)|0; + $1013 = $970 >>> $1012; + $1014 = $1013 & 1; + $1015 = $1014 | $1011; + $I1$0$i$i = $1015; + } + } + $1016 = (7256 + ($I1$0$i$i<<2)|0); + $1017 = ((($635)) + 28|0); + HEAP32[$1017>>2] = $I1$0$i$i; + $1018 = ((($635)) + 20|0); + HEAP32[$1018>>2] = 0; + HEAP32[$941>>2] = 0; + $1019 = HEAP32[(6956)>>2]|0; + $1020 = 1 << $I1$0$i$i; + $1021 = $1019 & $1020; + $1022 = ($1021|0)==(0); + if ($1022) { + $1023 = $1019 | $1020; + HEAP32[(6956)>>2] = $1023; + HEAP32[$1016>>2] = $635; + $1024 = ((($635)) + 24|0); + HEAP32[$1024>>2] = $1016; + $1025 = ((($635)) + 12|0); + HEAP32[$1025>>2] = $635; + $1026 = ((($635)) + 8|0); + HEAP32[$1026>>2] = $635; + break; + } + $1027 = HEAP32[$1016>>2]|0; + $1028 = ((($1027)) + 4|0); + $1029 = HEAP32[$1028>>2]|0; + $1030 = $1029 & -8; + $1031 = ($1030|0)==($970|0); + L459: do { + if ($1031) { + $T$0$lcssa$i$i = $1027; + } else { + $1032 = ($I1$0$i$i|0)==(31); + $1033 = $I1$0$i$i >>> 1; + $1034 = (25 - ($1033))|0; + $1035 = $1032 ? 0 : $1034; + $1036 = $970 << $1035; + $K2$07$i$i = $1036;$T$06$i$i = $1027; + while(1) { + $1043 = $K2$07$i$i >>> 31; + $1044 = (((($T$06$i$i)) + 16|0) + ($1043<<2)|0); + $1039 = HEAP32[$1044>>2]|0; + $1045 = ($1039|0)==(0|0); + if ($1045) { + $$lcssa211 = $1044;$T$06$i$i$lcssa = $T$06$i$i; + break; + } + $1037 = $K2$07$i$i << 1; + $1038 = ((($1039)) + 4|0); + $1040 = HEAP32[$1038>>2]|0; + $1041 = $1040 & -8; + $1042 = ($1041|0)==($970|0); + if ($1042) { + $T$0$lcssa$i$i = $1039; + break L459; + } else { + $K2$07$i$i = $1037;$T$06$i$i = $1039; + } + } + $1046 = HEAP32[(6968)>>2]|0; + $1047 = ($$lcssa211>>>0)<($1046>>>0); + if ($1047) { + _abort(); + // unreachable; + } else { + HEAP32[$$lcssa211>>2] = $635; + $1048 = ((($635)) + 24|0); + HEAP32[$1048>>2] = $T$06$i$i$lcssa; + $1049 = ((($635)) + 12|0); + HEAP32[$1049>>2] = $635; + $1050 = ((($635)) + 8|0); + HEAP32[$1050>>2] = $635; + break L299; + } + } + } while(0); + $1051 = ((($T$0$lcssa$i$i)) + 8|0); + $1052 = HEAP32[$1051>>2]|0; + $1053 = HEAP32[(6968)>>2]|0; + $1054 = ($1052>>>0)>=($1053>>>0); + $not$$i$i = ($T$0$lcssa$i$i>>>0)>=($1053>>>0); + $1055 = $1054 & $not$$i$i; + if ($1055) { + $1056 = ((($1052)) + 12|0); + HEAP32[$1056>>2] = $635; + HEAP32[$1051>>2] = $635; + $1057 = ((($635)) + 8|0); + HEAP32[$1057>>2] = $1052; + $1058 = ((($635)) + 12|0); + HEAP32[$1058>>2] = $T$0$lcssa$i$i; + $1059 = ((($635)) + 24|0); + HEAP32[$1059>>2] = 0; + break; + } else { + _abort(); + // unreachable; + } + } + } + } while(0); + $1060 = HEAP32[(6964)>>2]|0; + $1061 = ($1060>>>0)>($nb$0>>>0); + if ($1061) { + $1062 = (($1060) - ($nb$0))|0; + HEAP32[(6964)>>2] = $1062; + $1063 = HEAP32[(6976)>>2]|0; + $1064 = (($1063) + ($nb$0)|0); + HEAP32[(6976)>>2] = $1064; + $1065 = $1062 | 1; + $$sum$i32 = (($nb$0) + 4)|0; + $1066 = (($1063) + ($$sum$i32)|0); + HEAP32[$1066>>2] = $1065; + $1067 = $nb$0 | 3; + $1068 = ((($1063)) + 4|0); + HEAP32[$1068>>2] = $1067; + $1069 = ((($1063)) + 8|0); + $mem$0 = $1069; + return ($mem$0|0); + } + } + $1070 = (___errno_location()|0); + HEAP32[$1070>>2] = 12; + $mem$0 = 0; + return ($mem$0|0); +} +function _free($mem) { + $mem = $mem|0; + var $$lcssa = 0, $$pre = 0, $$pre$phi59Z2D = 0, $$pre$phi61Z2D = 0, $$pre$phiZ2D = 0, $$pre57 = 0, $$pre58 = 0, $$pre60 = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum1718 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0; + var $$sum25 = 0, $$sum26 = 0, $$sum27 = 0, $$sum28 = 0, $$sum29 = 0, $$sum3 = 0, $$sum30 = 0, $$sum31 = 0, $$sum5 = 0, $$sum67 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0; + var $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0; + var $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0; + var $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0; + var $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0; + var $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0; + var $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0; + var $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0; + var $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0; + var $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0; + var $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0; + var $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0; + var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0; + var $321 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0; + var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0; + var $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0; + var $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I18$0 = 0, $K19$052 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0; + var $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$051 = 0, $T$051$lcssa = 0, $cond = 0, $cond47 = 0, $not$ = 0, $p$0 = 0, $psize$0 = 0, $psize$1 = 0, $sp$0$i = 0, $sp$0$in$i = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($mem|0)==(0|0); + if ($0) { + return; + } + $1 = ((($mem)) + -8|0); + $2 = HEAP32[(6968)>>2]|0; + $3 = ($1>>>0)<($2>>>0); + if ($3) { + _abort(); + // unreachable; + } + $4 = ((($mem)) + -4|0); + $5 = HEAP32[$4>>2]|0; + $6 = $5 & 3; + $7 = ($6|0)==(1); + if ($7) { + _abort(); + // unreachable; + } + $8 = $5 & -8; + $$sum = (($8) + -8)|0; + $9 = (($mem) + ($$sum)|0); + $10 = $5 & 1; + $11 = ($10|0)==(0); + do { + if ($11) { + $12 = HEAP32[$1>>2]|0; + $13 = ($6|0)==(0); + if ($13) { + return; + } + $$sum2 = (-8 - ($12))|0; + $14 = (($mem) + ($$sum2)|0); + $15 = (($12) + ($8))|0; + $16 = ($14>>>0)<($2>>>0); + if ($16) { + _abort(); + // unreachable; + } + $17 = HEAP32[(6972)>>2]|0; + $18 = ($14|0)==($17|0); + if ($18) { + $$sum3 = (($8) + -4)|0; + $103 = (($mem) + ($$sum3)|0); + $104 = HEAP32[$103>>2]|0; + $105 = $104 & 3; + $106 = ($105|0)==(3); + if (!($106)) { + $p$0 = $14;$psize$0 = $15; + break; + } + HEAP32[(6960)>>2] = $15; + $107 = $104 & -2; + HEAP32[$103>>2] = $107; + $108 = $15 | 1; + $$sum20 = (($$sum2) + 4)|0; + $109 = (($mem) + ($$sum20)|0); + HEAP32[$109>>2] = $108; + HEAP32[$9>>2] = $15; + return; + } + $19 = $12 >>> 3; + $20 = ($12>>>0)<(256); + if ($20) { + $$sum30 = (($$sum2) + 8)|0; + $21 = (($mem) + ($$sum30)|0); + $22 = HEAP32[$21>>2]|0; + $$sum31 = (($$sum2) + 12)|0; + $23 = (($mem) + ($$sum31)|0); + $24 = HEAP32[$23>>2]|0; + $25 = $19 << 1; + $26 = (6992 + ($25<<2)|0); + $27 = ($22|0)==($26|0); + if (!($27)) { + $28 = ($22>>>0)<($2>>>0); + if ($28) { + _abort(); + // unreachable; + } + $29 = ((($22)) + 12|0); + $30 = HEAP32[$29>>2]|0; + $31 = ($30|0)==($14|0); + if (!($31)) { + _abort(); + // unreachable; + } + } + $32 = ($24|0)==($22|0); + if ($32) { + $33 = 1 << $19; + $34 = $33 ^ -1; + $35 = HEAP32[6952>>2]|0; + $36 = $35 & $34; + HEAP32[6952>>2] = $36; + $p$0 = $14;$psize$0 = $15; + break; + } + $37 = ($24|0)==($26|0); + if ($37) { + $$pre60 = ((($24)) + 8|0); + $$pre$phi61Z2D = $$pre60; + } else { + $38 = ($24>>>0)<($2>>>0); + if ($38) { + _abort(); + // unreachable; + } + $39 = ((($24)) + 8|0); + $40 = HEAP32[$39>>2]|0; + $41 = ($40|0)==($14|0); + if ($41) { + $$pre$phi61Z2D = $39; + } else { + _abort(); + // unreachable; + } + } + $42 = ((($22)) + 12|0); + HEAP32[$42>>2] = $24; + HEAP32[$$pre$phi61Z2D>>2] = $22; + $p$0 = $14;$psize$0 = $15; + break; + } + $$sum22 = (($$sum2) + 24)|0; + $43 = (($mem) + ($$sum22)|0); + $44 = HEAP32[$43>>2]|0; + $$sum23 = (($$sum2) + 12)|0; + $45 = (($mem) + ($$sum23)|0); + $46 = HEAP32[$45>>2]|0; + $47 = ($46|0)==($14|0); + do { + if ($47) { + $$sum25 = (($$sum2) + 20)|0; + $57 = (($mem) + ($$sum25)|0); + $58 = HEAP32[$57>>2]|0; + $59 = ($58|0)==(0|0); + if ($59) { + $$sum24 = (($$sum2) + 16)|0; + $60 = (($mem) + ($$sum24)|0); + $61 = HEAP32[$60>>2]|0; + $62 = ($61|0)==(0|0); + if ($62) { + $R$1 = 0; + break; + } else { + $R$0 = $61;$RP$0 = $60; + } + } else { + $R$0 = $58;$RP$0 = $57; + } + while(1) { + $63 = ((($R$0)) + 20|0); + $64 = HEAP32[$63>>2]|0; + $65 = ($64|0)==(0|0); + if (!($65)) { + $R$0 = $64;$RP$0 = $63; + continue; + } + $66 = ((($R$0)) + 16|0); + $67 = HEAP32[$66>>2]|0; + $68 = ($67|0)==(0|0); + if ($68) { + $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; + break; + } else { + $R$0 = $67;$RP$0 = $66; + } + } + $69 = ($RP$0$lcssa>>>0)<($2>>>0); + if ($69) { + _abort(); + // unreachable; + } else { + HEAP32[$RP$0$lcssa>>2] = 0; + $R$1 = $R$0$lcssa; + break; + } + } else { + $$sum29 = (($$sum2) + 8)|0; + $48 = (($mem) + ($$sum29)|0); + $49 = HEAP32[$48>>2]|0; + $50 = ($49>>>0)<($2>>>0); + if ($50) { + _abort(); + // unreachable; + } + $51 = ((($49)) + 12|0); + $52 = HEAP32[$51>>2]|0; + $53 = ($52|0)==($14|0); + if (!($53)) { + _abort(); + // unreachable; + } + $54 = ((($46)) + 8|0); + $55 = HEAP32[$54>>2]|0; + $56 = ($55|0)==($14|0); + if ($56) { + HEAP32[$51>>2] = $46; + HEAP32[$54>>2] = $49; + $R$1 = $46; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $70 = ($44|0)==(0|0); + if ($70) { + $p$0 = $14;$psize$0 = $15; + } else { + $$sum26 = (($$sum2) + 28)|0; + $71 = (($mem) + ($$sum26)|0); + $72 = HEAP32[$71>>2]|0; + $73 = (7256 + ($72<<2)|0); + $74 = HEAP32[$73>>2]|0; + $75 = ($14|0)==($74|0); + if ($75) { + HEAP32[$73>>2] = $R$1; + $cond = ($R$1|0)==(0|0); + if ($cond) { + $76 = 1 << $72; + $77 = $76 ^ -1; + $78 = HEAP32[(6956)>>2]|0; + $79 = $78 & $77; + HEAP32[(6956)>>2] = $79; + $p$0 = $14;$psize$0 = $15; + break; + } + } else { + $80 = HEAP32[(6968)>>2]|0; + $81 = ($44>>>0)<($80>>>0); + if ($81) { + _abort(); + // unreachable; + } + $82 = ((($44)) + 16|0); + $83 = HEAP32[$82>>2]|0; + $84 = ($83|0)==($14|0); + if ($84) { + HEAP32[$82>>2] = $R$1; + } else { + $85 = ((($44)) + 20|0); + HEAP32[$85>>2] = $R$1; + } + $86 = ($R$1|0)==(0|0); + if ($86) { + $p$0 = $14;$psize$0 = $15; + break; + } + } + $87 = HEAP32[(6968)>>2]|0; + $88 = ($R$1>>>0)<($87>>>0); + if ($88) { + _abort(); + // unreachable; + } + $89 = ((($R$1)) + 24|0); + HEAP32[$89>>2] = $44; + $$sum27 = (($$sum2) + 16)|0; + $90 = (($mem) + ($$sum27)|0); + $91 = HEAP32[$90>>2]|0; + $92 = ($91|0)==(0|0); + do { + if (!($92)) { + $93 = ($91>>>0)<($87>>>0); + if ($93) { + _abort(); + // unreachable; + } else { + $94 = ((($R$1)) + 16|0); + HEAP32[$94>>2] = $91; + $95 = ((($91)) + 24|0); + HEAP32[$95>>2] = $R$1; + break; + } + } + } while(0); + $$sum28 = (($$sum2) + 20)|0; + $96 = (($mem) + ($$sum28)|0); + $97 = HEAP32[$96>>2]|0; + $98 = ($97|0)==(0|0); + if ($98) { + $p$0 = $14;$psize$0 = $15; + } else { + $99 = HEAP32[(6968)>>2]|0; + $100 = ($97>>>0)<($99>>>0); + if ($100) { + _abort(); + // unreachable; + } else { + $101 = ((($R$1)) + 20|0); + HEAP32[$101>>2] = $97; + $102 = ((($97)) + 24|0); + HEAP32[$102>>2] = $R$1; + $p$0 = $14;$psize$0 = $15; + break; + } + } + } + } else { + $p$0 = $1;$psize$0 = $8; + } + } while(0); + $110 = ($p$0>>>0)<($9>>>0); + if (!($110)) { + _abort(); + // unreachable; + } + $$sum19 = (($8) + -4)|0; + $111 = (($mem) + ($$sum19)|0); + $112 = HEAP32[$111>>2]|0; + $113 = $112 & 1; + $114 = ($113|0)==(0); + if ($114) { + _abort(); + // unreachable; + } + $115 = $112 & 2; + $116 = ($115|0)==(0); + if ($116) { + $117 = HEAP32[(6976)>>2]|0; + $118 = ($9|0)==($117|0); + if ($118) { + $119 = HEAP32[(6964)>>2]|0; + $120 = (($119) + ($psize$0))|0; + HEAP32[(6964)>>2] = $120; + HEAP32[(6976)>>2] = $p$0; + $121 = $120 | 1; + $122 = ((($p$0)) + 4|0); + HEAP32[$122>>2] = $121; + $123 = HEAP32[(6972)>>2]|0; + $124 = ($p$0|0)==($123|0); + if (!($124)) { + return; + } + HEAP32[(6972)>>2] = 0; + HEAP32[(6960)>>2] = 0; + return; + } + $125 = HEAP32[(6972)>>2]|0; + $126 = ($9|0)==($125|0); + if ($126) { + $127 = HEAP32[(6960)>>2]|0; + $128 = (($127) + ($psize$0))|0; + HEAP32[(6960)>>2] = $128; + HEAP32[(6972)>>2] = $p$0; + $129 = $128 | 1; + $130 = ((($p$0)) + 4|0); + HEAP32[$130>>2] = $129; + $131 = (($p$0) + ($128)|0); + HEAP32[$131>>2] = $128; + return; + } + $132 = $112 & -8; + $133 = (($132) + ($psize$0))|0; + $134 = $112 >>> 3; + $135 = ($112>>>0)<(256); + do { + if ($135) { + $136 = (($mem) + ($8)|0); + $137 = HEAP32[$136>>2]|0; + $$sum1718 = $8 | 4; + $138 = (($mem) + ($$sum1718)|0); + $139 = HEAP32[$138>>2]|0; + $140 = $134 << 1; + $141 = (6992 + ($140<<2)|0); + $142 = ($137|0)==($141|0); + if (!($142)) { + $143 = HEAP32[(6968)>>2]|0; + $144 = ($137>>>0)<($143>>>0); + if ($144) { + _abort(); + // unreachable; + } + $145 = ((($137)) + 12|0); + $146 = HEAP32[$145>>2]|0; + $147 = ($146|0)==($9|0); + if (!($147)) { + _abort(); + // unreachable; + } + } + $148 = ($139|0)==($137|0); + if ($148) { + $149 = 1 << $134; + $150 = $149 ^ -1; + $151 = HEAP32[6952>>2]|0; + $152 = $151 & $150; + HEAP32[6952>>2] = $152; + break; + } + $153 = ($139|0)==($141|0); + if ($153) { + $$pre58 = ((($139)) + 8|0); + $$pre$phi59Z2D = $$pre58; + } else { + $154 = HEAP32[(6968)>>2]|0; + $155 = ($139>>>0)<($154>>>0); + if ($155) { + _abort(); + // unreachable; + } + $156 = ((($139)) + 8|0); + $157 = HEAP32[$156>>2]|0; + $158 = ($157|0)==($9|0); + if ($158) { + $$pre$phi59Z2D = $156; + } else { + _abort(); + // unreachable; + } + } + $159 = ((($137)) + 12|0); + HEAP32[$159>>2] = $139; + HEAP32[$$pre$phi59Z2D>>2] = $137; + } else { + $$sum5 = (($8) + 16)|0; + $160 = (($mem) + ($$sum5)|0); + $161 = HEAP32[$160>>2]|0; + $$sum67 = $8 | 4; + $162 = (($mem) + ($$sum67)|0); + $163 = HEAP32[$162>>2]|0; + $164 = ($163|0)==($9|0); + do { + if ($164) { + $$sum9 = (($8) + 12)|0; + $175 = (($mem) + ($$sum9)|0); + $176 = HEAP32[$175>>2]|0; + $177 = ($176|0)==(0|0); + if ($177) { + $$sum8 = (($8) + 8)|0; + $178 = (($mem) + ($$sum8)|0); + $179 = HEAP32[$178>>2]|0; + $180 = ($179|0)==(0|0); + if ($180) { + $R7$1 = 0; + break; + } else { + $R7$0 = $179;$RP9$0 = $178; + } + } else { + $R7$0 = $176;$RP9$0 = $175; + } + while(1) { + $181 = ((($R7$0)) + 20|0); + $182 = HEAP32[$181>>2]|0; + $183 = ($182|0)==(0|0); + if (!($183)) { + $R7$0 = $182;$RP9$0 = $181; + continue; + } + $184 = ((($R7$0)) + 16|0); + $185 = HEAP32[$184>>2]|0; + $186 = ($185|0)==(0|0); + if ($186) { + $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0; + break; + } else { + $R7$0 = $185;$RP9$0 = $184; + } + } + $187 = HEAP32[(6968)>>2]|0; + $188 = ($RP9$0$lcssa>>>0)<($187>>>0); + if ($188) { + _abort(); + // unreachable; + } else { + HEAP32[$RP9$0$lcssa>>2] = 0; + $R7$1 = $R7$0$lcssa; + break; + } + } else { + $165 = (($mem) + ($8)|0); + $166 = HEAP32[$165>>2]|0; + $167 = HEAP32[(6968)>>2]|0; + $168 = ($166>>>0)<($167>>>0); + if ($168) { + _abort(); + // unreachable; + } + $169 = ((($166)) + 12|0); + $170 = HEAP32[$169>>2]|0; + $171 = ($170|0)==($9|0); + if (!($171)) { + _abort(); + // unreachable; + } + $172 = ((($163)) + 8|0); + $173 = HEAP32[$172>>2]|0; + $174 = ($173|0)==($9|0); + if ($174) { + HEAP32[$169>>2] = $163; + HEAP32[$172>>2] = $166; + $R7$1 = $163; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $189 = ($161|0)==(0|0); + if (!($189)) { + $$sum12 = (($8) + 20)|0; + $190 = (($mem) + ($$sum12)|0); + $191 = HEAP32[$190>>2]|0; + $192 = (7256 + ($191<<2)|0); + $193 = HEAP32[$192>>2]|0; + $194 = ($9|0)==($193|0); + if ($194) { + HEAP32[$192>>2] = $R7$1; + $cond47 = ($R7$1|0)==(0|0); + if ($cond47) { + $195 = 1 << $191; + $196 = $195 ^ -1; + $197 = HEAP32[(6956)>>2]|0; + $198 = $197 & $196; + HEAP32[(6956)>>2] = $198; + break; + } + } else { + $199 = HEAP32[(6968)>>2]|0; + $200 = ($161>>>0)<($199>>>0); + if ($200) { + _abort(); + // unreachable; + } + $201 = ((($161)) + 16|0); + $202 = HEAP32[$201>>2]|0; + $203 = ($202|0)==($9|0); + if ($203) { + HEAP32[$201>>2] = $R7$1; + } else { + $204 = ((($161)) + 20|0); + HEAP32[$204>>2] = $R7$1; + } + $205 = ($R7$1|0)==(0|0); + if ($205) { + break; + } + } + $206 = HEAP32[(6968)>>2]|0; + $207 = ($R7$1>>>0)<($206>>>0); + if ($207) { + _abort(); + // unreachable; + } + $208 = ((($R7$1)) + 24|0); + HEAP32[$208>>2] = $161; + $$sum13 = (($8) + 8)|0; + $209 = (($mem) + ($$sum13)|0); + $210 = HEAP32[$209>>2]|0; + $211 = ($210|0)==(0|0); + do { + if (!($211)) { + $212 = ($210>>>0)<($206>>>0); + if ($212) { + _abort(); + // unreachable; + } else { + $213 = ((($R7$1)) + 16|0); + HEAP32[$213>>2] = $210; + $214 = ((($210)) + 24|0); + HEAP32[$214>>2] = $R7$1; + break; + } + } + } while(0); + $$sum14 = (($8) + 12)|0; + $215 = (($mem) + ($$sum14)|0); + $216 = HEAP32[$215>>2]|0; + $217 = ($216|0)==(0|0); + if (!($217)) { + $218 = HEAP32[(6968)>>2]|0; + $219 = ($216>>>0)<($218>>>0); + if ($219) { + _abort(); + // unreachable; + } else { + $220 = ((($R7$1)) + 20|0); + HEAP32[$220>>2] = $216; + $221 = ((($216)) + 24|0); + HEAP32[$221>>2] = $R7$1; + break; + } + } + } + } + } while(0); + $222 = $133 | 1; + $223 = ((($p$0)) + 4|0); + HEAP32[$223>>2] = $222; + $224 = (($p$0) + ($133)|0); + HEAP32[$224>>2] = $133; + $225 = HEAP32[(6972)>>2]|0; + $226 = ($p$0|0)==($225|0); + if ($226) { + HEAP32[(6960)>>2] = $133; + return; + } else { + $psize$1 = $133; + } + } else { + $227 = $112 & -2; + HEAP32[$111>>2] = $227; + $228 = $psize$0 | 1; + $229 = ((($p$0)) + 4|0); + HEAP32[$229>>2] = $228; + $230 = (($p$0) + ($psize$0)|0); + HEAP32[$230>>2] = $psize$0; + $psize$1 = $psize$0; + } + $231 = $psize$1 >>> 3; + $232 = ($psize$1>>>0)<(256); + if ($232) { + $233 = $231 << 1; + $234 = (6992 + ($233<<2)|0); + $235 = HEAP32[6952>>2]|0; + $236 = 1 << $231; + $237 = $235 & $236; + $238 = ($237|0)==(0); + if ($238) { + $239 = $235 | $236; + HEAP32[6952>>2] = $239; + $$pre = (($233) + 2)|0; + $$pre57 = (6992 + ($$pre<<2)|0); + $$pre$phiZ2D = $$pre57;$F16$0 = $234; + } else { + $$sum11 = (($233) + 2)|0; + $240 = (6992 + ($$sum11<<2)|0); + $241 = HEAP32[$240>>2]|0; + $242 = HEAP32[(6968)>>2]|0; + $243 = ($241>>>0)<($242>>>0); + if ($243) { + _abort(); + // unreachable; + } else { + $$pre$phiZ2D = $240;$F16$0 = $241; + } + } + HEAP32[$$pre$phiZ2D>>2] = $p$0; + $244 = ((($F16$0)) + 12|0); + HEAP32[$244>>2] = $p$0; + $245 = ((($p$0)) + 8|0); + HEAP32[$245>>2] = $F16$0; + $246 = ((($p$0)) + 12|0); + HEAP32[$246>>2] = $234; + return; + } + $247 = $psize$1 >>> 8; + $248 = ($247|0)==(0); + if ($248) { + $I18$0 = 0; + } else { + $249 = ($psize$1>>>0)>(16777215); + if ($249) { + $I18$0 = 31; + } else { + $250 = (($247) + 1048320)|0; + $251 = $250 >>> 16; + $252 = $251 & 8; + $253 = $247 << $252; + $254 = (($253) + 520192)|0; + $255 = $254 >>> 16; + $256 = $255 & 4; + $257 = $256 | $252; + $258 = $253 << $256; + $259 = (($258) + 245760)|0; + $260 = $259 >>> 16; + $261 = $260 & 2; + $262 = $257 | $261; + $263 = (14 - ($262))|0; + $264 = $258 << $261; + $265 = $264 >>> 15; + $266 = (($263) + ($265))|0; + $267 = $266 << 1; + $268 = (($266) + 7)|0; + $269 = $psize$1 >>> $268; + $270 = $269 & 1; + $271 = $270 | $267; + $I18$0 = $271; + } + } + $272 = (7256 + ($I18$0<<2)|0); + $273 = ((($p$0)) + 28|0); + HEAP32[$273>>2] = $I18$0; + $274 = ((($p$0)) + 16|0); + $275 = ((($p$0)) + 20|0); + HEAP32[$275>>2] = 0; + HEAP32[$274>>2] = 0; + $276 = HEAP32[(6956)>>2]|0; + $277 = 1 << $I18$0; + $278 = $276 & $277; + $279 = ($278|0)==(0); + L199: do { + if ($279) { + $280 = $276 | $277; + HEAP32[(6956)>>2] = $280; + HEAP32[$272>>2] = $p$0; + $281 = ((($p$0)) + 24|0); + HEAP32[$281>>2] = $272; + $282 = ((($p$0)) + 12|0); + HEAP32[$282>>2] = $p$0; + $283 = ((($p$0)) + 8|0); + HEAP32[$283>>2] = $p$0; + } else { + $284 = HEAP32[$272>>2]|0; + $285 = ((($284)) + 4|0); + $286 = HEAP32[$285>>2]|0; + $287 = $286 & -8; + $288 = ($287|0)==($psize$1|0); + L202: do { + if ($288) { + $T$0$lcssa = $284; + } else { + $289 = ($I18$0|0)==(31); + $290 = $I18$0 >>> 1; + $291 = (25 - ($290))|0; + $292 = $289 ? 0 : $291; + $293 = $psize$1 << $292; + $K19$052 = $293;$T$051 = $284; + while(1) { + $300 = $K19$052 >>> 31; + $301 = (((($T$051)) + 16|0) + ($300<<2)|0); + $296 = HEAP32[$301>>2]|0; + $302 = ($296|0)==(0|0); + if ($302) { + $$lcssa = $301;$T$051$lcssa = $T$051; + break; + } + $294 = $K19$052 << 1; + $295 = ((($296)) + 4|0); + $297 = HEAP32[$295>>2]|0; + $298 = $297 & -8; + $299 = ($298|0)==($psize$1|0); + if ($299) { + $T$0$lcssa = $296; + break L202; + } else { + $K19$052 = $294;$T$051 = $296; + } + } + $303 = HEAP32[(6968)>>2]|0; + $304 = ($$lcssa>>>0)<($303>>>0); + if ($304) { + _abort(); + // unreachable; + } else { + HEAP32[$$lcssa>>2] = $p$0; + $305 = ((($p$0)) + 24|0); + HEAP32[$305>>2] = $T$051$lcssa; + $306 = ((($p$0)) + 12|0); + HEAP32[$306>>2] = $p$0; + $307 = ((($p$0)) + 8|0); + HEAP32[$307>>2] = $p$0; + break L199; + } + } + } while(0); + $308 = ((($T$0$lcssa)) + 8|0); + $309 = HEAP32[$308>>2]|0; + $310 = HEAP32[(6968)>>2]|0; + $311 = ($309>>>0)>=($310>>>0); + $not$ = ($T$0$lcssa>>>0)>=($310>>>0); + $312 = $311 & $not$; + if ($312) { + $313 = ((($309)) + 12|0); + HEAP32[$313>>2] = $p$0; + HEAP32[$308>>2] = $p$0; + $314 = ((($p$0)) + 8|0); + HEAP32[$314>>2] = $309; + $315 = ((($p$0)) + 12|0); + HEAP32[$315>>2] = $T$0$lcssa; + $316 = ((($p$0)) + 24|0); + HEAP32[$316>>2] = 0; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $317 = HEAP32[(6984)>>2]|0; + $318 = (($317) + -1)|0; + HEAP32[(6984)>>2] = $318; + $319 = ($318|0)==(0); + if ($319) { + $sp$0$in$i = (7408); + } else { + return; + } + while(1) { + $sp$0$i = HEAP32[$sp$0$in$i>>2]|0; + $320 = ($sp$0$i|0)==(0|0); + $321 = ((($sp$0$i)) + 8|0); + if ($320) { + break; + } else { + $sp$0$in$i = $321; + } + } + HEAP32[(6984)>>2] = -1; + return; +} +function _realloc($oldmem,$bytes) { + $oldmem = $oldmem|0; + $bytes = $bytes|0; + var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0; + var $7 = 0, $8 = 0, $9 = 0, $mem$0 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ($oldmem|0)==(0|0); + if ($0) { + $1 = (_malloc($bytes)|0); + $mem$0 = $1; + return ($mem$0|0); + } + $2 = ($bytes>>>0)>(4294967231); + if ($2) { + $3 = (___errno_location()|0); + HEAP32[$3>>2] = 12; + $mem$0 = 0; + return ($mem$0|0); + } + $4 = ($bytes>>>0)<(11); + $5 = (($bytes) + 11)|0; + $6 = $5 & -8; + $7 = $4 ? 16 : $6; + $8 = ((($oldmem)) + -8|0); + $9 = (_try_realloc_chunk($8,$7)|0); + $10 = ($9|0)==(0|0); + if (!($10)) { + $11 = ((($9)) + 8|0); + $mem$0 = $11; + return ($mem$0|0); + } + $12 = (_malloc($bytes)|0); + $13 = ($12|0)==(0|0); + if ($13) { + $mem$0 = 0; + return ($mem$0|0); + } + $14 = ((($oldmem)) + -4|0); + $15 = HEAP32[$14>>2]|0; + $16 = $15 & -8; + $17 = $15 & 3; + $18 = ($17|0)==(0); + $19 = $18 ? 8 : 4; + $20 = (($16) - ($19))|0; + $21 = ($20>>>0)<($bytes>>>0); + $22 = $21 ? $20 : $bytes; + _memcpy(($12|0),($oldmem|0),($22|0))|0; + _free($oldmem); + $mem$0 = $12; + return ($mem$0|0); +} +function _try_realloc_chunk($p,$nb) { + $p = $p|0; + $nb = $nb|0; + var $$pre = 0, $$pre$phiZ2D = 0, $$sum = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum15 = 0, $$sum16 = 0, $$sum17 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum22 = 0, $$sum23 = 0, $$sum2728 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum78 = 0; + var $$sum910 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0; + var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0; + var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0; + var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0; + var $17 = 0, $170 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0; + var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0; + var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0; + var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0; + var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $cond = 0, $newp$0 = 0, $notlhs = 0; + var $notrhs = 0, $or$cond$not = 0, $or$cond30 = 0, $storemerge = 0, $storemerge21 = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = ((($p)) + 4|0); + $1 = HEAP32[$0>>2]|0; + $2 = $1 & -8; + $3 = (($p) + ($2)|0); + $4 = HEAP32[(6968)>>2]|0; + $5 = $1 & 3; + $notlhs = ($p>>>0)>=($4>>>0); + $notrhs = ($5|0)!=(1); + $or$cond$not = $notrhs & $notlhs; + $6 = ($p>>>0)<($3>>>0); + $or$cond30 = $or$cond$not & $6; + if (!($or$cond30)) { + _abort(); + // unreachable; + } + $$sum2728 = $2 | 4; + $7 = (($p) + ($$sum2728)|0); + $8 = HEAP32[$7>>2]|0; + $9 = $8 & 1; + $10 = ($9|0)==(0); + if ($10) { + _abort(); + // unreachable; + } + $11 = ($5|0)==(0); + if ($11) { + $12 = ($nb>>>0)<(256); + if ($12) { + $newp$0 = 0; + return ($newp$0|0); + } + $13 = (($nb) + 4)|0; + $14 = ($2>>>0)<($13>>>0); + if (!($14)) { + $15 = (($2) - ($nb))|0; + $16 = HEAP32[(7432)>>2]|0; + $17 = $16 << 1; + $18 = ($15>>>0)>($17>>>0); + if (!($18)) { + $newp$0 = $p; + return ($newp$0|0); + } + } + $newp$0 = 0; + return ($newp$0|0); + } + $19 = ($2>>>0)<($nb>>>0); + if (!($19)) { + $20 = (($2) - ($nb))|0; + $21 = ($20>>>0)>(15); + if (!($21)) { + $newp$0 = $p; + return ($newp$0|0); + } + $22 = (($p) + ($nb)|0); + $23 = $1 & 1; + $24 = $23 | $nb; + $25 = $24 | 2; + HEAP32[$0>>2] = $25; + $$sum23 = (($nb) + 4)|0; + $26 = (($p) + ($$sum23)|0); + $27 = $20 | 3; + HEAP32[$26>>2] = $27; + $28 = HEAP32[$7>>2]|0; + $29 = $28 | 1; + HEAP32[$7>>2] = $29; + _dispose_chunk($22,$20); + $newp$0 = $p; + return ($newp$0|0); + } + $30 = HEAP32[(6976)>>2]|0; + $31 = ($3|0)==($30|0); + if ($31) { + $32 = HEAP32[(6964)>>2]|0; + $33 = (($32) + ($2))|0; + $34 = ($33>>>0)>($nb>>>0); + if (!($34)) { + $newp$0 = 0; + return ($newp$0|0); + } + $35 = (($33) - ($nb))|0; + $36 = (($p) + ($nb)|0); + $37 = $1 & 1; + $38 = $37 | $nb; + $39 = $38 | 2; + HEAP32[$0>>2] = $39; + $$sum22 = (($nb) + 4)|0; + $40 = (($p) + ($$sum22)|0); + $41 = $35 | 1; + HEAP32[$40>>2] = $41; + HEAP32[(6976)>>2] = $36; + HEAP32[(6964)>>2] = $35; + $newp$0 = $p; + return ($newp$0|0); + } + $42 = HEAP32[(6972)>>2]|0; + $43 = ($3|0)==($42|0); + if ($43) { + $44 = HEAP32[(6960)>>2]|0; + $45 = (($44) + ($2))|0; + $46 = ($45>>>0)<($nb>>>0); + if ($46) { + $newp$0 = 0; + return ($newp$0|0); + } + $47 = (($45) - ($nb))|0; + $48 = ($47>>>0)>(15); + if ($48) { + $49 = (($p) + ($nb)|0); + $50 = (($p) + ($45)|0); + $51 = $1 & 1; + $52 = $51 | $nb; + $53 = $52 | 2; + HEAP32[$0>>2] = $53; + $$sum19 = (($nb) + 4)|0; + $54 = (($p) + ($$sum19)|0); + $55 = $47 | 1; + HEAP32[$54>>2] = $55; + HEAP32[$50>>2] = $47; + $$sum20 = (($45) + 4)|0; + $56 = (($p) + ($$sum20)|0); + $57 = HEAP32[$56>>2]|0; + $58 = $57 & -2; + HEAP32[$56>>2] = $58; + $storemerge = $49;$storemerge21 = $47; + } else { + $59 = $1 & 1; + $60 = $59 | $45; + $61 = $60 | 2; + HEAP32[$0>>2] = $61; + $$sum17 = (($45) + 4)|0; + $62 = (($p) + ($$sum17)|0); + $63 = HEAP32[$62>>2]|0; + $64 = $63 | 1; + HEAP32[$62>>2] = $64; + $storemerge = 0;$storemerge21 = 0; + } + HEAP32[(6960)>>2] = $storemerge21; + HEAP32[(6972)>>2] = $storemerge; + $newp$0 = $p; + return ($newp$0|0); + } + $65 = $8 & 2; + $66 = ($65|0)==(0); + if (!($66)) { + $newp$0 = 0; + return ($newp$0|0); + } + $67 = $8 & -8; + $68 = (($67) + ($2))|0; + $69 = ($68>>>0)<($nb>>>0); + if ($69) { + $newp$0 = 0; + return ($newp$0|0); + } + $70 = (($68) - ($nb))|0; + $71 = $8 >>> 3; + $72 = ($8>>>0)<(256); + do { + if ($72) { + $$sum15 = (($2) + 8)|0; + $73 = (($p) + ($$sum15)|0); + $74 = HEAP32[$73>>2]|0; + $$sum16 = (($2) + 12)|0; + $75 = (($p) + ($$sum16)|0); + $76 = HEAP32[$75>>2]|0; + $77 = $71 << 1; + $78 = (6992 + ($77<<2)|0); + $79 = ($74|0)==($78|0); + if (!($79)) { + $80 = ($74>>>0)<($4>>>0); + if ($80) { + _abort(); + // unreachable; + } + $81 = ((($74)) + 12|0); + $82 = HEAP32[$81>>2]|0; + $83 = ($82|0)==($3|0); + if (!($83)) { + _abort(); + // unreachable; + } + } + $84 = ($76|0)==($74|0); + if ($84) { + $85 = 1 << $71; + $86 = $85 ^ -1; + $87 = HEAP32[6952>>2]|0; + $88 = $87 & $86; + HEAP32[6952>>2] = $88; + break; + } + $89 = ($76|0)==($78|0); + if ($89) { + $$pre = ((($76)) + 8|0); + $$pre$phiZ2D = $$pre; + } else { + $90 = ($76>>>0)<($4>>>0); + if ($90) { + _abort(); + // unreachable; + } + $91 = ((($76)) + 8|0); + $92 = HEAP32[$91>>2]|0; + $93 = ($92|0)==($3|0); + if ($93) { + $$pre$phiZ2D = $91; + } else { + _abort(); + // unreachable; + } + } + $94 = ((($74)) + 12|0); + HEAP32[$94>>2] = $76; + HEAP32[$$pre$phiZ2D>>2] = $74; + } else { + $$sum = (($2) + 24)|0; + $95 = (($p) + ($$sum)|0); + $96 = HEAP32[$95>>2]|0; + $$sum2 = (($2) + 12)|0; + $97 = (($p) + ($$sum2)|0); + $98 = HEAP32[$97>>2]|0; + $99 = ($98|0)==($3|0); + do { + if ($99) { + $$sum4 = (($2) + 20)|0; + $109 = (($p) + ($$sum4)|0); + $110 = HEAP32[$109>>2]|0; + $111 = ($110|0)==(0|0); + if ($111) { + $$sum3 = (($2) + 16)|0; + $112 = (($p) + ($$sum3)|0); + $113 = HEAP32[$112>>2]|0; + $114 = ($113|0)==(0|0); + if ($114) { + $R$1 = 0; + break; + } else { + $R$0 = $113;$RP$0 = $112; + } + } else { + $R$0 = $110;$RP$0 = $109; + } + while(1) { + $115 = ((($R$0)) + 20|0); + $116 = HEAP32[$115>>2]|0; + $117 = ($116|0)==(0|0); + if (!($117)) { + $R$0 = $116;$RP$0 = $115; + continue; + } + $118 = ((($R$0)) + 16|0); + $119 = HEAP32[$118>>2]|0; + $120 = ($119|0)==(0|0); + if ($120) { + $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; + break; + } else { + $R$0 = $119;$RP$0 = $118; + } + } + $121 = ($RP$0$lcssa>>>0)<($4>>>0); + if ($121) { + _abort(); + // unreachable; + } else { + HEAP32[$RP$0$lcssa>>2] = 0; + $R$1 = $R$0$lcssa; + break; + } + } else { + $$sum14 = (($2) + 8)|0; + $100 = (($p) + ($$sum14)|0); + $101 = HEAP32[$100>>2]|0; + $102 = ($101>>>0)<($4>>>0); + if ($102) { + _abort(); + // unreachable; + } + $103 = ((($101)) + 12|0); + $104 = HEAP32[$103>>2]|0; + $105 = ($104|0)==($3|0); + if (!($105)) { + _abort(); + // unreachable; + } + $106 = ((($98)) + 8|0); + $107 = HEAP32[$106>>2]|0; + $108 = ($107|0)==($3|0); + if ($108) { + HEAP32[$103>>2] = $98; + HEAP32[$106>>2] = $101; + $R$1 = $98; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $122 = ($96|0)==(0|0); + if (!($122)) { + $$sum11 = (($2) + 28)|0; + $123 = (($p) + ($$sum11)|0); + $124 = HEAP32[$123>>2]|0; + $125 = (7256 + ($124<<2)|0); + $126 = HEAP32[$125>>2]|0; + $127 = ($3|0)==($126|0); + if ($127) { + HEAP32[$125>>2] = $R$1; + $cond = ($R$1|0)==(0|0); + if ($cond) { + $128 = 1 << $124; + $129 = $128 ^ -1; + $130 = HEAP32[(6956)>>2]|0; + $131 = $130 & $129; + HEAP32[(6956)>>2] = $131; + break; + } + } else { + $132 = HEAP32[(6968)>>2]|0; + $133 = ($96>>>0)<($132>>>0); + if ($133) { + _abort(); + // unreachable; + } + $134 = ((($96)) + 16|0); + $135 = HEAP32[$134>>2]|0; + $136 = ($135|0)==($3|0); + if ($136) { + HEAP32[$134>>2] = $R$1; + } else { + $137 = ((($96)) + 20|0); + HEAP32[$137>>2] = $R$1; + } + $138 = ($R$1|0)==(0|0); + if ($138) { + break; + } + } + $139 = HEAP32[(6968)>>2]|0; + $140 = ($R$1>>>0)<($139>>>0); + if ($140) { + _abort(); + // unreachable; + } + $141 = ((($R$1)) + 24|0); + HEAP32[$141>>2] = $96; + $$sum12 = (($2) + 16)|0; + $142 = (($p) + ($$sum12)|0); + $143 = HEAP32[$142>>2]|0; + $144 = ($143|0)==(0|0); + do { + if (!($144)) { + $145 = ($143>>>0)<($139>>>0); + if ($145) { + _abort(); + // unreachable; + } else { + $146 = ((($R$1)) + 16|0); + HEAP32[$146>>2] = $143; + $147 = ((($143)) + 24|0); + HEAP32[$147>>2] = $R$1; + break; + } + } + } while(0); + $$sum13 = (($2) + 20)|0; + $148 = (($p) + ($$sum13)|0); + $149 = HEAP32[$148>>2]|0; + $150 = ($149|0)==(0|0); + if (!($150)) { + $151 = HEAP32[(6968)>>2]|0; + $152 = ($149>>>0)<($151>>>0); + if ($152) { + _abort(); + // unreachable; + } else { + $153 = ((($R$1)) + 20|0); + HEAP32[$153>>2] = $149; + $154 = ((($149)) + 24|0); + HEAP32[$154>>2] = $R$1; + break; + } + } + } + } + } while(0); + $155 = ($70>>>0)<(16); + if ($155) { + $156 = $1 & 1; + $157 = $68 | $156; + $158 = $157 | 2; + HEAP32[$0>>2] = $158; + $$sum910 = $68 | 4; + $159 = (($p) + ($$sum910)|0); + $160 = HEAP32[$159>>2]|0; + $161 = $160 | 1; + HEAP32[$159>>2] = $161; + $newp$0 = $p; + return ($newp$0|0); + } else { + $162 = (($p) + ($nb)|0); + $163 = $1 & 1; + $164 = $163 | $nb; + $165 = $164 | 2; + HEAP32[$0>>2] = $165; + $$sum5 = (($nb) + 4)|0; + $166 = (($p) + ($$sum5)|0); + $167 = $70 | 3; + HEAP32[$166>>2] = $167; + $$sum78 = $68 | 4; + $168 = (($p) + ($$sum78)|0); + $169 = HEAP32[$168>>2]|0; + $170 = $169 | 1; + HEAP32[$168>>2] = $170; + _dispose_chunk($162,$70); + $newp$0 = $p; + return ($newp$0|0); + } + return (0)|0; +} +function _dispose_chunk($p,$psize) { + $p = $p|0; + $psize = $psize|0; + var $$0 = 0, $$02 = 0, $$1 = 0, $$lcssa = 0, $$pre = 0, $$pre$phi50Z2D = 0, $$pre$phi52Z2D = 0, $$pre$phiZ2D = 0, $$pre48 = 0, $$pre49 = 0, $$pre51 = 0, $$sum = 0, $$sum1 = 0, $$sum10 = 0, $$sum11 = 0, $$sum12 = 0, $$sum13 = 0, $$sum14 = 0, $$sum16 = 0, $$sum17 = 0; + var $$sum18 = 0, $$sum19 = 0, $$sum2 = 0, $$sum20 = 0, $$sum21 = 0, $$sum22 = 0, $$sum23 = 0, $$sum24 = 0, $$sum25 = 0, $$sum3 = 0, $$sum4 = 0, $$sum5 = 0, $$sum7 = 0, $$sum8 = 0, $$sum9 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0; + var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0; + var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0; + var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0; + var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0; + var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0; + var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0; + var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0; + var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0; + var $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0; + var $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0; + var $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0; + var $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0; + var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0; + var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0; + var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0; + var $97 = 0, $98 = 0, $99 = 0, $F16$0 = 0, $I19$0 = 0, $K20$043 = 0, $R$0 = 0, $R$0$lcssa = 0, $R$1 = 0, $R7$0 = 0, $R7$0$lcssa = 0, $R7$1 = 0, $RP$0 = 0, $RP$0$lcssa = 0, $RP9$0 = 0, $RP9$0$lcssa = 0, $T$0$lcssa = 0, $T$042 = 0, $T$042$lcssa = 0, $cond = 0; + var $cond39 = 0, $not$ = 0, label = 0, sp = 0; + sp = STACKTOP; + $0 = (($p) + ($psize)|0); + $1 = ((($p)) + 4|0); + $2 = HEAP32[$1>>2]|0; + $3 = $2 & 1; + $4 = ($3|0)==(0); + do { + if ($4) { + $5 = HEAP32[$p>>2]|0; + $6 = $2 & 3; + $7 = ($6|0)==(0); + if ($7) { + return; + } + $8 = (0 - ($5))|0; + $9 = (($p) + ($8)|0); + $10 = (($5) + ($psize))|0; + $11 = HEAP32[(6968)>>2]|0; + $12 = ($9>>>0)<($11>>>0); + if ($12) { + _abort(); + // unreachable; + } + $13 = HEAP32[(6972)>>2]|0; + $14 = ($9|0)==($13|0); + if ($14) { + $$sum = (($psize) + 4)|0; + $99 = (($p) + ($$sum)|0); + $100 = HEAP32[$99>>2]|0; + $101 = $100 & 3; + $102 = ($101|0)==(3); + if (!($102)) { + $$0 = $9;$$02 = $10; + break; + } + HEAP32[(6960)>>2] = $10; + $103 = $100 & -2; + HEAP32[$99>>2] = $103; + $104 = $10 | 1; + $$sum14 = (4 - ($5))|0; + $105 = (($p) + ($$sum14)|0); + HEAP32[$105>>2] = $104; + HEAP32[$0>>2] = $10; + return; + } + $15 = $5 >>> 3; + $16 = ($5>>>0)<(256); + if ($16) { + $$sum24 = (8 - ($5))|0; + $17 = (($p) + ($$sum24)|0); + $18 = HEAP32[$17>>2]|0; + $$sum25 = (12 - ($5))|0; + $19 = (($p) + ($$sum25)|0); + $20 = HEAP32[$19>>2]|0; + $21 = $15 << 1; + $22 = (6992 + ($21<<2)|0); + $23 = ($18|0)==($22|0); + if (!($23)) { + $24 = ($18>>>0)<($11>>>0); + if ($24) { + _abort(); + // unreachable; + } + $25 = ((($18)) + 12|0); + $26 = HEAP32[$25>>2]|0; + $27 = ($26|0)==($9|0); + if (!($27)) { + _abort(); + // unreachable; + } + } + $28 = ($20|0)==($18|0); + if ($28) { + $29 = 1 << $15; + $30 = $29 ^ -1; + $31 = HEAP32[6952>>2]|0; + $32 = $31 & $30; + HEAP32[6952>>2] = $32; + $$0 = $9;$$02 = $10; + break; + } + $33 = ($20|0)==($22|0); + if ($33) { + $$pre51 = ((($20)) + 8|0); + $$pre$phi52Z2D = $$pre51; + } else { + $34 = ($20>>>0)<($11>>>0); + if ($34) { + _abort(); + // unreachable; + } + $35 = ((($20)) + 8|0); + $36 = HEAP32[$35>>2]|0; + $37 = ($36|0)==($9|0); + if ($37) { + $$pre$phi52Z2D = $35; + } else { + _abort(); + // unreachable; + } + } + $38 = ((($18)) + 12|0); + HEAP32[$38>>2] = $20; + HEAP32[$$pre$phi52Z2D>>2] = $18; + $$0 = $9;$$02 = $10; + break; + } + $$sum16 = (24 - ($5))|0; + $39 = (($p) + ($$sum16)|0); + $40 = HEAP32[$39>>2]|0; + $$sum17 = (12 - ($5))|0; + $41 = (($p) + ($$sum17)|0); + $42 = HEAP32[$41>>2]|0; + $43 = ($42|0)==($9|0); + do { + if ($43) { + $$sum18 = (16 - ($5))|0; + $$sum19 = (($$sum18) + 4)|0; + $53 = (($p) + ($$sum19)|0); + $54 = HEAP32[$53>>2]|0; + $55 = ($54|0)==(0|0); + if ($55) { + $56 = (($p) + ($$sum18)|0); + $57 = HEAP32[$56>>2]|0; + $58 = ($57|0)==(0|0); + if ($58) { + $R$1 = 0; + break; + } else { + $R$0 = $57;$RP$0 = $56; + } + } else { + $R$0 = $54;$RP$0 = $53; + } + while(1) { + $59 = ((($R$0)) + 20|0); + $60 = HEAP32[$59>>2]|0; + $61 = ($60|0)==(0|0); + if (!($61)) { + $R$0 = $60;$RP$0 = $59; + continue; + } + $62 = ((($R$0)) + 16|0); + $63 = HEAP32[$62>>2]|0; + $64 = ($63|0)==(0|0); + if ($64) { + $R$0$lcssa = $R$0;$RP$0$lcssa = $RP$0; + break; + } else { + $R$0 = $63;$RP$0 = $62; + } + } + $65 = ($RP$0$lcssa>>>0)<($11>>>0); + if ($65) { + _abort(); + // unreachable; + } else { + HEAP32[$RP$0$lcssa>>2] = 0; + $R$1 = $R$0$lcssa; + break; + } + } else { + $$sum23 = (8 - ($5))|0; + $44 = (($p) + ($$sum23)|0); + $45 = HEAP32[$44>>2]|0; + $46 = ($45>>>0)<($11>>>0); + if ($46) { + _abort(); + // unreachable; + } + $47 = ((($45)) + 12|0); + $48 = HEAP32[$47>>2]|0; + $49 = ($48|0)==($9|0); + if (!($49)) { + _abort(); + // unreachable; + } + $50 = ((($42)) + 8|0); + $51 = HEAP32[$50>>2]|0; + $52 = ($51|0)==($9|0); + if ($52) { + HEAP32[$47>>2] = $42; + HEAP32[$50>>2] = $45; + $R$1 = $42; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $66 = ($40|0)==(0|0); + if ($66) { + $$0 = $9;$$02 = $10; + } else { + $$sum20 = (28 - ($5))|0; + $67 = (($p) + ($$sum20)|0); + $68 = HEAP32[$67>>2]|0; + $69 = (7256 + ($68<<2)|0); + $70 = HEAP32[$69>>2]|0; + $71 = ($9|0)==($70|0); + if ($71) { + HEAP32[$69>>2] = $R$1; + $cond = ($R$1|0)==(0|0); + if ($cond) { + $72 = 1 << $68; + $73 = $72 ^ -1; + $74 = HEAP32[(6956)>>2]|0; + $75 = $74 & $73; + HEAP32[(6956)>>2] = $75; + $$0 = $9;$$02 = $10; + break; + } + } else { + $76 = HEAP32[(6968)>>2]|0; + $77 = ($40>>>0)<($76>>>0); + if ($77) { + _abort(); + // unreachable; + } + $78 = ((($40)) + 16|0); + $79 = HEAP32[$78>>2]|0; + $80 = ($79|0)==($9|0); + if ($80) { + HEAP32[$78>>2] = $R$1; + } else { + $81 = ((($40)) + 20|0); + HEAP32[$81>>2] = $R$1; + } + $82 = ($R$1|0)==(0|0); + if ($82) { + $$0 = $9;$$02 = $10; + break; + } + } + $83 = HEAP32[(6968)>>2]|0; + $84 = ($R$1>>>0)<($83>>>0); + if ($84) { + _abort(); + // unreachable; + } + $85 = ((($R$1)) + 24|0); + HEAP32[$85>>2] = $40; + $$sum21 = (16 - ($5))|0; + $86 = (($p) + ($$sum21)|0); + $87 = HEAP32[$86>>2]|0; + $88 = ($87|0)==(0|0); + do { + if (!($88)) { + $89 = ($87>>>0)<($83>>>0); + if ($89) { + _abort(); + // unreachable; + } else { + $90 = ((($R$1)) + 16|0); + HEAP32[$90>>2] = $87; + $91 = ((($87)) + 24|0); + HEAP32[$91>>2] = $R$1; + break; + } + } + } while(0); + $$sum22 = (($$sum21) + 4)|0; + $92 = (($p) + ($$sum22)|0); + $93 = HEAP32[$92>>2]|0; + $94 = ($93|0)==(0|0); + if ($94) { + $$0 = $9;$$02 = $10; + } else { + $95 = HEAP32[(6968)>>2]|0; + $96 = ($93>>>0)<($95>>>0); + if ($96) { + _abort(); + // unreachable; + } else { + $97 = ((($R$1)) + 20|0); + HEAP32[$97>>2] = $93; + $98 = ((($93)) + 24|0); + HEAP32[$98>>2] = $R$1; + $$0 = $9;$$02 = $10; + break; + } + } + } + } else { + $$0 = $p;$$02 = $psize; + } + } while(0); + $106 = HEAP32[(6968)>>2]|0; + $107 = ($0>>>0)<($106>>>0); + if ($107) { + _abort(); + // unreachable; + } + $$sum1 = (($psize) + 4)|0; + $108 = (($p) + ($$sum1)|0); + $109 = HEAP32[$108>>2]|0; + $110 = $109 & 2; + $111 = ($110|0)==(0); + if ($111) { + $112 = HEAP32[(6976)>>2]|0; + $113 = ($0|0)==($112|0); + if ($113) { + $114 = HEAP32[(6964)>>2]|0; + $115 = (($114) + ($$02))|0; + HEAP32[(6964)>>2] = $115; + HEAP32[(6976)>>2] = $$0; + $116 = $115 | 1; + $117 = ((($$0)) + 4|0); + HEAP32[$117>>2] = $116; + $118 = HEAP32[(6972)>>2]|0; + $119 = ($$0|0)==($118|0); + if (!($119)) { + return; + } + HEAP32[(6972)>>2] = 0; + HEAP32[(6960)>>2] = 0; + return; + } + $120 = HEAP32[(6972)>>2]|0; + $121 = ($0|0)==($120|0); + if ($121) { + $122 = HEAP32[(6960)>>2]|0; + $123 = (($122) + ($$02))|0; + HEAP32[(6960)>>2] = $123; + HEAP32[(6972)>>2] = $$0; + $124 = $123 | 1; + $125 = ((($$0)) + 4|0); + HEAP32[$125>>2] = $124; + $126 = (($$0) + ($123)|0); + HEAP32[$126>>2] = $123; + return; + } + $127 = $109 & -8; + $128 = (($127) + ($$02))|0; + $129 = $109 >>> 3; + $130 = ($109>>>0)<(256); + do { + if ($130) { + $$sum12 = (($psize) + 8)|0; + $131 = (($p) + ($$sum12)|0); + $132 = HEAP32[$131>>2]|0; + $$sum13 = (($psize) + 12)|0; + $133 = (($p) + ($$sum13)|0); + $134 = HEAP32[$133>>2]|0; + $135 = $129 << 1; + $136 = (6992 + ($135<<2)|0); + $137 = ($132|0)==($136|0); + if (!($137)) { + $138 = ($132>>>0)<($106>>>0); + if ($138) { + _abort(); + // unreachable; + } + $139 = ((($132)) + 12|0); + $140 = HEAP32[$139>>2]|0; + $141 = ($140|0)==($0|0); + if (!($141)) { + _abort(); + // unreachable; + } + } + $142 = ($134|0)==($132|0); + if ($142) { + $143 = 1 << $129; + $144 = $143 ^ -1; + $145 = HEAP32[6952>>2]|0; + $146 = $145 & $144; + HEAP32[6952>>2] = $146; + break; + } + $147 = ($134|0)==($136|0); + if ($147) { + $$pre49 = ((($134)) + 8|0); + $$pre$phi50Z2D = $$pre49; + } else { + $148 = ($134>>>0)<($106>>>0); + if ($148) { + _abort(); + // unreachable; + } + $149 = ((($134)) + 8|0); + $150 = HEAP32[$149>>2]|0; + $151 = ($150|0)==($0|0); + if ($151) { + $$pre$phi50Z2D = $149; + } else { + _abort(); + // unreachable; + } + } + $152 = ((($132)) + 12|0); + HEAP32[$152>>2] = $134; + HEAP32[$$pre$phi50Z2D>>2] = $132; + } else { + $$sum2 = (($psize) + 24)|0; + $153 = (($p) + ($$sum2)|0); + $154 = HEAP32[$153>>2]|0; + $$sum3 = (($psize) + 12)|0; + $155 = (($p) + ($$sum3)|0); + $156 = HEAP32[$155>>2]|0; + $157 = ($156|0)==($0|0); + do { + if ($157) { + $$sum5 = (($psize) + 20)|0; + $167 = (($p) + ($$sum5)|0); + $168 = HEAP32[$167>>2]|0; + $169 = ($168|0)==(0|0); + if ($169) { + $$sum4 = (($psize) + 16)|0; + $170 = (($p) + ($$sum4)|0); + $171 = HEAP32[$170>>2]|0; + $172 = ($171|0)==(0|0); + if ($172) { + $R7$1 = 0; + break; + } else { + $R7$0 = $171;$RP9$0 = $170; + } + } else { + $R7$0 = $168;$RP9$0 = $167; + } + while(1) { + $173 = ((($R7$0)) + 20|0); + $174 = HEAP32[$173>>2]|0; + $175 = ($174|0)==(0|0); + if (!($175)) { + $R7$0 = $174;$RP9$0 = $173; + continue; + } + $176 = ((($R7$0)) + 16|0); + $177 = HEAP32[$176>>2]|0; + $178 = ($177|0)==(0|0); + if ($178) { + $R7$0$lcssa = $R7$0;$RP9$0$lcssa = $RP9$0; + break; + } else { + $R7$0 = $177;$RP9$0 = $176; + } + } + $179 = ($RP9$0$lcssa>>>0)<($106>>>0); + if ($179) { + _abort(); + // unreachable; + } else { + HEAP32[$RP9$0$lcssa>>2] = 0; + $R7$1 = $R7$0$lcssa; + break; + } + } else { + $$sum11 = (($psize) + 8)|0; + $158 = (($p) + ($$sum11)|0); + $159 = HEAP32[$158>>2]|0; + $160 = ($159>>>0)<($106>>>0); + if ($160) { + _abort(); + // unreachable; + } + $161 = ((($159)) + 12|0); + $162 = HEAP32[$161>>2]|0; + $163 = ($162|0)==($0|0); + if (!($163)) { + _abort(); + // unreachable; + } + $164 = ((($156)) + 8|0); + $165 = HEAP32[$164>>2]|0; + $166 = ($165|0)==($0|0); + if ($166) { + HEAP32[$161>>2] = $156; + HEAP32[$164>>2] = $159; + $R7$1 = $156; + break; + } else { + _abort(); + // unreachable; + } + } + } while(0); + $180 = ($154|0)==(0|0); + if (!($180)) { + $$sum8 = (($psize) + 28)|0; + $181 = (($p) + ($$sum8)|0); + $182 = HEAP32[$181>>2]|0; + $183 = (7256 + ($182<<2)|0); + $184 = HEAP32[$183>>2]|0; + $185 = ($0|0)==($184|0); + if ($185) { + HEAP32[$183>>2] = $R7$1; + $cond39 = ($R7$1|0)==(0|0); + if ($cond39) { + $186 = 1 << $182; + $187 = $186 ^ -1; + $188 = HEAP32[(6956)>>2]|0; + $189 = $188 & $187; + HEAP32[(6956)>>2] = $189; + break; + } + } else { + $190 = HEAP32[(6968)>>2]|0; + $191 = ($154>>>0)<($190>>>0); + if ($191) { + _abort(); + // unreachable; + } + $192 = ((($154)) + 16|0); + $193 = HEAP32[$192>>2]|0; + $194 = ($193|0)==($0|0); + if ($194) { + HEAP32[$192>>2] = $R7$1; + } else { + $195 = ((($154)) + 20|0); + HEAP32[$195>>2] = $R7$1; + } + $196 = ($R7$1|0)==(0|0); + if ($196) { + break; + } + } + $197 = HEAP32[(6968)>>2]|0; + $198 = ($R7$1>>>0)<($197>>>0); + if ($198) { + _abort(); + // unreachable; + } + $199 = ((($R7$1)) + 24|0); + HEAP32[$199>>2] = $154; + $$sum9 = (($psize) + 16)|0; + $200 = (($p) + ($$sum9)|0); + $201 = HEAP32[$200>>2]|0; + $202 = ($201|0)==(0|0); + do { + if (!($202)) { + $203 = ($201>>>0)<($197>>>0); + if ($203) { + _abort(); + // unreachable; + } else { + $204 = ((($R7$1)) + 16|0); + HEAP32[$204>>2] = $201; + $205 = ((($201)) + 24|0); + HEAP32[$205>>2] = $R7$1; + break; + } + } + } while(0); + $$sum10 = (($psize) + 20)|0; + $206 = (($p) + ($$sum10)|0); + $207 = HEAP32[$206>>2]|0; + $208 = ($207|0)==(0|0); + if (!($208)) { + $209 = HEAP32[(6968)>>2]|0; + $210 = ($207>>>0)<($209>>>0); + if ($210) { + _abort(); + // unreachable; + } else { + $211 = ((($R7$1)) + 20|0); + HEAP32[$211>>2] = $207; + $212 = ((($207)) + 24|0); + HEAP32[$212>>2] = $R7$1; + break; + } + } + } + } + } while(0); + $213 = $128 | 1; + $214 = ((($$0)) + 4|0); + HEAP32[$214>>2] = $213; + $215 = (($$0) + ($128)|0); + HEAP32[$215>>2] = $128; + $216 = HEAP32[(6972)>>2]|0; + $217 = ($$0|0)==($216|0); + if ($217) { + HEAP32[(6960)>>2] = $128; + return; + } else { + $$1 = $128; + } + } else { + $218 = $109 & -2; + HEAP32[$108>>2] = $218; + $219 = $$02 | 1; + $220 = ((($$0)) + 4|0); + HEAP32[$220>>2] = $219; + $221 = (($$0) + ($$02)|0); + HEAP32[$221>>2] = $$02; + $$1 = $$02; + } + $222 = $$1 >>> 3; + $223 = ($$1>>>0)<(256); + if ($223) { + $224 = $222 << 1; + $225 = (6992 + ($224<<2)|0); + $226 = HEAP32[6952>>2]|0; + $227 = 1 << $222; + $228 = $226 & $227; + $229 = ($228|0)==(0); + if ($229) { + $230 = $226 | $227; + HEAP32[6952>>2] = $230; + $$pre = (($224) + 2)|0; + $$pre48 = (6992 + ($$pre<<2)|0); + $$pre$phiZ2D = $$pre48;$F16$0 = $225; + } else { + $$sum7 = (($224) + 2)|0; + $231 = (6992 + ($$sum7<<2)|0); + $232 = HEAP32[$231>>2]|0; + $233 = HEAP32[(6968)>>2]|0; + $234 = ($232>>>0)<($233>>>0); + if ($234) { + _abort(); + // unreachable; + } else { + $$pre$phiZ2D = $231;$F16$0 = $232; + } + } + HEAP32[$$pre$phiZ2D>>2] = $$0; + $235 = ((($F16$0)) + 12|0); + HEAP32[$235>>2] = $$0; + $236 = ((($$0)) + 8|0); + HEAP32[$236>>2] = $F16$0; + $237 = ((($$0)) + 12|0); + HEAP32[$237>>2] = $225; + return; + } + $238 = $$1 >>> 8; + $239 = ($238|0)==(0); + if ($239) { + $I19$0 = 0; + } else { + $240 = ($$1>>>0)>(16777215); + if ($240) { + $I19$0 = 31; + } else { + $241 = (($238) + 1048320)|0; + $242 = $241 >>> 16; + $243 = $242 & 8; + $244 = $238 << $243; + $245 = (($244) + 520192)|0; + $246 = $245 >>> 16; + $247 = $246 & 4; + $248 = $247 | $243; + $249 = $244 << $247; + $250 = (($249) + 245760)|0; + $251 = $250 >>> 16; + $252 = $251 & 2; + $253 = $248 | $252; + $254 = (14 - ($253))|0; + $255 = $249 << $252; + $256 = $255 >>> 15; + $257 = (($254) + ($256))|0; + $258 = $257 << 1; + $259 = (($257) + 7)|0; + $260 = $$1 >>> $259; + $261 = $260 & 1; + $262 = $261 | $258; + $I19$0 = $262; + } + } + $263 = (7256 + ($I19$0<<2)|0); + $264 = ((($$0)) + 28|0); + HEAP32[$264>>2] = $I19$0; + $265 = ((($$0)) + 16|0); + $266 = ((($$0)) + 20|0); + HEAP32[$266>>2] = 0; + HEAP32[$265>>2] = 0; + $267 = HEAP32[(6956)>>2]|0; + $268 = 1 << $I19$0; + $269 = $267 & $268; + $270 = ($269|0)==(0); + if ($270) { + $271 = $267 | $268; + HEAP32[(6956)>>2] = $271; + HEAP32[$263>>2] = $$0; + $272 = ((($$0)) + 24|0); + HEAP32[$272>>2] = $263; + $273 = ((($$0)) + 12|0); + HEAP32[$273>>2] = $$0; + $274 = ((($$0)) + 8|0); + HEAP32[$274>>2] = $$0; + return; + } + $275 = HEAP32[$263>>2]|0; + $276 = ((($275)) + 4|0); + $277 = HEAP32[$276>>2]|0; + $278 = $277 & -8; + $279 = ($278|0)==($$1|0); + L191: do { + if ($279) { + $T$0$lcssa = $275; + } else { + $280 = ($I19$0|0)==(31); + $281 = $I19$0 >>> 1; + $282 = (25 - ($281))|0; + $283 = $280 ? 0 : $282; + $284 = $$1 << $283; + $K20$043 = $284;$T$042 = $275; + while(1) { + $291 = $K20$043 >>> 31; + $292 = (((($T$042)) + 16|0) + ($291<<2)|0); + $287 = HEAP32[$292>>2]|0; + $293 = ($287|0)==(0|0); + if ($293) { + $$lcssa = $292;$T$042$lcssa = $T$042; + break; + } + $285 = $K20$043 << 1; + $286 = ((($287)) + 4|0); + $288 = HEAP32[$286>>2]|0; + $289 = $288 & -8; + $290 = ($289|0)==($$1|0); + if ($290) { + $T$0$lcssa = $287; + break L191; + } else { + $K20$043 = $285;$T$042 = $287; + } + } + $294 = HEAP32[(6968)>>2]|0; + $295 = ($$lcssa>>>0)<($294>>>0); + if ($295) { + _abort(); + // unreachable; + } + HEAP32[$$lcssa>>2] = $$0; + $296 = ((($$0)) + 24|0); + HEAP32[$296>>2] = $T$042$lcssa; + $297 = ((($$0)) + 12|0); + HEAP32[$297>>2] = $$0; + $298 = ((($$0)) + 8|0); + HEAP32[$298>>2] = $$0; + return; + } + } while(0); + $299 = ((($T$0$lcssa)) + 8|0); + $300 = HEAP32[$299>>2]|0; + $301 = HEAP32[(6968)>>2]|0; + $302 = ($300>>>0)>=($301>>>0); + $not$ = ($T$0$lcssa>>>0)>=($301>>>0); + $303 = $302 & $not$; + if (!($303)) { + _abort(); + // unreachable; + } + $304 = ((($300)) + 12|0); + HEAP32[$304>>2] = $$0; + HEAP32[$299>>2] = $$0; + $305 = ((($$0)) + 8|0); + HEAP32[$305>>2] = $300; + $306 = ((($$0)) + 12|0); + HEAP32[$306>>2] = $T$0$lcssa; + $307 = ((($$0)) + 24|0); + HEAP32[$307>>2] = 0; + return; +} +function runPostSets() { +} +function _memcpy(dest, src, num) { + dest = dest|0; src = src|0; num = num|0; + var ret = 0; + if ((num|0) >= 4096) return _emscripten_memcpy_big(dest|0, src|0, num|0)|0; + ret = dest|0; + if ((dest&3) == (src&3)) { + while (dest & 3) { + if ((num|0) == 0) return ret|0; + HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); + dest = (dest+1)|0; + src = (src+1)|0; + num = (num-1)|0; + } + while ((num|0) >= 4) { + HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0); + dest = (dest+4)|0; + src = (src+4)|0; + num = (num-4)|0; + } + } + while ((num|0) > 0) { + HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); + dest = (dest+1)|0; + src = (src+1)|0; + num = (num-1)|0; + } + return ret|0; +} +function _memset(ptr, value, num) { + ptr = ptr|0; value = value|0; num = num|0; + var stop = 0, value4 = 0, stop4 = 0, unaligned = 0; + stop = (ptr + num)|0; + if ((num|0) >= 20) { + // This is unaligned, but quite large, so work hard to get to aligned settings + value = value & 0xff; + unaligned = ptr & 3; + value4 = value | (value << 8) | (value << 16) | (value << 24); + stop4 = stop & ~3; + if (unaligned) { + unaligned = (ptr + 4 - unaligned)|0; + while ((ptr|0) < (unaligned|0)) { // no need to check for stop, since we have large num + HEAP8[((ptr)>>0)]=value; + ptr = (ptr+1)|0; + } + } + while ((ptr|0) < (stop4|0)) { + HEAP32[((ptr)>>2)]=value4; + ptr = (ptr+4)|0; + } + } + while ((ptr|0) < (stop|0)) { + HEAP8[((ptr)>>0)]=value; + ptr = (ptr+1)|0; + } + return (ptr-num)|0; +} +function _i64Subtract(a, b, c, d) { + a = a|0; b = b|0; c = c|0; d = d|0; + var l = 0, h = 0; + l = (a - c)>>>0; + h = (b - d)>>>0; + h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow. + return ((tempRet0 = h,l|0)|0); +} +function _i64Add(a, b, c, d) { + /* + x = a + b*2^32 + y = c + d*2^32 + result = l + h*2^32 + */ + a = a|0; b = b|0; c = c|0; d = d|0; + var l = 0, h = 0; + l = (a + c)>>>0; + h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow. + return ((tempRet0 = h,l|0)|0); +} +function _memmove(dest, src, num) { + dest = dest|0; src = src|0; num = num|0; + var ret = 0; + if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) { + // Unlikely case: Copy backwards in a safe manner + ret = dest; + src = (src + num)|0; + dest = (dest + num)|0; + while ((num|0) > 0) { + dest = (dest - 1)|0; + src = (src - 1)|0; + num = (num - 1)|0; + HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0); + } + dest = ret; + } else { + _memcpy(dest, src, num) | 0; + } + return dest | 0; +} +function _bitshift64Lshr(low, high, bits) { + low = low|0; high = high|0; bits = bits|0; + var ander = 0; + if ((bits|0) < 32) { + ander = ((1 << bits) - 1)|0; + tempRet0 = high >>> bits; + return (low >>> bits) | ((high&ander) << (32 - bits)); + } + tempRet0 = 0; + return (high >>> (bits - 32))|0; +} +function _bitshift64Shl(low, high, bits) { + low = low|0; high = high|0; bits = bits|0; + var ander = 0; + if ((bits|0) < 32) { + ander = ((1 << bits) - 1)|0; + tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits)); + return low << bits; + } + tempRet0 = low << (bits - 32); + return 0; +} +function _bitshift64Ashr(low, high, bits) { + low = low|0; high = high|0; bits = bits|0; + var ander = 0; + if ((bits|0) < 32) { + ander = ((1 << bits) - 1)|0; + tempRet0 = high >> bits; + return (low >>> bits) | ((high&ander) << (32 - bits)); + } + tempRet0 = (high|0) < 0 ? -1 : 0; + return (high >> (bits - 32))|0; + } +function _llvm_cttz_i32(x) { + x = x|0; + var ret = 0; + ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0); + if ((ret|0) < 8) return ret|0; + ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0); + if ((ret|0) < 8) return (ret + 8)|0; + ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0); + if ((ret|0) < 8) return (ret + 16)|0; + return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0; + } + +// ======== compiled code from system/lib/compiler-rt , see readme therein +function ___muldsi3($a, $b) { + $a = $a | 0; + $b = $b | 0; + var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0; + $1 = $a & 65535; + $2 = $b & 65535; + $3 = Math_imul($2, $1) | 0; + $6 = $a >>> 16; + $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0; + $11 = $b >>> 16; + $12 = Math_imul($11, $1) | 0; + return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0; +} +function ___divdi3($a$0, $a$1, $b$0, $b$1) { + $a$0 = $a$0 | 0; + $a$1 = $a$1 | 0; + $b$0 = $b$0 | 0; + $b$1 = $b$1 | 0; + var $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $7$0 = 0, $7$1 = 0, $8$0 = 0, $10$0 = 0; + $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; + $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; + $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; + $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; + $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0; + $4$1 = tempRet0; + $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0; + $7$0 = $2$0 ^ $1$0; + $7$1 = $2$1 ^ $1$1; + $8$0 = ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, 0) | 0; + $10$0 = _i64Subtract($8$0 ^ $7$0, tempRet0 ^ $7$1, $7$0, $7$1) | 0; + return $10$0 | 0; +} +function ___remdi3($a$0, $a$1, $b$0, $b$1) { + $a$0 = $a$0 | 0; + $a$1 = $a$1 | 0; + $b$0 = $b$0 | 0; + $b$1 = $b$1 | 0; + var $rem = 0, $1$0 = 0, $1$1 = 0, $2$0 = 0, $2$1 = 0, $4$0 = 0, $4$1 = 0, $6$0 = 0, $10$0 = 0, $10$1 = 0, __stackBase__ = 0; + __stackBase__ = STACKTOP; + STACKTOP = STACKTOP + 16 | 0; + $rem = __stackBase__ | 0; + $1$0 = $a$1 >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; + $1$1 = (($a$1 | 0) < 0 ? -1 : 0) >> 31 | (($a$1 | 0) < 0 ? -1 : 0) << 1; + $2$0 = $b$1 >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; + $2$1 = (($b$1 | 0) < 0 ? -1 : 0) >> 31 | (($b$1 | 0) < 0 ? -1 : 0) << 1; + $4$0 = _i64Subtract($1$0 ^ $a$0, $1$1 ^ $a$1, $1$0, $1$1) | 0; + $4$1 = tempRet0; + $6$0 = _i64Subtract($2$0 ^ $b$0, $2$1 ^ $b$1, $2$0, $2$1) | 0; + ___udivmoddi4($4$0, $4$1, $6$0, tempRet0, $rem) | 0; + $10$0 = _i64Subtract(HEAP32[$rem >> 2] ^ $1$0, HEAP32[$rem + 4 >> 2] ^ $1$1, $1$0, $1$1) | 0; + $10$1 = tempRet0; + STACKTOP = __stackBase__; + return (tempRet0 = $10$1, $10$0) | 0; +} +function ___muldi3($a$0, $a$1, $b$0, $b$1) { + $a$0 = $a$0 | 0; + $a$1 = $a$1 | 0; + $b$0 = $b$0 | 0; + $b$1 = $b$1 | 0; + var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0; + $x_sroa_0_0_extract_trunc = $a$0; + $y_sroa_0_0_extract_trunc = $b$0; + $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0; + $1$1 = tempRet0; + $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0; + return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0; +} +function ___udivdi3($a$0, $a$1, $b$0, $b$1) { + $a$0 = $a$0 | 0; + $a$1 = $a$1 | 0; + $b$0 = $b$0 | 0; + $b$1 = $b$1 | 0; + var $1$0 = 0; + $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0; + return $1$0 | 0; +} +function ___uremdi3($a$0, $a$1, $b$0, $b$1) { + $a$0 = $a$0 | 0; + $a$1 = $a$1 | 0; + $b$0 = $b$0 | 0; + $b$1 = $b$1 | 0; + var $rem = 0, __stackBase__ = 0; + __stackBase__ = STACKTOP; + STACKTOP = STACKTOP + 16 | 0; + $rem = __stackBase__ | 0; + ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0; + STACKTOP = __stackBase__; + return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0; +} +function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) { + $a$0 = $a$0 | 0; + $a$1 = $a$1 | 0; + $b$0 = $b$0 | 0; + $b$1 = $b$1 | 0; + $rem = $rem | 0; + var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0; + $n_sroa_0_0_extract_trunc = $a$0; + $n_sroa_1_4_extract_shift$0 = $a$1; + $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0; + $d_sroa_0_0_extract_trunc = $b$0; + $d_sroa_1_4_extract_shift$0 = $b$1; + $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0; + if (($n_sroa_1_4_extract_trunc | 0) == 0) { + $4 = ($rem | 0) != 0; + if (($d_sroa_1_4_extract_trunc | 0) == 0) { + if ($4) { + HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0); + HEAP32[$rem + 4 >> 2] = 0; + } + $_0$1 = 0; + $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } else { + if (!$4) { + $_0$1 = 0; + $_0$0 = 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + HEAP32[$rem >> 2] = $a$0 & -1; + HEAP32[$rem + 4 >> 2] = $a$1 & 0; + $_0$1 = 0; + $_0$0 = 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + } + $17 = ($d_sroa_1_4_extract_trunc | 0) == 0; + do { + if (($d_sroa_0_0_extract_trunc | 0) == 0) { + if ($17) { + if (($rem | 0) != 0) { + HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0); + HEAP32[$rem + 4 >> 2] = 0; + } + $_0$1 = 0; + $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + if (($n_sroa_0_0_extract_trunc | 0) == 0) { + if (($rem | 0) != 0) { + HEAP32[$rem >> 2] = 0; + HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0); + } + $_0$1 = 0; + $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + $37 = $d_sroa_1_4_extract_trunc - 1 | 0; + if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) { + if (($rem | 0) != 0) { + HEAP32[$rem >> 2] = 0 | $a$0 & -1; + HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0; + } + $_0$1 = 0; + $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0); + return (tempRet0 = $_0$1, $_0$0) | 0; + } + $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0; + $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; + if ($51 >>> 0 <= 30) { + $57 = $51 + 1 | 0; + $58 = 31 - $51 | 0; + $sr_1_ph = $57; + $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0); + $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0); + $q_sroa_0_1_ph = 0; + $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58; + break; + } + if (($rem | 0) == 0) { + $_0$1 = 0; + $_0$0 = 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + HEAP32[$rem >> 2] = 0 | $a$0 & -1; + HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; + $_0$1 = 0; + $_0$0 = 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } else { + if (!$17) { + $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0; + $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; + if ($119 >>> 0 <= 31) { + $125 = $119 + 1 | 0; + $126 = 31 - $119 | 0; + $130 = $119 - 31 >> 31; + $sr_1_ph = $125; + $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126; + $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130; + $q_sroa_0_1_ph = 0; + $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126; + break; + } + if (($rem | 0) == 0) { + $_0$1 = 0; + $_0$0 = 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + HEAP32[$rem >> 2] = 0 | $a$0 & -1; + HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; + $_0$1 = 0; + $_0$0 = 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + $66 = $d_sroa_0_0_extract_trunc - 1 | 0; + if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) { + $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0; + $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0; + $89 = 64 - $88 | 0; + $91 = 32 - $88 | 0; + $92 = $91 >> 31; + $95 = $88 - 32 | 0; + $105 = $95 >> 31; + $sr_1_ph = $88; + $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105; + $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0); + $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92; + $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31; + break; + } + if (($rem | 0) != 0) { + HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc; + HEAP32[$rem + 4 >> 2] = 0; + } + if (($d_sroa_0_0_extract_trunc | 0) == 1) { + $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0; + $_0$0 = 0 | $a$0 & -1; + return (tempRet0 = $_0$1, $_0$0) | 0; + } else { + $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0; + $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0); + $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0; + return (tempRet0 = $_0$1, $_0$0) | 0; + } + } + } while (0); + if (($sr_1_ph | 0) == 0) { + $q_sroa_1_1_lcssa = $q_sroa_1_1_ph; + $q_sroa_0_1_lcssa = $q_sroa_0_1_ph; + $r_sroa_1_1_lcssa = $r_sroa_1_1_ph; + $r_sroa_0_1_lcssa = $r_sroa_0_1_ph; + $carry_0_lcssa$1 = 0; + $carry_0_lcssa$0 = 0; + } else { + $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1; + $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0; + $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0; + $137$1 = tempRet0; + $q_sroa_1_1198 = $q_sroa_1_1_ph; + $q_sroa_0_1199 = $q_sroa_0_1_ph; + $r_sroa_1_1200 = $r_sroa_1_1_ph; + $r_sroa_0_1201 = $r_sroa_0_1_ph; + $sr_1202 = $sr_1_ph; + $carry_0203 = 0; + while (1) { + $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1; + $149 = $carry_0203 | $q_sroa_0_1199 << 1; + $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31); + $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0; + _i64Subtract($137$0, $137$1, $r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1) | 0; + $150$1 = tempRet0; + $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1; + $152 = $151$0 & 1; + $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0, $r_sroa_0_0_insert_insert42$1, $151$0 & $d_sroa_0_0_insert_insert99$0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1) | 0; + $r_sroa_0_0_extract_trunc = $154$0; + $r_sroa_1_4_extract_trunc = tempRet0; + $155 = $sr_1202 - 1 | 0; + if (($155 | 0) == 0) { + break; + } else { + $q_sroa_1_1198 = $147; + $q_sroa_0_1199 = $149; + $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc; + $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc; + $sr_1202 = $155; + $carry_0203 = $152; + } + } + $q_sroa_1_1_lcssa = $147; + $q_sroa_0_1_lcssa = $149; + $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc; + $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc; + $carry_0_lcssa$1 = 0; + $carry_0_lcssa$0 = $152; + } + $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa; + $q_sroa_0_0_insert_ext75$1 = 0; + $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1; + if (($rem | 0) != 0) { + HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa; + HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0; + } + $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1; + $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0; + return (tempRet0 = $_0$1, $_0$0) | 0; +} +// ======================================================================= + + + + +function dynCall_viiiii(index,a1,a2,a3,a4,a5) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; + FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0); +} + + +function dynCall_vd(index,a1) { + index = index|0; + a1=+a1; + FUNCTION_TABLE_vd[index&3](+a1); +} + + +function dynCall_vid(index,a1,a2) { + index = index|0; + a1=a1|0; a2=+a2; + FUNCTION_TABLE_vid[index&3](a1|0,+a2); +} + + +function dynCall_vi(index,a1) { + index = index|0; + a1=a1|0; + FUNCTION_TABLE_vi[index&31](a1|0); +} + + +function dynCall_vii(index,a1,a2) { + index = index|0; + a1=a1|0; a2=a2|0; + FUNCTION_TABLE_vii[index&63](a1|0,a2|0); +} + + +function dynCall_ii(index,a1) { + index = index|0; + a1=a1|0; + return FUNCTION_TABLE_ii[index&15](a1|0)|0; +} + + +function dynCall_viddd(index,a1,a2,a3,a4) { + index = index|0; + a1=a1|0; a2=+a2; a3=+a3; a4=+a4; + FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4); +} + + +function dynCall_vidd(index,a1,a2,a3) { + index = index|0; + a1=a1|0; a2=+a2; a3=+a3; + FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3); +} + + +function dynCall_iiii(index,a1,a2,a3) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; + return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0; +} + + +function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; + FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0); +} + + +function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; + FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0); +} + + +function dynCall_viii(index,a1,a2,a3) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; + FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0); +} + + +function dynCall_vidddd(index,a1,a2,a3,a4,a5) { + index = index|0; + a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5; + FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5); +} + + +function dynCall_vdi(index,a1,a2) { + index = index|0; + a1=+a1; a2=a2|0; + FUNCTION_TABLE_vdi[index&1](+a1,a2|0); +} + + +function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; + FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0); +} + + +function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0; + FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0); +} + + +function dynCall_iii(index,a1,a2) { + index = index|0; + a1=a1|0; a2=a2|0; + return FUNCTION_TABLE_iii[index&3](a1|0,a2|0)|0; +} + + +function dynCall_i(index) { + index = index|0; + + return FUNCTION_TABLE_i[index&3]()|0; +} + + +function dynCall_iiiiii(index,a1,a2,a3,a4,a5) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; + return FUNCTION_TABLE_iiiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0)|0; +} + + +function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) { + index = index|0; + a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6; + FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6); +} + + +function dynCall_vdddd(index,a1,a2,a3,a4) { + index = index|0; + a1=+a1; a2=+a2; a3=+a3; a4=+a4; + FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4); +} + + +function dynCall_vdd(index,a1,a2) { + index = index|0; + a1=+a1; a2=+a2; + FUNCTION_TABLE_vdd[index&3](+a1,+a2); +} + + +function dynCall_v(index) { + index = index|0; + + FUNCTION_TABLE_v[index&7](); +} + + +function dynCall_viid(index,a1,a2,a3) { + index = index|0; + a1=a1|0; a2=a2|0; a3=+a3; + FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3); +} + + +function dynCall_viiii(index,a1,a2,a3,a4) { + index = index|0; + a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; + FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0); +} + +function b0(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(0); +} +function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0); +} +function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0); +} +function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0); +} +function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0); +} +function b1(p0) { + p0 = +p0; abort(1); +} +function _emscripten_glClearDepth__wrapper(p0) { + p0 = +p0; _emscripten_glClearDepth(+p0); +} +function _emscripten_glClearDepthf__wrapper(p0) { + p0 = +p0; _emscripten_glClearDepthf(+p0); +} +function _emscripten_glLineWidth__wrapper(p0) { + p0 = +p0; _emscripten_glLineWidth(+p0); +} +function b2(p0,p1) { + p0 = p0|0;p1 = +p1; abort(2); +} +function _emscripten_glUniform1f__wrapper(p0,p1) { + p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1); +} +function _emscripten_glVertexAttrib1f__wrapper(p0,p1) { + p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1); +} +function b3(p0) { + p0 = p0|0; abort(3); +} +function _emscripten_glDeleteShader__wrapper(p0) { + p0 = p0|0; _emscripten_glDeleteShader(p0|0); +} +function _emscripten_glCompileShader__wrapper(p0) { + p0 = p0|0; _emscripten_glCompileShader(p0|0); +} +function _emscripten_glDeleteProgram__wrapper(p0) { + p0 = p0|0; _emscripten_glDeleteProgram(p0|0); +} +function _emscripten_glLinkProgram__wrapper(p0) { + p0 = p0|0; _emscripten_glLinkProgram(p0|0); +} +function _emscripten_glUseProgram__wrapper(p0) { + p0 = p0|0; _emscripten_glUseProgram(p0|0); +} +function _emscripten_glValidateProgram__wrapper(p0) { + p0 = p0|0; _emscripten_glValidateProgram(p0|0); +} +function _emscripten_glDeleteObjectARB__wrapper(p0) { + p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0); +} +function _emscripten_glEnableClientState__wrapper(p0) { + p0 = p0|0; _emscripten_glEnableClientState(p0|0); +} +function _emscripten_glClientActiveTexture__wrapper(p0) { + p0 = p0|0; _emscripten_glClientActiveTexture(p0|0); +} +function _emscripten_glBindVertexArray__wrapper(p0) { + p0 = p0|0; _emscripten_glBindVertexArray(p0|0); +} +function _emscripten_glMatrixMode__wrapper(p0) { + p0 = p0|0; _emscripten_glMatrixMode(p0|0); +} +function _emscripten_glLoadMatrixf__wrapper(p0) { + p0 = p0|0; _emscripten_glLoadMatrixf(p0|0); +} +function _emscripten_glEnableVertexAttribArray__wrapper(p0) { + p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0); +} +function _emscripten_glDisableVertexAttribArray__wrapper(p0) { + p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0); +} +function _emscripten_glDepthFunc__wrapper(p0) { + p0 = p0|0; _emscripten_glDepthFunc(p0|0); +} +function _emscripten_glEnable__wrapper(p0) { + p0 = p0|0; _emscripten_glEnable(p0|0); +} +function _emscripten_glDisable__wrapper(p0) { + p0 = p0|0; _emscripten_glDisable(p0|0); +} +function _emscripten_glFrontFace__wrapper(p0) { + p0 = p0|0; _emscripten_glFrontFace(p0|0); +} +function _emscripten_glCullFace__wrapper(p0) { + p0 = p0|0; _emscripten_glCullFace(p0|0); +} +function _emscripten_glClear__wrapper(p0) { + p0 = p0|0; _emscripten_glClear(p0|0); +} +function _emscripten_glClearStencil__wrapper(p0) { + p0 = p0|0; _emscripten_glClearStencil(p0|0); +} +function _emscripten_glDepthMask__wrapper(p0) { + p0 = p0|0; _emscripten_glDepthMask(p0|0); +} +function _emscripten_glStencilMask__wrapper(p0) { + p0 = p0|0; _emscripten_glStencilMask(p0|0); +} +function _emscripten_glGenerateMipmap__wrapper(p0) { + p0 = p0|0; _emscripten_glGenerateMipmap(p0|0); +} +function _emscripten_glActiveTexture__wrapper(p0) { + p0 = p0|0; _emscripten_glActiveTexture(p0|0); +} +function _emscripten_glBlendEquation__wrapper(p0) { + p0 = p0|0; _emscripten_glBlendEquation(p0|0); +} +function b4(p0,p1) { + p0 = p0|0;p1 = p1|0; abort(4); +} +function _emscripten_glPixelStorei__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0); +} +function _emscripten_glGetIntegerv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0); +} +function _emscripten_glGetFloatv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0); +} +function _emscripten_glGetBooleanv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0); +} +function _emscripten_glGenTextures__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0); +} +function _emscripten_glDeleteTextures__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0); +} +function _emscripten_glBindTexture__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0); +} +function _emscripten_glGenBuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0); +} +function _emscripten_glDeleteBuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0); +} +function _emscripten_glGenRenderbuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0); +} +function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0); +} +function _emscripten_glBindRenderbuffer__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0); +} +function _emscripten_glUniform1i__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0); +} +function _emscripten_glBindBuffer__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0); +} +function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0); +} +function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0); +} +function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0); +} +function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0); +} +function _emscripten_glAttachShader__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0); +} +function _emscripten_glDetachShader__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0); +} +function _emscripten_glBindFramebuffer__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0); +} +function _emscripten_glGenFramebuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0); +} +function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0); +} +function _emscripten_glBindProgramARB__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0); +} +function _emscripten_glGetPointerv__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0); +} +function _emscripten_glGenVertexArrays__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0); +} +function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0); +} +function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0); +} +function _emscripten_glBlendFunc__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0); +} +function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0); +} +function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0); +} +function _emscripten_glHint__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0); +} +function _emscripten_glDrawBuffers__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0); +} +function b5(p0) { + p0 = p0|0; abort(5);return 0; +} +function _emscripten_glGetString__wrapper(p0) { + p0 = p0|0; return _emscripten_glGetString(p0|0)|0; +} +function _emscripten_glIsTexture__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0; +} +function _emscripten_glIsBuffer__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0; +} +function _emscripten_glIsRenderbuffer__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0; +} +function _emscripten_glCreateShader__wrapper(p0) { + p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0; +} +function _emscripten_glIsShader__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsShader(p0|0)|0; +} +function _emscripten_glIsProgram__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0; +} +function _emscripten_glIsFramebuffer__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0; +} +function _emscripten_glCheckFramebufferStatus__wrapper(p0) { + p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0; +} +function _emscripten_glIsEnabled__wrapper(p0) { + p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0; +} +function b6(p0,p1,p2,p3) { + p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; abort(6); +} +function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3); +} +function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3); +} +function b7(p0,p1,p2) { + p0 = p0|0;p1 = +p1;p2 = +p2; abort(7); +} +function _emscripten_glUniform2f__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2); +} +function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2); +} +function b8(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(8);return 0; +} +function b9(p0,p1,p2,p3,p4,p5,p6,p7) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; abort(9); +} +function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0); +} +function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0); +} +function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0); +} +function b10(p0,p1,p2,p3,p4,p5) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; abort(10); +} +function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0); +} +function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0); +} +function b11(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; abort(11); +} +function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0); +} +function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0); +} +function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform2i__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform1iv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform2iv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform3iv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform4iv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform1fv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform2fv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform3fv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0); +} +function _emscripten_glUniform4fv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0); +} +function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0); +} +function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0); +} +function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0); +} +function _emscripten_glNormalPointer__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0); +} +function _emscripten_glDrawArrays__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0); +} +function _emscripten_glTexParameteri__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0); +} +function _emscripten_glStencilFunc__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0); +} +function _emscripten_glStencilOp__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0); +} +function b12(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; abort(12); +} +function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4); +} +function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4); +} +function b13(p0,p1) { + p0 = +p0;p1 = p1|0; abort(13); +} +function _emscripten_glSampleCoverage__wrapper(p0,p1) { + p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0); +} +function b14(p0,p1,p2,p3,p4,p5,p6) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; abort(14); +} +function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0); +} +function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0); +} +function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0); +} +function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; abort(15); +} +function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0); +} +function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0); +} +function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0); +} +function b16(p0,p1) { + p0 = p0|0;p1 = p1|0; abort(16);return 0; +} +function _emscripten_glGetUniformLocation__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0; +} +function _emscripten_glGetAttribLocation__wrapper(p0,p1) { + p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0; +} +function b17() { + ; abort(17);return 0; +} +function _emscripten_glCreateProgram__wrapper() { + ; return _emscripten_glCreateProgram()|0; +} +function _emscripten_glGetError__wrapper() { + ; return _emscripten_glGetError()|0; +} +function b18(p0,p1,p2,p3,p4) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; abort(18);return 0; +} +function b19(p0,p1,p2,p3,p4,p5) { + p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; abort(19); +} +function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) { + p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5); +} +function b20(p0,p1,p2,p3) { + p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; abort(20); +} +function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) { + p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3); +} +function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) { + p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3); +} +function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) { + p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3); +} +function b21(p0,p1) { + p0 = +p0;p1 = +p1; abort(21); +} +function _emscripten_glDepthRange__wrapper(p0,p1) { + p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1); +} +function _emscripten_glDepthRangef__wrapper(p0,p1) { + p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1); +} +function _emscripten_glPolygonOffset__wrapper(p0,p1) { + p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1); +} +function b22() { + ; abort(22); +} +function _emscripten_glLoadIdentity__wrapper() { + ; _emscripten_glLoadIdentity(); +} +function _emscripten_glReleaseShaderCompiler__wrapper() { + ; _emscripten_glReleaseShaderCompiler(); +} +function _emscripten_glFinish__wrapper() { + ; _emscripten_glFinish(); +} +function _emscripten_glFlush__wrapper() { + ; _emscripten_glFlush(); +} +function b23(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = +p2; abort(23); +} +function _emscripten_glTexParameterf__wrapper(p0,p1,p2) { + p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2); +} +function b24(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; abort(24); +} +function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glViewport__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glScissor__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0); +} +function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) { + p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0); +} + +// EMSCRIPTEN_END_FUNCS +var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0]; +var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper]; +var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2]; +var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,_cleanup521,_cleanup526 +,b3,b3,b3]; +var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4 +,b4,b4,b4,b4,b4]; +var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5]; +var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6]; +var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7]; +var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,_sn_write,___stdout_write,___stdio_seek,_EmscriptenFullscreenChangeCallback,_EmscriptenInputCallback,___stdio_read,___stdio_write,b8,b8,b8,b8,b8,b8,b8]; +var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper]; +var FUNCTION_TABLE_viiiiii = [b10,_stbi__YCbCr_to_RGB_row,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper]; +var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_stbi__idct_block,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper]; +var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12]; +var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper]; +var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper]; +var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper]; +var FUNCTION_TABLE_iii = [b16,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16]; +var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17]; +var FUNCTION_TABLE_iiiiii = [b18,_stbi__resample_row_hv_2,_resample_row_1,_stbi__resample_row_v_2,_stbi__resample_row_h_2,_stbi__resample_row_generic,b18,b18]; +var FUNCTION_TABLE_vdddddd = [b19,_emscripten_glFrustum__wrapper]; +var FUNCTION_TABLE_vdddd = [b20,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper]; +var FUNCTION_TABLE_vdd = [b21,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper]; +var FUNCTION_TABLE_v = [b22,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b22,b22]; +var FUNCTION_TABLE_viid = [b23,_emscripten_glTexParameterf__wrapper]; +var FUNCTION_TABLE_viiii = [b24,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b24,b24,b24]; + + return { _i64Subtract: _i64Subtract, _fflush: _fflush, _main: _main, _i64Add: _i64Add, _memmove: _memmove, _strstr: _strstr, _memset: _memset, _malloc: _malloc, _memcpy: _memcpy, _bitshift64Lshr: _bitshift64Lshr, _free: _free, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___errno_location: ___errno_location, _bitshift64Shl: _bitshift64Shl, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_iiiiii: dynCall_iiiiii, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii }; +}) +// EMSCRIPTEN_END_ASM +(Module.asmGlobalArg, Module.asmLibraryArg, buffer); +var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"]; +var _fflush = Module["_fflush"] = asm["_fflush"]; +var _main = Module["_main"] = asm["_main"]; +var _i64Add = Module["_i64Add"] = asm["_i64Add"]; +var _memmove = Module["_memmove"] = asm["_memmove"]; +var _strstr = Module["_strstr"] = asm["_strstr"]; +var _memset = Module["_memset"] = asm["_memset"]; +var runPostSets = Module["runPostSets"] = asm["runPostSets"]; +var _malloc = Module["_malloc"] = asm["_malloc"]; +var _memcpy = Module["_memcpy"] = asm["_memcpy"]; +var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"]; +var _free = Module["_free"] = asm["_free"]; +var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"]; +var ___errno_location = Module["___errno_location"] = asm["___errno_location"]; +var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"]; +var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"]; +var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"]; +var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"]; +var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"]; +var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"]; +var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"]; +var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"]; +var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"]; +var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"]; +var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"]; +var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"]; +var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"]; +var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"]; +var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"]; +var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"]; +var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"]; +var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"]; +var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"]; +var dynCall_iiiiii = Module["dynCall_iiiiii"] = asm["dynCall_iiiiii"]; +var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"]; +var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"]; +var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"]; +var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"]; +var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"]; +var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"]; +; + +Runtime.stackAlloc = asm['stackAlloc']; +Runtime.stackSave = asm['stackSave']; +Runtime.stackRestore = asm['stackRestore']; +Runtime.establishStackSpace = asm['establishStackSpace']; + +Runtime.setTempRet0 = asm['setTempRet0']; +Runtime.getTempRet0 = asm['getTempRet0']; + + + +// === Auto-generated postamble setup entry stuff === + + +function ExitStatus(status) { + this.name = "ExitStatus"; + this.message = "Program terminated with exit(" + status + ")"; + this.status = status; +}; +ExitStatus.prototype = new Error(); +ExitStatus.prototype.constructor = ExitStatus; + +var initialStackTop; +var preloadStartTime = null; +var calledMain = false; + +dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!Module['calledRun']) run(); + if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled +} + +Module['callMain'] = Module.callMain = function callMain(args) { + assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)'); + assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called'); + + args = args || []; + + ensureInitRuntime(); + + var argc = args.length+1; + function pad() { + for (var i = 0; i < 4-1; i++) { + argv.push(0); + } + } + var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ]; + pad(); + for (var i = 0; i < argc-1; i = i + 1) { + argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL)); + pad(); + } + argv.push(0); + argv = allocate(argv, 'i32', ALLOC_NORMAL); + + + try { + + var ret = Module['_main'](argc, argv, 0); + + + // if we're not running an evented main loop, it's time to exit + exit(ret, /* implicit = */ true); + } + catch(e) { + if (e instanceof ExitStatus) { + // exit() throws this once it's done to make sure execution + // has been stopped completely + return; + } else if (e == 'SimulateInfiniteLoop') { + // running an evented main loop, don't immediately exit + Module['noExitRuntime'] = true; + return; + } else { + if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); + throw e; + } + } finally { + calledMain = true; + } +} + + + + +function run(args) { + args = args || Module['arguments']; + + if (preloadStartTime === null) preloadStartTime = Date.now(); + + if (runDependencies > 0) { + return; + } + + preRun(); + + if (runDependencies > 0) return; // a preRun added a dependency, run will be called later + if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame + + function doRun() { + if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening + Module['calledRun'] = true; + + if (ABORT) return; + + ensureInitRuntime(); + + preMain(); + + + if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); + + if (Module['_main'] && shouldRunNow) Module['callMain'](args); + + postRun(); + } + + if (Module['setStatus']) { + Module['setStatus']('Running...'); + setTimeout(function() { + setTimeout(function() { + Module['setStatus'](''); + }, 1); + doRun(); + }, 1); + } else { + doRun(); + } +} +Module['run'] = Module.run = run; + +function exit(status, implicit) { + if (implicit && Module['noExitRuntime']) { + return; + } + + if (Module['noExitRuntime']) { + } else { + + ABORT = true; + EXITSTATUS = status; + STACKTOP = initialStackTop; + + exitRuntime(); + + if (Module['onExit']) Module['onExit'](status); + } + + if (ENVIRONMENT_IS_NODE) { + // Work around a node.js bug where stdout buffer is not flushed at process exit: + // Instead of process.exit() directly, wait for stdout flush event. + // See https://github.com/joyent/node/issues/1669 and https://github.com/kripken/emscripten/issues/2582 + // Workaround is based on https://github.com/RReverser/acorn/commit/50ab143cecc9ed71a2d66f78b4aec3bb2e9844f6 + process['stdout']['once']('drain', function () { + process['exit'](status); + }); + console.log(' '); // Make sure to print something to force the drain event to occur, in case the stdout buffer was empty. + // Work around another node bug where sometimes 'drain' is never fired - make another effort + // to emit the exit status, after a significant delay (if node hasn't fired drain by then, give up) + setTimeout(function() { + process['exit'](status); + }, 500); + } else + if (ENVIRONMENT_IS_SHELL && typeof quit === 'function') { + quit(status); + } + // if we reach here, we must throw an exception to halt the current execution + throw new ExitStatus(status); +} +Module['exit'] = Module.exit = exit; + +var abortDecorators = []; + +function abort(what) { + if (what !== undefined) { + Module.print(what); + Module.printErr(what); + what = JSON.stringify(what) + } else { + what = ''; + } + + ABORT = true; + EXITSTATUS = 1; + + var extra = '\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.'; + + var output = 'abort(' + what + ') at ' + stackTrace() + extra; + if (abortDecorators) { + abortDecorators.forEach(function(decorator) { + output = decorator(output, what); + }); + } + throw output; +} +Module['abort'] = Module.abort = abort; + +// {{PRE_RUN_ADDITIONS}} + +if (Module['preInit']) { + if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; + while (Module['preInit'].length > 0) { + Module['preInit'].pop()(); + } +} + +// shouldRunNow refers to calling main(), not run(). +var shouldRunNow = true; +if (Module['noInitialRun']) { + shouldRunNow = false; +} + + +run(); + +// {{POST_RUN_ADDITIONS}} + + + + + + +// {{MODULE_ADDITIONS}} + + + |
