switch to vuepress

108 files changed, 21795 insertions, 0 deletions

diff --git a/node_modules/@babel/core/README.md b/node_modules/@babel/core/README.md
new file mode 100644
index 00000000..ec13d84e
--- /dev/null
+++ b/node_modules/@babel/core/README.md
@@ -0,0 +1,250 @@
+# @babel/core
+
+> Babel compiler core.
+
+
+```javascript
+var babel = require("@babel/core");
+import { transform } from "@babel/core";
+import * as babel from "@babel/core";
+```
+
+All transformations will use your local configuration files (`.babelrc` or in `package.json`). See [options](#options) to disable it.
+
+
+## babel.transform(code: string, [options?](#options): Object, callback: Function)
+
+Transforms the passed in `code`. Calling a callback with an object with the generated code,
+source map, and AST.
+
+```js
+babel.transform(code, options, function(err, result) {
+  result; // => { code, map, ast }
+});
+```
+
+**Example**
+
+```js
+babel.transform("code();", options, function(err, result) {
+  result.code;
+  result.map;
+  result.ast;
+});
+```
+
+### Compat Note:
+
+In Babel 6, this method was synchronous and `transformSync` did not exist. For backward-compatibility,
+this function will behave synchronously if no callback is given. If you're starting with Babel 7
+and need synchronous behavior, please use `transformSync` since this backward-compat may be dropped in
+future major versions of Babel.
+
+
+## babel.transformSync(code: string, [options?](#options): Object)
+
+Transforms the passed in `code`. Returning an object with the generated code,
+source map, and AST.
+
+```js
+babel.transformSync(code, options) // => { code, map, ast }
+```
+
+**Example**
+
+```js
+var result = babel.transformSync("code();", options);
+result.code;
+result.map;
+result.ast;
+```
+
+
+## babel.transformFile(filename: string, [options?](#options): Object, callback: Function)
+
+Asynchronously transforms the entire contents of a file.
+
+```js
+babel.transformFile(filename, options, callback)
+```
+
+**Example**
+
+```js
+babel.transformFile("filename.js", options, function (err, result) {
+  result; // => { code, map, ast }
+});
+```
+
+
+## babel.transformFileSync(filename: string, [options?](#options): Object)
+
+Synchronous version of `babel.transformFile`. Returns the transformed contents of
+the `filename`.
+
+```js
+babel.transformFileSync(filename, options) // => { code, map, ast }
+```
+
+**Example**
+
+```js
+babel.transformFileSync("filename.js", options).code;
+```
+
+
+## babel.transformFromAst(ast: Object, code?: string, [options?](#options): Object, callback: Function): FileNode | null
+
+Given an [AST](https://astexplorer.net/), transform it.
+
+```js
+const sourceCode = "if (true) return;";
+const parsedAst = babylon.parse(sourceCode, { allowReturnOutsideFunction: true });
+babel.transformFromAst(parsedAst, sourceCode, options, function(err, result) {
+  const { code, map, ast } = result;
+});
+```
+
+### Compat Note:
+
+In Babel 6, this method was synchronous and `transformFromAstSync` did not exist. For backward-compatibility,
+this function will behave synchronously if no callback is given. If you're starting with Babel 7
+and need synchronous behavior, please use `transformFromAstSync` since this backward-compat may be dropped in
+future major versions of Babel.
+
+
+## babel.transformFromAstSync(ast: Object, code?: string, [options?](#options): Object)
+
+Given an [AST](https://astexplorer.net/), transform it.
+
+```js
+const sourceCode = "if (true) return;";
+const parsedAst = babylon.parse(sourceCode, { allowReturnOutsideFunction: true });
+const { code, map, ast } = babel.transformFromAstSync(parsedAst, sourceCode, options);
+```
+
+## babel.parse(code: string, [options?](#options): Object)
+
+Given some code, parse it using Babel's standard behavior. Referenced presets and
+plugins will be loaded such that optional syntax plugins are automatically
+enabled.
+
+
+## Advanced APIs
+
+Many systems that wrap Babel like to automatically inject plugins and presets,
+or override options. To accomplish this goal, Babel exposes several functions
+that aid in loading the configuration part-way without transforming.
+
+### babel.loadOptions([options?](#options): Object)
+
+Resolve Babel's options fully, resulting in an options object where:
+
+* `opts.plugins` is a full list of `Plugin` instances.
+* `opts.presets` is empty and all presets are flattened into `opts`.
+* It can be safely passed back to Babel. Fields like `babelrc` have been set to 
+  false so that later calls to Babel will not make a second attempt to load
+  config files.
+
+`Plugin` instances aren't meant to be manipulated directly, but often
+callers will serialize this `opts` to JSON to use it as a cache key representing
+the options Babel has received. Caching on this isn't 100% guaranteed to
+invalidate properly, but it is the best we have at the moment.
+
+
+### babel.loadPartialConfig([options?](#options): Object): PartialConfig
+
+To allow systems to easily manipulate and validate a user's config, this function
+resolves the plugins and presets and proceeds no further. The expectation is
+that callers will take the config's `.options`, manipulate it as then see fit
+and pass it back to Babel again.
+
+* `babelrc: string | void` - The path of the `.babelrc` file, if there was one.
+* `babelignore: string | void` - The path of the `.babelignore` file, if there was one.
+* `options: ValidatedOptions` - The partially resolved options, which can be manipulated and passed back to Babel again.
+  * `plugins: Array<ConfigItem>` - See below.
+  * `presets: Array<ConfigItem>` - See below.
+  * It can be safely passed back to Babel. Fields like `babelrc` have been set
+    to false so that later calls to Babel will not make a second attempt to 
+    load config files.
+* `hasFilesystemConfig(): boolean` - Check if the resolved config loaded any settings from the filesystem.
+
+[`ConfigItem`](#configitem-type) instances expose properties to introspect the values, but each
+item should be treated as immutable. If changes are desired, the item should be
+removed from the list and replaced with either a normal Babel config value, or
+with a replacement item created by `babel.createConfigItem`. See that
+function for information about `ConfigItem` fields.
+
+
+### babel.createConfigItem(value: string | {} | Function | [string | {} | Function, {} | void], { dirname?: string, type?: "preset" | "plugin" }): ConfigItem
+
+Allows build tooling to create and cache config items up front. If this function
+is called multiple times for a given plugin, Babel will call the plugin's function itself
+multiple times. If you have a clear set of expected plugins and presets to
+inject, pre-constructing the config items would be recommended.
+
+
+### `ConfigItem` type
+
+Each `ConfigItem` exposes all of the information Babel knows. The fields are:
+
+* `value: {} | Function` - The resolved value of the plugin.
+* `options: {} | void` - The options object passed to the plugin.
+* `dirname: string` - The path that the options are relative to.
+* `name: string | void` - The name that the user gave the plugin instance, e.g. `plugins: [ ['env', {}, 'my-env'] ]` 
+* `file: Object | void` - Information about the plugin's file, if Babel knows it.
+  * `request: string` - The file that the user requested, e.g. `"@babel/env"`
+  * `resolved: string` - The full path of the resolved file, e.g. `"/tmp/node_modules/@babel/preset-env/lib/index.js"`
+
+
+## Options
+
+<blockquote class="babel-callout babel-callout-info">
+  <h4>Babel CLI</h4>
+  <p>
+    You can pass these options from the Babel CLI like so:
+  </p>
+  <p>
+    <code>babel --option-name<span class="o">=</span>value</code>
+  </p>
+</blockquote>
+
+Following is a table of the options you can use:
+
+| Option                   | Default              | Description                     |
+| ------------------------ | -------------------- | ------------------------------- |
+| `ast`                    | `false`              | Include the AST in the returned object |
+| `auxiliaryCommentAfter`  | `null`               | Attach a comment after all non-user injected code |
+| `auxiliaryCommentBefore` | `null`               | Attach a comment before all non-user injected code |
+| `root`                   | `"."`                | Specify the "root" folder that defines the location to search for "babel.config.js", and the default folder to allow `.babelrc` files inside of.|
+| `configFile`             | `undefined`          | The config file to load Babel's config from. Defaults to searching for "babel.config.js" inside the "root" folder. `false` will disable searching for config files.|
+| `babelrc`                | `true`               | Specify whether or not to use .babelrc and .babelignore files. Not available when using the CLI, [use `--no-babelrc` instead](https://babeljs.io/docs/usage/cli/#babel-ignoring-babelrc) |
+| `babelrcRoots`           | `(root)`             | Specify which packages should be search for .babelrc files when they are being compiled. `true` to _always_ search, or a path string or an array of paths to packages to search inside of. Defaults to only searching the "root" package. |
+| `envName`                | env vars             | Defaults to environment variable `BABEL_ENV` if set, or else `NODE_ENV` if set, or else it defaults to `"development"` |
+| `code`                   | `true`               | Enable code generation |
+| `comments`               | `true`               | Output comments in generated output |
+| `compact`                | `"auto"`             | Do not include superfluous whitespace characters and line terminators. When set to `"auto"` compact is set to `true` on input sizes of >500KB |
+| `env`                    | `{}`                 | This is an object of keys that represent different environments. For example, you may have: `{ env: { production: { /* specific options */ } } }` which will use those options when the `envName` is `production` |
+| `extends`                | `null`               | A path to a `.babelrc` file to extend |
+| `filename`               | `"unknown"`          | Filename for use in errors etc |
+| `filenameRelative`       | `(filename)`         | Filename relative to `sourceRoot` |
+| `generatorOpts`          | `{}`                 | An object containing the options to be passed down to the babel code generator, @babel/generator |
+| `getModuleId`            | `null`               | Specify a custom callback to generate a module id with. Called as `getModuleId(moduleName)`. If falsy value is returned then the generated module id is used |
+| `highlightCode`          | `true`               | ANSI highlight syntax error code frames |
+| `ignore`                 | `null`               | Opposite to the `only` option. `ignore` is disregarded if `only` is specified |
+| `inputSourceMap`         | `null`               | A source map object that the output source map will be based on |
+| `minified`               | `false`              | Should the output be minified (not printing last semicolons in blocks, printing literal string values instead of escaped ones, stripping `()` from `new` when safe) |
+| `moduleId`               | `null`               | Specify a custom name for module ids |
+| `moduleIds`              | `false`              | If truthy, insert an explicit id for modules. By default, all modules are anonymous. (Not available for `common` modules) |
+| `moduleRoot`             | `(sourceRoot)`       | Optional prefix for the AMD module formatter that will be prepend to the filename on module definitions |
+| `only`                   | `null`               | A [glob](https://github.com/isaacs/minimatch), regex, or mixed array of both, matching paths to **only** compile. Can also be an array of arrays containing paths to explicitly match. When attempting to compile a non-matching file it's returned verbatim |
+| `parserOpts`             | `{}`                 | An object containing the options to be passed down to the babel parser, babylon |
+| `plugins`                | `[]`                 | List of [plugins](https://babeljs.io/docs/plugins/) to load and use |
+| `presets`                | `[]`                 | List of [presets](https://babeljs.io/docs/plugins/#presets) (a set of plugins) to load and use |
+| `retainLines`            | `false`              | Retain line numbers. This will lead to wacky code but is handy for scenarios where you can't use source maps. (**NOTE:** This will not retain the columns) |
+| `shouldPrintComment`     | `null`               | An optional callback that controls whether a comment should be output or not. Called as `shouldPrintComment(commentContents)`. **NOTE:** This overrides the `comment` option when used |
+| `sourceFileName`         | `(filenameRelative)` | Set `sources[0]` on returned source map |
+| `sourceMaps`             | `false`              | If truthy, adds a `map` property to returned output. If set to `"inline"`, a comment with a sourceMappingURL directive is added to the bottom of the returned code. If set to `"both"` then a `map` property is returned as well as a source map comment appended. **This does not emit sourcemap files by itself!** To have sourcemaps emitted using the CLI, you must pass it the `--source-maps` option |
+| `sourceRoot`             | `(moduleRoot)`       | The root from which all sources are relative |
+| `sourceType`             | `"module"`           | Indicate the mode the code should be parsed in. Can be one of "script", "module", or "unambiguous". `"unambiguous"` will make Babel attempt to _guess_, based on the presence of ES6 `import` or `export` statements. Files with ES6 `import`s and `export`s are considered `"module"` and are otherwise `"script"`. |
+| `wrapPluginVisitorMethod`| `null`               | An optional callback that can be used to wrap visitor methods. **NOTE:** This is useful for things like introspection, and not really needed for implementing anything. Called as `wrapPluginVisitorMethod(pluginAlias, visitorType, callback)`.
diff --git a/node_modules/@babel/core/lib/config/caching.js b/node_modules/@babel/core/lib/config/caching.js
new file mode 100644
index 00000000..d092b2d0
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/caching.js
@@ -0,0 +1,200 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.makeStrongCache = makeStrongCache;
+exports.makeWeakCache = makeWeakCache;
+
+function makeStrongCache(handler) {
+  return makeCachedFunction(new Map(), handler);
+}
+
+function makeWeakCache(handler) {
+  return makeCachedFunction(new WeakMap(), handler);
+}
+
+function makeCachedFunction(callCache, handler) {
+  return function cachedFunction(arg, data) {
+    let cachedValue = callCache.get(arg);
+
+    if (cachedValue) {
+      for (var _iterator = cachedValue, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+        var _ref2;
+
+        if (_isArray) {
+          if (_i >= _iterator.length) break;
+          _ref2 = _iterator[_i++];
+        } else {
+          _i = _iterator.next();
+          if (_i.done) break;
+          _ref2 = _i.value;
+        }
+
+        const _ref = _ref2;
+        const value = _ref.value,
+              valid = _ref.valid;
+        if (valid(data)) return value;
+      }
+    }
+
+    const cache = new CacheConfigurator(data);
+    const value = handler(arg, cache);
+    if (!cache.configured()) cache.forever();
+    cache.deactivate();
+
+    switch (cache.mode()) {
+      case "forever":
+        cachedValue = [{
+          value,
+          valid: () => true
+        }];
+        callCache.set(arg, cachedValue);
+        break;
+
+      case "invalidate":
+        cachedValue = [{
+          value,
+          valid: cache.validator()
+        }];
+        callCache.set(arg, cachedValue);
+        break;
+
+      case "valid":
+        if (cachedValue) {
+          cachedValue.push({
+            value,
+            valid: cache.validator()
+          });
+        } else {
+          cachedValue = [{
+            value,
+            valid: cache.validator()
+          }];
+          callCache.set(arg, cachedValue);
+        }
+
+    }
+
+    return value;
+  };
+}
+
+class CacheConfigurator {
+  constructor(data) {
+    this._active = true;
+    this._never = false;
+    this._forever = false;
+    this._invalidate = false;
+    this._configured = false;
+    this._pairs = [];
+    this._data = data;
+  }
+
+  simple() {
+    return makeSimpleConfigurator(this);
+  }
+
+  mode() {
+    if (this._never) return "never";
+    if (this._forever) return "forever";
+    if (this._invalidate) return "invalidate";
+    return "valid";
+  }
+
+  forever() {
+    if (!this._active) {
+      throw new Error("Cannot change caching after evaluation has completed.");
+    }
+
+    if (this._never) {
+      throw new Error("Caching has already been configured with .never()");
+    }
+
+    this._forever = true;
+    this._configured = true;
+  }
+
+  never() {
+    if (!this._active) {
+      throw new Error("Cannot change caching after evaluation has completed.");
+    }
+
+    if (this._forever) {
+      throw new Error("Caching has already been configured with .forever()");
+    }
+
+    this._never = true;
+    this._configured = true;
+  }
+
+  using(handler) {
+    if (!this._active) {
+      throw new Error("Cannot change caching after evaluation has completed.");
+    }
+
+    if (this._never || this._forever) {
+      throw new Error("Caching has already been configured with .never or .forever()");
+    }
+
+    this._configured = true;
+    const key = handler(this._data);
+
+    this._pairs.push([key, handler]);
+
+    return key;
+  }
+
+  invalidate(handler) {
+    if (!this._active) {
+      throw new Error("Cannot change caching after evaluation has completed.");
+    }
+
+    if (this._never || this._forever) {
+      throw new Error("Caching has already been configured with .never or .forever()");
+    }
+
+    this._invalidate = true;
+    this._configured = true;
+    const key = handler(this._data);
+
+    this._pairs.push([key, handler]);
+
+    return key;
+  }
+
+  validator() {
+    const pairs = this._pairs;
+    return data => pairs.every(([key, fn]) => key === fn(data));
+  }
+
+  deactivate() {
+    this._active = false;
+  }
+
+  configured() {
+    return this._configured;
+  }
+
+}
+
+function makeSimpleConfigurator(cache) {
+  function cacheFn(val) {
+    if (typeof val === "boolean") {
+      if (val) cache.forever();else cache.never();
+      return;
+    }
+
+    return cache.using(val);
+  }
+
+  cacheFn.forever = () => cache.forever();
+
+  cacheFn.never = () => cache.never();
+
+  cacheFn.using = cb => cache.using(() => cb());
+
+  cacheFn.invalidate = cb => cache.invalidate(() => cb());
+
+  return cacheFn;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/config-chain.js b/node_modules/@babel/core/lib/config/config-chain.js
new file mode 100644
index 00000000..22bca2bd
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/config-chain.js
@@ -0,0 +1,487 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.buildRootChain = buildRootChain;
+exports.buildPresetChain = void 0;
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+function _micromatch() {
+  const data = _interopRequireDefault(require("micromatch"));
+
+  _micromatch = function _micromatch() {
+    return data;
+  };
+
+  return data;
+}
+
+function _debug() {
+  const data = _interopRequireDefault(require("debug"));
+
+  _debug = function _debug() {
+    return data;
+  };
+
+  return data;
+}
+
+var _options = require("./validation/options");
+
+var _files = require("./files");
+
+var _caching = require("./caching");
+
+var _configDescriptors = require("./config-descriptors");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const debug = (0, _debug().default)("babel:config:config-chain");
+const buildPresetChain = makeChainWalker({
+  init: arg => arg,
+  root: preset => loadPresetDescriptors(preset),
+  env: (preset, envName) => loadPresetEnvDescriptors(preset)(envName),
+  overrides: (preset, index) => loadPresetOverridesDescriptors(preset)(index),
+  overridesEnv: (preset, index, envName) => loadPresetOverridesEnvDescriptors(preset)(index)(envName)
+});
+exports.buildPresetChain = buildPresetChain;
+const loadPresetDescriptors = (0, _caching.makeWeakCache)(preset => buildRootDescriptors(preset, preset.alias, _configDescriptors.createUncachedDescriptors));
+const loadPresetEnvDescriptors = (0, _caching.makeWeakCache)(preset => (0, _caching.makeStrongCache)(envName => buildEnvDescriptors(preset, preset.alias, _configDescriptors.createUncachedDescriptors, envName)));
+const loadPresetOverridesDescriptors = (0, _caching.makeWeakCache)(preset => (0, _caching.makeStrongCache)(index => buildOverrideDescriptors(preset, preset.alias, _configDescriptors.createUncachedDescriptors, index)));
+const loadPresetOverridesEnvDescriptors = (0, _caching.makeWeakCache)(preset => (0, _caching.makeStrongCache)(index => (0, _caching.makeStrongCache)(envName => buildOverrideEnvDescriptors(preset, preset.alias, _configDescriptors.createUncachedDescriptors, index, envName))));
+
+function buildRootChain(opts, context) {
+  const programmaticChain = loadProgrammaticChain({
+    options: opts,
+    dirname: context.cwd
+  }, context);
+  if (!programmaticChain) return null;
+  const _opts$root = opts.root,
+        rootDir = _opts$root === void 0 ? "." : _opts$root,
+        _opts$configFile = opts.configFile,
+        configFileName = _opts$configFile === void 0 ? true : _opts$configFile;
+  let babelrc = opts.babelrc,
+      babelrcRoots = opts.babelrcRoots;
+
+  const absoluteRoot = _path().default.resolve(context.cwd, rootDir);
+
+  let configFile;
+
+  if (typeof configFileName === "string") {
+    configFile = (0, _files.loadConfig)(configFileName, context.cwd, context.envName);
+  } else if (configFileName === true) {
+    configFile = (0, _files.findRootConfig)(absoluteRoot, context.envName);
+  }
+
+  const configFileChain = emptyChain();
+
+  if (configFile) {
+    const validatedFile = validateConfigFile(configFile);
+    const result = loadFileChain(validatedFile, context);
+    if (!result) return null;
+
+    if (babelrc === undefined) {
+      babelrc = validatedFile.options.babelrc;
+    }
+
+    if (babelrcRoots === undefined) {
+      babelrcRoots = validatedFile.options.babelrcRoots;
+    }
+
+    mergeChain(configFileChain, result);
+  }
+
+  const pkgData = typeof context.filename === "string" ? (0, _files.findPackageData)(context.filename) : null;
+  let ignoreFile, babelrcFile;
+  const fileChain = emptyChain();
+
+  if ((babelrc === true || babelrc === undefined) && pkgData && babelrcLoadEnabled(context, pkgData, babelrcRoots, absoluteRoot)) {
+    var _findRelativeConfig = (0, _files.findRelativeConfig)(pkgData, context.envName);
+
+    ignoreFile = _findRelativeConfig.ignore;
+    babelrcFile = _findRelativeConfig.config;
+
+    if (ignoreFile && shouldIgnore(context, ignoreFile.ignore, null, ignoreFile.dirname)) {
+      return null;
+    }
+
+    if (babelrcFile) {
+      const result = loadFileChain(validateBabelrcFile(babelrcFile), context);
+      if (!result) return null;
+      mergeChain(fileChain, result);
+    }
+  }
+
+  const chain = mergeChain(mergeChain(mergeChain(emptyChain(), configFileChain), fileChain), programmaticChain);
+  return {
+    plugins: dedupDescriptors(chain.plugins),
+    presets: dedupDescriptors(chain.presets),
+    options: chain.options.map(o => normalizeOptions(o)),
+    ignore: ignoreFile || undefined,
+    babelrc: babelrcFile || undefined,
+    config: configFile || undefined
+  };
+}
+
+function babelrcLoadEnabled(context, pkgData, babelrcRoots, absoluteRoot) {
+  if (typeof babelrcRoots === "boolean") return babelrcRoots;
+
+  if (babelrcRoots === undefined) {
+    return pkgData.directories.indexOf(absoluteRoot) !== -1;
+  }
+
+  let babelrcPatterns = babelrcRoots;
+  if (!Array.isArray(babelrcPatterns)) babelrcPatterns = [babelrcPatterns];
+  babelrcPatterns = babelrcPatterns.map(pat => _path().default.resolve(context.cwd, pat));
+
+  if (babelrcPatterns.length === 1 && babelrcPatterns[0] === absoluteRoot) {
+    return pkgData.directories.indexOf(absoluteRoot) !== -1;
+  }
+
+  return (0, _micromatch().default)(pkgData.directories, babelrcPatterns).length > 0;
+}
+
+const validateConfigFile = (0, _caching.makeWeakCache)(file => ({
+  filepath: file.filepath,
+  dirname: file.dirname,
+  options: (0, _options.validate)("configfile", file.options)
+}));
+const validateBabelrcFile = (0, _caching.makeWeakCache)(file => ({
+  filepath: file.filepath,
+  dirname: file.dirname,
+  options: (0, _options.validate)("babelrcfile", file.options)
+}));
+const validateExtendFile = (0, _caching.makeWeakCache)(file => ({
+  filepath: file.filepath,
+  dirname: file.dirname,
+  options: (0, _options.validate)("extendsfile", file.options)
+}));
+const loadProgrammaticChain = makeChainWalker({
+  root: input => buildRootDescriptors(input, "base", _configDescriptors.createCachedDescriptors),
+  env: (input, envName) => buildEnvDescriptors(input, "base", _configDescriptors.createCachedDescriptors, envName),
+  overrides: (input, index) => buildOverrideDescriptors(input, "base", _configDescriptors.createCachedDescriptors, index),
+  overridesEnv: (input, index, envName) => buildOverrideEnvDescriptors(input, "base", _configDescriptors.createCachedDescriptors, index, envName)
+});
+const loadFileChain = makeChainWalker({
+  root: file => loadFileDescriptors(file),
+  env: (file, envName) => loadFileEnvDescriptors(file)(envName),
+  overrides: (file, index) => loadFileOverridesDescriptors(file)(index),
+  overridesEnv: (file, index, envName) => loadFileOverridesEnvDescriptors(file)(index)(envName)
+});
+const loadFileDescriptors = (0, _caching.makeWeakCache)(file => buildRootDescriptors(file, file.filepath, _configDescriptors.createUncachedDescriptors));
+const loadFileEnvDescriptors = (0, _caching.makeWeakCache)(file => (0, _caching.makeStrongCache)(envName => buildEnvDescriptors(file, file.filepath, _configDescriptors.createUncachedDescriptors, envName)));
+const loadFileOverridesDescriptors = (0, _caching.makeWeakCache)(file => (0, _caching.makeStrongCache)(index => buildOverrideDescriptors(file, file.filepath, _configDescriptors.createUncachedDescriptors, index)));
+const loadFileOverridesEnvDescriptors = (0, _caching.makeWeakCache)(file => (0, _caching.makeStrongCache)(index => (0, _caching.makeStrongCache)(envName => buildOverrideEnvDescriptors(file, file.filepath, _configDescriptors.createUncachedDescriptors, index, envName))));
+
+function buildRootDescriptors({
+  dirname,
+  options
+}, alias, descriptors) {
+  return descriptors(dirname, options, alias);
+}
+
+function buildEnvDescriptors({
+  dirname,
+  options
+}, alias, descriptors, envName) {
+  const opts = options.env && options.env[envName];
+  return opts ? descriptors(dirname, opts, `${alias}.env["${envName}"]`) : null;
+}
+
+function buildOverrideDescriptors({
+  dirname,
+  options
+}, alias, descriptors, index) {
+  const opts = options.overrides && options.overrides[index];
+  if (!opts) throw new Error("Assertion failure - missing override");
+  return descriptors(dirname, opts, `${alias}.overrides[${index}]`);
+}
+
+function buildOverrideEnvDescriptors({
+  dirname,
+  options
+}, alias, descriptors, index, envName) {
+  const override = options.overrides && options.overrides[index];
+  if (!override) throw new Error("Assertion failure - missing override");
+  const opts = override.env && override.env[envName];
+  return opts ? descriptors(dirname, opts, `${alias}.overrides[${index}].env["${envName}"]`) : null;
+}
+
+function makeChainWalker({
+  root,
+  env,
+  overrides,
+  overridesEnv
+}) {
+  return (input, context, files = new Set()) => {
+    const dirname = input.dirname;
+    const flattenedConfigs = [];
+    const rootOpts = root(input);
+
+    if (configIsApplicable(rootOpts, dirname, context)) {
+      flattenedConfigs.push(rootOpts);
+      const envOpts = env(input, context.envName);
+
+      if (envOpts && configIsApplicable(envOpts, dirname, context)) {
+        flattenedConfigs.push(envOpts);
+      }
+
+      (rootOpts.options.overrides || []).forEach((_, index) => {
+        const overrideOps = overrides(input, index);
+
+        if (configIsApplicable(overrideOps, dirname, context)) {
+          flattenedConfigs.push(overrideOps);
+          const overrideEnvOpts = overridesEnv(input, index, context.envName);
+
+          if (overrideEnvOpts && configIsApplicable(overrideEnvOpts, dirname, context)) {
+            flattenedConfigs.push(overrideEnvOpts);
+          }
+        }
+      });
+    }
+
+    if (flattenedConfigs.some(({
+      options: {
+        ignore,
+        only
+      }
+    }) => shouldIgnore(context, ignore, only, dirname))) {
+      return null;
+    }
+
+    const chain = emptyChain();
+
+    for (var _i = 0; _i < flattenedConfigs.length; _i++) {
+      const op = flattenedConfigs[_i];
+
+      if (!mergeExtendsChain(chain, op.options, dirname, context, files)) {
+        return null;
+      }
+
+      mergeChainOpts(chain, op);
+    }
+
+    return chain;
+  };
+}
+
+function mergeExtendsChain(chain, opts, dirname, context, files) {
+  if (opts.extends === undefined) return true;
+  const file = (0, _files.loadConfig)(opts.extends, dirname, context.envName);
+
+  if (files.has(file)) {
+    throw new Error(`Configuration cycle detected loading ${file.filepath}.\n` + `File already loaded following the config chain:\n` + Array.from(files, file => ` - ${file.filepath}`).join("\n"));
+  }
+
+  files.add(file);
+  const fileChain = loadFileChain(validateExtendFile(file), context, files);
+  files.delete(file);
+  if (!fileChain) return false;
+  mergeChain(chain, fileChain);
+  return true;
+}
+
+function mergeChain(target, source) {
+  target.options.push(...source.options);
+  target.plugins.push(...source.plugins);
+  target.presets.push(...source.presets);
+  return target;
+}
+
+function mergeChainOpts(target, {
+  options,
+  plugins,
+  presets
+}) {
+  target.options.push(options);
+  target.plugins.push(...plugins());
+  target.presets.push(...presets());
+  return target;
+}
+
+function emptyChain() {
+  return {
+    options: [],
+    presets: [],
+    plugins: []
+  };
+}
+
+function normalizeOptions(opts) {
+  const options = Object.assign({}, opts);
+  delete options.extends;
+  delete options.env;
+  delete options.plugins;
+  delete options.presets;
+  delete options.passPerPreset;
+  delete options.ignore;
+  delete options.only;
+
+  if (options.sourceMap) {
+    options.sourceMaps = options.sourceMap;
+    delete options.sourceMap;
+  }
+
+  return options;
+}
+
+function dedupDescriptors(items) {
+  const map = new Map();
+  const descriptors = [];
+
+  for (var _iterator = items, _isArray = Array.isArray(_iterator), _i2 = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref;
+
+    if (_isArray) {
+      if (_i2 >= _iterator.length) break;
+      _ref = _iterator[_i2++];
+    } else {
+      _i2 = _iterator.next();
+      if (_i2.done) break;
+      _ref = _i2.value;
+    }
+
+    const item = _ref;
+
+    if (typeof item.value === "function") {
+      const fnKey = item.value;
+      let nameMap = map.get(fnKey);
+
+      if (!nameMap) {
+        nameMap = new Map();
+        map.set(fnKey, nameMap);
+      }
+
+      let desc = nameMap.get(item.name);
+
+      if (!desc) {
+        desc = {
+          value: null
+        };
+        descriptors.push(desc);
+        if (!item.ownPass) nameMap.set(item.name, desc);
+      }
+
+      if (item.options === false) {
+        desc.value = null;
+      } else {
+        desc.value = item;
+      }
+    } else {
+      descriptors.push({
+        value: item
+      });
+    }
+  }
+
+  return descriptors.reduce((acc, desc) => {
+    if (desc.value) acc.push(desc.value);
+    return acc;
+  }, []);
+}
+
+function configIsApplicable({
+  options
+}, dirname, context) {
+  return (options.test === undefined || configFieldIsApplicable(context, options.test, dirname)) && (options.include === undefined || configFieldIsApplicable(context, options.include, dirname)) && (options.exclude === undefined || !configFieldIsApplicable(context, options.exclude, dirname));
+}
+
+function configFieldIsApplicable(context, test, dirname) {
+  if (context.filename === null) {
+    throw new Error(`Configuration contains explicit test/include/exclude checks, but no filename was passed to Babel`);
+  }
+
+  const ctx = context;
+  const patterns = Array.isArray(test) ? test : [test];
+  return matchesPatterns(ctx, patterns, dirname, false);
+}
+
+function shouldIgnore(context, ignore, only, dirname) {
+  if (ignore) {
+    if (context.filename === null) {
+      throw new Error(`Configuration contains ignore checks, but no filename was passed to Babel`);
+    }
+
+    const ctx = context;
+
+    if (matchesPatterns(ctx, ignore, dirname)) {
+      debug("Ignored %o because it matched one of %O from %o", context.filename, ignore, dirname);
+      return true;
+    }
+  }
+
+  if (only) {
+    if (context.filename === null) {
+      throw new Error(`Configuration contains ignore checks, but no filename was passed to Babel`);
+    }
+
+    const ctx = context;
+
+    if (!matchesPatterns(ctx, only, dirname)) {
+      debug("Ignored %o because it failed to match one of %O from %o", context.filename, only, dirname);
+      return true;
+    }
+  }
+
+  return false;
+}
+
+function matchesPatterns(context, patterns, dirname, allowNegation = true) {
+  const res = [];
+  const strings = [];
+  const fns = [];
+  patterns.forEach(pattern => {
+    if (typeof pattern === "string") strings.push(pattern);else if (typeof pattern === "function") fns.push(pattern);else res.push(pattern);
+  });
+  const filename = context.filename;
+  if (res.some(re => re.test(context.filename))) return true;
+  if (fns.some(fn => fn(filename))) return true;
+
+  if (strings.length > 0) {
+    const possibleDirs = getPossibleDirs(context);
+    const absolutePatterns = strings.map(pattern => {
+      const negate = pattern[0] === "!";
+
+      if (negate && !allowNegation) {
+        throw new Error(`Negation of file paths is not supported.`);
+      }
+
+      if (negate) pattern = pattern.slice(1);
+      return (negate ? "!" : "") + _path().default.resolve(dirname, pattern);
+    });
+
+    if ((0, _micromatch().default)(possibleDirs, absolutePatterns, {
+      nocase: true,
+      nonegate: !allowNegation
+    }).length > 0) {
+      return true;
+    }
+  }
+
+  return false;
+}
+
+const getPossibleDirs = (0, _caching.makeWeakCache)(context => {
+  let current = context.filename;
+  if (current === null) return [];
+  const possibleDirs = [current];
+
+  while (true) {
+    const previous = current;
+    current = _path().default.dirname(current);
+    if (previous === current) break;
+    possibleDirs.push(current);
+  }
+
+  return possibleDirs;
+});
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/config-descriptors.js b/node_modules/@babel/core/lib/config/config-descriptors.js
new file mode 100644
index 00000000..c4373f8b
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/config-descriptors.js
@@ -0,0 +1,206 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.createCachedDescriptors = createCachedDescriptors;
+exports.createUncachedDescriptors = createUncachedDescriptors;
+exports.createDescriptor = createDescriptor;
+
+var _files = require("./files");
+
+var _item = require("./item");
+
+var _caching = require("./caching");
+
+function createCachedDescriptors(dirname, options, alias) {
+  const plugins = options.plugins,
+        presets = options.presets,
+        passPerPreset = options.passPerPreset;
+  return {
+    options,
+    plugins: plugins ? () => createCachedPluginDescriptors(plugins, dirname)(alias) : () => [],
+    presets: presets ? () => createCachedPresetDescriptors(presets, dirname)(alias)(!!passPerPreset) : () => []
+  };
+}
+
+function createUncachedDescriptors(dirname, options, alias) {
+  let plugins;
+  let presets;
+  return {
+    options,
+    plugins: function (_plugins) {
+      function plugins() {
+        return _plugins.apply(this, arguments);
+      }
+
+      plugins.toString = function () {
+        return _plugins.toString();
+      };
+
+      return plugins;
+    }(() => {
+      if (!plugins) {
+        plugins = createPluginDescriptors(options.plugins || [], dirname, alias);
+      }
+
+      return plugins;
+    }),
+    presets: function (_presets) {
+      function presets() {
+        return _presets.apply(this, arguments);
+      }
+
+      presets.toString = function () {
+        return _presets.toString();
+      };
+
+      return presets;
+    }(() => {
+      if (!presets) {
+        presets = createPresetDescriptors(options.presets || [], dirname, alias, !!options.passPerPreset);
+      }
+
+      return presets;
+    })
+  };
+}
+
+const createCachedPresetDescriptors = (0, _caching.makeWeakCache)((items, cache) => {
+  const dirname = cache.using(dir => dir);
+  return (0, _caching.makeStrongCache)(alias => (0, _caching.makeStrongCache)(passPerPreset => createPresetDescriptors(items, dirname, alias, passPerPreset)));
+});
+const createCachedPluginDescriptors = (0, _caching.makeWeakCache)((items, cache) => {
+  const dirname = cache.using(dir => dir);
+  return (0, _caching.makeStrongCache)(alias => createPluginDescriptors(items, dirname, alias));
+});
+
+function createPresetDescriptors(items, dirname, alias, passPerPreset) {
+  return createDescriptors("preset", items, dirname, alias, passPerPreset);
+}
+
+function createPluginDescriptors(items, dirname, alias) {
+  return createDescriptors("plugin", items, dirname, alias);
+}
+
+function createDescriptors(type, items, dirname, alias, ownPass) {
+  const descriptors = items.map((item, index) => createDescriptor(item, dirname, {
+    type,
+    alias: `${alias}$${index}`,
+    ownPass: !!ownPass
+  }));
+  assertNoDuplicates(descriptors);
+  return descriptors;
+}
+
+function createDescriptor(pair, dirname, {
+  type,
+  alias,
+  ownPass
+}) {
+  const desc = (0, _item.getItemDescriptor)(pair);
+
+  if (desc) {
+    return desc;
+  }
+
+  let name;
+  let options;
+  let value = pair;
+
+  if (Array.isArray(value)) {
+    if (value.length === 3) {
+      var _value = value;
+      value = _value[0];
+      options = _value[1];
+      name = _value[2];
+    } else {
+      var _value2 = value;
+      value = _value2[0];
+      options = _value2[1];
+    }
+  }
+
+  let file = undefined;
+  let filepath = null;
+
+  if (typeof value === "string") {
+    if (typeof type !== "string") {
+      throw new Error("To resolve a string-based item, the type of item must be given");
+    }
+
+    const resolver = type === "plugin" ? _files.loadPlugin : _files.loadPreset;
+    const request = value;
+
+    var _resolver = resolver(value, dirname);
+
+    filepath = _resolver.filepath;
+    value = _resolver.value;
+    file = {
+      request,
+      resolved: filepath
+    };
+  }
+
+  if (!value) {
+    throw new Error(`Unexpected falsy value: ${String(value)}`);
+  }
+
+  if (typeof value === "object" && value.__esModule) {
+    if (value.default) {
+      value = value.default;
+    } else {
+      throw new Error("Must export a default export when using ES6 modules.");
+    }
+  }
+
+  if (typeof value !== "object" && typeof value !== "function") {
+    throw new Error(`Unsupported format: ${typeof value}. Expected an object or a function.`);
+  }
+
+  if (filepath !== null && typeof value === "object" && value) {
+    throw new Error(`Plugin/Preset files are not allowed to export objects, only functions. In ${filepath}`);
+  }
+
+  return {
+    name,
+    alias: filepath || alias,
+    value,
+    options,
+    dirname,
+    ownPass,
+    file
+  };
+}
+
+function assertNoDuplicates(items) {
+  const map = new Map();
+
+  for (var _iterator = items, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref;
+
+    if (_isArray) {
+      if (_i >= _iterator.length) break;
+      _ref = _iterator[_i++];
+    } else {
+      _i = _iterator.next();
+      if (_i.done) break;
+      _ref = _i.value;
+    }
+
+    const item = _ref;
+    if (typeof item.value !== "function") continue;
+    let nameMap = map.get(item.value);
+
+    if (!nameMap) {
+      nameMap = new Set();
+      map.set(item.value, nameMap);
+    }
+
+    if (nameMap.has(item.name)) {
+      throw new Error([`Duplicate plugin/preset detected.`, `If you'd like to use two separate instances of a plugin,`, `they neen separate names, e.g.`, ``, `  plugins: [`, `    ['some-plugin', {}],`, `    ['some-plugin', {}, 'some unique name'],`, `  ]`].join("\n"));
+    }
+
+    nameMap.add(item.name);
+  }
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/configuration.js b/node_modules/@babel/core/lib/config/files/configuration.js
new file mode 100644
index 00000000..e0667159
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/configuration.js
@@ -0,0 +1,306 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.findRelativeConfig = findRelativeConfig;
+exports.findRootConfig = findRootConfig;
+exports.loadConfig = loadConfig;
+
+function _debug() {
+  const data = _interopRequireDefault(require("debug"));
+
+  _debug = function _debug() {
+    return data;
+  };
+
+  return data;
+}
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+function _fs() {
+  const data = _interopRequireDefault(require("fs"));
+
+  _fs = function _fs() {
+    return data;
+  };
+
+  return data;
+}
+
+function _json() {
+  const data = _interopRequireDefault(require("json5"));
+
+  _json = function _json() {
+    return data;
+  };
+
+  return data;
+}
+
+function _resolve() {
+  const data = _interopRequireDefault(require("resolve"));
+
+  _resolve = function _resolve() {
+    return data;
+  };
+
+  return data;
+}
+
+var _caching = require("../caching");
+
+var _configApi = _interopRequireDefault(require("../helpers/config-api"));
+
+var _utils = require("./utils");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const debug = (0, _debug().default)("babel:config:loading:files:configuration");
+const BABEL_CONFIG_JS_FILENAME = "babel.config.js";
+const BABELRC_FILENAME = ".babelrc";
+const BABELRC_JS_FILENAME = ".babelrc.js";
+const BABELIGNORE_FILENAME = ".babelignore";
+
+function findRelativeConfig(packageData, envName) {
+  let config = null;
+  let ignore = null;
+
+  const dirname = _path().default.dirname(packageData.filepath);
+
+  for (var _iterator = packageData.directories, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref;
+
+    if (_isArray) {
+      if (_i >= _iterator.length) break;
+      _ref = _iterator[_i++];
+    } else {
+      _i = _iterator.next();
+      if (_i.done) break;
+      _ref = _i.value;
+    }
+
+    const loc = _ref;
+
+    if (!config) {
+      config = [BABELRC_FILENAME, BABELRC_JS_FILENAME].reduce((previousConfig, name) => {
+        const filepath = _path().default.join(loc, name);
+
+        const config = readConfig(filepath, envName);
+
+        if (config && previousConfig) {
+          throw new Error(`Multiple configuration files found. Please remove one:\n` + ` - ${_path().default.basename(previousConfig.filepath)}\n` + ` - ${name}\n` + `from ${loc}`);
+        }
+
+        return config || previousConfig;
+      }, null);
+      const pkgConfig = packageData.pkg && packageData.pkg.dirname === loc ? packageToBabelConfig(packageData.pkg) : null;
+
+      if (pkgConfig) {
+        if (config) {
+          throw new Error(`Multiple configuration files found. Please remove one:\n` + ` - ${_path().default.basename(pkgConfig.filepath)}#babel\n` + ` - ${_path().default.basename(config.filepath)}\n` + `from ${loc}`);
+        }
+
+        config = pkgConfig;
+      }
+
+      if (config) {
+        debug("Found configuration %o from %o.", config.filepath, dirname);
+      }
+    }
+
+    if (!ignore) {
+      const ignoreLoc = _path().default.join(loc, BABELIGNORE_FILENAME);
+
+      ignore = readIgnoreConfig(ignoreLoc);
+
+      if (ignore) {
+        debug("Found ignore %o from %o.", ignore.filepath, dirname);
+      }
+    }
+  }
+
+  return {
+    config,
+    ignore
+  };
+}
+
+function findRootConfig(dirname, envName) {
+  const filepath = _path().default.resolve(dirname, BABEL_CONFIG_JS_FILENAME);
+
+  const conf = readConfig(filepath, envName);
+
+  if (conf) {
+    debug("Found root config %o in $o.", BABEL_CONFIG_JS_FILENAME, dirname);
+  }
+
+  return conf;
+}
+
+function loadConfig(name, dirname, envName) {
+  const filepath = _resolve().default.sync(name, {
+    basedir: dirname
+  });
+
+  const conf = readConfig(filepath, envName);
+
+  if (!conf) {
+    throw new Error(`Config file ${filepath} contains no configuration data`);
+  }
+
+  debug("Loaded config %o from $o.", name, dirname);
+  return conf;
+}
+
+function readConfig(filepath, envName) {
+  return _path().default.extname(filepath) === ".js" ? readConfigJS(filepath, {
+    envName
+  }) : readConfigJSON5(filepath);
+}
+
+const LOADING_CONFIGS = new Set();
+const readConfigJS = (0, _caching.makeStrongCache)((filepath, cache) => {
+  if (!_fs().default.existsSync(filepath)) {
+    cache.forever();
+    return null;
+  }
+
+  if (LOADING_CONFIGS.has(filepath)) {
+    cache.never();
+    debug("Auto-ignoring usage of config %o.", filepath);
+    return {
+      filepath,
+      dirname: _path().default.dirname(filepath),
+      options: {}
+    };
+  }
+
+  let options;
+
+  try {
+    LOADING_CONFIGS.add(filepath);
+
+    const configModule = require(filepath);
+
+    options = configModule && configModule.__esModule ? configModule.default || undefined : configModule;
+  } catch (err) {
+    err.message = `${filepath}: Error while loading config - ${err.message}`;
+    throw err;
+  } finally {
+    LOADING_CONFIGS.delete(filepath);
+  }
+
+  if (typeof options === "function") {
+    options = options((0, _configApi.default)(cache));
+    if (!cache.configured()) throwConfigError();
+  }
+
+  if (!options || typeof options !== "object" || Array.isArray(options)) {
+    throw new Error(`${filepath}: Configuration should be an exported JavaScript object.`);
+  }
+
+  if (typeof options.then === "function") {
+    throw new Error(`You appear to be using an async configuration, ` + `which your current version of Babel does not support. ` + `We may add support for this in the future, ` + `but if you're on the most recent version of @babel/core and still ` + `seeing this error, then you'll need to synchronously return your config.`);
+  }
+
+  return {
+    filepath,
+    dirname: _path().default.dirname(filepath),
+    options
+  };
+});
+const packageToBabelConfig = (0, _caching.makeWeakCache)(file => {
+  if (typeof file.options.babel === "undefined") return null;
+  const babel = file.options.babel;
+
+  if (typeof babel !== "object" || Array.isArray(babel) || babel === null) {
+    throw new Error(`${file.filepath}: .babel property must be an object`);
+  }
+
+  return {
+    filepath: file.filepath,
+    dirname: file.dirname,
+    options: babel
+  };
+});
+const readConfigJSON5 = (0, _utils.makeStaticFileCache)((filepath, content) => {
+  let options;
+
+  try {
+    options = _json().default.parse(content);
+  } catch (err) {
+    err.message = `${filepath}: Error while parsing config - ${err.message}`;
+    throw err;
+  }
+
+  if (!options) throw new Error(`${filepath}: No config detected`);
+
+  if (typeof options !== "object") {
+    throw new Error(`${filepath}: Config returned typeof ${typeof options}`);
+  }
+
+  if (Array.isArray(options)) {
+    throw new Error(`${filepath}: Expected config object but found array`);
+  }
+
+  return {
+    filepath,
+    dirname: _path().default.dirname(filepath),
+    options
+  };
+});
+const readIgnoreConfig = (0, _utils.makeStaticFileCache)((filepath, content) => {
+  const ignore = content.split("\n").map(line => line.replace(/#(.*?)$/, "").trim()).filter(line => !!line);
+  return {
+    filepath,
+    dirname: _path().default.dirname(filepath),
+    ignore
+  };
+});
+
+function throwConfigError() {
+  throw new Error(`\
+Caching was left unconfigured. Babel's plugins, presets, and .babelrc.js files can be configured
+for various types of caching, using the first param of their handler functions:
+
+module.exports = function(api) {
+  // The API exposes the following:
+
+  // Cache the returned value forever and don't call this function again.
+  api.cache(true);
+
+  // Don't cache at all. Not recommended because it will be very slow.
+  api.cache(false);
+
+  // Cached based on the value of some function. If this function returns a value different from
+  // a previously-encountered value, the plugins will re-evaluate.
+  var env = api.cache(() => process.env.NODE_ENV);
+
+  // If testing for a specific env, we recommend specifics to avoid instantiating a plugin for
+  // any possible NODE_ENV value that might come up during plugin execution.
+  var isProd = api.cache(() => process.env.NODE_ENV === "production");
+
+  // .cache(fn) will perform a linear search though instances to find the matching plugin based
+  // based on previous instantiated plugins. If you want to recreate the plugin and discard the
+  // previous instance whenever something changes, you may use:
+  var isProd = api.cache.invalidate(() => process.env.NODE_ENV === "production");
+
+  // Note, we also expose the following more-verbose versions of the above examples:
+  api.cache.forever(); // api.cache(true)
+  api.cache.never();   // api.cache(false)
+  api.cache.using(fn); // api.cache(fn)
+
+  // Return the value that will be cached.
+  return { };
+};`);
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/index-browser.js b/node_modules/@babel/core/lib/config/files/index-browser.js
new file mode 100644
index 00000000..4f0174ee
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/index-browser.js
@@ -0,0 +1,54 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.findPackageData = findPackageData;
+exports.findRelativeConfig = findRelativeConfig;
+exports.findRootConfig = findRootConfig;
+exports.loadConfig = loadConfig;
+exports.resolvePlugin = resolvePlugin;
+exports.resolvePreset = resolvePreset;
+exports.loadPlugin = loadPlugin;
+exports.loadPreset = loadPreset;
+
+function findPackageData(filepath) {
+  return {
+    filepath,
+    directories: [],
+    pkg: null,
+    isPackage: false
+  };
+}
+
+function findRelativeConfig(pkgData, envName) {
+  return {
+    pkg: null,
+    config: null,
+    ignore: null
+  };
+}
+
+function findRootConfig(dirname, envName) {
+  return null;
+}
+
+function loadConfig(name, dirname, envName) {
+  throw new Error(`Cannot load ${name} relative to ${dirname} in a browser`);
+}
+
+function resolvePlugin(name, dirname) {
+  return null;
+}
+
+function resolvePreset(name, dirname) {
+  return null;
+}
+
+function loadPlugin(name, dirname) {
+  throw new Error(`Cannot load plugin ${name} relative to ${dirname} in a browser`);
+}
+
+function loadPreset(name, dirname) {
+  throw new Error(`Cannot load preset ${name} relative to ${dirname} in a browser`);
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/index.js b/node_modules/@babel/core/lib/config/files/index.js
new file mode 100644
index 00000000..25c3008b
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/index.js
@@ -0,0 +1,61 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+Object.defineProperty(exports, "findPackageData", {
+  enumerable: true,
+  get: function get() {
+    return _package.findPackageData;
+  }
+});
+Object.defineProperty(exports, "findRelativeConfig", {
+  enumerable: true,
+  get: function get() {
+    return _configuration.findRelativeConfig;
+  }
+});
+Object.defineProperty(exports, "findRootConfig", {
+  enumerable: true,
+  get: function get() {
+    return _configuration.findRootConfig;
+  }
+});
+Object.defineProperty(exports, "loadConfig", {
+  enumerable: true,
+  get: function get() {
+    return _configuration.loadConfig;
+  }
+});
+Object.defineProperty(exports, "resolvePlugin", {
+  enumerable: true,
+  get: function get() {
+    return _plugins.resolvePlugin;
+  }
+});
+Object.defineProperty(exports, "resolvePreset", {
+  enumerable: true,
+  get: function get() {
+    return _plugins.resolvePreset;
+  }
+});
+Object.defineProperty(exports, "loadPlugin", {
+  enumerable: true,
+  get: function get() {
+    return _plugins.loadPlugin;
+  }
+});
+Object.defineProperty(exports, "loadPreset", {
+  enumerable: true,
+  get: function get() {
+    return _plugins.loadPreset;
+  }
+});
+
+var _package = require("./package");
+
+var _configuration = require("./configuration");
+
+var _plugins = require("./plugins");
+
+({});
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/package.js b/node_modules/@babel/core/lib/config/files/package.js
new file mode 100644
index 00000000..4557b8ab
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/package.js
@@ -0,0 +1,76 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.findPackageData = findPackageData;
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+var _utils = require("./utils");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const PACKAGE_FILENAME = "package.json";
+
+function findPackageData(filepath) {
+  let pkg = null;
+  const directories = [];
+  let isPackage = true;
+
+  let dirname = _path().default.dirname(filepath);
+
+  while (!pkg && _path().default.basename(dirname) !== "node_modules") {
+    directories.push(dirname);
+    pkg = readConfigPackage(_path().default.join(dirname, PACKAGE_FILENAME));
+
+    const nextLoc = _path().default.dirname(dirname);
+
+    if (dirname === nextLoc) {
+      isPackage = false;
+      break;
+    }
+
+    dirname = nextLoc;
+  }
+
+  return {
+    filepath,
+    directories,
+    pkg,
+    isPackage
+  };
+}
+
+const readConfigPackage = (0, _utils.makeStaticFileCache)((filepath, content) => {
+  let options;
+
+  try {
+    options = JSON.parse(content);
+  } catch (err) {
+    err.message = `${filepath}: Error while parsing JSON - ${err.message}`;
+    throw err;
+  }
+
+  if (typeof options !== "object") {
+    throw new Error(`${filepath}: Config returned typeof ${typeof options}`);
+  }
+
+  if (Array.isArray(options)) {
+    throw new Error(`${filepath}: Expected config object but found array`);
+  }
+
+  return {
+    filepath,
+    dirname: _path().default.dirname(filepath),
+    options
+  };
+});
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/plugins.js b/node_modules/@babel/core/lib/config/files/plugins.js
new file mode 100644
index 00000000..e771dbe6
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/plugins.js
@@ -0,0 +1,168 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.resolvePlugin = resolvePlugin;
+exports.resolvePreset = resolvePreset;
+exports.loadPlugin = loadPlugin;
+exports.loadPreset = loadPreset;
+
+function _debug() {
+  const data = _interopRequireDefault(require("debug"));
+
+  _debug = function _debug() {
+    return data;
+  };
+
+  return data;
+}
+
+function _resolve() {
+  const data = _interopRequireDefault(require("resolve"));
+
+  _resolve = function _resolve() {
+    return data;
+  };
+
+  return data;
+}
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const debug = (0, _debug().default)("babel:config:loading:files:plugins");
+const EXACT_RE = /^module:/;
+const BABEL_PLUGIN_PREFIX_RE = /^(?!@|module:|[^/]+\/|babel-plugin-)/;
+const BABEL_PRESET_PREFIX_RE = /^(?!@|module:|[^/]+\/|babel-preset-)/;
+const BABEL_PLUGIN_ORG_RE = /^(@babel\/)(?!plugin-|[^/]+\/)/;
+const BABEL_PRESET_ORG_RE = /^(@babel\/)(?!preset-|[^/]+\/)/;
+const OTHER_PLUGIN_ORG_RE = /^(@(?!babel\/)[^/]+\/)(?!babel-plugin-|[^/]+\/)/;
+const OTHER_PRESET_ORG_RE = /^(@(?!babel\/)[^/]+\/)(?!babel-preset-|[^/]+\/)/;
+
+function resolvePlugin(name, dirname) {
+  return resolveStandardizedName("plugin", name, dirname);
+}
+
+function resolvePreset(name, dirname) {
+  return resolveStandardizedName("preset", name, dirname);
+}
+
+function loadPlugin(name, dirname) {
+  const filepath = resolvePlugin(name, dirname);
+
+  if (!filepath) {
+    throw new Error(`Plugin ${name} not found relative to ${dirname}`);
+  }
+
+  const value = requireModule("plugin", filepath);
+  debug("Loaded plugin %o from %o.", name, dirname);
+  return {
+    filepath,
+    value
+  };
+}
+
+function loadPreset(name, dirname) {
+  const filepath = resolvePreset(name, dirname);
+
+  if (!filepath) {
+    throw new Error(`Preset ${name} not found relative to ${dirname}`);
+  }
+
+  const value = requireModule("preset", filepath);
+  debug("Loaded preset %o from %o.", name, dirname);
+  return {
+    filepath,
+    value
+  };
+}
+
+function standardizeName(type, name) {
+  if (_path().default.isAbsolute(name)) return name;
+  const isPreset = type === "preset";
+  return name.replace(isPreset ? BABEL_PRESET_PREFIX_RE : BABEL_PLUGIN_PREFIX_RE, `babel-${type}-`).replace(isPreset ? BABEL_PRESET_ORG_RE : BABEL_PLUGIN_ORG_RE, `$1${type}-`).replace(isPreset ? OTHER_PRESET_ORG_RE : OTHER_PLUGIN_ORG_RE, `$1babel-${type}-`).replace(EXACT_RE, "");
+}
+
+function resolveStandardizedName(type, name, dirname = process.cwd()) {
+  const standardizedName = standardizeName(type, name);
+
+  try {
+    return _resolve().default.sync(standardizedName, {
+      basedir: dirname
+    });
+  } catch (e) {
+    if (e.code !== "MODULE_NOT_FOUND") throw e;
+
+    if (standardizedName !== name) {
+      let resolvedOriginal = false;
+
+      try {
+        _resolve().default.sync(name, {
+          basedir: dirname
+        });
+
+        resolvedOriginal = true;
+      } catch (e2) {}
+
+      if (resolvedOriginal) {
+        e.message += `\n- If you want to resolve "${name}", use "module:${name}"`;
+      }
+    }
+
+    let resolvedBabel = false;
+
+    try {
+      _resolve().default.sync(standardizeName(type, "@babel/" + name), {
+        basedir: dirname
+      });
+
+      resolvedBabel = true;
+    } catch (e2) {}
+
+    if (resolvedBabel) {
+      e.message += `\n- Did you mean "@babel/${name}"?`;
+    }
+
+    let resolvedOppositeType = false;
+    const oppositeType = type === "preset" ? "plugin" : "preset";
+
+    try {
+      _resolve().default.sync(standardizeName(oppositeType, name), {
+        basedir: dirname
+      });
+
+      resolvedOppositeType = true;
+    } catch (e2) {}
+
+    if (resolvedOppositeType) {
+      e.message += `\n- Did you accidentally pass a ${type} as a ${oppositeType}?`;
+    }
+
+    throw e;
+  }
+}
+
+const LOADING_MODULES = new Set();
+
+function requireModule(type, name) {
+  if (LOADING_MODULES.has(name)) {
+    throw new Error(`Reentrant ${type} detected trying to load "${name}". This module is not ignored ` + "and is trying to load itself while compiling itself, leading to a dependency cycle. " + 'We recommend adding it to your "ignore" list in your babelrc, or to a .babelignore.');
+  }
+
+  try {
+    LOADING_MODULES.add(name);
+    return require(name);
+  } finally {
+    LOADING_MODULES.delete(name);
+  }
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/types.js b/node_modules/@babel/core/lib/config/files/types.js
new file mode 100644
index 00000000..9a390c31
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/types.js
@@ -0,0 +1 @@
+"use strict";
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/files/utils.js b/node_modules/@babel/core/lib/config/files/utils.js
new file mode 100644
index 00000000..9314e2dc
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/files/utils.js
@@ -0,0 +1,41 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.makeStaticFileCache = makeStaticFileCache;
+
+function _fs() {
+  const data = _interopRequireDefault(require("fs"));
+
+  _fs = function _fs() {
+    return data;
+  };
+
+  return data;
+}
+
+var _caching = require("../caching");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function makeStaticFileCache(fn) {
+  return (0, _caching.makeStrongCache)((filepath, cache) => {
+    if (cache.invalidate(() => fileMtime(filepath)) === null) {
+      cache.forever();
+      return null;
+    }
+
+    return fn(filepath, _fs().default.readFileSync(filepath, "utf8"));
+  });
+}
+
+function fileMtime(filepath) {
+  try {
+    return +_fs().default.statSync(filepath).mtime;
+  } catch (e) {
+    if (e.code !== "ENOENT" && e.code !== "ENOTDIR") throw e;
+  }
+
+  return null;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/full.js b/node_modules/@babel/core/lib/config/full.js
new file mode 100644
index 00000000..e2875cdf
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/full.js
@@ -0,0 +1,268 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = loadFullConfig;
+
+var _util = require("./util");
+
+var context = _interopRequireWildcard(require("../index"));
+
+var _plugin = _interopRequireDefault(require("./plugin"));
+
+var _item = require("./item");
+
+var _configChain = require("./config-chain");
+
+function _traverse() {
+  const data = _interopRequireDefault(require("@babel/traverse"));
+
+  _traverse = function _traverse() {
+    return data;
+  };
+
+  return data;
+}
+
+var _caching = require("./caching");
+
+var _options = require("./validation/options");
+
+var _plugins = require("./validation/plugins");
+
+var _configApi = _interopRequireDefault(require("./helpers/config-api"));
+
+var _partial = _interopRequireDefault(require("./partial"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) { var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {}; if (desc.get || desc.set) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } } newObj.default = obj; return newObj; } }
+
+function loadFullConfig(inputOpts) {
+  const result = (0, _partial.default)(inputOpts);
+
+  if (!result) {
+    return null;
+  }
+
+  const options = result.options,
+        context = result.context;
+  const optionDefaults = {};
+  const passes = [[]];
+
+  try {
+    const plugins = options.plugins,
+          presets = options.presets;
+
+    if (!plugins || !presets) {
+      throw new Error("Assertion failure - plugins and presets exist");
+    }
+
+    const ignored = function recurseDescriptors(config, pass) {
+      const plugins = config.plugins.map(descriptor => {
+        return loadPluginDescriptor(descriptor, context);
+      });
+      const presets = config.presets.map(descriptor => {
+        return {
+          preset: loadPresetDescriptor(descriptor, context),
+          pass: descriptor.ownPass ? [] : pass
+        };
+      });
+
+      if (presets.length > 0) {
+        passes.splice(1, 0, ...presets.map(o => o.pass).filter(p => p !== pass));
+
+        for (var _iterator = presets, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+          var _ref2;
+
+          if (_isArray) {
+            if (_i >= _iterator.length) break;
+            _ref2 = _iterator[_i++];
+          } else {
+            _i = _iterator.next();
+            if (_i.done) break;
+            _ref2 = _i.value;
+          }
+
+          const _ref = _ref2;
+          const preset = _ref.preset,
+                pass = _ref.pass;
+          if (!preset) return true;
+          const ignored = recurseDescriptors({
+            plugins: preset.plugins,
+            presets: preset.presets
+          }, pass);
+          if (ignored) return true;
+          preset.options.forEach(opts => {
+            (0, _util.mergeOptions)(optionDefaults, opts);
+          });
+        }
+      }
+
+      if (plugins.length > 0) {
+        pass.unshift(...plugins);
+      }
+    }({
+      plugins: plugins.map(item => {
+        const desc = (0, _item.getItemDescriptor)(item);
+
+        if (!desc) {
+          throw new Error("Assertion failure - must be config item");
+        }
+
+        return desc;
+      }),
+      presets: presets.map(item => {
+        const desc = (0, _item.getItemDescriptor)(item);
+
+        if (!desc) {
+          throw new Error("Assertion failure - must be config item");
+        }
+
+        return desc;
+      })
+    }, passes[0]);
+
+    if (ignored) return null;
+  } catch (e) {
+    if (!/^\[BABEL\]/.test(e.message)) {
+      e.message = `[BABEL] ${context.filename || "unknown"}: ${e.message}`;
+    }
+
+    throw e;
+  }
+
+  const opts = optionDefaults;
+  (0, _util.mergeOptions)(opts, options);
+  opts.plugins = passes[0];
+  opts.presets = passes.slice(1).filter(plugins => plugins.length > 0).map(plugins => ({
+    plugins
+  }));
+  opts.passPerPreset = opts.presets.length > 0;
+  return {
+    options: opts,
+    passes: passes
+  };
+}
+
+const loadDescriptor = (0, _caching.makeWeakCache)(({
+  value,
+  options,
+  dirname,
+  alias
+}, cache) => {
+  if (options === false) throw new Error("Assertion failure");
+  options = options || {};
+  let item = value;
+
+  if (typeof value === "function") {
+    const api = Object.assign({}, context, (0, _configApi.default)(cache));
+
+    try {
+      item = value(api, options, dirname);
+    } catch (e) {
+      if (alias) {
+        e.message += ` (While processing: ${JSON.stringify(alias)})`;
+      }
+
+      throw e;
+    }
+  }
+
+  if (!item || typeof item !== "object") {
+    throw new Error("Plugin/Preset did not return an object.");
+  }
+
+  if (typeof item.then === "function") {
+    throw new Error(`You appear to be using an async plugin, ` + `which your current version of Babel does not support.` + `If you're using a published plugin, ` + `you may need to upgrade your @babel/core version.`);
+  }
+
+  return {
+    value: item,
+    options,
+    dirname,
+    alias
+  };
+});
+
+function loadPluginDescriptor(descriptor, context) {
+  if (descriptor.value instanceof _plugin.default) {
+    if (descriptor.options) {
+      throw new Error("Passed options to an existing Plugin instance will not work.");
+    }
+
+    return descriptor.value;
+  }
+
+  return instantiatePlugin(loadDescriptor(descriptor, context), context);
+}
+
+const instantiatePlugin = (0, _caching.makeWeakCache)(({
+  value,
+  options,
+  dirname,
+  alias
+}, cache) => {
+  const pluginObj = (0, _plugins.validatePluginObject)(value);
+  const plugin = Object.assign({}, pluginObj);
+
+  if (plugin.visitor) {
+    plugin.visitor = _traverse().default.explode(Object.assign({}, plugin.visitor));
+  }
+
+  if (plugin.inherits) {
+    const inheritsDescriptor = {
+      name: undefined,
+      alias: `${alias}$inherits`,
+      value: plugin.inherits,
+      options,
+      dirname
+    };
+    const inherits = cache.invalidate(data => loadPluginDescriptor(inheritsDescriptor, data));
+    plugin.pre = chain(inherits.pre, plugin.pre);
+    plugin.post = chain(inherits.post, plugin.post);
+    plugin.manipulateOptions = chain(inherits.manipulateOptions, plugin.manipulateOptions);
+    plugin.visitor = _traverse().default.visitors.merge([inherits.visitor || {}, plugin.visitor || {}]);
+  }
+
+  return new _plugin.default(plugin, options, alias);
+});
+
+const loadPresetDescriptor = (descriptor, context) => {
+  return (0, _configChain.buildPresetChain)(instantiatePreset(loadDescriptor(descriptor, context)), context);
+};
+
+const instantiatePreset = (0, _caching.makeWeakCache)(({
+  value,
+  dirname,
+  alias
+}) => {
+  return {
+    options: (0, _options.validate)("preset", value),
+    alias,
+    dirname
+  };
+});
+
+function chain(a, b) {
+  const fns = [a, b].filter(Boolean);
+  if (fns.length <= 1) return fns[0];
+  return function (...args) {
+    for (var _iterator2 = fns, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+      var _ref3;
+
+      if (_isArray2) {
+        if (_i2 >= _iterator2.length) break;
+        _ref3 = _iterator2[_i2++];
+      } else {
+        _i2 = _iterator2.next();
+        if (_i2.done) break;
+        _ref3 = _i2.value;
+      }
+
+      const fn = _ref3;
+      fn.apply(this, args);
+    }
+  };
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/helpers/config-api.js b/node_modules/@babel/core/lib/config/helpers/config-api.js
new file mode 100644
index 00000000..78080a80
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/helpers/config-api.js
@@ -0,0 +1,76 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = makeAPI;
+
+function _semver() {
+  const data = _interopRequireDefault(require("semver"));
+
+  _semver = function _semver() {
+    return data;
+  };
+
+  return data;
+}
+
+var _ = require("../../");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function makeAPI(cache) {
+  const env = value => cache.using(data => {
+    if (typeof value === "undefined") return data.envName;
+    if (typeof value === "function") return value(data.envName);
+    if (!Array.isArray(value)) value = [value];
+    return value.some(entry => {
+      if (typeof entry !== "string") {
+        throw new Error("Unexpected non-string value");
+      }
+
+      return entry === data.envName;
+    });
+  });
+
+  return {
+    version: _.version,
+    cache: cache.simple(),
+    env,
+    async: () => false,
+    assertVersion
+  };
+}
+
+function assertVersion(range) {
+  if (typeof range === "number") {
+    if (!Number.isInteger(range)) {
+      throw new Error("Expected string or integer value.");
+    }
+
+    range = `^${range}.0.0-0`;
+  }
+
+  if (typeof range !== "string") {
+    throw new Error("Expected string or integer value.");
+  }
+
+  if (_semver().default.satisfies(_.version, range)) return;
+  const limit = Error.stackTraceLimit;
+
+  if (typeof limit === "number" && limit < 25) {
+    Error.stackTraceLimit = 25;
+  }
+
+  const err = new Error(`Requires Babel "${range}", but was loaded with "${_.version}". ` + `If you are sure you have a compatible version of @babel/core, ` + `it is likely that something in your build process is loading the ` + `wrong version. Inspect the stack trace of this error to look for ` + `the first entry that doesn't mention "@babel/core" or "babel-core" ` + `to see what is calling Babel.`);
+
+  if (typeof limit === "number") {
+    Error.stackTraceLimit = limit;
+  }
+
+  throw Object.assign(err, {
+    code: "BABEL_VERSION_UNSUPPORTED",
+    version: _.version,
+    range
+  });
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/helpers/environment.js b/node_modules/@babel/core/lib/config/helpers/environment.js
new file mode 100644
index 00000000..e4bfdbc7
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/helpers/environment.js
@@ -0,0 +1,10 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.getEnv = getEnv;
+
+function getEnv(defaultValue = "development") {
+  return process.env.BABEL_ENV || process.env.NODE_ENV || defaultValue;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/index.js b/node_modules/@babel/core/lib/config/index.js
new file mode 100644
index 00000000..829a7952
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/index.js
@@ -0,0 +1,39 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.loadOptions = loadOptions;
+Object.defineProperty(exports, "default", {
+  enumerable: true,
+  get: function get() {
+    return _full.default;
+  }
+});
+Object.defineProperty(exports, "loadPartialConfig", {
+  enumerable: true,
+  get: function get() {
+    return _partial.loadPartialConfig;
+  }
+});
+exports.OptionManager = void 0;
+
+var _full = _interopRequireDefault(require("./full"));
+
+var _partial = require("./partial");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function loadOptions(opts) {
+  const config = (0, _full.default)(opts);
+  return config ? config.options : null;
+}
+
+class OptionManager {
+  init(opts) {
+    return loadOptions(opts);
+  }
+
+}
+
+exports.OptionManager = OptionManager;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/item.js b/node_modules/@babel/core/lib/config/item.js
new file mode 100644
index 00000000..3f2d5e69
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/item.js
@@ -0,0 +1,71 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.createItemFromDescriptor = createItemFromDescriptor;
+exports.createConfigItem = createConfigItem;
+exports.getItemDescriptor = getItemDescriptor;
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+var _configDescriptors = require("./config-descriptors");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function createItemFromDescriptor(desc) {
+  return new ConfigItem(desc);
+}
+
+function createConfigItem(value, {
+  dirname = ".",
+  type
+} = {}) {
+  const descriptor = (0, _configDescriptors.createDescriptor)(value, _path().default.resolve(dirname), {
+    type,
+    alias: "programmatic item"
+  });
+  return createItemFromDescriptor(descriptor);
+}
+
+function getItemDescriptor(item) {
+  if (item instanceof ConfigItem) {
+    return item._descriptor;
+  }
+
+  return undefined;
+}
+
+class ConfigItem {
+  constructor(descriptor) {
+    this._descriptor = descriptor;
+    Object.defineProperty(this, "_descriptor", {
+      enumerable: false
+    });
+
+    if (this._descriptor.options === false) {
+      throw new Error("Assertion failure - unexpected false options");
+    }
+
+    this.value = this._descriptor.value;
+    this.options = this._descriptor.options;
+    this.dirname = this._descriptor.dirname;
+    this.name = this._descriptor.name;
+    this.file = this._descriptor.file ? {
+      request: this._descriptor.file.request,
+      resolved: this._descriptor.file.resolved
+    } : undefined;
+    Object.freeze(this);
+  }
+
+}
+
+Object.freeze(ConfigItem.prototype);
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/partial.js b/node_modules/@babel/core/lib/config/partial.js
new file mode 100644
index 00000000..8b8937ed
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/partial.js
@@ -0,0 +1,103 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = loadPrivatePartialConfig;
+exports.loadPartialConfig = loadPartialConfig;
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+var _plugin = _interopRequireDefault(require("./plugin"));
+
+var _util = require("./util");
+
+var _item = require("./item");
+
+var _configChain = require("./config-chain");
+
+var _environment = require("./helpers/environment");
+
+var _options = require("./validation/options");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function loadPrivatePartialConfig(inputOpts) {
+  if (inputOpts != null && (typeof inputOpts !== "object" || Array.isArray(inputOpts))) {
+    throw new Error("Babel options must be an object, null, or undefined");
+  }
+
+  const args = inputOpts ? (0, _options.validate)("arguments", inputOpts) : {};
+  const _args$envName = args.envName,
+        envName = _args$envName === void 0 ? (0, _environment.getEnv)() : _args$envName,
+        _args$cwd = args.cwd,
+        cwd = _args$cwd === void 0 ? "." : _args$cwd;
+
+  const absoluteCwd = _path().default.resolve(cwd);
+
+  const context = {
+    filename: args.filename ? _path().default.resolve(cwd, args.filename) : null,
+    cwd: absoluteCwd,
+    envName
+  };
+  const configChain = (0, _configChain.buildRootChain)(args, context);
+  if (!configChain) return null;
+  const options = {};
+  configChain.options.forEach(opts => {
+    (0, _util.mergeOptions)(options, opts);
+  });
+  options.babelrc = false;
+  options.configFile = false;
+  options.envName = envName;
+  options.cwd = absoluteCwd;
+  options.passPerPreset = false;
+  options.plugins = configChain.plugins.map(descriptor => (0, _item.createItemFromDescriptor)(descriptor));
+  options.presets = configChain.presets.map(descriptor => (0, _item.createItemFromDescriptor)(descriptor));
+  return {
+    options,
+    context,
+    ignore: configChain.ignore,
+    babelrc: configChain.babelrc,
+    config: configChain.config
+  };
+}
+
+function loadPartialConfig(inputOpts) {
+  const result = loadPrivatePartialConfig(inputOpts);
+  if (!result) return null;
+  const options = result.options,
+        babelrc = result.babelrc,
+        ignore = result.ignore,
+        config = result.config;
+  (options.plugins || []).forEach(item => {
+    if (item.value instanceof _plugin.default) {
+      throw new Error("Passing cached plugin instances is not supported in " + "babel.loadPartialConfig()");
+    }
+  });
+  return new PartialConfig(options, babelrc ? babelrc.filepath : undefined, ignore ? ignore.filepath : undefined, config ? config.filepath : undefined);
+}
+
+class PartialConfig {
+  constructor(options, babelrc, ignore, config) {
+    this.options = options;
+    this.babelignore = ignore;
+    this.babelrc = babelrc;
+    this.config = config;
+    Object.freeze(this);
+  }
+
+  hasFilesystemConfig() {
+    return this.babelrc !== undefined || this.config !== undefined;
+  }
+
+}
+
+Object.freeze(PartialConfig.prototype);
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/plugin.js b/node_modules/@babel/core/lib/config/plugin.js
new file mode 100644
index 00000000..3c780708
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/plugin.js
@@ -0,0 +1,22 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+
+class Plugin {
+  constructor(plugin, options, key) {
+    this.key = plugin.name || key;
+    this.manipulateOptions = plugin.manipulateOptions;
+    this.post = plugin.post;
+    this.pre = plugin.pre;
+    this.visitor = plugin.visitor || {};
+    this.parserOverride = plugin.parserOverride;
+    this.generatorOverride = plugin.generatorOverride;
+    this.options = options;
+  }
+
+}
+
+exports.default = Plugin;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/util.js b/node_modules/@babel/core/lib/config/util.js
new file mode 100644
index 00000000..96de62c1
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/util.js
@@ -0,0 +1,37 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.mergeOptions = mergeOptions;
+
+function mergeOptions(target, source) {
+  var _arr = Object.keys(source);
+
+  for (var _i = 0; _i < _arr.length; _i++) {
+    const k = _arr[_i];
+
+    if (k === "parserOpts" && source.parserOpts) {
+      const parserOpts = source.parserOpts;
+      const targetObj = target.parserOpts = target.parserOpts || {};
+      mergeDefaultFields(targetObj, parserOpts);
+    } else if (k === "generatorOpts" && source.generatorOpts) {
+      const generatorOpts = source.generatorOpts;
+      const targetObj = target.generatorOpts = target.generatorOpts || {};
+      mergeDefaultFields(targetObj, generatorOpts);
+    } else {
+      const val = source[k];
+      if (val !== undefined) target[k] = val;
+    }
+  }
+}
+
+function mergeDefaultFields(target, source) {
+  var _arr2 = Object.keys(source);
+
+  for (var _i2 = 0; _i2 < _arr2.length; _i2++) {
+    const k = _arr2[_i2];
+    const val = source[k];
+    if (val !== undefined) target[k] = val;
+  }
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/validation/option-assertions.js b/node_modules/@babel/core/lib/config/validation/option-assertions.js
new file mode 100644
index 00000000..4aa57c37
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/validation/option-assertions.js
@@ -0,0 +1,205 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.assertSourceMaps = assertSourceMaps;
+exports.assertCompact = assertCompact;
+exports.assertSourceType = assertSourceType;
+exports.assertInputSourceMap = assertInputSourceMap;
+exports.assertString = assertString;
+exports.assertFunction = assertFunction;
+exports.assertBoolean = assertBoolean;
+exports.assertObject = assertObject;
+exports.assertArray = assertArray;
+exports.assertIgnoreList = assertIgnoreList;
+exports.assertConfigApplicableTest = assertConfigApplicableTest;
+exports.assertConfigFileSearch = assertConfigFileSearch;
+exports.assertBabelrcSearch = assertBabelrcSearch;
+exports.assertPluginList = assertPluginList;
+
+function assertSourceMaps(key, value) {
+  if (value !== undefined && typeof value !== "boolean" && value !== "inline" && value !== "both") {
+    throw new Error(`.${key} must be a boolean, "inline", "both", or undefined`);
+  }
+
+  return value;
+}
+
+function assertCompact(key, value) {
+  if (value !== undefined && typeof value !== "boolean" && value !== "auto") {
+    throw new Error(`.${key} must be a boolean, "auto", or undefined`);
+  }
+
+  return value;
+}
+
+function assertSourceType(key, value) {
+  if (value !== undefined && value !== "module" && value !== "script" && value !== "unambiguous") {
+    throw new Error(`.${key} must be "module", "script", "unambiguous", or undefined`);
+  }
+
+  return value;
+}
+
+function assertInputSourceMap(key, value) {
+  if (value !== undefined && typeof value !== "boolean" && (typeof value !== "object" || !value)) {
+    throw new Error(".inputSourceMap must be a boolean, object, or undefined");
+  }
+
+  return value;
+}
+
+function assertString(key, value) {
+  if (value !== undefined && typeof value !== "string") {
+    throw new Error(`.${key} must be a string, or undefined`);
+  }
+
+  return value;
+}
+
+function assertFunction(key, value) {
+  if (value !== undefined && typeof value !== "function") {
+    throw new Error(`.${key} must be a function, or undefined`);
+  }
+
+  return value;
+}
+
+function assertBoolean(key, value) {
+  if (value !== undefined && typeof value !== "boolean") {
+    throw new Error(`.${key} must be a boolean, or undefined`);
+  }
+
+  return value;
+}
+
+function assertObject(key, value) {
+  if (value !== undefined && (typeof value !== "object" || Array.isArray(value) || !value)) {
+    throw new Error(`.${key} must be an object, or undefined`);
+  }
+
+  return value;
+}
+
+function assertArray(key, value) {
+  if (value != null && !Array.isArray(value)) {
+    throw new Error(`.${key} must be an array, or undefined`);
+  }
+
+  return value;
+}
+
+function assertIgnoreList(key, value) {
+  const arr = assertArray(key, value);
+
+  if (arr) {
+    arr.forEach((item, i) => assertIgnoreItem(key, i, item));
+  }
+
+  return arr;
+}
+
+function assertIgnoreItem(key, index, value) {
+  if (typeof value !== "string" && typeof value !== "function" && !(value instanceof RegExp)) {
+    throw new Error(`.${key}[${index}] must be an array of string/Funtion/RegExp values, or undefined`);
+  }
+
+  return value;
+}
+
+function assertConfigApplicableTest(key, value) {
+  if (value === undefined) return value;
+
+  if (Array.isArray(value)) {
+    value.forEach((item, i) => {
+      if (!checkValidTest(item)) {
+        throw new Error(`.${key}[${i}] must be a string/Function/RegExp.`);
+      }
+    });
+  } else if (!checkValidTest(value)) {
+    throw new Error(`.${key} must be a string/Function/RegExp, or an array of those`);
+  }
+
+  return value;
+}
+
+function checkValidTest(value) {
+  return typeof value === "string" || typeof value === "function" || value instanceof RegExp;
+}
+
+function assertConfigFileSearch(key, value) {
+  if (value !== undefined && typeof value !== "boolean" && typeof value !== "string") {
+    throw new Error(`.${key} must be a undefined, a boolean, a string, ` + `got ${JSON.stringify(value)}`);
+  }
+
+  return value;
+}
+
+function assertBabelrcSearch(key, value) {
+  if (value === undefined || typeof value === "boolean") return value;
+
+  if (Array.isArray(value)) {
+    value.forEach((item, i) => {
+      if (typeof item !== "string") {
+        throw new Error(`.${key}[${i}] must be a string.`);
+      }
+    });
+  } else if (typeof value !== "string") {
+    throw new Error(`.${key} must be a undefined, a boolean, a string, ` + `or an array of strings, got ${JSON.stringify(value)}`);
+  }
+
+  return value;
+}
+
+function assertPluginList(key, value) {
+  const arr = assertArray(key, value);
+
+  if (arr) {
+    arr.forEach((item, i) => assertPluginItem(key, i, item));
+  }
+
+  return arr;
+}
+
+function assertPluginItem(key, index, value) {
+  if (Array.isArray(value)) {
+    if (value.length === 0) {
+      throw new Error(`.${key}[${index}] must include an object`);
+    }
+
+    if (value.length > 3) {
+      throw new Error(`.${key}[${index}] may only be a two-tuple or three-tuple`);
+    }
+
+    assertPluginTarget(key, index, true, value[0]);
+
+    if (value.length > 1) {
+      const opts = value[1];
+
+      if (opts !== undefined && opts !== false && (typeof opts !== "object" || Array.isArray(opts))) {
+        throw new Error(`.${key}[${index}][1] must be an object, false, or undefined`);
+      }
+    }
+
+    if (value.length === 3) {
+      const name = value[2];
+
+      if (name !== undefined && typeof name !== "string") {
+        throw new Error(`.${key}[${index}][2] must be a string, or undefined`);
+      }
+    }
+  } else {
+    assertPluginTarget(key, index, false, value);
+  }
+
+  return value;
+}
+
+function assertPluginTarget(key, index, inArray, value) {
+  if ((typeof value !== "object" || !value) && typeof value !== "string" && typeof value !== "function") {
+    throw new Error(`.${key}[${index}]${inArray ? `[0]` : ""} must be a string, object, function`);
+  }
+
+  return value;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/validation/options.js b/node_modules/@babel/core/lib/config/validation/options.js
new file mode 100644
index 00000000..b427b693
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/validation/options.js
@@ -0,0 +1,169 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.validate = validate;
+
+var _plugin = _interopRequireDefault(require("../plugin"));
+
+var _removed = _interopRequireDefault(require("./removed"));
+
+var _optionAssertions = require("./option-assertions");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+const ROOT_VALIDATORS = {
+  cwd: _optionAssertions.assertString,
+  root: _optionAssertions.assertString,
+  configFile: _optionAssertions.assertConfigFileSearch,
+  filename: _optionAssertions.assertString,
+  filenameRelative: _optionAssertions.assertString,
+  code: _optionAssertions.assertBoolean,
+  ast: _optionAssertions.assertBoolean,
+  envName: _optionAssertions.assertString
+};
+const BABELRC_VALIDATORS = {
+  babelrc: _optionAssertions.assertBoolean,
+  babelrcRoots: _optionAssertions.assertBabelrcSearch
+};
+const NONPRESET_VALIDATORS = {
+  extends: _optionAssertions.assertString,
+  env: assertEnvSet,
+  ignore: _optionAssertions.assertIgnoreList,
+  only: _optionAssertions.assertIgnoreList,
+  overrides: assertOverridesList,
+  test: _optionAssertions.assertConfigApplicableTest,
+  include: _optionAssertions.assertConfigApplicableTest,
+  exclude: _optionAssertions.assertConfigApplicableTest
+};
+const COMMON_VALIDATORS = {
+  inputSourceMap: _optionAssertions.assertInputSourceMap,
+  presets: _optionAssertions.assertPluginList,
+  plugins: _optionAssertions.assertPluginList,
+  passPerPreset: _optionAssertions.assertBoolean,
+  retainLines: _optionAssertions.assertBoolean,
+  comments: _optionAssertions.assertBoolean,
+  shouldPrintComment: _optionAssertions.assertFunction,
+  compact: _optionAssertions.assertCompact,
+  minified: _optionAssertions.assertBoolean,
+  auxiliaryCommentBefore: _optionAssertions.assertString,
+  auxiliaryCommentAfter: _optionAssertions.assertString,
+  sourceType: _optionAssertions.assertSourceType,
+  wrapPluginVisitorMethod: _optionAssertions.assertFunction,
+  highlightCode: _optionAssertions.assertBoolean,
+  sourceMaps: _optionAssertions.assertSourceMaps,
+  sourceMap: _optionAssertions.assertSourceMaps,
+  sourceFileName: _optionAssertions.assertString,
+  sourceRoot: _optionAssertions.assertString,
+  getModuleId: _optionAssertions.assertFunction,
+  moduleRoot: _optionAssertions.assertString,
+  moduleIds: _optionAssertions.assertBoolean,
+  moduleId: _optionAssertions.assertString,
+  parserOpts: _optionAssertions.assertObject,
+  generatorOpts: _optionAssertions.assertObject
+};
+
+function validate(type, opts) {
+  assertNoDuplicateSourcemap(opts);
+  Object.keys(opts).forEach(key => {
+    if (type === "preset" && NONPRESET_VALIDATORS[key]) {
+      throw new Error(`.${key} is not allowed in preset options`);
+    }
+
+    if (type !== "arguments" && ROOT_VALIDATORS[key]) {
+      throw new Error(`.${key} is only allowed in root programmatic options`);
+    }
+
+    if (type !== "arguments" && type !== "configfile" && BABELRC_VALIDATORS[key]) {
+      if (type === "babelrcfile" || type === "extendsfile") {
+        throw new Error(`.${key} is not allowed in .babelrc or "extend"ed files, only in root programmatic options, ` + `or babel.config.js/config file options`);
+      }
+
+      throw new Error(`.${key} is only allowed in root programmatic options, or babel.config.js/config file options`);
+    }
+
+    if (type === "env" && key === "env") {
+      throw new Error(`.${key} is not allowed inside another env block`);
+    }
+
+    if (type === "env" && key === "overrides") {
+      throw new Error(`.${key} is not allowed inside an env block`);
+    }
+
+    if (type === "override" && key === "overrides") {
+      throw new Error(`.${key} is not allowed inside an overrides block`);
+    }
+
+    const validator = COMMON_VALIDATORS[key] || NONPRESET_VALIDATORS[key] || BABELRC_VALIDATORS[key] || ROOT_VALIDATORS[key];
+    if (validator) validator(key, opts[key]);else throw buildUnknownError(key);
+  });
+  return opts;
+}
+
+function buildUnknownError(key) {
+  if (_removed.default[key]) {
+    const _removed$key = _removed.default[key],
+          message = _removed$key.message,
+          _removed$key$version = _removed$key.version,
+          version = _removed$key$version === void 0 ? 5 : _removed$key$version;
+    throw new ReferenceError(`Using removed Babel ${version} option: .${key} - ${message}`);
+  } else {
+    const unknownOptErr = `Unknown option: .${key}. Check out http://babeljs.io/docs/usage/options/ for more information about options.`;
+    throw new ReferenceError(unknownOptErr);
+  }
+}
+
+function has(obj, key) {
+  return Object.prototype.hasOwnProperty.call(obj, key);
+}
+
+function assertNoDuplicateSourcemap(opts) {
+  if (has(opts, "sourceMap") && has(opts, "sourceMaps")) {
+    throw new Error(".sourceMap is an alias for .sourceMaps, cannot use both");
+  }
+}
+
+function assertEnvSet(key, value) {
+  const obj = (0, _optionAssertions.assertObject)(key, value);
+
+  if (obj) {
+    var _arr = Object.keys(obj);
+
+    for (var _i = 0; _i < _arr.length; _i++) {
+      const key = _arr[_i];
+      const env = (0, _optionAssertions.assertObject)(key, obj[key]);
+      if (env) validate("env", env);
+    }
+  }
+
+  return obj;
+}
+
+function assertOverridesList(key, value) {
+  const arr = (0, _optionAssertions.assertArray)(key, value);
+
+  if (arr) {
+    for (var _iterator = arr.entries(), _isArray = Array.isArray(_iterator), _i2 = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+      var _ref;
+
+      if (_isArray) {
+        if (_i2 >= _iterator.length) break;
+        _ref = _iterator[_i2++];
+      } else {
+        _i2 = _iterator.next();
+        if (_i2.done) break;
+        _ref = _i2.value;
+      }
+
+      const _ref2 = _ref,
+            index = _ref2[0],
+            item = _ref2[1];
+      const env = (0, _optionAssertions.assertObject)(`${index}`, item);
+      if (!env) throw new Error(`.${key}[${index}] must be an object`);
+      validate("override", env);
+    }
+  }
+
+  return arr;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/validation/plugins.js b/node_modules/@babel/core/lib/config/validation/plugins.js
new file mode 100644
index 00000000..73b498cd
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/validation/plugins.js
@@ -0,0 +1,55 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.validatePluginObject = validatePluginObject;
+
+var _optionAssertions = require("./option-assertions");
+
+const VALIDATORS = {
+  name: _optionAssertions.assertString,
+  manipulateOptions: _optionAssertions.assertFunction,
+  pre: _optionAssertions.assertFunction,
+  post: _optionAssertions.assertFunction,
+  inherits: _optionAssertions.assertFunction,
+  visitor: assertVisitorMap,
+  parserOverride: _optionAssertions.assertFunction,
+  generatorOverride: _optionAssertions.assertFunction
+};
+
+function assertVisitorMap(key, value) {
+  const obj = (0, _optionAssertions.assertObject)(key, value);
+
+  if (obj) {
+    Object.keys(obj).forEach(prop => assertVisitorHandler(prop, obj[prop]));
+
+    if (obj.enter || obj.exit) {
+      throw new Error(`.${key} cannot contain catch-all "enter" or "exit" handlers. Please target individual nodes.`);
+    }
+  }
+
+  return obj;
+}
+
+function assertVisitorHandler(key, value) {
+  if (value && typeof value === "object") {
+    Object.keys(value).forEach(handler => {
+      if (handler !== "enter" && handler !== "exit") {
+        throw new Error(`.visitor["${key}"] may only have .enter and/or .exit handlers.`);
+      }
+    });
+  } else if (typeof value !== "function") {
+    throw new Error(`.visitor["${key}"] must be a function`);
+  }
+
+  return value;
+}
+
+function validatePluginObject(obj) {
+  Object.keys(obj).forEach(key => {
+    const validator = VALIDATORS[key];
+    if (validator) validator(key, obj[key]);else throw new Error(`.${key} is not a valid Plugin property`);
+  });
+  return obj;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/config/validation/removed.js b/node_modules/@babel/core/lib/config/validation/removed.js
new file mode 100644
index 00000000..f0fcd7de
--- /dev/null
+++ b/node_modules/@babel/core/lib/config/validation/removed.js
@@ -0,0 +1,66 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+var _default = {
+  auxiliaryComment: {
+    message: "Use `auxiliaryCommentBefore` or `auxiliaryCommentAfter`"
+  },
+  blacklist: {
+    message: "Put the specific transforms you want in the `plugins` option"
+  },
+  breakConfig: {
+    message: "This is not a necessary option in Babel 6"
+  },
+  experimental: {
+    message: "Put the specific transforms you want in the `plugins` option"
+  },
+  externalHelpers: {
+    message: "Use the `external-helpers` plugin instead. " + "Check out http://babeljs.io/docs/plugins/external-helpers/"
+  },
+  extra: {
+    message: ""
+  },
+  jsxPragma: {
+    message: "use the `pragma` option in the `react-jsx` plugin. " + "Check out http://babeljs.io/docs/plugins/transform-react-jsx/"
+  },
+  loose: {
+    message: "Specify the `loose` option for the relevant plugin you are using " + "or use a preset that sets the option."
+  },
+  metadataUsedHelpers: {
+    message: "Not required anymore as this is enabled by default"
+  },
+  modules: {
+    message: "Use the corresponding module transform plugin in the `plugins` option. " + "Check out http://babeljs.io/docs/plugins/#modules"
+  },
+  nonStandard: {
+    message: "Use the `react-jsx` and `flow-strip-types` plugins to support JSX and Flow. " + "Also check out the react preset http://babeljs.io/docs/plugins/preset-react/"
+  },
+  optional: {
+    message: "Put the specific transforms you want in the `plugins` option"
+  },
+  sourceMapName: {
+    message: "The `sourceMapName` option has been removed because it makes more sense for the " + "tooling that calls Babel to assign `map.file` themselves."
+  },
+  stage: {
+    message: "Check out the corresponding stage-x presets http://babeljs.io/docs/plugins/#presets"
+  },
+  whitelist: {
+    message: "Put the specific transforms you want in the `plugins` option"
+  },
+  resolveModuleSource: {
+    version: 6,
+    message: "Use `babel-plugin-module-resolver@3`'s 'resolvePath' options"
+  },
+  metadata: {
+    version: 6,
+    message: "Generated plugin metadata is always included in the output result"
+  },
+  sourceMapTarget: {
+    version: 6,
+    message: "The `sourceMapTarget` option has been removed because it makes more sense for the tooling " + "that calls Babel to assign `map.file` themselves."
+  }
+};
+exports.default = _default;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/index.js b/node_modules/@babel/core/lib/index.js
new file mode 100644
index 00000000..aa2e6afc
--- /dev/null
+++ b/node_modules/@babel/core/lib/index.js
@@ -0,0 +1,197 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.Plugin = Plugin;
+Object.defineProperty(exports, "File", {
+  enumerable: true,
+  get: function get() {
+    return _file.default;
+  }
+});
+Object.defineProperty(exports, "buildExternalHelpers", {
+  enumerable: true,
+  get: function get() {
+    return _buildExternalHelpers.default;
+  }
+});
+Object.defineProperty(exports, "resolvePlugin", {
+  enumerable: true,
+  get: function get() {
+    return _files.resolvePlugin;
+  }
+});
+Object.defineProperty(exports, "resolvePreset", {
+  enumerable: true,
+  get: function get() {
+    return _files.resolvePreset;
+  }
+});
+Object.defineProperty(exports, "version", {
+  enumerable: true,
+  get: function get() {
+    return _package.version;
+  }
+});
+Object.defineProperty(exports, "getEnv", {
+  enumerable: true,
+  get: function get() {
+    return _environment.getEnv;
+  }
+});
+Object.defineProperty(exports, "traverse", {
+  enumerable: true,
+  get: function get() {
+    return _traverse().default;
+  }
+});
+Object.defineProperty(exports, "template", {
+  enumerable: true,
+  get: function get() {
+    return _template().default;
+  }
+});
+Object.defineProperty(exports, "loadPartialConfig", {
+  enumerable: true,
+  get: function get() {
+    return _config.loadPartialConfig;
+  }
+});
+Object.defineProperty(exports, "loadOptions", {
+  enumerable: true,
+  get: function get() {
+    return _config.loadOptions;
+  }
+});
+Object.defineProperty(exports, "OptionManager", {
+  enumerable: true,
+  get: function get() {
+    return _config.OptionManager;
+  }
+});
+Object.defineProperty(exports, "createConfigItem", {
+  enumerable: true,
+  get: function get() {
+    return _item.createConfigItem;
+  }
+});
+Object.defineProperty(exports, "transform", {
+  enumerable: true,
+  get: function get() {
+    return _transform.default;
+  }
+});
+Object.defineProperty(exports, "transformSync", {
+  enumerable: true,
+  get: function get() {
+    return _transformSync.default;
+  }
+});
+Object.defineProperty(exports, "transformFile", {
+  enumerable: true,
+  get: function get() {
+    return _transformFile.default;
+  }
+});
+Object.defineProperty(exports, "transformFileSync", {
+  enumerable: true,
+  get: function get() {
+    return _transformFileSync.default;
+  }
+});
+Object.defineProperty(exports, "transformFromAst", {
+  enumerable: true,
+  get: function get() {
+    return _transformAst.default;
+  }
+});
+Object.defineProperty(exports, "transformFromAstSync", {
+  enumerable: true,
+  get: function get() {
+    return _transformAstSync.default;
+  }
+});
+Object.defineProperty(exports, "parse", {
+  enumerable: true,
+  get: function get() {
+    return _parse.default;
+  }
+});
+exports.types = exports.DEFAULT_EXTENSIONS = void 0;
+
+var _file = _interopRequireDefault(require("./transformation/file/file"));
+
+var _buildExternalHelpers = _interopRequireDefault(require("./tools/build-external-helpers"));
+
+var _files = require("./config/files");
+
+var _package = require("../package.json");
+
+var _environment = require("./config/helpers/environment");
+
+function _types() {
+  const data = _interopRequireWildcard(require("@babel/types"));
+
+  _types = function _types() {
+    return data;
+  };
+
+  return data;
+}
+
+Object.defineProperty(exports, "types", {
+  enumerable: true,
+  get: function get() {
+    return _types();
+  }
+});
+
+function _traverse() {
+  const data = _interopRequireDefault(require("@babel/traverse"));
+
+  _traverse = function _traverse() {
+    return data;
+  };
+
+  return data;
+}
+
+function _template() {
+  const data = _interopRequireDefault(require("@babel/template"));
+
+  _template = function _template() {
+    return data;
+  };
+
+  return data;
+}
+
+var _config = require("./config");
+
+var _item = require("./config/item");
+
+var _transform = _interopRequireDefault(require("./transform"));
+
+var _transformSync = _interopRequireDefault(require("./transform-sync"));
+
+var _transformFile = _interopRequireDefault(require("./transform-file"));
+
+var _transformFileSync = _interopRequireDefault(require("./transform-file-sync"));
+
+var _transformAst = _interopRequireDefault(require("./transform-ast"));
+
+var _transformAstSync = _interopRequireDefault(require("./transform-ast-sync"));
+
+var _parse = _interopRequireDefault(require("./parse"));
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) { var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {}; if (desc.get || desc.set) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } } newObj.default = obj; return newObj; } }
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function Plugin(alias) {
+  throw new Error(`The (${alias}) Babel 5 plugin is being run with an unsupported Babel version.`);
+}
+
+const DEFAULT_EXTENSIONS = Object.freeze([".js", ".jsx", ".es6", ".es", ".mjs"]);
+exports.DEFAULT_EXTENSIONS = DEFAULT_EXTENSIONS;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/parse.js b/node_modules/@babel/core/lib/parse.js
new file mode 100644
index 00000000..2251e268
--- /dev/null
+++ b/node_modules/@babel/core/lib/parse.js
@@ -0,0 +1,25 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = parse;
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _normalizeFile = _interopRequireDefault(require("./transformation/normalize-file"));
+
+var _normalizeOpts = _interopRequireDefault(require("./transformation/normalize-opts"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function parse(code, opts) {
+  const config = (0, _config.default)(opts);
+
+  if (config === null) {
+    return null;
+  }
+
+  const file = (0, _normalizeFile.default)(config.passes, (0, _normalizeOpts.default)(config), code);
+  return file.ast;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/tools/build-external-helpers.js b/node_modules/@babel/core/lib/tools/build-external-helpers.js
new file mode 100644
index 00000000..02af09e7
--- /dev/null
+++ b/node_modules/@babel/core/lib/tools/build-external-helpers.js
@@ -0,0 +1,144 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = _default;
+
+function helpers() {
+  const data = _interopRequireWildcard(require("@babel/helpers"));
+
+  helpers = function helpers() {
+    return data;
+  };
+
+  return data;
+}
+
+function _generator() {
+  const data = _interopRequireDefault(require("@babel/generator"));
+
+  _generator = function _generator() {
+    return data;
+  };
+
+  return data;
+}
+
+function _template() {
+  const data = _interopRequireDefault(require("@babel/template"));
+
+  _template = function _template() {
+    return data;
+  };
+
+  return data;
+}
+
+function t() {
+  const data = _interopRequireWildcard(require("@babel/types"));
+
+  t = function t() {
+    return data;
+  };
+
+  return data;
+}
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) { var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {}; if (desc.get || desc.set) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } } newObj.default = obj; return newObj; } }
+
+const buildUmdWrapper = replacements => _template().default`
+    (function (root, factory) {
+      if (typeof define === "function" && define.amd) {
+        define(AMD_ARGUMENTS, factory);
+      } else if (typeof exports === "object") {
+        factory(COMMON_ARGUMENTS);
+      } else {
+        factory(BROWSER_ARGUMENTS);
+      }
+    })(UMD_ROOT, function (FACTORY_PARAMETERS) {
+      FACTORY_BODY
+    });
+  `(replacements);
+
+function buildGlobal(whitelist) {
+  const namespace = t().identifier("babelHelpers");
+  const body = [];
+  const container = t().functionExpression(null, [t().identifier("global")], t().blockStatement(body));
+  const tree = t().program([t().expressionStatement(t().callExpression(container, [t().conditionalExpression(t().binaryExpression("===", t().unaryExpression("typeof", t().identifier("global")), t().stringLiteral("undefined")), t().identifier("self"), t().identifier("global"))]))]);
+  body.push(t().variableDeclaration("var", [t().variableDeclarator(namespace, t().assignmentExpression("=", t().memberExpression(t().identifier("global"), namespace), t().objectExpression([])))]));
+  buildHelpers(body, namespace, whitelist);
+  return tree;
+}
+
+function buildModule(whitelist) {
+  const body = [];
+  const refs = buildHelpers(body, null, whitelist);
+  body.unshift(t().exportNamedDeclaration(null, Object.keys(refs).map(name => {
+    return t().exportSpecifier(t().cloneNode(refs[name]), t().identifier(name));
+  })));
+  return t().program(body, [], "module");
+}
+
+function buildUmd(whitelist) {
+  const namespace = t().identifier("babelHelpers");
+  const body = [];
+  body.push(t().variableDeclaration("var", [t().variableDeclarator(namespace, t().identifier("global"))]));
+  buildHelpers(body, namespace, whitelist);
+  return t().program([buildUmdWrapper({
+    FACTORY_PARAMETERS: t().identifier("global"),
+    BROWSER_ARGUMENTS: t().assignmentExpression("=", t().memberExpression(t().identifier("root"), namespace), t().objectExpression([])),
+    COMMON_ARGUMENTS: t().identifier("exports"),
+    AMD_ARGUMENTS: t().arrayExpression([t().stringLiteral("exports")]),
+    FACTORY_BODY: body,
+    UMD_ROOT: t().identifier("this")
+  })]);
+}
+
+function buildVar(whitelist) {
+  const namespace = t().identifier("babelHelpers");
+  const body = [];
+  body.push(t().variableDeclaration("var", [t().variableDeclarator(namespace, t().objectExpression([]))]));
+  const tree = t().program(body);
+  buildHelpers(body, namespace, whitelist);
+  body.push(t().expressionStatement(namespace));
+  return tree;
+}
+
+function buildHelpers(body, namespace, whitelist) {
+  const getHelperReference = name => {
+    return namespace ? t().memberExpression(namespace, t().identifier(name)) : t().identifier(`_${name}`);
+  };
+
+  const refs = {};
+  helpers().list.forEach(function (name) {
+    if (whitelist && whitelist.indexOf(name) < 0) return;
+    const ref = refs[name] = getHelperReference(name);
+
+    const _helpers$get = helpers().get(name, getHelperReference, ref),
+          nodes = _helpers$get.nodes;
+
+    body.push(...nodes);
+  });
+  return refs;
+}
+
+function _default(whitelist, outputType = "global") {
+  let tree;
+  const build = {
+    global: buildGlobal,
+    module: buildModule,
+    umd: buildUmd,
+    var: buildVar
+  }[outputType];
+
+  if (build) {
+    tree = build(whitelist);
+  } else {
+    throw new Error(`Unsupported output type ${outputType}`);
+  }
+
+  return (0, _generator().default)(tree).code;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-ast-sync.js b/node_modules/@babel/core/lib/transform-ast-sync.js
new file mode 100644
index 00000000..a4946dd6
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-ast-sync.js
@@ -0,0 +1,19 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = transformFromAstSync;
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _transformation = require("./transformation");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function transformFromAstSync(ast, code, opts) {
+  const config = (0, _config.default)(opts);
+  if (config === null) return null;
+  if (!ast) throw new Error("No AST given");
+  return (0, _transformation.runSync)(config, code, ast);
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-ast.js b/node_modules/@babel/core/lib/transform-ast.js
new file mode 100644
index 00000000..13f18a40
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-ast.js
@@ -0,0 +1,39 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _transformation = require("./transformation");
+
+var _transformAstSync = _interopRequireDefault(require("./transform-ast-sync"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+var transformFromAst = function transformFromAst(ast, code, opts, callback) {
+  if (typeof opts === "function") {
+    opts = undefined;
+    callback = opts;
+  }
+
+  if (callback === undefined) return (0, _transformAstSync.default)(ast, code, opts);
+  const cb = callback;
+  process.nextTick(() => {
+    let cfg;
+
+    try {
+      cfg = (0, _config.default)(opts);
+      if (cfg === null) return cb(null, null);
+    } catch (err) {
+      return cb(err);
+    }
+
+    if (!ast) return cb(new Error("No AST given"));
+    (0, _transformation.runAsync)(cfg, code, ast, cb);
+  });
+};
+
+exports.default = transformFromAst;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-file-browser.js b/node_modules/@babel/core/lib/transform-file-browser.js
new file mode 100644
index 00000000..735e5829
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-file-browser.js
@@ -0,0 +1,14 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = transformFile;
+
+function transformFile(filename, opts = {}, callback) {
+  if (typeof opts === "function") {
+    callback = opts;
+  }
+
+  callback(new Error("Transforming files is not supported in browsers"), null);
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-file-sync-browser.js b/node_modules/@babel/core/lib/transform-file-sync-browser.js
new file mode 100644
index 00000000..3f5740dd
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-file-sync-browser.js
@@ -0,0 +1,10 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = transformFileSync;
+
+function transformFileSync() {
+  throw new Error("Transforming files is not supported in browsers");
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-file-sync.js b/node_modules/@babel/core/lib/transform-file-sync.js
new file mode 100644
index 00000000..53086e55
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-file-sync.js
@@ -0,0 +1,40 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = transformFileSync;
+
+function _fs() {
+  const data = _interopRequireDefault(require("fs"));
+
+  _fs = function _fs() {
+    return data;
+  };
+
+  return data;
+}
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _transformation = require("./transformation");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function transformFileSync(filename, opts) {
+  let options;
+
+  if (opts == null) {
+    options = {
+      filename
+    };
+  } else if (opts && typeof opts === "object") {
+    options = Object.assign({}, opts, {
+      filename
+    });
+  }
+
+  const config = (0, _config.default)(options);
+  if (config === null) return null;
+  return (0, _transformation.runSync)(config, _fs().default.readFileSync(filename, "utf8"));
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-file.js b/node_modules/@babel/core/lib/transform-file.js
new file mode 100644
index 00000000..a5d4e5e9
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-file.js
@@ -0,0 +1,61 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+
+function _fs() {
+  const data = _interopRequireDefault(require("fs"));
+
+  _fs = function _fs() {
+    return data;
+  };
+
+  return data;
+}
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _transformation = require("./transformation");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+var transformFile = function transformFile(filename, opts, callback) {
+  let options;
+
+  if (typeof opts === "function") {
+    callback = opts;
+    opts = undefined;
+  }
+
+  if (opts == null) {
+    options = {
+      filename
+    };
+  } else if (opts && typeof opts === "object") {
+    options = Object.assign({}, opts, {
+      filename
+    });
+  }
+
+  process.nextTick(() => {
+    let cfg;
+
+    try {
+      cfg = (0, _config.default)(options);
+      if (cfg === null) return callback(null, null);
+    } catch (err) {
+      return callback(err);
+    }
+
+    const config = cfg;
+
+    _fs().default.readFile(filename, "utf8", function (err, code) {
+      if (err) return callback(err, null);
+      (0, _transformation.runAsync)(config, code, null, callback);
+    });
+  });
+};
+
+exports.default = transformFile;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform-sync.js b/node_modules/@babel/core/lib/transform-sync.js
new file mode 100644
index 00000000..f3a36581
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform-sync.js
@@ -0,0 +1,18 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = transformSync;
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _transformation = require("./transformation");
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function transformSync(code, opts) {
+  const config = (0, _config.default)(opts);
+  if (config === null) return null;
+  return (0, _transformation.runSync)(config, code);
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transform.js b/node_modules/@babel/core/lib/transform.js
new file mode 100644
index 00000000..7891c38b
--- /dev/null
+++ b/node_modules/@babel/core/lib/transform.js
@@ -0,0 +1,38 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+
+var _config = _interopRequireDefault(require("./config"));
+
+var _transformation = require("./transformation");
+
+var _transformSync = _interopRequireDefault(require("./transform-sync"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+var transform = function transform(code, opts, callback) {
+  if (typeof opts === "function") {
+    opts = undefined;
+    callback = opts;
+  }
+
+  if (callback === undefined) return (0, _transformSync.default)(code, opts);
+  const cb = callback;
+  process.nextTick(() => {
+    let cfg;
+
+    try {
+      cfg = (0, _config.default)(opts);
+      if (cfg === null) return cb(null, null);
+    } catch (err) {
+      return cb(err);
+    }
+
+    (0, _transformation.runAsync)(cfg, code, null, cb);
+  });
+};
+
+exports.default = transform;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/block-hoist-plugin.js b/node_modules/@babel/core/lib/transformation/block-hoist-plugin.js
new file mode 100644
index 00000000..4e6056af
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/block-hoist-plugin.js
@@ -0,0 +1,67 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = loadBlockHoistPlugin;
+
+function _sortBy() {
+  const data = _interopRequireDefault(require("lodash/sortBy"));
+
+  _sortBy = function _sortBy() {
+    return data;
+  };
+
+  return data;
+}
+
+var _config = _interopRequireDefault(require("../config"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+let LOADED_PLUGIN;
+
+function loadBlockHoistPlugin() {
+  if (!LOADED_PLUGIN) {
+    const config = (0, _config.default)({
+      babelrc: false,
+      configFile: false,
+      plugins: [blockHoistPlugin]
+    });
+    LOADED_PLUGIN = config ? config.passes[0][0] : undefined;
+    if (!LOADED_PLUGIN) throw new Error("Assertion failure");
+  }
+
+  return LOADED_PLUGIN;
+}
+
+const blockHoistPlugin = {
+  name: "internal.blockHoist",
+  visitor: {
+    Block: {
+      exit({
+        node
+      }) {
+        let hasChange = false;
+
+        for (let i = 0; i < node.body.length; i++) {
+          const bodyNode = node.body[i];
+
+          if (bodyNode && bodyNode._blockHoist != null) {
+            hasChange = true;
+            break;
+          }
+        }
+
+        if (!hasChange) return;
+        node.body = (0, _sortBy().default)(node.body, function (bodyNode) {
+          let priority = bodyNode && bodyNode._blockHoist;
+          if (priority == null) priority = 1;
+          if (priority === true) priority = 2;
+          return -1 * priority;
+        });
+      }
+
+    }
+  }
+};
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/file/file.js b/node_modules/@babel/core/lib/transformation/file/file.js
new file mode 100644
index 00000000..c326b9f9
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/file/file.js
@@ -0,0 +1,238 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+
+function helpers() {
+  const data = _interopRequireWildcard(require("@babel/helpers"));
+
+  helpers = function helpers() {
+    return data;
+  };
+
+  return data;
+}
+
+function _traverse() {
+  const data = _interopRequireWildcard(require("@babel/traverse"));
+
+  _traverse = function _traverse() {
+    return data;
+  };
+
+  return data;
+}
+
+function _codeFrame() {
+  const data = require("@babel/code-frame");
+
+  _codeFrame = function _codeFrame() {
+    return data;
+  };
+
+  return data;
+}
+
+function t() {
+  const data = _interopRequireWildcard(require("@babel/types"));
+
+  t = function t() {
+    return data;
+  };
+
+  return data;
+}
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) { var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {}; if (desc.get || desc.set) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } } newObj.default = obj; return newObj; } }
+
+const errorVisitor = {
+  enter(path, state) {
+    const loc = path.node.loc;
+
+    if (loc) {
+      state.loc = loc;
+      path.stop();
+    }
+  }
+
+};
+
+class File {
+  constructor(options, {
+    code,
+    ast,
+    shebang,
+    inputMap
+  }) {
+    this._map = new Map();
+    this.declarations = {};
+    this.path = null;
+    this.ast = {};
+    this.metadata = {};
+    this.hub = new (_traverse().Hub)(this);
+    this.code = "";
+    this.shebang = "";
+    this.inputMap = null;
+    this.opts = options;
+    this.code = code;
+    this.ast = ast;
+    this.shebang = shebang;
+    this.inputMap = inputMap;
+    this.path = _traverse().NodePath.get({
+      hub: this.hub,
+      parentPath: null,
+      parent: this.ast,
+      container: this.ast,
+      key: "program"
+    }).setContext();
+    this.scope = this.path.scope;
+  }
+
+  set(key, val) {
+    this._map.set(key, val);
+  }
+
+  get(key) {
+    return this._map.get(key);
+  }
+
+  has(key) {
+    return this._map.has(key);
+  }
+
+  getModuleName() {
+    const _this$opts = this.opts,
+          filename = _this$opts.filename,
+          _this$opts$filenameRe = _this$opts.filenameRelative,
+          filenameRelative = _this$opts$filenameRe === void 0 ? filename : _this$opts$filenameRe,
+          moduleId = _this$opts.moduleId,
+          _this$opts$moduleIds = _this$opts.moduleIds,
+          moduleIds = _this$opts$moduleIds === void 0 ? !!moduleId : _this$opts$moduleIds,
+          getModuleId = _this$opts.getModuleId,
+          sourceRootTmp = _this$opts.sourceRoot,
+          _this$opts$moduleRoot = _this$opts.moduleRoot,
+          moduleRoot = _this$opts$moduleRoot === void 0 ? sourceRootTmp : _this$opts$moduleRoot,
+          _this$opts$sourceRoot = _this$opts.sourceRoot,
+          sourceRoot = _this$opts$sourceRoot === void 0 ? moduleRoot : _this$opts$sourceRoot;
+    if (!moduleIds) return null;
+
+    if (moduleId != null && !getModuleId) {
+      return moduleId;
+    }
+
+    let moduleName = moduleRoot != null ? moduleRoot + "/" : "";
+
+    if (filenameRelative) {
+      const sourceRootReplacer = sourceRoot != null ? new RegExp("^" + sourceRoot + "/?") : "";
+      moduleName += filenameRelative.replace(sourceRootReplacer, "").replace(/\.(\w*?)$/, "");
+    }
+
+    moduleName = moduleName.replace(/\\/g, "/");
+
+    if (getModuleId) {
+      return getModuleId(moduleName) || moduleName;
+    } else {
+      return moduleName;
+    }
+  }
+
+  resolveModuleSource(source) {
+    return source;
+  }
+
+  addImport() {
+    throw new Error("This API has been removed. If you're looking for this " + "functionality in Babel 7, you should import the " + "'@babel/helper-module-imports' module and use the functions exposed " + " from that module, such as 'addNamed' or 'addDefault'.");
+  }
+
+  addHelper(name) {
+    const declar = this.declarations[name];
+    if (declar) return t().cloneNode(declar);
+    const generator = this.get("helperGenerator");
+    const runtime = this.get("helpersNamespace");
+
+    if (generator) {
+      const res = generator(name);
+      if (res) return res;
+    } else if (runtime) {
+      return t().memberExpression(t().cloneNode(runtime), t().identifier(name));
+    }
+
+    const uid = this.declarations[name] = this.scope.generateUidIdentifier(name);
+    const dependencies = {};
+
+    for (var _iterator = helpers().getDependencies(name), _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+      var _ref;
+
+      if (_isArray) {
+        if (_i >= _iterator.length) break;
+        _ref = _iterator[_i++];
+      } else {
+        _i = _iterator.next();
+        if (_i.done) break;
+        _ref = _i.value;
+      }
+
+      const dep = _ref;
+      dependencies[dep] = this.addHelper(dep);
+    }
+
+    const _helpers$get = helpers().get(name, dep => dependencies[dep], uid, Object.keys(this.scope.getAllBindings())),
+          nodes = _helpers$get.nodes,
+          globals = _helpers$get.globals;
+
+    globals.forEach(name => {
+      if (this.path.scope.hasBinding(name, true)) {
+        this.path.scope.rename(name);
+      }
+    });
+    nodes.forEach(node => {
+      node._compact = true;
+    });
+    this.path.unshiftContainer("body", nodes);
+    this.path.get("body").forEach(path => {
+      if (nodes.indexOf(path.node) === -1) return;
+      if (path.isVariableDeclaration()) this.scope.registerDeclaration(path);
+    });
+    return uid;
+  }
+
+  addTemplateObject() {
+    throw new Error("This function has been moved into the template literal transform itself.");
+  }
+
+  buildCodeFrameError(node, msg, Error = SyntaxError) {
+    let loc = node && (node.loc || node._loc);
+    msg = `${this.opts.filename}: ${msg}`;
+
+    if (!loc && node) {
+      const state = {
+        loc: null
+      };
+      (0, _traverse().default)(node, errorVisitor, this.scope, state);
+      loc = state.loc;
+      let txt = "This is an error on an internal node. Probably an internal error.";
+      if (loc) txt += " Location has been estimated.";
+      msg += ` (${txt})`;
+    }
+
+    if (loc) {
+      const _this$opts$highlightC = this.opts.highlightCode,
+            highlightCode = _this$opts$highlightC === void 0 ? true : _this$opts$highlightC;
+      msg += "\n" + (0, _codeFrame().codeFrameColumns)(this.code, {
+        start: {
+          line: loc.start.line,
+          column: loc.start.column + 1
+        }
+      }, {
+        highlightCode
+      });
+    }
+
+    return new Error(msg);
+  }
+
+}
+
+exports.default = File;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/file/generate.js b/node_modules/@babel/core/lib/transformation/file/generate.js
new file mode 100644
index 00000000..98f2a54f
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/file/generate.js
@@ -0,0 +1,114 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = generateCode;
+
+function _convertSourceMap() {
+  const data = _interopRequireDefault(require("convert-source-map"));
+
+  _convertSourceMap = function _convertSourceMap() {
+    return data;
+  };
+
+  return data;
+}
+
+function _generator() {
+  const data = _interopRequireDefault(require("@babel/generator"));
+
+  _generator = function _generator() {
+    return data;
+  };
+
+  return data;
+}
+
+var _mergeMap = _interopRequireDefault(require("./merge-map"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function generateCode(pluginPasses, file) {
+  const opts = file.opts,
+        ast = file.ast,
+        shebang = file.shebang,
+        code = file.code,
+        inputMap = file.inputMap;
+  const results = [];
+
+  for (var _iterator = pluginPasses, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref;
+
+    if (_isArray) {
+      if (_i >= _iterator.length) break;
+      _ref = _iterator[_i++];
+    } else {
+      _i = _iterator.next();
+      if (_i.done) break;
+      _ref = _i.value;
+    }
+
+    const plugins = _ref;
+
+    for (var _iterator2 = plugins, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+      var _ref2;
+
+      if (_isArray2) {
+        if (_i2 >= _iterator2.length) break;
+        _ref2 = _iterator2[_i2++];
+      } else {
+        _i2 = _iterator2.next();
+        if (_i2.done) break;
+        _ref2 = _i2.value;
+      }
+
+      const plugin = _ref2;
+      const generatorOverride = plugin.generatorOverride;
+
+      if (generatorOverride) {
+        const result = generatorOverride(ast, opts.generatorOpts, code, _generator().default);
+        if (result !== undefined) results.push(result);
+      }
+    }
+  }
+
+  let result;
+
+  if (results.length === 0) {
+    result = (0, _generator().default)(ast, opts.generatorOpts, code);
+  } else if (results.length === 1) {
+    result = results[0];
+
+    if (typeof result.then === "function") {
+      throw new Error(`You appear to be using an async parser plugin, ` + `which your current version of Babel does not support. ` + `If you're using a published plugin, ` + `you may need to upgrade your @babel/core version.`);
+    }
+  } else {
+    throw new Error("More than one plugin attempted to override codegen.");
+  }
+
+  let _result = result,
+      outputCode = _result.code,
+      outputMap = _result.map;
+
+  if (shebang) {
+    outputCode = `${shebang}\n${outputCode}`;
+  }
+
+  if (outputMap && inputMap) {
+    outputMap = (0, _mergeMap.default)(inputMap.toObject(), outputMap);
+  }
+
+  if (opts.sourceMaps === "inline" || opts.sourceMaps === "both") {
+    outputCode += "\n" + _convertSourceMap().default.fromObject(outputMap).toComment();
+  }
+
+  if (opts.sourceMaps === "inline") {
+    outputMap = null;
+  }
+
+  return {
+    outputCode,
+    outputMap
+  };
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/file/merge-map.js b/node_modules/@babel/core/lib/transformation/file/merge-map.js
new file mode 100644
index 00000000..6f0edd17
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/file/merge-map.js
@@ -0,0 +1,332 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = mergeSourceMap;
+
+function _sourceMap() {
+  const data = _interopRequireDefault(require("source-map"));
+
+  _sourceMap = function _sourceMap() {
+    return data;
+  };
+
+  return data;
+}
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function mergeSourceMap(inputMap, map) {
+  const input = buildMappingData(inputMap);
+  const output = buildMappingData(map);
+  const mergedGenerator = new (_sourceMap().default.SourceMapGenerator)();
+
+  for (var _iterator = input.sources, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref2;
+
+    if (_isArray) {
+      if (_i >= _iterator.length) break;
+      _ref2 = _iterator[_i++];
+    } else {
+      _i = _iterator.next();
+      if (_i.done) break;
+      _ref2 = _i.value;
+    }
+
+    const _ref = _ref2;
+    const source = _ref.source;
+
+    if (typeof source.content === "string") {
+      mergedGenerator.setSourceContent(source.path, source.content);
+    }
+  }
+
+  if (output.sources.length === 1) {
+    const defaultSource = output.sources[0];
+    const insertedMappings = new Map();
+    eachInputGeneratedRange(input, (generated, original, source) => {
+      eachOverlappingGeneratedOutputRange(defaultSource, generated, item => {
+        const key = makeMappingKey(item);
+        if (insertedMappings.has(key)) return;
+        insertedMappings.set(key, item);
+        mergedGenerator.addMapping({
+          source: source.path,
+          original: {
+            line: original.line,
+            column: original.columnStart
+          },
+          generated: {
+            line: item.line,
+            column: item.columnStart
+          },
+          name: original.name
+        });
+      });
+    });
+
+    for (var _iterator2 = insertedMappings.values(), _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+      var _ref3;
+
+      if (_isArray2) {
+        if (_i2 >= _iterator2.length) break;
+        _ref3 = _iterator2[_i2++];
+      } else {
+        _i2 = _iterator2.next();
+        if (_i2.done) break;
+        _ref3 = _i2.value;
+      }
+
+      const item = _ref3;
+
+      if (item.columnEnd === Infinity) {
+        continue;
+      }
+
+      const clearItem = {
+        line: item.line,
+        columnStart: item.columnEnd
+      };
+      const key = makeMappingKey(clearItem);
+
+      if (insertedMappings.has(key)) {
+        continue;
+      }
+
+      mergedGenerator.addMapping({
+        generated: {
+          line: clearItem.line,
+          column: clearItem.columnStart
+        }
+      });
+    }
+  }
+
+  const result = mergedGenerator.toJSON();
+
+  if (typeof input.sourceRoot === "string") {
+    result.sourceRoot = input.sourceRoot;
+  }
+
+  return result;
+}
+
+function makeMappingKey(item) {
+  return JSON.stringify([item.line, item.columnStart]);
+}
+
+function eachOverlappingGeneratedOutputRange(outputFile, inputGeneratedRange, callback) {
+  const overlappingOriginal = filterApplicableOriginalRanges(outputFile, inputGeneratedRange);
+
+  for (var _iterator3 = overlappingOriginal, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) {
+    var _ref5;
+
+    if (_isArray3) {
+      if (_i3 >= _iterator3.length) break;
+      _ref5 = _iterator3[_i3++];
+    } else {
+      _i3 = _iterator3.next();
+      if (_i3.done) break;
+      _ref5 = _i3.value;
+    }
+
+    const _ref4 = _ref5;
+    const generated = _ref4.generated;
+
+    for (var _iterator4 = generated, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) {
+      var _ref6;
+
+      if (_isArray4) {
+        if (_i4 >= _iterator4.length) break;
+        _ref6 = _iterator4[_i4++];
+      } else {
+        _i4 = _iterator4.next();
+        if (_i4.done) break;
+        _ref6 = _i4.value;
+      }
+
+      const item = _ref6;
+      callback(item);
+    }
+  }
+}
+
+function filterApplicableOriginalRanges({
+  mappings
+}, {
+  line,
+  columnStart,
+  columnEnd
+}) {
+  return filterSortedArray(mappings, ({
+    original: outOriginal
+  }) => {
+    if (line > outOriginal.line) return -1;
+    if (line < outOriginal.line) return 1;
+    if (columnStart >= outOriginal.columnEnd) return -1;
+    if (columnEnd <= outOriginal.columnStart) return 1;
+    return 0;
+  });
+}
+
+function eachInputGeneratedRange(map, callback) {
+  for (var _iterator5 = map.sources, _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) {
+    var _ref8;
+
+    if (_isArray5) {
+      if (_i5 >= _iterator5.length) break;
+      _ref8 = _iterator5[_i5++];
+    } else {
+      _i5 = _iterator5.next();
+      if (_i5.done) break;
+      _ref8 = _i5.value;
+    }
+
+    const _ref7 = _ref8;
+    const source = _ref7.source,
+          mappings = _ref7.mappings;
+
+    for (var _iterator6 = mappings, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) {
+      var _ref10;
+
+      if (_isArray6) {
+        if (_i6 >= _iterator6.length) break;
+        _ref10 = _iterator6[_i6++];
+      } else {
+        _i6 = _iterator6.next();
+        if (_i6.done) break;
+        _ref10 = _i6.value;
+      }
+
+      const _ref9 = _ref10;
+      const original = _ref9.original,
+            generated = _ref9.generated;
+
+      for (var _iterator7 = generated, _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) {
+        var _ref11;
+
+        if (_isArray7) {
+          if (_i7 >= _iterator7.length) break;
+          _ref11 = _iterator7[_i7++];
+        } else {
+          _i7 = _iterator7.next();
+          if (_i7.done) break;
+          _ref11 = _i7.value;
+        }
+
+        const item = _ref11;
+        callback(item, original, source);
+      }
+    }
+  }
+}
+
+function buildMappingData(map) {
+  const consumer = new (_sourceMap().default.SourceMapConsumer)(Object.assign({}, map, {
+    sourceRoot: null
+  }));
+  const sources = new Map();
+  const mappings = new Map();
+  let last = null;
+  consumer.computeColumnSpans();
+  consumer.eachMapping(m => {
+    if (m.originalLine === null) return;
+    let source = sources.get(m.source);
+
+    if (!source) {
+      source = {
+        path: m.source,
+        content: consumer.sourceContentFor(m.source, true)
+      };
+      sources.set(m.source, source);
+    }
+
+    let sourceData = mappings.get(source);
+
+    if (!sourceData) {
+      sourceData = {
+        source,
+        mappings: []
+      };
+      mappings.set(source, sourceData);
+    }
+
+    const obj = {
+      line: m.originalLine,
+      columnStart: m.originalColumn,
+      columnEnd: Infinity,
+      name: m.name
+    };
+
+    if (last && last.source === source && last.mapping.line === m.originalLine) {
+      last.mapping.columnEnd = m.originalColumn;
+    }
+
+    last = {
+      source,
+      mapping: obj
+    };
+    sourceData.mappings.push({
+      original: obj,
+      generated: consumer.allGeneratedPositionsFor({
+        source: m.source,
+        line: m.originalLine,
+        column: m.originalColumn
+      }).map(item => ({
+        line: item.line,
+        columnStart: item.column,
+        columnEnd: item.lastColumn + 1
+      }))
+    });
+  }, null, _sourceMap().default.SourceMapConsumer.ORIGINAL_ORDER);
+  return {
+    file: map.file,
+    sourceRoot: map.sourceRoot,
+    sources: Array.from(mappings.values())
+  };
+}
+
+function findInsertionLocation(array, callback) {
+  let left = 0;
+  let right = array.length;
+
+  while (left < right) {
+    const mid = Math.floor((left + right) / 2);
+    const item = array[mid];
+    const result = callback(item);
+
+    if (result === 0) {
+      left = mid;
+      break;
+    }
+
+    if (result >= 0) {
+      right = mid;
+    } else {
+      left = mid + 1;
+    }
+  }
+
+  let i = left;
+
+  if (i < array.length) {
+    while (i > 0 && callback(array[i]) >= 0) {
+      i--;
+    }
+
+    return i + 1;
+  }
+
+  return i;
+}
+
+function filterSortedArray(array, callback) {
+  const start = findInsertionLocation(array, callback);
+  const results = [];
+
+  for (let i = start; i < array.length && callback(array[i]) === 0; i++) {
+    results.push(array[i]);
+  }
+
+  return results;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/index.js b/node_modules/@babel/core/lib/transformation/index.js
new file mode 100644
index 00000000..fc6aedba
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/index.js
@@ -0,0 +1,137 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.runAsync = runAsync;
+exports.runSync = runSync;
+
+function _traverse() {
+  const data = _interopRequireDefault(require("@babel/traverse"));
+
+  _traverse = function _traverse() {
+    return data;
+  };
+
+  return data;
+}
+
+var _pluginPass = _interopRequireDefault(require("./plugin-pass"));
+
+var _blockHoistPlugin = _interopRequireDefault(require("./block-hoist-plugin"));
+
+var _normalizeOpts = _interopRequireDefault(require("./normalize-opts"));
+
+var _normalizeFile = _interopRequireDefault(require("./normalize-file"));
+
+var _generate = _interopRequireDefault(require("./file/generate"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function runAsync(config, code, ast, callback) {
+  let result;
+
+  try {
+    result = runSync(config, code, ast);
+  } catch (err) {
+    return callback(err);
+  }
+
+  return callback(null, result);
+}
+
+function runSync(config, code, ast) {
+  const file = (0, _normalizeFile.default)(config.passes, (0, _normalizeOpts.default)(config), code, ast);
+  transformFile(file, config.passes);
+  const opts = file.opts;
+
+  const _ref = opts.code !== false ? (0, _generate.default)(config.passes, file) : {},
+        outputCode = _ref.outputCode,
+        outputMap = _ref.outputMap;
+
+  return {
+    metadata: file.metadata,
+    options: opts,
+    ast: opts.ast === true ? file.ast : null,
+    code: outputCode === undefined ? null : outputCode,
+    map: outputMap === undefined ? null : outputMap,
+    sourceType: file.ast.program.sourceType
+  };
+}
+
+function transformFile(file, pluginPasses) {
+  for (var _iterator = pluginPasses, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref2;
+
+    if (_isArray) {
+      if (_i >= _iterator.length) break;
+      _ref2 = _iterator[_i++];
+    } else {
+      _i = _iterator.next();
+      if (_i.done) break;
+      _ref2 = _i.value;
+    }
+
+    const pluginPairs = _ref2;
+    const passPairs = [];
+    const passes = [];
+    const visitors = [];
+
+    for (var _iterator2 = pluginPairs.concat([(0, _blockHoistPlugin.default)()]), _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+      var _ref3;
+
+      if (_isArray2) {
+        if (_i2 >= _iterator2.length) break;
+        _ref3 = _iterator2[_i2++];
+      } else {
+        _i2 = _iterator2.next();
+        if (_i2.done) break;
+        _ref3 = _i2.value;
+      }
+
+      const plugin = _ref3;
+      const pass = new _pluginPass.default(file, plugin.key, plugin.options);
+      passPairs.push([plugin, pass]);
+      passes.push(pass);
+      visitors.push(plugin.visitor);
+    }
+
+    for (var _i3 = 0; _i3 < passPairs.length; _i3++) {
+      const _passPairs$_i = passPairs[_i3],
+            plugin = _passPairs$_i[0],
+            pass = _passPairs$_i[1];
+      const fn = plugin.pre;
+
+      if (fn) {
+        const result = fn.call(pass, file);
+
+        if (isThenable(result)) {
+          throw new Error(`You appear to be using an plugin with an async .pre, ` + `which your current version of Babel does not support.` + `If you're using a published plugin, you may need to upgrade ` + `your @babel/core version.`);
+        }
+      }
+    }
+
+    const visitor = _traverse().default.visitors.merge(visitors, passes, file.opts.wrapPluginVisitorMethod);
+
+    (0, _traverse().default)(file.ast, visitor, file.scope);
+
+    for (var _i4 = 0; _i4 < passPairs.length; _i4++) {
+      const _passPairs$_i2 = passPairs[_i4],
+            plugin = _passPairs$_i2[0],
+            pass = _passPairs$_i2[1];
+      const fn = plugin.post;
+
+      if (fn) {
+        const result = fn.call(pass, file);
+
+        if (isThenable(result)) {
+          throw new Error(`You appear to be using an plugin with an async .post, ` + `which your current version of Babel does not support.` + `If you're using a published plugin, you may need to upgrade ` + `your @babel/core version.`);
+        }
+      }
+    }
+  }
+}
+
+function isThenable(val) {
+  return !!val && (typeof val === "object" || typeof val === "function") && typeof val.then === "function";
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/normalize-file.js b/node_modules/@babel/core/lib/transformation/normalize-file.js
new file mode 100644
index 00000000..6d21f2ef
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/normalize-file.js
@@ -0,0 +1,176 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = normalizeFile;
+
+function t() {
+  const data = _interopRequireWildcard(require("@babel/types"));
+
+  t = function t() {
+    return data;
+  };
+
+  return data;
+}
+
+function _convertSourceMap() {
+  const data = _interopRequireDefault(require("convert-source-map"));
+
+  _convertSourceMap = function _convertSourceMap() {
+    return data;
+  };
+
+  return data;
+}
+
+function _babylon() {
+  const data = require("babylon");
+
+  _babylon = function _babylon() {
+    return data;
+  };
+
+  return data;
+}
+
+function _codeFrame() {
+  const data = require("@babel/code-frame");
+
+  _codeFrame = function _codeFrame() {
+    return data;
+  };
+
+  return data;
+}
+
+var _file = _interopRequireDefault(require("./file/file"));
+
+var _missingPluginHelper = _interopRequireDefault(require("./util/missing-plugin-helper"));
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) { var desc = Object.defineProperty && Object.getOwnPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : {}; if (desc.get || desc.set) { Object.defineProperty(newObj, key, desc); } else { newObj[key] = obj[key]; } } } } newObj.default = obj; return newObj; } }
+
+const shebangRegex = /^#!.*/;
+
+function normalizeFile(pluginPasses, options, code, ast) {
+  code = `${code || ""}`;
+  let shebang = null;
+  let inputMap = null;
+
+  if (options.inputSourceMap !== false) {
+    inputMap = _convertSourceMap().default.fromSource(code);
+
+    if (inputMap) {
+      code = _convertSourceMap().default.removeComments(code);
+    } else if (typeof options.inputSourceMap === "object") {
+      inputMap = _convertSourceMap().default.fromObject(options.inputSourceMap);
+    }
+  }
+
+  const shebangMatch = shebangRegex.exec(code);
+
+  if (shebangMatch) {
+    shebang = shebangMatch[0];
+    code = code.replace(shebangRegex, "");
+  }
+
+  if (ast) {
+    if (ast.type === "Program") {
+      ast = t().file(ast, [], []);
+    } else if (ast.type !== "File") {
+      throw new Error("AST root must be a Program or File node");
+    }
+  } else {
+    ast = parser(pluginPasses, options, code);
+  }
+
+  return new _file.default(options, {
+    code,
+    ast,
+    shebang,
+    inputMap
+  });
+}
+
+function parser(pluginPasses, options, code) {
+  try {
+    const results = [];
+
+    for (var _iterator = pluginPasses, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+      var _ref;
+
+      if (_isArray) {
+        if (_i >= _iterator.length) break;
+        _ref = _iterator[_i++];
+      } else {
+        _i = _iterator.next();
+        if (_i.done) break;
+        _ref = _i.value;
+      }
+
+      const plugins = _ref;
+
+      for (var _iterator2 = plugins, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+        var _ref2;
+
+        if (_isArray2) {
+          if (_i2 >= _iterator2.length) break;
+          _ref2 = _iterator2[_i2++];
+        } else {
+          _i2 = _iterator2.next();
+          if (_i2.done) break;
+          _ref2 = _i2.value;
+        }
+
+        const plugin = _ref2;
+        const parserOverride = plugin.parserOverride;
+
+        if (parserOverride) {
+          const ast = parserOverride(code, options.parserOpts, _babylon().parse);
+          if (ast !== undefined) results.push(ast);
+        }
+      }
+    }
+
+    if (results.length === 0) {
+      return (0, _babylon().parse)(code, options.parserOpts);
+    } else if (results.length === 1) {
+      if (typeof results[0].then === "function") {
+        throw new Error(`You appear to be using an async codegen plugin, ` + `which your current version of Babel does not support. ` + `If you're using a published plugin, you may need to upgrade ` + `your @babel/core version.`);
+      }
+
+      return results[0];
+    }
+
+    throw new Error("More than one plugin attempted to override parsing.");
+  } catch (err) {
+    if (err.code === "BABEL_PARSER_SOURCETYPE_MODULE_REQUIRED") {
+      err.message += "\nConsider renaming the file to '.mjs', or setting sourceType:module " + "or sourceType:unambiguous in your Babel config for this file.";
+    }
+
+    const loc = err.loc,
+          missingPlugin = err.missingPlugin;
+
+    if (loc) {
+      const codeFrame = (0, _codeFrame().codeFrameColumns)(code, {
+        start: {
+          line: loc.line,
+          column: loc.column + 1
+        }
+      }, options);
+
+      if (missingPlugin) {
+        err.message = `${options.filename || "unknown"}: ` + (0, _missingPluginHelper.default)(missingPlugin[0], loc, codeFrame);
+      } else {
+        err.message = `${options.filename || "unknown"}: ${err.message}\n\n` + codeFrame;
+      }
+
+      err.code = "BABEL_PARSE_ERROR";
+    }
+
+    throw err;
+  }
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/normalize-opts.js b/node_modules/@babel/core/lib/transformation/normalize-opts.js
new file mode 100644
index 00000000..9afc83db
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/normalize-opts.js
@@ -0,0 +1,97 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = normalizeOptions;
+
+function _path() {
+  const data = _interopRequireDefault(require("path"));
+
+  _path = function _path() {
+    return data;
+  };
+
+  return data;
+}
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
+
+function normalizeOptions(config) {
+  const _config$options = config.options,
+        filename = _config$options.filename,
+        cwd = _config$options.cwd,
+        _config$options$filen = _config$options.filenameRelative,
+        filenameRelative = _config$options$filen === void 0 ? typeof filename === "string" ? _path().default.relative(cwd, filename) : "unknown" : _config$options$filen,
+        _config$options$sourc = _config$options.sourceType,
+        sourceType = _config$options$sourc === void 0 ? "module" : _config$options$sourc,
+        inputSourceMap = _config$options.inputSourceMap,
+        _config$options$sourc2 = _config$options.sourceMaps,
+        sourceMaps = _config$options$sourc2 === void 0 ? !!inputSourceMap : _config$options$sourc2,
+        moduleRoot = _config$options.moduleRoot,
+        _config$options$sourc3 = _config$options.sourceRoot,
+        sourceRoot = _config$options$sourc3 === void 0 ? moduleRoot : _config$options$sourc3,
+        _config$options$sourc4 = _config$options.sourceFileName,
+        sourceFileName = _config$options$sourc4 === void 0 ? _path().default.basename(filenameRelative) : _config$options$sourc4,
+        _config$options$comme = _config$options.comments,
+        comments = _config$options$comme === void 0 ? true : _config$options$comme,
+        _config$options$compa = _config$options.compact,
+        compact = _config$options$compa === void 0 ? "auto" : _config$options$compa;
+  const opts = config.options;
+  const options = Object.assign({}, opts, {
+    parserOpts: Object.assign({
+      sourceType: _path().default.extname(filenameRelative) === ".mjs" ? "module" : sourceType,
+      sourceFileName: filename,
+      plugins: []
+    }, opts.parserOpts),
+    generatorOpts: Object.assign({
+      filename,
+      auxiliaryCommentBefore: opts.auxiliaryCommentBefore,
+      auxiliaryCommentAfter: opts.auxiliaryCommentAfter,
+      retainLines: opts.retainLines,
+      comments,
+      shouldPrintComment: opts.shouldPrintComment,
+      compact,
+      minified: opts.minified,
+      sourceMaps,
+      sourceRoot,
+      sourceFileName
+    }, opts.generatorOpts)
+  });
+
+  for (var _iterator = config.passes, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) {
+    var _ref;
+
+    if (_isArray) {
+      if (_i >= _iterator.length) break;
+      _ref = _iterator[_i++];
+    } else {
+      _i = _iterator.next();
+      if (_i.done) break;
+      _ref = _i.value;
+    }
+
+    const plugins = _ref;
+
+    for (var _iterator2 = plugins, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) {
+      var _ref2;
+
+      if (_isArray2) {
+        if (_i2 >= _iterator2.length) break;
+        _ref2 = _iterator2[_i2++];
+      } else {
+        _i2 = _iterator2.next();
+        if (_i2.done) break;
+        _ref2 = _i2.value;
+      }
+
+      const plugin = _ref2;
+
+      if (plugin.manipulateOptions) {
+        plugin.manipulateOptions(options, options.parserOpts);
+      }
+    }
+  }
+
+  return options;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/plugin-pass.js b/node_modules/@babel/core/lib/transformation/plugin-pass.js
new file mode 100644
index 00000000..fe24bfd2
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/plugin-pass.js
@@ -0,0 +1,43 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = void 0;
+
+class PluginPass {
+  constructor(file, key, options) {
+    this._map = new Map();
+    this.key = key;
+    this.file = file;
+    this.opts = options || {};
+    this.filename = typeof file.opts.filename === "string" ? file.opts.filename : undefined;
+  }
+
+  set(key, val) {
+    this._map.set(key, val);
+  }
+
+  get(key) {
+    return this._map.get(key);
+  }
+
+  addHelper(name) {
+    return this.file.addHelper(name);
+  }
+
+  addImport() {
+    return this.file.addImport();
+  }
+
+  getModuleName() {
+    return this.file.getModuleName();
+  }
+
+  buildCodeFrameError(node, msg, Error) {
+    return this.file.buildCodeFrameError(node, msg, Error);
+  }
+
+}
+
+exports.default = PluginPass;
\ No newline at end of file
diff --git a/node_modules/@babel/core/lib/transformation/util/missing-plugin-helper.js b/node_modules/@babel/core/lib/transformation/util/missing-plugin-helper.js
new file mode 100644
index 00000000..d568709d
--- /dev/null
+++ b/node_modules/@babel/core/lib/transformation/util/missing-plugin-helper.js
@@ -0,0 +1,237 @@
+"use strict";
+
+Object.defineProperty(exports, "__esModule", {
+  value: true
+});
+exports.default = generateMissingPluginMessage;
+const pluginNameMap = {
+  asyncGenerators: {
+    syntax: {
+      name: "@babel/plugin-syntax-async-generators",
+      url: "https://git.io/vb4SY"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-async-generator-functions",
+      url: "https://git.io/vb4yp"
+    }
+  },
+  classProperties: {
+    syntax: {
+      name: "@babel/plugin-syntax-class-properties",
+      url: "https://git.io/vb4yQ"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-class-properties",
+      url: "https://git.io/vb4SL"
+    }
+  },
+  decorators: {
+    syntax: {
+      name: "@babel/plugin-syntax-decorators",
+      url: "https://git.io/vb4y9"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-decorators",
+      url: "https://git.io/vb4ST"
+    }
+  },
+  doExpressions: {
+    syntax: {
+      name: "@babel/plugin-syntax-do-expressions",
+      url: "https://git.io/vb4yh"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-do-expressions",
+      url: "https://git.io/vb4S3"
+    }
+  },
+  dynamicImport: {
+    syntax: {
+      name: "@babel/plugin-syntax-dynamic-import",
+      url: "https://git.io/vb4Sv"
+    }
+  },
+  exportDefaultFrom: {
+    syntax: {
+      name: "@babel/plugin-syntax-export-default-from",
+      url: "https://git.io/vb4SO"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-export-default-from",
+      url: "https://git.io/vb4yH"
+    }
+  },
+  exportNamespaceFrom: {
+    syntax: {
+      name: "@babel/plugin-syntax-export-namespace-from",
+      url: "https://git.io/vb4Sf"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-export-namespace-from",
+      url: "https://git.io/vb4SG"
+    }
+  },
+  flow: {
+    syntax: {
+      name: "@babel/plugin-syntax-flow",
+      url: "https://git.io/vb4yb"
+    },
+    transform: {
+      name: "@babel/plugin-transform-flow-strip-types",
+      url: "https://git.io/vb49g"
+    }
+  },
+  functionBind: {
+    syntax: {
+      name: "@babel/plugin-syntax-function-bind",
+      url: "https://git.io/vb4y7"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-function-bind",
+      url: "https://git.io/vb4St"
+    }
+  },
+  functionSent: {
+    syntax: {
+      name: "@babel/plugin-syntax-function-sent",
+      url: "https://git.io/vb4yN"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-function-sent",
+      url: "https://git.io/vb4SZ"
+    }
+  },
+  importMeta: {
+    syntax: {
+      name: "@babel/plugin-syntax-import-meta",
+      url: "https://git.io/vbKK6"
+    }
+  },
+  jsx: {
+    syntax: {
+      name: "@babel/plugin-syntax-jsx",
+      url: "https://git.io/vb4yA"
+    },
+    transform: {
+      name: "@babel/plugin-transform-react-jsx",
+      url: "https://git.io/vb4yd"
+    }
+  },
+  logicalAssignment: {
+    syntax: {
+      name: "@babel/plugin-syntax-logical-assignment-operators",
+      url: "https://git.io/vAlBp"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-logical-assignment-operators",
+      url: "https://git.io/vAlRe"
+    }
+  },
+  nullishCoalescingOperator: {
+    syntax: {
+      name: "@babel/plugin-syntax-nullish-coalescing-operator",
+      url: "https://git.io/vb4yx"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-nullish-coalescing-operator",
+      url: "https://git.io/vb4Se"
+    }
+  },
+  numericSeparator: {
+    syntax: {
+      name: "@babel/plugin-syntax-numeric-separator",
+      url: "https://git.io/vb4Sq"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-numeric-separator",
+      url: "https://git.io/vb4yS"
+    }
+  },
+  objectRestSpread: {
+    syntax: {
+      name: "@babel/plugin-syntax-object-rest-spread",
+      url: "https://git.io/vb4y5"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-object-rest-spread",
+      url: "https://git.io/vb4Ss"
+    }
+  },
+  optionalCatchBinding: {
+    syntax: {
+      name: "@babel/plugin-syntax-optional-catch-binding",
+      url: "https://git.io/vb4Sn"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-optional-catch-binding",
+      url: "https://git.io/vb4SI"
+    }
+  },
+  optionalChaining: {
+    syntax: {
+      name: "@babel/plugin-syntax-optional-chaining",
+      url: "https://git.io/vb4Sc"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-optional-chaining",
+      url: "https://git.io/vb4Sk"
+    }
+  },
+  pipelineOperator: {
+    syntax: {
+      name: "@babel/plugin-syntax-pipeline-operator",
+      url: "https://git.io/vb4yj"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-pipeline-operator",
+      url: "https://git.io/vb4SU"
+    }
+  },
+  throwExpressions: {
+    syntax: {
+      name: "@babel/plugin-syntax-throw-expressions",
+      url: "https://git.io/vb4SJ"
+    },
+    transform: {
+      name: "@babel/plugin-proposal-throw-expressions",
+      url: "https://git.io/vb4yF"
+    }
+  },
+  typescript: {
+    syntax: {
+      name: "@babel/plugin-syntax-typescript",
+      url: "https://git.io/vb4SC"
+    },
+    transform: {
+      name: "@babel/plugin-transform-typescript",
+      url: "https://git.io/vb4Sm"
+    }
+  }
+};
+
+const getNameURLCombination = ({
+  name,
+  url
+}) => `${name} (${url})`;
+
+function generateMissingPluginMessage(missingPluginName, loc, codeFrame) {
+  let helpMessage = `Support for the experimental syntax '${missingPluginName}' isn't currently enabled ` + `(${loc.line}:${loc.column + 1}):\n\n` + codeFrame;
+  const pluginInfo = pluginNameMap[missingPluginName];
+
+  if (pluginInfo) {
+    const syntaxPlugin = pluginInfo.syntax,
+          transformPlugin = pluginInfo.transform;
+
+    if (syntaxPlugin) {
+      if (transformPlugin) {
+        const transformPluginInfo = getNameURLCombination(transformPlugin);
+        helpMessage += `\n\nAdd ${transformPluginInfo} to the 'plugins' section of your Babel config ` + `to enable transformation.`;
+      } else {
+        const syntaxPluginInfo = getNameURLCombination(syntaxPlugin);
+        helpMessage += `\n\nAdd ${syntaxPluginInfo} to the 'plugins' section of your Babel config ` + `to enable parsing.`;
+      }
+    }
+  }
+
+  return helpMessage;
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/.bin/babylon b/node_modules/@babel/core/node_modules/.bin/babylon
new file mode 120000
index 00000000..5acfefcc
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/.bin/babylon
@@ -0,0 +1 @@
+../../../../babylon/bin/babylon.js
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/.bin/json5 b/node_modules/@babel/core/node_modules/.bin/json5
new file mode 120000
index 00000000..ea747651
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/.bin/json5
@@ -0,0 +1 @@
+../../../../json5/lib/cli.js
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/.bin/semver b/node_modules/@babel/core/node_modules/.bin/semver
new file mode 120000
index 00000000..7a17f06e
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/.bin/semver
@@ -0,0 +1 @@
+../../../../semver/bin/semver
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/arr-diff/LICENSE b/node_modules/@babel/core/node_modules/arr-diff/LICENSE
new file mode 100755
index 00000000..fa30c4cb
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/arr-diff/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2015, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/arr-diff/README.md b/node_modules/@babel/core/node_modules/arr-diff/README.md
new file mode 100644
index 00000000..7705c6cd
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/arr-diff/README.md
@@ -0,0 +1,74 @@
+# arr-diff [![NPM version](https://img.shields.io/npm/v/arr-diff.svg)](https://www.npmjs.com/package/arr-diff) [![Build Status](https://img.shields.io/travis/jonschlinkert/base.svg)](https://travis-ci.org/jonschlinkert/base)
+
+> Returns an array with only the unique values from the first array, by excluding all values from additional arrays using strict equality for comparisons.
+
+## Install
+
+Install with [npm](https://www.npmjs.com/)
+
+```sh
+$ npm i arr-diff --save
+```
+Install with [bower](http://bower.io/)
+
+```sh
+$ bower install arr-diff --save
+```
+
+## API
+
+### [diff](index.js#L33)
+
+Return the difference between the first array and additional arrays.
+
+**Params**
+
+* `a` **{Array}**
+* `b` **{Array}**
+* `returns` **{Array}**
+
+**Example**
+
+```js
+var diff = require('arr-diff');
+
+var a = ['a', 'b', 'c', 'd'];
+var b = ['b', 'c'];
+
+console.log(diff(a, b))
+//=> ['a', 'd']
+```
+
+## Related projects
+
+* [arr-flatten](https://www.npmjs.com/package/arr-flatten): Recursively flatten an array or arrays. This is the fastest implementation of array flatten. | [homepage](https://github.com/jonschlinkert/arr-flatten)
+* [array-filter](https://www.npmjs.com/package/array-filter): Array#filter for older browsers. | [homepage](https://github.com/juliangruber/array-filter)
+* [array-intersection](https://www.npmjs.com/package/array-intersection): Return an array with the unique values present in _all_ given arrays using strict equality… [more](https://www.npmjs.com/package/array-intersection) | [homepage](https://github.com/jonschlinkert/array-intersection)
+
+## Running tests
+
+Install dev dependencies:
+
+```sh
+$ npm i -d && npm test
+```
+
+## Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](https://github.com/jonschlinkert/arr-diff/issues/new).
+
+## Author
+
+**Jon Schlinkert**
+
++ [github/jonschlinkert](https://github.com/jonschlinkert)
++ [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+
+## License
+
+Copyright © 2015 [Jon Schlinkert](https://github.com/jonschlinkert)
+Released under the MIT license.
+
+***
+
+_This file was generated by [verb](https://github.com/verbose/verb) on Sat Dec 05 2015 23:24:53 GMT-0500 (EST)._
diff --git a/node_modules/@babel/core/node_modules/arr-diff/index.js b/node_modules/@babel/core/node_modules/arr-diff/index.js
new file mode 100644
index 00000000..bc7200d8
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/arr-diff/index.js
@@ -0,0 +1,58 @@
+/*!
+ * arr-diff <https://github.com/jonschlinkert/arr-diff>
+ *
+ * Copyright (c) 2014 Jon Schlinkert, contributors.
+ * Licensed under the MIT License
+ */
+
+'use strict';
+
+var flatten = require('arr-flatten');
+var slice = [].slice;
+
+/**
+ * Return the difference between the first array and
+ * additional arrays.
+ *
+ * ```js
+ * var diff = require('{%= name %}');
+ *
+ * var a = ['a', 'b', 'c', 'd'];
+ * var b = ['b', 'c'];
+ *
+ * console.log(diff(a, b))
+ * //=> ['a', 'd']
+ * ```
+ *
+ * @param  {Array} `a`
+ * @param  {Array} `b`
+ * @return {Array}
+ * @api public
+ */
+
+function diff(arr, arrays) {
+  var argsLen = arguments.length;
+  var len = arr.length, i = -1;
+  var res = [], arrays;
+
+  if (argsLen === 1) {
+    return arr;
+  }
+
+  if (argsLen > 2) {
+    arrays = flatten(slice.call(arguments, 1));
+  }
+
+  while (++i < len) {
+    if (!~arrays.indexOf(arr[i])) {
+      res.push(arr[i]);
+    }
+  }
+  return res;
+}
+
+/**
+ * Expose `diff`
+ */
+
+module.exports = diff;
diff --git a/node_modules/@babel/core/node_modules/arr-diff/package.json b/node_modules/@babel/core/node_modules/arr-diff/package.json
new file mode 100644
index 00000000..d40c2103
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/arr-diff/package.json
@@ -0,0 +1,49 @@
+{
+  "name": "arr-diff",
+  "description": "Returns an array with only the unique values from the first array, by excluding all values from additional arrays using strict equality for comparisons.",
+  "version": "2.0.0",
+  "homepage": "https://github.com/jonschlinkert/arr-diff",
+  "author": "Jon Schlinkert (https://github.com/jonschlinkert)",
+  "repository": "jonschlinkert/arr-diff",
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/arr-diff/issues"
+  },
+  "license": "MIT",
+  "files": [
+    "index.js"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "dependencies": {
+    "arr-flatten": "^1.0.1"
+  },
+  "devDependencies": {
+    "array-differ": "^1.0.0",
+    "array-slice": "^0.2.3",
+    "benchmarked": "^0.1.4",
+    "chalk": "^1.1.1",
+    "mocha": "*",
+    "should": "*"
+  },
+  "keywords": [
+    "arr",
+    "array",
+    "diff",
+    "differ",
+    "difference"
+  ],
+  "verb": {
+    "related": {
+      "list": [
+        "arr-flatten",
+        "array-filter",
+        "array-intersection"
+      ]
+    }
+  }
+}
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/array-unique/LICENSE b/node_modules/@babel/core/node_modules/array-unique/LICENSE
new file mode 100755
index 00000000..fa30c4cb
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/array-unique/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2015, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/array-unique/README.md b/node_modules/@babel/core/node_modules/array-unique/README.md
new file mode 100755
index 00000000..2e287743
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/array-unique/README.md
@@ -0,0 +1,51 @@
+# array-unique [![NPM version](https://badge.fury.io/js/array-unique.svg)](http://badge.fury.io/js/array-unique)  [![Build Status](https://travis-ci.org/jonschlinkert/array-unique.svg)](https://travis-ci.org/jonschlinkert/array-unique) 
+
+> Return an array free of duplicate values. Fastest ES5 implementation.
+
+## Install with [npm](npmjs.org)
+
+```bash
+npm i array-unique --save
+```
+
+## Usage
+
+```js
+var unique = require('array-unique');
+
+unique(['a', 'b', 'c', 'c']);
+//=> ['a', 'b', 'c']
+```
+
+## Related
+* [arr-diff](https://github.com/jonschlinkert/arr-diff): Returns an array with only the unique values from the first array, by excluding all values from additional arrays using strict equality for comparisons.
+* [arr-union](https://github.com/jonschlinkert/arr-union): Returns an array of unique values using strict equality for comparisons.
+* [arr-flatten](https://github.com/jonschlinkert/arr-flatten): Recursively flatten an array or arrays. This is the fastest implementation of array flatten.
+* [arr-reduce](https://github.com/jonschlinkert/arr-reduce): Fast array reduce that also loops over sparse elements.
+* [arr-map](https://github.com/jonschlinkert/arr-map): Faster, node.js focused alternative to JavaScript's native array map.
+* [arr-pluck](https://github.com/jonschlinkert/arr-pluck): Retrieves the value of a specified property from all elements in the collection.
+
+## Run tests
+Install dev dependencies.
+
+```bash
+npm i -d && npm test
+```
+
+## Contributing
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](https://github.com/jonschlinkert/array-unique/issues)
+
+## Author
+
+**Jon Schlinkert**
+ 
++ [github/jonschlinkert](https://github.com/jonschlinkert)
++ [twitter/jonschlinkert](http://twitter.com/jonschlinkert) 
+
+## License
+Copyright (c) 2015 Jon Schlinkert  
+Released under the MIT license
+
+***
+
+_This file was generated by [verb-cli](https://github.com/assemble/verb-cli) on March 24, 2015._
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/array-unique/index.js b/node_modules/@babel/core/node_modules/array-unique/index.js
new file mode 100755
index 00000000..7fa75af9
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/array-unique/index.js
@@ -0,0 +1,28 @@
+/*!
+ * array-unique <https://github.com/jonschlinkert/array-unique>
+ *
+ * Copyright (c) 2014-2015, Jon Schlinkert.
+ * Licensed under the MIT License.
+ */
+
+'use strict';
+
+module.exports = function unique(arr) {
+  if (!Array.isArray(arr)) {
+    throw new TypeError('array-unique expects an array.');
+  }
+
+  var len = arr.length;
+  var i = -1;
+
+  while (i++ < len) {
+    var j = i + 1;
+
+    for (; j < arr.length; ++j) {
+      if (arr[i] === arr[j]) {
+        arr.splice(j--, 1);
+      }
+    }
+  }
+  return arr;
+};
diff --git a/node_modules/@babel/core/node_modules/array-unique/package.json b/node_modules/@babel/core/node_modules/array-unique/package.json
new file mode 100755
index 00000000..a493f69b
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/array-unique/package.json
@@ -0,0 +1,37 @@
+{
+  "name": "array-unique",
+  "description": "Return an array free of duplicate values. Fastest ES5 implementation.",
+  "version": "0.2.1",
+  "homepage": "https://github.com/jonschlinkert/array-unique",
+  "author": {
+    "name": "Jon Schlinkert",
+    "url": "https://github.com/jonschlinkert"
+  },
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/jonschlinkert/array-unique.git"
+  },
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/array-unique/issues"
+  },
+  "license": {
+    "type": "MIT",
+    "url": "https://github.com/jonschlinkert/array-unique/blob/master/LICENSE"
+  },
+  "files": [
+    "index.js"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "devDependencies": {
+    "array-uniq": "^1.0.2",
+    "benchmarked": "^0.1.3",
+    "mocha": "*",
+    "should": "*"
+  }
+}
diff --git a/node_modules/@babel/core/node_modules/braces/LICENSE b/node_modules/@babel/core/node_modules/braces/LICENSE
new file mode 100644
index 00000000..39245ac1
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/braces/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2016, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/braces/README.md b/node_modules/@babel/core/node_modules/braces/README.md
new file mode 100644
index 00000000..52fa7569
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/braces/README.md
@@ -0,0 +1,248 @@
+# braces [![NPM version](https://img.shields.io/npm/v/braces.svg?style=flat)](https://www.npmjs.com/package/braces) [![NPM downloads](https://img.shields.io/npm/dm/braces.svg?style=flat)](https://npmjs.org/package/braces) [![Build Status](https://img.shields.io/travis/jonschlinkert/braces.svg?style=flat)](https://travis-ci.org/jonschlinkert/braces)
+
+Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces specification.
+
+## Install
+
+Install with [npm](https://www.npmjs.com/):
+
+```sh
+$ npm install braces --save
+```
+
+## Features
+
+* Complete support for the braces part of the [Bash 4.3 Brace Expansion](www.gnu.org/software/bash/). Braces passes [all of the relevant unit tests](#bash-4-3-support) from the spec.
+* Expands comma-separated values: `a/{b,c}/d` => `['a/b/d', 'a/c/d']`
+* Expands alphabetical or numerical ranges: `{1..3}` => `['1', '2', '3']`
+* [Very fast](#benchmarks)
+* [Special characters](./patterns.md) can be used to generate interesting patterns.
+
+## Example usage
+
+```js
+var braces = require('braces');
+
+braces('a/{x,y}/c{d}e')
+//=> ['a/x/cde', 'a/y/cde']
+
+braces('a/b/c/{x,y}')
+//=> ['a/b/c/x', 'a/b/c/y']
+
+braces('a/{x,{1..5},y}/c{d}e')
+//=> ['a/x/cde', 'a/1/cde', 'a/y/cde', 'a/2/cde', 'a/3/cde', 'a/4/cde', 'a/5/cde']
+```
+
+### Use case: fixtures
+
+> Use braces to generate test fixtures!
+
+**Example**
+
+```js
+var braces = require('./');
+var path = require('path');
+var fs = require('fs');
+
+braces('blah/{a..z}.js').forEach(function(fp) {
+  if (!fs.existsSync(path.dirname(fp))) {
+    fs.mkdirSync(path.dirname(fp));
+  }
+  fs.writeFileSync(fp, '');
+});
+```
+
+See the [tests](./test/test.js) for more examples and use cases (also see the [bash spec tests](./test/bash-mm-adjusted.js));
+
+### Range expansion
+
+Uses [expand-range](https://github.com/jonschlinkert/expand-range) for range expansion.
+
+```js
+braces('a{1..3}b')
+//=> ['a1b', 'a2b', 'a3b']
+
+braces('a{5..8}b')
+//=> ['a5b', 'a6b', 'a7b', 'a8b']
+
+braces('a{00..05}b')
+//=> ['a00b', 'a01b', 'a02b', 'a03b', 'a04b', 'a05b']
+
+braces('a{01..03}b')
+//=> ['a01b', 'a02b', 'a03b']
+
+braces('a{000..005}b')
+//=> ['a000b', 'a001b', 'a002b', 'a003b', 'a004b', 'a005b']
+
+braces('a{a..e}b')
+//=> ['aab', 'abb', 'acb', 'adb', 'aeb']
+
+braces('a{A..E}b')
+//=> ['aAb', 'aBb', 'aCb', 'aDb', 'aEb']
+```
+
+Pass a function as the last argument to customize range expansions:
+
+```js
+var range = braces('x{a..e}y', function (str, i) {
+  return String.fromCharCode(str) + i;
+});
+
+console.log(range);
+//=> ['xa0y', 'xb1y', 'xc2y', 'xd3y', 'xe4y']
+```
+
+See [expand-range](https://github.com/jonschlinkert/expand-range) for benchmarks, tests and the full list of range expansion features.
+
+## Options
+
+### options.makeRe
+
+Type: `Boolean`
+
+Deafault: `false`
+
+Return a regex-optimal string. If you're using braces to generate regex, this will result in dramatically faster performance.
+
+**Examples**
+
+With the default settings (`{makeRe: false}`):
+
+```js
+braces('{1..5}');
+//=> ['1', '2', '3', '4', '5']
+```
+
+With `{makeRe: true}`:
+
+```js
+braces('{1..5}', {makeRe: true});
+//=> ['[1-5]']
+
+braces('{3..9..3}', {makeRe: true});
+//=> ['(3|6|9)']
+```
+
+### options.bash
+
+Type: `Boolean`
+
+Default: `false`
+
+Enables complete support for the Bash specification. The downside is a 20-25% speed decrease.
+
+**Example**
+
+Using the default setting (`{bash: false}`):
+
+```js
+braces('a{b}c');
+//=> ['abc']
+```
+
+In bash (and minimatch), braces with one item are not expanded. To get the same result with braces, set `{bash: true}`:
+
+```js
+braces('a{b}c', {bash: true});
+//=> ['a{b}c']
+```
+
+### options.nodupes
+
+Type: `Boolean`
+
+Deafault: `true`
+
+Duplicates are removed by default. To keep duplicates, pass `{nodupes: false}` on the options
+
+## Bash 4.3 Support
+
+> Better support for Bash 4.3 than minimatch
+
+This project has comprehensive unit tests, including tests coverted from [Bash 4.3](www.gnu.org/software/bash/). Currently only 8 of 102 unit tests fail, and
+
+## Run benchmarks
+
+Install dev dependencies:
+
+```bash
+npm i -d && npm benchmark
+```
+
+### Latest results
+
+```bash
+#1: escape.js
+  brace-expansion.js x 114,934 ops/sec ±1.24% (93 runs sampled)
+  braces.js x 342,254 ops/sec ±0.84% (90 runs sampled)
+
+#2: exponent.js
+  brace-expansion.js x 12,359 ops/sec ±0.86% (96 runs sampled)
+  braces.js x 20,389 ops/sec ±0.71% (97 runs sampled)
+
+#3: multiple.js
+  brace-expansion.js x 114,469 ops/sec ±1.44% (94 runs sampled)
+  braces.js x 401,621 ops/sec ±0.87% (91 runs sampled)
+
+#4: nested.js
+  brace-expansion.js x 102,769 ops/sec ±1.55% (92 runs sampled)
+  braces.js x 314,088 ops/sec ±0.71% (98 runs sampled)
+
+#5: normal.js
+  brace-expansion.js x 157,577 ops/sec ±1.65% (91 runs sampled)
+  braces.js x 1,115,950 ops/sec ±0.74% (94 runs sampled)
+
+#6: range.js
+  brace-expansion.js x 138,822 ops/sec ±1.71% (91 runs sampled)
+  braces.js x 1,108,353 ops/sec ±0.85% (94 runs sampled)
+```
+
+## Related projects
+
+You might also be interested in these projects:
+
+* [expand-range](https://www.npmjs.com/package/expand-range): Fast, bash-like range expansion. Expand a range of numbers or letters, uppercase or lowercase. See… [more](https://www.npmjs.com/package/expand-range) | [homepage](https://github.com/jonschlinkert/expand-range)
+* [fill-range](https://www.npmjs.com/package/fill-range): Fill in a range of numbers or letters, optionally passing an increment or multiplier to… [more](https://www.npmjs.com/package/fill-range) | [homepage](https://github.com/jonschlinkert/fill-range)
+* [micromatch](https://www.npmjs.com/package/micromatch): Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch. | [homepage](https://github.com/jonschlinkert/micromatch)
+
+## Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](https://github.com/jonschlinkert/braces/issues/new).
+
+## Building docs
+
+Generate readme and API documentation with [verb](https://github.com/verbose/verb):
+
+```sh
+$ npm install verb && npm run docs
+```
+
+Or, if [verb](https://github.com/verbose/verb) is installed globally:
+
+```sh
+$ verb
+```
+
+## Running tests
+
+Install dev dependencies:
+
+```sh
+$ npm install -d && npm test
+```
+
+## Author
+
+**Jon Schlinkert**
+
+* [github/jonschlinkert](https://github.com/jonschlinkert)
+* [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+
+## License
+
+Copyright © 2016, [Jon Schlinkert](https://github.com/jonschlinkert).
+Released under the [MIT license](https://github.com/jonschlinkert/braces/blob/master/LICENSE).
+
+***
+
+_This file was generated by [verb](https://github.com/verbose/verb), v0.9.0, on May 21, 2016._
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/braces/index.js b/node_modules/@babel/core/node_modules/braces/index.js
new file mode 100644
index 00000000..3b4c58d7
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/braces/index.js
@@ -0,0 +1,399 @@
+/*!
+ * braces <https://github.com/jonschlinkert/braces>
+ *
+ * Copyright (c) 2014-2015, Jon Schlinkert.
+ * Licensed under the MIT license.
+ */
+
+'use strict';
+
+/**
+ * Module dependencies
+ */
+
+var expand = require('expand-range');
+var repeat = require('repeat-element');
+var tokens = require('preserve');
+
+/**
+ * Expose `braces`
+ */
+
+module.exports = function(str, options) {
+  if (typeof str !== 'string') {
+    throw new Error('braces expects a string');
+  }
+  return braces(str, options);
+};
+
+/**
+ * Expand `{foo,bar}` or `{1..5}` braces in the
+ * given `string`.
+ *
+ * @param  {String} `str`
+ * @param  {Array} `arr`
+ * @param  {Object} `options`
+ * @return {Array}
+ */
+
+function braces(str, arr, options) {
+  if (str === '') {
+    return [];
+  }
+
+  if (!Array.isArray(arr)) {
+    options = arr;
+    arr = [];
+  }
+
+  var opts = options || {};
+  arr = arr || [];
+
+  if (typeof opts.nodupes === 'undefined') {
+    opts.nodupes = true;
+  }
+
+  var fn = opts.fn;
+  var es6;
+
+  if (typeof opts === 'function') {
+    fn = opts;
+    opts = {};
+  }
+
+  if (!(patternRe instanceof RegExp)) {
+    patternRe = patternRegex();
+  }
+
+  var matches = str.match(patternRe) || [];
+  var m = matches[0];
+
+  switch(m) {
+    case '\\,':
+      return escapeCommas(str, arr, opts);
+    case '\\.':
+      return escapeDots(str, arr, opts);
+    case '\/.':
+      return escapePaths(str, arr, opts);
+    case ' ':
+      return splitWhitespace(str);
+    case '{,}':
+      return exponential(str, opts, braces);
+    case '{}':
+      return emptyBraces(str, arr, opts);
+    case '\\{':
+    case '\\}':
+      return escapeBraces(str, arr, opts);
+    case '${':
+      if (!/\{[^{]+\{/.test(str)) {
+        return arr.concat(str);
+      } else {
+        es6 = true;
+        str = tokens.before(str, es6Regex());
+      }
+  }
+
+  if (!(braceRe instanceof RegExp)) {
+    braceRe = braceRegex();
+  }
+
+  var match = braceRe.exec(str);
+  if (match == null) {
+    return [str];
+  }
+
+  var outter = match[1];
+  var inner = match[2];
+  if (inner === '') { return [str]; }
+
+  var segs, segsLength;
+
+  if (inner.indexOf('..') !== -1) {
+    segs = expand(inner, opts, fn) || inner.split(',');
+    segsLength = segs.length;
+
+  } else if (inner[0] === '"' || inner[0] === '\'') {
+    return arr.concat(str.split(/['"]/).join(''));
+
+  } else {
+    segs = inner.split(',');
+    if (opts.makeRe) {
+      return braces(str.replace(outter, wrap(segs, '|')), opts);
+    }
+
+    segsLength = segs.length;
+    if (segsLength === 1 && opts.bash) {
+      segs[0] = wrap(segs[0], '\\');
+    }
+  }
+
+  var len = segs.length;
+  var i = 0, val;
+
+  while (len--) {
+    var path = segs[i++];
+
+    if (/(\.[^.\/])/.test(path)) {
+      if (segsLength > 1) {
+        return segs;
+      } else {
+        return [str];
+      }
+    }
+
+    val = splice(str, outter, path);
+
+    if (/\{[^{}]+?\}/.test(val)) {
+      arr = braces(val, arr, opts);
+    } else if (val !== '') {
+      if (opts.nodupes && arr.indexOf(val) !== -1) { continue; }
+      arr.push(es6 ? tokens.after(val) : val);
+    }
+  }
+
+  if (opts.strict) { return filter(arr, filterEmpty); }
+  return arr;
+}
+
+/**
+ * Expand exponential ranges
+ *
+ *   `a{,}{,}` => ['a', 'a', 'a', 'a']
+ */
+
+function exponential(str, options, fn) {
+  if (typeof options === 'function') {
+    fn = options;
+    options = null;
+  }
+
+  var opts = options || {};
+  var esc = '__ESC_EXP__';
+  var exp = 0;
+  var res;
+
+  var parts = str.split('{,}');
+  if (opts.nodupes) {
+    return fn(parts.join(''), opts);
+  }
+
+  exp = parts.length - 1;
+  res = fn(parts.join(esc), opts);
+  var len = res.length;
+  var arr = [];
+  var i = 0;
+
+  while (len--) {
+    var ele = res[i++];
+    var idx = ele.indexOf(esc);
+
+    if (idx === -1) {
+      arr.push(ele);
+
+    } else {
+      ele = ele.split('__ESC_EXP__').join('');
+      if (!!ele && opts.nodupes !== false) {
+        arr.push(ele);
+
+      } else {
+        var num = Math.pow(2, exp);
+        arr.push.apply(arr, repeat(ele, num));
+      }
+    }
+  }
+  return arr;
+}
+
+/**
+ * Wrap a value with parens, brackets or braces,
+ * based on the given character/separator.
+ *
+ * @param  {String|Array} `val`
+ * @param  {String} `ch`
+ * @return {String}
+ */
+
+function wrap(val, ch) {
+  if (ch === '|') {
+    return '(' + val.join(ch) + ')';
+  }
+  if (ch === ',') {
+    return '{' + val.join(ch) + '}';
+  }
+  if (ch === '-') {
+    return '[' + val.join(ch) + ']';
+  }
+  if (ch === '\\') {
+    return '\\{' + val + '\\}';
+  }
+}
+
+/**
+ * Handle empty braces: `{}`
+ */
+
+function emptyBraces(str, arr, opts) {
+  return braces(str.split('{}').join('\\{\\}'), arr, opts);
+}
+
+/**
+ * Filter out empty-ish values
+ */
+
+function filterEmpty(ele) {
+  return !!ele && ele !== '\\';
+}
+
+/**
+ * Handle patterns with whitespace
+ */
+
+function splitWhitespace(str) {
+  var segs = str.split(' ');
+  var len = segs.length;
+  var res = [];
+  var i = 0;
+
+  while (len--) {
+    res.push.apply(res, braces(segs[i++]));
+  }
+  return res;
+}
+
+/**
+ * Handle escaped braces: `\\{foo,bar}`
+ */
+
+function escapeBraces(str, arr, opts) {
+  if (!/\{[^{]+\{/.test(str)) {
+    return arr.concat(str.split('\\').join(''));
+  } else {
+    str = str.split('\\{').join('__LT_BRACE__');
+    str = str.split('\\}').join('__RT_BRACE__');
+    return map(braces(str, arr, opts), function(ele) {
+      ele = ele.split('__LT_BRACE__').join('{');
+      return ele.split('__RT_BRACE__').join('}');
+    });
+  }
+}
+
+/**
+ * Handle escaped dots: `{1\\.2}`
+ */
+
+function escapeDots(str, arr, opts) {
+  if (!/[^\\]\..+\\\./.test(str)) {
+    return arr.concat(str.split('\\').join(''));
+  } else {
+    str = str.split('\\.').join('__ESC_DOT__');
+    return map(braces(str, arr, opts), function(ele) {
+      return ele.split('__ESC_DOT__').join('.');
+    });
+  }
+}
+
+/**
+ * Handle escaped dots: `{1\\.2}`
+ */
+
+function escapePaths(str, arr, opts) {
+  str = str.split('\/.').join('__ESC_PATH__');
+  return map(braces(str, arr, opts), function(ele) {
+    return ele.split('__ESC_PATH__').join('\/.');
+  });
+}
+
+/**
+ * Handle escaped commas: `{a\\,b}`
+ */
+
+function escapeCommas(str, arr, opts) {
+  if (!/\w,/.test(str)) {
+    return arr.concat(str.split('\\').join(''));
+  } else {
+    str = str.split('\\,').join('__ESC_COMMA__');
+    return map(braces(str, arr, opts), function(ele) {
+      return ele.split('__ESC_COMMA__').join(',');
+    });
+  }
+}
+
+/**
+ * Regex for common patterns
+ */
+
+function patternRegex() {
+  return /\${|( (?=[{,}])|(?=[{,}]) )|{}|{,}|\\,(?=.*[{}])|\/\.(?=.*[{}])|\\\.(?={)|\\{|\\}/;
+}
+
+/**
+ * Braces regex.
+ */
+
+function braceRegex() {
+  return /.*(\\?\{([^}]+)\})/;
+}
+
+/**
+ * es6 delimiter regex.
+ */
+
+function es6Regex() {
+  return /\$\{([^}]+)\}/;
+}
+
+var braceRe;
+var patternRe;
+
+/**
+ * Faster alternative to `String.replace()` when the
+ * index of the token to be replaces can't be supplied
+ */
+
+function splice(str, token, replacement) {
+  var i = str.indexOf(token);
+  return str.substr(0, i) + replacement
+    + str.substr(i + token.length);
+}
+
+/**
+ * Fast array map
+ */
+
+function map(arr, fn) {
+  if (arr == null) {
+    return [];
+  }
+
+  var len = arr.length;
+  var res = new Array(len);
+  var i = -1;
+
+  while (++i < len) {
+    res[i] = fn(arr[i], i, arr);
+  }
+
+  return res;
+}
+
+/**
+ * Fast array filter
+ */
+
+function filter(arr, cb) {
+  if (arr == null) return [];
+  if (typeof cb !== 'function') {
+    throw new TypeError('braces: filter expects a callback function.');
+  }
+
+  var len = arr.length;
+  var res = arr.slice();
+  var i = 0;
+
+  while (len--) {
+    if (!cb(arr[len], i++)) {
+      res.splice(len, 1);
+    }
+  }
+  return res;
+}
diff --git a/node_modules/@babel/core/node_modules/braces/package.json b/node_modules/@babel/core/node_modules/braces/package.json
new file mode 100644
index 00000000..ab6bcdc3
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/braces/package.json
@@ -0,0 +1,83 @@
+{
+  "name": "braces",
+  "description": "Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces specification.",
+  "version": "1.8.5",
+  "homepage": "https://github.com/jonschlinkert/braces",
+  "author": "Jon Schlinkert (https://github.com/jonschlinkert)",
+  "repository": "jonschlinkert/braces",
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/braces/issues"
+  },
+  "license": "MIT",
+  "files": [
+    "index.js"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "dependencies": {
+    "expand-range": "^1.8.1",
+    "preserve": "^0.2.0",
+    "repeat-element": "^1.1.2"
+  },
+  "devDependencies": {
+    "benchmarked": "^0.1.5",
+    "brace-expansion": "^1.1.3",
+    "chalk": "^1.1.3",
+    "gulp-format-md": "^0.1.8",
+    "minimatch": "^3.0.0",
+    "minimist": "^1.2.0",
+    "mocha": "^2.4.5",
+    "should": "^8.3.1"
+  },
+  "keywords": [
+    "alpha",
+    "alphabetical",
+    "bash",
+    "brace",
+    "expand",
+    "expansion",
+    "filepath",
+    "fill",
+    "fs",
+    "glob",
+    "globbing",
+    "letter",
+    "match",
+    "matches",
+    "matching",
+    "number",
+    "numerical",
+    "path",
+    "range",
+    "ranges",
+    "sh"
+  ],
+  "verb": {
+    "plugins": [
+      "gulp-format-md"
+    ],
+    "reflinks": [
+      "verb"
+    ],
+    "toc": false,
+    "layout": "default",
+    "lint": {
+      "reflinks": true
+    },
+    "tasks": [
+      "readme"
+    ],
+    "related": {
+      "list": [
+        "micromatch",
+        "expand-range",
+        "fill-range"
+      ]
+    }
+  }
+}
diff --git a/node_modules/@babel/core/node_modules/debug/CHANGELOG.md b/node_modules/@babel/core/node_modules/debug/CHANGELOG.md
new file mode 100644
index 00000000..820d21e3
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,395 @@
+
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release
diff --git a/node_modules/@babel/core/node_modules/debug/LICENSE b/node_modules/@babel/core/node_modules/debug/LICENSE
new file mode 100644
index 00000000..658c933d
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/@babel/core/node_modules/debug/README.md b/node_modules/@babel/core/node_modules/debug/README.md
new file mode 100644
index 00000000..0ee7634d
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/README.md
@@ -0,0 +1,437 @@
+# debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
+
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+  "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger 
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :   
+```
+1 false
+2 true
+3 false
+```
+
+Usage :  
+`enable(namespaces)`  
+`namespaces` can include modes separated by a colon and wildcards.
+   
+Note that calling `enable()` completely overrides previously set DEBUG variable : 
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/debug/dist/debug.js b/node_modules/@babel/core/node_modules/debug/dist/debug.js
new file mode 100644
index 00000000..f271e01c
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/dist/debug.js
@@ -0,0 +1,886 @@
+"use strict";
+
+function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
+
+(function (f) {
+  if ((typeof exports === "undefined" ? "undefined" : _typeof(exports)) === "object" && typeof module !== "undefined") {
+    module.exports = f();
+  } else if (typeof define === "function" && define.amd) {
+    define([], f);
+  } else {
+    var g;
+
+    if (typeof window !== "undefined") {
+      g = window;
+    } else if (typeof global !== "undefined") {
+      g = global;
+    } else if (typeof self !== "undefined") {
+      g = self;
+    } else {
+      g = this;
+    }
+
+    g.debug = f();
+  }
+})(function () {
+  var define, module, exports;
+  return function () {
+    function r(e, n, t) {
+      function o(i, f) {
+        if (!n[i]) {
+          if (!e[i]) {
+            var c = "function" == typeof require && require;
+            if (!f && c) return c(i, !0);
+            if (u) return u(i, !0);
+            var a = new Error("Cannot find module '" + i + "'");
+            throw a.code = "MODULE_NOT_FOUND", a;
+          }
+
+          var p = n[i] = {
+            exports: {}
+          };
+          e[i][0].call(p.exports, function (r) {
+            var n = e[i][1][r];
+            return o(n || r);
+          }, p, p.exports, r, e, n, t);
+        }
+
+        return n[i].exports;
+      }
+
+      for (var u = "function" == typeof require && require, i = 0; i < t.length; i++) {
+        o(t[i]);
+      }
+
+      return o;
+    }
+
+    return r;
+  }()({
+    1: [function (require, module, exports) {
+      /**
+       * Helpers.
+       */
+      var s = 1000;
+      var m = s * 60;
+      var h = m * 60;
+      var d = h * 24;
+      var w = d * 7;
+      var y = d * 365.25;
+      /**
+       * Parse or format the given `val`.
+       *
+       * Options:
+       *
+       *  - `long` verbose formatting [false]
+       *
+       * @param {String|Number} val
+       * @param {Object} [options]
+       * @throws {Error} throw an error if val is not a non-empty string or a number
+       * @return {String|Number}
+       * @api public
+       */
+
+      module.exports = function (val, options) {
+        options = options || {};
+
+        var type = _typeof(val);
+
+        if (type === 'string' && val.length > 0) {
+          return parse(val);
+        } else if (type === 'number' && isNaN(val) === false) {
+          return options.long ? fmtLong(val) : fmtShort(val);
+        }
+
+        throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val));
+      };
+      /**
+       * Parse the given `str` and return milliseconds.
+       *
+       * @param {String} str
+       * @return {Number}
+       * @api private
+       */
+
+
+      function parse(str) {
+        str = String(str);
+
+        if (str.length > 100) {
+          return;
+        }
+
+        var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(str);
+
+        if (!match) {
+          return;
+        }
+
+        var n = parseFloat(match[1]);
+        var type = (match[2] || 'ms').toLowerCase();
+
+        switch (type) {
+          case 'years':
+          case 'year':
+          case 'yrs':
+          case 'yr':
+          case 'y':
+            return n * y;
+
+          case 'weeks':
+          case 'week':
+          case 'w':
+            return n * w;
+
+          case 'days':
+          case 'day':
+          case 'd':
+            return n * d;
+
+          case 'hours':
+          case 'hour':
+          case 'hrs':
+          case 'hr':
+          case 'h':
+            return n * h;
+
+          case 'minutes':
+          case 'minute':
+          case 'mins':
+          case 'min':
+          case 'm':
+            return n * m;
+
+          case 'seconds':
+          case 'second':
+          case 'secs':
+          case 'sec':
+          case 's':
+            return n * s;
+
+          case 'milliseconds':
+          case 'millisecond':
+          case 'msecs':
+          case 'msec':
+          case 'ms':
+            return n;
+
+          default:
+            return undefined;
+        }
+      }
+      /**
+       * Short format for `ms`.
+       *
+       * @param {Number} ms
+       * @return {String}
+       * @api private
+       */
+
+
+      function fmtShort(ms) {
+        var msAbs = Math.abs(ms);
+
+        if (msAbs >= d) {
+          return Math.round(ms / d) + 'd';
+        }
+
+        if (msAbs >= h) {
+          return Math.round(ms / h) + 'h';
+        }
+
+        if (msAbs >= m) {
+          return Math.round(ms / m) + 'm';
+        }
+
+        if (msAbs >= s) {
+          return Math.round(ms / s) + 's';
+        }
+
+        return ms + 'ms';
+      }
+      /**
+       * Long format for `ms`.
+       *
+       * @param {Number} ms
+       * @return {String}
+       * @api private
+       */
+
+
+      function fmtLong(ms) {
+        var msAbs = Math.abs(ms);
+
+        if (msAbs >= d) {
+          return plural(ms, msAbs, d, 'day');
+        }
+
+        if (msAbs >= h) {
+          return plural(ms, msAbs, h, 'hour');
+        }
+
+        if (msAbs >= m) {
+          return plural(ms, msAbs, m, 'minute');
+        }
+
+        if (msAbs >= s) {
+          return plural(ms, msAbs, s, 'second');
+        }
+
+        return ms + ' ms';
+      }
+      /**
+       * Pluralization helper.
+       */
+
+
+      function plural(ms, msAbs, n, name) {
+        var isPlural = msAbs >= n * 1.5;
+        return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+      }
+    }, {}],
+    2: [function (require, module, exports) {
+      // shim for using process in browser
+      var process = module.exports = {}; // cached from whatever global is present so that test runners that stub it
+      // don't break things.  But we need to wrap it in a try catch in case it is
+      // wrapped in strict mode code which doesn't define any globals.  It's inside a
+      // function because try/catches deoptimize in certain engines.
+
+      var cachedSetTimeout;
+      var cachedClearTimeout;
+
+      function defaultSetTimout() {
+        throw new Error('setTimeout has not been defined');
+      }
+
+      function defaultClearTimeout() {
+        throw new Error('clearTimeout has not been defined');
+      }
+
+      (function () {
+        try {
+          if (typeof setTimeout === 'function') {
+            cachedSetTimeout = setTimeout;
+          } else {
+            cachedSetTimeout = defaultSetTimout;
+          }
+        } catch (e) {
+          cachedSetTimeout = defaultSetTimout;
+        }
+
+        try {
+          if (typeof clearTimeout === 'function') {
+            cachedClearTimeout = clearTimeout;
+          } else {
+            cachedClearTimeout = defaultClearTimeout;
+          }
+        } catch (e) {
+          cachedClearTimeout = defaultClearTimeout;
+        }
+      })();
+
+      function runTimeout(fun) {
+        if (cachedSetTimeout === setTimeout) {
+          //normal enviroments in sane situations
+          return setTimeout(fun, 0);
+        } // if setTimeout wasn't available but was latter defined
+
+
+        if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
+          cachedSetTimeout = setTimeout;
+          return setTimeout(fun, 0);
+        }
+
+        try {
+          // when when somebody has screwed with setTimeout but no I.E. maddness
+          return cachedSetTimeout(fun, 0);
+        } catch (e) {
+          try {
+            // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+            return cachedSetTimeout.call(null, fun, 0);
+          } catch (e) {
+            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
+            return cachedSetTimeout.call(this, fun, 0);
+          }
+        }
+      }
+
+      function runClearTimeout(marker) {
+        if (cachedClearTimeout === clearTimeout) {
+          //normal enviroments in sane situations
+          return clearTimeout(marker);
+        } // if clearTimeout wasn't available but was latter defined
+
+
+        if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
+          cachedClearTimeout = clearTimeout;
+          return clearTimeout(marker);
+        }
+
+        try {
+          // when when somebody has screwed with setTimeout but no I.E. maddness
+          return cachedClearTimeout(marker);
+        } catch (e) {
+          try {
+            // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally
+            return cachedClearTimeout.call(null, marker);
+          } catch (e) {
+            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
+            // Some versions of I.E. have different rules for clearTimeout vs setTimeout
+            return cachedClearTimeout.call(this, marker);
+          }
+        }
+      }
+
+      var queue = [];
+      var draining = false;
+      var currentQueue;
+      var queueIndex = -1;
+
+      function cleanUpNextTick() {
+        if (!draining || !currentQueue) {
+          return;
+        }
+
+        draining = false;
+
+        if (currentQueue.length) {
+          queue = currentQueue.concat(queue);
+        } else {
+          queueIndex = -1;
+        }
+
+        if (queue.length) {
+          drainQueue();
+        }
+      }
+
+      function drainQueue() {
+        if (draining) {
+          return;
+        }
+
+        var timeout = runTimeout(cleanUpNextTick);
+        draining = true;
+        var len = queue.length;
+
+        while (len) {
+          currentQueue = queue;
+          queue = [];
+
+          while (++queueIndex < len) {
+            if (currentQueue) {
+              currentQueue[queueIndex].run();
+            }
+          }
+
+          queueIndex = -1;
+          len = queue.length;
+        }
+
+        currentQueue = null;
+        draining = false;
+        runClearTimeout(timeout);
+      }
+
+      process.nextTick = function (fun) {
+        var args = new Array(arguments.length - 1);
+
+        if (arguments.length > 1) {
+          for (var i = 1; i < arguments.length; i++) {
+            args[i - 1] = arguments[i];
+          }
+        }
+
+        queue.push(new Item(fun, args));
+
+        if (queue.length === 1 && !draining) {
+          runTimeout(drainQueue);
+        }
+      }; // v8 likes predictible objects
+
+
+      function Item(fun, array) {
+        this.fun = fun;
+        this.array = array;
+      }
+
+      Item.prototype.run = function () {
+        this.fun.apply(null, this.array);
+      };
+
+      process.title = 'browser';
+      process.browser = true;
+      process.env = {};
+      process.argv = [];
+      process.version = ''; // empty string to avoid regexp issues
+
+      process.versions = {};
+
+      function noop() {}
+
+      process.on = noop;
+      process.addListener = noop;
+      process.once = noop;
+      process.off = noop;
+      process.removeListener = noop;
+      process.removeAllListeners = noop;
+      process.emit = noop;
+      process.prependListener = noop;
+      process.prependOnceListener = noop;
+
+      process.listeners = function (name) {
+        return [];
+      };
+
+      process.binding = function (name) {
+        throw new Error('process.binding is not supported');
+      };
+
+      process.cwd = function () {
+        return '/';
+      };
+
+      process.chdir = function (dir) {
+        throw new Error('process.chdir is not supported');
+      };
+
+      process.umask = function () {
+        return 0;
+      };
+    }, {}],
+    3: [function (require, module, exports) {
+      /**
+       * This is the common logic for both the Node.js and web browser
+       * implementations of `debug()`.
+       */
+      function setup(env) {
+        createDebug.debug = createDebug;
+        createDebug.default = createDebug;
+        createDebug.coerce = coerce;
+        createDebug.disable = disable;
+        createDebug.enable = enable;
+        createDebug.enabled = enabled;
+        createDebug.humanize = require('ms');
+        Object.keys(env).forEach(function (key) {
+          createDebug[key] = env[key];
+        });
+        /**
+        * Active `debug` instances.
+        */
+
+        createDebug.instances = [];
+        /**
+        * The currently active debug mode names, and names to skip.
+        */
+
+        createDebug.names = [];
+        createDebug.skips = [];
+        /**
+        * Map of special "%n" handling functions, for the debug "format" argument.
+        *
+        * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+        */
+
+        createDebug.formatters = {};
+        /**
+        * Selects a color for a debug namespace
+        * @param {String} namespace The namespace string for the for the debug instance to be colored
+        * @return {Number|String} An ANSI color code for the given namespace
+        * @api private
+        */
+
+        function selectColor(namespace) {
+          var hash = 0;
+
+          for (var i = 0; i < namespace.length; i++) {
+            hash = (hash << 5) - hash + namespace.charCodeAt(i);
+            hash |= 0; // Convert to 32bit integer
+          }
+
+          return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+        }
+
+        createDebug.selectColor = selectColor;
+        /**
+        * Create a debugger with the given `namespace`.
+        *
+        * @param {String} namespace
+        * @return {Function}
+        * @api public
+        */
+
+        function createDebug(namespace) {
+          var prevTime;
+
+          function debug() {
+            for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+              args[_key] = arguments[_key];
+            }
+
+            // Disabled?
+            if (!debug.enabled) {
+              return;
+            }
+
+            var self = debug; // Set `diff` timestamp
+
+            var curr = Number(new Date());
+            var ms = curr - (prevTime || curr);
+            self.diff = ms;
+            self.prev = prevTime;
+            self.curr = curr;
+            prevTime = curr;
+            args[0] = createDebug.coerce(args[0]);
+
+            if (typeof args[0] !== 'string') {
+              // Anything else let's inspect with %O
+              args.unshift('%O');
+            } // Apply any `formatters` transformations
+
+
+            var index = 0;
+            args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
+              // If we encounter an escaped % then don't increase the array index
+              if (match === '%%') {
+                return match;
+              }
+
+              index++;
+              var formatter = createDebug.formatters[format];
+
+              if (typeof formatter === 'function') {
+                var val = args[index];
+                match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format`
+
+                args.splice(index, 1);
+                index--;
+              }
+
+              return match;
+            }); // Apply env-specific formatting (colors, etc.)
+
+            createDebug.formatArgs.call(self, args);
+            var logFn = self.log || createDebug.log;
+            logFn.apply(self, args);
+          }
+
+          debug.namespace = namespace;
+          debug.enabled = createDebug.enabled(namespace);
+          debug.useColors = createDebug.useColors();
+          debug.color = selectColor(namespace);
+          debug.destroy = destroy;
+          debug.extend = extend; // Debug.formatArgs = formatArgs;
+          // debug.rawLog = rawLog;
+          // env-specific initialization logic for debug instances
+
+          if (typeof createDebug.init === 'function') {
+            createDebug.init(debug);
+          }
+
+          createDebug.instances.push(debug);
+          return debug;
+        }
+
+        function destroy() {
+          var index = createDebug.instances.indexOf(this);
+
+          if (index !== -1) {
+            createDebug.instances.splice(index, 1);
+            return true;
+          }
+
+          return false;
+        }
+
+        function extend(namespace, delimiter) {
+          return createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+        }
+        /**
+        * Enables a debug mode by namespaces. This can include modes
+        * separated by a colon and wildcards.
+        *
+        * @param {String} namespaces
+        * @api public
+        */
+
+
+        function enable(namespaces) {
+          createDebug.save(namespaces);
+          createDebug.names = [];
+          createDebug.skips = [];
+          var i;
+          var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+          var len = split.length;
+
+          for (i = 0; i < len; i++) {
+            if (!split[i]) {
+              // ignore empty strings
+              continue;
+            }
+
+            namespaces = split[i].replace(/\*/g, '.*?');
+
+            if (namespaces[0] === '-') {
+              createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+            } else {
+              createDebug.names.push(new RegExp('^' + namespaces + '$'));
+            }
+          }
+
+          for (i = 0; i < createDebug.instances.length; i++) {
+            var instance = createDebug.instances[i];
+            instance.enabled = createDebug.enabled(instance.namespace);
+          }
+        }
+        /**
+        * Disable debug output.
+        *
+        * @api public
+        */
+
+
+        function disable() {
+          createDebug.enable('');
+        }
+        /**
+        * Returns true if the given mode name is enabled, false otherwise.
+        *
+        * @param {String} name
+        * @return {Boolean}
+        * @api public
+        */
+
+
+        function enabled(name) {
+          if (name[name.length - 1] === '*') {
+            return true;
+          }
+
+          var i;
+          var len;
+
+          for (i = 0, len = createDebug.skips.length; i < len; i++) {
+            if (createDebug.skips[i].test(name)) {
+              return false;
+            }
+          }
+
+          for (i = 0, len = createDebug.names.length; i < len; i++) {
+            if (createDebug.names[i].test(name)) {
+              return true;
+            }
+          }
+
+          return false;
+        }
+        /**
+        * Coerce `val`.
+        *
+        * @param {Mixed} val
+        * @return {Mixed}
+        * @api private
+        */
+
+
+        function coerce(val) {
+          if (val instanceof Error) {
+            return val.stack || val.message;
+          }
+
+          return val;
+        }
+
+        createDebug.enable(createDebug.load());
+        return createDebug;
+      }
+
+      module.exports = setup;
+    }, {
+      "ms": 1
+    }],
+    4: [function (require, module, exports) {
+      (function (process) {
+        /* eslint-env browser */
+
+        /**
+         * This is the web browser implementation of `debug()`.
+         */
+        exports.log = log;
+        exports.formatArgs = formatArgs;
+        exports.save = save;
+        exports.load = load;
+        exports.useColors = useColors;
+        exports.storage = localstorage();
+        /**
+         * Colors.
+         */
+
+        exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
+        /**
+         * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+         * and the Firebug extension (any Firefox version) are known
+         * to support "%c" CSS customizations.
+         *
+         * TODO: add a `localStorage` variable to explicitly enable/disable colors
+         */
+        // eslint-disable-next-line complexity
+
+        function useColors() {
+          // NB: In an Electron preload script, document will be defined but not fully
+          // initialized. Since we know we're in Chrome, we'll just detect this case
+          // explicitly
+          if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+            return true;
+          } // Internet Explorer and Edge do not support colors.
+
+
+          if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+            return false;
+          } // Is webkit? http://stackoverflow.com/a/16459606/376773
+          // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+
+
+          return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773
+          typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31?
+          // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+          typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker
+          typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
+        }
+        /**
+         * Colorize log arguments if enabled.
+         *
+         * @api public
+         */
+
+
+        function formatArgs(args) {
+          args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
+
+          if (!this.useColors) {
+            return;
+          }
+
+          var c = 'color: ' + this.color;
+          args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other
+          // arguments passed either before or after the %c, so we need to
+          // figure out the correct index to insert the CSS into
+
+          var index = 0;
+          var lastC = 0;
+          args[0].replace(/%[a-zA-Z%]/g, function (match) {
+            if (match === '%%') {
+              return;
+            }
+
+            index++;
+
+            if (match === '%c') {
+              // We only are interested in the *last* %c
+              // (the user may have provided their own)
+              lastC = index;
+            }
+          });
+          args.splice(lastC, 0, c);
+        }
+        /**
+         * Invokes `console.log()` when available.
+         * No-op when `console.log` is not a "function".
+         *
+         * @api public
+         */
+
+
+        function log() {
+          var _console;
+
+          // This hackery is required for IE8/9, where
+          // the `console.log` function doesn't have 'apply'
+          return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments);
+        }
+        /**
+         * Save `namespaces`.
+         *
+         * @param {String} namespaces
+         * @api private
+         */
+
+
+        function save(namespaces) {
+          try {
+            if (namespaces) {
+              exports.storage.setItem('debug', namespaces);
+            } else {
+              exports.storage.removeItem('debug');
+            }
+          } catch (error) {// Swallow
+            // XXX (@Qix-) should we be logging these?
+          }
+        }
+        /**
+         * Load `namespaces`.
+         *
+         * @return {String} returns the previously persisted debug modes
+         * @api private
+         */
+
+
+        function load() {
+          var r;
+
+          try {
+            r = exports.storage.getItem('debug');
+          } catch (error) {} // Swallow
+          // XXX (@Qix-) should we be logging these?
+          // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+
+
+          if (!r && typeof process !== 'undefined' && 'env' in process) {
+            r = process.env.DEBUG;
+          }
+
+          return r;
+        }
+        /**
+         * Localstorage attempts to return the localstorage.
+         *
+         * This is necessary because safari throws
+         * when a user disables cookies/localstorage
+         * and you attempt to access it.
+         *
+         * @return {LocalStorage}
+         * @api private
+         */
+
+
+        function localstorage() {
+          try {
+            // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+            // The Browser also has localStorage in the global context.
+            return localStorage;
+          } catch (error) {// Swallow
+            // XXX (@Qix-) should we be logging these?
+          }
+        }
+
+        module.exports = require('./common')(exports);
+        var formatters = module.exports.formatters;
+        /**
+         * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+         */
+
+        formatters.j = function (v) {
+          try {
+            return JSON.stringify(v);
+          } catch (error) {
+            return '[UnexpectedJSONParseError]: ' + error.message;
+          }
+        };
+      }).call(this, require('_process'));
+    }, {
+      "./common": 3,
+      "_process": 2
+    }]
+  }, {}, [4])(4);
+});
+
diff --git a/node_modules/@babel/core/node_modules/debug/node.js b/node_modules/@babel/core/node_modules/debug/node.js
new file mode 100644
index 00000000..7fc36fe6
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/node.js
@@ -0,0 +1 @@
+module.exports = require('./src/node');
diff --git a/node_modules/@babel/core/node_modules/debug/package.json b/node_modules/@babel/core/node_modules/debug/package.json
new file mode 100644
index 00000000..3650bb0b
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/package.json
@@ -0,0 +1,51 @@
+{
+  "name": "debug",
+  "version": "3.2.6",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/debug.git"
+  },
+  "description": "small debugging utility",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "files": [
+    "src",
+    "node.js",
+    "dist/debug.js",
+    "LICENSE",
+    "README.md"
+  ],
+  "author": "TJ Holowaychuk <tj@vision-media.ca>",
+  "contributors": [
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ],
+  "license": "MIT",
+  "dependencies": {
+    "ms": "^2.1.1"
+  },
+  "devDependencies": {
+    "@babel/cli": "^7.0.0",
+    "@babel/core": "^7.0.0",
+    "@babel/preset-env": "^7.0.0",
+    "browserify": "14.4.0",
+    "chai": "^3.5.0",
+    "concurrently": "^3.1.0",
+    "coveralls": "^3.0.2",
+    "istanbul": "^0.4.5",
+    "karma": "^3.0.0",
+    "karma-chai": "^0.1.0",
+    "karma-mocha": "^1.3.0",
+    "karma-phantomjs-launcher": "^1.0.2",
+    "mocha": "^5.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "rimraf": "^2.5.4",
+    "xo": "^0.23.0"
+  },
+  "main": "./src/index.js",
+  "browser": "./src/browser.js",
+  "unpkg": "./dist/debug.js"
+}
diff --git a/node_modules/@babel/core/node_modules/debug/src/browser.js b/node_modules/@babel/core/node_modules/debug/src/browser.js
new file mode 100644
index 00000000..c924b0ac
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/src/browser.js
@@ -0,0 +1,180 @@
+"use strict";
+
+function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
+
+/* eslint-env browser */
+
+/**
+ * This is the web browser implementation of `debug()`.
+ */
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = localstorage();
+/**
+ * Colors.
+ */
+
+exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+// eslint-disable-next-line complexity
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+    return true;
+  } // Internet Explorer and Edge do not support colors.
+
+
+  if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+    return false;
+  } // Is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+
+
+  return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773
+  typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31?
+  // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+  typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker
+  typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
+}
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+
+function formatArgs(args) {
+  args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
+
+  if (!this.useColors) {
+    return;
+  }
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function (match) {
+    if (match === '%%') {
+      return;
+    }
+
+    index++;
+
+    if (match === '%c') {
+      // We only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+  args.splice(lastC, 0, c);
+}
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+
+function log() {
+  var _console;
+
+  // This hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments);
+}
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+
+function save(namespaces) {
+  try {
+    if (namespaces) {
+      exports.storage.setItem('debug', namespaces);
+    } else {
+      exports.storage.removeItem('debug');
+    }
+  } catch (error) {// Swallow
+    // XXX (@Qix-) should we be logging these?
+  }
+}
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+
+function load() {
+  var r;
+
+  try {
+    r = exports.storage.getItem('debug');
+  } catch (error) {} // Swallow
+  // XXX (@Qix-) should we be logging these?
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+
+
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+
+function localstorage() {
+  try {
+    // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+    // The Browser also has localStorage in the global context.
+    return localStorage;
+  } catch (error) {// Swallow
+    // XXX (@Qix-) should we be logging these?
+  }
+}
+
+module.exports = require('./common')(exports);
+var formatters = module.exports.formatters;
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+formatters.j = function (v) {
+  try {
+    return JSON.stringify(v);
+  } catch (error) {
+    return '[UnexpectedJSONParseError]: ' + error.message;
+  }
+};
+
diff --git a/node_modules/@babel/core/node_modules/debug/src/common.js b/node_modules/@babel/core/node_modules/debug/src/common.js
new file mode 100644
index 00000000..e0de3fb5
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/src/common.js
@@ -0,0 +1,249 @@
+"use strict";
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ */
+function setup(env) {
+  createDebug.debug = createDebug;
+  createDebug.default = createDebug;
+  createDebug.coerce = coerce;
+  createDebug.disable = disable;
+  createDebug.enable = enable;
+  createDebug.enabled = enabled;
+  createDebug.humanize = require('ms');
+  Object.keys(env).forEach(function (key) {
+    createDebug[key] = env[key];
+  });
+  /**
+  * Active `debug` instances.
+  */
+
+  createDebug.instances = [];
+  /**
+  * The currently active debug mode names, and names to skip.
+  */
+
+  createDebug.names = [];
+  createDebug.skips = [];
+  /**
+  * Map of special "%n" handling functions, for the debug "format" argument.
+  *
+  * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+  */
+
+  createDebug.formatters = {};
+  /**
+  * Selects a color for a debug namespace
+  * @param {String} namespace The namespace string for the for the debug instance to be colored
+  * @return {Number|String} An ANSI color code for the given namespace
+  * @api private
+  */
+
+  function selectColor(namespace) {
+    var hash = 0;
+
+    for (var i = 0; i < namespace.length; i++) {
+      hash = (hash << 5) - hash + namespace.charCodeAt(i);
+      hash |= 0; // Convert to 32bit integer
+    }
+
+    return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+  }
+
+  createDebug.selectColor = selectColor;
+  /**
+  * Create a debugger with the given `namespace`.
+  *
+  * @param {String} namespace
+  * @return {Function}
+  * @api public
+  */
+
+  function createDebug(namespace) {
+    var prevTime;
+
+    function debug() {
+      // Disabled?
+      if (!debug.enabled) {
+        return;
+      }
+
+      for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+        args[_key] = arguments[_key];
+      }
+
+      var self = debug; // Set `diff` timestamp
+
+      var curr = Number(new Date());
+      var ms = curr - (prevTime || curr);
+      self.diff = ms;
+      self.prev = prevTime;
+      self.curr = curr;
+      prevTime = curr;
+      args[0] = createDebug.coerce(args[0]);
+
+      if (typeof args[0] !== 'string') {
+        // Anything else let's inspect with %O
+        args.unshift('%O');
+      } // Apply any `formatters` transformations
+
+
+      var index = 0;
+      args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
+        // If we encounter an escaped % then don't increase the array index
+        if (match === '%%') {
+          return match;
+        }
+
+        index++;
+        var formatter = createDebug.formatters[format];
+
+        if (typeof formatter === 'function') {
+          var val = args[index];
+          match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format`
+
+          args.splice(index, 1);
+          index--;
+        }
+
+        return match;
+      }); // Apply env-specific formatting (colors, etc.)
+
+      createDebug.formatArgs.call(self, args);
+      var logFn = self.log || createDebug.log;
+      logFn.apply(self, args);
+    }
+
+    debug.namespace = namespace;
+    debug.enabled = createDebug.enabled(namespace);
+    debug.useColors = createDebug.useColors();
+    debug.color = selectColor(namespace);
+    debug.destroy = destroy;
+    debug.extend = extend; // Debug.formatArgs = formatArgs;
+    // debug.rawLog = rawLog;
+    // env-specific initialization logic for debug instances
+
+    if (typeof createDebug.init === 'function') {
+      createDebug.init(debug);
+    }
+
+    createDebug.instances.push(debug);
+    return debug;
+  }
+
+  function destroy() {
+    var index = createDebug.instances.indexOf(this);
+
+    if (index !== -1) {
+      createDebug.instances.splice(index, 1);
+      return true;
+    }
+
+    return false;
+  }
+
+  function extend(namespace, delimiter) {
+    return createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+  }
+  /**
+  * Enables a debug mode by namespaces. This can include modes
+  * separated by a colon and wildcards.
+  *
+  * @param {String} namespaces
+  * @api public
+  */
+
+
+  function enable(namespaces) {
+    createDebug.save(namespaces);
+    createDebug.names = [];
+    createDebug.skips = [];
+    var i;
+    var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+    var len = split.length;
+
+    for (i = 0; i < len; i++) {
+      if (!split[i]) {
+        // ignore empty strings
+        continue;
+      }
+
+      namespaces = split[i].replace(/\*/g, '.*?');
+
+      if (namespaces[0] === '-') {
+        createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+      } else {
+        createDebug.names.push(new RegExp('^' + namespaces + '$'));
+      }
+    }
+
+    for (i = 0; i < createDebug.instances.length; i++) {
+      var instance = createDebug.instances[i];
+      instance.enabled = createDebug.enabled(instance.namespace);
+    }
+  }
+  /**
+  * Disable debug output.
+  *
+  * @api public
+  */
+
+
+  function disable() {
+    createDebug.enable('');
+  }
+  /**
+  * Returns true if the given mode name is enabled, false otherwise.
+  *
+  * @param {String} name
+  * @return {Boolean}
+  * @api public
+  */
+
+
+  function enabled(name) {
+    if (name[name.length - 1] === '*') {
+      return true;
+    }
+
+    var i;
+    var len;
+
+    for (i = 0, len = createDebug.skips.length; i < len; i++) {
+      if (createDebug.skips[i].test(name)) {
+        return false;
+      }
+    }
+
+    for (i = 0, len = createDebug.names.length; i < len; i++) {
+      if (createDebug.names[i].test(name)) {
+        return true;
+      }
+    }
+
+    return false;
+  }
+  /**
+  * Coerce `val`.
+  *
+  * @param {Mixed} val
+  * @return {Mixed}
+  * @api private
+  */
+
+
+  function coerce(val) {
+    if (val instanceof Error) {
+      return val.stack || val.message;
+    }
+
+    return val;
+  }
+
+  createDebug.enable(createDebug.load());
+  return createDebug;
+}
+
+module.exports = setup;
+
diff --git a/node_modules/@babel/core/node_modules/debug/src/index.js b/node_modules/@babel/core/node_modules/debug/src/index.js
new file mode 100644
index 00000000..02173159
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/src/index.js
@@ -0,0 +1,12 @@
+"use strict";
+
+/**
+ * Detect Electron renderer / nwjs process, which is node, but we should
+ * treat as a browser.
+ */
+if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
+  module.exports = require('./browser.js');
+} else {
+  module.exports = require('./node.js');
+}
+
diff --git a/node_modules/@babel/core/node_modules/debug/src/node.js b/node_modules/@babel/core/node_modules/debug/src/node.js
new file mode 100644
index 00000000..dbbb5f10
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/debug/src/node.js
@@ -0,0 +1,174 @@
+"use strict";
+
+/**
+ * Module dependencies.
+ */
+var tty = require('tty');
+
+var util = require('util');
+/**
+ * This is the Node.js implementation of `debug()`.
+ */
+
+
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+try {
+  // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
+  // eslint-disable-next-line import/no-extraneous-dependencies
+  var supportsColor = require('supports-color');
+
+  if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
+    exports.colors = [20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207, 208, 209, 214, 215, 220, 221];
+  }
+} catch (error) {} // Swallow - we only care if `supports-color` is available; it doesn't have to be.
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+  return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+  // Camel-case
+  var prop = key.substring(6).toLowerCase().replace(/_([a-z])/g, function (_, k) {
+    return k.toUpperCase();
+  }); // Coerce string value into JS value
+
+  var val = process.env[key];
+
+  if (/^(yes|on|true|enabled)$/i.test(val)) {
+    val = true;
+  } else if (/^(no|off|false|disabled)$/i.test(val)) {
+    val = false;
+  } else if (val === 'null') {
+    val = null;
+  } else {
+    val = Number(val);
+  }
+
+  obj[prop] = val;
+  return obj;
+}, {});
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  return 'colors' in exports.inspectOpts ? Boolean(exports.inspectOpts.colors) : tty.isatty(process.stderr.fd);
+}
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+
+function formatArgs(args) {
+  var name = this.namespace,
+      useColors = this.useColors;
+
+  if (useColors) {
+    var c = this.color;
+    var colorCode = "\x1B[3" + (c < 8 ? c : '8;5;' + c);
+    var prefix = "  ".concat(colorCode, ";1m").concat(name, " \x1B[0m");
+    args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+    args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + "\x1B[0m");
+  } else {
+    args[0] = getDate() + name + ' ' + args[0];
+  }
+}
+
+function getDate() {
+  if (exports.inspectOpts.hideDate) {
+    return '';
+  }
+
+  return new Date().toISOString() + ' ';
+}
+/**
+ * Invokes `util.format()` with the specified arguments and writes to stderr.
+ */
+
+
+function log() {
+  return process.stderr.write(util.format.apply(util, arguments) + '\n');
+}
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+
+function save(namespaces) {
+  if (namespaces) {
+    process.env.DEBUG = namespaces;
+  } else {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  }
+}
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+
+function load() {
+  return process.env.DEBUG;
+}
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+
+function init(debug) {
+  debug.inspectOpts = {};
+  var keys = Object.keys(exports.inspectOpts);
+
+  for (var i = 0; i < keys.length; i++) {
+    debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+  }
+}
+
+module.exports = require('./common')(exports);
+var formatters = module.exports.formatters;
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+formatters.o = function (v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts).replace(/\s*\n\s*/g, ' ');
+};
+/**
+ * Map %O to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+
+formatters.O = function (v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts);
+};
+
diff --git a/node_modules/@babel/core/node_modules/expand-brackets/LICENSE b/node_modules/@babel/core/node_modules/expand-brackets/LICENSE
new file mode 100644
index 00000000..1e49edf8
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/expand-brackets/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015-2016, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/expand-brackets/README.md b/node_modules/@babel/core/node_modules/expand-brackets/README.md
new file mode 100644
index 00000000..d3c913e7
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/expand-brackets/README.md
@@ -0,0 +1,107 @@
+# expand-brackets [![NPM version](https://img.shields.io/npm/v/expand-brackets.svg?style=flat)](https://www.npmjs.com/package/expand-brackets) [![NPM downloads](https://img.shields.io/npm/dm/expand-brackets.svg?style=flat)](https://npmjs.org/package/expand-brackets) [![Build Status](https://img.shields.io/travis/jonschlinkert/expand-brackets.svg?style=flat)](https://travis-ci.org/jonschlinkert/expand-brackets)
+
+> Expand POSIX bracket expressions (character classes) in glob patterns.
+
+## Install
+
+Install with [npm](https://www.npmjs.com/):
+
+```sh
+$ npm install expand-brackets --save
+```
+
+## Usage
+
+```js
+var brackets = require('expand-brackets');
+
+brackets('[![:lower:]]');
+//=> '[^a-z]'
+```
+
+## .isMatch
+
+Return true if the given string matches the bracket expression:
+
+```js
+brackets.isMatch('A', '[![:lower:]]');
+//=> true
+
+brackets.isMatch('a', '[![:lower:]]');
+//=> false
+```
+
+## .makeRe
+
+Make a regular expression from a bracket expression:
+
+```js
+brackets.makeRe('[![:lower:]]');
+//=> /[^a-z]/
+```
+
+The following named POSIX bracket expressions are supported:
+
+* `[:alnum:]`: Alphanumeric characters (`a-zA-Z0-9]`)
+* `[:alpha:]`: Alphabetic characters (`a-zA-Z]`)
+* `[:blank:]`: Space and tab (`[ t]`)
+* `[:digit:]`: Digits (`[0-9]`)
+* `[:lower:]`: Lowercase letters (`[a-z]`)
+* `[:punct:]`: Punctuation and symbols. (`[!"#$%&'()*+, -./:;<=>?@ [\]^_``{|}~]`)
+* `[:upper:]`: Uppercase letters (`[A-Z]`)
+* `[:word:]`: Word characters (letters, numbers and underscores) (`[A-Za-z0-9_]`)
+* `[:xdigit:]`: Hexadecimal digits (`[A-Fa-f0-9]`)
+
+Collating sequences are not supported.
+
+## Related projects
+
+You might also be interested in these projects:
+
+* [extglob](https://www.npmjs.com/package/extglob): Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to… [more](https://www.npmjs.com/package/extglob) | [homepage](https://github.com/jonschlinkert/extglob)
+* [is-extglob](https://www.npmjs.com/package/is-extglob): Returns true if a string has an extglob. | [homepage](https://github.com/jonschlinkert/is-extglob)
+* [is-glob](https://www.npmjs.com/package/is-glob): Returns `true` if the given string looks like a glob pattern or an extglob pattern.… [more](https://www.npmjs.com/package/is-glob) | [homepage](https://github.com/jonschlinkert/is-glob)
+* [is-posix-bracket](https://www.npmjs.com/package/is-posix-bracket): Returns true if the given string is a POSIX bracket expression (POSIX character class). | [homepage](https://github.com/jonschlinkert/is-posix-bracket)
+* [micromatch](https://www.npmjs.com/package/micromatch): Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch. Just… [more](https://www.npmjs.com/package/micromatch) | [homepage](https://github.com/jonschlinkert/micromatch)
+
+## Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](https://github.com/jonschlinkert/expand-brackets/issues/new).
+
+## Building docs
+
+Generate readme and API documentation with [verb](https://github.com/verbose/verb):
+
+```sh
+$ npm install verb && npm run docs
+```
+
+Or, if [verb](https://github.com/verbose/verb) is installed globally:
+
+```sh
+$ verb
+```
+
+## Running tests
+
+Install dev dependencies:
+
+```sh
+$ npm install -d && npm test
+```
+
+## Author
+
+**Jon Schlinkert**
+
+* [github/jonschlinkert](https://github.com/jonschlinkert)
+* [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+
+## License
+
+verb © 2016, [Jon Schlinkert](https://github.com/jonschlinkert).
+Released under the [MIT license](https://github.com/jonschlinkert/expand-brackets/blob/master/LICENSE).
+
+***
+
+_This file was generated by [verb](https://github.com/verbose/verb), v, on April 01, 2016._
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/expand-brackets/index.js b/node_modules/@babel/core/node_modules/expand-brackets/index.js
new file mode 100644
index 00000000..b843cc2b
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/expand-brackets/index.js
@@ -0,0 +1,163 @@
+/*!
+ * expand-brackets <https://github.com/jonschlinkert/expand-brackets>
+ *
+ * Copyright (c) 2015 Jon Schlinkert.
+ * Licensed under the MIT license.
+ */
+
+'use strict';
+
+var isPosixBracket = require('is-posix-bracket');
+
+/**
+ * POSIX character classes
+ */
+
+var POSIX = {
+  alnum: 'a-zA-Z0-9',
+  alpha: 'a-zA-Z',
+  blank: ' \\t',
+  cntrl: '\\x00-\\x1F\\x7F',
+  digit: '0-9',
+  graph: '\\x21-\\x7E',
+  lower: 'a-z',
+  print: '\\x20-\\x7E',
+  punct: '-!"#$%&\'()\\*+,./:;<=>?@[\\]^_`{|}~',
+  space: ' \\t\\r\\n\\v\\f',
+  upper: 'A-Z',
+  word:  'A-Za-z0-9_',
+  xdigit: 'A-Fa-f0-9',
+};
+
+/**
+ * Expose `brackets`
+ */
+
+module.exports = brackets;
+
+function brackets(str) {
+  if (!isPosixBracket(str)) {
+    return str;
+  }
+
+  var negated = false;
+  if (str.indexOf('[^') !== -1) {
+    negated = true;
+    str = str.split('[^').join('[');
+  }
+  if (str.indexOf('[!') !== -1) {
+    negated = true;
+    str = str.split('[!').join('[');
+  }
+
+  var a = str.split('[');
+  var b = str.split(']');
+  var imbalanced = a.length !== b.length;
+
+  var parts = str.split(/(?::\]\[:|\[?\[:|:\]\]?)/);
+  var len = parts.length, i = 0;
+  var end = '', beg = '';
+  var res = [];
+
+  // start at the end (innermost) first
+  while (len--) {
+    var inner = parts[i++];
+    if (inner === '^[!' || inner === '[!') {
+      inner = '';
+      negated = true;
+    }
+
+    var prefix = negated ? '^' : '';
+    var ch = POSIX[inner];
+
+    if (ch) {
+      res.push('[' + prefix + ch + ']');
+    } else if (inner) {
+      if (/^\[?\w-\w\]?$/.test(inner)) {
+        if (i === parts.length) {
+          res.push('[' + prefix + inner);
+        } else if (i === 1) {
+          res.push(prefix + inner + ']');
+        } else {
+          res.push(prefix + inner);
+        }
+      } else {
+        if (i === 1) {
+          beg += inner;
+        } else if (i === parts.length) {
+          end += inner;
+        } else {
+          res.push('[' + prefix + inner + ']');
+        }
+      }
+    }
+  }
+
+  var result = res.join('|');
+  var rlen = res.length || 1;
+  if (rlen > 1) {
+    result = '(?:' + result + ')';
+    rlen = 1;
+  }
+  if (beg) {
+    rlen++;
+    if (beg.charAt(0) === '[') {
+      if (imbalanced) {
+        beg = '\\[' + beg.slice(1);
+      } else {
+        beg += ']';
+      }
+    }
+    result = beg + result;
+  }
+  if (end) {
+    rlen++;
+    if (end.slice(-1) === ']') {
+      if (imbalanced) {
+        end = end.slice(0, end.length - 1) + '\\]';
+      } else {
+        end = '[' + end;
+      }
+    }
+    result += end;
+  }
+
+  if (rlen > 1) {
+    result = result.split('][').join(']|[');
+    if (result.indexOf('|') !== -1 && !/\(\?/.test(result)) {
+      result = '(?:' + result + ')';
+    }
+  }
+
+  result = result.replace(/\[+=|=\]+/g, '\\b');
+  return result;
+}
+
+brackets.makeRe = function(pattern) {
+  try {
+    return new RegExp(brackets(pattern));
+  } catch (err) {}
+};
+
+brackets.isMatch = function(str, pattern) {
+  try {
+    return brackets.makeRe(pattern).test(str);
+  } catch (err) {
+    return false;
+  }
+};
+
+brackets.match = function(arr, pattern) {
+  var len = arr.length, i = 0;
+  var res = arr.slice();
+
+  var re = brackets.makeRe(pattern);
+  while (i < len) {
+    var ele = arr[i++];
+    if (!re.test(ele)) {
+      continue;
+    }
+    res.splice(i, 1);
+  }
+  return res;
+};
diff --git a/node_modules/@babel/core/node_modules/expand-brackets/package.json b/node_modules/@babel/core/node_modules/expand-brackets/package.json
new file mode 100644
index 00000000..99dddafc
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/expand-brackets/package.json
@@ -0,0 +1,62 @@
+{
+  "name": "expand-brackets",
+  "description": "Expand POSIX bracket expressions (character classes) in glob patterns.",
+  "version": "0.1.5",
+  "homepage": "https://github.com/jonschlinkert/expand-brackets",
+  "author": "Jon Schlinkert (https://github.com/jonschlinkert)",
+  "repository": "jonschlinkert/expand-brackets",
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/expand-brackets/issues"
+  },
+  "license": "MIT",
+  "files": [
+    "index.js"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "dependencies": {
+    "is-posix-bracket": "^0.1.0"
+  },
+  "devDependencies": {
+    "gulp-format-md": "^0.1.7",
+    "mocha": "^2.2.5",
+    "should": "^7.0.2"
+  },
+  "keywords": [
+    "bracket",
+    "character class",
+    "expression",
+    "posix"
+  ],
+  "verb": {
+    "run": true,
+    "toc": false,
+    "layout": "default",
+    "tasks": [
+      "readme"
+    ],
+    "plugins": [
+      "gulp-format-md"
+    ],
+    "related": {
+      "list": [
+        "extglob",
+        "is-extglob",
+        "is-glob",
+        "is-posix-bracket",
+        "micromatch"
+      ]
+    },
+    "reflinks": [
+      "verb"
+    ],
+    "lint": {
+      "reflinks": true
+    }
+  }
+}
diff --git a/node_modules/@babel/core/node_modules/extglob/LICENSE b/node_modules/@babel/core/node_modules/extglob/LICENSE
new file mode 100644
index 00000000..65f90aca
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/extglob/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/extglob/README.md b/node_modules/@babel/core/node_modules/extglob/README.md
new file mode 100644
index 00000000..66644066
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/extglob/README.md
@@ -0,0 +1,88 @@
+# extglob [![NPM version](https://badge.fury.io/js/extglob.svg)](http://badge.fury.io/js/extglob)  [![Build Status](https://travis-ci.org/jonschlinkert/extglob.svg)](https://travis-ci.org/jonschlinkert/extglob)
+
+> Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to glob patterns.
+
+Install with [npm](https://www.npmjs.com/)
+
+```sh
+$ npm i extglob --save
+```
+
+Used by [micromatch](https://github.com/jonschlinkert/micromatch).
+
+**Features**
+
+* Convert an extglob string to a regex-compatible string. **Only converts extglobs**, to handle full globs use [micromatch](https://github.com/jonschlinkert/micromatch).
+* Pass `{regex: true}` to return a regex
+* Handles nested patterns
+* More complete (and correct) support than [minimatch](https://github.com/isaacs/minimatch)
+
+## Usage
+
+```js
+var extglob = require('extglob');
+
+extglob('?(z)');
+//=> '(?:z)?'
+extglob('*(z)');
+//=> '(?:z)*'
+extglob('+(z)');
+//=> '(?:z)+'
+extglob('@(z)');
+//=> '(?:z)'
+extglob('!(z)');
+//=> '(?!^(?:(?!z)[^/]*?)).*$'
+```
+
+**Optionally return regex**
+
+```js
+extglob('!(z)', {regex: true});
+//=> /(?!^(?:(?!z)[^/]*?)).*$/
+```
+
+## Extglob patterns
+
+To learn more about how extglobs work, see the docs for [Bash pattern matching](https://www.gnu.org/software/bash/manual/html_node/Pattern-Matching.html):
+
+* `?(pattern)`: Match zero or one occurrence of the given pattern.
+* `*(pattern)`: Match zero or more occurrences of the given pattern.
+* `+(pattern)`: Match one or more occurrences of the given pattern.
+* `@(pattern)`: Match one of the given pattern.
+* `!(pattern)`: Match anything except one of the given pattern.
+
+## Related
+
+* [braces](https://github.com/jonschlinkert/braces): Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces… [more](https://github.com/jonschlinkert/braces)
+* [expand-brackets](https://github.com/jonschlinkert/expand-brackets): Expand POSIX bracket expressions (character classes) in glob patterns.
+* [expand-range](https://github.com/jonschlinkert/expand-range): Fast, bash-like range expansion. Expand a range of numbers or letters, uppercase or lowercase. See… [more](https://github.com/jonschlinkert/expand-range)
+* [fill-range](https://github.com/jonschlinkert/fill-range): Fill in a range of numbers or letters, optionally passing an increment or multiplier to… [more](https://github.com/jonschlinkert/fill-range)
+* [micromatch](https://github.com/jonschlinkert/micromatch): Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch. Just… [more](https://github.com/jonschlinkert/micromatch)
+
+## Run tests
+
+Install dev dependencies:
+
+```sh
+$ npm i -d && npm test
+```
+
+## Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](https://github.com/jonschlinkert/extglob/issues/new)
+
+## Author
+
+**Jon Schlinkert**
+
++ [github/jonschlinkert](https://github.com/jonschlinkert)
++ [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+
+## License
+
+Copyright © 2015 Jon Schlinkert
+Released under the MIT license.
+
+***
+
+_This file was generated by [verb-cli](https://github.com/assemble/verb-cli) on August 01, 2015._
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/extglob/index.js b/node_modules/@babel/core/node_modules/extglob/index.js
new file mode 100644
index 00000000..2e774d4a
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/extglob/index.js
@@ -0,0 +1,178 @@
+/*!
+ * extglob <https://github.com/jonschlinkert/extglob>
+ *
+ * Copyright (c) 2015, Jon Schlinkert.
+ * Licensed under the MIT License.
+ */
+
+'use strict';
+
+/**
+ * Module dependencies
+ */
+
+var isExtglob = require('is-extglob');
+var re, cache = {};
+
+/**
+ * Expose `extglob`
+ */
+
+module.exports = extglob;
+
+/**
+ * Convert the given extglob `string` to a regex-compatible
+ * string.
+ *
+ * ```js
+ * var extglob = require('extglob');
+ * extglob('!(a?(b))');
+ * //=> '(?!a(?:b)?)[^/]*?'
+ * ```
+ *
+ * @param {String} `str` The string to convert.
+ * @param {Object} `options`
+ *   @option {Boolean} [options] `esc` If `false` special characters will not be escaped. Defaults to `true`.
+ *   @option {Boolean} [options] `regex` If `true` a regular expression is returned instead of a string.
+ * @return {String}
+ * @api public
+ */
+
+
+function extglob(str, opts) {
+  opts = opts || {};
+  var o = {}, i = 0;
+
+  // fix common character reversals
+  // '*!(.js)' => '*.!(js)'
+  str = str.replace(/!\(([^\w*()])/g, '$1!(');
+
+  // support file extension negation
+  str = str.replace(/([*\/])\.!\([*]\)/g, function (m, ch) {
+    if (ch === '/') {
+      return escape('\\/[^.]+');
+    }
+    return escape('[^.]+');
+  });
+
+  // create a unique key for caching by
+  // combining the string and options
+  var key = str
+    + String(!!opts.regex)
+    + String(!!opts.contains)
+    + String(!!opts.escape);
+
+  if (cache.hasOwnProperty(key)) {
+    return cache[key];
+  }
+
+  if (!(re instanceof RegExp)) {
+    re = regex();
+  }
+
+  opts.negate = false;
+  var m;
+
+  while (m = re.exec(str)) {
+    var prefix = m[1];
+    var inner = m[3];
+    if (prefix === '!') {
+      opts.negate = true;
+    }
+
+    var id = '__EXTGLOB_' + (i++) + '__';
+    // use the prefix of the _last_ (outtermost) pattern
+    o[id] = wrap(inner, prefix, opts.escape);
+    str = str.split(m[0]).join(id);
+  }
+
+  var keys = Object.keys(o);
+  var len = keys.length;
+
+  // we have to loop again to allow us to convert
+  // patterns in reverse order (starting with the
+  // innermost/last pattern first)
+  while (len--) {
+    var prop = keys[len];
+    str = str.split(prop).join(o[prop]);
+  }
+
+  var result = opts.regex
+    ? toRegex(str, opts.contains, opts.negate)
+    : str;
+
+  result = result.split('.').join('\\.');
+
+  // cache the result and return it
+  return (cache[key] = result);
+}
+
+/**
+ * Convert `string` to a regex string.
+ *
+ * @param  {String} `str`
+ * @param  {String} `prefix` Character that determines how to wrap the string.
+ * @param  {Boolean} `esc` If `false` special characters will not be escaped. Defaults to `true`.
+ * @return {String}
+ */
+
+function wrap(inner, prefix, esc) {
+  if (esc) inner = escape(inner);
+
+  switch (prefix) {
+    case '!':
+      return '(?!' + inner + ')[^/]' + (esc ? '%%%~' : '*?');
+    case '@':
+      return '(?:' + inner + ')';
+    case '+':
+      return '(?:' + inner + ')+';
+    case '*':
+      return '(?:' + inner + ')' + (esc ? '%%' : '*')
+    case '?':
+      return '(?:' + inner + '|)';
+    default:
+      return inner;
+  }
+}
+
+function escape(str) {
+  str = str.split('*').join('[^/]%%%~');
+  str = str.split('.').join('\\.');
+  return str;
+}
+
+/**
+ * extglob regex.
+ */
+
+function regex() {
+  return /(\\?[@?!+*$]\\?)(\(([^()]*?)\))/;
+}
+
+/**
+ * Negation regex
+ */
+
+function negate(str) {
+  return '(?!^' + str + ').*$';
+}
+
+/**
+ * Create the regex to do the matching. If
+ * the leading character in the `pattern` is `!`
+ * a negation regex is returned.
+ *
+ * @param {String} `pattern`
+ * @param {Boolean} `contains` Allow loose matching.
+ * @param {Boolean} `isNegated` True if the pattern is a negation pattern.
+ */
+
+function toRegex(pattern, contains, isNegated) {
+  var prefix = contains ? '^' : '';
+  var after = contains ? '$' : '';
+  pattern = ('(?:' + pattern + ')' + after);
+  if (isNegated) {
+    pattern = prefix + negate(pattern);
+  }
+  return new RegExp(prefix + pattern);
+}
diff --git a/node_modules/@babel/core/node_modules/extglob/package.json b/node_modules/@babel/core/node_modules/extglob/package.json
new file mode 100644
index 00000000..969cbe56
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/extglob/package.json
@@ -0,0 +1,60 @@
+{
+  "name": "extglob",
+  "description": "Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to glob patterns.",
+  "version": "0.3.2",
+  "homepage": "https://github.com/jonschlinkert/extglob",
+  "author": {
+    "name": "Jon Schlinkert",
+    "url": "https://github.com/jonschlinkert"
+  },
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/jonschlinkert/extglob.git"
+  },
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/extglob/issues"
+  },
+  "license": "MIT",
+  "files": [
+    "index.js"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "dependencies": {
+    "is-extglob": "^1.0.0"
+  },
+  "devDependencies": {
+    "ansi-green": "^0.1.1",
+    "micromatch": "^2.1.6",
+    "minimatch": "^2.0.1",
+    "minimist": "^1.1.0",
+    "mocha": "*",
+    "should": "*",
+    "success-symbol": "^0.1.0"
+  },
+  "keywords": [
+    "bash",
+    "extended",
+    "extglob",
+    "glob",
+    "ksh",
+    "match",
+    "wildcard"
+  ],
+  "verb": {
+    "related": {
+      "list": [
+        "micromatch",
+        "expand-brackets",
+        "braces",
+        "fill-range",
+        "expand-range"
+      ]
+    }
+  }
+}
diff --git a/node_modules/@babel/core/node_modules/micromatch/LICENSE b/node_modules/@babel/core/node_modules/micromatch/LICENSE
new file mode 100755
index 00000000..fa30c4cb
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014-2015, Jon Schlinkert.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/micromatch/README.md b/node_modules/@babel/core/node_modules/micromatch/README.md
new file mode 100644
index 00000000..8fb39191
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/README.md
@@ -0,0 +1,689 @@
+# micromatch [![NPM version](https://img.shields.io/npm/v/micromatch.svg?style=flat)](https://www.npmjs.com/package/micromatch) [![NPM downloads](https://img.shields.io/npm/dm/micromatch.svg?style=flat)](https://npmjs.org/package/micromatch) [![Build Status](https://img.shields.io/travis/jonschlinkert/micromatch.svg?style=flat)](https://travis-ci.org/jonschlinkert/micromatch)
+
+> Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch.
+
+Micromatch supports all of the same matching features as [minimatch](https://github.com/isaacs/minimatch) and [multimatch](https://github.com/sindresorhus/multimatch).
+
+* [mm()](#usage) is the same as [multimatch()](https://github.com/sindresorhus/multimatch)
+* [mm.match()](#match) is the same as [minimatch.match()](https://github.com/isaacs/minimatch)
+* use [mm.isMatch()](#ismatch) instead of [minimatch()](https://github.com/isaacs/minimatch)
+
+## Install
+
+Install with [npm](https://www.npmjs.com/):
+
+```sh
+$ npm install --save micromatch
+```
+
+## Start matching!
+
+```js
+var mm = require('micromatch');
+console.log(mm(['']))
+```
+
+***
+
+### Features
+
+* [Drop-in replacement](#switch-from-minimatch) for [minimatch](https://github.com/isaacs/minimatch) and [multimatch](https://github.com/sindresorhus/multimatch)
+* Built-in support for multiple glob patterns, like `['foo/*.js', '!bar.js']`
+* [Brace Expansion](https://github.com/jonschlinkert/braces) (`foo/bar-{1..5}.md`, `one/{two,three}/four.md`)
+* Typical glob patterns, like `**/*`, `a/b/*.js`, or `['foo/*.js', '!bar.js']`
+* Methods like `.isMatch()`, `.contains()` and `.any()`
+
+**Extended globbing features:**
+
+* Logical `OR` (`foo/bar/(abc|xyz).js`)
+* Regex character classes (`foo/bar/baz-[1-5].js`)
+* POSIX [bracket expressions](https://github.com/jonschlinkert/expand-brackets) (`**/[[:alpha:][:digit:]]/`)
+* [extglobs](https://github.com/jonschlinkert/extglob) (`**/+(x|y)`, `!(a|b)`, etc).
+
+You can combine these to create whatever matching patterns you need.
+
+**Example**
+
+```js
+// double-negation!
+mm(['fa', 'fb', 'f', 'fo'], '!(f!(o))');
+//=> ['fo']
+```
+
+## Why switch to micromatch?
+
+* Native support for multiple glob patterns, no need for wrappers like [multimatch](https://github.com/sindresorhus/multimatch)
+* [10-55x faster](#benchmarks) and more performant than [minimatch](https://github.com/isaacs/minimatch) and [multimatch](https://github.com/sindresorhus/multimatch). This is achieved through a combination of caching and regex optimization strategies, a fundamentally different approach than minimatch.
+* More extensive support for the Bash 4.3 specification
+* More complete extglob support
+* Extensive [unit tests](./test) (approx. 1,300 tests). Minimatch fails many of the tests.
+
+### Switch from minimatch
+
+Use `mm.isMatch()` instead of `minimatch()`:
+
+```js
+mm.isMatch('foo', 'b*');
+//=> false
+```
+
+Use `mm.match()` instead of `minimatch.match()`:
+
+```js
+mm.match(['foo', 'bar'], 'b*');
+//=> 'bar'
+```
+
+### Switch from multimatch
+
+Same signature:
+
+```js
+mm(['foo', 'bar', 'baz'], ['f*', '*z']);
+//=> ['foo', 'baz']
+```
+
+***
+
+## Usage
+
+Add micromatch to your node.js project:
+
+```js
+var mm = require('micromatch');
+```
+
+**Signature**
+
+```js
+mm(array_of_strings, glob_patterns[, options]);
+```
+
+**Example**
+
+```js
+mm(['foo', 'bar', 'baz'], 'b*');
+//=> ['bar', 'baz']
+```
+
+### Usage examples
+
+**Brace expansion**
+
+Match files with `.js` or `.txt` extensions.
+
+```js
+mm(['a.js', 'b.md', 'c.txt'], '*.{js,txt}');
+//=> ['a.js', 'c.txt']
+```
+
+**Extglobs**
+
+Match anything except for files with the `.md` extension.
+
+```js
+mm(files, '**/*.!(md)');
+
+//=> ['a.js', 'c.txt']
+```
+
+**Multiple patterns**
+
+Match using an array of patterns.
+
+```js
+mm(['a.md', 'b.js', 'c.txt', 'd.json'], ['*.md', '*.txt']);
+//=> ['a.md', 'c.txt']
+```
+
+**Negation patterns:**
+
+Behavior is designed to be what users would expect, based on conventions that are already well-established.
+
+* [minimatch](https://github.com/isaacs/minimatch) behavior is used when the pattern is a string, so patterns are **inclusive by default**.
+* [multimatch](https://github.com/sindresorhus/multimatch) behavior is used when an array of patterns is passed, so patterns are **exclusive by default**.
+
+```js
+mm(['a.js', 'b.md', 'c.txt'], '!*.{js,txt}');
+//=> ['b.md']
+
+mm(['a.md', 'b.js', 'c.txt', 'd.json'], ['*.*', '!*.{js,txt}']);
+//=> ['a.md', 'd.json']
+```
+
+***
+
+## API methods
+
+```js
+var mm = require('micromatch');
+```
+
+### .match
+
+```js
+mm.match(array, globString);
+```
+
+Return an array of files that match the given glob pattern. Useful if you only need to use a single glob pattern.
+
+**Example**
+
+```js
+mm.match(['ab', 'a/b', 'bb', 'b/c'], '?b');
+//=> ['ab', 'bb']
+
+mm.match(['ab', 'a/b', 'bb', 'b/c'], '*/b');
+//=> ['a/b']
+```
+
+### .isMatch
+
+```js
+mm.isMatch(filepath, globString);
+```
+
+Returns true if a file path matches the given glob pattern.
+
+**Example**
+
+```js
+mm.isMatch('.verb.md', '*.md');
+//=> false
+
+mm.isMatch('.verb.md', '*.md', {dot: true});
+//=> true
+```
+
+### .contains
+
+Returns true if any part of a file path matches the given glob pattern. Think of this is "has path" versus "is path".
+
+**Example**
+
+`.isMatch()` would return false for both of the following:
+
+```js
+mm.contains('a/b/c', 'a/b');
+//=> true
+
+mm.contains('a/b/c', 'a/*');
+//=> true
+```
+
+### .matcher
+
+Returns a function for matching using the supplied pattern. e.g. create your own "matcher". The advantage of this method is that the pattern can be compiled outside of a loop.
+
+**Pattern**
+
+Can be any of the following:
+
+* `glob/string`
+* `regex`
+* `function`
+
+**Example**
+
+```js
+var isMatch = mm.matcher('*.md');
+var files = [];
+
+['a.md', 'b.txt', 'c.md'].forEach(function(fp) {
+  if (isMatch(fp)) {
+    files.push(fp);
+  }
+});
+```
+
+### .filter
+
+Returns a function that can be passed to `Array#filter()`.
+
+**Params**
+
+* `patterns` **{String|Array}**:
+
+**Examples**
+
+Single glob:
+
+```js
+var fn = mm.filter('*.md');
+['a.js', 'b.txt', 'c.md'].filter(fn);
+//=> ['c.md']
+
+var fn = mm.filter('[a-c]');
+['a', 'b', 'c', 'd', 'e'].filter(fn);
+//=> ['a', 'b', 'c']
+```
+
+Array of glob patterns:
+
+```js
+var arr = [1,2,3,4,5,6,7,8,9,10,11,12,13,14,15];
+
+var fn = mm.filter(['{1..10}', '![7-9]', '!{3..4}']);
+arr.filter(fn);
+//=> [1, 2, 5, 6, 10]
+```
+
+_(Internally this function generates the matching function by using the [matcher](#matcher) method. You can use the [matcher](#matcher) method directly to create your own filter function)_
+
+### .any
+
+Returns true if a file path matches any of the given patterns.
+
+```js
+mm.any(filepath, patterns, options);
+```
+
+**Params**
+
+* filepath `{String}`: The file path to test.
+* patterns `{String|Array}`: One or more glob patterns
+* options: `{Object}`: options to pass to the `.matcher()` method.
+
+**Example**
+
+```js
+mm.any('abc', ['!*z']);
+//=> true
+mm.any('abc', ['a*', 'z*']);
+//=> true
+mm.any('abc', 'a*');
+//=> true
+mm.any('abc', ['z*']);
+//=> false
+```
+
+### .expand
+
+Returns an object with a regex-compatible string and tokens.
+
+```js
+mm.expand('*.js');
+
+// when `track` is enabled (for debugging), the `history` array is used
+// to record each mutation to the glob pattern as it's converted to regex
+{ options: { track: false, dot: undefined, makeRe: true, negated: false },
+  pattern: '(.*\\/|^)bar\\/(?:(?!(?:^|\\/)\\.).)*?',
+  history: [],
+  tokens:
+   { path:
+      { whole: '**/bar/**',
+        dirname: '**/bar/',
+        filename: '**',
+        basename: '**',
+        extname: '',
+        ext: '' },
+     is:
+      { glob: true,
+        negated: false,
+        globstar: true,
+        dotfile: false,
+        dotdir: false },
+     match: {},
+     original: '**/bar/**',
+     pattern: '**/bar/**',
+     base: '' } }
+```
+
+### .makeRe
+
+Create a regular expression for matching file paths based on the given pattern:
+
+```js
+mm.makeRe('*.js');
+//=> /^(?:(?!\.)(?=.)[^/]*?\.js)$/
+```
+
+## Options
+
+### options.unixify
+
+Normalize slashes in file paths and glob patterns to forward slashes.
+
+Type: `{Boolean}`
+
+Default: `undefined` on non-windows, `true` on windows.
+
+### options.dot
+
+Match dotfiles. Same behavior as [minimatch](https://github.com/isaacs/minimatch).
+
+Type: `{Boolean}`
+
+Default: `false`
+
+### options.unescape
+
+Unescape slashes in glob patterns. Use cautiously, especially on windows.
+
+Type: `{Boolean}`
+
+Default: `undefined`
+
+**Example**
+
+```js
+mm.isMatch('abc', '\\a\\b\\c', {unescape: true});
+//=> true
+```
+
+### options.nodupes
+
+Remove duplicate elements from the result array.
+
+Type: `{Boolean}`
+
+Default: `undefined`
+
+**Example**
+
+Example of using the `unescape` and `nodupes` options together:
+
+```js
+mm.match(['abc', '\\a\\b\\c'], '\\a\\b\\c', {unescape: true});
+//=> ['abc', 'abc']
+
+mm.match(['abc', '\\a\\b\\c'], '\\a\\b\\c', {unescape: true, nodupes: true});
+//=> ['abc']
+```
+
+### options.matchBase
+
+Allow glob patterns without slashes to match a file path based on its basename. . Same behavior as [minimatch](https://github.com/isaacs/minimatch).
+
+Type: `{Boolean}`
+
+Default: `false`
+
+**Example**
+
+```js
+mm(['a/b.js', 'a/c.md'], '*.js');
+//=> []
+
+mm(['a/b.js', 'a/c.md'], '*.js', {matchBase: true});
+//=> ['a/b.js']
+```
+
+### options.nobraces
+
+Don't expand braces in glob patterns. Same behavior as [minimatch](https://github.com/isaacs/minimatch) `nobrace`.
+
+Type: `{Boolean}`
+
+Default: `undefined`
+
+See [braces](https://github.com/jonschlinkert/braces) for more information about extended brace expansion.
+
+### options.nobrackets
+
+Don't expand POSIX bracket expressions.
+
+Type: `{Boolean}`
+
+Default: `undefined`
+
+See [expand-brackets](https://github.com/jonschlinkert/expand-brackets) for more information about extended bracket expressions.
+
+### options.noextglob
+
+Don't expand extended globs.
+
+Type: `{Boolean}`
+
+Default: `undefined`
+
+See [extglob](https://github.com/jonschlinkert/extglob) for more information about extended globs.
+
+### options.nocase
+
+Use a case-insensitive regex for matching files. Same behavior as [minimatch](https://github.com/isaacs/minimatch).
+
+Type: `{Boolean}`
+
+Default: `false`
+
+### options.nonegate
+
+Disallow negation (`!`) patterns.
+
+Type: `{Boolean}`
+
+Default: `false`
+
+### options.nonull
+
+If `true`, when no matches are found the actual (array-ified) glob pattern is returned instead of an empty array. Same behavior as [minimatch](https://github.com/isaacs/minimatch).
+
+Type: `{Boolean}`
+
+Default: `false`
+
+### options.cache
+
+Cache the platform (e.g. `win32`) to prevent this from being looked up for every filepath.
+
+Type: `{Boolean}`
+
+Default: `true`
+
+***
+
+## Other features
+
+Micromatch also supports the following.
+
+### Extended globbing
+
+#### extglobs
+
+Extended globbing, as described by the bash man page:
+
+| **pattern** | **regex equivalent** | **description** | 
+| --- | --- | --- |
+| `?(pattern-list)` | `(... | ...)?` | Matches zero or one occurrence of the given patterns |
+| `*(pattern-list)` | `(... | ...)*` | Matches zero or more occurrences of the given patterns |
+| `+(pattern-list)` | `(... | ...)+` | Matches one or more occurrences of the given patterns |
+| `@(pattern-list)` | `(... | ...)` <sup>*</sup> | Matches one of the given patterns |
+| `!(pattern-list)` | N/A | Matches anything except one of the given patterns |
+
+<sup><strong>*</strong></sup> `@` isn't a RegEx character.
+
+Powered by [extglob](https://github.com/jonschlinkert/extglob). Visit that library for the full range of options or to report extglob related issues.
+
+See [extglob](https://github.com/jonschlinkert/extglob) for more information about extended globs.
+
+#### brace expansion
+
+In simple cases, brace expansion appears to work the same way as the logical `OR` operator. For example, `(a|b)` will achieve the same result as `{a,b}`.
+
+Here are some powerful features unique to brace expansion (versus character classes):
+
+* range expansion: `a{1..3}b/*.js` expands to: `['a1b/*.js', 'a2b/*.js', 'a3b/*.js']`
+* nesting: `a{c,{d,e}}b/*.js` expands to: `['acb/*.js', 'adb/*.js', 'aeb/*.js']`
+
+Visit [braces](https://github.com/jonschlinkert/braces) to ask questions and create an issue related to brace-expansion, or to see the full range of features and options related to brace expansion.
+
+#### regex character classes
+
+With the exception of brace expansion (`{a,b}`, `{1..5}`, etc), most of the special characters convert directly to regex, so you can expect them to follow the same rules and produce the same results as regex.
+
+For example, given the list: `['a.js', 'b.js', 'c.js', 'd.js', 'E.js']`:
+
+* `[ac].js`: matches both `a` and `c`, returning `['a.js', 'c.js']`
+* `[b-d].js`: matches from `b` to `d`, returning `['b.js', 'c.js', 'd.js']`
+* `[b-d].js`: matches from `b` to `d`, returning `['b.js', 'c.js', 'd.js']`
+* `a/[A-Z].js`: matches and uppercase letter, returning `['a/E.md']`
+
+Learn about [regex character classes](http://www.regular-expressions.info/charclass.html).
+
+#### regex groups
+
+Given `['a.js', 'b.js', 'c.js', 'd.js', 'E.js']`:
+
+* `(a|c).js`: would match either `a` or `c`, returning `['a.js', 'c.js']`
+* `(b|d).js`: would match either `b` or `d`, returning `['b.js', 'd.js']`
+* `(b|[A-Z]).js`: would match either `b` or an uppercase letter, returning `['b.js', 'E.js']`
+
+As with regex, parenthese can be nested, so patterns like `((a|b)|c)/b` will work. But it might be easier to achieve your goal using brace expansion.
+
+#### POSIX bracket expressions
+
+**Example**
+
+```js
+mm.isMatch('a1', '[[:alpha:][:digit:]]');
+//=> true
+```
+
+See [expand-brackets](https://github.com/jonschlinkert/expand-brackets) for more information about extended bracket expressions.
+
+***
+
+## Notes
+
+Whenever possible parsing behavior for patterns is based on globbing specifications in Bash 4.3. Patterns that aren't described by Bash follow wildmatch spec (used by git).
+
+## Benchmarks
+
+Run the [benchmarks](./benchmark):
+
+```bash
+node benchmark
+```
+
+As of July 15, 2016:
+
+```bash
+#1: basename-braces
+  micromatch x 26,420 ops/sec ±0.89% (91 runs sampled)
+  minimatch x 3,507 ops/sec ±0.64% (97 runs sampled)
+
+#2: basename
+  micromatch x 25,315 ops/sec ±0.82% (93 runs sampled)
+  minimatch x 4,398 ops/sec ±0.86% (94 runs sampled)
+
+#3: braces-no-glob
+  micromatch x 341,254 ops/sec ±0.78% (93 runs sampled)
+  minimatch x 30,197 ops/sec ±1.12% (91 runs sampled)
+
+#4: braces
+  micromatch x 54,649 ops/sec ±0.74% (94 runs sampled)
+  minimatch x 3,095 ops/sec ±0.82% (95 runs sampled)
+
+#5: immediate
+  micromatch x 16,719 ops/sec ±0.79% (95 runs sampled)
+  minimatch x 4,348 ops/sec ±0.86% (96 runs sampled)
+
+#6: large
+  micromatch x 721 ops/sec ±0.77% (94 runs sampled)
+  minimatch x 17.73 ops/sec ±1.08% (50 runs sampled)
+
+#7: long
+  micromatch x 5,051 ops/sec ±0.87% (97 runs sampled)
+  minimatch x 628 ops/sec ±0.83% (94 runs sampled)
+
+#8: mid
+  micromatch x 51,280 ops/sec ±0.80% (95 runs sampled)
+  minimatch x 1,923 ops/sec ±0.84% (95 runs sampled)
+
+#9: multi-patterns
+  micromatch x 22,440 ops/sec ±0.97% (94 runs sampled)
+  minimatch x 2,481 ops/sec ±1.10% (94 runs sampled)
+
+#10: no-glob
+  micromatch x 722,823 ops/sec ±1.30% (87 runs sampled)
+  minimatch x 52,967 ops/sec ±1.09% (94 runs sampled)
+
+#11: range
+  micromatch x 243,471 ops/sec ±0.79% (94 runs sampled)
+  minimatch x 11,736 ops/sec ±0.82% (96 runs sampled)
+
+#12: shallow
+  micromatch x 190,874 ops/sec ±0.98% (95 runs sampled)
+  minimatch x 21,699 ops/sec ±0.81% (97 runs sampled)
+
+#13: short
+  micromatch x 496,393 ops/sec ±3.86% (90 runs sampled)
+  minimatch x 53,765 ops/sec ±0.75% (95 runs sampled)
+```
+
+## Tests
+
+### Running tests
+
+Install dev dependencies:
+
+```sh
+$ npm install -d && npm test
+```
+
+### Coverage
+
+As of July 15, 2016:
+
+```sh
+Statements : 100% (441/441)
+Branches   : 100% (270/270)
+Functions  : 100% (54/54)
+Lines      : 100% (429/429)
+```
+
+## Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
+
+Please be sure to run the benchmarks before/after any code changes to judge the impact before you do a PR. thanks!
+
+## Related
+
+* [braces](https://www.npmjs.com/package/braces): Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces… [more](https://github.com/jonschlinkert/braces) | [homepage](https://github.com/jonschlinkert/braces "Fastest brace expansion for node.js, with the most complete support for the Bash 4.3 braces specification.")
+* [expand-brackets](https://www.npmjs.com/package/expand-brackets): Expand POSIX bracket expressions (character classes) in glob patterns. | [homepage](https://github.com/jonschlinkert/expand-brackets "Expand POSIX bracket expressions (character classes) in glob patterns.")
+* [expand-range](https://www.npmjs.com/package/expand-range): Fast, bash-like range expansion. Expand a range of numbers or letters, uppercase or lowercase. See… [more](https://github.com/jonschlinkert/expand-range) | [homepage](https://github.com/jonschlinkert/expand-range "Fast, bash-like range expansion. Expand a range of numbers or letters, uppercase or lowercase. See the benchmarks. Used by micromatch.")
+* [extglob](https://www.npmjs.com/package/extglob): Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to… [more](https://github.com/jonschlinkert/extglob) | [homepage](https://github.com/jonschlinkert/extglob "Convert extended globs to regex-compatible strings. Add (almost) the expressive power of regular expressions to glob patterns.")
+* [fill-range](https://www.npmjs.com/package/fill-range): Fill in a range of numbers or letters, optionally passing an increment or multiplier to… [more](https://github.com/jonschlinkert/fill-range) | [homepage](https://github.com/jonschlinkert/fill-range "Fill in a range of numbers or letters, optionally passing an increment or multiplier to use.")
+* [gulp-micromatch](https://www.npmjs.com/package/gulp-micromatch): Filter vinyl files with glob patterns, string, regexp, array, object or matcher function. micromatch stream. | [homepage](https://github.com/tunnckocore/gulp-micromatch#readme "Filter vinyl files with glob patterns, string, regexp, array, object or matcher function. micromatch stream.")
+* [is-glob](https://www.npmjs.com/package/is-glob): Returns `true` if the given string looks like a glob pattern or an extglob pattern… [more](https://github.com/jonschlinkert/is-glob) | [homepage](https://github.com/jonschlinkert/is-glob "Returns `true` if the given string looks like a glob pattern or an extglob pattern. This makes it easy to create code that only uses external modules like node-glob when necessary, resulting in much faster code execution and initialization time, and a bet")
+* [parse-glob](https://www.npmjs.com/package/parse-glob): Parse a glob pattern into an object of tokens. | [homepage](https://github.com/jonschlinkert/parse-glob "Parse a glob pattern into an object of tokens.")
+
+## Contributing
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
+
+## Building docs
+
+_(This document was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme) (a [verb](https://github.com/verbose/verb) generator), please don't edit the readme directly. Any changes to the readme must be made in [.verb.md](.verb.md).)_
+
+To generate the readme and API documentation with [verb](https://github.com/verbose/verb):
+
+```sh
+$ npm install -g verb verb-generate-readme && verb
+```
+
+## Running tests
+
+Install dev dependencies:
+
+```sh
+$ npm install -d && npm test
+```
+
+## Author
+
+**Jon Schlinkert**
+
+* [github/jonschlinkert](https://github.com/jonschlinkert)
+* [twitter/jonschlinkert](http://twitter.com/jonschlinkert)
+
+## License
+
+Copyright © 2016, [Jon Schlinkert](https://github.com/jonschlinkert).
+Released under the [MIT license](https://github.com/jonschlinkert/micromatch/blob/master/LICENSE).
+
+***
+
+_This file was generated by [verb](https://github.com/verbose/verb), v0.9.0, on July 15, 2016._
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/micromatch/index.js b/node_modules/@babel/core/node_modules/micromatch/index.js
new file mode 100755
index 00000000..f898ec17
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/index.js
@@ -0,0 +1,431 @@
+/*!
+ * micromatch <https://github.com/jonschlinkert/micromatch>
+ *
+ * Copyright (c) 2014-2015, Jon Schlinkert.
+ * Licensed under the MIT License.
+ */
+
+'use strict';
+
+var expand = require('./lib/expand');
+var utils = require('./lib/utils');
+
+/**
+ * The main function. Pass an array of filepaths,
+ * and a string or array of glob patterns
+ *
+ * @param  {Array|String} `files`
+ * @param  {Array|String} `patterns`
+ * @param  {Object} `opts`
+ * @return {Array} Array of matches
+ */
+
+function micromatch(files, patterns, opts) {
+  if (!files || !patterns) return [];
+  opts = opts || {};
+
+  if (typeof opts.cache === 'undefined') {
+    opts.cache = true;
+  }
+
+  if (!Array.isArray(patterns)) {
+    return match(files, patterns, opts);
+  }
+
+  var len = patterns.length, i = 0;
+  var omit = [], keep = [];
+
+  while (len--) {
+    var glob = patterns[i++];
+    if (typeof glob === 'string' && glob.charCodeAt(0) === 33 /* ! */) {
+      omit.push.apply(omit, match(files, glob.slice(1), opts));
+    } else {
+      keep.push.apply(keep, match(files, glob, opts));
+    }
+  }
+  return utils.diff(keep, omit);
+}
+
+/**
+ * Return an array of files that match the given glob pattern.
+ *
+ * This function is called by the main `micromatch` function If you only
+ * need to pass a single pattern you might get very minor speed improvements
+ * using this function.
+ *
+ * @param  {Array} `files`
+ * @param  {String} `pattern`
+ * @param  {Object} `options`
+ * @return {Array}
+ */
+
+function match(files, pattern, opts) {
+  if (utils.typeOf(files) !== 'string' && !Array.isArray(files)) {
+    throw new Error(msg('match', 'files', 'a string or array'));
+  }
+
+  files = utils.arrayify(files);
+  opts = opts || {};
+
+  var negate = opts.negate || false;
+  var orig = pattern;
+
+  if (typeof pattern === 'string') {
+    negate = pattern.charAt(0) === '!';
+    if (negate) {
+      pattern = pattern.slice(1);
+    }
+
+    // we need to remove the character regardless,
+    // so the above logic is still needed
+    if (opts.nonegate === true) {
+      negate = false;
+    }
+  }
+
+  var _isMatch = matcher(pattern, opts);
+  var len = files.length, i = 0;
+  var res = [];
+
+  while (i < len) {
+    var file = files[i++];
+    var fp = utils.unixify(file, opts);
+
+    if (!_isMatch(fp)) { continue; }
+    res.push(fp);
+  }
+
+  if (res.length === 0) {
+    if (opts.failglob === true) {
+      throw new Error('micromatch.match() found no matches for: "' + orig + '".');
+    }
+
+    if (opts.nonull || opts.nullglob) {
+      res.push(utils.unescapeGlob(orig));
+    }
+  }
+
+  // if `negate` was defined, diff negated files
+  if (negate) { res = utils.diff(files, res); }
+
+  // if `ignore` was defined, diff ignored filed
+  if (opts.ignore && opts.ignore.length) {
+    pattern = opts.ignore;
+    opts = utils.omit(opts, ['ignore']);
+    res = utils.diff(res, micromatch(res, pattern, opts));
+  }
+
+  if (opts.nodupes) {
+    return utils.unique(res);
+  }
+  return res;
+}
+
+/**
+ * Returns a function that takes a glob pattern or array of glob patterns
+ * to be used with `Array#filter()`. (Internally this function generates
+ * the matching function using the [matcher] method).
+ *
+ * ```js
+ * var fn = mm.filter('[a-c]');
+ * ['a', 'b', 'c', 'd', 'e'].filter(fn);
+ * //=> ['a', 'b', 'c']
+ * ```
+ * @param  {String|Array} `patterns` Can be a glob or array of globs.
+ * @param  {Options} `opts` Options to pass to the [matcher] method.
+ * @return {Function} Filter function to be passed to `Array#filter()`.
+ */
+
+function filter(patterns, opts) {
+  if (!Array.isArray(patterns) && typeof patterns !== 'string') {
+    throw new TypeError(msg('filter', 'patterns', 'a string or array'));
+  }
+
+  patterns = utils.arrayify(patterns);
+  var len = patterns.length, i = 0;
+  var patternMatchers = Array(len);
+  while (i < len) {
+    patternMatchers[i] = matcher(patterns[i++], opts);
+  }
+
+  return function(fp) {
+    if (fp == null) return [];
+    var len = patternMatchers.length, i = 0;
+    var res = true;
+
+    fp = utils.unixify(fp, opts);
+    while (i < len) {
+      var fn = patternMatchers[i++];
+      if (!fn(fp)) {
+        res = false;
+        break;
+      }
+    }
+    return res;
+  };
+}
+
+/**
+ * Returns true if the filepath contains the given
+ * pattern. Can also return a function for matching.
+ *
+ * ```js
+ * isMatch('foo.md', '*.md', {});
+ * //=> true
+ *
+ * isMatch('*.md', {})('foo.md')
+ * //=> true
+ * ```
+ * @param  {String} `fp`
+ * @param  {String} `pattern`
+ * @param  {Object} `opts`
+ * @return {Boolean}
+ */
+
+function isMatch(fp, pattern, opts) {
+  if (typeof fp !== 'string') {
+    throw new TypeError(msg('isMatch', 'filepath', 'a string'));
+  }
+
+  fp = utils.unixify(fp, opts);
+  if (utils.typeOf(pattern) === 'object') {
+    return matcher(fp, pattern);
+  }
+  return matcher(pattern, opts)(fp);
+}
+
+/**
+ * Returns true if the filepath matches the
+ * given pattern.
+ */
+
+function contains(fp, pattern, opts) {
+  if (typeof fp !== 'string') {
+    throw new TypeError(msg('contains', 'pattern', 'a string'));
+  }
+
+  opts = opts || {};
+  opts.contains = (pattern !== '');
+  fp = utils.unixify(fp, opts);
+
+  if (opts.contains && !utils.isGlob(pattern)) {
+    return fp.indexOf(pattern) !== -1;
+  }
+  return matcher(pattern, opts)(fp);
+}
+
+/**
+ * Returns true if a file path matches any of the
+ * given patterns.
+ *
+ * @param  {String} `fp` The filepath to test.
+ * @param  {String|Array} `patterns` Glob patterns to use.
+ * @param  {Object} `opts` Options to pass to the `matcher()` function.
+ * @return {String}
+ */
+
+function any(fp, patterns, opts) {
+  if (!Array.isArray(patterns) && typeof patterns !== 'string') {
+    throw new TypeError(msg('any', 'patterns', 'a string or array'));
+  }
+
+  patterns = utils.arrayify(patterns);
+  var len = patterns.length;
+
+  fp = utils.unixify(fp, opts);
+  while (len--) {
+    var isMatch = matcher(patterns[len], opts);
+    if (isMatch(fp)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * Filter the keys of an object with the given `glob` pattern
+ * and `options`
+ *
+ * @param  {Object} `object`
+ * @param  {Pattern} `object`
+ * @return {Array}
+ */
+
+function matchKeys(obj, glob, options) {
+  if (utils.typeOf(obj) !== 'object') {
+    throw new TypeError(msg('matchKeys', 'first argument', 'an object'));
+  }
+
+  var fn = matcher(glob, options);
+  var res = {};
+
+  for (var key in obj) {
+    if (obj.hasOwnProperty(key) && fn(key)) {
+      res[key] = obj[key];
+    }
+  }
+  return res;
+}
+
+/**
+ * Return a function for matching based on the
+ * given `pattern` and `options`.
+ *
+ * @param  {String} `pattern`
+ * @param  {Object} `options`
+ * @return {Function}
+ */
+
+function matcher(pattern, opts) {
+  // pattern is a function
+  if (typeof pattern === 'function') {
+    return pattern;
+  }
+  // pattern is a regex
+  if (pattern instanceof RegExp) {
+    return function(fp) {
+      return pattern.test(fp);
+    };
+  }
+
+  if (typeof pattern !== 'string') {
+    throw new TypeError(msg('matcher', 'pattern', 'a string, regex, or function'));
+  }
+
+  // strings, all the way down...
+  pattern = utils.unixify(pattern, opts);
+
+  // pattern is a non-glob string
+  if (!utils.isGlob(pattern)) {
+    return utils.matchPath(pattern, opts);
+  }
+  // pattern is a glob string
+  var re = makeRe(pattern, opts);
+
+  // `matchBase` is defined
+  if (opts && opts.matchBase) {
+    return utils.hasFilename(re, opts);
+  }
+  // `matchBase` is not defined
+  return function(fp) {
+    fp = utils.unixify(fp, opts);
+    return re.test(fp);
+  };
+}
+
+/**
+ * Create and cache a regular expression for matching
+ * file paths.
+ *
+ * If the leading character in the `glob` is `!`, a negation
+ * regex is returned.
+ *
+ * @param  {String} `glob`
+ * @param  {Object} `options`
+ * @return {RegExp}
+ */
+
+function toRegex(glob, options) {
+  // clone options to prevent  mutating the original object
+  var opts = Object.create(options || {});
+  var flags = opts.flags || '';
+  if (opts.nocase && flags.indexOf('i') === -1) {
+    flags += 'i';
+  }
+
+  var parsed = expand(glob, opts);
+
+  // pass in tokens to avoid parsing more than once
+  opts.negated = opts.negated || parsed.negated;
+  opts.negate = opts.negated;
+  glob = wrapGlob(parsed.pattern, opts);
+  var re;
+
+  try {
+    re = new RegExp(glob, flags);
+    return re;
+  } catch (err) {
+    err.reason = 'micromatch invalid regex: (' + re + ')';
+    if (opts.strict) throw new SyntaxError(err);
+  }
+
+  // we're only here if a bad pattern was used and the user
+  // passed `options.silent`, so match nothing
+  return /$^/;
+}
+
+/**
+ * Create the regex to do the matching. If the leading
+ * character in the `glob` is `!` a negation regex is returned.
+ *
+ * @param {String} `glob`
+ * @param {Boolean} `negate`
+ */
+
+function wrapGlob(glob, opts) {
+  var prefix = (opts && !opts.contains) ? '^' : '';
+  var after = (opts && !opts.contains) ? '$' : '';
+  glob = ('(?:' + glob + ')' + after);
+  if (opts && opts.negate) {
+    return prefix + ('(?!^' + glob + ').*$');
+  }
+  return prefix + glob;
+}
+
+/**
+ * Create and cache a regular expression for matching file paths.
+ * If the leading character in the `glob` is `!`, a negation
+ * regex is returned.
+ *
+ * @param  {String} `glob`
+ * @param  {Object} `options`
+ * @return {RegExp}
+ */
+
+function makeRe(glob, opts) {
+  if (utils.typeOf(glob) !== 'string') {
+    throw new Error(msg('makeRe', 'glob', 'a string'));
+  }
+  return utils.cache(toRegex, glob, opts);
+}
+
+/**
+ * Make error messages consistent. Follows this format:
+ *
+ * ```js
+ * msg(methodName, argNumber, nativeType);
+ * // example:
+ * msg('matchKeys', 'first', 'an object');
+ * ```
+ *
+ * @param  {String} `method`
+ * @param  {String} `num`
+ * @param  {String} `type`
+ * @return {String}
+ */
+
+function msg(method, what, type) {
+  return 'micromatch.' + method + '(): ' + what + ' should be ' + type + '.';
+}
+
+/**
+ * Public methods
+ */
+
+/* eslint no-multi-spaces: 0 */
+micromatch.any       = any;
+micromatch.braces    = micromatch.braceExpand = utils.braces;
+micromatch.contains  = contains;
+micromatch.expand    = expand;
+micromatch.filter    = filter;
+micromatch.isMatch   = isMatch;
+micromatch.makeRe    = makeRe;
+micromatch.match     = match;
+micromatch.matcher   = matcher;
+micromatch.matchKeys = matchKeys;
+
+/**
+ * Expose `micromatch`
+ */
+
+module.exports = micromatch;
diff --git a/node_modules/@babel/core/node_modules/micromatch/lib/chars.js b/node_modules/@babel/core/node_modules/micromatch/lib/chars.js
new file mode 100644
index 00000000..a1ffe371
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/lib/chars.js
@@ -0,0 +1,67 @@
+'use strict';
+
+var chars = {}, unesc, temp;
+
+function reverse(object, prepender) {
+  return Object.keys(object).reduce(function(reversed, key) {
+    var newKey = prepender ? prepender + key : key; // Optionally prepend a string to key.
+    reversed[object[key]] = newKey; // Swap key and value.
+    return reversed; // Return the result.
+  }, {});
+}
+
+/**
+ * Regex for common characters
+ */
+
+chars.escapeRegex = {
+  '?': /\?/g,
+  '@': /\@/g,
+  '!': /\!/g,
+  '+': /\+/g,
+  '*': /\*/g,
+  '(': /\(/g,
+  ')': /\)/g,
+  '[': /\[/g,
+  ']': /\]/g
+};
+
+/**
+ * Escape characters
+ */
+
+chars.ESC = {
+  '?': '__UNESC_QMRK__',
+  '@': '__UNESC_AMPE__',
+  '!': '__UNESC_EXCL__',
+  '+': '__UNESC_PLUS__',
+  '*': '__UNESC_STAR__',
+  ',': '__UNESC_COMMA__',
+  '(': '__UNESC_LTPAREN__',
+  ')': '__UNESC_RTPAREN__',
+  '[': '__UNESC_LTBRACK__',
+  ']': '__UNESC_RTBRACK__'
+};
+
+/**
+ * Unescape characters
+ */
+
+chars.UNESC = unesc || (unesc = reverse(chars.ESC, '\\'));
+
+chars.ESC_TEMP = {
+  '?': '__TEMP_QMRK__',
+  '@': '__TEMP_AMPE__',
+  '!': '__TEMP_EXCL__',
+  '*': '__TEMP_STAR__',
+  '+': '__TEMP_PLUS__',
+  ',': '__TEMP_COMMA__',
+  '(': '__TEMP_LTPAREN__',
+  ')': '__TEMP_RTPAREN__',
+  '[': '__TEMP_LTBRACK__',
+  ']': '__TEMP_RTBRACK__'
+};
+
+chars.TEMP = temp || (temp = reverse(chars.ESC_TEMP));
+
+module.exports = chars;
diff --git a/node_modules/@babel/core/node_modules/micromatch/lib/expand.js b/node_modules/@babel/core/node_modules/micromatch/lib/expand.js
new file mode 100644
index 00000000..e99b081e
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/lib/expand.js
@@ -0,0 +1,304 @@
+/*!
+ * micromatch <https://github.com/jonschlinkert/micromatch>
+ *
+ * Copyright (c) 2014-2015, Jon Schlinkert.
+ * Licensed under the MIT License.
+ */
+
+'use strict';
+
+var utils = require('./utils');
+var Glob = require('./glob');
+
+/**
+ * Expose `expand`
+ */
+
+module.exports = expand;
+
+/**
+ * Expand a glob pattern to resolve braces and
+ * similar patterns before converting to regex.
+ *
+ * @param  {String|Array} `pattern`
+ * @param  {Array} `files`
+ * @param  {Options} `opts`
+ * @return {Array}
+ */
+
+function expand(pattern, options) {
+  if (typeof pattern !== 'string') {
+    throw new TypeError('micromatch.expand(): argument should be a string.');
+  }
+
+  var glob = new Glob(pattern, options || {});
+  var opts = glob.options;
+
+  if (!utils.isGlob(pattern)) {
+    glob.pattern = glob.pattern.replace(/([\/.])/g, '\\$1');
+    return glob;
+  }
+
+  glob.pattern = glob.pattern.replace(/(\+)(?!\()/g, '\\$1');
+  glob.pattern = glob.pattern.split('$').join('\\$');
+
+  if (typeof opts.braces !== 'boolean' && typeof opts.nobraces !== 'boolean') {
+    opts.braces = true;
+  }
+
+  if (glob.pattern === '.*') {
+    return {
+      pattern: '\\.' + star,
+      tokens: tok,
+      options: opts
+    };
+  }
+
+  if (glob.pattern === '*') {
+    return {
+      pattern: oneStar(opts.dot),
+      tokens: tok,
+      options: opts
+    };
+  }
+
+  // parse the glob pattern into tokens
+  glob.parse();
+  var tok = glob.tokens;
+  tok.is.negated = opts.negated;
+
+  // dotfile handling
+  if ((opts.dotfiles === true || tok.is.dotfile) && opts.dot !== false) {
+    opts.dotfiles = true;
+    opts.dot = true;
+  }
+
+  if ((opts.dotdirs === true || tok.is.dotdir) && opts.dot !== false) {
+    opts.dotdirs = true;
+    opts.dot = true;
+  }
+
+  // check for braces with a dotfile pattern
+  if (/[{,]\./.test(glob.pattern)) {
+    opts.makeRe = false;
+    opts.dot = true;
+  }
+
+  if (opts.nonegate !== true) {
+    opts.negated = glob.negated;
+  }
+
+  // if the leading character is a dot or a slash, escape it
+  if (glob.pattern.charAt(0) === '.' && glob.pattern.charAt(1) !== '/') {
+    glob.pattern = '\\' + glob.pattern;
+  }
+
+  /**
+   * Extended globs
+   */
+
+  // expand braces, e.g `{1..5}`
+  glob.track('before braces');
+  if (tok.is.braces) {
+    glob.braces();
+  }
+  glob.track('after braces');
+
+  // expand extglobs, e.g `foo/!(a|b)`
+  glob.track('before extglob');
+  if (tok.is.extglob) {
+    glob.extglob();
+  }
+  glob.track('after extglob');
+
+  // expand brackets, e.g `[[:alpha:]]`
+  glob.track('before brackets');
+  if (tok.is.brackets) {
+    glob.brackets();
+  }
+  glob.track('after brackets');
+
+  // special patterns
+  glob._replace('[!', '[^');
+  glob._replace('(?', '(%~');
+  glob._replace(/\[\]/, '\\[\\]');
+  glob._replace('/[', '/' + (opts.dot ? dotfiles : nodot) + '[', true);
+  glob._replace('/?', '/' + (opts.dot ? dotfiles : nodot) + '[^/]', true);
+  glob._replace('/.', '/(?=.)\\.', true);
+
+  // windows drives
+  glob._replace(/^(\w):([\\\/]+?)/gi, '(?=.)$1:$2', true);
+
+  // negate slashes in exclusion ranges
+  if (glob.pattern.indexOf('[^') !== -1) {
+    glob.pattern = negateSlash(glob.pattern);
+  }
+
+  if (opts.globstar !== false && glob.pattern === '**') {
+    glob.pattern = globstar(opts.dot);
+
+  } else {
+    glob.pattern = balance(glob.pattern, '[', ']');
+    glob.escape(glob.pattern);
+
+    // if the pattern has `**`
+    if (tok.is.globstar) {
+      glob.pattern = collapse(glob.pattern, '/**');
+      glob.pattern = collapse(glob.pattern, '**/');
+      glob._replace('/**/', '(?:/' + globstar(opts.dot) + '/|/)', true);
+      glob._replace(/\*{2,}/g, '**');
+
+      // 'foo/*'
+      glob._replace(/(\w+)\*(?!\/)/g, '$1[^/]*?', true);
+      glob._replace(/\*\*\/\*(\w)/g, globstar(opts.dot) + '\\/' + (opts.dot ? dotfiles : nodot) + '[^/]*?$1', true);
+
+      if (opts.dot !== true) {
+        glob._replace(/\*\*\/(.)/g, '(?:**\\/|)$1');
+      }
+
+      // 'foo/**' or '{**,*}', but not 'foo**'
+      if (tok.path.dirname !== '' || /,\*\*|\*\*,/.test(glob.orig)) {
+        glob._replace('**', globstar(opts.dot), true);
+      }
+    }
+
+    // ends with /*
+    glob._replace(/\/\*$/, '\\/' + oneStar(opts.dot), true);
+    // ends with *, no slashes
+    glob._replace(/(?!\/)\*$/, star, true);
+    // has 'n*.' (partial wildcard w/ file extension)
+    glob._replace(/([^\/]+)\*/, '$1' + oneStar(true), true);
+    // has '*'
+    glob._replace('*', oneStar(opts.dot), true);
+    glob._replace('?.', '?\\.', true);
+    glob._replace('?:', '?:', true);
+
+    glob._replace(/\?+/g, function(match) {
+      var len = match.length;
+      if (len === 1) {
+        return qmark;
+      }
+      return qmark + '{' + len + '}';
+    });
+
+    // escape '.abc' => '\\.abc'
+    glob._replace(/\.([*\w]+)/g, '\\.$1');
+    // fix '[^\\\\/]'
+    glob._replace(/\[\^[\\\/]+\]/g, qmark);
+    // '///' => '\/'
+    glob._replace(/\/+/g, '\\/');
+    // '\\\\\\' => '\\'
+    glob._replace(/\\{2,}/g, '\\');
+  }
+
+  // unescape previously escaped patterns
+  glob.unescape(glob.pattern);
+  glob._replace('__UNESC_STAR__', '*');
+
+  // escape dots that follow qmarks
+  glob._replace('?.', '?\\.');
+
+  // remove unnecessary slashes in character classes
+  glob._replace('[^\\/]', qmark);
+
+  if (glob.pattern.length > 1) {
+    if (/^[\[?*]/.test(glob.pattern)) {
+      // only prepend the string if we don't want to match dotfiles
+      glob.pattern = (opts.dot ? dotfiles : nodot) + glob.pattern;
+    }
+  }
+
+  return glob;
+}
+
+/**
+ * Collapse repeated character sequences.
+ *
+ * ```js
+ * collapse('a/../../../b', '../');
+ * //=> 'a/../b'
+ * ```
+ *
+ * @param  {String} `str`
+ * @param  {String} `ch` Character sequence to collapse
+ * @return {String}
+ */
+
+function collapse(str, ch) {
+  var res = str.split(ch);
+  var isFirst = res[0] === '';
+  var isLast = res[res.length - 1] === '';
+  res = res.filter(Boolean);
+  if (isFirst) res.unshift('');
+  if (isLast) res.push('');
+  return res.join(ch);
+}
+
+/**
+ * Negate slashes in exclusion ranges, per glob spec:
+ *
+ * ```js
+ * negateSlash('[^foo]');
+ * //=> '[^\\/foo]'
+ * ```
+ *
+ * @param  {String} `str` glob pattern
+ * @return {String}
+ */
+
+function negateSlash(str) {
+  return str.replace(/\[\^([^\]]*?)\]/g, function(match, inner) {
+    if (inner.indexOf('/') === -1) {
+      inner = '\\/' + inner;
+    }
+    return '[^' + inner + ']';
+  });
+}
+
+/**
+ * Escape imbalanced braces/bracket. This is a very
+ * basic, naive implementation that only does enough
+ * to serve the purpose.
+ */
+
+function balance(str, a, b) {
+  var aarr = str.split(a);
+  var alen = aarr.join('').length;
+  var blen = str.split(b).join('').length;
+
+  if (alen !== blen) {
+    str = aarr.join('\\' + a);
+    return str.split(b).join('\\' + b);
+  }
+  return str;
+}
+
+/**
+ * Special patterns to be converted to regex.
+ * Heuristics are used to simplify patterns
+ * and speed up processing.
+ */
+
+/* eslint no-multi-spaces: 0 */
+var qmark       = '[^/]';
+var star        = qmark + '*?';
+var nodot       = '(?!\\.)(?=.)';
+var dotfileGlob = '(?:\\/|^)\\.{1,2}($|\\/)';
+var dotfiles    = '(?!' + dotfileGlob + ')(?=.)';
+var twoStarDot  = '(?:(?!' + dotfileGlob + ').)*?';
+
+/**
+ * Create a regex for `*`.
+ *
+ * If `dot` is true, or the pattern does not begin with
+ * a leading star, then return the simpler regex.
+ */
+
+function oneStar(dotfile) {
+  return dotfile ? '(?!' + dotfileGlob + ')(?=.)' + star : (nodot + star);
+}
+
+function globstar(dotfile) {
+  if (dotfile) { return twoStarDot; }
+  return '(?:(?!(?:\\/|^)\\.).)*?';
+}
diff --git a/node_modules/@babel/core/node_modules/micromatch/lib/glob.js b/node_modules/@babel/core/node_modules/micromatch/lib/glob.js
new file mode 100644
index 00000000..c6133267
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/lib/glob.js
@@ -0,0 +1,193 @@
+'use strict';
+
+var chars = require('./chars');
+var utils = require('./utils');
+
+/**
+ * Expose `Glob`
+ */
+
+var Glob = module.exports = function Glob(pattern, options) {
+  if (!(this instanceof Glob)) {
+    return new Glob(pattern, options);
+  }
+  this.options = options || {};
+  this.pattern = pattern;
+  this.history = [];
+  this.tokens = {};
+  this.init(pattern);
+};
+
+/**
+ * Initialize defaults
+ */
+
+Glob.prototype.init = function(pattern) {
+  this.orig = pattern;
+  this.negated = this.isNegated();
+  this.options.track = this.options.track || false;
+  this.options.makeRe = true;
+};
+
+/**
+ * Push a change into `glob.history`. Useful
+ * for debugging.
+ */
+
+Glob.prototype.track = function(msg) {
+  if (this.options.track) {
+    this.history.push({msg: msg, pattern: this.pattern});
+  }
+};
+
+/**
+ * Return true if `glob.pattern` was negated
+ * with `!`, also remove the `!` from the pattern.
+ *
+ * @return {Boolean}
+ */
+
+Glob.prototype.isNegated = function() {
+  if (this.pattern.charCodeAt(0) === 33 /* '!' */) {
+    this.pattern = this.pattern.slice(1);
+    return true;
+  }
+  return false;
+};
+
+/**
+ * Expand braces in the given glob pattern.
+ *
+ * We only need to use the [braces] lib when
+ * patterns are nested.
+ */
+
+Glob.prototype.braces = function() {
+  if (this.options.nobraces !== true && this.options.nobrace !== true) {
+    // naive/fast check for imbalanced characters
+    var a = this.pattern.match(/[\{\(\[]/g);
+    var b = this.pattern.match(/[\}\)\]]/g);
+
+    // if imbalanced, don't optimize the pattern
+    if (a && b && (a.length !== b.length)) {
+      this.options.makeRe = false;
+    }
+
+    // expand brace patterns and join the resulting array
+    var expanded = utils.braces(this.pattern, this.options);
+    this.pattern = expanded.join('|');
+  }
+};
+
+/**
+ * Expand bracket expressions in `glob.pattern`
+ */
+
+Glob.prototype.brackets = function() {
+  if (this.options.nobrackets !== true) {
+    this.pattern = utils.brackets(this.pattern);
+  }
+};
+
+/**
+ * Expand bracket expressions in `glob.pattern`
+ */
+
+Glob.prototype.extglob = function() {
+  if (this.options.noextglob === true) return;
+
+  if (utils.isExtglob(this.pattern)) {
+    this.pattern = utils.extglob(this.pattern, {escape: true});
+  }
+};
+
+/**
+ * Parse the given pattern
+ */
+
+Glob.prototype.parse = function(pattern) {
+  this.tokens = utils.parseGlob(pattern || this.pattern, true);
+  return this.tokens;
+};
+
+/**
+ * Replace `a` with `b`. Also tracks the change before and
+ * after each replacement. This is disabled by default, but
+ * can be enabled by setting `options.track` to true.
+ *
+ * Also, when the pattern is a string, `.split()` is used,
+ * because it's much faster than replace.
+ *
+ * @param  {RegExp|String} `a`
+ * @param  {String} `b`
+ * @param  {Boolean} `escape` When `true`, escapes `*` and `?` in the replacement.
+ * @return {String}
+ */
+
+Glob.prototype._replace = function(a, b, escape) {
+  this.track('before (find): "' + a + '" (replace with): "' + b + '"');
+  if (escape) b = esc(b);
+  if (a && b && typeof a === 'string') {
+    this.pattern = this.pattern.split(a).join(b);
+  } else {
+    this.pattern = this.pattern.replace(a, b);
+  }
+  this.track('after');
+};
+
+/**
+ * Escape special characters in the given string.
+ *
+ * @param  {String} `str` Glob pattern
+ * @return {String}
+ */
+
+Glob.prototype.escape = function(str) {
+  this.track('before escape: ');
+  var re = /["\\](['"]?[^"'\\]['"]?)/g;
+
+  this.pattern = str.replace(re, function($0, $1) {
+    var o = chars.ESC;
+    var ch = o && o[$1];
+    if (ch) {
+      return ch;
+    }
+    if (/[a-z]/i.test($0)) {
+      return $0.split('\\').join('');
+    }
+    return $0;
+  });
+
+  this.track('after escape: ');
+};
+
+/**
+ * Unescape special characters in the given string.
+ *
+ * @param  {String} `str`
+ * @return {String}
+ */
+
+Glob.prototype.unescape = function(str) {
+  var re = /__([A-Z]+)_([A-Z]+)__/g;
+  this.pattern = str.replace(re, function($0, $1) {
+    return chars[$1][$0];
+  });
+  this.pattern = unesc(this.pattern);
+};
+
+/**
+ * Escape/unescape utils
+ */
+
+function esc(str) {
+  str = str.split('?').join('%~');
+  str = str.split('*').join('%%');
+  return str;
+}
+
+function unesc(str) {
+  str = str.split('%~').join('?');
+  str = str.split('%%').join('*');
+  return str;
+}
diff --git a/node_modules/@babel/core/node_modules/micromatch/lib/utils.js b/node_modules/@babel/core/node_modules/micromatch/lib/utils.js
new file mode 100644
index 00000000..7c24a510
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/lib/utils.js
@@ -0,0 +1,149 @@
+'use strict';
+
+var win32 = process && process.platform === 'win32';
+var path = require('path');
+var fileRe = require('filename-regex');
+var utils = module.exports;
+
+/**
+ * Module dependencies
+ */
+
+utils.diff = require('arr-diff');
+utils.unique = require('array-unique');
+utils.braces = require('braces');
+utils.brackets = require('expand-brackets');
+utils.extglob = require('extglob');
+utils.isExtglob = require('is-extglob');
+utils.isGlob = require('is-glob');
+utils.typeOf = require('kind-of');
+utils.normalize = require('normalize-path');
+utils.omit = require('object.omit');
+utils.parseGlob = require('parse-glob');
+utils.cache = require('regex-cache');
+
+/**
+ * Get the filename of a filepath
+ *
+ * @param {String} `string`
+ * @return {String}
+ */
+
+utils.filename = function filename(fp) {
+  var seg = fp.match(fileRe());
+  return seg && seg[0];
+};
+
+/**
+ * Returns a function that returns true if the given
+ * pattern is the same as a given `filepath`
+ *
+ * @param {String} `pattern`
+ * @return {Function}
+ */
+
+utils.isPath = function isPath(pattern, opts) {
+  opts = opts || {};
+  return function(fp) {
+    var unixified = utils.unixify(fp, opts);
+    if(opts.nocase){
+      return pattern.toLowerCase() === unixified.toLowerCase();
+    }
+    return pattern === unixified;
+  };
+};
+
+/**
+ * Returns a function that returns true if the given
+ * pattern contains a `filepath`
+ *
+ * @param {String} `pattern`
+ * @return {Function}
+ */
+
+utils.hasPath = function hasPath(pattern, opts) {
+  return function(fp) {
+    return utils.unixify(pattern, opts).indexOf(fp) !== -1;
+  };
+};
+
+/**
+ * Returns a function that returns true if the given
+ * pattern matches or contains a `filepath`
+ *
+ * @param {String} `pattern`
+ * @return {Function}
+ */
+
+utils.matchPath = function matchPath(pattern, opts) {
+  var fn = (opts && opts.contains)
+    ? utils.hasPath(pattern, opts)
+    : utils.isPath(pattern, opts);
+  return fn;
+};
+
+/**
+ * Returns a function that returns true if the given
+ * regex matches the `filename` of a file path.
+ *
+ * @param {RegExp} `re`
+ * @return {Boolean}
+ */
+
+utils.hasFilename = function hasFilename(re) {
+  return function(fp) {
+    var name = utils.filename(fp);
+    return name && re.test(name);
+  };
+};
+
+/**
+ * Coerce `val` to an array
+ *
+ * @param  {*} val
+ * @return {Array}
+ */
+
+utils.arrayify = function arrayify(val) {
+  return !Array.isArray(val)
+    ? [val]
+    : val;
+};
+
+/**
+ * Normalize all slashes in a file path or glob pattern to
+ * forward slashes.
+ */
+
+utils.unixify = function unixify(fp, opts) {
+  if (opts && opts.unixify === false) return fp;
+  if (opts && opts.unixify === true || win32 || path.sep === '\\') {
+    return utils.normalize(fp, false);
+  }
+  if (opts && opts.unescape === true) {
+    return fp ? fp.toString().replace(/\\(\w)/g, '$1') : '';
+  }
+  return fp;
+};
+
+/**
+ * Escape/unescape utils
+ */
+
+utils.escapePath = function escapePath(fp) {
+  return fp.replace(/[\\.]/g, '\\$&');
+};
+
+utils.unescapeGlob = function unescapeGlob(fp) {
+  return fp.replace(/[\\"']/g, '');
+};
+
+utils.escapeRe = function escapeRe(str) {
+  return str.replace(/[-[\\$*+?.#^\s{}(|)\]]/g, '\\$&');
+};
+
+/**
+ * Expose `utils`
+ */
+
+module.exports = utils;
diff --git a/node_modules/@babel/core/node_modules/micromatch/package.json b/node_modules/@babel/core/node_modules/micromatch/package.json
new file mode 100644
index 00000000..f2aef5b1
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/micromatch/package.json
@@ -0,0 +1,114 @@
+{
+  "name": "micromatch",
+  "description": "Glob matching for javascript/node.js. A drop-in replacement and faster alternative to minimatch and multimatch.",
+  "version": "2.3.11",
+  "homepage": "https://github.com/jonschlinkert/micromatch",
+  "author": "Jon Schlinkert (https://github.com/jonschlinkert)",
+  "repository": "jonschlinkert/micromatch",
+  "bugs": {
+    "url": "https://github.com/jonschlinkert/micromatch/issues"
+  },
+  "license": "MIT",
+  "files": [
+    "index.js",
+    "lib"
+  ],
+  "main": "index.js",
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "scripts": {
+    "test": "mocha"
+  },
+  "dependencies": {
+    "arr-diff": "^2.0.0",
+    "array-unique": "^0.2.1",
+    "braces": "^1.8.2",
+    "expand-brackets": "^0.1.4",
+    "extglob": "^0.3.1",
+    "filename-regex": "^2.0.0",
+    "is-extglob": "^1.0.0",
+    "is-glob": "^2.0.1",
+    "kind-of": "^3.0.2",
+    "normalize-path": "^2.0.1",
+    "object.omit": "^2.0.0",
+    "parse-glob": "^3.0.4",
+    "regex-cache": "^0.4.2"
+  },
+  "devDependencies": {
+    "benchmarked": "^0.1.4",
+    "chalk": "^1.1.1",
+    "gulp": "^3.9.0",
+    "gulp-eslint": "^1.1.1",
+    "gulp-format-md": "^0.1.8",
+    "gulp-istanbul": "^0.10.1",
+    "gulp-mocha": "^2.1.3",
+    "minimatch": "^3.0.0",
+    "minimist": "^1.2.0",
+    "mocha": "^2",
+    "multimatch": "^2.0.0",
+    "should": "^8",
+    "write": "^0.2.1"
+  },
+  "keywords": [
+    "bash",
+    "expand",
+    "expansion",
+    "expression",
+    "file",
+    "files",
+    "filter",
+    "find",
+    "glob",
+    "globbing",
+    "globs",
+    "globstar",
+    "match",
+    "matcher",
+    "matches",
+    "matching",
+    "minimatch",
+    "multimatch",
+    "path",
+    "pattern",
+    "patterns",
+    "regex",
+    "regexp",
+    "regular",
+    "shell",
+    "wildcard"
+  ],
+  "verb": {
+    "related": {
+      "list": [
+        "braces",
+        "expand-brackets",
+        "expand-range",
+        "extglob",
+        "fill-range",
+        "gulp-micromatch",
+        "is-glob",
+        "parse-glob"
+      ]
+    },
+    "reflinks": [
+      "braces",
+      "expand-brackets",
+      "extglob",
+      "minimatch",
+      "multimatch",
+      "verb"
+    ],
+    "toc": false,
+    "layout": false,
+    "tasks": [
+      "readme"
+    ],
+    "plugins": [
+      "gulp-format-md"
+    ],
+    "lint": {
+      "reflinks": true
+    }
+  }
+}
diff --git a/node_modules/@babel/core/node_modules/ms/index.js b/node_modules/@babel/core/node_modules/ms/index.js
new file mode 100644
index 00000000..72297501
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/ms/index.js
@@ -0,0 +1,162 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var w = d * 7;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isNaN(val) === false) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'weeks':
+    case 'week':
+    case 'w':
+      return n * w;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (msAbs >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (msAbs >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (msAbs >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return plural(ms, msAbs, d, 'day');
+  }
+  if (msAbs >= h) {
+    return plural(ms, msAbs, h, 'hour');
+  }
+  if (msAbs >= m) {
+    return plural(ms, msAbs, m, 'minute');
+  }
+  if (msAbs >= s) {
+    return plural(ms, msAbs, s, 'second');
+  }
+  return ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, msAbs, n, name) {
+  var isPlural = msAbs >= n * 1.5;
+  return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+}
diff --git a/node_modules/@babel/core/node_modules/ms/license.md b/node_modules/@babel/core/node_modules/ms/license.md
new file mode 100644
index 00000000..69b61253
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/ms/license.md
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Zeit, Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/@babel/core/node_modules/ms/package.json b/node_modules/@babel/core/node_modules/ms/package.json
new file mode 100644
index 00000000..fc28cb39
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/ms/package.json
@@ -0,0 +1,37 @@
+{
+  "name": "ms",
+  "version": "2.1.1",
+  "description": "Tiny millisecond conversion utility",
+  "repository": "zeit/ms",
+  "main": "./index",
+  "files": [
+    "index.js"
+  ],
+  "scripts": {
+    "precommit": "lint-staged",
+    "lint": "eslint lib/* bin/*",
+    "test": "mocha tests.js"
+  },
+  "eslintConfig": {
+    "extends": "eslint:recommended",
+    "env": {
+      "node": true,
+      "es6": true
+    }
+  },
+  "lint-staged": {
+    "*.js": [
+      "npm run lint",
+      "prettier --single-quote --write",
+      "git add"
+    ]
+  },
+  "license": "MIT",
+  "devDependencies": {
+    "eslint": "4.12.1",
+    "expect.js": "0.3.1",
+    "husky": "0.14.3",
+    "lint-staged": "5.0.0",
+    "mocha": "4.0.1"
+  }
+}
diff --git a/node_modules/@babel/core/node_modules/ms/readme.md b/node_modules/@babel/core/node_modules/ms/readme.md
new file mode 100644
index 00000000..bb767293
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/ms/readme.md
@@ -0,0 +1,60 @@
+# ms
+
+[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms)
+[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/)
+
+Use this package to easily convert various time formats to milliseconds.
+
+## Examples
+
+```js
+ms('2 days')  // 172800000
+ms('1d')      // 86400000
+ms('10h')     // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h')      // 7200000
+ms('1m')      // 60000
+ms('5s')      // 5000
+ms('1y')      // 31557600000
+ms('100')     // 100
+ms('-3 days') // -259200000
+ms('-1h')     // -3600000
+ms('-200')    // -200
+```
+
+### Convert from Milliseconds
+
+```js
+ms(60000)             // "1m"
+ms(2 * 60000)         // "2m"
+ms(-3 * 60000)        // "-3m"
+ms(ms('10 hours'))    // "10h"
+```
+
+### Time Format Written-Out
+
+```js
+ms(60000, { long: true })             // "1 minute"
+ms(2 * 60000, { long: true })         // "2 minutes"
+ms(-3 * 60000, { long: true })        // "-3 minutes"
+ms(ms('10 hours'), { long: true })    // "10 hours"
+```
+
+## Features
+
+- Works both in [Node.js](https://nodejs.org) and in the browser
+- If a number is supplied to `ms`, a string with a unit is returned
+- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`)
+- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned
+
+## Related Packages
+
+- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time.
+
+## Caught a Bug?
+
+1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device
+2. Link the package to the global module directory: `npm link`
+3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms!
+
+As always, you can run the tests using: `npm test`
diff --git a/node_modules/@babel/core/node_modules/source-map/CHANGELOG.md b/node_modules/@babel/core/node_modules/source-map/CHANGELOG.md
new file mode 100644
index 00000000..3a8c066c
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/CHANGELOG.md
@@ -0,0 +1,301 @@
+# Change Log
+
+## 0.5.6
+
+* Fix for regression when people were using numbers as names in source maps. See
+  #236.
+
+## 0.5.5
+
+* Fix "regression" of unsupported, implementation behavior that half the world
+  happens to have come to depend on. See #235.
+
+* Fix regression involving function hoisting in SpiderMonkey. See #233.
+
+## 0.5.4
+
+* Large performance improvements to source-map serialization. See #228 and #229.
+
+## 0.5.3
+
+* Do not include unnecessary distribution files. See
+  commit ef7006f8d1647e0a83fdc60f04f5a7ca54886f86.
+
+## 0.5.2
+
+* Include browser distributions of the library in package.json's `files`. See
+  issue #212.
+
+## 0.5.1
+
+* Fix latent bugs in IndexedSourceMapConsumer.prototype._parseMappings. See
+  ff05274becc9e6e1295ed60f3ea090d31d843379.
+
+## 0.5.0
+
+* Node 0.8 is no longer supported.
+
+* Use webpack instead of dryice for bundling.
+
+* Big speedups serializing source maps. See pull request #203.
+
+* Fix a bug with `SourceMapConsumer.prototype.sourceContentFor` and sources that
+  explicitly start with the source root. See issue #199.
+
+## 0.4.4
+
+* Fix an issue where using a `SourceMapGenerator` after having created a
+  `SourceMapConsumer` from it via `SourceMapConsumer.fromSourceMap` failed. See
+  issue #191.
+
+* Fix an issue with where `SourceMapGenerator` would mistakenly consider
+  different mappings as duplicates of each other and avoid generating them. See
+  issue #192.
+
+## 0.4.3
+
+* A very large number of performance improvements, particularly when parsing
+  source maps. Collectively about 75% of time shaved off of the source map
+  parsing benchmark!
+
+* Fix a bug in `SourceMapConsumer.prototype.allGeneratedPositionsFor` and fuzzy
+  searching in the presence of a column option. See issue #177.
+
+* Fix a bug with joining a source and its source root when the source is above
+  the root. See issue #182.
+
+* Add the `SourceMapConsumer.prototype.hasContentsOfAllSources` method to
+  determine when all sources' contents are inlined into the source map. See
+  issue #190.
+
+## 0.4.2
+
+* Add an `.npmignore` file so that the benchmarks aren't pulled down by
+  dependent projects. Issue #169.
+
+* Add an optional `column` argument to
+  `SourceMapConsumer.prototype.allGeneratedPositionsFor` and better handle lines
+  with no mappings. Issues #172 and #173.
+
+## 0.4.1
+
+* Fix accidentally defining a global variable. #170.
+
+## 0.4.0
+
+* The default direction for fuzzy searching was changed back to its original
+  direction. See #164.
+
+* There is now a `bias` option you can supply to `SourceMapConsumer` to control
+  the fuzzy searching direction. See #167.
+
+* About an 8% speed up in parsing source maps. See #159.
+
+* Added a benchmark for parsing and generating source maps.
+
+## 0.3.0
+
+* Change the default direction that searching for positions fuzzes when there is
+  not an exact match. See #154.
+
+* Support for environments using json2.js for JSON serialization. See #156.
+
+## 0.2.0
+
+* Support for consuming "indexed" source maps which do not have any remote
+  sections. See pull request #127. This introduces a minor backwards
+  incompatibility if you are monkey patching `SourceMapConsumer.prototype`
+  methods.
+
+## 0.1.43
+
+* Performance improvements for `SourceMapGenerator` and `SourceNode`. See issue
+  #148 for some discussion and issues #150, #151, and #152 for implementations.
+
+## 0.1.42
+
+* Fix an issue where `SourceNode`s from different versions of the source-map
+  library couldn't be used in conjunction with each other. See issue #142.
+
+## 0.1.41
+
+* Fix a bug with getting the source content of relative sources with a "./"
+  prefix. See issue #145 and [Bug 1090768](bugzil.la/1090768).
+
+* Add the `SourceMapConsumer.prototype.computeColumnSpans` method to compute the
+  column span of each mapping.
+
+* Add the `SourceMapConsumer.prototype.allGeneratedPositionsFor` method to find
+  all generated positions associated with a given original source and line.
+
+## 0.1.40
+
+* Performance improvements for parsing source maps in SourceMapConsumer.
+
+## 0.1.39
+
+* Fix a bug where setting a source's contents to null before any source content
+  had been set before threw a TypeError. See issue #131.
+
+## 0.1.38
+
+* Fix a bug where finding relative paths from an empty path were creating
+  absolute paths. See issue #129.
+
+## 0.1.37
+
+* Fix a bug where if the source root was an empty string, relative source paths
+  would turn into absolute source paths. Issue #124.
+
+## 0.1.36
+
+* Allow the `names` mapping property to be an empty string. Issue #121.
+
+## 0.1.35
+
+* A third optional parameter was added to `SourceNode.fromStringWithSourceMap`
+  to specify a path that relative sources in the second parameter should be
+  relative to. Issue #105.
+
+* If no file property is given to a `SourceMapGenerator`, then the resulting
+  source map will no longer have a `null` file property. The property will
+  simply not exist. Issue #104.
+
+* Fixed a bug where consecutive newlines were ignored in `SourceNode`s.
+  Issue #116.
+
+## 0.1.34
+
+* Make `SourceNode` work with windows style ("\r\n") newlines. Issue #103.
+
+* Fix bug involving source contents and the
+  `SourceMapGenerator.prototype.applySourceMap`. Issue #100.
+
+## 0.1.33
+
+* Fix some edge cases surrounding path joining and URL resolution.
+
+* Add a third parameter for relative path to
+  `SourceMapGenerator.prototype.applySourceMap`.
+
+* Fix issues with mappings and EOLs.
+
+## 0.1.32
+
+* Fixed a bug where SourceMapConsumer couldn't handle negative relative columns
+  (issue 92).
+
+* Fixed test runner to actually report number of failed tests as its process
+  exit code.
+
+* Fixed a typo when reporting bad mappings (issue 87).
+
+## 0.1.31
+
+* Delay parsing the mappings in SourceMapConsumer until queried for a source
+  location.
+
+* Support Sass source maps (which at the time of writing deviate from the spec
+  in small ways) in SourceMapConsumer.
+
+## 0.1.30
+
+* Do not join source root with a source, when the source is a data URI.
+
+* Extend the test runner to allow running single specific test files at a time.
+
+* Performance improvements in `SourceNode.prototype.walk` and
+  `SourceMapConsumer.prototype.eachMapping`.
+
+* Source map browser builds will now work inside Workers.
+
+* Better error messages when attempting to add an invalid mapping to a
+  `SourceMapGenerator`.
+
+## 0.1.29
+
+* Allow duplicate entries in the `names` and `sources` arrays of source maps
+  (usually from TypeScript) we are parsing. Fixes github issue 72.
+
+## 0.1.28
+
+* Skip duplicate mappings when creating source maps from SourceNode; github
+  issue 75.
+
+## 0.1.27
+
+* Don't throw an error when the `file` property is missing in SourceMapConsumer,
+  we don't use it anyway.
+
+## 0.1.26
+
+* Fix SourceNode.fromStringWithSourceMap for empty maps. Fixes github issue 70.
+
+## 0.1.25
+
+* Make compatible with browserify
+
+## 0.1.24
+
+* Fix issue with absolute paths and `file://` URIs. See
+  https://bugzilla.mozilla.org/show_bug.cgi?id=885597
+
+## 0.1.23
+
+* Fix issue with absolute paths and sourcesContent, github issue 64.
+
+## 0.1.22
+
+* Ignore duplicate mappings in SourceMapGenerator. Fixes github issue 21.
+
+## 0.1.21
+
+* Fixed handling of sources that start with a slash so that they are relative to
+  the source root's host.
+
+## 0.1.20
+
+* Fixed github issue #43: absolute URLs aren't joined with the source root
+  anymore.
+
+## 0.1.19
+
+* Using Travis CI to run tests.
+
+## 0.1.18
+
+* Fixed a bug in the handling of sourceRoot.
+
+## 0.1.17
+
+* Added SourceNode.fromStringWithSourceMap.
+
+## 0.1.16
+
+* Added missing documentation.
+
+* Fixed the generating of empty mappings in SourceNode.
+
+## 0.1.15
+
+* Added SourceMapGenerator.applySourceMap.
+
+## 0.1.14
+
+* The sourceRoot is now handled consistently.
+
+## 0.1.13
+
+* Added SourceMapGenerator.fromSourceMap.
+
+## 0.1.12
+
+* SourceNode now generates empty mappings too.
+
+## 0.1.11
+
+* Added name support to SourceNode.
+
+## 0.1.10
+
+* Added sourcesContent support to the customer and generator.
diff --git a/node_modules/@babel/core/node_modules/source-map/LICENSE b/node_modules/@babel/core/node_modules/source-map/LICENSE
new file mode 100644
index 00000000..ed1b7cf2
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/LICENSE
@@ -0,0 +1,28 @@
+
+Copyright (c) 2009-2011, Mozilla Foundation and contributors
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+  list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+  this list of conditions and the following disclaimer in the documentation
+  and/or other materials provided with the distribution.
+
+* Neither the names of the Mozilla Foundation nor the names of project
+  contributors may be used to endorse or promote products derived from this
+  software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/node_modules/@babel/core/node_modules/source-map/README.md b/node_modules/@babel/core/node_modules/source-map/README.md
new file mode 100644
index 00000000..32813394
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/README.md
@@ -0,0 +1,729 @@
+# Source Map
+
+[![Build Status](https://travis-ci.org/mozilla/source-map.png?branch=master)](https://travis-ci.org/mozilla/source-map)
+
+[![NPM](https://nodei.co/npm/source-map.png?downloads=true&downloadRank=true)](https://www.npmjs.com/package/source-map)
+
+This is a library to generate and consume the source map format
+[described here][format].
+
+[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit
+
+## Use with Node
+
+    $ npm install source-map
+
+## Use on the Web
+
+    <script src="https://raw.githubusercontent.com/mozilla/source-map/master/dist/source-map.min.js" defer></script>
+
+--------------------------------------------------------------------------------
+
+<!-- `npm run toc` to regenerate the Table of Contents -->
+
+<!-- START doctoc generated TOC please keep comment here to allow auto update -->
+<!-- DON'T EDIT THIS SECTION, INSTEAD RE-RUN doctoc TO UPDATE -->
+## Table of Contents
+
+- [Examples](#examples)
+  - [Consuming a source map](#consuming-a-source-map)
+  - [Generating a source map](#generating-a-source-map)
+    - [With SourceNode (high level API)](#with-sourcenode-high-level-api)
+    - [With SourceMapGenerator (low level API)](#with-sourcemapgenerator-low-level-api)
+- [API](#api)
+  - [SourceMapConsumer](#sourcemapconsumer)
+    - [new SourceMapConsumer(rawSourceMap)](#new-sourcemapconsumerrawsourcemap)
+    - [SourceMapConsumer.prototype.computeColumnSpans()](#sourcemapconsumerprototypecomputecolumnspans)
+    - [SourceMapConsumer.prototype.originalPositionFor(generatedPosition)](#sourcemapconsumerprototypeoriginalpositionforgeneratedposition)
+    - [SourceMapConsumer.prototype.generatedPositionFor(originalPosition)](#sourcemapconsumerprototypegeneratedpositionfororiginalposition)
+    - [SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)](#sourcemapconsumerprototypeallgeneratedpositionsfororiginalposition)
+    - [SourceMapConsumer.prototype.hasContentsOfAllSources()](#sourcemapconsumerprototypehascontentsofallsources)
+    - [SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])](#sourcemapconsumerprototypesourcecontentforsource-returnnullonmissing)
+    - [SourceMapConsumer.prototype.eachMapping(callback, context, order)](#sourcemapconsumerprototypeeachmappingcallback-context-order)
+  - [SourceMapGenerator](#sourcemapgenerator)
+    - [new SourceMapGenerator([startOfSourceMap])](#new-sourcemapgeneratorstartofsourcemap)
+    - [SourceMapGenerator.fromSourceMap(sourceMapConsumer)](#sourcemapgeneratorfromsourcemapsourcemapconsumer)
+    - [SourceMapGenerator.prototype.addMapping(mapping)](#sourcemapgeneratorprototypeaddmappingmapping)
+    - [SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)](#sourcemapgeneratorprototypesetsourcecontentsourcefile-sourcecontent)
+    - [SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])](#sourcemapgeneratorprototypeapplysourcemapsourcemapconsumer-sourcefile-sourcemappath)
+    - [SourceMapGenerator.prototype.toString()](#sourcemapgeneratorprototypetostring)
+  - [SourceNode](#sourcenode)
+    - [new SourceNode([line, column, source[, chunk[, name]]])](#new-sourcenodeline-column-source-chunk-name)
+    - [SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])](#sourcenodefromstringwithsourcemapcode-sourcemapconsumer-relativepath)
+    - [SourceNode.prototype.add(chunk)](#sourcenodeprototypeaddchunk)
+    - [SourceNode.prototype.prepend(chunk)](#sourcenodeprototypeprependchunk)
+    - [SourceNode.prototype.setSourceContent(sourceFile, sourceContent)](#sourcenodeprototypesetsourcecontentsourcefile-sourcecontent)
+    - [SourceNode.prototype.walk(fn)](#sourcenodeprototypewalkfn)
+    - [SourceNode.prototype.walkSourceContents(fn)](#sourcenodeprototypewalksourcecontentsfn)
+    - [SourceNode.prototype.join(sep)](#sourcenodeprototypejoinsep)
+    - [SourceNode.prototype.replaceRight(pattern, replacement)](#sourcenodeprototypereplacerightpattern-replacement)
+    - [SourceNode.prototype.toString()](#sourcenodeprototypetostring)
+    - [SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])](#sourcenodeprototypetostringwithsourcemapstartofsourcemap)
+
+<!-- END doctoc generated TOC please keep comment here to allow auto update -->
+
+## Examples
+
+### Consuming a source map
+
+```js
+var rawSourceMap = {
+  version: 3,
+  file: 'min.js',
+  names: ['bar', 'baz', 'n'],
+  sources: ['one.js', 'two.js'],
+  sourceRoot: 'http://example.com/www/js/',
+  mappings: 'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA'
+};
+
+var smc = new SourceMapConsumer(rawSourceMap);
+
+console.log(smc.sources);
+// [ 'http://example.com/www/js/one.js',
+//   'http://example.com/www/js/two.js' ]
+
+console.log(smc.originalPositionFor({
+  line: 2,
+  column: 28
+}));
+// { source: 'http://example.com/www/js/two.js',
+//   line: 2,
+//   column: 10,
+//   name: 'n' }
+
+console.log(smc.generatedPositionFor({
+  source: 'http://example.com/www/js/two.js',
+  line: 2,
+  column: 10
+}));
+// { line: 2, column: 28 }
+
+smc.eachMapping(function (m) {
+  // ...
+});
+```
+
+### Generating a source map
+
+In depth guide:
+[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/)
+
+#### With SourceNode (high level API)
+
+```js
+function compile(ast) {
+  switch (ast.type) {
+  case 'BinaryExpression':
+    return new SourceNode(
+      ast.location.line,
+      ast.location.column,
+      ast.location.source,
+      [compile(ast.left), " + ", compile(ast.right)]
+    );
+  case 'Literal':
+    return new SourceNode(
+      ast.location.line,
+      ast.location.column,
+      ast.location.source,
+      String(ast.value)
+    );
+  // ...
+  default:
+    throw new Error("Bad AST");
+  }
+}
+
+var ast = parse("40 + 2", "add.js");
+console.log(compile(ast).toStringWithSourceMap({
+  file: 'add.js'
+}));
+// { code: '40 + 2',
+//   map: [object SourceMapGenerator] }
+```
+
+#### With SourceMapGenerator (low level API)
+
+```js
+var map = new SourceMapGenerator({
+  file: "source-mapped.js"
+});
+
+map.addMapping({
+  generated: {
+    line: 10,
+    column: 35
+  },
+  source: "foo.js",
+  original: {
+    line: 33,
+    column: 2
+  },
+  name: "christopher"
+});
+
+console.log(map.toString());
+// '{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}'
+```
+
+## API
+
+Get a reference to the module:
+
+```js
+// Node.js
+var sourceMap = require('source-map');
+
+// Browser builds
+var sourceMap = window.sourceMap;
+
+// Inside Firefox
+const sourceMap = require("devtools/toolkit/sourcemap/source-map.js");
+```
+
+### SourceMapConsumer
+
+A SourceMapConsumer instance represents a parsed source map which we can query
+for information about the original file positions by giving it a file position
+in the generated source.
+
+#### new SourceMapConsumer(rawSourceMap)
+
+The only parameter is the raw source map (either as a string which can be
+`JSON.parse`'d, or an object). According to the spec, source maps have the
+following attributes:
+
+* `version`: Which version of the source map spec this map is following.
+
+* `sources`: An array of URLs to the original source files.
+
+* `names`: An array of identifiers which can be referenced by individual
+  mappings.
+
+* `sourceRoot`: Optional. The URL root from which all sources are relative.
+
+* `sourcesContent`: Optional. An array of contents of the original source files.
+
+* `mappings`: A string of base64 VLQs which contain the actual mappings.
+
+* `file`: Optional. The generated filename this source map is associated with.
+
+```js
+var consumer = new sourceMap.SourceMapConsumer(rawSourceMapJsonData);
+```
+
+#### SourceMapConsumer.prototype.computeColumnSpans()
+
+Compute the last column for each generated mapping. The last column is
+inclusive.
+
+```js
+// Before:
+consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1 },
+//   { line: 2,
+//     column: 10 },
+//   { line: 2,
+//     column: 20 } ]
+
+consumer.computeColumnSpans();
+
+// After:
+consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1,
+//     lastColumn: 9 },
+//   { line: 2,
+//     column: 10,
+//     lastColumn: 19 },
+//   { line: 2,
+//     column: 20,
+//     lastColumn: Infinity } ]
+
+```
+
+#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition)
+
+Returns the original source, line, and column information for the generated
+source's line and column positions provided. The only argument is an object with
+the following properties:
+
+* `line`: The line number in the generated source.
+
+* `column`: The column number in the generated source.
+
+* `bias`: Either `SourceMapConsumer.GREATEST_LOWER_BOUND` or
+  `SourceMapConsumer.LEAST_UPPER_BOUND`. Specifies whether to return the closest
+  element that is smaller than or greater than the one we are searching for,
+  respectively, if the exact element cannot be found.  Defaults to
+  `SourceMapConsumer.GREATEST_LOWER_BOUND`.
+
+and an object is returned with the following properties:
+
+* `source`: The original source file, or null if this information is not
+  available.
+
+* `line`: The line number in the original source, or null if this information is
+  not available.
+
+* `column`: The column number in the original source, or null if this
+  information is not available.
+
+* `name`: The original identifier, or null if this information is not available.
+
+```js
+consumer.originalPositionFor({ line: 2, column: 10 })
+// { source: 'foo.coffee',
+//   line: 2,
+//   column: 2,
+//   name: null }
+
+consumer.originalPositionFor({ line: 99999999999999999, column: 999999999999999 })
+// { source: null,
+//   line: null,
+//   column: null,
+//   name: null }
+```
+
+#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition)
+
+Returns the generated line and column information for the original source,
+line, and column positions provided. The only argument is an object with
+the following properties:
+
+* `source`: The filename of the original source.
+
+* `line`: The line number in the original source.
+
+* `column`: The column number in the original source.
+
+and an object is returned with the following properties:
+
+* `line`: The line number in the generated source, or null.
+
+* `column`: The column number in the generated source, or null.
+
+```js
+consumer.generatedPositionFor({ source: "example.js", line: 2, column: 10 })
+// { line: 1,
+//   column: 56 }
+```
+
+#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)
+
+Returns all generated line and column information for the original source, line,
+and column provided. If no column is provided, returns all mappings
+corresponding to a either the line we are searching for or the next closest line
+that has any mappings. Otherwise, returns all mappings corresponding to the
+given line and either the column we are searching for or the next closest column
+that has any offsets.
+
+The only argument is an object with the following properties:
+
+* `source`: The filename of the original source.
+
+* `line`: The line number in the original source.
+
+* `column`: Optional. The column number in the original source.
+
+and an array of objects is returned, each with the following properties:
+
+* `line`: The line number in the generated source, or null.
+
+* `column`: The column number in the generated source, or null.
+
+```js
+consumer.allGeneratedpositionsfor({ line: 2, source: "foo.coffee" })
+// [ { line: 2,
+//     column: 1 },
+//   { line: 2,
+//     column: 10 },
+//   { line: 2,
+//     column: 20 } ]
+```
+
+#### SourceMapConsumer.prototype.hasContentsOfAllSources()
+
+Return true if we have the embedded source content for every source listed in
+the source map, false otherwise.
+
+In other words, if this method returns `true`, then
+`consumer.sourceContentFor(s)` will succeed for every source `s` in
+`consumer.sources`.
+
+```js
+// ...
+if (consumer.hasContentsOfAllSources()) {
+  consumerReadyCallback(consumer);
+} else {
+  fetchSources(consumer, consumerReadyCallback);
+}
+// ...
+```
+
+#### SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])
+
+Returns the original source content for the source provided. The only
+argument is the URL of the original source file.
+
+If the source content for the given source is not found, then an error is
+thrown. Optionally, pass `true` as the second param to have `null` returned
+instead.
+
+```js
+consumer.sources
+// [ "my-cool-lib.clj" ]
+
+consumer.sourceContentFor("my-cool-lib.clj")
+// "..."
+
+consumer.sourceContentFor("this is not in the source map");
+// Error: "this is not in the source map" is not in the source map
+
+consumer.sourceContentFor("this is not in the source map", true);
+// null
+```
+
+#### SourceMapConsumer.prototype.eachMapping(callback, context, order)
+
+Iterate over each mapping between an original source/line/column and a
+generated line/column in this source map.
+
+* `callback`: The function that is called with each mapping. Mappings have the
+  form `{ source, generatedLine, generatedColumn, originalLine, originalColumn,
+  name }`
+
+* `context`: Optional. If specified, this object will be the value of `this`
+  every time that `callback` is called.
+
+* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or
+  `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over
+  the mappings sorted by the generated file's line/column order or the
+  original's source/line/column order, respectively. Defaults to
+  `SourceMapConsumer.GENERATED_ORDER`.
+
+```js
+consumer.eachMapping(function (m) { console.log(m); })
+// ...
+// { source: 'illmatic.js',
+//   generatedLine: 1,
+//   generatedColumn: 0,
+//   originalLine: 1,
+//   originalColumn: 0,
+//   name: null }
+// { source: 'illmatic.js',
+//   generatedLine: 2,
+//   generatedColumn: 0,
+//   originalLine: 2,
+//   originalColumn: 0,
+//   name: null }
+// ...
+```
+### SourceMapGenerator
+
+An instance of the SourceMapGenerator represents a source map which is being
+built incrementally.
+
+#### new SourceMapGenerator([startOfSourceMap])
+
+You may pass an object with the following properties:
+
+* `file`: The filename of the generated source that this source map is
+  associated with.
+
+* `sourceRoot`: A root for all relative URLs in this source map.
+
+* `skipValidation`: Optional. When `true`, disables validation of mappings as
+  they are added. This can improve performance but should be used with
+  discretion, as a last resort. Even then, one should avoid using this flag when
+  running tests, if possible.
+
+```js
+var generator = new sourceMap.SourceMapGenerator({
+  file: "my-generated-javascript-file.js",
+  sourceRoot: "http://example.com/app/js/"
+});
+```
+
+#### SourceMapGenerator.fromSourceMap(sourceMapConsumer)
+
+Creates a new `SourceMapGenerator` from an existing `SourceMapConsumer` instance.
+
+* `sourceMapConsumer` The SourceMap.
+
+```js
+var generator = sourceMap.SourceMapGenerator.fromSourceMap(consumer);
+```
+
+#### SourceMapGenerator.prototype.addMapping(mapping)
+
+Add a single mapping from original source line and column to the generated
+source's line and column for this source map being created. The mapping object
+should have the following properties:
+
+* `generated`: An object with the generated line and column positions.
+
+* `original`: An object with the original line and column positions.
+
+* `source`: The original source file (relative to the sourceRoot).
+
+* `name`: An optional original token name for this mapping.
+
+```js
+generator.addMapping({
+  source: "module-one.scm",
+  original: { line: 128, column: 0 },
+  generated: { line: 3, column: 456 }
+})
+```
+
+#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)
+
+Set the source content for an original source file.
+
+* `sourceFile` the URL of the original source file.
+
+* `sourceContent` the content of the source file.
+
+```js
+generator.setSourceContent("module-one.scm",
+                           fs.readFileSync("path/to/module-one.scm"))
+```
+
+#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])
+
+Applies a SourceMap for a source file to the SourceMap.
+Each mapping to the supplied source file is rewritten using the
+supplied SourceMap. Note: The resolution for the resulting mappings
+is the minimum of this map and the supplied map.
+
+* `sourceMapConsumer`: The SourceMap to be applied.
+
+* `sourceFile`: Optional. The filename of the source file.
+  If omitted, sourceMapConsumer.file will be used, if it exists.
+  Otherwise an error will be thrown.
+
+* `sourceMapPath`: Optional. The dirname of the path to the SourceMap
+  to be applied. If relative, it is relative to the SourceMap.
+
+  This parameter is needed when the two SourceMaps aren't in the same
+  directory, and the SourceMap to be applied contains relative source
+  paths. If so, those relative source paths need to be rewritten
+  relative to the SourceMap.
+
+  If omitted, it is assumed that both SourceMaps are in the same directory,
+  thus not needing any rewriting. (Supplying `'.'` has the same effect.)
+
+#### SourceMapGenerator.prototype.toString()
+
+Renders the source map being generated to a string.
+
+```js
+generator.toString()
+// '{"version":3,"sources":["module-one.scm"],"names":[],"mappings":"...snip...","file":"my-generated-javascript-file.js","sourceRoot":"http://example.com/app/js/"}'
+```
+
+### SourceNode
+
+SourceNodes provide a way to abstract over interpolating and/or concatenating
+snippets of generated JavaScript source code, while maintaining the line and
+column information associated between those snippets and the original source
+code. This is useful as the final intermediate representation a compiler might
+use before outputting the generated JS and source map.
+
+#### new SourceNode([line, column, source[, chunk[, name]]])
+
+* `line`: The original line number associated with this source node, or null if
+  it isn't associated with an original line.
+
+* `column`: The original column number associated with this source node, or null
+  if it isn't associated with an original column.
+
+* `source`: The original source's filename; null if no filename is provided.
+
+* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see
+  below.
+
+* `name`: Optional. The original identifier.
+
+```js
+var node = new SourceNode(1, 2, "a.cpp", [
+  new SourceNode(3, 4, "b.cpp", "extern int status;\n"),
+  new SourceNode(5, 6, "c.cpp", "std::string* make_string(size_t n);\n"),
+  new SourceNode(7, 8, "d.cpp", "int main(int argc, char** argv) {}\n"),
+]);
+```
+
+#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])
+
+Creates a SourceNode from generated code and a SourceMapConsumer.
+
+* `code`: The generated code
+
+* `sourceMapConsumer` The SourceMap for the generated code
+
+* `relativePath` The optional path that relative sources in `sourceMapConsumer`
+  should be relative to.
+
+```js
+var consumer = new SourceMapConsumer(fs.readFileSync("path/to/my-file.js.map", "utf8"));
+var node = SourceNode.fromStringWithSourceMap(fs.readFileSync("path/to/my-file.js"),
+                                              consumer);
+```
+
+#### SourceNode.prototype.add(chunk)
+
+Add a chunk of generated JS to this source node.
+
+* `chunk`: A string snippet of generated JS code, another instance of
+   `SourceNode`, or an array where each member is one of those things.
+
+```js
+node.add(" + ");
+node.add(otherNode);
+node.add([leftHandOperandNode, " + ", rightHandOperandNode]);
+```
+
+#### SourceNode.prototype.prepend(chunk)
+
+Prepend a chunk of generated JS to this source node.
+
+* `chunk`: A string snippet of generated JS code, another instance of
+   `SourceNode`, or an array where each member is one of those things.
+
+```js
+node.prepend("/** Build Id: f783haef86324gf **/\n\n");
+```
+
+#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent)
+
+Set the source content for a source file. This will be added to the
+`SourceMap` in the `sourcesContent` field.
+
+* `sourceFile`: The filename of the source file
+
+* `sourceContent`: The content of the source file
+
+```js
+node.setSourceContent("module-one.scm",
+                      fs.readFileSync("path/to/module-one.scm"))
+```
+
+#### SourceNode.prototype.walk(fn)
+
+Walk over the tree of JS snippets in this node and its children. The walking
+function is called once for each snippet of JS and is passed that snippet and
+the its original associated source's line/column location.
+
+* `fn`: The traversal function.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.walk(function (code, loc) { console.log("WALK:", code, loc); })
+// WALK: uno { source: 'b.js', line: 3, column: 4, name: null }
+// WALK: dos { source: 'a.js', line: 1, column: 2, name: null }
+// WALK: tres { source: 'a.js', line: 1, column: 2, name: null }
+// WALK: quatro { source: 'c.js', line: 5, column: 6, name: null }
+```
+
+#### SourceNode.prototype.walkSourceContents(fn)
+
+Walk over the tree of SourceNodes. The walking function is called for each
+source file content and is passed the filename and source content.
+
+* `fn`: The traversal function.
+
+```js
+var a = new SourceNode(1, 2, "a.js", "generated from a");
+a.setSourceContent("a.js", "original a");
+var b = new SourceNode(1, 2, "b.js", "generated from b");
+b.setSourceContent("b.js", "original b");
+var c = new SourceNode(1, 2, "c.js", "generated from c");
+c.setSourceContent("c.js", "original c");
+
+var node = new SourceNode(null, null, null, [a, b, c]);
+node.walkSourceContents(function (source, contents) { console.log("WALK:", source, ":", contents); })
+// WALK: a.js : original a
+// WALK: b.js : original b
+// WALK: c.js : original c
+```
+
+#### SourceNode.prototype.join(sep)
+
+Like `Array.prototype.join` except for SourceNodes. Inserts the separator
+between each of this source node's children.
+
+* `sep`: The separator.
+
+```js
+var lhs = new SourceNode(1, 2, "a.rs", "my_copy");
+var operand = new SourceNode(3, 4, "a.rs", "=");
+var rhs = new SourceNode(5, 6, "a.rs", "orig.clone()");
+
+var node = new SourceNode(null, null, null, [ lhs, operand, rhs ]);
+var joinedNode = node.join(" ");
+```
+
+#### SourceNode.prototype.replaceRight(pattern, replacement)
+
+Call `String.prototype.replace` on the very right-most source snippet. Useful
+for trimming white space from the end of a source node, etc.
+
+* `pattern`: The pattern to replace.
+
+* `replacement`: The thing to replace the pattern with.
+
+```js
+// Trim trailing white space.
+node.replaceRight(/\s*$/, "");
+```
+
+#### SourceNode.prototype.toString()
+
+Return the string representation of this source node. Walks over the tree and
+concatenates all the various snippets together to one string.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.toString()
+// 'unodostresquatro'
+```
+
+#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])
+
+Returns the string representation of this tree of source nodes, plus a
+SourceMapGenerator which contains all the mappings between the generated and
+original sources.
+
+The arguments are the same as those to `new SourceMapGenerator`.
+
+```js
+var node = new SourceNode(1, 2, "a.js", [
+  new SourceNode(3, 4, "b.js", "uno"),
+  "dos",
+  [
+    "tres",
+    new SourceNode(5, 6, "c.js", "quatro")
+  ]
+]);
+
+node.toStringWithSourceMap({ file: "my-output-file.js" })
+// { code: 'unodostresquatro',
+//   map: [object SourceMapGenerator] }
+```
diff --git a/node_modules/@babel/core/node_modules/source-map/dist/source-map.debug.js b/node_modules/@babel/core/node_modules/source-map/dist/source-map.debug.js
new file mode 100644
index 00000000..b5ab6382
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/dist/source-map.debug.js
@@ -0,0 +1,3091 @@
+(function webpackUniversalModuleDefinition(root, factory) {
+	if(typeof exports === 'object' && typeof module === 'object')
+		module.exports = factory();
+	else if(typeof define === 'function' && define.amd)
+		define([], factory);
+	else if(typeof exports === 'object')
+		exports["sourceMap"] = factory();
+	else
+		root["sourceMap"] = factory();
+})(this, function() {
+return /******/ (function(modules) { // webpackBootstrap
+/******/ 	// The module cache
+/******/ 	var installedModules = {};
+/******/
+/******/ 	// The require function
+/******/ 	function __webpack_require__(moduleId) {
+/******/
+/******/ 		// Check if module is in cache
+/******/ 		if(installedModules[moduleId])
+/******/ 			return installedModules[moduleId].exports;
+/******/
+/******/ 		// Create a new module (and put it into the cache)
+/******/ 		var module = installedModules[moduleId] = {
+/******/ 			exports: {},
+/******/ 			id: moduleId,
+/******/ 			loaded: false
+/******/ 		};
+/******/
+/******/ 		// Execute the module function
+/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+/******/
+/******/ 		// Flag the module as loaded
+/******/ 		module.loaded = true;
+/******/
+/******/ 		// Return the exports of the module
+/******/ 		return module.exports;
+/******/ 	}
+/******/
+/******/
+/******/ 	// expose the modules object (__webpack_modules__)
+/******/ 	__webpack_require__.m = modules;
+/******/
+/******/ 	// expose the module cache
+/******/ 	__webpack_require__.c = installedModules;
+/******/
+/******/ 	// __webpack_public_path__
+/******/ 	__webpack_require__.p = "";
+/******/
+/******/ 	// Load entry module and return exports
+/******/ 	return __webpack_require__(0);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*
+	 * Copyright 2009-2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE.txt or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	exports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;
+	exports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer;
+	exports.SourceNode = __webpack_require__(10).SourceNode;
+
+
+/***/ }),
+/* 1 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	var base64VLQ = __webpack_require__(2);
+	var util = __webpack_require__(4);
+	var ArraySet = __webpack_require__(5).ArraySet;
+	var MappingList = __webpack_require__(6).MappingList;
+	
+	/**
+	 * An instance of the SourceMapGenerator represents a source map which is
+	 * being built incrementally. You may pass an object with the following
+	 * properties:
+	 *
+	 *   - file: The filename of the generated source.
+	 *   - sourceRoot: A root for all relative URLs in this source map.
+	 */
+	function SourceMapGenerator(aArgs) {
+	  if (!aArgs) {
+	    aArgs = {};
+	  }
+	  this._file = util.getArg(aArgs, 'file', null);
+	  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
+	  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);
+	  this._sources = new ArraySet();
+	  this._names = new ArraySet();
+	  this._mappings = new MappingList();
+	  this._sourcesContents = null;
+	}
+	
+	SourceMapGenerator.prototype._version = 3;
+	
+	/**
+	 * Creates a new SourceMapGenerator based on a SourceMapConsumer
+	 *
+	 * @param aSourceMapConsumer The SourceMap.
+	 */
+	SourceMapGenerator.fromSourceMap =
+	  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
+	    var sourceRoot = aSourceMapConsumer.sourceRoot;
+	    var generator = new SourceMapGenerator({
+	      file: aSourceMapConsumer.file,
+	      sourceRoot: sourceRoot
+	    });
+	    aSourceMapConsumer.eachMapping(function (mapping) {
+	      var newMapping = {
+	        generated: {
+	          line: mapping.generatedLine,
+	          column: mapping.generatedColumn
+	        }
+	      };
+	
+	      if (mapping.source != null) {
+	        newMapping.source = mapping.source;
+	        if (sourceRoot != null) {
+	          newMapping.source = util.relative(sourceRoot, newMapping.source);
+	        }
+	
+	        newMapping.original = {
+	          line: mapping.originalLine,
+	          column: mapping.originalColumn
+	        };
+	
+	        if (mapping.name != null) {
+	          newMapping.name = mapping.name;
+	        }
+	      }
+	
+	      generator.addMapping(newMapping);
+	    });
+	    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+	      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+	      if (content != null) {
+	        generator.setSourceContent(sourceFile, content);
+	      }
+	    });
+	    return generator;
+	  };
+	
+	/**
+	 * Add a single mapping from original source line and column to the generated
+	 * source's line and column for this source map being created. The mapping
+	 * object should have the following properties:
+	 *
+	 *   - generated: An object with the generated line and column positions.
+	 *   - original: An object with the original line and column positions.
+	 *   - source: The original source file (relative to the sourceRoot).
+	 *   - name: An optional original token name for this mapping.
+	 */
+	SourceMapGenerator.prototype.addMapping =
+	  function SourceMapGenerator_addMapping(aArgs) {
+	    var generated = util.getArg(aArgs, 'generated');
+	    var original = util.getArg(aArgs, 'original', null);
+	    var source = util.getArg(aArgs, 'source', null);
+	    var name = util.getArg(aArgs, 'name', null);
+	
+	    if (!this._skipValidation) {
+	      this._validateMapping(generated, original, source, name);
+	    }
+	
+	    if (source != null) {
+	      source = String(source);
+	      if (!this._sources.has(source)) {
+	        this._sources.add(source);
+	      }
+	    }
+	
+	    if (name != null) {
+	      name = String(name);
+	      if (!this._names.has(name)) {
+	        this._names.add(name);
+	      }
+	    }
+	
+	    this._mappings.add({
+	      generatedLine: generated.line,
+	      generatedColumn: generated.column,
+	      originalLine: original != null && original.line,
+	      originalColumn: original != null && original.column,
+	      source: source,
+	      name: name
+	    });
+	  };
+	
+	/**
+	 * Set the source content for a source file.
+	 */
+	SourceMapGenerator.prototype.setSourceContent =
+	  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
+	    var source = aSourceFile;
+	    if (this._sourceRoot != null) {
+	      source = util.relative(this._sourceRoot, source);
+	    }
+	
+	    if (aSourceContent != null) {
+	      // Add the source content to the _sourcesContents map.
+	      // Create a new _sourcesContents map if the property is null.
+	      if (!this._sourcesContents) {
+	        this._sourcesContents = Object.create(null);
+	      }
+	      this._sourcesContents[util.toSetString(source)] = aSourceContent;
+	    } else if (this._sourcesContents) {
+	      // Remove the source file from the _sourcesContents map.
+	      // If the _sourcesContents map is empty, set the property to null.
+	      delete this._sourcesContents[util.toSetString(source)];
+	      if (Object.keys(this._sourcesContents).length === 0) {
+	        this._sourcesContents = null;
+	      }
+	    }
+	  };
+	
+	/**
+	 * Applies the mappings of a sub-source-map for a specific source file to the
+	 * source map being generated. Each mapping to the supplied source file is
+	 * rewritten using the supplied source map. Note: The resolution for the
+	 * resulting mappings is the minimium of this map and the supplied map.
+	 *
+	 * @param aSourceMapConsumer The source map to be applied.
+	 * @param aSourceFile Optional. The filename of the source file.
+	 *        If omitted, SourceMapConsumer's file property will be used.
+	 * @param aSourceMapPath Optional. The dirname of the path to the source map
+	 *        to be applied. If relative, it is relative to the SourceMapConsumer.
+	 *        This parameter is needed when the two source maps aren't in the same
+	 *        directory, and the source map to be applied contains relative source
+	 *        paths. If so, those relative source paths need to be rewritten
+	 *        relative to the SourceMapGenerator.
+	 */
+	SourceMapGenerator.prototype.applySourceMap =
+	  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
+	    var sourceFile = aSourceFile;
+	    // If aSourceFile is omitted, we will use the file property of the SourceMap
+	    if (aSourceFile == null) {
+	      if (aSourceMapConsumer.file == null) {
+	        throw new Error(
+	          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
+	          'or the source map\'s "file" property. Both were omitted.'
+	        );
+	      }
+	      sourceFile = aSourceMapConsumer.file;
+	    }
+	    var sourceRoot = this._sourceRoot;
+	    // Make "sourceFile" relative if an absolute Url is passed.
+	    if (sourceRoot != null) {
+	      sourceFile = util.relative(sourceRoot, sourceFile);
+	    }
+	    // Applying the SourceMap can add and remove items from the sources and
+	    // the names array.
+	    var newSources = new ArraySet();
+	    var newNames = new ArraySet();
+	
+	    // Find mappings for the "sourceFile"
+	    this._mappings.unsortedForEach(function (mapping) {
+	      if (mapping.source === sourceFile && mapping.originalLine != null) {
+	        // Check if it can be mapped by the source map, then update the mapping.
+	        var original = aSourceMapConsumer.originalPositionFor({
+	          line: mapping.originalLine,
+	          column: mapping.originalColumn
+	        });
+	        if (original.source != null) {
+	          // Copy mapping
+	          mapping.source = original.source;
+	          if (aSourceMapPath != null) {
+	            mapping.source = util.join(aSourceMapPath, mapping.source)
+	          }
+	          if (sourceRoot != null) {
+	            mapping.source = util.relative(sourceRoot, mapping.source);
+	          }
+	          mapping.originalLine = original.line;
+	          mapping.originalColumn = original.column;
+	          if (original.name != null) {
+	            mapping.name = original.name;
+	          }
+	        }
+	      }
+	
+	      var source = mapping.source;
+	      if (source != null && !newSources.has(source)) {
+	        newSources.add(source);
+	      }
+	
+	      var name = mapping.name;
+	      if (name != null && !newNames.has(name)) {
+	        newNames.add(name);
+	      }
+	
+	    }, this);
+	    this._sources = newSources;
+	    this._names = newNames;
+	
+	    // Copy sourcesContents of applied map.
+	    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+	      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+	      if (content != null) {
+	        if (aSourceMapPath != null) {
+	          sourceFile = util.join(aSourceMapPath, sourceFile);
+	        }
+	        if (sourceRoot != null) {
+	          sourceFile = util.relative(sourceRoot, sourceFile);
+	        }
+	        this.setSourceContent(sourceFile, content);
+	      }
+	    }, this);
+	  };
+	
+	/**
+	 * A mapping can have one of the three levels of data:
+	 *
+	 *   1. Just the generated position.
+	 *   2. The Generated position, original position, and original source.
+	 *   3. Generated and original position, original source, as well as a name
+	 *      token.
+	 *
+	 * To maintain consistency, we validate that any new mapping being added falls
+	 * in to one of these categories.
+	 */
+	SourceMapGenerator.prototype._validateMapping =
+	  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
+	                                              aName) {
+	    // When aOriginal is truthy but has empty values for .line and .column,
+	    // it is most likely a programmer error. In this case we throw a very
+	    // specific error message to try to guide them the right way.
+	    // For example: https://github.com/Polymer/polymer-bundler/pull/519
+	    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {
+	        throw new Error(
+	            'original.line and original.column are not numbers -- you probably meant to omit ' +
+	            'the original mapping entirely and only map the generated position. If so, pass ' +
+	            'null for the original mapping instead of an object with empty or null values.'
+	        );
+	    }
+	
+	    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+	        && aGenerated.line > 0 && aGenerated.column >= 0
+	        && !aOriginal && !aSource && !aName) {
+	      // Case 1.
+	      return;
+	    }
+	    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+	             && aOriginal && 'line' in aOriginal && 'column' in aOriginal
+	             && aGenerated.line > 0 && aGenerated.column >= 0
+	             && aOriginal.line > 0 && aOriginal.column >= 0
+	             && aSource) {
+	      // Cases 2 and 3.
+	      return;
+	    }
+	    else {
+	      throw new Error('Invalid mapping: ' + JSON.stringify({
+	        generated: aGenerated,
+	        source: aSource,
+	        original: aOriginal,
+	        name: aName
+	      }));
+	    }
+	  };
+	
+	/**
+	 * Serialize the accumulated mappings in to the stream of base 64 VLQs
+	 * specified by the source map format.
+	 */
+	SourceMapGenerator.prototype._serializeMappings =
+	  function SourceMapGenerator_serializeMappings() {
+	    var previousGeneratedColumn = 0;
+	    var previousGeneratedLine = 1;
+	    var previousOriginalColumn = 0;
+	    var previousOriginalLine = 0;
+	    var previousName = 0;
+	    var previousSource = 0;
+	    var result = '';
+	    var next;
+	    var mapping;
+	    var nameIdx;
+	    var sourceIdx;
+	
+	    var mappings = this._mappings.toArray();
+	    for (var i = 0, len = mappings.length; i < len; i++) {
+	      mapping = mappings[i];
+	      next = ''
+	
+	      if (mapping.generatedLine !== previousGeneratedLine) {
+	        previousGeneratedColumn = 0;
+	        while (mapping.generatedLine !== previousGeneratedLine) {
+	          next += ';';
+	          previousGeneratedLine++;
+	        }
+	      }
+	      else {
+	        if (i > 0) {
+	          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {
+	            continue;
+	          }
+	          next += ',';
+	        }
+	      }
+	
+	      next += base64VLQ.encode(mapping.generatedColumn
+	                                 - previousGeneratedColumn);
+	      previousGeneratedColumn = mapping.generatedColumn;
+	
+	      if (mapping.source != null) {
+	        sourceIdx = this._sources.indexOf(mapping.source);
+	        next += base64VLQ.encode(sourceIdx - previousSource);
+	        previousSource = sourceIdx;
+	
+	        // lines are stored 0-based in SourceMap spec version 3
+	        next += base64VLQ.encode(mapping.originalLine - 1
+	                                   - previousOriginalLine);
+	        previousOriginalLine = mapping.originalLine - 1;
+	
+	        next += base64VLQ.encode(mapping.originalColumn
+	                                   - previousOriginalColumn);
+	        previousOriginalColumn = mapping.originalColumn;
+	
+	        if (mapping.name != null) {
+	          nameIdx = this._names.indexOf(mapping.name);
+	          next += base64VLQ.encode(nameIdx - previousName);
+	          previousName = nameIdx;
+	        }
+	      }
+	
+	      result += next;
+	    }
+	
+	    return result;
+	  };
+	
+	SourceMapGenerator.prototype._generateSourcesContent =
+	  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
+	    return aSources.map(function (source) {
+	      if (!this._sourcesContents) {
+	        return null;
+	      }
+	      if (aSourceRoot != null) {
+	        source = util.relative(aSourceRoot, source);
+	      }
+	      var key = util.toSetString(source);
+	      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)
+	        ? this._sourcesContents[key]
+	        : null;
+	    }, this);
+	  };
+	
+	/**
+	 * Externalize the source map.
+	 */
+	SourceMapGenerator.prototype.toJSON =
+	  function SourceMapGenerator_toJSON() {
+	    var map = {
+	      version: this._version,
+	      sources: this._sources.toArray(),
+	      names: this._names.toArray(),
+	      mappings: this._serializeMappings()
+	    };
+	    if (this._file != null) {
+	      map.file = this._file;
+	    }
+	    if (this._sourceRoot != null) {
+	      map.sourceRoot = this._sourceRoot;
+	    }
+	    if (this._sourcesContents) {
+	      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
+	    }
+	
+	    return map;
+	  };
+	
+	/**
+	 * Render the source map being generated to a string.
+	 */
+	SourceMapGenerator.prototype.toString =
+	  function SourceMapGenerator_toString() {
+	    return JSON.stringify(this.toJSON());
+	  };
+	
+	exports.SourceMapGenerator = SourceMapGenerator;
+
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 *
+	 * Based on the Base 64 VLQ implementation in Closure Compiler:
+	 * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
+	 *
+	 * Copyright 2011 The Closure Compiler Authors. All rights reserved.
+	 * Redistribution and use in source and binary forms, with or without
+	 * modification, are permitted provided that the following conditions are
+	 * met:
+	 *
+	 *  * Redistributions of source code must retain the above copyright
+	 *    notice, this list of conditions and the following disclaimer.
+	 *  * Redistributions in binary form must reproduce the above
+	 *    copyright notice, this list of conditions and the following
+	 *    disclaimer in the documentation and/or other materials provided
+	 *    with the distribution.
+	 *  * Neither the name of Google Inc. nor the names of its
+	 *    contributors may be used to endorse or promote products derived
+	 *    from this software without specific prior written permission.
+	 *
+	 * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+	 * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+	 * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+	 * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+	 * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+	 * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+	 * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+	 * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+	 * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+	 * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+	 * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+	 */
+	
+	var base64 = __webpack_require__(3);
+	
+	// A single base 64 digit can contain 6 bits of data. For the base 64 variable
+	// length quantities we use in the source map spec, the first bit is the sign,
+	// the next four bits are the actual value, and the 6th bit is the
+	// continuation bit. The continuation bit tells us whether there are more
+	// digits in this value following this digit.
+	//
+	//   Continuation
+	//   |    Sign
+	//   |    |
+	//   V    V
+	//   101011
+	
+	var VLQ_BASE_SHIFT = 5;
+	
+	// binary: 100000
+	var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
+	
+	// binary: 011111
+	var VLQ_BASE_MASK = VLQ_BASE - 1;
+	
+	// binary: 100000
+	var VLQ_CONTINUATION_BIT = VLQ_BASE;
+	
+	/**
+	 * Converts from a two-complement value to a value where the sign bit is
+	 * placed in the least significant bit.  For example, as decimals:
+	 *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
+	 *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
+	 */
+	function toVLQSigned(aValue) {
+	  return aValue < 0
+	    ? ((-aValue) << 1) + 1
+	    : (aValue << 1) + 0;
+	}
+	
+	/**
+	 * Converts to a two-complement value from a value where the sign bit is
+	 * placed in the least significant bit.  For example, as decimals:
+	 *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1
+	 *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2
+	 */
+	function fromVLQSigned(aValue) {
+	  var isNegative = (aValue & 1) === 1;
+	  var shifted = aValue >> 1;
+	  return isNegative
+	    ? -shifted
+	    : shifted;
+	}
+	
+	/**
+	 * Returns the base 64 VLQ encoded value.
+	 */
+	exports.encode = function base64VLQ_encode(aValue) {
+	  var encoded = "";
+	  var digit;
+	
+	  var vlq = toVLQSigned(aValue);
+	
+	  do {
+	    digit = vlq & VLQ_BASE_MASK;
+	    vlq >>>= VLQ_BASE_SHIFT;
+	    if (vlq > 0) {
+	      // There are still more digits in this value, so we must make sure the
+	      // continuation bit is marked.
+	      digit |= VLQ_CONTINUATION_BIT;
+	    }
+	    encoded += base64.encode(digit);
+	  } while (vlq > 0);
+	
+	  return encoded;
+	};
+	
+	/**
+	 * Decodes the next base 64 VLQ value from the given string and returns the
+	 * value and the rest of the string via the out parameter.
+	 */
+	exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {
+	  var strLen = aStr.length;
+	  var result = 0;
+	  var shift = 0;
+	  var continuation, digit;
+	
+	  do {
+	    if (aIndex >= strLen) {
+	      throw new Error("Expected more digits in base 64 VLQ value.");
+	    }
+	
+	    digit = base64.decode(aStr.charCodeAt(aIndex++));
+	    if (digit === -1) {
+	      throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1));
+	    }
+	
+	    continuation = !!(digit & VLQ_CONTINUATION_BIT);
+	    digit &= VLQ_BASE_MASK;
+	    result = result + (digit << shift);
+	    shift += VLQ_BASE_SHIFT;
+	  } while (continuation);
+	
+	  aOutParam.value = fromVLQSigned(result);
+	  aOutParam.rest = aIndex;
+	};
+
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');
+	
+	/**
+	 * Encode an integer in the range of 0 to 63 to a single base 64 digit.
+	 */
+	exports.encode = function (number) {
+	  if (0 <= number && number < intToCharMap.length) {
+	    return intToCharMap[number];
+	  }
+	  throw new TypeError("Must be between 0 and 63: " + number);
+	};
+	
+	/**
+	 * Decode a single base 64 character code digit to an integer. Returns -1 on
+	 * failure.
+	 */
+	exports.decode = function (charCode) {
+	  var bigA = 65;     // 'A'
+	  var bigZ = 90;     // 'Z'
+	
+	  var littleA = 97;  // 'a'
+	  var littleZ = 122; // 'z'
+	
+	  var zero = 48;     // '0'
+	  var nine = 57;     // '9'
+	
+	  var plus = 43;     // '+'
+	  var slash = 47;    // '/'
+	
+	  var littleOffset = 26;
+	  var numberOffset = 52;
+	
+	  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ
+	  if (bigA <= charCode && charCode <= bigZ) {
+	    return (charCode - bigA);
+	  }
+	
+	  // 26 - 51: abcdefghijklmnopqrstuvwxyz
+	  if (littleA <= charCode && charCode <= littleZ) {
+	    return (charCode - littleA + littleOffset);
+	  }
+	
+	  // 52 - 61: 0123456789
+	  if (zero <= charCode && charCode <= nine) {
+	    return (charCode - zero + numberOffset);
+	  }
+	
+	  // 62: +
+	  if (charCode == plus) {
+	    return 62;
+	  }
+	
+	  // 63: /
+	  if (charCode == slash) {
+	    return 63;
+	  }
+	
+	  // Invalid base64 digit.
+	  return -1;
+	};
+
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	/**
+	 * This is a helper function for getting values from parameter/options
+	 * objects.
+	 *
+	 * @param args The object we are extracting values from
+	 * @param name The name of the property we are getting.
+	 * @param defaultValue An optional value to return if the property is missing
+	 * from the object. If this is not specified and the property is missing, an
+	 * error will be thrown.
+	 */
+	function getArg(aArgs, aName, aDefaultValue) {
+	  if (aName in aArgs) {
+	    return aArgs[aName];
+	  } else if (arguments.length === 3) {
+	    return aDefaultValue;
+	  } else {
+	    throw new Error('"' + aName + '" is a required argument.');
+	  }
+	}
+	exports.getArg = getArg;
+	
+	var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.]*)(?::(\d+))?(\S*)$/;
+	var dataUrlRegexp = /^data:.+\,.+$/;
+	
+	function urlParse(aUrl) {
+	  var match = aUrl.match(urlRegexp);
+	  if (!match) {
+	    return null;
+	  }
+	  return {
+	    scheme: match[1],
+	    auth: match[2],
+	    host: match[3],
+	    port: match[4],
+	    path: match[5]
+	  };
+	}
+	exports.urlParse = urlParse;
+	
+	function urlGenerate(aParsedUrl) {
+	  var url = '';
+	  if (aParsedUrl.scheme) {
+	    url += aParsedUrl.scheme + ':';
+	  }
+	  url += '//';
+	  if (aParsedUrl.auth) {
+	    url += aParsedUrl.auth + '@';
+	  }
+	  if (aParsedUrl.host) {
+	    url += aParsedUrl.host;
+	  }
+	  if (aParsedUrl.port) {
+	    url += ":" + aParsedUrl.port
+	  }
+	  if (aParsedUrl.path) {
+	    url += aParsedUrl.path;
+	  }
+	  return url;
+	}
+	exports.urlGenerate = urlGenerate;
+	
+	/**
+	 * Normalizes a path, or the path portion of a URL:
+	 *
+	 * - Replaces consecutive slashes with one slash.
+	 * - Removes unnecessary '.' parts.
+	 * - Removes unnecessary '<dir>/..' parts.
+	 *
+	 * Based on code in the Node.js 'path' core module.
+	 *
+	 * @param aPath The path or url to normalize.
+	 */
+	function normalize(aPath) {
+	  var path = aPath;
+	  var url = urlParse(aPath);
+	  if (url) {
+	    if (!url.path) {
+	      return aPath;
+	    }
+	    path = url.path;
+	  }
+	  var isAbsolute = exports.isAbsolute(path);
+	
+	  var parts = path.split(/\/+/);
+	  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
+	    part = parts[i];
+	    if (part === '.') {
+	      parts.splice(i, 1);
+	    } else if (part === '..') {
+	      up++;
+	    } else if (up > 0) {
+	      if (part === '') {
+	        // The first part is blank if the path is absolute. Trying to go
+	        // above the root is a no-op. Therefore we can remove all '..' parts
+	        // directly after the root.
+	        parts.splice(i + 1, up);
+	        up = 0;
+	      } else {
+	        parts.splice(i, 2);
+	        up--;
+	      }
+	    }
+	  }
+	  path = parts.join('/');
+	
+	  if (path === '') {
+	    path = isAbsolute ? '/' : '.';
+	  }
+	
+	  if (url) {
+	    url.path = path;
+	    return urlGenerate(url);
+	  }
+	  return path;
+	}
+	exports.normalize = normalize;
+	
+	/**
+	 * Joins two paths/URLs.
+	 *
+	 * @param aRoot The root path or URL.
+	 * @param aPath The path or URL to be joined with the root.
+	 *
+	 * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
+	 *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended
+	 *   first.
+	 * - Otherwise aPath is a path. If aRoot is a URL, then its path portion
+	 *   is updated with the result and aRoot is returned. Otherwise the result
+	 *   is returned.
+	 *   - If aPath is absolute, the result is aPath.
+	 *   - Otherwise the two paths are joined with a slash.
+	 * - Joining for example 'http://' and 'www.example.com' is also supported.
+	 */
+	function join(aRoot, aPath) {
+	  if (aRoot === "") {
+	    aRoot = ".";
+	  }
+	  if (aPath === "") {
+	    aPath = ".";
+	  }
+	  var aPathUrl = urlParse(aPath);
+	  var aRootUrl = urlParse(aRoot);
+	  if (aRootUrl) {
+	    aRoot = aRootUrl.path || '/';
+	  }
+	
+	  // `join(foo, '//www.example.org')`
+	  if (aPathUrl && !aPathUrl.scheme) {
+	    if (aRootUrl) {
+	      aPathUrl.scheme = aRootUrl.scheme;
+	    }
+	    return urlGenerate(aPathUrl);
+	  }
+	
+	  if (aPathUrl || aPath.match(dataUrlRegexp)) {
+	    return aPath;
+	  }
+	
+	  // `join('http://', 'www.example.com')`
+	  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
+	    aRootUrl.host = aPath;
+	    return urlGenerate(aRootUrl);
+	  }
+	
+	  var joined = aPath.charAt(0) === '/'
+	    ? aPath
+	    : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
+	
+	  if (aRootUrl) {
+	    aRootUrl.path = joined;
+	    return urlGenerate(aRootUrl);
+	  }
+	  return joined;
+	}
+	exports.join = join;
+	
+	exports.isAbsolute = function (aPath) {
+	  return aPath.charAt(0) === '/' || !!aPath.match(urlRegexp);
+	};
+	
+	/**
+	 * Make a path relative to a URL or another path.
+	 *
+	 * @param aRoot The root path or URL.
+	 * @param aPath The path or URL to be made relative to aRoot.
+	 */
+	function relative(aRoot, aPath) {
+	  if (aRoot === "") {
+	    aRoot = ".";
+	  }
+	
+	  aRoot = aRoot.replace(/\/$/, '');
+	
+	  // It is possible for the path to be above the root. In this case, simply
+	  // checking whether the root is a prefix of the path won't work. Instead, we
+	  // need to remove components from the root one by one, until either we find
+	  // a prefix that fits, or we run out of components to remove.
+	  var level = 0;
+	  while (aPath.indexOf(aRoot + '/') !== 0) {
+	    var index = aRoot.lastIndexOf("/");
+	    if (index < 0) {
+	      return aPath;
+	    }
+	
+	    // If the only part of the root that is left is the scheme (i.e. http://,
+	    // file:///, etc.), one or more slashes (/), or simply nothing at all, we
+	    // have exhausted all components, so the path is not relative to the root.
+	    aRoot = aRoot.slice(0, index);
+	    if (aRoot.match(/^([^\/]+:\/)?\/*$/)) {
+	      return aPath;
+	    }
+	
+	    ++level;
+	  }
+	
+	  // Make sure we add a "../" for each component we removed from the root.
+	  return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1);
+	}
+	exports.relative = relative;
+	
+	var supportsNullProto = (function () {
+	  var obj = Object.create(null);
+	  return !('__proto__' in obj);
+	}());
+	
+	function identity (s) {
+	  return s;
+	}
+	
+	/**
+	 * Because behavior goes wacky when you set `__proto__` on objects, we
+	 * have to prefix all the strings in our set with an arbitrary character.
+	 *
+	 * See https://github.com/mozilla/source-map/pull/31 and
+	 * https://github.com/mozilla/source-map/issues/30
+	 *
+	 * @param String aStr
+	 */
+	function toSetString(aStr) {
+	  if (isProtoString(aStr)) {
+	    return '$' + aStr;
+	  }
+	
+	  return aStr;
+	}
+	exports.toSetString = supportsNullProto ? identity : toSetString;
+	
+	function fromSetString(aStr) {
+	  if (isProtoString(aStr)) {
+	    return aStr.slice(1);
+	  }
+	
+	  return aStr;
+	}
+	exports.fromSetString = supportsNullProto ? identity : fromSetString;
+	
+	function isProtoString(s) {
+	  if (!s) {
+	    return false;
+	  }
+	
+	  var length = s.length;
+	
+	  if (length < 9 /* "__proto__".length */) {
+	    return false;
+	  }
+	
+	  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||
+	      s.charCodeAt(length - 2) !== 95  /* '_' */ ||
+	      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||
+	      s.charCodeAt(length - 4) !== 116 /* 't' */ ||
+	      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||
+	      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||
+	      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||
+	      s.charCodeAt(length - 8) !== 95  /* '_' */ ||
+	      s.charCodeAt(length - 9) !== 95  /* '_' */) {
+	    return false;
+	  }
+	
+	  for (var i = length - 10; i >= 0; i--) {
+	    if (s.charCodeAt(i) !== 36 /* '$' */) {
+	      return false;
+	    }
+	  }
+	
+	  return true;
+	}
+	
+	/**
+	 * Comparator between two mappings where the original positions are compared.
+	 *
+	 * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+	 * mappings with the same original source/line/column, but different generated
+	 * line and column the same. Useful when searching for a mapping with a
+	 * stubbed out mapping.
+	 */
+	function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
+	  var cmp = mappingA.source - mappingB.source;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.originalLine - mappingB.originalLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.originalColumn - mappingB.originalColumn;
+	  if (cmp !== 0 || onlyCompareOriginal) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.generatedLine - mappingB.generatedLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  return mappingA.name - mappingB.name;
+	}
+	exports.compareByOriginalPositions = compareByOriginalPositions;
+	
+	/**
+	 * Comparator between two mappings with deflated source and name indices where
+	 * the generated positions are compared.
+	 *
+	 * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+	 * mappings with the same generated line and column, but different
+	 * source/name/original line and column the same. Useful when searching for a
+	 * mapping with a stubbed out mapping.
+	 */
+	function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {
+	  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+	  if (cmp !== 0 || onlyCompareGenerated) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.source - mappingB.source;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.originalLine - mappingB.originalLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.originalColumn - mappingB.originalColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  return mappingA.name - mappingB.name;
+	}
+	exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;
+	
+	function strcmp(aStr1, aStr2) {
+	  if (aStr1 === aStr2) {
+	    return 0;
+	  }
+	
+	  if (aStr1 > aStr2) {
+	    return 1;
+	  }
+	
+	  return -1;
+	}
+	
+	/**
+	 * Comparator between two mappings with inflated source and name strings where
+	 * the generated positions are compared.
+	 */
+	function compareByGeneratedPositionsInflated(mappingA, mappingB) {
+	  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = strcmp(mappingA.source, mappingB.source);
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.originalLine - mappingB.originalLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  cmp = mappingA.originalColumn - mappingB.originalColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+	
+	  return strcmp(mappingA.name, mappingB.name);
+	}
+	exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;
+
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	var util = __webpack_require__(4);
+	var has = Object.prototype.hasOwnProperty;
+	var hasNativeMap = typeof Map !== "undefined";
+	
+	/**
+	 * A data structure which is a combination of an array and a set. Adding a new
+	 * member is O(1), testing for membership is O(1), and finding the index of an
+	 * element is O(1). Removing elements from the set is not supported. Only
+	 * strings are supported for membership.
+	 */
+	function ArraySet() {
+	  this._array = [];
+	  this._set = hasNativeMap ? new Map() : Object.create(null);
+	}
+	
+	/**
+	 * Static method for creating ArraySet instances from an existing array.
+	 */
+	ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
+	  var set = new ArraySet();
+	  for (var i = 0, len = aArray.length; i < len; i++) {
+	    set.add(aArray[i], aAllowDuplicates);
+	  }
+	  return set;
+	};
+	
+	/**
+	 * Return how many unique items are in this ArraySet. If duplicates have been
+	 * added, than those do not count towards the size.
+	 *
+	 * @returns Number
+	 */
+	ArraySet.prototype.size = function ArraySet_size() {
+	  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;
+	};
+	
+	/**
+	 * Add the given string to this set.
+	 *
+	 * @param String aStr
+	 */
+	ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
+	  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);
+	  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);
+	  var idx = this._array.length;
+	  if (!isDuplicate || aAllowDuplicates) {
+	    this._array.push(aStr);
+	  }
+	  if (!isDuplicate) {
+	    if (hasNativeMap) {
+	      this._set.set(aStr, idx);
+	    } else {
+	      this._set[sStr] = idx;
+	    }
+	  }
+	};
+	
+	/**
+	 * Is the given string a member of this set?
+	 *
+	 * @param String aStr
+	 */
+	ArraySet.prototype.has = function ArraySet_has(aStr) {
+	  if (hasNativeMap) {
+	    return this._set.has(aStr);
+	  } else {
+	    var sStr = util.toSetString(aStr);
+	    return has.call(this._set, sStr);
+	  }
+	};
+	
+	/**
+	 * What is the index of the given string in the array?
+	 *
+	 * @param String aStr
+	 */
+	ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
+	  if (hasNativeMap) {
+	    var idx = this._set.get(aStr);
+	    if (idx >= 0) {
+	        return idx;
+	    }
+	  } else {
+	    var sStr = util.toSetString(aStr);
+	    if (has.call(this._set, sStr)) {
+	      return this._set[sStr];
+	    }
+	  }
+	
+	  throw new Error('"' + aStr + '" is not in the set.');
+	};
+	
+	/**
+	 * What is the element at the given index?
+	 *
+	 * @param Number aIdx
+	 */
+	ArraySet.prototype.at = function ArraySet_at(aIdx) {
+	  if (aIdx >= 0 && aIdx < this._array.length) {
+	    return this._array[aIdx];
+	  }
+	  throw new Error('No element indexed by ' + aIdx);
+	};
+	
+	/**
+	 * Returns the array representation of this set (which has the proper indices
+	 * indicated by indexOf). Note that this is a copy of the internal array used
+	 * for storing the members so that no one can mess with internal state.
+	 */
+	ArraySet.prototype.toArray = function ArraySet_toArray() {
+	  return this._array.slice();
+	};
+	
+	exports.ArraySet = ArraySet;
+
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2014 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	var util = __webpack_require__(4);
+	
+	/**
+	 * Determine whether mappingB is after mappingA with respect to generated
+	 * position.
+	 */
+	function generatedPositionAfter(mappingA, mappingB) {
+	  // Optimized for most common case
+	  var lineA = mappingA.generatedLine;
+	  var lineB = mappingB.generatedLine;
+	  var columnA = mappingA.generatedColumn;
+	  var columnB = mappingB.generatedColumn;
+	  return lineB > lineA || lineB == lineA && columnB >= columnA ||
+	         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;
+	}
+	
+	/**
+	 * A data structure to provide a sorted view of accumulated mappings in a
+	 * performance conscious manner. It trades a neglibable overhead in general
+	 * case for a large speedup in case of mappings being added in order.
+	 */
+	function MappingList() {
+	  this._array = [];
+	  this._sorted = true;
+	  // Serves as infimum
+	  this._last = {generatedLine: -1, generatedColumn: 0};
+	}
+	
+	/**
+	 * Iterate through internal items. This method takes the same arguments that
+	 * `Array.prototype.forEach` takes.
+	 *
+	 * NOTE: The order of the mappings is NOT guaranteed.
+	 */
+	MappingList.prototype.unsortedForEach =
+	  function MappingList_forEach(aCallback, aThisArg) {
+	    this._array.forEach(aCallback, aThisArg);
+	  };
+	
+	/**
+	 * Add the given source mapping.
+	 *
+	 * @param Object aMapping
+	 */
+	MappingList.prototype.add = function MappingList_add(aMapping) {
+	  if (generatedPositionAfter(this._last, aMapping)) {
+	    this._last = aMapping;
+	    this._array.push(aMapping);
+	  } else {
+	    this._sorted = false;
+	    this._array.push(aMapping);
+	  }
+	};
+	
+	/**
+	 * Returns the flat, sorted array of mappings. The mappings are sorted by
+	 * generated position.
+	 *
+	 * WARNING: This method returns internal data without copying, for
+	 * performance. The return value must NOT be mutated, and should be treated as
+	 * an immutable borrow. If you want to take ownership, you must make your own
+	 * copy.
+	 */
+	MappingList.prototype.toArray = function MappingList_toArray() {
+	  if (!this._sorted) {
+	    this._array.sort(util.compareByGeneratedPositionsInflated);
+	    this._sorted = true;
+	  }
+	  return this._array;
+	};
+	
+	exports.MappingList = MappingList;
+
+
+/***/ }),
+/* 7 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	var util = __webpack_require__(4);
+	var binarySearch = __webpack_require__(8);
+	var ArraySet = __webpack_require__(5).ArraySet;
+	var base64VLQ = __webpack_require__(2);
+	var quickSort = __webpack_require__(9).quickSort;
+	
+	function SourceMapConsumer(aSourceMap) {
+	  var sourceMap = aSourceMap;
+	  if (typeof aSourceMap === 'string') {
+	    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+	  }
+	
+	  return sourceMap.sections != null
+	    ? new IndexedSourceMapConsumer(sourceMap)
+	    : new BasicSourceMapConsumer(sourceMap);
+	}
+	
+	SourceMapConsumer.fromSourceMap = function(aSourceMap) {
+	  return BasicSourceMapConsumer.fromSourceMap(aSourceMap);
+	}
+	
+	/**
+	 * The version of the source mapping spec that we are consuming.
+	 */
+	SourceMapConsumer.prototype._version = 3;
+	
+	// `__generatedMappings` and `__originalMappings` are arrays that hold the
+	// parsed mapping coordinates from the source map's "mappings" attribute. They
+	// are lazily instantiated, accessed via the `_generatedMappings` and
+	// `_originalMappings` getters respectively, and we only parse the mappings
+	// and create these arrays once queried for a source location. We jump through
+	// these hoops because there can be many thousands of mappings, and parsing
+	// them is expensive, so we only want to do it if we must.
+	//
+	// Each object in the arrays is of the form:
+	//
+	//     {
+	//       generatedLine: The line number in the generated code,
+	//       generatedColumn: The column number in the generated code,
+	//       source: The path to the original source file that generated this
+	//               chunk of code,
+	//       originalLine: The line number in the original source that
+	//                     corresponds to this chunk of generated code,
+	//       originalColumn: The column number in the original source that
+	//                       corresponds to this chunk of generated code,
+	//       name: The name of the original symbol which generated this chunk of
+	//             code.
+	//     }
+	//
+	// All properties except for `generatedLine` and `generatedColumn` can be
+	// `null`.
+	//
+	// `_generatedMappings` is ordered by the generated positions.
+	//
+	// `_originalMappings` is ordered by the original positions.
+	
+	SourceMapConsumer.prototype.__generatedMappings = null;
+	Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {
+	  get: function () {
+	    if (!this.__generatedMappings) {
+	      this._parseMappings(this._mappings, this.sourceRoot);
+	    }
+	
+	    return this.__generatedMappings;
+	  }
+	});
+	
+	SourceMapConsumer.prototype.__originalMappings = null;
+	Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {
+	  get: function () {
+	    if (!this.__originalMappings) {
+	      this._parseMappings(this._mappings, this.sourceRoot);
+	    }
+	
+	    return this.__originalMappings;
+	  }
+	});
+	
+	SourceMapConsumer.prototype._charIsMappingSeparator =
+	  function SourceMapConsumer_charIsMappingSeparator(aStr, index) {
+	    var c = aStr.charAt(index);
+	    return c === ";" || c === ",";
+	  };
+	
+	/**
+	 * Parse the mappings in a string in to a data structure which we can easily
+	 * query (the ordered arrays in the `this.__generatedMappings` and
+	 * `this.__originalMappings` properties).
+	 */
+	SourceMapConsumer.prototype._parseMappings =
+	  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+	    throw new Error("Subclasses must implement _parseMappings");
+	  };
+	
+	SourceMapConsumer.GENERATED_ORDER = 1;
+	SourceMapConsumer.ORIGINAL_ORDER = 2;
+	
+	SourceMapConsumer.GREATEST_LOWER_BOUND = 1;
+	SourceMapConsumer.LEAST_UPPER_BOUND = 2;
+	
+	/**
+	 * Iterate over each mapping between an original source/line/column and a
+	 * generated line/column in this source map.
+	 *
+	 * @param Function aCallback
+	 *        The function that is called with each mapping.
+	 * @param Object aContext
+	 *        Optional. If specified, this object will be the value of `this` every
+	 *        time that `aCallback` is called.
+	 * @param aOrder
+	 *        Either `SourceMapConsumer.GENERATED_ORDER` or
+	 *        `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to
+	 *        iterate over the mappings sorted by the generated file's line/column
+	 *        order or the original's source/line/column order, respectively. Defaults to
+	 *        `SourceMapConsumer.GENERATED_ORDER`.
+	 */
+	SourceMapConsumer.prototype.eachMapping =
+	  function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {
+	    var context = aContext || null;
+	    var order = aOrder || SourceMapConsumer.GENERATED_ORDER;
+	
+	    var mappings;
+	    switch (order) {
+	    case SourceMapConsumer.GENERATED_ORDER:
+	      mappings = this._generatedMappings;
+	      break;
+	    case SourceMapConsumer.ORIGINAL_ORDER:
+	      mappings = this._originalMappings;
+	      break;
+	    default:
+	      throw new Error("Unknown order of iteration.");
+	    }
+	
+	    var sourceRoot = this.sourceRoot;
+	    mappings.map(function (mapping) {
+	      var source = mapping.source === null ? null : this._sources.at(mapping.source);
+	      if (source != null && sourceRoot != null) {
+	        source = util.join(sourceRoot, source);
+	      }
+	      return {
+	        source: source,
+	        generatedLine: mapping.generatedLine,
+	        generatedColumn: mapping.generatedColumn,
+	        originalLine: mapping.originalLine,
+	        originalColumn: mapping.originalColumn,
+	        name: mapping.name === null ? null : this._names.at(mapping.name)
+	      };
+	    }, this).forEach(aCallback, context);
+	  };
+	
+	/**
+	 * Returns all generated line and column information for the original source,
+	 * line, and column provided. If no column is provided, returns all mappings
+	 * corresponding to a either the line we are searching for or the next
+	 * closest line that has any mappings. Otherwise, returns all mappings
+	 * corresponding to the given line and either the column we are searching for
+	 * or the next closest column that has any offsets.
+	 *
+	 * The only argument is an object with the following properties:
+	 *
+	 *   - source: The filename of the original source.
+	 *   - line: The line number in the original source.
+	 *   - column: Optional. the column number in the original source.
+	 *
+	 * and an array of objects is returned, each with the following properties:
+	 *
+	 *   - line: The line number in the generated source, or null.
+	 *   - column: The column number in the generated source, or null.
+	 */
+	SourceMapConsumer.prototype.allGeneratedPositionsFor =
+	  function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {
+	    var line = util.getArg(aArgs, 'line');
+	
+	    // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping
+	    // returns the index of the closest mapping less than the needle. By
+	    // setting needle.originalColumn to 0, we thus find the last mapping for
+	    // the given line, provided such a mapping exists.
+	    var needle = {
+	      source: util.getArg(aArgs, 'source'),
+	      originalLine: line,
+	      originalColumn: util.getArg(aArgs, 'column', 0)
+	    };
+	
+	    if (this.sourceRoot != null) {
+	      needle.source = util.relative(this.sourceRoot, needle.source);
+	    }
+	    if (!this._sources.has(needle.source)) {
+	      return [];
+	    }
+	    needle.source = this._sources.indexOf(needle.source);
+	
+	    var mappings = [];
+	
+	    var index = this._findMapping(needle,
+	                                  this._originalMappings,
+	                                  "originalLine",
+	                                  "originalColumn",
+	                                  util.compareByOriginalPositions,
+	                                  binarySearch.LEAST_UPPER_BOUND);
+	    if (index >= 0) {
+	      var mapping = this._originalMappings[index];
+	
+	      if (aArgs.column === undefined) {
+	        var originalLine = mapping.originalLine;
+	
+	        // Iterate until either we run out of mappings, or we run into
+	        // a mapping for a different line than the one we found. Since
+	        // mappings are sorted, this is guaranteed to find all mappings for
+	        // the line we found.
+	        while (mapping && mapping.originalLine === originalLine) {
+	          mappings.push({
+	            line: util.getArg(mapping, 'generatedLine', null),
+	            column: util.getArg(mapping, 'generatedColumn', null),
+	            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+	          });
+	
+	          mapping = this._originalMappings[++index];
+	        }
+	      } else {
+	        var originalColumn = mapping.originalColumn;
+	
+	        // Iterate until either we run out of mappings, or we run into
+	        // a mapping for a different line than the one we were searching for.
+	        // Since mappings are sorted, this is guaranteed to find all mappings for
+	        // the line we are searching for.
+	        while (mapping &&
+	               mapping.originalLine === line &&
+	               mapping.originalColumn == originalColumn) {
+	          mappings.push({
+	            line: util.getArg(mapping, 'generatedLine', null),
+	            column: util.getArg(mapping, 'generatedColumn', null),
+	            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+	          });
+	
+	          mapping = this._originalMappings[++index];
+	        }
+	      }
+	    }
+	
+	    return mappings;
+	  };
+	
+	exports.SourceMapConsumer = SourceMapConsumer;
+	
+	/**
+	 * A BasicSourceMapConsumer instance represents a parsed source map which we can
+	 * query for information about the original file positions by giving it a file
+	 * position in the generated source.
+	 *
+	 * The only parameter is the raw source map (either as a JSON string, or
+	 * already parsed to an object). According to the spec, source maps have the
+	 * following attributes:
+	 *
+	 *   - version: Which version of the source map spec this map is following.
+	 *   - sources: An array of URLs to the original source files.
+	 *   - names: An array of identifiers which can be referrenced by individual mappings.
+	 *   - sourceRoot: Optional. The URL root from which all sources are relative.
+	 *   - sourcesContent: Optional. An array of contents of the original source files.
+	 *   - mappings: A string of base64 VLQs which contain the actual mappings.
+	 *   - file: Optional. The generated file this source map is associated with.
+	 *
+	 * Here is an example source map, taken from the source map spec[0]:
+	 *
+	 *     {
+	 *       version : 3,
+	 *       file: "out.js",
+	 *       sourceRoot : "",
+	 *       sources: ["foo.js", "bar.js"],
+	 *       names: ["src", "maps", "are", "fun"],
+	 *       mappings: "AA,AB;;ABCDE;"
+	 *     }
+	 *
+	 * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#
+	 */
+	function BasicSourceMapConsumer(aSourceMap) {
+	  var sourceMap = aSourceMap;
+	  if (typeof aSourceMap === 'string') {
+	    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+	  }
+	
+	  var version = util.getArg(sourceMap, 'version');
+	  var sources = util.getArg(sourceMap, 'sources');
+	  // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which
+	  // requires the array) to play nice here.
+	  var names = util.getArg(sourceMap, 'names', []);
+	  var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);
+	  var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);
+	  var mappings = util.getArg(sourceMap, 'mappings');
+	  var file = util.getArg(sourceMap, 'file', null);
+	
+	  // Once again, Sass deviates from the spec and supplies the version as a
+	  // string rather than a number, so we use loose equality checking here.
+	  if (version != this._version) {
+	    throw new Error('Unsupported version: ' + version);
+	  }
+	
+	  sources = sources
+	    .map(String)
+	    // Some source maps produce relative source paths like "./foo.js" instead of
+	    // "foo.js".  Normalize these first so that future comparisons will succeed.
+	    // See bugzil.la/1090768.
+	    .map(util.normalize)
+	    // Always ensure that absolute sources are internally stored relative to
+	    // the source root, if the source root is absolute. Not doing this would
+	    // be particularly problematic when the source root is a prefix of the
+	    // source (valid, but why??). See github issue #199 and bugzil.la/1188982.
+	    .map(function (source) {
+	      return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)
+	        ? util.relative(sourceRoot, source)
+	        : source;
+	    });
+	
+	  // Pass `true` below to allow duplicate names and sources. While source maps
+	  // are intended to be compressed and deduplicated, the TypeScript compiler
+	  // sometimes generates source maps with duplicates in them. See Github issue
+	  // #72 and bugzil.la/889492.
+	  this._names = ArraySet.fromArray(names.map(String), true);
+	  this._sources = ArraySet.fromArray(sources, true);
+	
+	  this.sourceRoot = sourceRoot;
+	  this.sourcesContent = sourcesContent;
+	  this._mappings = mappings;
+	  this.file = file;
+	}
+	
+	BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
+	BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;
+	
+	/**
+	 * Create a BasicSourceMapConsumer from a SourceMapGenerator.
+	 *
+	 * @param SourceMapGenerator aSourceMap
+	 *        The source map that will be consumed.
+	 * @returns BasicSourceMapConsumer
+	 */
+	BasicSourceMapConsumer.fromSourceMap =
+	  function SourceMapConsumer_fromSourceMap(aSourceMap) {
+	    var smc = Object.create(BasicSourceMapConsumer.prototype);
+	
+	    var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);
+	    var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);
+	    smc.sourceRoot = aSourceMap._sourceRoot;
+	    smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),
+	                                                            smc.sourceRoot);
+	    smc.file = aSourceMap._file;
+	
+	    // Because we are modifying the entries (by converting string sources and
+	    // names to indices into the sources and names ArraySets), we have to make
+	    // a copy of the entry or else bad things happen. Shared mutable state
+	    // strikes again! See github issue #191.
+	
+	    var generatedMappings = aSourceMap._mappings.toArray().slice();
+	    var destGeneratedMappings = smc.__generatedMappings = [];
+	    var destOriginalMappings = smc.__originalMappings = [];
+	
+	    for (var i = 0, length = generatedMappings.length; i < length; i++) {
+	      var srcMapping = generatedMappings[i];
+	      var destMapping = new Mapping;
+	      destMapping.generatedLine = srcMapping.generatedLine;
+	      destMapping.generatedColumn = srcMapping.generatedColumn;
+	
+	      if (srcMapping.source) {
+	        destMapping.source = sources.indexOf(srcMapping.source);
+	        destMapping.originalLine = srcMapping.originalLine;
+	        destMapping.originalColumn = srcMapping.originalColumn;
+	
+	        if (srcMapping.name) {
+	          destMapping.name = names.indexOf(srcMapping.name);
+	        }
+	
+	        destOriginalMappings.push(destMapping);
+	      }
+	
+	      destGeneratedMappings.push(destMapping);
+	    }
+	
+	    quickSort(smc.__originalMappings, util.compareByOriginalPositions);
+	
+	    return smc;
+	  };
+	
+	/**
+	 * The version of the source mapping spec that we are consuming.
+	 */
+	BasicSourceMapConsumer.prototype._version = 3;
+	
+	/**
+	 * The list of original sources.
+	 */
+	Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {
+	  get: function () {
+	    return this._sources.toArray().map(function (s) {
+	      return this.sourceRoot != null ? util.join(this.sourceRoot, s) : s;
+	    }, this);
+	  }
+	});
+	
+	/**
+	 * Provide the JIT with a nice shape / hidden class.
+	 */
+	function Mapping() {
+	  this.generatedLine = 0;
+	  this.generatedColumn = 0;
+	  this.source = null;
+	  this.originalLine = null;
+	  this.originalColumn = null;
+	  this.name = null;
+	}
+	
+	/**
+	 * Parse the mappings in a string in to a data structure which we can easily
+	 * query (the ordered arrays in the `this.__generatedMappings` and
+	 * `this.__originalMappings` properties).
+	 */
+	BasicSourceMapConsumer.prototype._parseMappings =
+	  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+	    var generatedLine = 1;
+	    var previousGeneratedColumn = 0;
+	    var previousOriginalLine = 0;
+	    var previousOriginalColumn = 0;
+	    var previousSource = 0;
+	    var previousName = 0;
+	    var length = aStr.length;
+	    var index = 0;
+	    var cachedSegments = {};
+	    var temp = {};
+	    var originalMappings = [];
+	    var generatedMappings = [];
+	    var mapping, str, segment, end, value;
+	
+	    while (index < length) {
+	      if (aStr.charAt(index) === ';') {
+	        generatedLine++;
+	        index++;
+	        previousGeneratedColumn = 0;
+	      }
+	      else if (aStr.charAt(index) === ',') {
+	        index++;
+	      }
+	      else {
+	        mapping = new Mapping();
+	        mapping.generatedLine = generatedLine;
+	
+	        // Because each offset is encoded relative to the previous one,
+	        // many segments often have the same encoding. We can exploit this
+	        // fact by caching the parsed variable length fields of each segment,
+	        // allowing us to avoid a second parse if we encounter the same
+	        // segment again.
+	        for (end = index; end < length; end++) {
+	          if (this._charIsMappingSeparator(aStr, end)) {
+	            break;
+	          }
+	        }
+	        str = aStr.slice(index, end);
+	
+	        segment = cachedSegments[str];
+	        if (segment) {
+	          index += str.length;
+	        } else {
+	          segment = [];
+	          while (index < end) {
+	            base64VLQ.decode(aStr, index, temp);
+	            value = temp.value;
+	            index = temp.rest;
+	            segment.push(value);
+	          }
+	
+	          if (segment.length === 2) {
+	            throw new Error('Found a source, but no line and column');
+	          }
+	
+	          if (segment.length === 3) {
+	            throw new Error('Found a source and line, but no column');
+	          }
+	
+	          cachedSegments[str] = segment;
+	        }
+	
+	        // Generated column.
+	        mapping.generatedColumn = previousGeneratedColumn + segment[0];
+	        previousGeneratedColumn = mapping.generatedColumn;
+	
+	        if (segment.length > 1) {
+	          // Original source.
+	          mapping.source = previousSource + segment[1];
+	          previousSource += segment[1];
+	
+	          // Original line.
+	          mapping.originalLine = previousOriginalLine + segment[2];
+	          previousOriginalLine = mapping.originalLine;
+	          // Lines are stored 0-based
+	          mapping.originalLine += 1;
+	
+	          // Original column.
+	          mapping.originalColumn = previousOriginalColumn + segment[3];
+	          previousOriginalColumn = mapping.originalColumn;
+	
+	          if (segment.length > 4) {
+	            // Original name.
+	            mapping.name = previousName + segment[4];
+	            previousName += segment[4];
+	          }
+	        }
+	
+	        generatedMappings.push(mapping);
+	        if (typeof mapping.originalLine === 'number') {
+	          originalMappings.push(mapping);
+	        }
+	      }
+	    }
+	
+	    quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);
+	    this.__generatedMappings = generatedMappings;
+	
+	    quickSort(originalMappings, util.compareByOriginalPositions);
+	    this.__originalMappings = originalMappings;
+	  };
+	
+	/**
+	 * Find the mapping that best matches the hypothetical "needle" mapping that
+	 * we are searching for in the given "haystack" of mappings.
+	 */
+	BasicSourceMapConsumer.prototype._findMapping =
+	  function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,
+	                                         aColumnName, aComparator, aBias) {
+	    // To return the position we are searching for, we must first find the
+	    // mapping for the given position and then return the opposite position it
+	    // points to. Because the mappings are sorted, we can use binary search to
+	    // find the best mapping.
+	
+	    if (aNeedle[aLineName] <= 0) {
+	      throw new TypeError('Line must be greater than or equal to 1, got '
+	                          + aNeedle[aLineName]);
+	    }
+	    if (aNeedle[aColumnName] < 0) {
+	      throw new TypeError('Column must be greater than or equal to 0, got '
+	                          + aNeedle[aColumnName]);
+	    }
+	
+	    return binarySearch.search(aNeedle, aMappings, aComparator, aBias);
+	  };
+	
+	/**
+	 * Compute the last column for each generated mapping. The last column is
+	 * inclusive.
+	 */
+	BasicSourceMapConsumer.prototype.computeColumnSpans =
+	  function SourceMapConsumer_computeColumnSpans() {
+	    for (var index = 0; index < this._generatedMappings.length; ++index) {
+	      var mapping = this._generatedMappings[index];
+	
+	      // Mappings do not contain a field for the last generated columnt. We
+	      // can come up with an optimistic estimate, however, by assuming that
+	      // mappings are contiguous (i.e. given two consecutive mappings, the
+	      // first mapping ends where the second one starts).
+	      if (index + 1 < this._generatedMappings.length) {
+	        var nextMapping = this._generatedMappings[index + 1];
+	
+	        if (mapping.generatedLine === nextMapping.generatedLine) {
+	          mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;
+	          continue;
+	        }
+	      }
+	
+	      // The last mapping for each line spans the entire line.
+	      mapping.lastGeneratedColumn = Infinity;
+	    }
+	  };
+	
+	/**
+	 * Returns the original source, line, and column information for the generated
+	 * source's line and column positions provided. The only argument is an object
+	 * with the following properties:
+	 *
+	 *   - line: The line number in the generated source.
+	 *   - column: The column number in the generated source.
+	 *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
+	 *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - source: The original source file, or null.
+	 *   - line: The line number in the original source, or null.
+	 *   - column: The column number in the original source, or null.
+	 *   - name: The original identifier, or null.
+	 */
+	BasicSourceMapConsumer.prototype.originalPositionFor =
+	  function SourceMapConsumer_originalPositionFor(aArgs) {
+	    var needle = {
+	      generatedLine: util.getArg(aArgs, 'line'),
+	      generatedColumn: util.getArg(aArgs, 'column')
+	    };
+	
+	    var index = this._findMapping(
+	      needle,
+	      this._generatedMappings,
+	      "generatedLine",
+	      "generatedColumn",
+	      util.compareByGeneratedPositionsDeflated,
+	      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
+	    );
+	
+	    if (index >= 0) {
+	      var mapping = this._generatedMappings[index];
+	
+	      if (mapping.generatedLine === needle.generatedLine) {
+	        var source = util.getArg(mapping, 'source', null);
+	        if (source !== null) {
+	          source = this._sources.at(source);
+	          if (this.sourceRoot != null) {
+	            source = util.join(this.sourceRoot, source);
+	          }
+	        }
+	        var name = util.getArg(mapping, 'name', null);
+	        if (name !== null) {
+	          name = this._names.at(name);
+	        }
+	        return {
+	          source: source,
+	          line: util.getArg(mapping, 'originalLine', null),
+	          column: util.getArg(mapping, 'originalColumn', null),
+	          name: name
+	        };
+	      }
+	    }
+	
+	    return {
+	      source: null,
+	      line: null,
+	      column: null,
+	      name: null
+	    };
+	  };
+	
+	/**
+	 * Return true if we have the source content for every source in the source
+	 * map, false otherwise.
+	 */
+	BasicSourceMapConsumer.prototype.hasContentsOfAllSources =
+	  function BasicSourceMapConsumer_hasContentsOfAllSources() {
+	    if (!this.sourcesContent) {
+	      return false;
+	    }
+	    return this.sourcesContent.length >= this._sources.size() &&
+	      !this.sourcesContent.some(function (sc) { return sc == null; });
+	  };
+	
+	/**
+	 * Returns the original source content. The only argument is the url of the
+	 * original source file. Returns null if no original source content is
+	 * available.
+	 */
+	BasicSourceMapConsumer.prototype.sourceContentFor =
+	  function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
+	    if (!this.sourcesContent) {
+	      return null;
+	    }
+	
+	    if (this.sourceRoot != null) {
+	      aSource = util.relative(this.sourceRoot, aSource);
+	    }
+	
+	    if (this._sources.has(aSource)) {
+	      return this.sourcesContent[this._sources.indexOf(aSource)];
+	    }
+	
+	    var url;
+	    if (this.sourceRoot != null
+	        && (url = util.urlParse(this.sourceRoot))) {
+	      // XXX: file:// URIs and absolute paths lead to unexpected behavior for
+	      // many users. We can help them out when they expect file:// URIs to
+	      // behave like it would if they were running a local HTTP server. See
+	      // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.
+	      var fileUriAbsPath = aSource.replace(/^file:\/\//, "");
+	      if (url.scheme == "file"
+	          && this._sources.has(fileUriAbsPath)) {
+	        return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]
+	      }
+	
+	      if ((!url.path || url.path == "/")
+	          && this._sources.has("/" + aSource)) {
+	        return this.sourcesContent[this._sources.indexOf("/" + aSource)];
+	      }
+	    }
+	
+	    // This function is used recursively from
+	    // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we
+	    // don't want to throw if we can't find the source - we just want to
+	    // return null, so we provide a flag to exit gracefully.
+	    if (nullOnMissing) {
+	      return null;
+	    }
+	    else {
+	      throw new Error('"' + aSource + '" is not in the SourceMap.');
+	    }
+	  };
+	
+	/**
+	 * Returns the generated line and column information for the original source,
+	 * line, and column positions provided. The only argument is an object with
+	 * the following properties:
+	 *
+	 *   - source: The filename of the original source.
+	 *   - line: The line number in the original source.
+	 *   - column: The column number in the original source.
+	 *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
+	 *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - line: The line number in the generated source, or null.
+	 *   - column: The column number in the generated source, or null.
+	 */
+	BasicSourceMapConsumer.prototype.generatedPositionFor =
+	  function SourceMapConsumer_generatedPositionFor(aArgs) {
+	    var source = util.getArg(aArgs, 'source');
+	    if (this.sourceRoot != null) {
+	      source = util.relative(this.sourceRoot, source);
+	    }
+	    if (!this._sources.has(source)) {
+	      return {
+	        line: null,
+	        column: null,
+	        lastColumn: null
+	      };
+	    }
+	    source = this._sources.indexOf(source);
+	
+	    var needle = {
+	      source: source,
+	      originalLine: util.getArg(aArgs, 'line'),
+	      originalColumn: util.getArg(aArgs, 'column')
+	    };
+	
+	    var index = this._findMapping(
+	      needle,
+	      this._originalMappings,
+	      "originalLine",
+	      "originalColumn",
+	      util.compareByOriginalPositions,
+	      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
+	    );
+	
+	    if (index >= 0) {
+	      var mapping = this._originalMappings[index];
+	
+	      if (mapping.source === needle.source) {
+	        return {
+	          line: util.getArg(mapping, 'generatedLine', null),
+	          column: util.getArg(mapping, 'generatedColumn', null),
+	          lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+	        };
+	      }
+	    }
+	
+	    return {
+	      line: null,
+	      column: null,
+	      lastColumn: null
+	    };
+	  };
+	
+	exports.BasicSourceMapConsumer = BasicSourceMapConsumer;
+	
+	/**
+	 * An IndexedSourceMapConsumer instance represents a parsed source map which
+	 * we can query for information. It differs from BasicSourceMapConsumer in
+	 * that it takes "indexed" source maps (i.e. ones with a "sections" field) as
+	 * input.
+	 *
+	 * The only parameter is a raw source map (either as a JSON string, or already
+	 * parsed to an object). According to the spec for indexed source maps, they
+	 * have the following attributes:
+	 *
+	 *   - version: Which version of the source map spec this map is following.
+	 *   - file: Optional. The generated file this source map is associated with.
+	 *   - sections: A list of section definitions.
+	 *
+	 * Each value under the "sections" field has two fields:
+	 *   - offset: The offset into the original specified at which this section
+	 *       begins to apply, defined as an object with a "line" and "column"
+	 *       field.
+	 *   - map: A source map definition. This source map could also be indexed,
+	 *       but doesn't have to be.
+	 *
+	 * Instead of the "map" field, it's also possible to have a "url" field
+	 * specifying a URL to retrieve a source map from, but that's currently
+	 * unsupported.
+	 *
+	 * Here's an example source map, taken from the source map spec[0], but
+	 * modified to omit a section which uses the "url" field.
+	 *
+	 *  {
+	 *    version : 3,
+	 *    file: "app.js",
+	 *    sections: [{
+	 *      offset: {line:100, column:10},
+	 *      map: {
+	 *        version : 3,
+	 *        file: "section.js",
+	 *        sources: ["foo.js", "bar.js"],
+	 *        names: ["src", "maps", "are", "fun"],
+	 *        mappings: "AAAA,E;;ABCDE;"
+	 *      }
+	 *    }],
+	 *  }
+	 *
+	 * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt
+	 */
+	function IndexedSourceMapConsumer(aSourceMap) {
+	  var sourceMap = aSourceMap;
+	  if (typeof aSourceMap === 'string') {
+	    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+	  }
+	
+	  var version = util.getArg(sourceMap, 'version');
+	  var sections = util.getArg(sourceMap, 'sections');
+	
+	  if (version != this._version) {
+	    throw new Error('Unsupported version: ' + version);
+	  }
+	
+	  this._sources = new ArraySet();
+	  this._names = new ArraySet();
+	
+	  var lastOffset = {
+	    line: -1,
+	    column: 0
+	  };
+	  this._sections = sections.map(function (s) {
+	    if (s.url) {
+	      // The url field will require support for asynchronicity.
+	      // See https://github.com/mozilla/source-map/issues/16
+	      throw new Error('Support for url field in sections not implemented.');
+	    }
+	    var offset = util.getArg(s, 'offset');
+	    var offsetLine = util.getArg(offset, 'line');
+	    var offsetColumn = util.getArg(offset, 'column');
+	
+	    if (offsetLine < lastOffset.line ||
+	        (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {
+	      throw new Error('Section offsets must be ordered and non-overlapping.');
+	    }
+	    lastOffset = offset;
+	
+	    return {
+	      generatedOffset: {
+	        // The offset fields are 0-based, but we use 1-based indices when
+	        // encoding/decoding from VLQ.
+	        generatedLine: offsetLine + 1,
+	        generatedColumn: offsetColumn + 1
+	      },
+	      consumer: new SourceMapConsumer(util.getArg(s, 'map'))
+	    }
+	  });
+	}
+	
+	IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
+	IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;
+	
+	/**
+	 * The version of the source mapping spec that we are consuming.
+	 */
+	IndexedSourceMapConsumer.prototype._version = 3;
+	
+	/**
+	 * The list of original sources.
+	 */
+	Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {
+	  get: function () {
+	    var sources = [];
+	    for (var i = 0; i < this._sections.length; i++) {
+	      for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {
+	        sources.push(this._sections[i].consumer.sources[j]);
+	      }
+	    }
+	    return sources;
+	  }
+	});
+	
+	/**
+	 * Returns the original source, line, and column information for the generated
+	 * source's line and column positions provided. The only argument is an object
+	 * with the following properties:
+	 *
+	 *   - line: The line number in the generated source.
+	 *   - column: The column number in the generated source.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - source: The original source file, or null.
+	 *   - line: The line number in the original source, or null.
+	 *   - column: The column number in the original source, or null.
+	 *   - name: The original identifier, or null.
+	 */
+	IndexedSourceMapConsumer.prototype.originalPositionFor =
+	  function IndexedSourceMapConsumer_originalPositionFor(aArgs) {
+	    var needle = {
+	      generatedLine: util.getArg(aArgs, 'line'),
+	      generatedColumn: util.getArg(aArgs, 'column')
+	    };
+	
+	    // Find the section containing the generated position we're trying to map
+	    // to an original position.
+	    var sectionIndex = binarySearch.search(needle, this._sections,
+	      function(needle, section) {
+	        var cmp = needle.generatedLine - section.generatedOffset.generatedLine;
+	        if (cmp) {
+	          return cmp;
+	        }
+	
+	        return (needle.generatedColumn -
+	                section.generatedOffset.generatedColumn);
+	      });
+	    var section = this._sections[sectionIndex];
+	
+	    if (!section) {
+	      return {
+	        source: null,
+	        line: null,
+	        column: null,
+	        name: null
+	      };
+	    }
+	
+	    return section.consumer.originalPositionFor({
+	      line: needle.generatedLine -
+	        (section.generatedOffset.generatedLine - 1),
+	      column: needle.generatedColumn -
+	        (section.generatedOffset.generatedLine === needle.generatedLine
+	         ? section.generatedOffset.generatedColumn - 1
+	         : 0),
+	      bias: aArgs.bias
+	    });
+	  };
+	
+	/**
+	 * Return true if we have the source content for every source in the source
+	 * map, false otherwise.
+	 */
+	IndexedSourceMapConsumer.prototype.hasContentsOfAllSources =
+	  function IndexedSourceMapConsumer_hasContentsOfAllSources() {
+	    return this._sections.every(function (s) {
+	      return s.consumer.hasContentsOfAllSources();
+	    });
+	  };
+	
+	/**
+	 * Returns the original source content. The only argument is the url of the
+	 * original source file. Returns null if no original source content is
+	 * available.
+	 */
+	IndexedSourceMapConsumer.prototype.sourceContentFor =
+	  function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
+	    for (var i = 0; i < this._sections.length; i++) {
+	      var section = this._sections[i];
+	
+	      var content = section.consumer.sourceContentFor(aSource, true);
+	      if (content) {
+	        return content;
+	      }
+	    }
+	    if (nullOnMissing) {
+	      return null;
+	    }
+	    else {
+	      throw new Error('"' + aSource + '" is not in the SourceMap.');
+	    }
+	  };
+	
+	/**
+	 * Returns the generated line and column information for the original source,
+	 * line, and column positions provided. The only argument is an object with
+	 * the following properties:
+	 *
+	 *   - source: The filename of the original source.
+	 *   - line: The line number in the original source.
+	 *   - column: The column number in the original source.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - line: The line number in the generated source, or null.
+	 *   - column: The column number in the generated source, or null.
+	 */
+	IndexedSourceMapConsumer.prototype.generatedPositionFor =
+	  function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {
+	    for (var i = 0; i < this._sections.length; i++) {
+	      var section = this._sections[i];
+	
+	      // Only consider this section if the requested source is in the list of
+	      // sources of the consumer.
+	      if (section.consumer.sources.indexOf(util.getArg(aArgs, 'source')) === -1) {
+	        continue;
+	      }
+	      var generatedPosition = section.consumer.generatedPositionFor(aArgs);
+	      if (generatedPosition) {
+	        var ret = {
+	          line: generatedPosition.line +
+	            (section.generatedOffset.generatedLine - 1),
+	          column: generatedPosition.column +
+	            (section.generatedOffset.generatedLine === generatedPosition.line
+	             ? section.generatedOffset.generatedColumn - 1
+	             : 0)
+	        };
+	        return ret;
+	      }
+	    }
+	
+	    return {
+	      line: null,
+	      column: null
+	    };
+	  };
+	
+	/**
+	 * Parse the mappings in a string in to a data structure which we can easily
+	 * query (the ordered arrays in the `this.__generatedMappings` and
+	 * `this.__originalMappings` properties).
+	 */
+	IndexedSourceMapConsumer.prototype._parseMappings =
+	  function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+	    this.__generatedMappings = [];
+	    this.__originalMappings = [];
+	    for (var i = 0; i < this._sections.length; i++) {
+	      var section = this._sections[i];
+	      var sectionMappings = section.consumer._generatedMappings;
+	      for (var j = 0; j < sectionMappings.length; j++) {
+	        var mapping = sectionMappings[j];
+	
+	        var source = section.consumer._sources.at(mapping.source);
+	        if (section.consumer.sourceRoot !== null) {
+	          source = util.join(section.consumer.sourceRoot, source);
+	        }
+	        this._sources.add(source);
+	        source = this._sources.indexOf(source);
+	
+	        var name = section.consumer._names.at(mapping.name);
+	        this._names.add(name);
+	        name = this._names.indexOf(name);
+	
+	        // The mappings coming from the consumer for the section have
+	        // generated positions relative to the start of the section, so we
+	        // need to offset them to be relative to the start of the concatenated
+	        // generated file.
+	        var adjustedMapping = {
+	          source: source,
+	          generatedLine: mapping.generatedLine +
+	            (section.generatedOffset.generatedLine - 1),
+	          generatedColumn: mapping.generatedColumn +
+	            (section.generatedOffset.generatedLine === mapping.generatedLine
+	            ? section.generatedOffset.generatedColumn - 1
+	            : 0),
+	          originalLine: mapping.originalLine,
+	          originalColumn: mapping.originalColumn,
+	          name: name
+	        };
+	
+	        this.__generatedMappings.push(adjustedMapping);
+	        if (typeof adjustedMapping.originalLine === 'number') {
+	          this.__originalMappings.push(adjustedMapping);
+	        }
+	      }
+	    }
+	
+	    quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);
+	    quickSort(this.__originalMappings, util.compareByOriginalPositions);
+	  };
+	
+	exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	exports.GREATEST_LOWER_BOUND = 1;
+	exports.LEAST_UPPER_BOUND = 2;
+	
+	/**
+	 * Recursive implementation of binary search.
+	 *
+	 * @param aLow Indices here and lower do not contain the needle.
+	 * @param aHigh Indices here and higher do not contain the needle.
+	 * @param aNeedle The element being searched for.
+	 * @param aHaystack The non-empty array being searched.
+	 * @param aCompare Function which takes two elements and returns -1, 0, or 1.
+	 * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+	 *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 */
+	function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {
+	  // This function terminates when one of the following is true:
+	  //
+	  //   1. We find the exact element we are looking for.
+	  //
+	  //   2. We did not find the exact element, but we can return the index of
+	  //      the next-closest element.
+	  //
+	  //   3. We did not find the exact element, and there is no next-closest
+	  //      element than the one we are searching for, so we return -1.
+	  var mid = Math.floor((aHigh - aLow) / 2) + aLow;
+	  var cmp = aCompare(aNeedle, aHaystack[mid], true);
+	  if (cmp === 0) {
+	    // Found the element we are looking for.
+	    return mid;
+	  }
+	  else if (cmp > 0) {
+	    // Our needle is greater than aHaystack[mid].
+	    if (aHigh - mid > 1) {
+	      // The element is in the upper half.
+	      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);
+	    }
+	
+	    // The exact needle element was not found in this haystack. Determine if
+	    // we are in termination case (3) or (2) and return the appropriate thing.
+	    if (aBias == exports.LEAST_UPPER_BOUND) {
+	      return aHigh < aHaystack.length ? aHigh : -1;
+	    } else {
+	      return mid;
+	    }
+	  }
+	  else {
+	    // Our needle is less than aHaystack[mid].
+	    if (mid - aLow > 1) {
+	      // The element is in the lower half.
+	      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);
+	    }
+	
+	    // we are in termination case (3) or (2) and return the appropriate thing.
+	    if (aBias == exports.LEAST_UPPER_BOUND) {
+	      return mid;
+	    } else {
+	      return aLow < 0 ? -1 : aLow;
+	    }
+	  }
+	}
+	
+	/**
+	 * This is an implementation of binary search which will always try and return
+	 * the index of the closest element if there is no exact hit. This is because
+	 * mappings between original and generated line/col pairs are single points,
+	 * and there is an implicit region between each of them, so a miss just means
+	 * that you aren't on the very start of a region.
+	 *
+	 * @param aNeedle The element you are looking for.
+	 * @param aHaystack The array that is being searched.
+	 * @param aCompare A function which takes the needle and an element in the
+	 *     array and returns -1, 0, or 1 depending on whether the needle is less
+	 *     than, equal to, or greater than the element, respectively.
+	 * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+	 *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.
+	 */
+	exports.search = function search(aNeedle, aHaystack, aCompare, aBias) {
+	  if (aHaystack.length === 0) {
+	    return -1;
+	  }
+	
+	  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,
+	                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);
+	  if (index < 0) {
+	    return -1;
+	  }
+	
+	  // We have found either the exact element, or the next-closest element than
+	  // the one we are searching for. However, there may be more than one such
+	  // element. Make sure we always return the smallest of these.
+	  while (index - 1 >= 0) {
+	    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {
+	      break;
+	    }
+	    --index;
+	  }
+	
+	  return index;
+	};
+
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	// It turns out that some (most?) JavaScript engines don't self-host
+	// `Array.prototype.sort`. This makes sense because C++ will likely remain
+	// faster than JS when doing raw CPU-intensive sorting. However, when using a
+	// custom comparator function, calling back and forth between the VM's C++ and
+	// JIT'd JS is rather slow *and* loses JIT type information, resulting in
+	// worse generated code for the comparator function than would be optimal. In
+	// fact, when sorting with a comparator, these costs outweigh the benefits of
+	// sorting in C++. By using our own JS-implemented Quick Sort (below), we get
+	// a ~3500ms mean speed-up in `bench/bench.html`.
+	
+	/**
+	 * Swap the elements indexed by `x` and `y` in the array `ary`.
+	 *
+	 * @param {Array} ary
+	 *        The array.
+	 * @param {Number} x
+	 *        The index of the first item.
+	 * @param {Number} y
+	 *        The index of the second item.
+	 */
+	function swap(ary, x, y) {
+	  var temp = ary[x];
+	  ary[x] = ary[y];
+	  ary[y] = temp;
+	}
+	
+	/**
+	 * Returns a random integer within the range `low .. high` inclusive.
+	 *
+	 * @param {Number} low
+	 *        The lower bound on the range.
+	 * @param {Number} high
+	 *        The upper bound on the range.
+	 */
+	function randomIntInRange(low, high) {
+	  return Math.round(low + (Math.random() * (high - low)));
+	}
+	
+	/**
+	 * The Quick Sort algorithm.
+	 *
+	 * @param {Array} ary
+	 *        An array to sort.
+	 * @param {function} comparator
+	 *        Function to use to compare two items.
+	 * @param {Number} p
+	 *        Start index of the array
+	 * @param {Number} r
+	 *        End index of the array
+	 */
+	function doQuickSort(ary, comparator, p, r) {
+	  // If our lower bound is less than our upper bound, we (1) partition the
+	  // array into two pieces and (2) recurse on each half. If it is not, this is
+	  // the empty array and our base case.
+	
+	  if (p < r) {
+	    // (1) Partitioning.
+	    //
+	    // The partitioning chooses a pivot between `p` and `r` and moves all
+	    // elements that are less than or equal to the pivot to the before it, and
+	    // all the elements that are greater than it after it. The effect is that
+	    // once partition is done, the pivot is in the exact place it will be when
+	    // the array is put in sorted order, and it will not need to be moved
+	    // again. This runs in O(n) time.
+	
+	    // Always choose a random pivot so that an input array which is reverse
+	    // sorted does not cause O(n^2) running time.
+	    var pivotIndex = randomIntInRange(p, r);
+	    var i = p - 1;
+	
+	    swap(ary, pivotIndex, r);
+	    var pivot = ary[r];
+	
+	    // Immediately after `j` is incremented in this loop, the following hold
+	    // true:
+	    //
+	    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.
+	    //
+	    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.
+	    for (var j = p; j < r; j++) {
+	      if (comparator(ary[j], pivot) <= 0) {
+	        i += 1;
+	        swap(ary, i, j);
+	      }
+	    }
+	
+	    swap(ary, i + 1, j);
+	    var q = i + 1;
+	
+	    // (2) Recurse on each half.
+	
+	    doQuickSort(ary, comparator, p, q - 1);
+	    doQuickSort(ary, comparator, q + 1, r);
+	  }
+	}
+	
+	/**
+	 * Sort the given array in-place with the given comparator function.
+	 *
+	 * @param {Array} ary
+	 *        An array to sort.
+	 * @param {function} comparator
+	 *        Function to use to compare two items.
+	 */
+	exports.quickSort = function (ary, comparator) {
+	  doQuickSort(ary, comparator, 0, ary.length - 1);
+	};
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	
+	var SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;
+	var util = __webpack_require__(4);
+	
+	// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other
+	// operating systems these days (capturing the result).
+	var REGEX_NEWLINE = /(\r?\n)/;
+	
+	// Newline character code for charCodeAt() comparisons
+	var NEWLINE_CODE = 10;
+	
+	// Private symbol for identifying `SourceNode`s when multiple versions of
+	// the source-map library are loaded. This MUST NOT CHANGE across
+	// versions!
+	var isSourceNode = "$$$isSourceNode$$$";
+	
+	/**
+	 * SourceNodes provide a way to abstract over interpolating/concatenating
+	 * snippets of generated JavaScript source code while maintaining the line and
+	 * column information associated with the original source code.
+	 *
+	 * @param aLine The original line number.
+	 * @param aColumn The original column number.
+	 * @param aSource The original source's filename.
+	 * @param aChunks Optional. An array of strings which are snippets of
+	 *        generated JS, or other SourceNodes.
+	 * @param aName The original identifier.
+	 */
+	function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
+	  this.children = [];
+	  this.sourceContents = {};
+	  this.line = aLine == null ? null : aLine;
+	  this.column = aColumn == null ? null : aColumn;
+	  this.source = aSource == null ? null : aSource;
+	  this.name = aName == null ? null : aName;
+	  this[isSourceNode] = true;
+	  if (aChunks != null) this.add(aChunks);
+	}
+	
+	/**
+	 * Creates a SourceNode from generated code and a SourceMapConsumer.
+	 *
+	 * @param aGeneratedCode The generated code
+	 * @param aSourceMapConsumer The SourceMap for the generated code
+	 * @param aRelativePath Optional. The path that relative sources in the
+	 *        SourceMapConsumer should be relative to.
+	 */
+	SourceNode.fromStringWithSourceMap =
+	  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {
+	    // The SourceNode we want to fill with the generated code
+	    // and the SourceMap
+	    var node = new SourceNode();
+	
+	    // All even indices of this array are one line of the generated code,
+	    // while all odd indices are the newlines between two adjacent lines
+	    // (since `REGEX_NEWLINE` captures its match).
+	    // Processed fragments are accessed by calling `shiftNextLine`.
+	    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);
+	    var remainingLinesIndex = 0;
+	    var shiftNextLine = function() {
+	      var lineContents = getNextLine();
+	      // The last line of a file might not have a newline.
+	      var newLine = getNextLine() || "";
+	      return lineContents + newLine;
+	
+	      function getNextLine() {
+	        return remainingLinesIndex < remainingLines.length ?
+	            remainingLines[remainingLinesIndex++] : undefined;
+	      }
+	    };
+	
+	    // We need to remember the position of "remainingLines"
+	    var lastGeneratedLine = 1, lastGeneratedColumn = 0;
+	
+	    // The generate SourceNodes we need a code range.
+	    // To extract it current and last mapping is used.
+	    // Here we store the last mapping.
+	    var lastMapping = null;
+	
+	    aSourceMapConsumer.eachMapping(function (mapping) {
+	      if (lastMapping !== null) {
+	        // We add the code from "lastMapping" to "mapping":
+	        // First check if there is a new line in between.
+	        if (lastGeneratedLine < mapping.generatedLine) {
+	          // Associate first line with "lastMapping"
+	          addMappingWithCode(lastMapping, shiftNextLine());
+	          lastGeneratedLine++;
+	          lastGeneratedColumn = 0;
+	          // The remaining code is added without mapping
+	        } else {
+	          // There is no new line in between.
+	          // Associate the code between "lastGeneratedColumn" and
+	          // "mapping.generatedColumn" with "lastMapping"
+	          var nextLine = remainingLines[remainingLinesIndex];
+	          var code = nextLine.substr(0, mapping.generatedColumn -
+	                                        lastGeneratedColumn);
+	          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -
+	                                              lastGeneratedColumn);
+	          lastGeneratedColumn = mapping.generatedColumn;
+	          addMappingWithCode(lastMapping, code);
+	          // No more remaining code, continue
+	          lastMapping = mapping;
+	          return;
+	        }
+	      }
+	      // We add the generated code until the first mapping
+	      // to the SourceNode without any mapping.
+	      // Each line is added as separate string.
+	      while (lastGeneratedLine < mapping.generatedLine) {
+	        node.add(shiftNextLine());
+	        lastGeneratedLine++;
+	      }
+	      if (lastGeneratedColumn < mapping.generatedColumn) {
+	        var nextLine = remainingLines[remainingLinesIndex];
+	        node.add(nextLine.substr(0, mapping.generatedColumn));
+	        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);
+	        lastGeneratedColumn = mapping.generatedColumn;
+	      }
+	      lastMapping = mapping;
+	    }, this);
+	    // We have processed all mappings.
+	    if (remainingLinesIndex < remainingLines.length) {
+	      if (lastMapping) {
+	        // Associate the remaining code in the current line with "lastMapping"
+	        addMappingWithCode(lastMapping, shiftNextLine());
+	      }
+	      // and add the remaining lines without any mapping
+	      node.add(remainingLines.splice(remainingLinesIndex).join(""));
+	    }
+	
+	    // Copy sourcesContent into SourceNode
+	    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+	      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+	      if (content != null) {
+	        if (aRelativePath != null) {
+	          sourceFile = util.join(aRelativePath, sourceFile);
+	        }
+	        node.setSourceContent(sourceFile, content);
+	      }
+	    });
+	
+	    return node;
+	
+	    function addMappingWithCode(mapping, code) {
+	      if (mapping === null || mapping.source === undefined) {
+	        node.add(code);
+	      } else {
+	        var source = aRelativePath
+	          ? util.join(aRelativePath, mapping.source)
+	          : mapping.source;
+	        node.add(new SourceNode(mapping.originalLine,
+	                                mapping.originalColumn,
+	                                source,
+	                                code,
+	                                mapping.name));
+	      }
+	    }
+	  };
+	
+	/**
+	 * Add a chunk of generated JS to this source node.
+	 *
+	 * @param aChunk A string snippet of generated JS code, another instance of
+	 *        SourceNode, or an array where each member is one of those things.
+	 */
+	SourceNode.prototype.add = function SourceNode_add(aChunk) {
+	  if (Array.isArray(aChunk)) {
+	    aChunk.forEach(function (chunk) {
+	      this.add(chunk);
+	    }, this);
+	  }
+	  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+	    if (aChunk) {
+	      this.children.push(aChunk);
+	    }
+	  }
+	  else {
+	    throw new TypeError(
+	      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+	    );
+	  }
+	  return this;
+	};
+	
+	/**
+	 * Add a chunk of generated JS to the beginning of this source node.
+	 *
+	 * @param aChunk A string snippet of generated JS code, another instance of
+	 *        SourceNode, or an array where each member is one of those things.
+	 */
+	SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
+	  if (Array.isArray(aChunk)) {
+	    for (var i = aChunk.length-1; i >= 0; i--) {
+	      this.prepend(aChunk[i]);
+	    }
+	  }
+	  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+	    this.children.unshift(aChunk);
+	  }
+	  else {
+	    throw new TypeError(
+	      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+	    );
+	  }
+	  return this;
+	};
+	
+	/**
+	 * Walk over the tree of JS snippets in this node and its children. The
+	 * walking function is called once for each snippet of JS and is passed that
+	 * snippet and the its original associated source's line/column location.
+	 *
+	 * @param aFn The traversal function.
+	 */
+	SourceNode.prototype.walk = function SourceNode_walk(aFn) {
+	  var chunk;
+	  for (var i = 0, len = this.children.length; i < len; i++) {
+	    chunk = this.children[i];
+	    if (chunk[isSourceNode]) {
+	      chunk.walk(aFn);
+	    }
+	    else {
+	      if (chunk !== '') {
+	        aFn(chunk, { source: this.source,
+	                     line: this.line,
+	                     column: this.column,
+	                     name: this.name });
+	      }
+	    }
+	  }
+	};
+	
+	/**
+	 * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
+	 * each of `this.children`.
+	 *
+	 * @param aSep The separator.
+	 */
+	SourceNode.prototype.join = function SourceNode_join(aSep) {
+	  var newChildren;
+	  var i;
+	  var len = this.children.length;
+	  if (len > 0) {
+	    newChildren = [];
+	    for (i = 0; i < len-1; i++) {
+	      newChildren.push(this.children[i]);
+	      newChildren.push(aSep);
+	    }
+	    newChildren.push(this.children[i]);
+	    this.children = newChildren;
+	  }
+	  return this;
+	};
+	
+	/**
+	 * Call String.prototype.replace on the very right-most source snippet. Useful
+	 * for trimming whitespace from the end of a source node, etc.
+	 *
+	 * @param aPattern The pattern to replace.
+	 * @param aReplacement The thing to replace the pattern with.
+	 */
+	SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
+	  var lastChild = this.children[this.children.length - 1];
+	  if (lastChild[isSourceNode]) {
+	    lastChild.replaceRight(aPattern, aReplacement);
+	  }
+	  else if (typeof lastChild === 'string') {
+	    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
+	  }
+	  else {
+	    this.children.push(''.replace(aPattern, aReplacement));
+	  }
+	  return this;
+	};
+	
+	/**
+	 * Set the source content for a source file. This will be added to the SourceMapGenerator
+	 * in the sourcesContent field.
+	 *
+	 * @param aSourceFile The filename of the source file
+	 * @param aSourceContent The content of the source file
+	 */
+	SourceNode.prototype.setSourceContent =
+	  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
+	    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
+	  };
+	
+	/**
+	 * Walk over the tree of SourceNodes. The walking function is called for each
+	 * source file content and is passed the filename and source content.
+	 *
+	 * @param aFn The traversal function.
+	 */
+	SourceNode.prototype.walkSourceContents =
+	  function SourceNode_walkSourceContents(aFn) {
+	    for (var i = 0, len = this.children.length; i < len; i++) {
+	      if (this.children[i][isSourceNode]) {
+	        this.children[i].walkSourceContents(aFn);
+	      }
+	    }
+	
+	    var sources = Object.keys(this.sourceContents);
+	    for (var i = 0, len = sources.length; i < len; i++) {
+	      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
+	    }
+	  };
+	
+	/**
+	 * Return the string representation of this source node. Walks over the tree
+	 * and concatenates all the various snippets together to one string.
+	 */
+	SourceNode.prototype.toString = function SourceNode_toString() {
+	  var str = "";
+	  this.walk(function (chunk) {
+	    str += chunk;
+	  });
+	  return str;
+	};
+	
+	/**
+	 * Returns the string representation of this source node along with a source
+	 * map.
+	 */
+	SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
+	  var generated = {
+	    code: "",
+	    line: 1,
+	    column: 0
+	  };
+	  var map = new SourceMapGenerator(aArgs);
+	  var sourceMappingActive = false;
+	  var lastOriginalSource = null;
+	  var lastOriginalLine = null;
+	  var lastOriginalColumn = null;
+	  var lastOriginalName = null;
+	  this.walk(function (chunk, original) {
+	    generated.code += chunk;
+	    if (original.source !== null
+	        && original.line !== null
+	        && original.column !== null) {
+	      if(lastOriginalSource !== original.source
+	         || lastOriginalLine !== original.line
+	         || lastOriginalColumn !== original.column
+	         || lastOriginalName !== original.name) {
+	        map.addMapping({
+	          source: original.source,
+	          original: {
+	            line: original.line,
+	            column: original.column
+	          },
+	          generated: {
+	            line: generated.line,
+	            column: generated.column
+	          },
+	          name: original.name
+	        });
+	      }
+	      lastOriginalSource = original.source;
+	      lastOriginalLine = original.line;
+	      lastOriginalColumn = original.column;
+	      lastOriginalName = original.name;
+	      sourceMappingActive = true;
+	    } else if (sourceMappingActive) {
+	      map.addMapping({
+	        generated: {
+	          line: generated.line,
+	          column: generated.column
+	        }
+	      });
+	      lastOriginalSource = null;
+	      sourceMappingActive = false;
+	    }
+	    for (var idx = 0, length = chunk.length; idx < length; idx++) {
+	      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {
+	        generated.line++;
+	        generated.column = 0;
+	        // Mappings end at eol
+	        if (idx + 1 === length) {
+	          lastOriginalSource = null;
+	          sourceMappingActive = false;
+	        } else if (sourceMappingActive) {
+	          map.addMapping({
+	            source: original.source,
+	            original: {
+	              line: original.line,
+	              column: original.column
+	            },
+	            generated: {
+	              line: generated.line,
+	              column: generated.column
+	            },
+	            name: original.name
+	          });
+	        }
+	      } else {
+	        generated.column++;
+	      }
+	    }
+	  });
+	  this.walkSourceContents(function (sourceFile, sourceContent) {
+	    map.setSourceContent(sourceFile, sourceContent);
+	  });
+	
+	  return { code: generated.code, map: map };
+	};
+	
+	exports.SourceNode = SourceNode;
+
+
+/***/ })
+/******/ ])
+});
+;
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIndlYnBhY2s6Ly8vd2VicGFjay91bml2ZXJzYWxNb2R1bGVEZWZpbml0aW9uIiwid2VicGFjazovLy93ZWJwYWNrL2Jvb3RzdHJhcCBlNDczOGZjNzJhN2IyMzAzOTg4OSIsIndlYnBhY2s6Ly8vLi9zb3VyY2UtbWFwLmpzIiwid2VicGFjazovLy8uL2xpYi9zb3VyY2UtbWFwLWdlbmVyYXRvci5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmFzZTY0LXZscS5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmFzZTY0LmpzIiwid2VicGFjazovLy8uL2xpYi91dGlsLmpzIiwid2VicGFjazovLy8uL2xpYi9hcnJheS1zZXQuanMiLCJ3ZWJwYWNrOi8vLy4vbGliL21hcHBpbmctbGlzdC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvc291cmNlLW1hcC1jb25zdW1lci5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmluYXJ5LXNlYXJjaC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvcXVpY2stc29ydC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvc291cmNlLW5vZGUuanMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6IkFBQUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsQ0FBQztBQUNELE87QUNWQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQSx1QkFBZTtBQUNmO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7QUFHQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOzs7Ozs7O0FDdENBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNQQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUEsTUFBSztBQUNMO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0EsMkNBQTBDLFNBQVM7QUFDbkQ7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxxQkFBb0I7QUFDcEI7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOzs7Ozs7O0FDL1pBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLDREQUEyRDtBQUMzRCxxQkFBb0I7QUFDcEI7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFHOztBQUVIO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRzs7QUFFSDtBQUNBO0FBQ0E7Ozs7Ozs7QUMzSUEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsaUJBQWdCO0FBQ2hCLGlCQUFnQjs7QUFFaEIsb0JBQW1CO0FBQ25CLHFCQUFvQjs7QUFFcEIsaUJBQWdCO0FBQ2hCLGlCQUFnQjs7QUFFaEIsaUJBQWdCO0FBQ2hCLGtCQUFpQjs7QUFFakI7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNsRUEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0EsSUFBRztBQUNIO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0EsK0NBQThDLFFBQVE7QUFDdEQ7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFFBQU87QUFDUDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxFQUFDOztBQUVEO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBLDRCQUEyQixRQUFRO0FBQ25DO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNoYUEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsdUNBQXNDLFNBQVM7QUFDL0M7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFHO0FBQ0g7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7Ozs7OztBQ3hIQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsaUJBQWdCO0FBQ2hCOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7Ozs7OztBQzlFQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSx1REFBc0Q7QUFDdEQ7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQSxFQUFDOztBQUVEO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0EsRUFBQzs7QUFFRDtBQUNBO0FBQ0E7QUFDQSxvQkFBbUI7QUFDbkI7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFlBQVc7O0FBRVg7QUFDQTtBQUNBLFFBQU87QUFDUDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsWUFBVzs7QUFFWDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsNEJBQTJCLE1BQU07QUFDakM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSx1REFBc0Q7QUFDdEQ7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7O0FBRUw7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBLHVEQUFzRCxZQUFZO0FBQ2xFO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0Esb0NBQW1DO0FBQ25DO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSwwQkFBeUIsY0FBYztBQUN2QztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBLFVBQVM7QUFDVDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esd0JBQXVCLHdDQUF3QztBQUMvRDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsZ0RBQStDLG1CQUFtQixFQUFFO0FBQ3BFOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGtCQUFpQixvQkFBb0I7QUFDckM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLDhCQUE2QixNQUFNO0FBQ25DO0FBQ0EsUUFBTztBQUNQO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsdURBQXNEO0FBQ3REOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBLElBQUc7QUFDSDs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLG9CQUFtQiwyQkFBMkI7QUFDOUMsc0JBQXFCLCtDQUErQztBQUNwRTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsRUFBQzs7QUFFRDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0EsUUFBTztBQUNQOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CLDJCQUEyQjtBQUM5Qzs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxvQkFBbUIsMkJBQTJCO0FBQzlDOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLG9CQUFtQiwyQkFBMkI7QUFDOUM7QUFDQTtBQUNBLHNCQUFxQiw0QkFBNEI7QUFDakQ7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBOzs7Ozs7O0FDempDQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7Ozs7OztBQzlHQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBLFlBQVcsTUFBTTtBQUNqQjtBQUNBLFlBQVcsT0FBTztBQUNsQjtBQUNBLFlBQVcsT0FBTztBQUNsQjtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxZQUFXLE1BQU07QUFDakI7QUFDQSxZQUFXLFNBQVM7QUFDcEI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLG9CQUFtQixPQUFPO0FBQzFCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxZQUFXLE1BQU07QUFDakI7QUFDQSxZQUFXLFNBQVM7QUFDcEI7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7Ozs7OztBQ2pIQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFVBQVM7QUFDVDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLOztBQUVMOztBQUVBO0FBQ0E7QUFDQTtBQUNBLFFBQU87QUFDUDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxrQ0FBaUMsUUFBUTtBQUN6QztBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSw4Q0FBNkMsU0FBUztBQUN0RDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxxQkFBb0I7QUFDcEI7QUFDQTtBQUNBLHVDQUFzQztBQUN0QztBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxnQkFBZSxXQUFXO0FBQzFCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxnREFBK0MsU0FBUztBQUN4RDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLDBDQUF5QyxTQUFTO0FBQ2xEO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsWUFBVztBQUNYO0FBQ0E7QUFDQTtBQUNBLFlBQVc7QUFDWDtBQUNBLFVBQVM7QUFDVDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFFBQU87QUFDUDtBQUNBO0FBQ0E7QUFDQSw2Q0FBNEMsY0FBYztBQUMxRDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFVBQVM7QUFDVDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsY0FBYTtBQUNiO0FBQ0E7QUFDQTtBQUNBLGNBQWE7QUFDYjtBQUNBLFlBQVc7QUFDWDtBQUNBLFFBQU87QUFDUDtBQUNBO0FBQ0E7QUFDQSxJQUFHO0FBQ0g7QUFDQTtBQUNBLElBQUc7O0FBRUgsV0FBVTtBQUNWOztBQUVBIiwiZmlsZSI6InNvdXJjZS1tYXAuZGVidWcuanMiLCJzb3VyY2VzQ29udGVudCI6WyIoZnVuY3Rpb24gd2VicGFja1VuaXZlcnNhbE1vZHVsZURlZmluaXRpb24ocm9vdCwgZmFjdG9yeSkge1xuXHRpZih0eXBlb2YgZXhwb3J0cyA9PT0gJ29iamVjdCcgJiYgdHlwZW9mIG1vZHVsZSA9PT0gJ29iamVjdCcpXG5cdFx0bW9kdWxlLmV4cG9ydHMgPSBmYWN0b3J5KCk7XG5cdGVsc2UgaWYodHlwZW9mIGRlZmluZSA9PT0gJ2Z1bmN0aW9uJyAmJiBkZWZpbmUuYW1kKVxuXHRcdGRlZmluZShbXSwgZmFjdG9yeSk7XG5cdGVsc2UgaWYodHlwZW9mIGV4cG9ydHMgPT09ICdvYmplY3QnKVxuXHRcdGV4cG9ydHNbXCJzb3VyY2VNYXBcIl0gPSBmYWN0b3J5KCk7XG5cdGVsc2Vcblx0XHRyb290W1wic291cmNlTWFwXCJdID0gZmFjdG9yeSgpO1xufSkodGhpcywgZnVuY3Rpb24oKSB7XG5yZXR1cm4gXG5cblxuLy8gV0VCUEFDSyBGT09URVIgLy9cbi8vIHdlYnBhY2svdW5pdmVyc2FsTW9kdWxlRGVmaW5pdGlvbiIsIiBcdC8vIFRoZSBtb2R1bGUgY2FjaGVcbiBcdHZhciBpbnN0YWxsZWRNb2R1bGVzID0ge307XG5cbiBcdC8vIFRoZSByZXF1aXJlIGZ1bmN0aW9uXG4gXHRmdW5jdGlvbiBfX3dlYnBhY2tfcmVxdWlyZV9fKG1vZHVsZUlkKSB7XG5cbiBcdFx0Ly8gQ2hlY2sgaWYgbW9kdWxlIGlzIGluIGNhY2hlXG4gXHRcdGlmKGluc3RhbGxlZE1vZHVsZXNbbW9kdWxlSWRdKVxuIFx0XHRcdHJldHVybiBpbnN0YWxsZWRNb2R1bGVzW21vZHVsZUlkXS5leHBvcnRzO1xuXG4gXHRcdC8vIENyZWF0ZSBhIG5ldyBtb2R1bGUgKGFuZCBwdXQgaXQgaW50byB0aGUgY2FjaGUpXG4gXHRcdHZhciBtb2R1bGUgPSBpbnN0YWxsZWRNb2R1bGVzW21vZHVsZUlkXSA9IHtcbiBcdFx0XHRleHBvcnRzOiB7fSxcbiBcdFx0XHRpZDogbW9kdWxlSWQsXG4gXHRcdFx0bG9hZGVkOiBmYWxzZVxuIFx0XHR9O1xuXG4gXHRcdC8vIEV4ZWN1dGUgdGhlIG1vZHVsZSBmdW5jdGlvblxuIFx0XHRtb2R1bGVzW21vZHVsZUlkXS5jYWxsKG1vZHVsZS5leHBvcnRzLCBtb2R1bGUsIG1vZHVsZS5leHBvcnRzLCBfX3dlYnBhY2tfcmVxdWlyZV9fKTtcblxuIFx0XHQvLyBGbGFnIHRoZSBtb2R1bGUgYXMgbG9hZGVkXG4gXHRcdG1vZHVsZS5sb2FkZWQgPSB0cnVlO1xuXG4gXHRcdC8vIFJldHVybiB0aGUgZXhwb3J0cyBvZiB0aGUgbW9kdWxlXG4gXHRcdHJldHVybiBtb2R1bGUuZXhwb3J0cztcbiBcdH1cblxuXG4gXHQvLyBleHBvc2UgdGhlIG1vZHVsZXMgb2JqZWN0IChfX3dlYnBhY2tfbW9kdWxlc19fKVxuIFx0X193ZWJwYWNrX3JlcXVpcmVfXy5tID0gbW9kdWxlcztcblxuIFx0Ly8gZXhwb3NlIHRoZSBtb2R1bGUgY2FjaGVcbiBcdF9fd2VicGFja19yZXF1aXJlX18uYyA9IGluc3RhbGxlZE1vZHVsZXM7XG5cbiBcdC8vIF9fd2VicGFja19wdWJsaWNfcGF0aF9fXG4gXHRfX3dlYnBhY2tfcmVxdWlyZV9fLnAgPSBcIlwiO1xuXG4gXHQvLyBMb2FkIGVudHJ5IG1vZHVsZSBhbmQgcmV0dXJuIGV4cG9ydHNcbiBcdHJldHVybiBfX3dlYnBhY2tfcmVxdWlyZV9fKDApO1xuXG5cblxuLy8gV0VCUEFDSyBGT09URVIgLy9cbi8vIHdlYnBhY2svYm9vdHN0cmFwIGU0NzM4ZmM3MmE3YjIzMDM5ODg5IiwiLypcbiAqIENvcHlyaWdodCAyMDA5LTIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFLnR4dCBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuZXhwb3J0cy5Tb3VyY2VNYXBHZW5lcmF0b3IgPSByZXF1aXJlKCcuL2xpYi9zb3VyY2UtbWFwLWdlbmVyYXRvcicpLlNvdXJjZU1hcEdlbmVyYXRvcjtcbmV4cG9ydHMuU291cmNlTWFwQ29uc3VtZXIgPSByZXF1aXJlKCcuL2xpYi9zb3VyY2UtbWFwLWNvbnN1bWVyJykuU291cmNlTWFwQ29uc3VtZXI7XG5leHBvcnRzLlNvdXJjZU5vZGUgPSByZXF1aXJlKCcuL2xpYi9zb3VyY2Utbm9kZScpLlNvdXJjZU5vZGU7XG5cblxuXG4vLy8vLy8vLy8vLy8vLy8vLy9cbi8vIFdFQlBBQ0sgRk9PVEVSXG4vLyAuL3NvdXJjZS1tYXAuanNcbi8vIG1vZHVsZSBpZCA9IDBcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgYmFzZTY0VkxRID0gcmVxdWlyZSgnLi9iYXNlNjQtdmxxJyk7XG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIEFycmF5U2V0ID0gcmVxdWlyZSgnLi9hcnJheS1zZXQnKS5BcnJheVNldDtcbnZhciBNYXBwaW5nTGlzdCA9IHJlcXVpcmUoJy4vbWFwcGluZy1saXN0JykuTWFwcGluZ0xpc3Q7XG5cbi8qKlxuICogQW4gaW5zdGFuY2Ugb2YgdGhlIFNvdXJjZU1hcEdlbmVyYXRvciByZXByZXNlbnRzIGEgc291cmNlIG1hcCB3aGljaCBpc1xuICogYmVpbmcgYnVpbHQgaW5jcmVtZW50YWxseS4gWW91IG1heSBwYXNzIGFuIG9iamVjdCB3aXRoIHRoZSBmb2xsb3dpbmdcbiAqIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGZpbGU6IFRoZSBmaWxlbmFtZSBvZiB0aGUgZ2VuZXJhdGVkIHNvdXJjZS5cbiAqICAgLSBzb3VyY2VSb290OiBBIHJvb3QgZm9yIGFsbCByZWxhdGl2ZSBVUkxzIGluIHRoaXMgc291cmNlIG1hcC5cbiAqL1xuZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yKGFBcmdzKSB7XG4gIGlmICghYUFyZ3MpIHtcbiAgICBhQXJncyA9IHt9O1xuICB9XG4gIHRoaXMuX2ZpbGUgPSB1dGlsLmdldEFyZyhhQXJncywgJ2ZpbGUnLCBudWxsKTtcbiAgdGhpcy5fc291cmNlUm9vdCA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlUm9vdCcsIG51bGwpO1xuICB0aGlzLl9za2lwVmFsaWRhdGlvbiA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc2tpcFZhbGlkYXRpb24nLCBmYWxzZSk7XG4gIHRoaXMuX3NvdXJjZXMgPSBuZXcgQXJyYXlTZXQoKTtcbiAgdGhpcy5fbmFtZXMgPSBuZXcgQXJyYXlTZXQoKTtcbiAgdGhpcy5fbWFwcGluZ3MgPSBuZXcgTWFwcGluZ0xpc3QoKTtcbiAgdGhpcy5fc291cmNlc0NvbnRlbnRzID0gbnVsbDtcbn1cblxuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogQ3JlYXRlcyBhIG5ldyBTb3VyY2VNYXBHZW5lcmF0b3IgYmFzZWQgb24gYSBTb3VyY2VNYXBDb25zdW1lclxuICpcbiAqIEBwYXJhbSBhU291cmNlTWFwQ29uc3VtZXIgVGhlIFNvdXJjZU1hcC5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLmZyb21Tb3VyY2VNYXAgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfZnJvbVNvdXJjZU1hcChhU291cmNlTWFwQ29uc3VtZXIpIHtcbiAgICB2YXIgc291cmNlUm9vdCA9IGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VSb290O1xuICAgIHZhciBnZW5lcmF0b3IgPSBuZXcgU291cmNlTWFwR2VuZXJhdG9yKHtcbiAgICAgIGZpbGU6IGFTb3VyY2VNYXBDb25zdW1lci5maWxlLFxuICAgICAgc291cmNlUm9vdDogc291cmNlUm9vdFxuICAgIH0pO1xuICAgIGFTb3VyY2VNYXBDb25zdW1lci5lYWNoTWFwcGluZyhmdW5jdGlvbiAobWFwcGluZykge1xuICAgICAgdmFyIG5ld01hcHBpbmcgPSB7XG4gICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgIGxpbmU6IG1hcHBpbmcuZ2VuZXJhdGVkTGluZSxcbiAgICAgICAgICBjb2x1bW46IG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uXG4gICAgICAgIH1cbiAgICAgIH07XG5cbiAgICAgIGlmIChtYXBwaW5nLnNvdXJjZSAhPSBudWxsKSB7XG4gICAgICAgIG5ld01hcHBpbmcuc291cmNlID0gbWFwcGluZy5zb3VyY2U7XG4gICAgICAgIGlmIChzb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgICAgICBuZXdNYXBwaW5nLnNvdXJjZSA9IHV0aWwucmVsYXRpdmUoc291cmNlUm9vdCwgbmV3TWFwcGluZy5zb3VyY2UpO1xuICAgICAgICB9XG5cbiAgICAgICAgbmV3TWFwcGluZy5vcmlnaW5hbCA9IHtcbiAgICAgICAgICBsaW5lOiBtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICBjb2x1bW46IG1hcHBpbmcub3JpZ2luYWxDb2x1bW5cbiAgICAgICAgfTtcblxuICAgICAgICBpZiAobWFwcGluZy5uYW1lICE9IG51bGwpIHtcbiAgICAgICAgICBuZXdNYXBwaW5nLm5hbWUgPSBtYXBwaW5nLm5hbWU7XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgZ2VuZXJhdG9yLmFkZE1hcHBpbmcobmV3TWFwcGluZyk7XG4gICAgfSk7XG4gICAgYVNvdXJjZU1hcENvbnN1bWVyLnNvdXJjZXMuZm9yRWFjaChmdW5jdGlvbiAoc291cmNlRmlsZSkge1xuICAgICAgdmFyIGNvbnRlbnQgPSBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlQ29udGVudEZvcihzb3VyY2VGaWxlKTtcbiAgICAgIGlmIChjb250ZW50ICE9IG51bGwpIHtcbiAgICAgICAgZ2VuZXJhdG9yLnNldFNvdXJjZUNvbnRlbnQoc291cmNlRmlsZSwgY29udGVudCk7XG4gICAgICB9XG4gICAgfSk7XG4gICAgcmV0dXJuIGdlbmVyYXRvcjtcbiAgfTtcblxuLyoqXG4gKiBBZGQgYSBzaW5nbGUgbWFwcGluZyBmcm9tIG9yaWdpbmFsIHNvdXJjZSBsaW5lIGFuZCBjb2x1bW4gdG8gdGhlIGdlbmVyYXRlZFxuICogc291cmNlJ3MgbGluZSBhbmQgY29sdW1uIGZvciB0aGlzIHNvdXJjZSBtYXAgYmVpbmcgY3JlYXRlZC4gVGhlIG1hcHBpbmdcbiAqIG9iamVjdCBzaG91bGQgaGF2ZSB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGdlbmVyYXRlZDogQW4gb2JqZWN0IHdpdGggdGhlIGdlbmVyYXRlZCBsaW5lIGFuZCBjb2x1bW4gcG9zaXRpb25zLlxuICogICAtIG9yaWdpbmFsOiBBbiBvYmplY3Qgd2l0aCB0aGUgb3JpZ2luYWwgbGluZSBhbmQgY29sdW1uIHBvc2l0aW9ucy5cbiAqICAgLSBzb3VyY2U6IFRoZSBvcmlnaW5hbCBzb3VyY2UgZmlsZSAocmVsYXRpdmUgdG8gdGhlIHNvdXJjZVJvb3QpLlxuICogICAtIG5hbWU6IEFuIG9wdGlvbmFsIG9yaWdpbmFsIHRva2VuIG5hbWUgZm9yIHRoaXMgbWFwcGluZy5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5hZGRNYXBwaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX2FkZE1hcHBpbmcoYUFyZ3MpIHtcbiAgICB2YXIgZ2VuZXJhdGVkID0gdXRpbC5nZXRBcmcoYUFyZ3MsICdnZW5lcmF0ZWQnKTtcbiAgICB2YXIgb3JpZ2luYWwgPSB1dGlsLmdldEFyZyhhQXJncywgJ29yaWdpbmFsJywgbnVsbCk7XG4gICAgdmFyIHNvdXJjZSA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlJywgbnVsbCk7XG4gICAgdmFyIG5hbWUgPSB1dGlsLmdldEFyZyhhQXJncywgJ25hbWUnLCBudWxsKTtcblxuICAgIGlmICghdGhpcy5fc2tpcFZhbGlkYXRpb24pIHtcbiAgICAgIHRoaXMuX3ZhbGlkYXRlTWFwcGluZyhnZW5lcmF0ZWQsIG9yaWdpbmFsLCBzb3VyY2UsIG5hbWUpO1xuICAgIH1cblxuICAgIGlmIChzb3VyY2UgIT0gbnVsbCkge1xuICAgICAgc291cmNlID0gU3RyaW5nKHNvdXJjZSk7XG4gICAgICBpZiAoIXRoaXMuX3NvdXJjZXMuaGFzKHNvdXJjZSkpIHtcbiAgICAgICAgdGhpcy5fc291cmNlcy5hZGQoc291cmNlKTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICBpZiAobmFtZSAhPSBudWxsKSB7XG4gICAgICBuYW1lID0gU3RyaW5nKG5hbWUpO1xuICAgICAgaWYgKCF0aGlzLl9uYW1lcy5oYXMobmFtZSkpIHtcbiAgICAgICAgdGhpcy5fbmFtZXMuYWRkKG5hbWUpO1xuICAgICAgfVxuICAgIH1cblxuICAgIHRoaXMuX21hcHBpbmdzLmFkZCh7XG4gICAgICBnZW5lcmF0ZWRMaW5lOiBnZW5lcmF0ZWQubGluZSxcbiAgICAgIGdlbmVyYXRlZENvbHVtbjogZ2VuZXJhdGVkLmNvbHVtbixcbiAgICAgIG9yaWdpbmFsTGluZTogb3JpZ2luYWwgIT0gbnVsbCAmJiBvcmlnaW5hbC5saW5lLFxuICAgICAgb3JpZ2luYWxDb2x1bW46IG9yaWdpbmFsICE9IG51bGwgJiYgb3JpZ2luYWwuY29sdW1uLFxuICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICBuYW1lOiBuYW1lXG4gICAgfSk7XG4gIH07XG5cbi8qKlxuICogU2V0IHRoZSBzb3VyY2UgY29udGVudCBmb3IgYSBzb3VyY2UgZmlsZS5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5zZXRTb3VyY2VDb250ZW50ID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX3NldFNvdXJjZUNvbnRlbnQoYVNvdXJjZUZpbGUsIGFTb3VyY2VDb250ZW50KSB7XG4gICAgdmFyIHNvdXJjZSA9IGFTb3VyY2VGaWxlO1xuICAgIGlmICh0aGlzLl9zb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgIHNvdXJjZSA9IHV0aWwucmVsYXRpdmUodGhpcy5fc291cmNlUm9vdCwgc291cmNlKTtcbiAgICB9XG5cbiAgICBpZiAoYVNvdXJjZUNvbnRlbnQgIT0gbnVsbCkge1xuICAgICAgLy8gQWRkIHRoZSBzb3VyY2UgY29udGVudCB0byB0aGUgX3NvdXJjZXNDb250ZW50cyBtYXAuXG4gICAgICAvLyBDcmVhdGUgYSBuZXcgX3NvdXJjZXNDb250ZW50cyBtYXAgaWYgdGhlIHByb3BlcnR5IGlzIG51bGwuXG4gICAgICBpZiAoIXRoaXMuX3NvdXJjZXNDb250ZW50cykge1xuICAgICAgICB0aGlzLl9zb3VyY2VzQ29udGVudHMgPSBPYmplY3QuY3JlYXRlKG51bGwpO1xuICAgICAgfVxuICAgICAgdGhpcy5fc291cmNlc0NvbnRlbnRzW3V0aWwudG9TZXRTdHJpbmcoc291cmNlKV0gPSBhU291cmNlQ29udGVudDtcbiAgICB9IGVsc2UgaWYgKHRoaXMuX3NvdXJjZXNDb250ZW50cykge1xuICAgICAgLy8gUmVtb3ZlIHRoZSBzb3VyY2UgZmlsZSBmcm9tIHRoZSBfc291cmNlc0NvbnRlbnRzIG1hcC5cbiAgICAgIC8vIElmIHRoZSBfc291cmNlc0NvbnRlbnRzIG1hcCBpcyBlbXB0eSwgc2V0IHRoZSBwcm9wZXJ0eSB0byBudWxsLlxuICAgICAgZGVsZXRlIHRoaXMuX3NvdXJjZXNDb250ZW50c1t1dGlsLnRvU2V0U3RyaW5nKHNvdXJjZSldO1xuICAgICAgaWYgKE9iamVjdC5rZXlzKHRoaXMuX3NvdXJjZXNDb250ZW50cykubGVuZ3RoID09PSAwKSB7XG4gICAgICAgIHRoaXMuX3NvdXJjZXNDb250ZW50cyA9IG51bGw7XG4gICAgICB9XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIEFwcGxpZXMgdGhlIG1hcHBpbmdzIG9mIGEgc3ViLXNvdXJjZS1tYXAgZm9yIGEgc3BlY2lmaWMgc291cmNlIGZpbGUgdG8gdGhlXG4gKiBzb3VyY2UgbWFwIGJlaW5nIGdlbmVyYXRlZC4gRWFjaCBtYXBwaW5nIHRvIHRoZSBzdXBwbGllZCBzb3VyY2UgZmlsZSBpc1xuICogcmV3cml0dGVuIHVzaW5nIHRoZSBzdXBwbGllZCBzb3VyY2UgbWFwLiBOb3RlOiBUaGUgcmVzb2x1dGlvbiBmb3IgdGhlXG4gKiByZXN1bHRpbmcgbWFwcGluZ3MgaXMgdGhlIG1pbmltaXVtIG9mIHRoaXMgbWFwIGFuZCB0aGUgc3VwcGxpZWQgbWFwLlxuICpcbiAqIEBwYXJhbSBhU291cmNlTWFwQ29uc3VtZXIgVGhlIHNvdXJjZSBtYXAgdG8gYmUgYXBwbGllZC5cbiAqIEBwYXJhbSBhU291cmNlRmlsZSBPcHRpb25hbC4gVGhlIGZpbGVuYW1lIG9mIHRoZSBzb3VyY2UgZmlsZS5cbiAqICAgICAgICBJZiBvbWl0dGVkLCBTb3VyY2VNYXBDb25zdW1lcidzIGZpbGUgcHJvcGVydHkgd2lsbCBiZSB1c2VkLlxuICogQHBhcmFtIGFTb3VyY2VNYXBQYXRoIE9wdGlvbmFsLiBUaGUgZGlybmFtZSBvZiB0aGUgcGF0aCB0byB0aGUgc291cmNlIG1hcFxuICogICAgICAgIHRvIGJlIGFwcGxpZWQuIElmIHJlbGF0aXZlLCBpdCBpcyByZWxhdGl2ZSB0byB0aGUgU291cmNlTWFwQ29uc3VtZXIuXG4gKiAgICAgICAgVGhpcyBwYXJhbWV0ZXIgaXMgbmVlZGVkIHdoZW4gdGhlIHR3byBzb3VyY2UgbWFwcyBhcmVuJ3QgaW4gdGhlIHNhbWVcbiAqICAgICAgICBkaXJlY3RvcnksIGFuZCB0aGUgc291cmNlIG1hcCB0byBiZSBhcHBsaWVkIGNvbnRhaW5zIHJlbGF0aXZlIHNvdXJjZVxuICogICAgICAgIHBhdGhzLiBJZiBzbywgdGhvc2UgcmVsYXRpdmUgc291cmNlIHBhdGhzIG5lZWQgdG8gYmUgcmV3cml0dGVuXG4gKiAgICAgICAgcmVsYXRpdmUgdG8gdGhlIFNvdXJjZU1hcEdlbmVyYXRvci5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5hcHBseVNvdXJjZU1hcCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9hcHBseVNvdXJjZU1hcChhU291cmNlTWFwQ29uc3VtZXIsIGFTb3VyY2VGaWxlLCBhU291cmNlTWFwUGF0aCkge1xuICAgIHZhciBzb3VyY2VGaWxlID0gYVNvdXJjZUZpbGU7XG4gICAgLy8gSWYgYVNvdXJjZUZpbGUgaXMgb21pdHRlZCwgd2Ugd2lsbCB1c2UgdGhlIGZpbGUgcHJvcGVydHkgb2YgdGhlIFNvdXJjZU1hcFxuICAgIGlmIChhU291cmNlRmlsZSA9PSBudWxsKSB7XG4gICAgICBpZiAoYVNvdXJjZU1hcENvbnN1bWVyLmZpbGUgPT0gbnVsbCkge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoXG4gICAgICAgICAgJ1NvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuYXBwbHlTb3VyY2VNYXAgcmVxdWlyZXMgZWl0aGVyIGFuIGV4cGxpY2l0IHNvdXJjZSBmaWxlLCAnICtcbiAgICAgICAgICAnb3IgdGhlIHNvdXJjZSBtYXBcXCdzIFwiZmlsZVwiIHByb3BlcnR5LiBCb3RoIHdlcmUgb21pdHRlZC4nXG4gICAgICAgICk7XG4gICAgICB9XG4gICAgICBzb3VyY2VGaWxlID0gYVNvdXJjZU1hcENvbnN1bWVyLmZpbGU7XG4gICAgfVxuICAgIHZhciBzb3VyY2VSb290ID0gdGhpcy5fc291cmNlUm9vdDtcbiAgICAvLyBNYWtlIFwic291cmNlRmlsZVwiIHJlbGF0aXZlIGlmIGFuIGFic29sdXRlIFVybCBpcyBwYXNzZWQuXG4gICAgaWYgKHNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgc291cmNlRmlsZSA9IHV0aWwucmVsYXRpdmUoc291cmNlUm9vdCwgc291cmNlRmlsZSk7XG4gICAgfVxuICAgIC8vIEFwcGx5aW5nIHRoZSBTb3VyY2VNYXAgY2FuIGFkZCBhbmQgcmVtb3ZlIGl0ZW1zIGZyb20gdGhlIHNvdXJjZXMgYW5kXG4gICAgLy8gdGhlIG5hbWVzIGFycmF5LlxuICAgIHZhciBuZXdTb3VyY2VzID0gbmV3IEFycmF5U2V0KCk7XG4gICAgdmFyIG5ld05hbWVzID0gbmV3IEFycmF5U2V0KCk7XG5cbiAgICAvLyBGaW5kIG1hcHBpbmdzIGZvciB0aGUgXCJzb3VyY2VGaWxlXCJcbiAgICB0aGlzLl9tYXBwaW5ncy51bnNvcnRlZEZvckVhY2goZnVuY3Rpb24gKG1hcHBpbmcpIHtcbiAgICAgIGlmIChtYXBwaW5nLnNvdXJjZSA9PT0gc291cmNlRmlsZSAmJiBtYXBwaW5nLm9yaWdpbmFsTGluZSAhPSBudWxsKSB7XG4gICAgICAgIC8vIENoZWNrIGlmIGl0IGNhbiBiZSBtYXBwZWQgYnkgdGhlIHNvdXJjZSBtYXAsIHRoZW4gdXBkYXRlIHRoZSBtYXBwaW5nLlxuICAgICAgICB2YXIgb3JpZ2luYWwgPSBhU291cmNlTWFwQ29uc3VtZXIub3JpZ2luYWxQb3NpdGlvbkZvcih7XG4gICAgICAgICAgbGluZTogbWFwcGluZy5vcmlnaW5hbExpbmUsXG4gICAgICAgICAgY29sdW1uOiBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uXG4gICAgICAgIH0pO1xuICAgICAgICBpZiAob3JpZ2luYWwuc291cmNlICE9IG51bGwpIHtcbiAgICAgICAgICAvLyBDb3B5IG1hcHBpbmdcbiAgICAgICAgICBtYXBwaW5nLnNvdXJjZSA9IG9yaWdpbmFsLnNvdXJjZTtcbiAgICAgICAgICBpZiAoYVNvdXJjZU1hcFBhdGggIT0gbnVsbCkge1xuICAgICAgICAgICAgbWFwcGluZy5zb3VyY2UgPSB1dGlsLmpvaW4oYVNvdXJjZU1hcFBhdGgsIG1hcHBpbmcuc291cmNlKVxuICAgICAgICAgIH1cbiAgICAgICAgICBpZiAoc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICAgICAgICBtYXBwaW5nLnNvdXJjZSA9IHV0aWwucmVsYXRpdmUoc291cmNlUm9vdCwgbWFwcGluZy5zb3VyY2UpO1xuICAgICAgICAgIH1cbiAgICAgICAgICBtYXBwaW5nLm9yaWdpbmFsTGluZSA9IG9yaWdpbmFsLmxpbmU7XG4gICAgICAgICAgbWFwcGluZy5vcmlnaW5hbENvbHVtbiA9IG9yaWdpbmFsLmNvbHVtbjtcbiAgICAgICAgICBpZiAob3JpZ2luYWwubmFtZSAhPSBudWxsKSB7XG4gICAgICAgICAgICBtYXBwaW5nLm5hbWUgPSBvcmlnaW5hbC5uYW1lO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgfVxuXG4gICAgICB2YXIgc291cmNlID0gbWFwcGluZy5zb3VyY2U7XG4gICAgICBpZiAoc291cmNlICE9IG51bGwgJiYgIW5ld1NvdXJjZXMuaGFzKHNvdXJjZSkpIHtcbiAgICAgICAgbmV3U291cmNlcy5hZGQoc291cmNlKTtcbiAgICAgIH1cblxuICAgICAgdmFyIG5hbWUgPSBtYXBwaW5nLm5hbWU7XG4gICAgICBpZiAobmFtZSAhPSBudWxsICYmICFuZXdOYW1lcy5oYXMobmFtZSkpIHtcbiAgICAgICAgbmV3TmFtZXMuYWRkKG5hbWUpO1xuICAgICAgfVxuXG4gICAgfSwgdGhpcyk7XG4gICAgdGhpcy5fc291cmNlcyA9IG5ld1NvdXJjZXM7XG4gICAgdGhpcy5fbmFtZXMgPSBuZXdOYW1lcztcblxuICAgIC8vIENvcHkgc291cmNlc0NvbnRlbnRzIG9mIGFwcGxpZWQgbWFwLlxuICAgIGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VzLmZvckVhY2goZnVuY3Rpb24gKHNvdXJjZUZpbGUpIHtcbiAgICAgIHZhciBjb250ZW50ID0gYVNvdXJjZU1hcENvbnN1bWVyLnNvdXJjZUNvbnRlbnRGb3Ioc291cmNlRmlsZSk7XG4gICAgICBpZiAoY29udGVudCAhPSBudWxsKSB7XG4gICAgICAgIGlmIChhU291cmNlTWFwUGF0aCAhPSBudWxsKSB7XG4gICAgICAgICAgc291cmNlRmlsZSA9IHV0aWwuam9pbihhU291cmNlTWFwUGF0aCwgc291cmNlRmlsZSk7XG4gICAgICAgIH1cbiAgICAgICAgaWYgKHNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgICAgIHNvdXJjZUZpbGUgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIHNvdXJjZUZpbGUpO1xuICAgICAgICB9XG4gICAgICAgIHRoaXMuc2V0U291cmNlQ29udGVudChzb3VyY2VGaWxlLCBjb250ZW50KTtcbiAgICAgIH1cbiAgICB9LCB0aGlzKTtcbiAgfTtcblxuLyoqXG4gKiBBIG1hcHBpbmcgY2FuIGhhdmUgb25lIG9mIHRoZSB0aHJlZSBsZXZlbHMgb2YgZGF0YTpcbiAqXG4gKiAgIDEuIEp1c3QgdGhlIGdlbmVyYXRlZCBwb3NpdGlvbi5cbiAqICAgMi4gVGhlIEdlbmVyYXRlZCBwb3NpdGlvbiwgb3JpZ2luYWwgcG9zaXRpb24sIGFuZCBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIDMuIEdlbmVyYXRlZCBhbmQgb3JpZ2luYWwgcG9zaXRpb24sIG9yaWdpbmFsIHNvdXJjZSwgYXMgd2VsbCBhcyBhIG5hbWVcbiAqICAgICAgdG9rZW4uXG4gKlxuICogVG8gbWFpbnRhaW4gY29uc2lzdGVuY3ksIHdlIHZhbGlkYXRlIHRoYXQgYW55IG5ldyBtYXBwaW5nIGJlaW5nIGFkZGVkIGZhbGxzXG4gKiBpbiB0byBvbmUgb2YgdGhlc2UgY2F0ZWdvcmllcy5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5fdmFsaWRhdGVNYXBwaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX3ZhbGlkYXRlTWFwcGluZyhhR2VuZXJhdGVkLCBhT3JpZ2luYWwsIGFTb3VyY2UsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgYU5hbWUpIHtcbiAgICAvLyBXaGVuIGFPcmlnaW5hbCBpcyB0cnV0aHkgYnV0IGhhcyBlbXB0eSB2YWx1ZXMgZm9yIC5saW5lIGFuZCAuY29sdW1uLFxuICAgIC8vIGl0IGlzIG1vc3QgbGlrZWx5IGEgcHJvZ3JhbW1lciBlcnJvci4gSW4gdGhpcyBjYXNlIHdlIHRocm93IGEgdmVyeVxuICAgIC8vIHNwZWNpZmljIGVycm9yIG1lc3NhZ2UgdG8gdHJ5IHRvIGd1aWRlIHRoZW0gdGhlIHJpZ2h0IHdheS5cbiAgICAvLyBGb3IgZXhhbXBsZTogaHR0cHM6Ly9naXRodWIuY29tL1BvbHltZXIvcG9seW1lci1idW5kbGVyL3B1bGwvNTE5XG4gICAgaWYgKGFPcmlnaW5hbCAmJiB0eXBlb2YgYU9yaWdpbmFsLmxpbmUgIT09ICdudW1iZXInICYmIHR5cGVvZiBhT3JpZ2luYWwuY29sdW1uICE9PSAnbnVtYmVyJykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoXG4gICAgICAgICAgICAnb3JpZ2luYWwubGluZSBhbmQgb3JpZ2luYWwuY29sdW1uIGFyZSBub3QgbnVtYmVycyAtLSB5b3UgcHJvYmFibHkgbWVhbnQgdG8gb21pdCAnICtcbiAgICAgICAgICAgICd0aGUgb3JpZ2luYWwgbWFwcGluZyBlbnRpcmVseSBhbmQgb25seSBtYXAgdGhlIGdlbmVyYXRlZCBwb3NpdGlvbi4gSWYgc28sIHBhc3MgJyArXG4gICAgICAgICAgICAnbnVsbCBmb3IgdGhlIG9yaWdpbmFsIG1hcHBpbmcgaW5zdGVhZCBvZiBhbiBvYmplY3Qgd2l0aCBlbXB0eSBvciBudWxsIHZhbHVlcy4nXG4gICAgICAgICk7XG4gICAgfVxuXG4gICAgaWYgKGFHZW5lcmF0ZWQgJiYgJ2xpbmUnIGluIGFHZW5lcmF0ZWQgJiYgJ2NvbHVtbicgaW4gYUdlbmVyYXRlZFxuICAgICAgICAmJiBhR2VuZXJhdGVkLmxpbmUgPiAwICYmIGFHZW5lcmF0ZWQuY29sdW1uID49IDBcbiAgICAgICAgJiYgIWFPcmlnaW5hbCAmJiAhYVNvdXJjZSAmJiAhYU5hbWUpIHtcbiAgICAgIC8vIENhc2UgMS5cbiAgICAgIHJldHVybjtcbiAgICB9XG4gICAgZWxzZSBpZiAoYUdlbmVyYXRlZCAmJiAnbGluZScgaW4gYUdlbmVyYXRlZCAmJiAnY29sdW1uJyBpbiBhR2VuZXJhdGVkXG4gICAgICAgICAgICAgJiYgYU9yaWdpbmFsICYmICdsaW5lJyBpbiBhT3JpZ2luYWwgJiYgJ2NvbHVtbicgaW4gYU9yaWdpbmFsXG4gICAgICAgICAgICAgJiYgYUdlbmVyYXRlZC5saW5lID4gMCAmJiBhR2VuZXJhdGVkLmNvbHVtbiA+PSAwXG4gICAgICAgICAgICAgJiYgYU9yaWdpbmFsLmxpbmUgPiAwICYmIGFPcmlnaW5hbC5jb2x1bW4gPj0gMFxuICAgICAgICAgICAgICYmIGFTb3VyY2UpIHtcbiAgICAgIC8vIENhc2VzIDIgYW5kIDMuXG4gICAgICByZXR1cm47XG4gICAgfVxuICAgIGVsc2Uge1xuICAgICAgdGhyb3cgbmV3IEVycm9yKCdJbnZhbGlkIG1hcHBpbmc6ICcgKyBKU09OLnN0cmluZ2lmeSh7XG4gICAgICAgIGdlbmVyYXRlZDogYUdlbmVyYXRlZCxcbiAgICAgICAgc291cmNlOiBhU291cmNlLFxuICAgICAgICBvcmlnaW5hbDogYU9yaWdpbmFsLFxuICAgICAgICBuYW1lOiBhTmFtZVxuICAgICAgfSkpO1xuICAgIH1cbiAgfTtcblxuLyoqXG4gKiBTZXJpYWxpemUgdGhlIGFjY3VtdWxhdGVkIG1hcHBpbmdzIGluIHRvIHRoZSBzdHJlYW0gb2YgYmFzZSA2NCBWTFFzXG4gKiBzcGVjaWZpZWQgYnkgdGhlIHNvdXJjZSBtYXAgZm9ybWF0LlxuICovXG5Tb3VyY2VNYXBHZW5lcmF0b3IucHJvdG90eXBlLl9zZXJpYWxpemVNYXBwaW5ncyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9zZXJpYWxpemVNYXBwaW5ncygpIHtcbiAgICB2YXIgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSAwO1xuICAgIHZhciBwcmV2aW91c0dlbmVyYXRlZExpbmUgPSAxO1xuICAgIHZhciBwcmV2aW91c09yaWdpbmFsQ29sdW1uID0gMDtcbiAgICB2YXIgcHJldmlvdXNPcmlnaW5hbExpbmUgPSAwO1xuICAgIHZhciBwcmV2aW91c05hbWUgPSAwO1xuICAgIHZhciBwcmV2aW91c1NvdXJjZSA9IDA7XG4gICAgdmFyIHJlc3VsdCA9ICcnO1xuICAgIHZhciBuZXh0O1xuICAgIHZhciBtYXBwaW5nO1xuICAgIHZhciBuYW1lSWR4O1xuICAgIHZhciBzb3VyY2VJZHg7XG5cbiAgICB2YXIgbWFwcGluZ3MgPSB0aGlzLl9tYXBwaW5ncy50b0FycmF5KCk7XG4gICAgZm9yICh2YXIgaSA9IDAsIGxlbiA9IG1hcHBpbmdzLmxlbmd0aDsgaSA8IGxlbjsgaSsrKSB7XG4gICAgICBtYXBwaW5nID0gbWFwcGluZ3NbaV07XG4gICAgICBuZXh0ID0gJydcblxuICAgICAgaWYgKG1hcHBpbmcuZ2VuZXJhdGVkTGluZSAhPT0gcHJldmlvdXNHZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgIHByZXZpb3VzR2VuZXJhdGVkQ29sdW1uID0gMDtcbiAgICAgICAgd2hpbGUgKG1hcHBpbmcuZ2VuZXJhdGVkTGluZSAhPT0gcHJldmlvdXNHZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgICAgbmV4dCArPSAnOyc7XG4gICAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRMaW5lKys7XG4gICAgICAgIH1cbiAgICAgIH1cbiAgICAgIGVsc2Uge1xuICAgICAgICBpZiAoaSA+IDApIHtcbiAgICAgICAgICBpZiAoIXV0aWwuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zSW5mbGF0ZWQobWFwcGluZywgbWFwcGluZ3NbaSAtIDFdKSkge1xuICAgICAgICAgICAgY29udGludWU7XG4gICAgICAgICAgfVxuICAgICAgICAgIG5leHQgKz0gJywnO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIG5leHQgKz0gYmFzZTY0VkxRLmVuY29kZShtYXBwaW5nLmdlbmVyYXRlZENvbHVtblxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgLSBwcmV2aW91c0dlbmVyYXRlZENvbHVtbik7XG4gICAgICBwcmV2aW91c0dlbmVyYXRlZENvbHVtbiA9IG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uO1xuXG4gICAgICBpZiAobWFwcGluZy5zb3VyY2UgIT0gbnVsbCkge1xuICAgICAgICBzb3VyY2VJZHggPSB0aGlzLl9zb3VyY2VzLmluZGV4T2YobWFwcGluZy5zb3VyY2UpO1xuICAgICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUoc291cmNlSWR4IC0gcHJldmlvdXNTb3VyY2UpO1xuICAgICAgICBwcmV2aW91c1NvdXJjZSA9IHNvdXJjZUlkeDtcblxuICAgICAgICAvLyBsaW5lcyBhcmUgc3RvcmVkIDAtYmFzZWQgaW4gU291cmNlTWFwIHNwZWMgdmVyc2lvbiAzXG4gICAgICAgIG5leHQgKz0gYmFzZTY0VkxRLmVuY29kZShtYXBwaW5nLm9yaWdpbmFsTGluZSAtIDFcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgLSBwcmV2aW91c09yaWdpbmFsTGluZSk7XG4gICAgICAgIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gbWFwcGluZy5vcmlnaW5hbExpbmUgLSAxO1xuXG4gICAgICAgIG5leHQgKz0gYmFzZTY0VkxRLmVuY29kZShtYXBwaW5nLm9yaWdpbmFsQ29sdW1uXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIC0gcHJldmlvdXNPcmlnaW5hbENvbHVtbik7XG4gICAgICAgIHByZXZpb3VzT3JpZ2luYWxDb2x1bW4gPSBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uO1xuXG4gICAgICAgIGlmIChtYXBwaW5nLm5hbWUgIT0gbnVsbCkge1xuICAgICAgICAgIG5hbWVJZHggPSB0aGlzLl9uYW1lcy5pbmRleE9mKG1hcHBpbmcubmFtZSk7XG4gICAgICAgICAgbmV4dCArPSBiYXNlNjRWTFEuZW5jb2RlKG5hbWVJZHggLSBwcmV2aW91c05hbWUpO1xuICAgICAgICAgIHByZXZpb3VzTmFtZSA9IG5hbWVJZHg7XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgcmVzdWx0ICs9IG5leHQ7XG4gICAgfVxuXG4gICAgcmV0dXJuIHJlc3VsdDtcbiAgfTtcblxuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5fZ2VuZXJhdGVTb3VyY2VzQ29udGVudCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9nZW5lcmF0ZVNvdXJjZXNDb250ZW50KGFTb3VyY2VzLCBhU291cmNlUm9vdCkge1xuICAgIHJldHVybiBhU291cmNlcy5tYXAoZnVuY3Rpb24gKHNvdXJjZSkge1xuICAgICAgaWYgKCF0aGlzLl9zb3VyY2VzQ29udGVudHMpIHtcbiAgICAgICAgcmV0dXJuIG51bGw7XG4gICAgICB9XG4gICAgICBpZiAoYVNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgICBzb3VyY2UgPSB1dGlsLnJlbGF0aXZlKGFTb3VyY2VSb290LCBzb3VyY2UpO1xuICAgICAgfVxuICAgICAgdmFyIGtleSA9IHV0aWwudG9TZXRTdHJpbmcoc291cmNlKTtcbiAgICAgIHJldHVybiBPYmplY3QucHJvdG90eXBlLmhhc093blByb3BlcnR5LmNhbGwodGhpcy5fc291cmNlc0NvbnRlbnRzLCBrZXkpXG4gICAgICAgID8gdGhpcy5fc291cmNlc0NvbnRlbnRzW2tleV1cbiAgICAgICAgOiBudWxsO1xuICAgIH0sIHRoaXMpO1xuICB9O1xuXG4vKipcbiAqIEV4dGVybmFsaXplIHRoZSBzb3VyY2UgbWFwLlxuICovXG5Tb3VyY2VNYXBHZW5lcmF0b3IucHJvdG90eXBlLnRvSlNPTiA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl90b0pTT04oKSB7XG4gICAgdmFyIG1hcCA9IHtcbiAgICAgIHZlcnNpb246IHRoaXMuX3ZlcnNpb24sXG4gICAgICBzb3VyY2VzOiB0aGlzLl9zb3VyY2VzLnRvQXJyYXkoKSxcbiAgICAgIG5hbWVzOiB0aGlzLl9uYW1lcy50b0FycmF5KCksXG4gICAgICBtYXBwaW5nczogdGhpcy5fc2VyaWFsaXplTWFwcGluZ3MoKVxuICAgIH07XG4gICAgaWYgKHRoaXMuX2ZpbGUgIT0gbnVsbCkge1xuICAgICAgbWFwLmZpbGUgPSB0aGlzLl9maWxlO1xuICAgIH1cbiAgICBpZiAodGhpcy5fc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICBtYXAuc291cmNlUm9vdCA9IHRoaXMuX3NvdXJjZVJvb3Q7XG4gICAgfVxuICAgIGlmICh0aGlzLl9zb3VyY2VzQ29udGVudHMpIHtcbiAgICAgIG1hcC5zb3VyY2VzQ29udGVudCA9IHRoaXMuX2dlbmVyYXRlU291cmNlc0NvbnRlbnQobWFwLnNvdXJjZXMsIG1hcC5zb3VyY2VSb290KTtcbiAgICB9XG5cbiAgICByZXR1cm4gbWFwO1xuICB9O1xuXG4vKipcbiAqIFJlbmRlciB0aGUgc291cmNlIG1hcCBiZWluZyBnZW5lcmF0ZWQgdG8gYSBzdHJpbmcuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUudG9TdHJpbmcgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfdG9TdHJpbmcoKSB7XG4gICAgcmV0dXJuIEpTT04uc3RyaW5naWZ5KHRoaXMudG9KU09OKCkpO1xuICB9O1xuXG5leHBvcnRzLlNvdXJjZU1hcEdlbmVyYXRvciA9IFNvdXJjZU1hcEdlbmVyYXRvcjtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL3NvdXJjZS1tYXAtZ2VuZXJhdG9yLmpzXG4vLyBtb2R1bGUgaWQgPSAxXG4vLyBtb2R1bGUgY2h1bmtzID0gMCIsIi8qIC0qLSBNb2RlOiBqczsganMtaW5kZW50LWxldmVsOiAyOyAtKi0gKi9cbi8qXG4gKiBDb3B5cmlnaHQgMjAxMSBNb3ppbGxhIEZvdW5kYXRpb24gYW5kIGNvbnRyaWJ1dG9yc1xuICogTGljZW5zZWQgdW5kZXIgdGhlIE5ldyBCU0QgbGljZW5zZS4gU2VlIExJQ0VOU0Ugb3I6XG4gKiBodHRwOi8vb3BlbnNvdXJjZS5vcmcvbGljZW5zZXMvQlNELTMtQ2xhdXNlXG4gKlxuICogQmFzZWQgb24gdGhlIEJhc2UgNjQgVkxRIGltcGxlbWVudGF0aW9uIGluIENsb3N1cmUgQ29tcGlsZXI6XG4gKiBodHRwczovL2NvZGUuZ29vZ2xlLmNvbS9wL2Nsb3N1cmUtY29tcGlsZXIvc291cmNlL2Jyb3dzZS90cnVuay9zcmMvY29tL2dvb2dsZS9kZWJ1Z2dpbmcvc291cmNlbWFwL0Jhc2U2NFZMUS5qYXZhXG4gKlxuICogQ29weXJpZ2h0IDIwMTEgVGhlIENsb3N1cmUgQ29tcGlsZXIgQXV0aG9ycy4gQWxsIHJpZ2h0cyByZXNlcnZlZC5cbiAqIFJlZGlzdHJpYnV0aW9uIGFuZCB1c2UgaW4gc291cmNlIGFuZCBiaW5hcnkgZm9ybXMsIHdpdGggb3Igd2l0aG91dFxuICogbW9kaWZpY2F0aW9uLCBhcmUgcGVybWl0dGVkIHByb3ZpZGVkIHRoYXQgdGhlIGZvbGxvd2luZyBjb25kaXRpb25zIGFyZVxuICogbWV0OlxuICpcbiAqICAqIFJlZGlzdHJpYnV0aW9ucyBvZiBzb3VyY2UgY29kZSBtdXN0IHJldGFpbiB0aGUgYWJvdmUgY29weXJpZ2h0XG4gKiAgICBub3RpY2UsIHRoaXMgbGlzdCBvZiBjb25kaXRpb25zIGFuZCB0aGUgZm9sbG93aW5nIGRpc2NsYWltZXIuXG4gKiAgKiBSZWRpc3RyaWJ1dGlvbnMgaW4gYmluYXJ5IGZvcm0gbXVzdCByZXByb2R1Y2UgdGhlIGFib3ZlXG4gKiAgICBjb3B5cmlnaHQgbm90aWNlLCB0aGlzIGxpc3Qgb2YgY29uZGl0aW9ucyBhbmQgdGhlIGZvbGxvd2luZ1xuICogICAgZGlzY2xhaW1lciBpbiB0aGUgZG9jdW1lbnRhdGlvbiBhbmQvb3Igb3RoZXIgbWF0ZXJpYWxzIHByb3ZpZGVkXG4gKiAgICB3aXRoIHRoZSBkaXN0cmlidXRpb24uXG4gKiAgKiBOZWl0aGVyIHRoZSBuYW1lIG9mIEdvb2dsZSBJbmMuIG5vciB0aGUgbmFtZXMgb2YgaXRzXG4gKiAgICBjb250cmlidXRvcnMgbWF5IGJlIHVzZWQgdG8gZW5kb3JzZSBvciBwcm9tb3RlIHByb2R1Y3RzIGRlcml2ZWRcbiAqICAgIGZyb20gdGhpcyBzb2Z0d2FyZSB3aXRob3V0IHNwZWNpZmljIHByaW9yIHdyaXR0ZW4gcGVybWlzc2lvbi5cbiAqXG4gKiBUSElTIFNPRlRXQVJFIElTIFBST1ZJREVEIEJZIFRIRSBDT1BZUklHSFQgSE9MREVSUyBBTkQgQ09OVFJJQlVUT1JTXG4gKiBcIkFTIElTXCIgQU5EIEFOWSBFWFBSRVNTIE9SIElNUExJRUQgV0FSUkFOVElFUywgSU5DTFVESU5HLCBCVVQgTk9UXG4gKiBMSU1JVEVEIFRPLCBUSEUgSU1QTElFRCBXQVJSQU5USUVTIE9GIE1FUkNIQU5UQUJJTElUWSBBTkQgRklUTkVTUyBGT1JcbiAqIEEgUEFSVElDVUxBUiBQVVJQT1NFIEFSRSBESVNDTEFJTUVELiBJTiBOTyBFVkVOVCBTSEFMTCBUSEUgQ09QWVJJR0hUXG4gKiBPV05FUiBPUiBDT05UUklCVVRPUlMgQkUgTElBQkxFIEZPUiBBTlkgRElSRUNULCBJTkRJUkVDVCwgSU5DSURFTlRBTCxcbiAqIFNQRUNJQUwsIEVYRU1QTEFSWSwgT1IgQ09OU0VRVUVOVElBTCBEQU1BR0VTIChJTkNMVURJTkcsIEJVVCBOT1RcbiAqIExJTUlURUQgVE8sIFBST0NVUkVNRU5UIE9GIFNVQlNUSVRVVEUgR09PRFMgT1IgU0VSVklDRVM7IExPU1MgT0YgVVNFLFxuICogREFUQSwgT1IgUFJPRklUUzsgT1IgQlVTSU5FU1MgSU5URVJSVVBUSU9OKSBIT1dFVkVSIENBVVNFRCBBTkQgT04gQU5ZXG4gKiBUSEVPUlkgT0YgTElBQklMSVRZLCBXSEVUSEVSIElOIENPTlRSQUNULCBTVFJJQ1QgTElBQklMSVRZLCBPUiBUT1JUXG4gKiAoSU5DTFVESU5HIE5FR0xJR0VOQ0UgT1IgT1RIRVJXSVNFKSBBUklTSU5HIElOIEFOWSBXQVkgT1VUIE9GIFRIRSBVU0VcbiAqIE9GIFRISVMgU09GVFdBUkUsIEVWRU4gSUYgQURWSVNFRCBPRiBUSEUgUE9TU0lCSUxJVFkgT0YgU1VDSCBEQU1BR0UuXG4gKi9cblxudmFyIGJhc2U2NCA9IHJlcXVpcmUoJy4vYmFzZTY0Jyk7XG5cbi8vIEEgc2luZ2xlIGJhc2UgNjQgZGlnaXQgY2FuIGNvbnRhaW4gNiBiaXRzIG9mIGRhdGEuIEZvciB0aGUgYmFzZSA2NCB2YXJpYWJsZVxuLy8gbGVuZ3RoIHF1YW50aXRpZXMgd2UgdXNlIGluIHRoZSBzb3VyY2UgbWFwIHNwZWMsIHRoZSBmaXJzdCBiaXQgaXMgdGhlIHNpZ24sXG4vLyB0aGUgbmV4dCBmb3VyIGJpdHMgYXJlIHRoZSBhY3R1YWwgdmFsdWUsIGFuZCB0aGUgNnRoIGJpdCBpcyB0aGVcbi8vIGNvbnRpbnVhdGlvbiBiaXQuIFRoZSBjb250aW51YXRpb24gYml0IHRlbGxzIHVzIHdoZXRoZXIgdGhlcmUgYXJlIG1vcmVcbi8vIGRpZ2l0cyBpbiB0aGlzIHZhbHVlIGZvbGxvd2luZyB0aGlzIGRpZ2l0LlxuLy9cbi8vICAgQ29udGludWF0aW9uXG4vLyAgIHwgICAgU2lnblxuLy8gICB8ICAgIHxcbi8vICAgViAgICBWXG4vLyAgIDEwMTAxMVxuXG52YXIgVkxRX0JBU0VfU0hJRlQgPSA1O1xuXG4vLyBiaW5hcnk6IDEwMDAwMFxudmFyIFZMUV9CQVNFID0gMSA8PCBWTFFfQkFTRV9TSElGVDtcblxuLy8gYmluYXJ5OiAwMTExMTFcbnZhciBWTFFfQkFTRV9NQVNLID0gVkxRX0JBU0UgLSAxO1xuXG4vLyBiaW5hcnk6IDEwMDAwMFxudmFyIFZMUV9DT05USU5VQVRJT05fQklUID0gVkxRX0JBU0U7XG5cbi8qKlxuICogQ29udmVydHMgZnJvbSBhIHR3by1jb21wbGVtZW50IHZhbHVlIHRvIGEgdmFsdWUgd2hlcmUgdGhlIHNpZ24gYml0IGlzXG4gKiBwbGFjZWQgaW4gdGhlIGxlYXN0IHNpZ25pZmljYW50IGJpdC4gIEZvciBleGFtcGxlLCBhcyBkZWNpbWFsczpcbiAqICAgMSBiZWNvbWVzIDIgKDEwIGJpbmFyeSksIC0xIGJlY29tZXMgMyAoMTEgYmluYXJ5KVxuICogICAyIGJlY29tZXMgNCAoMTAwIGJpbmFyeSksIC0yIGJlY29tZXMgNSAoMTAxIGJpbmFyeSlcbiAqL1xuZnVuY3Rpb24gdG9WTFFTaWduZWQoYVZhbHVlKSB7XG4gIHJldHVybiBhVmFsdWUgPCAwXG4gICAgPyAoKC1hVmFsdWUpIDw8IDEpICsgMVxuICAgIDogKGFWYWx1ZSA8PCAxKSArIDA7XG59XG5cbi8qKlxuICogQ29udmVydHMgdG8gYSB0d28tY29tcGxlbWVudCB2YWx1ZSBmcm9tIGEgdmFsdWUgd2hlcmUgdGhlIHNpZ24gYml0IGlzXG4gKiBwbGFjZWQgaW4gdGhlIGxlYXN0IHNpZ25pZmljYW50IGJpdC4gIEZvciBleGFtcGxlLCBhcyBkZWNpbWFsczpcbiAqICAgMiAoMTAgYmluYXJ5KSBiZWNvbWVzIDEsIDMgKDExIGJpbmFyeSkgYmVjb21lcyAtMVxuICogICA0ICgxMDAgYmluYXJ5KSBiZWNvbWVzIDIsIDUgKDEwMSBiaW5hcnkpIGJlY29tZXMgLTJcbiAqL1xuZnVuY3Rpb24gZnJvbVZMUVNpZ25lZChhVmFsdWUpIHtcbiAgdmFyIGlzTmVnYXRpdmUgPSAoYVZhbHVlICYgMSkgPT09IDE7XG4gIHZhciBzaGlmdGVkID0gYVZhbHVlID4+IDE7XG4gIHJldHVybiBpc05lZ2F0aXZlXG4gICAgPyAtc2hpZnRlZFxuICAgIDogc2hpZnRlZDtcbn1cblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBiYXNlIDY0IFZMUSBlbmNvZGVkIHZhbHVlLlxuICovXG5leHBvcnRzLmVuY29kZSA9IGZ1bmN0aW9uIGJhc2U2NFZMUV9lbmNvZGUoYVZhbHVlKSB7XG4gIHZhciBlbmNvZGVkID0gXCJcIjtcbiAgdmFyIGRpZ2l0O1xuXG4gIHZhciB2bHEgPSB0b1ZMUVNpZ25lZChhVmFsdWUpO1xuXG4gIGRvIHtcbiAgICBkaWdpdCA9IHZscSAmIFZMUV9CQVNFX01BU0s7XG4gICAgdmxxID4+Pj0gVkxRX0JBU0VfU0hJRlQ7XG4gICAgaWYgKHZscSA+IDApIHtcbiAgICAgIC8vIFRoZXJlIGFyZSBzdGlsbCBtb3JlIGRpZ2l0cyBpbiB0aGlzIHZhbHVlLCBzbyB3ZSBtdXN0IG1ha2Ugc3VyZSB0aGVcbiAgICAgIC8vIGNvbnRpbnVhdGlvbiBiaXQgaXMgbWFya2VkLlxuICAgICAgZGlnaXQgfD0gVkxRX0NPTlRJTlVBVElPTl9CSVQ7XG4gICAgfVxuICAgIGVuY29kZWQgKz0gYmFzZTY0LmVuY29kZShkaWdpdCk7XG4gIH0gd2hpbGUgKHZscSA+IDApO1xuXG4gIHJldHVybiBlbmNvZGVkO1xufTtcblxuLyoqXG4gKiBEZWNvZGVzIHRoZSBuZXh0IGJhc2UgNjQgVkxRIHZhbHVlIGZyb20gdGhlIGdpdmVuIHN0cmluZyBhbmQgcmV0dXJucyB0aGVcbiAqIHZhbHVlIGFuZCB0aGUgcmVzdCBvZiB0aGUgc3RyaW5nIHZpYSB0aGUgb3V0IHBhcmFtZXRlci5cbiAqL1xuZXhwb3J0cy5kZWNvZGUgPSBmdW5jdGlvbiBiYXNlNjRWTFFfZGVjb2RlKGFTdHIsIGFJbmRleCwgYU91dFBhcmFtKSB7XG4gIHZhciBzdHJMZW4gPSBhU3RyLmxlbmd0aDtcbiAgdmFyIHJlc3VsdCA9IDA7XG4gIHZhciBzaGlmdCA9IDA7XG4gIHZhciBjb250aW51YXRpb24sIGRpZ2l0O1xuXG4gIGRvIHtcbiAgICBpZiAoYUluZGV4ID49IHN0ckxlbikge1xuICAgICAgdGhyb3cgbmV3IEVycm9yKFwiRXhwZWN0ZWQgbW9yZSBkaWdpdHMgaW4gYmFzZSA2NCBWTFEgdmFsdWUuXCIpO1xuICAgIH1cblxuICAgIGRpZ2l0ID0gYmFzZTY0LmRlY29kZShhU3RyLmNoYXJDb2RlQXQoYUluZGV4KyspKTtcbiAgICBpZiAoZGlnaXQgPT09IC0xKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoXCJJbnZhbGlkIGJhc2U2NCBkaWdpdDogXCIgKyBhU3RyLmNoYXJBdChhSW5kZXggLSAxKSk7XG4gICAgfVxuXG4gICAgY29udGludWF0aW9uID0gISEoZGlnaXQgJiBWTFFfQ09OVElOVUFUSU9OX0JJVCk7XG4gICAgZGlnaXQgJj0gVkxRX0JBU0VfTUFTSztcbiAgICByZXN1bHQgPSByZXN1bHQgKyAoZGlnaXQgPDwgc2hpZnQpO1xuICAgIHNoaWZ0ICs9IFZMUV9CQVNFX1NISUZUO1xuICB9IHdoaWxlIChjb250aW51YXRpb24pO1xuXG4gIGFPdXRQYXJhbS52YWx1ZSA9IGZyb21WTFFTaWduZWQocmVzdWx0KTtcbiAgYU91dFBhcmFtLnJlc3QgPSBhSW5kZXg7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvYmFzZTY0LXZscS5qc1xuLy8gbW9kdWxlIGlkID0gMlxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciBpbnRUb0NoYXJNYXAgPSAnQUJDREVGR0hJSktMTU5PUFFSU1RVVldYWVphYmNkZWZnaGlqa2xtbm9wcXJzdHV2d3h5ejAxMjM0NTY3ODkrLycuc3BsaXQoJycpO1xuXG4vKipcbiAqIEVuY29kZSBhbiBpbnRlZ2VyIGluIHRoZSByYW5nZSBvZiAwIHRvIDYzIHRvIGEgc2luZ2xlIGJhc2UgNjQgZGlnaXQuXG4gKi9cbmV4cG9ydHMuZW5jb2RlID0gZnVuY3Rpb24gKG51bWJlcikge1xuICBpZiAoMCA8PSBudW1iZXIgJiYgbnVtYmVyIDwgaW50VG9DaGFyTWFwLmxlbmd0aCkge1xuICAgIHJldHVybiBpbnRUb0NoYXJNYXBbbnVtYmVyXTtcbiAgfVxuICB0aHJvdyBuZXcgVHlwZUVycm9yKFwiTXVzdCBiZSBiZXR3ZWVuIDAgYW5kIDYzOiBcIiArIG51bWJlcik7XG59O1xuXG4vKipcbiAqIERlY29kZSBhIHNpbmdsZSBiYXNlIDY0IGNoYXJhY3RlciBjb2RlIGRpZ2l0IHRvIGFuIGludGVnZXIuIFJldHVybnMgLTEgb25cbiAqIGZhaWx1cmUuXG4gKi9cbmV4cG9ydHMuZGVjb2RlID0gZnVuY3Rpb24gKGNoYXJDb2RlKSB7XG4gIHZhciBiaWdBID0gNjU7ICAgICAvLyAnQSdcbiAgdmFyIGJpZ1ogPSA5MDsgICAgIC8vICdaJ1xuXG4gIHZhciBsaXR0bGVBID0gOTc7ICAvLyAnYSdcbiAgdmFyIGxpdHRsZVogPSAxMjI7IC8vICd6J1xuXG4gIHZhciB6ZXJvID0gNDg7ICAgICAvLyAnMCdcbiAgdmFyIG5pbmUgPSA1NzsgICAgIC8vICc5J1xuXG4gIHZhciBwbHVzID0gNDM7ICAgICAvLyAnKydcbiAgdmFyIHNsYXNoID0gNDc7ICAgIC8vICcvJ1xuXG4gIHZhciBsaXR0bGVPZmZzZXQgPSAyNjtcbiAgdmFyIG51bWJlck9mZnNldCA9IDUyO1xuXG4gIC8vIDAgLSAyNTogQUJDREVGR0hJSktMTU5PUFFSU1RVVldYWVpcbiAgaWYgKGJpZ0EgPD0gY2hhckNvZGUgJiYgY2hhckNvZGUgPD0gYmlnWikge1xuICAgIHJldHVybiAoY2hhckNvZGUgLSBiaWdBKTtcbiAgfVxuXG4gIC8vIDI2IC0gNTE6IGFiY2RlZmdoaWprbG1ub3BxcnN0dXZ3eHl6XG4gIGlmIChsaXR0bGVBIDw9IGNoYXJDb2RlICYmIGNoYXJDb2RlIDw9IGxpdHRsZVopIHtcbiAgICByZXR1cm4gKGNoYXJDb2RlIC0gbGl0dGxlQSArIGxpdHRsZU9mZnNldCk7XG4gIH1cblxuICAvLyA1MiAtIDYxOiAwMTIzNDU2Nzg5XG4gIGlmICh6ZXJvIDw9IGNoYXJDb2RlICYmIGNoYXJDb2RlIDw9IG5pbmUpIHtcbiAgICByZXR1cm4gKGNoYXJDb2RlIC0gemVybyArIG51bWJlck9mZnNldCk7XG4gIH1cblxuICAvLyA2MjogK1xuICBpZiAoY2hhckNvZGUgPT0gcGx1cykge1xuICAgIHJldHVybiA2MjtcbiAgfVxuXG4gIC8vIDYzOiAvXG4gIGlmIChjaGFyQ29kZSA9PSBzbGFzaCkge1xuICAgIHJldHVybiA2MztcbiAgfVxuXG4gIC8vIEludmFsaWQgYmFzZTY0IGRpZ2l0LlxuICByZXR1cm4gLTE7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvYmFzZTY0LmpzXG4vLyBtb2R1bGUgaWQgPSAzXG4vLyBtb2R1bGUgY2h1bmtzID0gMCIsIi8qIC0qLSBNb2RlOiBqczsganMtaW5kZW50LWxldmVsOiAyOyAtKi0gKi9cbi8qXG4gKiBDb3B5cmlnaHQgMjAxMSBNb3ppbGxhIEZvdW5kYXRpb24gYW5kIGNvbnRyaWJ1dG9yc1xuICogTGljZW5zZWQgdW5kZXIgdGhlIE5ldyBCU0QgbGljZW5zZS4gU2VlIExJQ0VOU0Ugb3I6XG4gKiBodHRwOi8vb3BlbnNvdXJjZS5vcmcvbGljZW5zZXMvQlNELTMtQ2xhdXNlXG4gKi9cblxuLyoqXG4gKiBUaGlzIGlzIGEgaGVscGVyIGZ1bmN0aW9uIGZvciBnZXR0aW5nIHZhbHVlcyBmcm9tIHBhcmFtZXRlci9vcHRpb25zXG4gKiBvYmplY3RzLlxuICpcbiAqIEBwYXJhbSBhcmdzIFRoZSBvYmplY3Qgd2UgYXJlIGV4dHJhY3RpbmcgdmFsdWVzIGZyb21cbiAqIEBwYXJhbSBuYW1lIFRoZSBuYW1lIG9mIHRoZSBwcm9wZXJ0eSB3ZSBhcmUgZ2V0dGluZy5cbiAqIEBwYXJhbSBkZWZhdWx0VmFsdWUgQW4gb3B0aW9uYWwgdmFsdWUgdG8gcmV0dXJuIGlmIHRoZSBwcm9wZXJ0eSBpcyBtaXNzaW5nXG4gKiBmcm9tIHRoZSBvYmplY3QuIElmIHRoaXMgaXMgbm90IHNwZWNpZmllZCBhbmQgdGhlIHByb3BlcnR5IGlzIG1pc3NpbmcsIGFuXG4gKiBlcnJvciB3aWxsIGJlIHRocm93bi5cbiAqL1xuZnVuY3Rpb24gZ2V0QXJnKGFBcmdzLCBhTmFtZSwgYURlZmF1bHRWYWx1ZSkge1xuICBpZiAoYU5hbWUgaW4gYUFyZ3MpIHtcbiAgICByZXR1cm4gYUFyZ3NbYU5hbWVdO1xuICB9IGVsc2UgaWYgKGFyZ3VtZW50cy5sZW5ndGggPT09IDMpIHtcbiAgICByZXR1cm4gYURlZmF1bHRWYWx1ZTtcbiAgfSBlbHNlIHtcbiAgICB0aHJvdyBuZXcgRXJyb3IoJ1wiJyArIGFOYW1lICsgJ1wiIGlzIGEgcmVxdWlyZWQgYXJndW1lbnQuJyk7XG4gIH1cbn1cbmV4cG9ydHMuZ2V0QXJnID0gZ2V0QXJnO1xuXG52YXIgdXJsUmVnZXhwID0gL14oPzooW1xcdytcXC0uXSspOik/XFwvXFwvKD86KFxcdys6XFx3KylAKT8oW1xcdy5dKikoPzo6KFxcZCspKT8oXFxTKikkLztcbnZhciBkYXRhVXJsUmVnZXhwID0gL15kYXRhOi4rXFwsLiskLztcblxuZnVuY3Rpb24gdXJsUGFyc2UoYVVybCkge1xuICB2YXIgbWF0Y2ggPSBhVXJsLm1hdGNoKHVybFJlZ2V4cCk7XG4gIGlmICghbWF0Y2gpIHtcbiAgICByZXR1cm4gbnVsbDtcbiAgfVxuICByZXR1cm4ge1xuICAgIHNjaGVtZTogbWF0Y2hbMV0sXG4gICAgYXV0aDogbWF0Y2hbMl0sXG4gICAgaG9zdDogbWF0Y2hbM10sXG4gICAgcG9ydDogbWF0Y2hbNF0sXG4gICAgcGF0aDogbWF0Y2hbNV1cbiAgfTtcbn1cbmV4cG9ydHMudXJsUGFyc2UgPSB1cmxQYXJzZTtcblxuZnVuY3Rpb24gdXJsR2VuZXJhdGUoYVBhcnNlZFVybCkge1xuICB2YXIgdXJsID0gJyc7XG4gIGlmIChhUGFyc2VkVXJsLnNjaGVtZSkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLnNjaGVtZSArICc6JztcbiAgfVxuICB1cmwgKz0gJy8vJztcbiAgaWYgKGFQYXJzZWRVcmwuYXV0aCkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLmF1dGggKyAnQCc7XG4gIH1cbiAgaWYgKGFQYXJzZWRVcmwuaG9zdCkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLmhvc3Q7XG4gIH1cbiAgaWYgKGFQYXJzZWRVcmwucG9ydCkge1xuICAgIHVybCArPSBcIjpcIiArIGFQYXJzZWRVcmwucG9ydFxuICB9XG4gIGlmIChhUGFyc2VkVXJsLnBhdGgpIHtcbiAgICB1cmwgKz0gYVBhcnNlZFVybC5wYXRoO1xuICB9XG4gIHJldHVybiB1cmw7XG59XG5leHBvcnRzLnVybEdlbmVyYXRlID0gdXJsR2VuZXJhdGU7XG5cbi8qKlxuICogTm9ybWFsaXplcyBhIHBhdGgsIG9yIHRoZSBwYXRoIHBvcnRpb24gb2YgYSBVUkw6XG4gKlxuICogLSBSZXBsYWNlcyBjb25zZWN1dGl2ZSBzbGFzaGVzIHdpdGggb25lIHNsYXNoLlxuICogLSBSZW1vdmVzIHVubmVjZXNzYXJ5ICcuJyBwYXJ0cy5cbiAqIC0gUmVtb3ZlcyB1bm5lY2Vzc2FyeSAnPGRpcj4vLi4nIHBhcnRzLlxuICpcbiAqIEJhc2VkIG9uIGNvZGUgaW4gdGhlIE5vZGUuanMgJ3BhdGgnIGNvcmUgbW9kdWxlLlxuICpcbiAqIEBwYXJhbSBhUGF0aCBUaGUgcGF0aCBvciB1cmwgdG8gbm9ybWFsaXplLlxuICovXG5mdW5jdGlvbiBub3JtYWxpemUoYVBhdGgpIHtcbiAgdmFyIHBhdGggPSBhUGF0aDtcbiAgdmFyIHVybCA9IHVybFBhcnNlKGFQYXRoKTtcbiAgaWYgKHVybCkge1xuICAgIGlmICghdXJsLnBhdGgpIHtcbiAgICAgIHJldHVybiBhUGF0aDtcbiAgICB9XG4gICAgcGF0aCA9IHVybC5wYXRoO1xuICB9XG4gIHZhciBpc0Fic29sdXRlID0gZXhwb3J0cy5pc0Fic29sdXRlKHBhdGgpO1xuXG4gIHZhciBwYXJ0cyA9IHBhdGguc3BsaXQoL1xcLysvKTtcbiAgZm9yICh2YXIgcGFydCwgdXAgPSAwLCBpID0gcGFydHMubGVuZ3RoIC0gMTsgaSA+PSAwOyBpLS0pIHtcbiAgICBwYXJ0ID0gcGFydHNbaV07XG4gICAgaWYgKHBhcnQgPT09ICcuJykge1xuICAgICAgcGFydHMuc3BsaWNlKGksIDEpO1xuICAgIH0gZWxzZSBpZiAocGFydCA9PT0gJy4uJykge1xuICAgICAgdXArKztcbiAgICB9IGVsc2UgaWYgKHVwID4gMCkge1xuICAgICAgaWYgKHBhcnQgPT09ICcnKSB7XG4gICAgICAgIC8vIFRoZSBmaXJzdCBwYXJ0IGlzIGJsYW5rIGlmIHRoZSBwYXRoIGlzIGFic29sdXRlLiBUcnlpbmcgdG8gZ29cbiAgICAgICAgLy8gYWJvdmUgdGhlIHJvb3QgaXMgYSBuby1vcC4gVGhlcmVmb3JlIHdlIGNhbiByZW1vdmUgYWxsICcuLicgcGFydHNcbiAgICAgICAgLy8gZGlyZWN0bHkgYWZ0ZXIgdGhlIHJvb3QuXG4gICAgICAgIHBhcnRzLnNwbGljZShpICsgMSwgdXApO1xuICAgICAgICB1cCA9IDA7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBwYXJ0cy5zcGxpY2UoaSwgMik7XG4gICAgICAgIHVwLS07XG4gICAgICB9XG4gICAgfVxuICB9XG4gIHBhdGggPSBwYXJ0cy5qb2luKCcvJyk7XG5cbiAgaWYgKHBhdGggPT09ICcnKSB7XG4gICAgcGF0aCA9IGlzQWJzb2x1dGUgPyAnLycgOiAnLic7XG4gIH1cblxuICBpZiAodXJsKSB7XG4gICAgdXJsLnBhdGggPSBwYXRoO1xuICAgIHJldHVybiB1cmxHZW5lcmF0ZSh1cmwpO1xuICB9XG4gIHJldHVybiBwYXRoO1xufVxuZXhwb3J0cy5ub3JtYWxpemUgPSBub3JtYWxpemU7XG5cbi8qKlxuICogSm9pbnMgdHdvIHBhdGhzL1VSTHMuXG4gKlxuICogQHBhcmFtIGFSb290IFRoZSByb290IHBhdGggb3IgVVJMLlxuICogQHBhcmFtIGFQYXRoIFRoZSBwYXRoIG9yIFVSTCB0byBiZSBqb2luZWQgd2l0aCB0aGUgcm9vdC5cbiAqXG4gKiAtIElmIGFQYXRoIGlzIGEgVVJMIG9yIGEgZGF0YSBVUkksIGFQYXRoIGlzIHJldHVybmVkLCB1bmxlc3MgYVBhdGggaXMgYVxuICogICBzY2hlbWUtcmVsYXRpdmUgVVJMOiBUaGVuIHRoZSBzY2hlbWUgb2YgYVJvb3QsIGlmIGFueSwgaXMgcHJlcGVuZGVkXG4gKiAgIGZpcnN0LlxuICogLSBPdGhlcndpc2UgYVBhdGggaXMgYSBwYXRoLiBJZiBhUm9vdCBpcyBhIFVSTCwgdGhlbiBpdHMgcGF0aCBwb3J0aW9uXG4gKiAgIGlzIHVwZGF0ZWQgd2l0aCB0aGUgcmVzdWx0IGFuZCBhUm9vdCBpcyByZXR1cm5lZC4gT3RoZXJ3aXNlIHRoZSByZXN1bHRcbiAqICAgaXMgcmV0dXJuZWQuXG4gKiAgIC0gSWYgYVBhdGggaXMgYWJzb2x1dGUsIHRoZSByZXN1bHQgaXMgYVBhdGguXG4gKiAgIC0gT3RoZXJ3aXNlIHRoZSB0d28gcGF0aHMgYXJlIGpvaW5lZCB3aXRoIGEgc2xhc2guXG4gKiAtIEpvaW5pbmcgZm9yIGV4YW1wbGUgJ2h0dHA6Ly8nIGFuZCAnd3d3LmV4YW1wbGUuY29tJyBpcyBhbHNvIHN1cHBvcnRlZC5cbiAqL1xuZnVuY3Rpb24gam9pbihhUm9vdCwgYVBhdGgpIHtcbiAgaWYgKGFSb290ID09PSBcIlwiKSB7XG4gICAgYVJvb3QgPSBcIi5cIjtcbiAgfVxuICBpZiAoYVBhdGggPT09IFwiXCIpIHtcbiAgICBhUGF0aCA9IFwiLlwiO1xuICB9XG4gIHZhciBhUGF0aFVybCA9IHVybFBhcnNlKGFQYXRoKTtcbiAgdmFyIGFSb290VXJsID0gdXJsUGFyc2UoYVJvb3QpO1xuICBpZiAoYVJvb3RVcmwpIHtcbiAgICBhUm9vdCA9IGFSb290VXJsLnBhdGggfHwgJy8nO1xuICB9XG5cbiAgLy8gYGpvaW4oZm9vLCAnLy93d3cuZXhhbXBsZS5vcmcnKWBcbiAgaWYgKGFQYXRoVXJsICYmICFhUGF0aFVybC5zY2hlbWUpIHtcbiAgICBpZiAoYVJvb3RVcmwpIHtcbiAgICAgIGFQYXRoVXJsLnNjaGVtZSA9IGFSb290VXJsLnNjaGVtZTtcbiAgICB9XG4gICAgcmV0dXJuIHVybEdlbmVyYXRlKGFQYXRoVXJsKTtcbiAgfVxuXG4gIGlmIChhUGF0aFVybCB8fCBhUGF0aC5tYXRjaChkYXRhVXJsUmVnZXhwKSkge1xuICAgIHJldHVybiBhUGF0aDtcbiAgfVxuXG4gIC8vIGBqb2luKCdodHRwOi8vJywgJ3d3dy5leGFtcGxlLmNvbScpYFxuICBpZiAoYVJvb3RVcmwgJiYgIWFSb290VXJsLmhvc3QgJiYgIWFSb290VXJsLnBhdGgpIHtcbiAgICBhUm9vdFVybC5ob3N0ID0gYVBhdGg7XG4gICAgcmV0dXJuIHVybEdlbmVyYXRlKGFSb290VXJsKTtcbiAgfVxuXG4gIHZhciBqb2luZWQgPSBhUGF0aC5jaGFyQXQoMCkgPT09ICcvJ1xuICAgID8gYVBhdGhcbiAgICA6IG5vcm1hbGl6ZShhUm9vdC5yZXBsYWNlKC9cXC8rJC8sICcnKSArICcvJyArIGFQYXRoKTtcblxuICBpZiAoYVJvb3RVcmwpIHtcbiAgICBhUm9vdFVybC5wYXRoID0gam9pbmVkO1xuICAgIHJldHVybiB1cmxHZW5lcmF0ZShhUm9vdFVybCk7XG4gIH1cbiAgcmV0dXJuIGpvaW5lZDtcbn1cbmV4cG9ydHMuam9pbiA9IGpvaW47XG5cbmV4cG9ydHMuaXNBYnNvbHV0ZSA9IGZ1bmN0aW9uIChhUGF0aCkge1xuICByZXR1cm4gYVBhdGguY2hhckF0KDApID09PSAnLycgfHwgISFhUGF0aC5tYXRjaCh1cmxSZWdleHApO1xufTtcblxuLyoqXG4gKiBNYWtlIGEgcGF0aCByZWxhdGl2ZSB0byBhIFVSTCBvciBhbm90aGVyIHBhdGguXG4gKlxuICogQHBhcmFtIGFSb290IFRoZSByb290IHBhdGggb3IgVVJMLlxuICogQHBhcmFtIGFQYXRoIFRoZSBwYXRoIG9yIFVSTCB0byBiZSBtYWRlIHJlbGF0aXZlIHRvIGFSb290LlxuICovXG5mdW5jdGlvbiByZWxhdGl2ZShhUm9vdCwgYVBhdGgpIHtcbiAgaWYgKGFSb290ID09PSBcIlwiKSB7XG4gICAgYVJvb3QgPSBcIi5cIjtcbiAgfVxuXG4gIGFSb290ID0gYVJvb3QucmVwbGFjZSgvXFwvJC8sICcnKTtcblxuICAvLyBJdCBpcyBwb3NzaWJsZSBmb3IgdGhlIHBhdGggdG8gYmUgYWJvdmUgdGhlIHJvb3QuIEluIHRoaXMgY2FzZSwgc2ltcGx5XG4gIC8vIGNoZWNraW5nIHdoZXRoZXIgdGhlIHJvb3QgaXMgYSBwcmVmaXggb2YgdGhlIHBhdGggd29uJ3Qgd29yay4gSW5zdGVhZCwgd2VcbiAgLy8gbmVlZCB0byByZW1vdmUgY29tcG9uZW50cyBmcm9tIHRoZSByb290IG9uZSBieSBvbmUsIHVudGlsIGVpdGhlciB3ZSBmaW5kXG4gIC8vIGEgcHJlZml4IHRoYXQgZml0cywgb3Igd2UgcnVuIG91dCBvZiBjb21wb25lbnRzIHRvIHJlbW92ZS5cbiAgdmFyIGxldmVsID0gMDtcbiAgd2hpbGUgKGFQYXRoLmluZGV4T2YoYVJvb3QgKyAnLycpICE9PSAwKSB7XG4gICAgdmFyIGluZGV4ID0gYVJvb3QubGFzdEluZGV4T2YoXCIvXCIpO1xuICAgIGlmIChpbmRleCA8IDApIHtcbiAgICAgIHJldHVybiBhUGF0aDtcbiAgICB9XG5cbiAgICAvLyBJZiB0aGUgb25seSBwYXJ0IG9mIHRoZSByb290IHRoYXQgaXMgbGVmdCBpcyB0aGUgc2NoZW1lIChpLmUuIGh0dHA6Ly8sXG4gICAgLy8gZmlsZTovLy8sIGV0Yy4pLCBvbmUgb3IgbW9yZSBzbGFzaGVzICgvKSwgb3Igc2ltcGx5IG5vdGhpbmcgYXQgYWxsLCB3ZVxuICAgIC8vIGhhdmUgZXhoYXVzdGVkIGFsbCBjb21wb25lbnRzLCBzbyB0aGUgcGF0aCBpcyBub3QgcmVsYXRpdmUgdG8gdGhlIHJvb3QuXG4gICAgYVJvb3QgPSBhUm9vdC5zbGljZSgwLCBpbmRleCk7XG4gICAgaWYgKGFSb290Lm1hdGNoKC9eKFteXFwvXSs6XFwvKT9cXC8qJC8pKSB7XG4gICAgICByZXR1cm4gYVBhdGg7XG4gICAgfVxuXG4gICAgKytsZXZlbDtcbiAgfVxuXG4gIC8vIE1ha2Ugc3VyZSB3ZSBhZGQgYSBcIi4uL1wiIGZvciBlYWNoIGNvbXBvbmVudCB3ZSByZW1vdmVkIGZyb20gdGhlIHJvb3QuXG4gIHJldHVybiBBcnJheShsZXZlbCArIDEpLmpvaW4oXCIuLi9cIikgKyBhUGF0aC5zdWJzdHIoYVJvb3QubGVuZ3RoICsgMSk7XG59XG5leHBvcnRzLnJlbGF0aXZlID0gcmVsYXRpdmU7XG5cbnZhciBzdXBwb3J0c051bGxQcm90byA9IChmdW5jdGlvbiAoKSB7XG4gIHZhciBvYmogPSBPYmplY3QuY3JlYXRlKG51bGwpO1xuICByZXR1cm4gISgnX19wcm90b19fJyBpbiBvYmopO1xufSgpKTtcblxuZnVuY3Rpb24gaWRlbnRpdHkgKHMpIHtcbiAgcmV0dXJuIHM7XG59XG5cbi8qKlxuICogQmVjYXVzZSBiZWhhdmlvciBnb2VzIHdhY2t5IHdoZW4geW91IHNldCBgX19wcm90b19fYCBvbiBvYmplY3RzLCB3ZVxuICogaGF2ZSB0byBwcmVmaXggYWxsIHRoZSBzdHJpbmdzIGluIG91ciBzZXQgd2l0aCBhbiBhcmJpdHJhcnkgY2hhcmFjdGVyLlxuICpcbiAqIFNlZSBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL3B1bGwvMzEgYW5kXG4gKiBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL2lzc3Vlcy8zMFxuICpcbiAqIEBwYXJhbSBTdHJpbmcgYVN0clxuICovXG5mdW5jdGlvbiB0b1NldFN0cmluZyhhU3RyKSB7XG4gIGlmIChpc1Byb3RvU3RyaW5nKGFTdHIpKSB7XG4gICAgcmV0dXJuICckJyArIGFTdHI7XG4gIH1cblxuICByZXR1cm4gYVN0cjtcbn1cbmV4cG9ydHMudG9TZXRTdHJpbmcgPSBzdXBwb3J0c051bGxQcm90byA/IGlkZW50aXR5IDogdG9TZXRTdHJpbmc7XG5cbmZ1bmN0aW9uIGZyb21TZXRTdHJpbmcoYVN0cikge1xuICBpZiAoaXNQcm90b1N0cmluZyhhU3RyKSkge1xuICAgIHJldHVybiBhU3RyLnNsaWNlKDEpO1xuICB9XG5cbiAgcmV0dXJuIGFTdHI7XG59XG5leHBvcnRzLmZyb21TZXRTdHJpbmcgPSBzdXBwb3J0c051bGxQcm90byA/IGlkZW50aXR5IDogZnJvbVNldFN0cmluZztcblxuZnVuY3Rpb24gaXNQcm90b1N0cmluZyhzKSB7XG4gIGlmICghcykge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIHZhciBsZW5ndGggPSBzLmxlbmd0aDtcblxuICBpZiAobGVuZ3RoIDwgOSAvKiBcIl9fcHJvdG9fX1wiLmxlbmd0aCAqLykge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGlmIChzLmNoYXJDb2RlQXQobGVuZ3RoIC0gMSkgIT09IDk1ICAvKiAnXycgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSAyKSAhPT0gOTUgIC8qICdfJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDMpICE9PSAxMTEgLyogJ28nICovIHx8XG4gICAgICBzLmNoYXJDb2RlQXQobGVuZ3RoIC0gNCkgIT09IDExNiAvKiAndCcgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSA1KSAhPT0gMTExIC8qICdvJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDYpICE9PSAxMTQgLyogJ3InICovIHx8XG4gICAgICBzLmNoYXJDb2RlQXQobGVuZ3RoIC0gNykgIT09IDExMiAvKiAncCcgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSA4KSAhPT0gOTUgIC8qICdfJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDkpICE9PSA5NSAgLyogJ18nICovKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgZm9yICh2YXIgaSA9IGxlbmd0aCAtIDEwOyBpID49IDA7IGktLSkge1xuICAgIGlmIChzLmNoYXJDb2RlQXQoaSkgIT09IDM2IC8qICckJyAqLykge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB0cnVlO1xufVxuXG4vKipcbiAqIENvbXBhcmF0b3IgYmV0d2VlbiB0d28gbWFwcGluZ3Mgd2hlcmUgdGhlIG9yaWdpbmFsIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKlxuICogT3B0aW9uYWxseSBwYXNzIGluIGB0cnVlYCBhcyBgb25seUNvbXBhcmVHZW5lcmF0ZWRgIHRvIGNvbnNpZGVyIHR3b1xuICogbWFwcGluZ3Mgd2l0aCB0aGUgc2FtZSBvcmlnaW5hbCBzb3VyY2UvbGluZS9jb2x1bW4sIGJ1dCBkaWZmZXJlbnQgZ2VuZXJhdGVkXG4gKiBsaW5lIGFuZCBjb2x1bW4gdGhlIHNhbWUuIFVzZWZ1bCB3aGVuIHNlYXJjaGluZyBmb3IgYSBtYXBwaW5nIHdpdGggYVxuICogc3R1YmJlZCBvdXQgbWFwcGluZy5cbiAqL1xuZnVuY3Rpb24gY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMobWFwcGluZ0EsIG1hcHBpbmdCLCBvbmx5Q29tcGFyZU9yaWdpbmFsKSB7XG4gIHZhciBjbXAgPSBtYXBwaW5nQS5zb3VyY2UgLSBtYXBwaW5nQi5zb3VyY2U7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDAgfHwgb25seUNvbXBhcmVPcmlnaW5hbCkge1xuICAgIHJldHVybiBjbXA7XG4gIH1cblxuICBjbXAgPSBtYXBwaW5nQS5nZW5lcmF0ZWRDb2x1bW4gLSBtYXBwaW5nQi5nZW5lcmF0ZWRDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkTGluZSAtIG1hcHBpbmdCLmdlbmVyYXRlZExpbmU7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIG1hcHBpbmdBLm5hbWUgLSBtYXBwaW5nQi5uYW1lO1xufVxuZXhwb3J0cy5jb21wYXJlQnlPcmlnaW5hbFBvc2l0aW9ucyA9IGNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zO1xuXG4vKipcbiAqIENvbXBhcmF0b3IgYmV0d2VlbiB0d28gbWFwcGluZ3Mgd2l0aCBkZWZsYXRlZCBzb3VyY2UgYW5kIG5hbWUgaW5kaWNlcyB3aGVyZVxuICogdGhlIGdlbmVyYXRlZCBwb3NpdGlvbnMgYXJlIGNvbXBhcmVkLlxuICpcbiAqIE9wdGlvbmFsbHkgcGFzcyBpbiBgdHJ1ZWAgYXMgYG9ubHlDb21wYXJlR2VuZXJhdGVkYCB0byBjb25zaWRlciB0d29cbiAqIG1hcHBpbmdzIHdpdGggdGhlIHNhbWUgZ2VuZXJhdGVkIGxpbmUgYW5kIGNvbHVtbiwgYnV0IGRpZmZlcmVudFxuICogc291cmNlL25hbWUvb3JpZ2luYWwgbGluZSBhbmQgY29sdW1uIHRoZSBzYW1lLiBVc2VmdWwgd2hlbiBzZWFyY2hpbmcgZm9yIGFcbiAqIG1hcHBpbmcgd2l0aCBhIHN0dWJiZWQgb3V0IG1hcHBpbmcuXG4gKi9cbmZ1bmN0aW9uIGNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkKG1hcHBpbmdBLCBtYXBwaW5nQiwgb25seUNvbXBhcmVHZW5lcmF0ZWQpIHtcbiAgdmFyIGNtcCA9IG1hcHBpbmdBLmdlbmVyYXRlZExpbmUgLSBtYXBwaW5nQi5nZW5lcmF0ZWRMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLmdlbmVyYXRlZENvbHVtbiAtIG1hcHBpbmdCLmdlbmVyYXRlZENvbHVtbjtcbiAgaWYgKGNtcCAhPT0gMCB8fCBvbmx5Q29tcGFyZUdlbmVyYXRlZCkge1xuICAgIHJldHVybiBjbXA7XG4gIH1cblxuICBjbXAgPSBtYXBwaW5nQS5zb3VyY2UgLSBtYXBwaW5nQi5zb3VyY2U7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIG1hcHBpbmdBLm5hbWUgLSBtYXBwaW5nQi5uYW1lO1xufVxuZXhwb3J0cy5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNEZWZsYXRlZCA9IGNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkO1xuXG5mdW5jdGlvbiBzdHJjbXAoYVN0cjEsIGFTdHIyKSB7XG4gIGlmIChhU3RyMSA9PT0gYVN0cjIpIHtcbiAgICByZXR1cm4gMDtcbiAgfVxuXG4gIGlmIChhU3RyMSA+IGFTdHIyKSB7XG4gICAgcmV0dXJuIDE7XG4gIH1cblxuICByZXR1cm4gLTE7XG59XG5cbi8qKlxuICogQ29tcGFyYXRvciBiZXR3ZWVuIHR3byBtYXBwaW5ncyB3aXRoIGluZmxhdGVkIHNvdXJjZSBhbmQgbmFtZSBzdHJpbmdzIHdoZXJlXG4gKiB0aGUgZ2VuZXJhdGVkIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKi9cbmZ1bmN0aW9uIGNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0luZmxhdGVkKG1hcHBpbmdBLCBtYXBwaW5nQikge1xuICB2YXIgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkTGluZSAtIG1hcHBpbmdCLmdlbmVyYXRlZExpbmU7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IHN0cmNtcChtYXBwaW5nQS5zb3VyY2UsIG1hcHBpbmdCLnNvdXJjZSk7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIHN0cmNtcChtYXBwaW5nQS5uYW1lLCBtYXBwaW5nQi5uYW1lKTtcbn1cbmV4cG9ydHMuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zSW5mbGF0ZWQgPSBjb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZDtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL3V0aWwuanNcbi8vIG1vZHVsZSBpZCA9IDRcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIGhhcyA9IE9iamVjdC5wcm90b3R5cGUuaGFzT3duUHJvcGVydHk7XG52YXIgaGFzTmF0aXZlTWFwID0gdHlwZW9mIE1hcCAhPT0gXCJ1bmRlZmluZWRcIjtcblxuLyoqXG4gKiBBIGRhdGEgc3RydWN0dXJlIHdoaWNoIGlzIGEgY29tYmluYXRpb24gb2YgYW4gYXJyYXkgYW5kIGEgc2V0LiBBZGRpbmcgYSBuZXdcbiAqIG1lbWJlciBpcyBPKDEpLCB0ZXN0aW5nIGZvciBtZW1iZXJzaGlwIGlzIE8oMSksIGFuZCBmaW5kaW5nIHRoZSBpbmRleCBvZiBhblxuICogZWxlbWVudCBpcyBPKDEpLiBSZW1vdmluZyBlbGVtZW50cyBmcm9tIHRoZSBzZXQgaXMgbm90IHN1cHBvcnRlZC4gT25seVxuICogc3RyaW5ncyBhcmUgc3VwcG9ydGVkIGZvciBtZW1iZXJzaGlwLlxuICovXG5mdW5jdGlvbiBBcnJheVNldCgpIHtcbiAgdGhpcy5fYXJyYXkgPSBbXTtcbiAgdGhpcy5fc2V0ID0gaGFzTmF0aXZlTWFwID8gbmV3IE1hcCgpIDogT2JqZWN0LmNyZWF0ZShudWxsKTtcbn1cblxuLyoqXG4gKiBTdGF0aWMgbWV0aG9kIGZvciBjcmVhdGluZyBBcnJheVNldCBpbnN0YW5jZXMgZnJvbSBhbiBleGlzdGluZyBhcnJheS5cbiAqL1xuQXJyYXlTZXQuZnJvbUFycmF5ID0gZnVuY3Rpb24gQXJyYXlTZXRfZnJvbUFycmF5KGFBcnJheSwgYUFsbG93RHVwbGljYXRlcykge1xuICB2YXIgc2V0ID0gbmV3IEFycmF5U2V0KCk7XG4gIGZvciAodmFyIGkgPSAwLCBsZW4gPSBhQXJyYXkubGVuZ3RoOyBpIDwgbGVuOyBpKyspIHtcbiAgICBzZXQuYWRkKGFBcnJheVtpXSwgYUFsbG93RHVwbGljYXRlcyk7XG4gIH1cbiAgcmV0dXJuIHNldDtcbn07XG5cbi8qKlxuICogUmV0dXJuIGhvdyBtYW55IHVuaXF1ZSBpdGVtcyBhcmUgaW4gdGhpcyBBcnJheVNldC4gSWYgZHVwbGljYXRlcyBoYXZlIGJlZW5cbiAqIGFkZGVkLCB0aGFuIHRob3NlIGRvIG5vdCBjb3VudCB0b3dhcmRzIHRoZSBzaXplLlxuICpcbiAqIEByZXR1cm5zIE51bWJlclxuICovXG5BcnJheVNldC5wcm90b3R5cGUuc2l6ZSA9IGZ1bmN0aW9uIEFycmF5U2V0X3NpemUoKSB7XG4gIHJldHVybiBoYXNOYXRpdmVNYXAgPyB0aGlzLl9zZXQuc2l6ZSA6IE9iamVjdC5nZXRPd25Qcm9wZXJ0eU5hbWVzKHRoaXMuX3NldCkubGVuZ3RoO1xufTtcblxuLyoqXG4gKiBBZGQgdGhlIGdpdmVuIHN0cmluZyB0byB0aGlzIHNldC5cbiAqXG4gKiBAcGFyYW0gU3RyaW5nIGFTdHJcbiAqL1xuQXJyYXlTZXQucHJvdG90eXBlLmFkZCA9IGZ1bmN0aW9uIEFycmF5U2V0X2FkZChhU3RyLCBhQWxsb3dEdXBsaWNhdGVzKSB7XG4gIHZhciBzU3RyID0gaGFzTmF0aXZlTWFwID8gYVN0ciA6IHV0aWwudG9TZXRTdHJpbmcoYVN0cik7XG4gIHZhciBpc0R1cGxpY2F0ZSA9IGhhc05hdGl2ZU1hcCA/IHRoaXMuaGFzKGFTdHIpIDogaGFzLmNhbGwodGhpcy5fc2V0LCBzU3RyKTtcbiAgdmFyIGlkeCA9IHRoaXMuX2FycmF5Lmxlbmd0aDtcbiAgaWYgKCFpc0R1cGxpY2F0ZSB8fCBhQWxsb3dEdXBsaWNhdGVzKSB7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhU3RyKTtcbiAgfVxuICBpZiAoIWlzRHVwbGljYXRlKSB7XG4gICAgaWYgKGhhc05hdGl2ZU1hcCkge1xuICAgICAgdGhpcy5fc2V0LnNldChhU3RyLCBpZHgpO1xuICAgIH0gZWxzZSB7XG4gICAgICB0aGlzLl9zZXRbc1N0cl0gPSBpZHg7XG4gICAgfVxuICB9XG59O1xuXG4vKipcbiAqIElzIHRoZSBnaXZlbiBzdHJpbmcgYSBtZW1iZXIgb2YgdGhpcyBzZXQ/XG4gKlxuICogQHBhcmFtIFN0cmluZyBhU3RyXG4gKi9cbkFycmF5U2V0LnByb3RvdHlwZS5oYXMgPSBmdW5jdGlvbiBBcnJheVNldF9oYXMoYVN0cikge1xuICBpZiAoaGFzTmF0aXZlTWFwKSB7XG4gICAgcmV0dXJuIHRoaXMuX3NldC5oYXMoYVN0cik7XG4gIH0gZWxzZSB7XG4gICAgdmFyIHNTdHIgPSB1dGlsLnRvU2V0U3RyaW5nKGFTdHIpO1xuICAgIHJldHVybiBoYXMuY2FsbCh0aGlzLl9zZXQsIHNTdHIpO1xuICB9XG59O1xuXG4vKipcbiAqIFdoYXQgaXMgdGhlIGluZGV4IG9mIHRoZSBnaXZlbiBzdHJpbmcgaW4gdGhlIGFycmF5P1xuICpcbiAqIEBwYXJhbSBTdHJpbmcgYVN0clxuICovXG5BcnJheVNldC5wcm90b3R5cGUuaW5kZXhPZiA9IGZ1bmN0aW9uIEFycmF5U2V0X2luZGV4T2YoYVN0cikge1xuICBpZiAoaGFzTmF0aXZlTWFwKSB7XG4gICAgdmFyIGlkeCA9IHRoaXMuX3NldC5nZXQoYVN0cik7XG4gICAgaWYgKGlkeCA+PSAwKSB7XG4gICAgICAgIHJldHVybiBpZHg7XG4gICAgfVxuICB9IGVsc2Uge1xuICAgIHZhciBzU3RyID0gdXRpbC50b1NldFN0cmluZyhhU3RyKTtcbiAgICBpZiAoaGFzLmNhbGwodGhpcy5fc2V0LCBzU3RyKSkge1xuICAgICAgcmV0dXJuIHRoaXMuX3NldFtzU3RyXTtcbiAgICB9XG4gIH1cblxuICB0aHJvdyBuZXcgRXJyb3IoJ1wiJyArIGFTdHIgKyAnXCIgaXMgbm90IGluIHRoZSBzZXQuJyk7XG59O1xuXG4vKipcbiAqIFdoYXQgaXMgdGhlIGVsZW1lbnQgYXQgdGhlIGdpdmVuIGluZGV4P1xuICpcbiAqIEBwYXJhbSBOdW1iZXIgYUlkeFxuICovXG5BcnJheVNldC5wcm90b3R5cGUuYXQgPSBmdW5jdGlvbiBBcnJheVNldF9hdChhSWR4KSB7XG4gIGlmIChhSWR4ID49IDAgJiYgYUlkeCA8IHRoaXMuX2FycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiB0aGlzLl9hcnJheVthSWR4XTtcbiAgfVxuICB0aHJvdyBuZXcgRXJyb3IoJ05vIGVsZW1lbnQgaW5kZXhlZCBieSAnICsgYUlkeCk7XG59O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGFycmF5IHJlcHJlc2VudGF0aW9uIG9mIHRoaXMgc2V0ICh3aGljaCBoYXMgdGhlIHByb3BlciBpbmRpY2VzXG4gKiBpbmRpY2F0ZWQgYnkgaW5kZXhPZikuIE5vdGUgdGhhdCB0aGlzIGlzIGEgY29weSBvZiB0aGUgaW50ZXJuYWwgYXJyYXkgdXNlZFxuICogZm9yIHN0b3JpbmcgdGhlIG1lbWJlcnMgc28gdGhhdCBubyBvbmUgY2FuIG1lc3Mgd2l0aCBpbnRlcm5hbCBzdGF0ZS5cbiAqL1xuQXJyYXlTZXQucHJvdG90eXBlLnRvQXJyYXkgPSBmdW5jdGlvbiBBcnJheVNldF90b0FycmF5KCkge1xuICByZXR1cm4gdGhpcy5fYXJyYXkuc2xpY2UoKTtcbn07XG5cbmV4cG9ydHMuQXJyYXlTZXQgPSBBcnJheVNldDtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2FycmF5LXNldC5qc1xuLy8gbW9kdWxlIGlkID0gNVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTQgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciB1dGlsID0gcmVxdWlyZSgnLi91dGlsJyk7XG5cbi8qKlxuICogRGV0ZXJtaW5lIHdoZXRoZXIgbWFwcGluZ0IgaXMgYWZ0ZXIgbWFwcGluZ0Egd2l0aCByZXNwZWN0IHRvIGdlbmVyYXRlZFxuICogcG9zaXRpb24uXG4gKi9cbmZ1bmN0aW9uIGdlbmVyYXRlZFBvc2l0aW9uQWZ0ZXIobWFwcGluZ0EsIG1hcHBpbmdCKSB7XG4gIC8vIE9wdGltaXplZCBmb3IgbW9zdCBjb21tb24gY2FzZVxuICB2YXIgbGluZUEgPSBtYXBwaW5nQS5nZW5lcmF0ZWRMaW5lO1xuICB2YXIgbGluZUIgPSBtYXBwaW5nQi5nZW5lcmF0ZWRMaW5lO1xuICB2YXIgY29sdW1uQSA9IG1hcHBpbmdBLmdlbmVyYXRlZENvbHVtbjtcbiAgdmFyIGNvbHVtbkIgPSBtYXBwaW5nQi5nZW5lcmF0ZWRDb2x1bW47XG4gIHJldHVybiBsaW5lQiA+IGxpbmVBIHx8IGxpbmVCID09IGxpbmVBICYmIGNvbHVtbkIgPj0gY29sdW1uQSB8fFxuICAgICAgICAgdXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZChtYXBwaW5nQSwgbWFwcGluZ0IpIDw9IDA7XG59XG5cbi8qKlxuICogQSBkYXRhIHN0cnVjdHVyZSB0byBwcm92aWRlIGEgc29ydGVkIHZpZXcgb2YgYWNjdW11bGF0ZWQgbWFwcGluZ3MgaW4gYVxuICogcGVyZm9ybWFuY2UgY29uc2Npb3VzIG1hbm5lci4gSXQgdHJhZGVzIGEgbmVnbGliYWJsZSBvdmVyaGVhZCBpbiBnZW5lcmFsXG4gKiBjYXNlIGZvciBhIGxhcmdlIHNwZWVkdXAgaW4gY2FzZSBvZiBtYXBwaW5ncyBiZWluZyBhZGRlZCBpbiBvcmRlci5cbiAqL1xuZnVuY3Rpb24gTWFwcGluZ0xpc3QoKSB7XG4gIHRoaXMuX2FycmF5ID0gW107XG4gIHRoaXMuX3NvcnRlZCA9IHRydWU7XG4gIC8vIFNlcnZlcyBhcyBpbmZpbXVtXG4gIHRoaXMuX2xhc3QgPSB7Z2VuZXJhdGVkTGluZTogLTEsIGdlbmVyYXRlZENvbHVtbjogMH07XG59XG5cbi8qKlxuICogSXRlcmF0ZSB0aHJvdWdoIGludGVybmFsIGl0ZW1zLiBUaGlzIG1ldGhvZCB0YWtlcyB0aGUgc2FtZSBhcmd1bWVudHMgdGhhdFxuICogYEFycmF5LnByb3RvdHlwZS5mb3JFYWNoYCB0YWtlcy5cbiAqXG4gKiBOT1RFOiBUaGUgb3JkZXIgb2YgdGhlIG1hcHBpbmdzIGlzIE5PVCBndWFyYW50ZWVkLlxuICovXG5NYXBwaW5nTGlzdC5wcm90b3R5cGUudW5zb3J0ZWRGb3JFYWNoID1cbiAgZnVuY3Rpb24gTWFwcGluZ0xpc3RfZm9yRWFjaChhQ2FsbGJhY2ssIGFUaGlzQXJnKSB7XG4gICAgdGhpcy5fYXJyYXkuZm9yRWFjaChhQ2FsbGJhY2ssIGFUaGlzQXJnKTtcbiAgfTtcblxuLyoqXG4gKiBBZGQgdGhlIGdpdmVuIHNvdXJjZSBtYXBwaW5nLlxuICpcbiAqIEBwYXJhbSBPYmplY3QgYU1hcHBpbmdcbiAqL1xuTWFwcGluZ0xpc3QucHJvdG90eXBlLmFkZCA9IGZ1bmN0aW9uIE1hcHBpbmdMaXN0X2FkZChhTWFwcGluZykge1xuICBpZiAoZ2VuZXJhdGVkUG9zaXRpb25BZnRlcih0aGlzLl9sYXN0LCBhTWFwcGluZykpIHtcbiAgICB0aGlzLl9sYXN0ID0gYU1hcHBpbmc7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhTWFwcGluZyk7XG4gIH0gZWxzZSB7XG4gICAgdGhpcy5fc29ydGVkID0gZmFsc2U7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhTWFwcGluZyk7XG4gIH1cbn07XG5cbi8qKlxuICogUmV0dXJucyB0aGUgZmxhdCwgc29ydGVkIGFycmF5IG9mIG1hcHBpbmdzLiBUaGUgbWFwcGluZ3MgYXJlIHNvcnRlZCBieVxuICogZ2VuZXJhdGVkIHBvc2l0aW9uLlxuICpcbiAqIFdBUk5JTkc6IFRoaXMgbWV0aG9kIHJldHVybnMgaW50ZXJuYWwgZGF0YSB3aXRob3V0IGNvcHlpbmcsIGZvclxuICogcGVyZm9ybWFuY2UuIFRoZSByZXR1cm4gdmFsdWUgbXVzdCBOT1QgYmUgbXV0YXRlZCwgYW5kIHNob3VsZCBiZSB0cmVhdGVkIGFzXG4gKiBhbiBpbW11dGFibGUgYm9ycm93LiBJZiB5b3Ugd2FudCB0byB0YWtlIG93bmVyc2hpcCwgeW91IG11c3QgbWFrZSB5b3VyIG93blxuICogY29weS5cbiAqL1xuTWFwcGluZ0xpc3QucHJvdG90eXBlLnRvQXJyYXkgPSBmdW5jdGlvbiBNYXBwaW5nTGlzdF90b0FycmF5KCkge1xuICBpZiAoIXRoaXMuX3NvcnRlZCkge1xuICAgIHRoaXMuX2FycmF5LnNvcnQodXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZCk7XG4gICAgdGhpcy5fc29ydGVkID0gdHJ1ZTtcbiAgfVxuICByZXR1cm4gdGhpcy5fYXJyYXk7XG59O1xuXG5leHBvcnRzLk1hcHBpbmdMaXN0ID0gTWFwcGluZ0xpc3Q7XG5cblxuXG4vLy8vLy8vLy8vLy8vLy8vLy9cbi8vIFdFQlBBQ0sgRk9PVEVSXG4vLyAuL2xpYi9tYXBwaW5nLWxpc3QuanNcbi8vIG1vZHVsZSBpZCA9IDZcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIGJpbmFyeVNlYXJjaCA9IHJlcXVpcmUoJy4vYmluYXJ5LXNlYXJjaCcpO1xudmFyIEFycmF5U2V0ID0gcmVxdWlyZSgnLi9hcnJheS1zZXQnKS5BcnJheVNldDtcbnZhciBiYXNlNjRWTFEgPSByZXF1aXJlKCcuL2Jhc2U2NC12bHEnKTtcbnZhciBxdWlja1NvcnQgPSByZXF1aXJlKCcuL3F1aWNrLXNvcnQnKS5xdWlja1NvcnQ7XG5cbmZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyKGFTb3VyY2VNYXApIHtcbiAgdmFyIHNvdXJjZU1hcCA9IGFTb3VyY2VNYXA7XG4gIGlmICh0eXBlb2YgYVNvdXJjZU1hcCA9PT0gJ3N0cmluZycpIHtcbiAgICBzb3VyY2VNYXAgPSBKU09OLnBhcnNlKGFTb3VyY2VNYXAucmVwbGFjZSgvXlxcKVxcXVxcfScvLCAnJykpO1xuICB9XG5cbiAgcmV0dXJuIHNvdXJjZU1hcC5zZWN0aW9ucyAhPSBudWxsXG4gICAgPyBuZXcgSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyKHNvdXJjZU1hcClcbiAgICA6IG5ldyBCYXNpY1NvdXJjZU1hcENvbnN1bWVyKHNvdXJjZU1hcCk7XG59XG5cblNvdXJjZU1hcENvbnN1bWVyLmZyb21Tb3VyY2VNYXAgPSBmdW5jdGlvbihhU291cmNlTWFwKSB7XG4gIHJldHVybiBCYXNpY1NvdXJjZU1hcENvbnN1bWVyLmZyb21Tb3VyY2VNYXAoYVNvdXJjZU1hcCk7XG59XG5cbi8qKlxuICogVGhlIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXBwaW5nIHNwZWMgdGhhdCB3ZSBhcmUgY29uc3VtaW5nLlxuICovXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3ZlcnNpb24gPSAzO1xuXG4vLyBgX19nZW5lcmF0ZWRNYXBwaW5nc2AgYW5kIGBfX29yaWdpbmFsTWFwcGluZ3NgIGFyZSBhcnJheXMgdGhhdCBob2xkIHRoZVxuLy8gcGFyc2VkIG1hcHBpbmcgY29vcmRpbmF0ZXMgZnJvbSB0aGUgc291cmNlIG1hcCdzIFwibWFwcGluZ3NcIiBhdHRyaWJ1dGUuIFRoZXlcbi8vIGFyZSBsYXppbHkgaW5zdGFudGlhdGVkLCBhY2Nlc3NlZCB2aWEgdGhlIGBfZ2VuZXJhdGVkTWFwcGluZ3NgIGFuZFxuLy8gYF9vcmlnaW5hbE1hcHBpbmdzYCBnZXR0ZXJzIHJlc3BlY3RpdmVseSwgYW5kIHdlIG9ubHkgcGFyc2UgdGhlIG1hcHBpbmdzXG4vLyBhbmQgY3JlYXRlIHRoZXNlIGFycmF5cyBvbmNlIHF1ZXJpZWQgZm9yIGEgc291cmNlIGxvY2F0aW9uLiBXZSBqdW1wIHRocm91Z2hcbi8vIHRoZXNlIGhvb3BzIGJlY2F1c2UgdGhlcmUgY2FuIGJlIG1hbnkgdGhvdXNhbmRzIG9mIG1hcHBpbmdzLCBhbmQgcGFyc2luZ1xuLy8gdGhlbSBpcyBleHBlbnNpdmUsIHNvIHdlIG9ubHkgd2FudCB0byBkbyBpdCBpZiB3ZSBtdXN0LlxuLy9cbi8vIEVhY2ggb2JqZWN0IGluIHRoZSBhcnJheXMgaXMgb2YgdGhlIGZvcm06XG4vL1xuLy8gICAgIHtcbi8vICAgICAgIGdlbmVyYXRlZExpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIGNvZGUsXG4vLyAgICAgICBnZW5lcmF0ZWRDb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgY29kZSxcbi8vICAgICAgIHNvdXJjZTogVGhlIHBhdGggdG8gdGhlIG9yaWdpbmFsIHNvdXJjZSBmaWxlIHRoYXQgZ2VuZXJhdGVkIHRoaXNcbi8vICAgICAgICAgICAgICAgY2h1bmsgb2YgY29kZSxcbi8vICAgICAgIG9yaWdpbmFsTGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UgdGhhdFxuLy8gICAgICAgICAgICAgICAgICAgICBjb3JyZXNwb25kcyB0byB0aGlzIGNodW5rIG9mIGdlbmVyYXRlZCBjb2RlLFxuLy8gICAgICAgb3JpZ2luYWxDb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UgdGhhdFxuLy8gICAgICAgICAgICAgICAgICAgICAgIGNvcnJlc3BvbmRzIHRvIHRoaXMgY2h1bmsgb2YgZ2VuZXJhdGVkIGNvZGUsXG4vLyAgICAgICBuYW1lOiBUaGUgbmFtZSBvZiB0aGUgb3JpZ2luYWwgc3ltYm9sIHdoaWNoIGdlbmVyYXRlZCB0aGlzIGNodW5rIG9mXG4vLyAgICAgICAgICAgICBjb2RlLlxuLy8gICAgIH1cbi8vXG4vLyBBbGwgcHJvcGVydGllcyBleGNlcHQgZm9yIGBnZW5lcmF0ZWRMaW5lYCBhbmQgYGdlbmVyYXRlZENvbHVtbmAgY2FuIGJlXG4vLyBgbnVsbGAuXG4vL1xuLy8gYF9nZW5lcmF0ZWRNYXBwaW5nc2AgaXMgb3JkZXJlZCBieSB0aGUgZ2VuZXJhdGVkIHBvc2l0aW9ucy5cbi8vXG4vLyBgX29yaWdpbmFsTWFwcGluZ3NgIGlzIG9yZGVyZWQgYnkgdGhlIG9yaWdpbmFsIHBvc2l0aW9ucy5cblxuU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBudWxsO1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSwgJ19nZW5lcmF0ZWRNYXBwaW5ncycsIHtcbiAgZ2V0OiBmdW5jdGlvbiAoKSB7XG4gICAgaWYgKCF0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MpIHtcbiAgICAgIHRoaXMuX3BhcnNlTWFwcGluZ3ModGhpcy5fbWFwcGluZ3MsIHRoaXMuc291cmNlUm9vdCk7XG4gICAgfVxuXG4gICAgcmV0dXJuIHRoaXMuX19nZW5lcmF0ZWRNYXBwaW5ncztcbiAgfVxufSk7XG5cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fX29yaWdpbmFsTWFwcGluZ3MgPSBudWxsO1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSwgJ19vcmlnaW5hbE1hcHBpbmdzJywge1xuICBnZXQ6IGZ1bmN0aW9uICgpIHtcbiAgICBpZiAoIXRoaXMuX19vcmlnaW5hbE1hcHBpbmdzKSB7XG4gICAgICB0aGlzLl9wYXJzZU1hcHBpbmdzKHRoaXMuX21hcHBpbmdzLCB0aGlzLnNvdXJjZVJvb3QpO1xuICAgIH1cblxuICAgIHJldHVybiB0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncztcbiAgfVxufSk7XG5cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fY2hhcklzTWFwcGluZ1NlcGFyYXRvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2NoYXJJc01hcHBpbmdTZXBhcmF0b3IoYVN0ciwgaW5kZXgpIHtcbiAgICB2YXIgYyA9IGFTdHIuY2hhckF0KGluZGV4KTtcbiAgICByZXR1cm4gYyA9PT0gXCI7XCIgfHwgYyA9PT0gXCIsXCI7XG4gIH07XG5cbi8qKlxuICogUGFyc2UgdGhlIG1hcHBpbmdzIGluIGEgc3RyaW5nIGluIHRvIGEgZGF0YSBzdHJ1Y3R1cmUgd2hpY2ggd2UgY2FuIGVhc2lseVxuICogcXVlcnkgKHRoZSBvcmRlcmVkIGFycmF5cyBpbiB0aGUgYHRoaXMuX19nZW5lcmF0ZWRNYXBwaW5nc2AgYW5kXG4gKiBgdGhpcy5fX29yaWdpbmFsTWFwcGluZ3NgIHByb3BlcnRpZXMpLlxuICovXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKFwiU3ViY2xhc3NlcyBtdXN0IGltcGxlbWVudCBfcGFyc2VNYXBwaW5nc1wiKTtcbiAgfTtcblxuU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSID0gMTtcblNvdXJjZU1hcENvbnN1bWVyLk9SSUdJTkFMX09SREVSID0gMjtcblxuU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQgPSAxO1xuU291cmNlTWFwQ29uc3VtZXIuTEVBU1RfVVBQRVJfQk9VTkQgPSAyO1xuXG4vKipcbiAqIEl0ZXJhdGUgb3ZlciBlYWNoIG1hcHBpbmcgYmV0d2VlbiBhbiBvcmlnaW5hbCBzb3VyY2UvbGluZS9jb2x1bW4gYW5kIGFcbiAqIGdlbmVyYXRlZCBsaW5lL2NvbHVtbiBpbiB0aGlzIHNvdXJjZSBtYXAuXG4gKlxuICogQHBhcmFtIEZ1bmN0aW9uIGFDYWxsYmFja1xuICogICAgICAgIFRoZSBmdW5jdGlvbiB0aGF0IGlzIGNhbGxlZCB3aXRoIGVhY2ggbWFwcGluZy5cbiAqIEBwYXJhbSBPYmplY3QgYUNvbnRleHRcbiAqICAgICAgICBPcHRpb25hbC4gSWYgc3BlY2lmaWVkLCB0aGlzIG9iamVjdCB3aWxsIGJlIHRoZSB2YWx1ZSBvZiBgdGhpc2AgZXZlcnlcbiAqICAgICAgICB0aW1lIHRoYXQgYGFDYWxsYmFja2AgaXMgY2FsbGVkLlxuICogQHBhcmFtIGFPcmRlclxuICogICAgICAgIEVpdGhlciBgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSYCBvclxuICogICAgICAgIGBTb3VyY2VNYXBDb25zdW1lci5PUklHSU5BTF9PUkRFUmAuIFNwZWNpZmllcyB3aGV0aGVyIHlvdSB3YW50IHRvXG4gKiAgICAgICAgaXRlcmF0ZSBvdmVyIHRoZSBtYXBwaW5ncyBzb3J0ZWQgYnkgdGhlIGdlbmVyYXRlZCBmaWxlJ3MgbGluZS9jb2x1bW5cbiAqICAgICAgICBvcmRlciBvciB0aGUgb3JpZ2luYWwncyBzb3VyY2UvbGluZS9jb2x1bW4gb3JkZXIsIHJlc3BlY3RpdmVseS4gRGVmYXVsdHMgdG9cbiAqICAgICAgICBgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSYC5cbiAqL1xuU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmVhY2hNYXBwaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfZWFjaE1hcHBpbmcoYUNhbGxiYWNrLCBhQ29udGV4dCwgYU9yZGVyKSB7XG4gICAgdmFyIGNvbnRleHQgPSBhQ29udGV4dCB8fCBudWxsO1xuICAgIHZhciBvcmRlciA9IGFPcmRlciB8fCBTb3VyY2VNYXBDb25zdW1lci5HRU5FUkFURURfT1JERVI7XG5cbiAgICB2YXIgbWFwcGluZ3M7XG4gICAgc3dpdGNoIChvcmRlcikge1xuICAgIGNhc2UgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSOlxuICAgICAgbWFwcGluZ3MgPSB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5ncztcbiAgICAgIGJyZWFrO1xuICAgIGNhc2UgU291cmNlTWFwQ29uc3VtZXIuT1JJR0lOQUxfT1JERVI6XG4gICAgICBtYXBwaW5ncyA9IHRoaXMuX29yaWdpbmFsTWFwcGluZ3M7XG4gICAgICBicmVhaztcbiAgICBkZWZhdWx0OlxuICAgICAgdGhyb3cgbmV3IEVycm9yKFwiVW5rbm93biBvcmRlciBvZiBpdGVyYXRpb24uXCIpO1xuICAgIH1cblxuICAgIHZhciBzb3VyY2VSb290ID0gdGhpcy5zb3VyY2VSb290O1xuICAgIG1hcHBpbmdzLm1hcChmdW5jdGlvbiAobWFwcGluZykge1xuICAgICAgdmFyIHNvdXJjZSA9IG1hcHBpbmcuc291cmNlID09PSBudWxsID8gbnVsbCA6IHRoaXMuX3NvdXJjZXMuYXQobWFwcGluZy5zb3VyY2UpO1xuICAgICAgaWYgKHNvdXJjZSAhPSBudWxsICYmIHNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgICBzb3VyY2UgPSB1dGlsLmpvaW4oc291cmNlUm9vdCwgc291cmNlKTtcbiAgICAgIH1cbiAgICAgIHJldHVybiB7XG4gICAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgICBnZW5lcmF0ZWRMaW5lOiBtYXBwaW5nLmdlbmVyYXRlZExpbmUsXG4gICAgICAgIGdlbmVyYXRlZENvbHVtbjogbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4sXG4gICAgICAgIG9yaWdpbmFsTGluZTogbWFwcGluZy5vcmlnaW5hbExpbmUsXG4gICAgICAgIG9yaWdpbmFsQ29sdW1uOiBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uLFxuICAgICAgICBuYW1lOiBtYXBwaW5nLm5hbWUgPT09IG51bGwgPyBudWxsIDogdGhpcy5fbmFtZXMuYXQobWFwcGluZy5uYW1lKVxuICAgICAgfTtcbiAgICB9LCB0aGlzKS5mb3JFYWNoKGFDYWxsYmFjaywgY29udGV4dCk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJucyBhbGwgZ2VuZXJhdGVkIGxpbmUgYW5kIGNvbHVtbiBpbmZvcm1hdGlvbiBmb3IgdGhlIG9yaWdpbmFsIHNvdXJjZSxcbiAqIGxpbmUsIGFuZCBjb2x1bW4gcHJvdmlkZWQuIElmIG5vIGNvbHVtbiBpcyBwcm92aWRlZCwgcmV0dXJucyBhbGwgbWFwcGluZ3NcbiAqIGNvcnJlc3BvbmRpbmcgdG8gYSBlaXRoZXIgdGhlIGxpbmUgd2UgYXJlIHNlYXJjaGluZyBmb3Igb3IgdGhlIG5leHRcbiAqIGNsb3Nlc3QgbGluZSB0aGF0IGhhcyBhbnkgbWFwcGluZ3MuIE90aGVyd2lzZSwgcmV0dXJucyBhbGwgbWFwcGluZ3NcbiAqIGNvcnJlc3BvbmRpbmcgdG8gdGhlIGdpdmVuIGxpbmUgYW5kIGVpdGhlciB0aGUgY29sdW1uIHdlIGFyZSBzZWFyY2hpbmcgZm9yXG4gKiBvciB0aGUgbmV4dCBjbG9zZXN0IGNvbHVtbiB0aGF0IGhhcyBhbnkgb2Zmc2V0cy5cbiAqXG4gKiBUaGUgb25seSBhcmd1bWVudCBpcyBhbiBvYmplY3Qgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIGZpbGVuYW1lIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gY29sdW1uOiBPcHRpb25hbC4gdGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZS5cbiAqXG4gKiBhbmQgYW4gYXJyYXkgb2Ygb2JqZWN0cyBpcyByZXR1cm5lZCwgZWFjaCB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLCBvciBudWxsLlxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UsIG9yIG51bGwuXG4gKi9cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5hbGxHZW5lcmF0ZWRQb3NpdGlvbnNGb3IgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9hbGxHZW5lcmF0ZWRQb3NpdGlvbnNGb3IoYUFyZ3MpIHtcbiAgICB2YXIgbGluZSA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnbGluZScpO1xuXG4gICAgLy8gV2hlbiB0aGVyZSBpcyBubyBleGFjdCBtYXRjaCwgQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX2ZpbmRNYXBwaW5nXG4gICAgLy8gcmV0dXJucyB0aGUgaW5kZXggb2YgdGhlIGNsb3Nlc3QgbWFwcGluZyBsZXNzIHRoYW4gdGhlIG5lZWRsZS4gQnlcbiAgICAvLyBzZXR0aW5nIG5lZWRsZS5vcmlnaW5hbENvbHVtbiB0byAwLCB3ZSB0aHVzIGZpbmQgdGhlIGxhc3QgbWFwcGluZyBmb3JcbiAgICAvLyB0aGUgZ2l2ZW4gbGluZSwgcHJvdmlkZWQgc3VjaCBhIG1hcHBpbmcgZXhpc3RzLlxuICAgIHZhciBuZWVkbGUgPSB7XG4gICAgICBzb3VyY2U6IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlJyksXG4gICAgICBvcmlnaW5hbExpbmU6IGxpbmUsXG4gICAgICBvcmlnaW5hbENvbHVtbjogdXRpbC5nZXRBcmcoYUFyZ3MsICdjb2x1bW4nLCAwKVxuICAgIH07XG5cbiAgICBpZiAodGhpcy5zb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgIG5lZWRsZS5zb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHRoaXMuc291cmNlUm9vdCwgbmVlZGxlLnNvdXJjZSk7XG4gICAgfVxuICAgIGlmICghdGhpcy5fc291cmNlcy5oYXMobmVlZGxlLnNvdXJjZSkpIHtcbiAgICAgIHJldHVybiBbXTtcbiAgICB9XG4gICAgbmVlZGxlLnNvdXJjZSA9IHRoaXMuX3NvdXJjZXMuaW5kZXhPZihuZWVkbGUuc291cmNlKTtcblxuICAgIHZhciBtYXBwaW5ncyA9IFtdO1xuXG4gICAgdmFyIGluZGV4ID0gdGhpcy5fZmluZE1hcHBpbmcobmVlZGxlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIHRoaXMuX29yaWdpbmFsTWFwcGluZ3MsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgXCJvcmlnaW5hbExpbmVcIixcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBcIm9yaWdpbmFsQ29sdW1uXCIsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgdXRpbC5jb21wYXJlQnlPcmlnaW5hbFBvc2l0aW9ucyxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBiaW5hcnlTZWFyY2guTEVBU1RfVVBQRVJfQk9VTkQpO1xuICAgIGlmIChpbmRleCA+PSAwKSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX29yaWdpbmFsTWFwcGluZ3NbaW5kZXhdO1xuXG4gICAgICBpZiAoYUFyZ3MuY29sdW1uID09PSB1bmRlZmluZWQpIHtcbiAgICAgICAgdmFyIG9yaWdpbmFsTGluZSA9IG1hcHBpbmcub3JpZ2luYWxMaW5lO1xuXG4gICAgICAgIC8vIEl0ZXJhdGUgdW50aWwgZWl0aGVyIHdlIHJ1biBvdXQgb2YgbWFwcGluZ3MsIG9yIHdlIHJ1biBpbnRvXG4gICAgICAgIC8vIGEgbWFwcGluZyBmb3IgYSBkaWZmZXJlbnQgbGluZSB0aGFuIHRoZSBvbmUgd2UgZm91bmQuIFNpbmNlXG4gICAgICAgIC8vIG1hcHBpbmdzIGFyZSBzb3J0ZWQsIHRoaXMgaXMgZ3VhcmFudGVlZCB0byBmaW5kIGFsbCBtYXBwaW5ncyBmb3JcbiAgICAgICAgLy8gdGhlIGxpbmUgd2UgZm91bmQuXG4gICAgICAgIHdoaWxlIChtYXBwaW5nICYmIG1hcHBpbmcub3JpZ2luYWxMaW5lID09PSBvcmlnaW5hbExpbmUpIHtcbiAgICAgICAgICBtYXBwaW5ncy5wdXNoKHtcbiAgICAgICAgICAgIGxpbmU6IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdnZW5lcmF0ZWRMaW5lJywgbnVsbCksXG4gICAgICAgICAgICBjb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdnZW5lcmF0ZWRDb2x1bW4nLCBudWxsKSxcbiAgICAgICAgICAgIGxhc3RDb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdsYXN0R2VuZXJhdGVkQ29sdW1uJywgbnVsbClcbiAgICAgICAgICB9KTtcblxuICAgICAgICAgIG1hcHBpbmcgPSB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzWysraW5kZXhdO1xuICAgICAgICB9XG4gICAgICB9IGVsc2Uge1xuICAgICAgICB2YXIgb3JpZ2luYWxDb2x1bW4gPSBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uO1xuXG4gICAgICAgIC8vIEl0ZXJhdGUgdW50aWwgZWl0aGVyIHdlIHJ1biBvdXQgb2YgbWFwcGluZ3MsIG9yIHdlIHJ1biBpbnRvXG4gICAgICAgIC8vIGEgbWFwcGluZyBmb3IgYSBkaWZmZXJlbnQgbGluZSB0aGFuIHRoZSBvbmUgd2Ugd2VyZSBzZWFyY2hpbmcgZm9yLlxuICAgICAgICAvLyBTaW5jZSBtYXBwaW5ncyBhcmUgc29ydGVkLCB0aGlzIGlzIGd1YXJhbnRlZWQgdG8gZmluZCBhbGwgbWFwcGluZ3MgZm9yXG4gICAgICAgIC8vIHRoZSBsaW5lIHdlIGFyZSBzZWFyY2hpbmcgZm9yLlxuICAgICAgICB3aGlsZSAobWFwcGluZyAmJlxuICAgICAgICAgICAgICAgbWFwcGluZy5vcmlnaW5hbExpbmUgPT09IGxpbmUgJiZcbiAgICAgICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxDb2x1bW4gPT0gb3JpZ2luYWxDb2x1bW4pIHtcbiAgICAgICAgICBtYXBwaW5ncy5wdXNoKHtcbiAgICAgICAgICAgIGxpbmU6IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdnZW5lcmF0ZWRMaW5lJywgbnVsbCksXG4gICAgICAgICAgICBjb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdnZW5lcmF0ZWRDb2x1bW4nLCBudWxsKSxcbiAgICAgICAgICAgIGxhc3RDb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdsYXN0R2VuZXJhdGVkQ29sdW1uJywgbnVsbClcbiAgICAgICAgICB9KTtcblxuICAgICAgICAgIG1hcHBpbmcgPSB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzWysraW5kZXhdO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuXG4gICAgcmV0dXJuIG1hcHBpbmdzO1xuICB9O1xuXG5leHBvcnRzLlNvdXJjZU1hcENvbnN1bWVyID0gU291cmNlTWFwQ29uc3VtZXI7XG5cbi8qKlxuICogQSBCYXNpY1NvdXJjZU1hcENvbnN1bWVyIGluc3RhbmNlIHJlcHJlc2VudHMgYSBwYXJzZWQgc291cmNlIG1hcCB3aGljaCB3ZSBjYW5cbiAqIHF1ZXJ5IGZvciBpbmZvcm1hdGlvbiBhYm91dCB0aGUgb3JpZ2luYWwgZmlsZSBwb3NpdGlvbnMgYnkgZ2l2aW5nIGl0IGEgZmlsZVxuICogcG9zaXRpb24gaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UuXG4gKlxuICogVGhlIG9ubHkgcGFyYW1ldGVyIGlzIHRoZSByYXcgc291cmNlIG1hcCAoZWl0aGVyIGFzIGEgSlNPTiBzdHJpbmcsIG9yXG4gKiBhbHJlYWR5IHBhcnNlZCB0byBhbiBvYmplY3QpLiBBY2NvcmRpbmcgdG8gdGhlIHNwZWMsIHNvdXJjZSBtYXBzIGhhdmUgdGhlXG4gKiBmb2xsb3dpbmcgYXR0cmlidXRlczpcbiAqXG4gKiAgIC0gdmVyc2lvbjogV2hpY2ggdmVyc2lvbiBvZiB0aGUgc291cmNlIG1hcCBzcGVjIHRoaXMgbWFwIGlzIGZvbGxvd2luZy5cbiAqICAgLSBzb3VyY2VzOiBBbiBhcnJheSBvZiBVUkxzIHRvIHRoZSBvcmlnaW5hbCBzb3VyY2UgZmlsZXMuXG4gKiAgIC0gbmFtZXM6IEFuIGFycmF5IG9mIGlkZW50aWZpZXJzIHdoaWNoIGNhbiBiZSByZWZlcnJlbmNlZCBieSBpbmRpdmlkdWFsIG1hcHBpbmdzLlxuICogICAtIHNvdXJjZVJvb3Q6IE9wdGlvbmFsLiBUaGUgVVJMIHJvb3QgZnJvbSB3aGljaCBhbGwgc291cmNlcyBhcmUgcmVsYXRpdmUuXG4gKiAgIC0gc291cmNlc0NvbnRlbnQ6IE9wdGlvbmFsLiBBbiBhcnJheSBvZiBjb250ZW50cyBvZiB0aGUgb3JpZ2luYWwgc291cmNlIGZpbGVzLlxuICogICAtIG1hcHBpbmdzOiBBIHN0cmluZyBvZiBiYXNlNjQgVkxRcyB3aGljaCBjb250YWluIHRoZSBhY3R1YWwgbWFwcGluZ3MuXG4gKiAgIC0gZmlsZTogT3B0aW9uYWwuIFRoZSBnZW5lcmF0ZWQgZmlsZSB0aGlzIHNvdXJjZSBtYXAgaXMgYXNzb2NpYXRlZCB3aXRoLlxuICpcbiAqIEhlcmUgaXMgYW4gZXhhbXBsZSBzb3VyY2UgbWFwLCB0YWtlbiBmcm9tIHRoZSBzb3VyY2UgbWFwIHNwZWNbMF06XG4gKlxuICogICAgIHtcbiAqICAgICAgIHZlcnNpb24gOiAzLFxuICogICAgICAgZmlsZTogXCJvdXQuanNcIixcbiAqICAgICAgIHNvdXJjZVJvb3QgOiBcIlwiLFxuICogICAgICAgc291cmNlczogW1wiZm9vLmpzXCIsIFwiYmFyLmpzXCJdLFxuICogICAgICAgbmFtZXM6IFtcInNyY1wiLCBcIm1hcHNcIiwgXCJhcmVcIiwgXCJmdW5cIl0sXG4gKiAgICAgICBtYXBwaW5nczogXCJBQSxBQjs7QUJDREU7XCJcbiAqICAgICB9XG4gKlxuICogWzBdOiBodHRwczovL2RvY3MuZ29vZ2xlLmNvbS9kb2N1bWVudC9kLzFVMVJHQWVoUXdSeXBVVG92RjFLUmxwaU9GemUwYi1fMmdjNmZBSDBLWTBrL2VkaXQ/cGxpPTEjXG4gKi9cbmZ1bmN0aW9uIEJhc2ljU291cmNlTWFwQ29uc3VtZXIoYVNvdXJjZU1hcCkge1xuICB2YXIgc291cmNlTWFwID0gYVNvdXJjZU1hcDtcbiAgaWYgKHR5cGVvZiBhU291cmNlTWFwID09PSAnc3RyaW5nJykge1xuICAgIHNvdXJjZU1hcCA9IEpTT04ucGFyc2UoYVNvdXJjZU1hcC5yZXBsYWNlKC9eXFwpXFxdXFx9Jy8sICcnKSk7XG4gIH1cblxuICB2YXIgdmVyc2lvbiA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3ZlcnNpb24nKTtcbiAgdmFyIHNvdXJjZXMgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICdzb3VyY2VzJyk7XG4gIC8vIFNhc3MgMy4zIGxlYXZlcyBvdXQgdGhlICduYW1lcycgYXJyYXksIHNvIHdlIGRldmlhdGUgZnJvbSB0aGUgc3BlYyAod2hpY2hcbiAgLy8gcmVxdWlyZXMgdGhlIGFycmF5KSB0byBwbGF5IG5pY2UgaGVyZS5cbiAgdmFyIG5hbWVzID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnbmFtZXMnLCBbXSk7XG4gIHZhciBzb3VyY2VSb290ID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnc291cmNlUm9vdCcsIG51bGwpO1xuICB2YXIgc291cmNlc0NvbnRlbnQgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICdzb3VyY2VzQ29udGVudCcsIG51bGwpO1xuICB2YXIgbWFwcGluZ3MgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICdtYXBwaW5ncycpO1xuICB2YXIgZmlsZSA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ2ZpbGUnLCBudWxsKTtcblxuICAvLyBPbmNlIGFnYWluLCBTYXNzIGRldmlhdGVzIGZyb20gdGhlIHNwZWMgYW5kIHN1cHBsaWVzIHRoZSB2ZXJzaW9uIGFzIGFcbiAgLy8gc3RyaW5nIHJhdGhlciB0aGFuIGEgbnVtYmVyLCBzbyB3ZSB1c2UgbG9vc2UgZXF1YWxpdHkgY2hlY2tpbmcgaGVyZS5cbiAgaWYgKHZlcnNpb24gIT0gdGhpcy5fdmVyc2lvbikge1xuICAgIHRocm93IG5ldyBFcnJvcignVW5zdXBwb3J0ZWQgdmVyc2lvbjogJyArIHZlcnNpb24pO1xuICB9XG5cbiAgc291cmNlcyA9IHNvdXJjZXNcbiAgICAubWFwKFN0cmluZylcbiAgICAvLyBTb21lIHNvdXJjZSBtYXBzIHByb2R1Y2UgcmVsYXRpdmUgc291cmNlIHBhdGhzIGxpa2UgXCIuL2Zvby5qc1wiIGluc3RlYWQgb2ZcbiAgICAvLyBcImZvby5qc1wiLiAgTm9ybWFsaXplIHRoZXNlIGZpcnN0IHNvIHRoYXQgZnV0dXJlIGNvbXBhcmlzb25zIHdpbGwgc3VjY2VlZC5cbiAgICAvLyBTZWUgYnVnemlsLmxhLzEwOTA3NjguXG4gICAgLm1hcCh1dGlsLm5vcm1hbGl6ZSlcbiAgICAvLyBBbHdheXMgZW5zdXJlIHRoYXQgYWJzb2x1dGUgc291cmNlcyBhcmUgaW50ZXJuYWxseSBzdG9yZWQgcmVsYXRpdmUgdG9cbiAgICAvLyB0aGUgc291cmNlIHJvb3QsIGlmIHRoZSBzb3VyY2Ugcm9vdCBpcyBhYnNvbHV0ZS4gTm90IGRvaW5nIHRoaXMgd291bGRcbiAgICAvLyBiZSBwYXJ0aWN1bGFybHkgcHJvYmxlbWF0aWMgd2hlbiB0aGUgc291cmNlIHJvb3QgaXMgYSBwcmVmaXggb2YgdGhlXG4gICAgLy8gc291cmNlICh2YWxpZCwgYnV0IHdoeT8/KS4gU2VlIGdpdGh1YiBpc3N1ZSAjMTk5IGFuZCBidWd6aWwubGEvMTE4ODk4Mi5cbiAgICAubWFwKGZ1bmN0aW9uIChzb3VyY2UpIHtcbiAgICAgIHJldHVybiBzb3VyY2VSb290ICYmIHV0aWwuaXNBYnNvbHV0ZShzb3VyY2VSb290KSAmJiB1dGlsLmlzQWJzb2x1dGUoc291cmNlKVxuICAgICAgICA/IHV0aWwucmVsYXRpdmUoc291cmNlUm9vdCwgc291cmNlKVxuICAgICAgICA6IHNvdXJjZTtcbiAgICB9KTtcblxuICAvLyBQYXNzIGB0cnVlYCBiZWxvdyB0byBhbGxvdyBkdXBsaWNhdGUgbmFtZXMgYW5kIHNvdXJjZXMuIFdoaWxlIHNvdXJjZSBtYXBzXG4gIC8vIGFyZSBpbnRlbmRlZCB0byBiZSBjb21wcmVzc2VkIGFuZCBkZWR1cGxpY2F0ZWQsIHRoZSBUeXBlU2NyaXB0IGNvbXBpbGVyXG4gIC8vIHNvbWV0aW1lcyBnZW5lcmF0ZXMgc291cmNlIG1hcHMgd2l0aCBkdXBsaWNhdGVzIGluIHRoZW0uIFNlZSBHaXRodWIgaXNzdWVcbiAgLy8gIzcyIGFuZCBidWd6aWwubGEvODg5NDkyLlxuICB0aGlzLl9uYW1lcyA9IEFycmF5U2V0LmZyb21BcnJheShuYW1lcy5tYXAoU3RyaW5nKSwgdHJ1ZSk7XG4gIHRoaXMuX3NvdXJjZXMgPSBBcnJheVNldC5mcm9tQXJyYXkoc291cmNlcywgdHJ1ZSk7XG5cbiAgdGhpcy5zb3VyY2VSb290ID0gc291cmNlUm9vdDtcbiAgdGhpcy5zb3VyY2VzQ29udGVudCA9IHNvdXJjZXNDb250ZW50O1xuICB0aGlzLl9tYXBwaW5ncyA9IG1hcHBpbmdzO1xuICB0aGlzLmZpbGUgPSBmaWxlO1xufVxuXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSA9IE9iamVjdC5jcmVhdGUoU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlKTtcbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmNvbnN1bWVyID0gU291cmNlTWFwQ29uc3VtZXI7XG5cbi8qKlxuICogQ3JlYXRlIGEgQmFzaWNTb3VyY2VNYXBDb25zdW1lciBmcm9tIGEgU291cmNlTWFwR2VuZXJhdG9yLlxuICpcbiAqIEBwYXJhbSBTb3VyY2VNYXBHZW5lcmF0b3IgYVNvdXJjZU1hcFxuICogICAgICAgIFRoZSBzb3VyY2UgbWFwIHRoYXQgd2lsbCBiZSBjb25zdW1lZC5cbiAqIEByZXR1cm5zIEJhc2ljU291cmNlTWFwQ29uc3VtZXJcbiAqL1xuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5mcm9tU291cmNlTWFwID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfZnJvbVNvdXJjZU1hcChhU291cmNlTWFwKSB7XG4gICAgdmFyIHNtYyA9IE9iamVjdC5jcmVhdGUoQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUpO1xuXG4gICAgdmFyIG5hbWVzID0gc21jLl9uYW1lcyA9IEFycmF5U2V0LmZyb21BcnJheShhU291cmNlTWFwLl9uYW1lcy50b0FycmF5KCksIHRydWUpO1xuICAgIHZhciBzb3VyY2VzID0gc21jLl9zb3VyY2VzID0gQXJyYXlTZXQuZnJvbUFycmF5KGFTb3VyY2VNYXAuX3NvdXJjZXMudG9BcnJheSgpLCB0cnVlKTtcbiAgICBzbWMuc291cmNlUm9vdCA9IGFTb3VyY2VNYXAuX3NvdXJjZVJvb3Q7XG4gICAgc21jLnNvdXJjZXNDb250ZW50ID0gYVNvdXJjZU1hcC5fZ2VuZXJhdGVTb3VyY2VzQ29udGVudChzbWMuX3NvdXJjZXMudG9BcnJheSgpLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgc21jLnNvdXJjZVJvb3QpO1xuICAgIHNtYy5maWxlID0gYVNvdXJjZU1hcC5fZmlsZTtcblxuICAgIC8vIEJlY2F1c2Ugd2UgYXJlIG1vZGlmeWluZyB0aGUgZW50cmllcyAoYnkgY29udmVydGluZyBzdHJpbmcgc291cmNlcyBhbmRcbiAgICAvLyBuYW1lcyB0byBpbmRpY2VzIGludG8gdGhlIHNvdXJjZXMgYW5kIG5hbWVzIEFycmF5U2V0cyksIHdlIGhhdmUgdG8gbWFrZVxuICAgIC8vIGEgY29weSBvZiB0aGUgZW50cnkgb3IgZWxzZSBiYWQgdGhpbmdzIGhhcHBlbi4gU2hhcmVkIG11dGFibGUgc3RhdGVcbiAgICAvLyBzdHJpa2VzIGFnYWluISBTZWUgZ2l0aHViIGlzc3VlICMxOTEuXG5cbiAgICB2YXIgZ2VuZXJhdGVkTWFwcGluZ3MgPSBhU291cmNlTWFwLl9tYXBwaW5ncy50b0FycmF5KCkuc2xpY2UoKTtcbiAgICB2YXIgZGVzdEdlbmVyYXRlZE1hcHBpbmdzID0gc21jLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBbXTtcbiAgICB2YXIgZGVzdE9yaWdpbmFsTWFwcGluZ3MgPSBzbWMuX19vcmlnaW5hbE1hcHBpbmdzID0gW107XG5cbiAgICBmb3IgKHZhciBpID0gMCwgbGVuZ3RoID0gZ2VuZXJhdGVkTWFwcGluZ3MubGVuZ3RoOyBpIDwgbGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzcmNNYXBwaW5nID0gZ2VuZXJhdGVkTWFwcGluZ3NbaV07XG4gICAgICB2YXIgZGVzdE1hcHBpbmcgPSBuZXcgTWFwcGluZztcbiAgICAgIGRlc3RNYXBwaW5nLmdlbmVyYXRlZExpbmUgPSBzcmNNYXBwaW5nLmdlbmVyYXRlZExpbmU7XG4gICAgICBkZXN0TWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4gPSBzcmNNYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgaWYgKHNyY01hcHBpbmcuc291cmNlKSB7XG4gICAgICAgIGRlc3RNYXBwaW5nLnNvdXJjZSA9IHNvdXJjZXMuaW5kZXhPZihzcmNNYXBwaW5nLnNvdXJjZSk7XG4gICAgICAgIGRlc3RNYXBwaW5nLm9yaWdpbmFsTGluZSA9IHNyY01hcHBpbmcub3JpZ2luYWxMaW5lO1xuICAgICAgICBkZXN0TWFwcGluZy5vcmlnaW5hbENvbHVtbiA9IHNyY01hcHBpbmcub3JpZ2luYWxDb2x1bW47XG5cbiAgICAgICAgaWYgKHNyY01hcHBpbmcubmFtZSkge1xuICAgICAgICAgIGRlc3RNYXBwaW5nLm5hbWUgPSBuYW1lcy5pbmRleE9mKHNyY01hcHBpbmcubmFtZSk7XG4gICAgICAgIH1cblxuICAgICAgICBkZXN0T3JpZ2luYWxNYXBwaW5ncy5wdXNoKGRlc3RNYXBwaW5nKTtcbiAgICAgIH1cblxuICAgICAgZGVzdEdlbmVyYXRlZE1hcHBpbmdzLnB1c2goZGVzdE1hcHBpbmcpO1xuICAgIH1cblxuICAgIHF1aWNrU29ydChzbWMuX19vcmlnaW5hbE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zKTtcblxuICAgIHJldHVybiBzbWM7XG4gIH07XG5cbi8qKlxuICogVGhlIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXBwaW5nIHNwZWMgdGhhdCB3ZSBhcmUgY29uc3VtaW5nLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogVGhlIGxpc3Qgb2Ygb3JpZ2luYWwgc291cmNlcy5cbiAqL1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KEJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLCAnc291cmNlcycsIHtcbiAgZ2V0OiBmdW5jdGlvbiAoKSB7XG4gICAgcmV0dXJuIHRoaXMuX3NvdXJjZXMudG9BcnJheSgpLm1hcChmdW5jdGlvbiAocykge1xuICAgICAgcmV0dXJuIHRoaXMuc291cmNlUm9vdCAhPSBudWxsID8gdXRpbC5qb2luKHRoaXMuc291cmNlUm9vdCwgcykgOiBzO1xuICAgIH0sIHRoaXMpO1xuICB9XG59KTtcblxuLyoqXG4gKiBQcm92aWRlIHRoZSBKSVQgd2l0aCBhIG5pY2Ugc2hhcGUgLyBoaWRkZW4gY2xhc3MuXG4gKi9cbmZ1bmN0aW9uIE1hcHBpbmcoKSB7XG4gIHRoaXMuZ2VuZXJhdGVkTGluZSA9IDA7XG4gIHRoaXMuZ2VuZXJhdGVkQ29sdW1uID0gMDtcbiAgdGhpcy5zb3VyY2UgPSBudWxsO1xuICB0aGlzLm9yaWdpbmFsTGluZSA9IG51bGw7XG4gIHRoaXMub3JpZ2luYWxDb2x1bW4gPSBudWxsO1xuICB0aGlzLm5hbWUgPSBudWxsO1xufVxuXG4vKipcbiAqIFBhcnNlIHRoZSBtYXBwaW5ncyBpbiBhIHN0cmluZyBpbiB0byBhIGRhdGEgc3RydWN0dXJlIHdoaWNoIHdlIGNhbiBlYXNpbHlcbiAqIHF1ZXJ5ICh0aGUgb3JkZXJlZCBhcnJheXMgaW4gdGhlIGB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3NgIGFuZFxuICogYHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzYCBwcm9wZXJ0aWVzKS5cbiAqL1xuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdmFyIGdlbmVyYXRlZExpbmUgPSAxO1xuICAgIHZhciBwcmV2aW91c0dlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gMDtcbiAgICB2YXIgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzU291cmNlID0gMDtcbiAgICB2YXIgcHJldmlvdXNOYW1lID0gMDtcbiAgICB2YXIgbGVuZ3RoID0gYVN0ci5sZW5ndGg7XG4gICAgdmFyIGluZGV4ID0gMDtcbiAgICB2YXIgY2FjaGVkU2VnbWVudHMgPSB7fTtcbiAgICB2YXIgdGVtcCA9IHt9O1xuICAgIHZhciBvcmlnaW5hbE1hcHBpbmdzID0gW107XG4gICAgdmFyIGdlbmVyYXRlZE1hcHBpbmdzID0gW107XG4gICAgdmFyIG1hcHBpbmcsIHN0ciwgc2VnbWVudCwgZW5kLCB2YWx1ZTtcblxuICAgIHdoaWxlIChpbmRleCA8IGxlbmd0aCkge1xuICAgICAgaWYgKGFTdHIuY2hhckF0KGluZGV4KSA9PT0gJzsnKSB7XG4gICAgICAgIGdlbmVyYXRlZExpbmUrKztcbiAgICAgICAgaW5kZXgrKztcbiAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSAwO1xuICAgICAgfVxuICAgICAgZWxzZSBpZiAoYVN0ci5jaGFyQXQoaW5kZXgpID09PSAnLCcpIHtcbiAgICAgICAgaW5kZXgrKztcbiAgICAgIH1cbiAgICAgIGVsc2Uge1xuICAgICAgICBtYXBwaW5nID0gbmV3IE1hcHBpbmcoKTtcbiAgICAgICAgbWFwcGluZy5nZW5lcmF0ZWRMaW5lID0gZ2VuZXJhdGVkTGluZTtcblxuICAgICAgICAvLyBCZWNhdXNlIGVhY2ggb2Zmc2V0IGlzIGVuY29kZWQgcmVsYXRpdmUgdG8gdGhlIHByZXZpb3VzIG9uZSxcbiAgICAgICAgLy8gbWFueSBzZWdtZW50cyBvZnRlbiBoYXZlIHRoZSBzYW1lIGVuY29kaW5nLiBXZSBjYW4gZXhwbG9pdCB0aGlzXG4gICAgICAgIC8vIGZhY3QgYnkgY2FjaGluZyB0aGUgcGFyc2VkIHZhcmlhYmxlIGxlbmd0aCBmaWVsZHMgb2YgZWFjaCBzZWdtZW50LFxuICAgICAgICAvLyBhbGxvd2luZyB1cyB0byBhdm9pZCBhIHNlY29uZCBwYXJzZSBpZiB3ZSBlbmNvdW50ZXIgdGhlIHNhbWVcbiAgICAgICAgLy8gc2VnbWVudCBhZ2Fpbi5cbiAgICAgICAgZm9yIChlbmQgPSBpbmRleDsgZW5kIDwgbGVuZ3RoOyBlbmQrKykge1xuICAgICAgICAgIGlmICh0aGlzLl9jaGFySXNNYXBwaW5nU2VwYXJhdG9yKGFTdHIsIGVuZCkpIHtcbiAgICAgICAgICAgIGJyZWFrO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICBzdHIgPSBhU3RyLnNsaWNlKGluZGV4LCBlbmQpO1xuXG4gICAgICAgIHNlZ21lbnQgPSBjYWNoZWRTZWdtZW50c1tzdHJdO1xuICAgICAgICBpZiAoc2VnbWVudCkge1xuICAgICAgICAgIGluZGV4ICs9IHN0ci5sZW5ndGg7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgc2VnbWVudCA9IFtdO1xuICAgICAgICAgIHdoaWxlIChpbmRleCA8IGVuZCkge1xuICAgICAgICAgICAgYmFzZTY0VkxRLmRlY29kZShhU3RyLCBpbmRleCwgdGVtcCk7XG4gICAgICAgICAgICB2YWx1ZSA9IHRlbXAudmFsdWU7XG4gICAgICAgICAgICBpbmRleCA9IHRlbXAucmVzdDtcbiAgICAgICAgICAgIHNlZ21lbnQucHVzaCh2YWx1ZSk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKHNlZ21lbnQubGVuZ3RoID09PSAyKSB7XG4gICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0ZvdW5kIGEgc291cmNlLCBidXQgbm8gbGluZSBhbmQgY29sdW1uJyk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKHNlZ21lbnQubGVuZ3RoID09PSAzKSB7XG4gICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0ZvdW5kIGEgc291cmNlIGFuZCBsaW5lLCBidXQgbm8gY29sdW1uJyk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgY2FjaGVkU2VnbWVudHNbc3RyXSA9IHNlZ21lbnQ7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBHZW5lcmF0ZWQgY29sdW1uLlxuICAgICAgICBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbiA9IHByZXZpb3VzR2VuZXJhdGVkQ29sdW1uICsgc2VnbWVudFswXTtcbiAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgICBpZiAoc2VnbWVudC5sZW5ndGggPiAxKSB7XG4gICAgICAgICAgLy8gT3JpZ2luYWwgc291cmNlLlxuICAgICAgICAgIG1hcHBpbmcuc291cmNlID0gcHJldmlvdXNTb3VyY2UgKyBzZWdtZW50WzFdO1xuICAgICAgICAgIHByZXZpb3VzU291cmNlICs9IHNlZ21lbnRbMV07XG5cbiAgICAgICAgICAvLyBPcmlnaW5hbCBsaW5lLlxuICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxMaW5lID0gcHJldmlvdXNPcmlnaW5hbExpbmUgKyBzZWdtZW50WzJdO1xuICAgICAgICAgIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gbWFwcGluZy5vcmlnaW5hbExpbmU7XG4gICAgICAgICAgLy8gTGluZXMgYXJlIHN0b3JlZCAwLWJhc2VkXG4gICAgICAgICAgbWFwcGluZy5vcmlnaW5hbExpbmUgKz0gMTtcblxuICAgICAgICAgIC8vIE9yaWdpbmFsIGNvbHVtbi5cbiAgICAgICAgICBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uID0gcHJldmlvdXNPcmlnaW5hbENvbHVtbiArIHNlZ21lbnRbM107XG4gICAgICAgICAgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IG1hcHBpbmcub3JpZ2luYWxDb2x1bW47XG5cbiAgICAgICAgICBpZiAoc2VnbWVudC5sZW5ndGggPiA0KSB7XG4gICAgICAgICAgICAvLyBPcmlnaW5hbCBuYW1lLlxuICAgICAgICAgICAgbWFwcGluZy5uYW1lID0gcHJldmlvdXNOYW1lICsgc2VnbWVudFs0XTtcbiAgICAgICAgICAgIHByZXZpb3VzTmFtZSArPSBzZWdtZW50WzRdO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuXG4gICAgICAgIGdlbmVyYXRlZE1hcHBpbmdzLnB1c2gobWFwcGluZyk7XG4gICAgICAgIGlmICh0eXBlb2YgbWFwcGluZy5vcmlnaW5hbExpbmUgPT09ICdudW1iZXInKSB7XG4gICAgICAgICAgb3JpZ2luYWxNYXBwaW5ncy5wdXNoKG1hcHBpbmcpO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuXG4gICAgcXVpY2tTb3J0KGdlbmVyYXRlZE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkKTtcbiAgICB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBnZW5lcmF0ZWRNYXBwaW5ncztcblxuICAgIHF1aWNrU29ydChvcmlnaW5hbE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zKTtcbiAgICB0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncyA9IG9yaWdpbmFsTWFwcGluZ3M7XG4gIH07XG5cbi8qKlxuICogRmluZCB0aGUgbWFwcGluZyB0aGF0IGJlc3QgbWF0Y2hlcyB0aGUgaHlwb3RoZXRpY2FsIFwibmVlZGxlXCIgbWFwcGluZyB0aGF0XG4gKiB3ZSBhcmUgc2VhcmNoaW5nIGZvciBpbiB0aGUgZ2l2ZW4gXCJoYXlzdGFja1wiIG9mIG1hcHBpbmdzLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fZmluZE1hcHBpbmcgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9maW5kTWFwcGluZyhhTmVlZGxlLCBhTWFwcGluZ3MsIGFMaW5lTmFtZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgYUNvbHVtbk5hbWUsIGFDb21wYXJhdG9yLCBhQmlhcykge1xuICAgIC8vIFRvIHJldHVybiB0aGUgcG9zaXRpb24gd2UgYXJlIHNlYXJjaGluZyBmb3IsIHdlIG11c3QgZmlyc3QgZmluZCB0aGVcbiAgICAvLyBtYXBwaW5nIGZvciB0aGUgZ2l2ZW4gcG9zaXRpb24gYW5kIHRoZW4gcmV0dXJuIHRoZSBvcHBvc2l0ZSBwb3NpdGlvbiBpdFxuICAgIC8vIHBvaW50cyB0by4gQmVjYXVzZSB0aGUgbWFwcGluZ3MgYXJlIHNvcnRlZCwgd2UgY2FuIHVzZSBiaW5hcnkgc2VhcmNoIHRvXG4gICAgLy8gZmluZCB0aGUgYmVzdCBtYXBwaW5nLlxuXG4gICAgaWYgKGFOZWVkbGVbYUxpbmVOYW1lXSA8PSAwKSB7XG4gICAgICB0aHJvdyBuZXcgVHlwZUVycm9yKCdMaW5lIG11c3QgYmUgZ3JlYXRlciB0aGFuIG9yIGVxdWFsIHRvIDEsIGdvdCAnXG4gICAgICAgICAgICAgICAgICAgICAgICAgICsgYU5lZWRsZVthTGluZU5hbWVdKTtcbiAgICB9XG4gICAgaWYgKGFOZWVkbGVbYUNvbHVtbk5hbWVdIDwgMCkge1xuICAgICAgdGhyb3cgbmV3IFR5cGVFcnJvcignQ29sdW1uIG11c3QgYmUgZ3JlYXRlciB0aGFuIG9yIGVxdWFsIHRvIDAsIGdvdCAnXG4gICAgICAgICAgICAgICAgICAgICAgICAgICsgYU5lZWRsZVthQ29sdW1uTmFtZV0pO1xuICAgIH1cblxuICAgIHJldHVybiBiaW5hcnlTZWFyY2guc2VhcmNoKGFOZWVkbGUsIGFNYXBwaW5ncywgYUNvbXBhcmF0b3IsIGFCaWFzKTtcbiAgfTtcblxuLyoqXG4gKiBDb21wdXRlIHRoZSBsYXN0IGNvbHVtbiBmb3IgZWFjaCBnZW5lcmF0ZWQgbWFwcGluZy4gVGhlIGxhc3QgY29sdW1uIGlzXG4gKiBpbmNsdXNpdmUuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmNvbXB1dGVDb2x1bW5TcGFucyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2NvbXB1dGVDb2x1bW5TcGFucygpIHtcbiAgICBmb3IgKHZhciBpbmRleCA9IDA7IGluZGV4IDwgdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3MubGVuZ3RoOyArK2luZGV4KSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX2dlbmVyYXRlZE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgLy8gTWFwcGluZ3MgZG8gbm90IGNvbnRhaW4gYSBmaWVsZCBmb3IgdGhlIGxhc3QgZ2VuZXJhdGVkIGNvbHVtbnQuIFdlXG4gICAgICAvLyBjYW4gY29tZSB1cCB3aXRoIGFuIG9wdGltaXN0aWMgZXN0aW1hdGUsIGhvd2V2ZXIsIGJ5IGFzc3VtaW5nIHRoYXRcbiAgICAgIC8vIG1hcHBpbmdzIGFyZSBjb250aWd1b3VzIChpLmUuIGdpdmVuIHR3byBjb25zZWN1dGl2ZSBtYXBwaW5ncywgdGhlXG4gICAgICAvLyBmaXJzdCBtYXBwaW5nIGVuZHMgd2hlcmUgdGhlIHNlY29uZCBvbmUgc3RhcnRzKS5cbiAgICAgIGlmIChpbmRleCArIDEgPCB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5ncy5sZW5ndGgpIHtcbiAgICAgICAgdmFyIG5leHRNYXBwaW5nID0gdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3NbaW5kZXggKyAxXTtcblxuICAgICAgICBpZiAobWFwcGluZy5nZW5lcmF0ZWRMaW5lID09PSBuZXh0TWFwcGluZy5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgICAgbWFwcGluZy5sYXN0R2VuZXJhdGVkQ29sdW1uID0gbmV4dE1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uIC0gMTtcbiAgICAgICAgICBjb250aW51ZTtcbiAgICAgICAgfVxuICAgICAgfVxuXG4gICAgICAvLyBUaGUgbGFzdCBtYXBwaW5nIGZvciBlYWNoIGxpbmUgc3BhbnMgdGhlIGVudGlyZSBsaW5lLlxuICAgICAgbWFwcGluZy5sYXN0R2VuZXJhdGVkQ29sdW1uID0gSW5maW5pdHk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIG9yaWdpbmFsIHNvdXJjZSwgbGluZSwgYW5kIGNvbHVtbiBpbmZvcm1hdGlvbiBmb3IgdGhlIGdlbmVyYXRlZFxuICogc291cmNlJ3MgbGluZSBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0XG4gKiB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLlxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UuXG4gKiAgIC0gYmlhczogRWl0aGVyICdTb3VyY2VNYXBDb25zdW1lci5HUkVBVEVTVF9MT1dFUl9CT1VORCcgb3JcbiAqICAgICAnU291cmNlTWFwQ29uc3VtZXIuTEVBU1RfVVBQRVJfQk9VTkQnLiBTcGVjaWZpZXMgd2hldGhlciB0byByZXR1cm4gdGhlXG4gKiAgICAgY2xvc2VzdCBlbGVtZW50IHRoYXQgaXMgc21hbGxlciB0aGFuIG9yIGdyZWF0ZXIgdGhhbiB0aGUgb25lIHdlIGFyZVxuICogICAgIHNlYXJjaGluZyBmb3IsIHJlc3BlY3RpdmVseSwgaWYgdGhlIGV4YWN0IGVsZW1lbnQgY2Fubm90IGJlIGZvdW5kLlxuICogICAgIERlZmF1bHRzIHRvICdTb3VyY2VNYXBDb25zdW1lci5HUkVBVEVTVF9MT1dFUl9CT1VORCcuXG4gKlxuICogYW5kIGFuIG9iamVjdCBpcyByZXR1cm5lZCB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gc291cmNlOiBUaGUgb3JpZ2luYWwgc291cmNlIGZpbGUsIG9yIG51bGwuXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UsIG9yIG51bGwuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLCBvciBudWxsLlxuICogICAtIG5hbWU6IFRoZSBvcmlnaW5hbCBpZGVudGlmaWVyLCBvciBudWxsLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5vcmlnaW5hbFBvc2l0aW9uRm9yID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfb3JpZ2luYWxQb3NpdGlvbkZvcihhQXJncykge1xuICAgIHZhciBuZWVkbGUgPSB7XG4gICAgICBnZW5lcmF0ZWRMaW5lOiB1dGlsLmdldEFyZyhhQXJncywgJ2xpbmUnKSxcbiAgICAgIGdlbmVyYXRlZENvbHVtbjogdXRpbC5nZXRBcmcoYUFyZ3MsICdjb2x1bW4nKVxuICAgIH07XG5cbiAgICB2YXIgaW5kZXggPSB0aGlzLl9maW5kTWFwcGluZyhcbiAgICAgIG5lZWRsZSxcbiAgICAgIHRoaXMuX2dlbmVyYXRlZE1hcHBpbmdzLFxuICAgICAgXCJnZW5lcmF0ZWRMaW5lXCIsXG4gICAgICBcImdlbmVyYXRlZENvbHVtblwiLFxuICAgICAgdXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNEZWZsYXRlZCxcbiAgICAgIHV0aWwuZ2V0QXJnKGFBcmdzLCAnYmlhcycsIFNvdXJjZU1hcENvbnN1bWVyLkdSRUFURVNUX0xPV0VSX0JPVU5EKVxuICAgICk7XG5cbiAgICBpZiAoaW5kZXggPj0gMCkge1xuICAgICAgdmFyIG1hcHBpbmcgPSB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5nc1tpbmRleF07XG5cbiAgICAgIGlmIChtYXBwaW5nLmdlbmVyYXRlZExpbmUgPT09IG5lZWRsZS5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgIHZhciBzb3VyY2UgPSB1dGlsLmdldEFyZyhtYXBwaW5nLCAnc291cmNlJywgbnVsbCk7XG4gICAgICAgIGlmIChzb3VyY2UgIT09IG51bGwpIHtcbiAgICAgICAgICBzb3VyY2UgPSB0aGlzLl9zb3VyY2VzLmF0KHNvdXJjZSk7XG4gICAgICAgICAgaWYgKHRoaXMuc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICAgICAgICBzb3VyY2UgPSB1dGlsLmpvaW4odGhpcy5zb3VyY2VSb290LCBzb3VyY2UpO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICB2YXIgbmFtZSA9IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICduYW1lJywgbnVsbCk7XG4gICAgICAgIGlmIChuYW1lICE9PSBudWxsKSB7XG4gICAgICAgICAgbmFtZSA9IHRoaXMuX25hbWVzLmF0KG5hbWUpO1xuICAgICAgICB9XG4gICAgICAgIHJldHVybiB7XG4gICAgICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICAgICAgbGluZTogdXRpbC5nZXRBcmcobWFwcGluZywgJ29yaWdpbmFsTGluZScsIG51bGwpLFxuICAgICAgICAgIGNvbHVtbjogdXRpbC5nZXRBcmcobWFwcGluZywgJ29yaWdpbmFsQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgbmFtZTogbmFtZVxuICAgICAgICB9O1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB7XG4gICAgICBzb3VyY2U6IG51bGwsXG4gICAgICBsaW5lOiBudWxsLFxuICAgICAgY29sdW1uOiBudWxsLFxuICAgICAgbmFtZTogbnVsbFxuICAgIH07XG4gIH07XG5cbi8qKlxuICogUmV0dXJuIHRydWUgaWYgd2UgaGF2ZSB0aGUgc291cmNlIGNvbnRlbnQgZm9yIGV2ZXJ5IHNvdXJjZSBpbiB0aGUgc291cmNlXG4gKiBtYXAsIGZhbHNlIG90aGVyd2lzZS5cbiAqL1xuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuaGFzQ29udGVudHNPZkFsbFNvdXJjZXMgPVxuICBmdW5jdGlvbiBCYXNpY1NvdXJjZU1hcENvbnN1bWVyX2hhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzKCkge1xuICAgIGlmICghdGhpcy5zb3VyY2VzQ29udGVudCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgICByZXR1cm4gdGhpcy5zb3VyY2VzQ29udGVudC5sZW5ndGggPj0gdGhpcy5fc291cmNlcy5zaXplKCkgJiZcbiAgICAgICF0aGlzLnNvdXJjZXNDb250ZW50LnNvbWUoZnVuY3Rpb24gKHNjKSB7IHJldHVybiBzYyA9PSBudWxsOyB9KTtcbiAgfTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBvcmlnaW5hbCBzb3VyY2UgY29udGVudC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgdGhlIHVybCBvZiB0aGVcbiAqIG9yaWdpbmFsIHNvdXJjZSBmaWxlLiBSZXR1cm5zIG51bGwgaWYgbm8gb3JpZ2luYWwgc291cmNlIGNvbnRlbnQgaXNcbiAqIGF2YWlsYWJsZS5cbiAqL1xuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuc291cmNlQ29udGVudEZvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX3NvdXJjZUNvbnRlbnRGb3IoYVNvdXJjZSwgbnVsbE9uTWlzc2luZykge1xuICAgIGlmICghdGhpcy5zb3VyY2VzQ29udGVudCkge1xuICAgICAgcmV0dXJuIG51bGw7XG4gICAgfVxuXG4gICAgaWYgKHRoaXMuc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICBhU291cmNlID0gdXRpbC5yZWxhdGl2ZSh0aGlzLnNvdXJjZVJvb3QsIGFTb3VyY2UpO1xuICAgIH1cblxuICAgIGlmICh0aGlzLl9zb3VyY2VzLmhhcyhhU291cmNlKSkge1xuICAgICAgcmV0dXJuIHRoaXMuc291cmNlc0NvbnRlbnRbdGhpcy5fc291cmNlcy5pbmRleE9mKGFTb3VyY2UpXTtcbiAgICB9XG5cbiAgICB2YXIgdXJsO1xuICAgIGlmICh0aGlzLnNvdXJjZVJvb3QgIT0gbnVsbFxuICAgICAgICAmJiAodXJsID0gdXRpbC51cmxQYXJzZSh0aGlzLnNvdXJjZVJvb3QpKSkge1xuICAgICAgLy8gWFhYOiBmaWxlOi8vIFVSSXMgYW5kIGFic29sdXRlIHBhdGhzIGxlYWQgdG8gdW5leHBlY3RlZCBiZWhhdmlvciBmb3JcbiAgICAgIC8vIG1hbnkgdXNlcnMuIFdlIGNhbiBoZWxwIHRoZW0gb3V0IHdoZW4gdGhleSBleHBlY3QgZmlsZTovLyBVUklzIHRvXG4gICAgICAvLyBiZWhhdmUgbGlrZSBpdCB3b3VsZCBpZiB0aGV5IHdlcmUgcnVubmluZyBhIGxvY2FsIEhUVFAgc2VydmVyLiBTZWVcbiAgICAgIC8vIGh0dHBzOi8vYnVnemlsbGEubW96aWxsYS5vcmcvc2hvd19idWcuY2dpP2lkPTg4NTU5Ny5cbiAgICAgIHZhciBmaWxlVXJpQWJzUGF0aCA9IGFTb3VyY2UucmVwbGFjZSgvXmZpbGU6XFwvXFwvLywgXCJcIik7XG4gICAgICBpZiAodXJsLnNjaGVtZSA9PSBcImZpbGVcIlxuICAgICAgICAgICYmIHRoaXMuX3NvdXJjZXMuaGFzKGZpbGVVcmlBYnNQYXRoKSkge1xuICAgICAgICByZXR1cm4gdGhpcy5zb3VyY2VzQ29udGVudFt0aGlzLl9zb3VyY2VzLmluZGV4T2YoZmlsZVVyaUFic1BhdGgpXVxuICAgICAgfVxuXG4gICAgICBpZiAoKCF1cmwucGF0aCB8fCB1cmwucGF0aCA9PSBcIi9cIilcbiAgICAgICAgICAmJiB0aGlzLl9zb3VyY2VzLmhhcyhcIi9cIiArIGFTb3VyY2UpKSB7XG4gICAgICAgIHJldHVybiB0aGlzLnNvdXJjZXNDb250ZW50W3RoaXMuX3NvdXJjZXMuaW5kZXhPZihcIi9cIiArIGFTb3VyY2UpXTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICAvLyBUaGlzIGZ1bmN0aW9uIGlzIHVzZWQgcmVjdXJzaXZlbHkgZnJvbVxuICAgIC8vIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuc291cmNlQ29udGVudEZvci4gSW4gdGhhdCBjYXNlLCB3ZVxuICAgIC8vIGRvbid0IHdhbnQgdG8gdGhyb3cgaWYgd2UgY2FuJ3QgZmluZCB0aGUgc291cmNlIC0gd2UganVzdCB3YW50IHRvXG4gICAgLy8gcmV0dXJuIG51bGwsIHNvIHdlIHByb3ZpZGUgYSBmbGFnIHRvIGV4aXQgZ3JhY2VmdWxseS5cbiAgICBpZiAobnVsbE9uTWlzc2luZykge1xuICAgICAgcmV0dXJuIG51bGw7XG4gICAgfVxuICAgIGVsc2Uge1xuICAgICAgdGhyb3cgbmV3IEVycm9yKCdcIicgKyBhU291cmNlICsgJ1wiIGlzIG5vdCBpbiB0aGUgU291cmNlTWFwLicpO1xuICAgIH1cbiAgfTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBnZW5lcmF0ZWQgbGluZSBhbmQgY29sdW1uIGluZm9ybWF0aW9uIGZvciB0aGUgb3JpZ2luYWwgc291cmNlLFxuICogbGluZSwgYW5kIGNvbHVtbiBwb3NpdGlvbnMgcHJvdmlkZWQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIGFuIG9iamVjdCB3aXRoXG4gKiB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIGZpbGVuYW1lIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLlxuICogICAtIGJpYXM6IEVpdGhlciAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnIG9yXG4gKiAgICAgJ1NvdXJjZU1hcENvbnN1bWVyLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLCBvciBudWxsLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5nZW5lcmF0ZWRQb3NpdGlvbkZvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2dlbmVyYXRlZFBvc2l0aW9uRm9yKGFBcmdzKSB7XG4gICAgdmFyIHNvdXJjZSA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlJyk7XG4gICAgaWYgKHRoaXMuc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICBzb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHRoaXMuc291cmNlUm9vdCwgc291cmNlKTtcbiAgICB9XG4gICAgaWYgKCF0aGlzLl9zb3VyY2VzLmhhcyhzb3VyY2UpKSB7XG4gICAgICByZXR1cm4ge1xuICAgICAgICBsaW5lOiBudWxsLFxuICAgICAgICBjb2x1bW46IG51bGwsXG4gICAgICAgIGxhc3RDb2x1bW46IG51bGxcbiAgICAgIH07XG4gICAgfVxuICAgIHNvdXJjZSA9IHRoaXMuX3NvdXJjZXMuaW5kZXhPZihzb3VyY2UpO1xuXG4gICAgdmFyIG5lZWRsZSA9IHtcbiAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgb3JpZ2luYWxMaW5lOiB1dGlsLmdldEFyZyhhQXJncywgJ2xpbmUnKSxcbiAgICAgIG9yaWdpbmFsQ29sdW1uOiB1dGlsLmdldEFyZyhhQXJncywgJ2NvbHVtbicpXG4gICAgfTtcblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRNYXBwaW5nKFxuICAgICAgbmVlZGxlLFxuICAgICAgdGhpcy5fb3JpZ2luYWxNYXBwaW5ncyxcbiAgICAgIFwib3JpZ2luYWxMaW5lXCIsXG4gICAgICBcIm9yaWdpbmFsQ29sdW1uXCIsXG4gICAgICB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zLFxuICAgICAgdXRpbC5nZXRBcmcoYUFyZ3MsICdiaWFzJywgU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQpXG4gICAgKTtcblxuICAgIGlmIChpbmRleCA+PSAwKSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX29yaWdpbmFsTWFwcGluZ3NbaW5kZXhdO1xuXG4gICAgICBpZiAobWFwcGluZy5zb3VyY2UgPT09IG5lZWRsZS5zb3VyY2UpIHtcbiAgICAgICAgcmV0dXJuIHtcbiAgICAgICAgICBsaW5lOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkTGluZScsIG51bGwpLFxuICAgICAgICAgIGNvbHVtbjogdXRpbC5nZXRBcmcobWFwcGluZywgJ2dlbmVyYXRlZENvbHVtbicsIG51bGwpLFxuICAgICAgICAgIGxhc3RDb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdsYXN0R2VuZXJhdGVkQ29sdW1uJywgbnVsbClcbiAgICAgICAgfTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICByZXR1cm4ge1xuICAgICAgbGluZTogbnVsbCxcbiAgICAgIGNvbHVtbjogbnVsbCxcbiAgICAgIGxhc3RDb2x1bW46IG51bGxcbiAgICB9O1xuICB9O1xuXG5leHBvcnRzLkJhc2ljU291cmNlTWFwQ29uc3VtZXIgPSBCYXNpY1NvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIEFuIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lciBpbnN0YW5jZSByZXByZXNlbnRzIGEgcGFyc2VkIHNvdXJjZSBtYXAgd2hpY2hcbiAqIHdlIGNhbiBxdWVyeSBmb3IgaW5mb3JtYXRpb24uIEl0IGRpZmZlcnMgZnJvbSBCYXNpY1NvdXJjZU1hcENvbnN1bWVyIGluXG4gKiB0aGF0IGl0IHRha2VzIFwiaW5kZXhlZFwiIHNvdXJjZSBtYXBzIChpLmUuIG9uZXMgd2l0aCBhIFwic2VjdGlvbnNcIiBmaWVsZCkgYXNcbiAqIGlucHV0LlxuICpcbiAqIFRoZSBvbmx5IHBhcmFtZXRlciBpcyBhIHJhdyBzb3VyY2UgbWFwIChlaXRoZXIgYXMgYSBKU09OIHN0cmluZywgb3IgYWxyZWFkeVxuICogcGFyc2VkIHRvIGFuIG9iamVjdCkuIEFjY29yZGluZyB0byB0aGUgc3BlYyBmb3IgaW5kZXhlZCBzb3VyY2UgbWFwcywgdGhleVxuICogaGF2ZSB0aGUgZm9sbG93aW5nIGF0dHJpYnV0ZXM6XG4gKlxuICogICAtIHZlcnNpb246IFdoaWNoIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXAgc3BlYyB0aGlzIG1hcCBpcyBmb2xsb3dpbmcuXG4gKiAgIC0gZmlsZTogT3B0aW9uYWwuIFRoZSBnZW5lcmF0ZWQgZmlsZSB0aGlzIHNvdXJjZSBtYXAgaXMgYXNzb2NpYXRlZCB3aXRoLlxuICogICAtIHNlY3Rpb25zOiBBIGxpc3Qgb2Ygc2VjdGlvbiBkZWZpbml0aW9ucy5cbiAqXG4gKiBFYWNoIHZhbHVlIHVuZGVyIHRoZSBcInNlY3Rpb25zXCIgZmllbGQgaGFzIHR3byBmaWVsZHM6XG4gKiAgIC0gb2Zmc2V0OiBUaGUgb2Zmc2V0IGludG8gdGhlIG9yaWdpbmFsIHNwZWNpZmllZCBhdCB3aGljaCB0aGlzIHNlY3Rpb25cbiAqICAgICAgIGJlZ2lucyB0byBhcHBseSwgZGVmaW5lZCBhcyBhbiBvYmplY3Qgd2l0aCBhIFwibGluZVwiIGFuZCBcImNvbHVtblwiXG4gKiAgICAgICBmaWVsZC5cbiAqICAgLSBtYXA6IEEgc291cmNlIG1hcCBkZWZpbml0aW9uLiBUaGlzIHNvdXJjZSBtYXAgY291bGQgYWxzbyBiZSBpbmRleGVkLFxuICogICAgICAgYnV0IGRvZXNuJ3QgaGF2ZSB0byBiZS5cbiAqXG4gKiBJbnN0ZWFkIG9mIHRoZSBcIm1hcFwiIGZpZWxkLCBpdCdzIGFsc28gcG9zc2libGUgdG8gaGF2ZSBhIFwidXJsXCIgZmllbGRcbiAqIHNwZWNpZnlpbmcgYSBVUkwgdG8gcmV0cmlldmUgYSBzb3VyY2UgbWFwIGZyb20sIGJ1dCB0aGF0J3MgY3VycmVudGx5XG4gKiB1bnN1cHBvcnRlZC5cbiAqXG4gKiBIZXJlJ3MgYW4gZXhhbXBsZSBzb3VyY2UgbWFwLCB0YWtlbiBmcm9tIHRoZSBzb3VyY2UgbWFwIHNwZWNbMF0sIGJ1dFxuICogbW9kaWZpZWQgdG8gb21pdCBhIHNlY3Rpb24gd2hpY2ggdXNlcyB0aGUgXCJ1cmxcIiBmaWVsZC5cbiAqXG4gKiAge1xuICogICAgdmVyc2lvbiA6IDMsXG4gKiAgICBmaWxlOiBcImFwcC5qc1wiLFxuICogICAgc2VjdGlvbnM6IFt7XG4gKiAgICAgIG9mZnNldDoge2xpbmU6MTAwLCBjb2x1bW46MTB9LFxuICogICAgICBtYXA6IHtcbiAqICAgICAgICB2ZXJzaW9uIDogMyxcbiAqICAgICAgICBmaWxlOiBcInNlY3Rpb24uanNcIixcbiAqICAgICAgICBzb3VyY2VzOiBbXCJmb28uanNcIiwgXCJiYXIuanNcIl0sXG4gKiAgICAgICAgbmFtZXM6IFtcInNyY1wiLCBcIm1hcHNcIiwgXCJhcmVcIiwgXCJmdW5cIl0sXG4gKiAgICAgICAgbWFwcGluZ3M6IFwiQUFBQSxFOztBQkNERTtcIlxuICogICAgICB9XG4gKiAgICB9XSxcbiAqICB9XG4gKlxuICogWzBdOiBodHRwczovL2RvY3MuZ29vZ2xlLmNvbS9kb2N1bWVudC9kLzFVMVJHQWVoUXdSeXBVVG92RjFLUmxwaU9GemUwYi1fMmdjNmZBSDBLWTBrL2VkaXQjaGVhZGluZz1oLjUzNWVzM3hlcHJndFxuICovXG5mdW5jdGlvbiBJbmRleGVkU291cmNlTWFwQ29uc3VtZXIoYVNvdXJjZU1hcCkge1xuICB2YXIgc291cmNlTWFwID0gYVNvdXJjZU1hcDtcbiAgaWYgKHR5cGVvZiBhU291cmNlTWFwID09PSAnc3RyaW5nJykge1xuICAgIHNvdXJjZU1hcCA9IEpTT04ucGFyc2UoYVNvdXJjZU1hcC5yZXBsYWNlKC9eXFwpXFxdXFx9Jy8sICcnKSk7XG4gIH1cblxuICB2YXIgdmVyc2lvbiA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3ZlcnNpb24nKTtcbiAgdmFyIHNlY3Rpb25zID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnc2VjdGlvbnMnKTtcblxuICBpZiAodmVyc2lvbiAhPSB0aGlzLl92ZXJzaW9uKSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdVbnN1cHBvcnRlZCB2ZXJzaW9uOiAnICsgdmVyc2lvbik7XG4gIH1cblxuICB0aGlzLl9zb3VyY2VzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX25hbWVzID0gbmV3IEFycmF5U2V0KCk7XG5cbiAgdmFyIGxhc3RPZmZzZXQgPSB7XG4gICAgbGluZTogLTEsXG4gICAgY29sdW1uOiAwXG4gIH07XG4gIHRoaXMuX3NlY3Rpb25zID0gc2VjdGlvbnMubWFwKGZ1bmN0aW9uIChzKSB7XG4gICAgaWYgKHMudXJsKSB7XG4gICAgICAvLyBUaGUgdXJsIGZpZWxkIHdpbGwgcmVxdWlyZSBzdXBwb3J0IGZvciBhc3luY2hyb25pY2l0eS5cbiAgICAgIC8vIFNlZSBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL2lzc3Vlcy8xNlxuICAgICAgdGhyb3cgbmV3IEVycm9yKCdTdXBwb3J0IGZvciB1cmwgZmllbGQgaW4gc2VjdGlvbnMgbm90IGltcGxlbWVudGVkLicpO1xuICAgIH1cbiAgICB2YXIgb2Zmc2V0ID0gdXRpbC5nZXRBcmcocywgJ29mZnNldCcpO1xuICAgIHZhciBvZmZzZXRMaW5lID0gdXRpbC5nZXRBcmcob2Zmc2V0LCAnbGluZScpO1xuICAgIHZhciBvZmZzZXRDb2x1bW4gPSB1dGlsLmdldEFyZyhvZmZzZXQsICdjb2x1bW4nKTtcblxuICAgIGlmIChvZmZzZXRMaW5lIDwgbGFzdE9mZnNldC5saW5lIHx8XG4gICAgICAgIChvZmZzZXRMaW5lID09PSBsYXN0T2Zmc2V0LmxpbmUgJiYgb2Zmc2V0Q29sdW1uIDwgbGFzdE9mZnNldC5jb2x1bW4pKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ1NlY3Rpb24gb2Zmc2V0cyBtdXN0IGJlIG9yZGVyZWQgYW5kIG5vbi1vdmVybGFwcGluZy4nKTtcbiAgICB9XG4gICAgbGFzdE9mZnNldCA9IG9mZnNldDtcblxuICAgIHJldHVybiB7XG4gICAgICBnZW5lcmF0ZWRPZmZzZXQ6IHtcbiAgICAgICAgLy8gVGhlIG9mZnNldCBmaWVsZHMgYXJlIDAtYmFzZWQsIGJ1dCB3ZSB1c2UgMS1iYXNlZCBpbmRpY2VzIHdoZW5cbiAgICAgICAgLy8gZW5jb2RpbmcvZGVjb2RpbmcgZnJvbSBWTFEuXG4gICAgICAgIGdlbmVyYXRlZExpbmU6IG9mZnNldExpbmUgKyAxLFxuICAgICAgICBnZW5lcmF0ZWRDb2x1bW46IG9mZnNldENvbHVtbiArIDFcbiAgICAgIH0sXG4gICAgICBjb25zdW1lcjogbmV3IFNvdXJjZU1hcENvbnN1bWVyKHV0aWwuZ2V0QXJnKHMsICdtYXAnKSlcbiAgICB9XG4gIH0pO1xufVxuXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlID0gT2JqZWN0LmNyZWF0ZShTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUpO1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5jb25zdHJ1Y3RvciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIFRoZSB2ZXJzaW9uIG9mIHRoZSBzb3VyY2UgbWFwcGluZyBzcGVjIHRoYXQgd2UgYXJlIGNvbnN1bWluZy5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogVGhlIGxpc3Qgb2Ygb3JpZ2luYWwgc291cmNlcy5cbiAqL1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUsICdzb3VyY2VzJywge1xuICBnZXQ6IGZ1bmN0aW9uICgpIHtcbiAgICB2YXIgc291cmNlcyA9IFtdO1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIGZvciAodmFyIGogPSAwOyBqIDwgdGhpcy5fc2VjdGlvbnNbaV0uY29uc3VtZXIuc291cmNlcy5sZW5ndGg7IGorKykge1xuICAgICAgICBzb3VyY2VzLnB1c2godGhpcy5fc2VjdGlvbnNbaV0uY29uc3VtZXIuc291cmNlc1tqXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiBzb3VyY2VzO1xuICB9XG59KTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBvcmlnaW5hbCBzb3VyY2UsIGxpbmUsIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBnZW5lcmF0ZWRcbiAqIHNvdXJjZSdzIGxpbmUgYW5kIGNvbHVtbiBwb3NpdGlvbnMgcHJvdmlkZWQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIGFuIG9iamVjdFxuICogd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZS5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIG9yaWdpbmFsIHNvdXJjZSBmaWxlLCBvciBudWxsLlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLCBvciBudWxsLlxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSwgb3IgbnVsbC5cbiAqICAgLSBuYW1lOiBUaGUgb3JpZ2luYWwgaWRlbnRpZmllciwgb3IgbnVsbC5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5vcmlnaW5hbFBvc2l0aW9uRm9yID1cbiAgZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyX29yaWdpbmFsUG9zaXRpb25Gb3IoYUFyZ3MpIHtcbiAgICB2YXIgbmVlZGxlID0ge1xuICAgICAgZ2VuZXJhdGVkTGluZTogdXRpbC5nZXRBcmcoYUFyZ3MsICdsaW5lJyksXG4gICAgICBnZW5lcmF0ZWRDb2x1bW46IHV0aWwuZ2V0QXJnKGFBcmdzLCAnY29sdW1uJylcbiAgICB9O1xuXG4gICAgLy8gRmluZCB0aGUgc2VjdGlvbiBjb250YWluaW5nIHRoZSBnZW5lcmF0ZWQgcG9zaXRpb24gd2UncmUgdHJ5aW5nIHRvIG1hcFxuICAgIC8vIHRvIGFuIG9yaWdpbmFsIHBvc2l0aW9uLlxuICAgIHZhciBzZWN0aW9uSW5kZXggPSBiaW5hcnlTZWFyY2guc2VhcmNoKG5lZWRsZSwgdGhpcy5fc2VjdGlvbnMsXG4gICAgICBmdW5jdGlvbihuZWVkbGUsIHNlY3Rpb24pIHtcbiAgICAgICAgdmFyIGNtcCA9IG5lZWRsZS5nZW5lcmF0ZWRMaW5lIC0gc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZTtcbiAgICAgICAgaWYgKGNtcCkge1xuICAgICAgICAgIHJldHVybiBjbXA7XG4gICAgICAgIH1cblxuICAgICAgICByZXR1cm4gKG5lZWRsZS5nZW5lcmF0ZWRDb2x1bW4gLVxuICAgICAgICAgICAgICAgIHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbik7XG4gICAgICB9KTtcbiAgICB2YXIgc2VjdGlvbiA9IHRoaXMuX3NlY3Rpb25zW3NlY3Rpb25JbmRleF07XG5cbiAgICBpZiAoIXNlY3Rpb24pIHtcbiAgICAgIHJldHVybiB7XG4gICAgICAgIHNvdXJjZTogbnVsbCxcbiAgICAgICAgbGluZTogbnVsbCxcbiAgICAgICAgY29sdW1uOiBudWxsLFxuICAgICAgICBuYW1lOiBudWxsXG4gICAgICB9O1xuICAgIH1cblxuICAgIHJldHVybiBzZWN0aW9uLmNvbnN1bWVyLm9yaWdpbmFsUG9zaXRpb25Gb3Ioe1xuICAgICAgbGluZTogbmVlZGxlLmdlbmVyYXRlZExpbmUgLVxuICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSAtIDEpLFxuICAgICAgY29sdW1uOiBuZWVkbGUuZ2VuZXJhdGVkQ29sdW1uIC1cbiAgICAgICAgKHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZExpbmUgPT09IG5lZWRsZS5nZW5lcmF0ZWRMaW5lXG4gICAgICAgICA/IHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbiAtIDFcbiAgICAgICAgIDogMCksXG4gICAgICBiaWFzOiBhQXJncy5iaWFzXG4gICAgfSk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJuIHRydWUgaWYgd2UgaGF2ZSB0aGUgc291cmNlIGNvbnRlbnQgZm9yIGV2ZXJ5IHNvdXJjZSBpbiB0aGUgc291cmNlXG4gKiBtYXAsIGZhbHNlIG90aGVyd2lzZS5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5oYXNDb250ZW50c09mQWxsU291cmNlcyA9XG4gIGZ1bmN0aW9uIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lcl9oYXNDb250ZW50c09mQWxsU291cmNlcygpIHtcbiAgICByZXR1cm4gdGhpcy5fc2VjdGlvbnMuZXZlcnkoZnVuY3Rpb24gKHMpIHtcbiAgICAgIHJldHVybiBzLmNvbnN1bWVyLmhhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzKCk7XG4gICAgfSk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJucyB0aGUgb3JpZ2luYWwgc291cmNlIGNvbnRlbnQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIHRoZSB1cmwgb2YgdGhlXG4gKiBvcmlnaW5hbCBzb3VyY2UgZmlsZS4gUmV0dXJucyBudWxsIGlmIG5vIG9yaWdpbmFsIHNvdXJjZSBjb250ZW50IGlzXG4gKiBhdmFpbGFibGUuXG4gKi9cbkluZGV4ZWRTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuc291cmNlQ29udGVudEZvciA9XG4gIGZ1bmN0aW9uIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lcl9zb3VyY2VDb250ZW50Rm9yKGFTb3VyY2UsIG51bGxPbk1pc3NpbmcpIHtcbiAgICBmb3IgKHZhciBpID0gMDsgaSA8IHRoaXMuX3NlY3Rpb25zLmxlbmd0aDsgaSsrKSB7XG4gICAgICB2YXIgc2VjdGlvbiA9IHRoaXMuX3NlY3Rpb25zW2ldO1xuXG4gICAgICB2YXIgY29udGVudCA9IHNlY3Rpb24uY29uc3VtZXIuc291cmNlQ29udGVudEZvcihhU291cmNlLCB0cnVlKTtcbiAgICAgIGlmIChjb250ZW50KSB7XG4gICAgICAgIHJldHVybiBjb250ZW50O1xuICAgICAgfVxuICAgIH1cbiAgICBpZiAobnVsbE9uTWlzc2luZykge1xuICAgICAgcmV0dXJuIG51bGw7XG4gICAgfVxuICAgIGVsc2Uge1xuICAgICAgdGhyb3cgbmV3IEVycm9yKCdcIicgKyBhU291cmNlICsgJ1wiIGlzIG5vdCBpbiB0aGUgU291cmNlTWFwLicpO1xuICAgIH1cbiAgfTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBnZW5lcmF0ZWQgbGluZSBhbmQgY29sdW1uIGluZm9ybWF0aW9uIGZvciB0aGUgb3JpZ2luYWwgc291cmNlLFxuICogbGluZSwgYW5kIGNvbHVtbiBwb3NpdGlvbnMgcHJvdmlkZWQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIGFuIG9iamVjdCB3aXRoXG4gKiB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIGZpbGVuYW1lIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLCBvciBudWxsLlxuICovXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmdlbmVyYXRlZFBvc2l0aW9uRm9yID1cbiAgZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyX2dlbmVyYXRlZFBvc2l0aW9uRm9yKGFBcmdzKSB7XG4gICAgZm9yICh2YXIgaSA9IDA7IGkgPCB0aGlzLl9zZWN0aW9ucy5sZW5ndGg7IGkrKykge1xuICAgICAgdmFyIHNlY3Rpb24gPSB0aGlzLl9zZWN0aW9uc1tpXTtcblxuICAgICAgLy8gT25seSBjb25zaWRlciB0aGlzIHNlY3Rpb24gaWYgdGhlIHJlcXVlc3RlZCBzb3VyY2UgaXMgaW4gdGhlIGxpc3Qgb2ZcbiAgICAgIC8vIHNvdXJjZXMgb2YgdGhlIGNvbnN1bWVyLlxuICAgICAgaWYgKHNlY3Rpb24uY29uc3VtZXIuc291cmNlcy5pbmRleE9mKHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlJykpID09PSAtMSkge1xuICAgICAgICBjb250aW51ZTtcbiAgICAgIH1cbiAgICAgIHZhciBnZW5lcmF0ZWRQb3NpdGlvbiA9IHNlY3Rpb24uY29uc3VtZXIuZ2VuZXJhdGVkUG9zaXRpb25Gb3IoYUFyZ3MpO1xuICAgICAgaWYgKGdlbmVyYXRlZFBvc2l0aW9uKSB7XG4gICAgICAgIHZhciByZXQgPSB7XG4gICAgICAgICAgbGluZTogZ2VuZXJhdGVkUG9zaXRpb24ubGluZSArXG4gICAgICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSAtIDEpLFxuICAgICAgICAgIGNvbHVtbjogZ2VuZXJhdGVkUG9zaXRpb24uY29sdW1uICtcbiAgICAgICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lID09PSBnZW5lcmF0ZWRQb3NpdGlvbi5saW5lXG4gICAgICAgICAgICAgPyBzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRDb2x1bW4gLSAxXG4gICAgICAgICAgICAgOiAwKVxuICAgICAgICB9O1xuICAgICAgICByZXR1cm4gcmV0O1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB7XG4gICAgICBsaW5lOiBudWxsLFxuICAgICAgY29sdW1uOiBudWxsXG4gICAgfTtcbiAgfTtcblxuLyoqXG4gKiBQYXJzZSB0aGUgbWFwcGluZ3MgaW4gYSBzdHJpbmcgaW4gdG8gYSBkYXRhIHN0cnVjdHVyZSB3aGljaCB3ZSBjYW4gZWFzaWx5XG4gKiBxdWVyeSAodGhlIG9yZGVyZWQgYXJyYXlzIGluIHRoZSBgdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzYCBhbmRcbiAqIGB0aGlzLl9fb3JpZ2luYWxNYXBwaW5nc2AgcHJvcGVydGllcykuXG4gKi9cbkluZGV4ZWRTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBJbmRleGVkU291cmNlTWFwQ29uc3VtZXJfcGFyc2VNYXBwaW5ncyhhU3RyLCBhU291cmNlUm9vdCkge1xuICAgIHRoaXMuX19nZW5lcmF0ZWRNYXBwaW5ncyA9IFtdO1xuICAgIHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzID0gW107XG4gICAgZm9yICh2YXIgaSA9IDA7IGkgPCB0aGlzLl9zZWN0aW9ucy5sZW5ndGg7IGkrKykge1xuICAgICAgdmFyIHNlY3Rpb24gPSB0aGlzLl9zZWN0aW9uc1tpXTtcbiAgICAgIHZhciBzZWN0aW9uTWFwcGluZ3MgPSBzZWN0aW9uLmNvbnN1bWVyLl9nZW5lcmF0ZWRNYXBwaW5ncztcbiAgICAgIGZvciAodmFyIGogPSAwOyBqIDwgc2VjdGlvbk1hcHBpbmdzLmxlbmd0aDsgaisrKSB7XG4gICAgICAgIHZhciBtYXBwaW5nID0gc2VjdGlvbk1hcHBpbmdzW2pdO1xuXG4gICAgICAgIHZhciBzb3VyY2UgPSBzZWN0aW9uLmNvbnN1bWVyLl9zb3VyY2VzLmF0KG1hcHBpbmcuc291cmNlKTtcbiAgICAgICAgaWYgKHNlY3Rpb24uY29uc3VtZXIuc291cmNlUm9vdCAhPT0gbnVsbCkge1xuICAgICAgICAgIHNvdXJjZSA9IHV0aWwuam9pbihzZWN0aW9uLmNvbnN1bWVyLnNvdXJjZVJvb3QsIHNvdXJjZSk7XG4gICAgICAgIH1cbiAgICAgICAgdGhpcy5fc291cmNlcy5hZGQoc291cmNlKTtcbiAgICAgICAgc291cmNlID0gdGhpcy5fc291cmNlcy5pbmRleE9mKHNvdXJjZSk7XG5cbiAgICAgICAgdmFyIG5hbWUgPSBzZWN0aW9uLmNvbnN1bWVyLl9uYW1lcy5hdChtYXBwaW5nLm5hbWUpO1xuICAgICAgICB0aGlzLl9uYW1lcy5hZGQobmFtZSk7XG4gICAgICAgIG5hbWUgPSB0aGlzLl9uYW1lcy5pbmRleE9mKG5hbWUpO1xuXG4gICAgICAgIC8vIFRoZSBtYXBwaW5ncyBjb21pbmcgZnJvbSB0aGUgY29uc3VtZXIgZm9yIHRoZSBzZWN0aW9uIGhhdmVcbiAgICAgICAgLy8gZ2VuZXJhdGVkIHBvc2l0aW9ucyByZWxhdGl2ZSB0byB0aGUgc3RhcnQgb2YgdGhlIHNlY3Rpb24sIHNvIHdlXG4gICAgICAgIC8vIG5lZWQgdG8gb2Zmc2V0IHRoZW0gdG8gYmUgcmVsYXRpdmUgdG8gdGhlIHN0YXJ0IG9mIHRoZSBjb25jYXRlbmF0ZWRcbiAgICAgICAgLy8gZ2VuZXJhdGVkIGZpbGUuXG4gICAgICAgIHZhciBhZGp1c3RlZE1hcHBpbmcgPSB7XG4gICAgICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICAgICAgZ2VuZXJhdGVkTGluZTogbWFwcGluZy5nZW5lcmF0ZWRMaW5lICtcbiAgICAgICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICAgICAgZ2VuZXJhdGVkQ29sdW1uOiBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbiArXG4gICAgICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSA9PT0gbWFwcGluZy5nZW5lcmF0ZWRMaW5lXG4gICAgICAgICAgICA/IHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbiAtIDFcbiAgICAgICAgICAgIDogMCksXG4gICAgICAgICAgb3JpZ2luYWxMaW5lOiBtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICBvcmlnaW5hbENvbHVtbjogbWFwcGluZy5vcmlnaW5hbENvbHVtbixcbiAgICAgICAgICBuYW1lOiBuYW1lXG4gICAgICAgIH07XG5cbiAgICAgICAgdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzLnB1c2goYWRqdXN0ZWRNYXBwaW5nKTtcbiAgICAgICAgaWYgKHR5cGVvZiBhZGp1c3RlZE1hcHBpbmcub3JpZ2luYWxMaW5lID09PSAnbnVtYmVyJykge1xuICAgICAgICAgIHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzLnB1c2goYWRqdXN0ZWRNYXBwaW5nKTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cblxuICAgIHF1aWNrU29ydCh0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MsIHV0aWwuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQpO1xuICAgIHF1aWNrU29ydCh0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncywgdXRpbC5jb21wYXJlQnlPcmlnaW5hbFBvc2l0aW9ucyk7XG4gIH07XG5cbmV4cG9ydHMuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyID0gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvc291cmNlLW1hcC1jb25zdW1lci5qc1xuLy8gbW9kdWxlIGlkID0gN1xuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbmV4cG9ydHMuR1JFQVRFU1RfTE9XRVJfQk9VTkQgPSAxO1xuZXhwb3J0cy5MRUFTVF9VUFBFUl9CT1VORCA9IDI7XG5cbi8qKlxuICogUmVjdXJzaXZlIGltcGxlbWVudGF0aW9uIG9mIGJpbmFyeSBzZWFyY2guXG4gKlxuICogQHBhcmFtIGFMb3cgSW5kaWNlcyBoZXJlIGFuZCBsb3dlciBkbyBub3QgY29udGFpbiB0aGUgbmVlZGxlLlxuICogQHBhcmFtIGFIaWdoIEluZGljZXMgaGVyZSBhbmQgaGlnaGVyIGRvIG5vdCBjb250YWluIHRoZSBuZWVkbGUuXG4gKiBAcGFyYW0gYU5lZWRsZSBUaGUgZWxlbWVudCBiZWluZyBzZWFyY2hlZCBmb3IuXG4gKiBAcGFyYW0gYUhheXN0YWNrIFRoZSBub24tZW1wdHkgYXJyYXkgYmVpbmcgc2VhcmNoZWQuXG4gKiBAcGFyYW0gYUNvbXBhcmUgRnVuY3Rpb24gd2hpY2ggdGFrZXMgdHdvIGVsZW1lbnRzIGFuZCByZXR1cm5zIC0xLCAwLCBvciAxLlxuICogQHBhcmFtIGFCaWFzIEVpdGhlciAnYmluYXJ5U2VhcmNoLkdSRUFURVNUX0xPV0VSX0JPVU5EJyBvclxuICogICAgICdiaW5hcnlTZWFyY2guTEVBU1RfVVBQRVJfQk9VTkQnLiBTcGVjaWZpZXMgd2hldGhlciB0byByZXR1cm4gdGhlXG4gKiAgICAgY2xvc2VzdCBlbGVtZW50IHRoYXQgaXMgc21hbGxlciB0aGFuIG9yIGdyZWF0ZXIgdGhhbiB0aGUgb25lIHdlIGFyZVxuICogICAgIHNlYXJjaGluZyBmb3IsIHJlc3BlY3RpdmVseSwgaWYgdGhlIGV4YWN0IGVsZW1lbnQgY2Fubm90IGJlIGZvdW5kLlxuICovXG5mdW5jdGlvbiByZWN1cnNpdmVTZWFyY2goYUxvdywgYUhpZ2gsIGFOZWVkbGUsIGFIYXlzdGFjaywgYUNvbXBhcmUsIGFCaWFzKSB7XG4gIC8vIFRoaXMgZnVuY3Rpb24gdGVybWluYXRlcyB3aGVuIG9uZSBvZiB0aGUgZm9sbG93aW5nIGlzIHRydWU6XG4gIC8vXG4gIC8vICAgMS4gV2UgZmluZCB0aGUgZXhhY3QgZWxlbWVudCB3ZSBhcmUgbG9va2luZyBmb3IuXG4gIC8vXG4gIC8vICAgMi4gV2UgZGlkIG5vdCBmaW5kIHRoZSBleGFjdCBlbGVtZW50LCBidXQgd2UgY2FuIHJldHVybiB0aGUgaW5kZXggb2ZcbiAgLy8gICAgICB0aGUgbmV4dC1jbG9zZXN0IGVsZW1lbnQuXG4gIC8vXG4gIC8vICAgMy4gV2UgZGlkIG5vdCBmaW5kIHRoZSBleGFjdCBlbGVtZW50LCBhbmQgdGhlcmUgaXMgbm8gbmV4dC1jbG9zZXN0XG4gIC8vICAgICAgZWxlbWVudCB0aGFuIHRoZSBvbmUgd2UgYXJlIHNlYXJjaGluZyBmb3IsIHNvIHdlIHJldHVybiAtMS5cbiAgdmFyIG1pZCA9IE1hdGguZmxvb3IoKGFIaWdoIC0gYUxvdykgLyAyKSArIGFMb3c7XG4gIHZhciBjbXAgPSBhQ29tcGFyZShhTmVlZGxlLCBhSGF5c3RhY2tbbWlkXSwgdHJ1ZSk7XG4gIGlmIChjbXAgPT09IDApIHtcbiAgICAvLyBGb3VuZCB0aGUgZWxlbWVudCB3ZSBhcmUgbG9va2luZyBmb3IuXG4gICAgcmV0dXJuIG1pZDtcbiAgfVxuICBlbHNlIGlmIChjbXAgPiAwKSB7XG4gICAgLy8gT3VyIG5lZWRsZSBpcyBncmVhdGVyIHRoYW4gYUhheXN0YWNrW21pZF0uXG4gICAgaWYgKGFIaWdoIC0gbWlkID4gMSkge1xuICAgICAgLy8gVGhlIGVsZW1lbnQgaXMgaW4gdGhlIHVwcGVyIGhhbGYuXG4gICAgICByZXR1cm4gcmVjdXJzaXZlU2VhcmNoKG1pZCwgYUhpZ2gsIGFOZWVkbGUsIGFIYXlzdGFjaywgYUNvbXBhcmUsIGFCaWFzKTtcbiAgICB9XG5cbiAgICAvLyBUaGUgZXhhY3QgbmVlZGxlIGVsZW1lbnQgd2FzIG5vdCBmb3VuZCBpbiB0aGlzIGhheXN0YWNrLiBEZXRlcm1pbmUgaWZcbiAgICAvLyB3ZSBhcmUgaW4gdGVybWluYXRpb24gY2FzZSAoMykgb3IgKDIpIGFuZCByZXR1cm4gdGhlIGFwcHJvcHJpYXRlIHRoaW5nLlxuICAgIGlmIChhQmlhcyA9PSBleHBvcnRzLkxFQVNUX1VQUEVSX0JPVU5EKSB7XG4gICAgICByZXR1cm4gYUhpZ2ggPCBhSGF5c3RhY2subGVuZ3RoID8gYUhpZ2ggOiAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgcmV0dXJuIG1pZDtcbiAgICB9XG4gIH1cbiAgZWxzZSB7XG4gICAgLy8gT3VyIG5lZWRsZSBpcyBsZXNzIHRoYW4gYUhheXN0YWNrW21pZF0uXG4gICAgaWYgKG1pZCAtIGFMb3cgPiAxKSB7XG4gICAgICAvLyBUaGUgZWxlbWVudCBpcyBpbiB0aGUgbG93ZXIgaGFsZi5cbiAgICAgIHJldHVybiByZWN1cnNpdmVTZWFyY2goYUxvdywgbWlkLCBhTmVlZGxlLCBhSGF5c3RhY2ssIGFDb21wYXJlLCBhQmlhcyk7XG4gICAgfVxuXG4gICAgLy8gd2UgYXJlIGluIHRlcm1pbmF0aW9uIGNhc2UgKDMpIG9yICgyKSBhbmQgcmV0dXJuIHRoZSBhcHByb3ByaWF0ZSB0aGluZy5cbiAgICBpZiAoYUJpYXMgPT0gZXhwb3J0cy5MRUFTVF9VUFBFUl9CT1VORCkge1xuICAgICAgcmV0dXJuIG1pZDtcbiAgICB9IGVsc2Uge1xuICAgICAgcmV0dXJuIGFMb3cgPCAwID8gLTEgOiBhTG93O1xuICAgIH1cbiAgfVxufVxuXG4vKipcbiAqIFRoaXMgaXMgYW4gaW1wbGVtZW50YXRpb24gb2YgYmluYXJ5IHNlYXJjaCB3aGljaCB3aWxsIGFsd2F5cyB0cnkgYW5kIHJldHVyblxuICogdGhlIGluZGV4IG9mIHRoZSBjbG9zZXN0IGVsZW1lbnQgaWYgdGhlcmUgaXMgbm8gZXhhY3QgaGl0LiBUaGlzIGlzIGJlY2F1c2VcbiAqIG1hcHBpbmdzIGJldHdlZW4gb3JpZ2luYWwgYW5kIGdlbmVyYXRlZCBsaW5lL2NvbCBwYWlycyBhcmUgc2luZ2xlIHBvaW50cyxcbiAqIGFuZCB0aGVyZSBpcyBhbiBpbXBsaWNpdCByZWdpb24gYmV0d2VlbiBlYWNoIG9mIHRoZW0sIHNvIGEgbWlzcyBqdXN0IG1lYW5zXG4gKiB0aGF0IHlvdSBhcmVuJ3Qgb24gdGhlIHZlcnkgc3RhcnQgb2YgYSByZWdpb24uXG4gKlxuICogQHBhcmFtIGFOZWVkbGUgVGhlIGVsZW1lbnQgeW91IGFyZSBsb29raW5nIGZvci5cbiAqIEBwYXJhbSBhSGF5c3RhY2sgVGhlIGFycmF5IHRoYXQgaXMgYmVpbmcgc2VhcmNoZWQuXG4gKiBAcGFyYW0gYUNvbXBhcmUgQSBmdW5jdGlvbiB3aGljaCB0YWtlcyB0aGUgbmVlZGxlIGFuZCBhbiBlbGVtZW50IGluIHRoZVxuICogICAgIGFycmF5IGFuZCByZXR1cm5zIC0xLCAwLCBvciAxIGRlcGVuZGluZyBvbiB3aGV0aGVyIHRoZSBuZWVkbGUgaXMgbGVzc1xuICogICAgIHRoYW4sIGVxdWFsIHRvLCBvciBncmVhdGVyIHRoYW4gdGhlIGVsZW1lbnQsIHJlc3BlY3RpdmVseS5cbiAqIEBwYXJhbSBhQmlhcyBFaXRoZXIgJ2JpbmFyeVNlYXJjaC5HUkVBVEVTVF9MT1dFUl9CT1VORCcgb3JcbiAqICAgICAnYmluYXJ5U2VhcmNoLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnYmluYXJ5U2VhcmNoLkdSRUFURVNUX0xPV0VSX0JPVU5EJy5cbiAqL1xuZXhwb3J0cy5zZWFyY2ggPSBmdW5jdGlvbiBzZWFyY2goYU5lZWRsZSwgYUhheXN0YWNrLCBhQ29tcGFyZSwgYUJpYXMpIHtcbiAgaWYgKGFIYXlzdGFjay5sZW5ndGggPT09IDApIHtcbiAgICByZXR1cm4gLTE7XG4gIH1cblxuICB2YXIgaW5kZXggPSByZWN1cnNpdmVTZWFyY2goLTEsIGFIYXlzdGFjay5sZW5ndGgsIGFOZWVkbGUsIGFIYXlzdGFjayxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGFDb21wYXJlLCBhQmlhcyB8fCBleHBvcnRzLkdSRUFURVNUX0xPV0VSX0JPVU5EKTtcbiAgaWYgKGluZGV4IDwgMCkge1xuICAgIHJldHVybiAtMTtcbiAgfVxuXG4gIC8vIFdlIGhhdmUgZm91bmQgZWl0aGVyIHRoZSBleGFjdCBlbGVtZW50LCBvciB0aGUgbmV4dC1jbG9zZXN0IGVsZW1lbnQgdGhhblxuICAvLyB0aGUgb25lIHdlIGFyZSBzZWFyY2hpbmcgZm9yLiBIb3dldmVyLCB0aGVyZSBtYXkgYmUgbW9yZSB0aGFuIG9uZSBzdWNoXG4gIC8vIGVsZW1lbnQuIE1ha2Ugc3VyZSB3ZSBhbHdheXMgcmV0dXJuIHRoZSBzbWFsbGVzdCBvZiB0aGVzZS5cbiAgd2hpbGUgKGluZGV4IC0gMSA+PSAwKSB7XG4gICAgaWYgKGFDb21wYXJlKGFIYXlzdGFja1tpbmRleF0sIGFIYXlzdGFja1tpbmRleCAtIDFdLCB0cnVlKSAhPT0gMCkge1xuICAgICAgYnJlYWs7XG4gICAgfVxuICAgIC0taW5kZXg7XG4gIH1cblxuICByZXR1cm4gaW5kZXg7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvYmluYXJ5LXNlYXJjaC5qc1xuLy8gbW9kdWxlIGlkID0gOFxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbi8vIEl0IHR1cm5zIG91dCB0aGF0IHNvbWUgKG1vc3Q/KSBKYXZhU2NyaXB0IGVuZ2luZXMgZG9uJ3Qgc2VsZi1ob3N0XG4vLyBgQXJyYXkucHJvdG90eXBlLnNvcnRgLiBUaGlzIG1ha2VzIHNlbnNlIGJlY2F1c2UgQysrIHdpbGwgbGlrZWx5IHJlbWFpblxuLy8gZmFzdGVyIHRoYW4gSlMgd2hlbiBkb2luZyByYXcgQ1BVLWludGVuc2l2ZSBzb3J0aW5nLiBIb3dldmVyLCB3aGVuIHVzaW5nIGFcbi8vIGN1c3RvbSBjb21wYXJhdG9yIGZ1bmN0aW9uLCBjYWxsaW5nIGJhY2sgYW5kIGZvcnRoIGJldHdlZW4gdGhlIFZNJ3MgQysrIGFuZFxuLy8gSklUJ2QgSlMgaXMgcmF0aGVyIHNsb3cgKmFuZCogbG9zZXMgSklUIHR5cGUgaW5mb3JtYXRpb24sIHJlc3VsdGluZyBpblxuLy8gd29yc2UgZ2VuZXJhdGVkIGNvZGUgZm9yIHRoZSBjb21wYXJhdG9yIGZ1bmN0aW9uIHRoYW4gd291bGQgYmUgb3B0aW1hbC4gSW5cbi8vIGZhY3QsIHdoZW4gc29ydGluZyB3aXRoIGEgY29tcGFyYXRvciwgdGhlc2UgY29zdHMgb3V0d2VpZ2ggdGhlIGJlbmVmaXRzIG9mXG4vLyBzb3J0aW5nIGluIEMrKy4gQnkgdXNpbmcgb3VyIG93biBKUy1pbXBsZW1lbnRlZCBRdWljayBTb3J0IChiZWxvdyksIHdlIGdldFxuLy8gYSB+MzUwMG1zIG1lYW4gc3BlZWQtdXAgaW4gYGJlbmNoL2JlbmNoLmh0bWxgLlxuXG4vKipcbiAqIFN3YXAgdGhlIGVsZW1lbnRzIGluZGV4ZWQgYnkgYHhgIGFuZCBgeWAgaW4gdGhlIGFycmF5IGBhcnlgLlxuICpcbiAqIEBwYXJhbSB7QXJyYXl9IGFyeVxuICogICAgICAgIFRoZSBhcnJheS5cbiAqIEBwYXJhbSB7TnVtYmVyfSB4XG4gKiAgICAgICAgVGhlIGluZGV4IG9mIHRoZSBmaXJzdCBpdGVtLlxuICogQHBhcmFtIHtOdW1iZXJ9IHlcbiAqICAgICAgICBUaGUgaW5kZXggb2YgdGhlIHNlY29uZCBpdGVtLlxuICovXG5mdW5jdGlvbiBzd2FwKGFyeSwgeCwgeSkge1xuICB2YXIgdGVtcCA9IGFyeVt4XTtcbiAgYXJ5W3hdID0gYXJ5W3ldO1xuICBhcnlbeV0gPSB0ZW1wO1xufVxuXG4vKipcbiAqIFJldHVybnMgYSByYW5kb20gaW50ZWdlciB3aXRoaW4gdGhlIHJhbmdlIGBsb3cgLi4gaGlnaGAgaW5jbHVzaXZlLlxuICpcbiAqIEBwYXJhbSB7TnVtYmVyfSBsb3dcbiAqICAgICAgICBUaGUgbG93ZXIgYm91bmQgb24gdGhlIHJhbmdlLlxuICogQHBhcmFtIHtOdW1iZXJ9IGhpZ2hcbiAqICAgICAgICBUaGUgdXBwZXIgYm91bmQgb24gdGhlIHJhbmdlLlxuICovXG5mdW5jdGlvbiByYW5kb21JbnRJblJhbmdlKGxvdywgaGlnaCkge1xuICByZXR1cm4gTWF0aC5yb3VuZChsb3cgKyAoTWF0aC5yYW5kb20oKSAqIChoaWdoIC0gbG93KSkpO1xufVxuXG4vKipcbiAqIFRoZSBRdWljayBTb3J0IGFsZ29yaXRobS5cbiAqXG4gKiBAcGFyYW0ge0FycmF5fSBhcnlcbiAqICAgICAgICBBbiBhcnJheSB0byBzb3J0LlxuICogQHBhcmFtIHtmdW5jdGlvbn0gY29tcGFyYXRvclxuICogICAgICAgIEZ1bmN0aW9uIHRvIHVzZSB0byBjb21wYXJlIHR3byBpdGVtcy5cbiAqIEBwYXJhbSB7TnVtYmVyfSBwXG4gKiAgICAgICAgU3RhcnQgaW5kZXggb2YgdGhlIGFycmF5XG4gKiBAcGFyYW0ge051bWJlcn0gclxuICogICAgICAgIEVuZCBpbmRleCBvZiB0aGUgYXJyYXlcbiAqL1xuZnVuY3Rpb24gZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBwLCByKSB7XG4gIC8vIElmIG91ciBsb3dlciBib3VuZCBpcyBsZXNzIHRoYW4gb3VyIHVwcGVyIGJvdW5kLCB3ZSAoMSkgcGFydGl0aW9uIHRoZVxuICAvLyBhcnJheSBpbnRvIHR3byBwaWVjZXMgYW5kICgyKSByZWN1cnNlIG9uIGVhY2ggaGFsZi4gSWYgaXQgaXMgbm90LCB0aGlzIGlzXG4gIC8vIHRoZSBlbXB0eSBhcnJheSBhbmQgb3VyIGJhc2UgY2FzZS5cblxuICBpZiAocCA8IHIpIHtcbiAgICAvLyAoMSkgUGFydGl0aW9uaW5nLlxuICAgIC8vXG4gICAgLy8gVGhlIHBhcnRpdGlvbmluZyBjaG9vc2VzIGEgcGl2b3QgYmV0d2VlbiBgcGAgYW5kIGByYCBhbmQgbW92ZXMgYWxsXG4gICAgLy8gZWxlbWVudHMgdGhhdCBhcmUgbGVzcyB0aGFuIG9yIGVxdWFsIHRvIHRoZSBwaXZvdCB0byB0aGUgYmVmb3JlIGl0LCBhbmRcbiAgICAvLyBhbGwgdGhlIGVsZW1lbnRzIHRoYXQgYXJlIGdyZWF0ZXIgdGhhbiBpdCBhZnRlciBpdC4gVGhlIGVmZmVjdCBpcyB0aGF0XG4gICAgLy8gb25jZSBwYXJ0aXRpb24gaXMgZG9uZSwgdGhlIHBpdm90IGlzIGluIHRoZSBleGFjdCBwbGFjZSBpdCB3aWxsIGJlIHdoZW5cbiAgICAvLyB0aGUgYXJyYXkgaXMgcHV0IGluIHNvcnRlZCBvcmRlciwgYW5kIGl0IHdpbGwgbm90IG5lZWQgdG8gYmUgbW92ZWRcbiAgICAvLyBhZ2Fpbi4gVGhpcyBydW5zIGluIE8obikgdGltZS5cblxuICAgIC8vIEFsd2F5cyBjaG9vc2UgYSByYW5kb20gcGl2b3Qgc28gdGhhdCBhbiBpbnB1dCBhcnJheSB3aGljaCBpcyByZXZlcnNlXG4gICAgLy8gc29ydGVkIGRvZXMgbm90IGNhdXNlIE8obl4yKSBydW5uaW5nIHRpbWUuXG4gICAgdmFyIHBpdm90SW5kZXggPSByYW5kb21JbnRJblJhbmdlKHAsIHIpO1xuICAgIHZhciBpID0gcCAtIDE7XG5cbiAgICBzd2FwKGFyeSwgcGl2b3RJbmRleCwgcik7XG4gICAgdmFyIHBpdm90ID0gYXJ5W3JdO1xuXG4gICAgLy8gSW1tZWRpYXRlbHkgYWZ0ZXIgYGpgIGlzIGluY3JlbWVudGVkIGluIHRoaXMgbG9vcCwgdGhlIGZvbGxvd2luZyBob2xkXG4gICAgLy8gdHJ1ZTpcbiAgICAvL1xuICAgIC8vICAgKiBFdmVyeSBlbGVtZW50IGluIGBhcnlbcCAuLiBpXWAgaXMgbGVzcyB0aGFuIG9yIGVxdWFsIHRvIHRoZSBwaXZvdC5cbiAgICAvL1xuICAgIC8vICAgKiBFdmVyeSBlbGVtZW50IGluIGBhcnlbaSsxIC4uIGotMV1gIGlzIGdyZWF0ZXIgdGhhbiB0aGUgcGl2b3QuXG4gICAgZm9yICh2YXIgaiA9IHA7IGogPCByOyBqKyspIHtcbiAgICAgIGlmIChjb21wYXJhdG9yKGFyeVtqXSwgcGl2b3QpIDw9IDApIHtcbiAgICAgICAgaSArPSAxO1xuICAgICAgICBzd2FwKGFyeSwgaSwgaik7XG4gICAgICB9XG4gICAgfVxuXG4gICAgc3dhcChhcnksIGkgKyAxLCBqKTtcbiAgICB2YXIgcSA9IGkgKyAxO1xuXG4gICAgLy8gKDIpIFJlY3Vyc2Ugb24gZWFjaCBoYWxmLlxuXG4gICAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBwLCBxIC0gMSk7XG4gICAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBxICsgMSwgcik7XG4gIH1cbn1cblxuLyoqXG4gKiBTb3J0IHRoZSBnaXZlbiBhcnJheSBpbi1wbGFjZSB3aXRoIHRoZSBnaXZlbiBjb21wYXJhdG9yIGZ1bmN0aW9uLlxuICpcbiAqIEBwYXJhbSB7QXJyYXl9IGFyeVxuICogICAgICAgIEFuIGFycmF5IHRvIHNvcnQuXG4gKiBAcGFyYW0ge2Z1bmN0aW9ufSBjb21wYXJhdG9yXG4gKiAgICAgICAgRnVuY3Rpb24gdG8gdXNlIHRvIGNvbXBhcmUgdHdvIGl0ZW1zLlxuICovXG5leHBvcnRzLnF1aWNrU29ydCA9IGZ1bmN0aW9uIChhcnksIGNvbXBhcmF0b3IpIHtcbiAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCAwLCBhcnkubGVuZ3RoIC0gMSk7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvcXVpY2stc29ydC5qc1xuLy8gbW9kdWxlIGlkID0gOVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciBTb3VyY2VNYXBHZW5lcmF0b3IgPSByZXF1aXJlKCcuL3NvdXJjZS1tYXAtZ2VuZXJhdG9yJykuU291cmNlTWFwR2VuZXJhdG9yO1xudmFyIHV0aWwgPSByZXF1aXJlKCcuL3V0aWwnKTtcblxuLy8gTWF0Y2hlcyBhIFdpbmRvd3Mtc3R5bGUgYFxcclxcbmAgbmV3bGluZSBvciBhIGBcXG5gIG5ld2xpbmUgdXNlZCBieSBhbGwgb3RoZXJcbi8vIG9wZXJhdGluZyBzeXN0ZW1zIHRoZXNlIGRheXMgKGNhcHR1cmluZyB0aGUgcmVzdWx0KS5cbnZhciBSRUdFWF9ORVdMSU5FID0gLyhcXHI/XFxuKS87XG5cbi8vIE5ld2xpbmUgY2hhcmFjdGVyIGNvZGUgZm9yIGNoYXJDb2RlQXQoKSBjb21wYXJpc29uc1xudmFyIE5FV0xJTkVfQ09ERSA9IDEwO1xuXG4vLyBQcml2YXRlIHN5bWJvbCBmb3IgaWRlbnRpZnlpbmcgYFNvdXJjZU5vZGVgcyB3aGVuIG11bHRpcGxlIHZlcnNpb25zIG9mXG4vLyB0aGUgc291cmNlLW1hcCBsaWJyYXJ5IGFyZSBsb2FkZWQuIFRoaXMgTVVTVCBOT1QgQ0hBTkdFIGFjcm9zc1xuLy8gdmVyc2lvbnMhXG52YXIgaXNTb3VyY2VOb2RlID0gXCIkJCRpc1NvdXJjZU5vZGUkJCRcIjtcblxuLyoqXG4gKiBTb3VyY2VOb2RlcyBwcm92aWRlIGEgd2F5IHRvIGFic3RyYWN0IG92ZXIgaW50ZXJwb2xhdGluZy9jb25jYXRlbmF0aW5nXG4gKiBzbmlwcGV0cyBvZiBnZW5lcmF0ZWQgSmF2YVNjcmlwdCBzb3VyY2UgY29kZSB3aGlsZSBtYWludGFpbmluZyB0aGUgbGluZSBhbmRcbiAqIGNvbHVtbiBpbmZvcm1hdGlvbiBhc3NvY2lhdGVkIHdpdGggdGhlIG9yaWdpbmFsIHNvdXJjZSBjb2RlLlxuICpcbiAqIEBwYXJhbSBhTGluZSBUaGUgb3JpZ2luYWwgbGluZSBudW1iZXIuXG4gKiBAcGFyYW0gYUNvbHVtbiBUaGUgb3JpZ2luYWwgY29sdW1uIG51bWJlci5cbiAqIEBwYXJhbSBhU291cmNlIFRoZSBvcmlnaW5hbCBzb3VyY2UncyBmaWxlbmFtZS5cbiAqIEBwYXJhbSBhQ2h1bmtzIE9wdGlvbmFsLiBBbiBhcnJheSBvZiBzdHJpbmdzIHdoaWNoIGFyZSBzbmlwcGV0cyBvZlxuICogICAgICAgIGdlbmVyYXRlZCBKUywgb3Igb3RoZXIgU291cmNlTm9kZXMuXG4gKiBAcGFyYW0gYU5hbWUgVGhlIG9yaWdpbmFsIGlkZW50aWZpZXIuXG4gKi9cbmZ1bmN0aW9uIFNvdXJjZU5vZGUoYUxpbmUsIGFDb2x1bW4sIGFTb3VyY2UsIGFDaHVua3MsIGFOYW1lKSB7XG4gIHRoaXMuY2hpbGRyZW4gPSBbXTtcbiAgdGhpcy5zb3VyY2VDb250ZW50cyA9IHt9O1xuICB0aGlzLmxpbmUgPSBhTGluZSA9PSBudWxsID8gbnVsbCA6IGFMaW5lO1xuICB0aGlzLmNvbHVtbiA9IGFDb2x1bW4gPT0gbnVsbCA/IG51bGwgOiBhQ29sdW1uO1xuICB0aGlzLnNvdXJjZSA9IGFTb3VyY2UgPT0gbnVsbCA/IG51bGwgOiBhU291cmNlO1xuICB0aGlzLm5hbWUgPSBhTmFtZSA9PSBudWxsID8gbnVsbCA6IGFOYW1lO1xuICB0aGlzW2lzU291cmNlTm9kZV0gPSB0cnVlO1xuICBpZiAoYUNodW5rcyAhPSBudWxsKSB0aGlzLmFkZChhQ2h1bmtzKTtcbn1cblxuLyoqXG4gKiBDcmVhdGVzIGEgU291cmNlTm9kZSBmcm9tIGdlbmVyYXRlZCBjb2RlIGFuZCBhIFNvdXJjZU1hcENvbnN1bWVyLlxuICpcbiAqIEBwYXJhbSBhR2VuZXJhdGVkQ29kZSBUaGUgZ2VuZXJhdGVkIGNvZGVcbiAqIEBwYXJhbSBhU291cmNlTWFwQ29uc3VtZXIgVGhlIFNvdXJjZU1hcCBmb3IgdGhlIGdlbmVyYXRlZCBjb2RlXG4gKiBAcGFyYW0gYVJlbGF0aXZlUGF0aCBPcHRpb25hbC4gVGhlIHBhdGggdGhhdCByZWxhdGl2ZSBzb3VyY2VzIGluIHRoZVxuICogICAgICAgIFNvdXJjZU1hcENvbnN1bWVyIHNob3VsZCBiZSByZWxhdGl2ZSB0by5cbiAqL1xuU291cmNlTm9kZS5mcm9tU3RyaW5nV2l0aFNvdXJjZU1hcCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU5vZGVfZnJvbVN0cmluZ1dpdGhTb3VyY2VNYXAoYUdlbmVyYXRlZENvZGUsIGFTb3VyY2VNYXBDb25zdW1lciwgYVJlbGF0aXZlUGF0aCkge1xuICAgIC8vIFRoZSBTb3VyY2VOb2RlIHdlIHdhbnQgdG8gZmlsbCB3aXRoIHRoZSBnZW5lcmF0ZWQgY29kZVxuICAgIC8vIGFuZCB0aGUgU291cmNlTWFwXG4gICAgdmFyIG5vZGUgPSBuZXcgU291cmNlTm9kZSgpO1xuXG4gICAgLy8gQWxsIGV2ZW4gaW5kaWNlcyBvZiB0aGlzIGFycmF5IGFyZSBvbmUgbGluZSBvZiB0aGUgZ2VuZXJhdGVkIGNvZGUsXG4gICAgLy8gd2hpbGUgYWxsIG9kZCBpbmRpY2VzIGFyZSB0aGUgbmV3bGluZXMgYmV0d2VlbiB0d28gYWRqYWNlbnQgbGluZXNcbiAgICAvLyAoc2luY2UgYFJFR0VYX05FV0xJTkVgIGNhcHR1cmVzIGl0cyBtYXRjaCkuXG4gICAgLy8gUHJvY2Vzc2VkIGZyYWdtZW50cyBhcmUgYWNjZXNzZWQgYnkgY2FsbGluZyBgc2hpZnROZXh0TGluZWAuXG4gICAgdmFyIHJlbWFpbmluZ0xpbmVzID0gYUdlbmVyYXRlZENvZGUuc3BsaXQoUkVHRVhfTkVXTElORSk7XG4gICAgdmFyIHJlbWFpbmluZ0xpbmVzSW5kZXggPSAwO1xuICAgIHZhciBzaGlmdE5leHRMaW5lID0gZnVuY3Rpb24oKSB7XG4gICAgICB2YXIgbGluZUNvbnRlbnRzID0gZ2V0TmV4dExpbmUoKTtcbiAgICAgIC8vIFRoZSBsYXN0IGxpbmUgb2YgYSBmaWxlIG1pZ2h0IG5vdCBoYXZlIGEgbmV3bGluZS5cbiAgICAgIHZhciBuZXdMaW5lID0gZ2V0TmV4dExpbmUoKSB8fCBcIlwiO1xuICAgICAgcmV0dXJuIGxpbmVDb250ZW50cyArIG5ld0xpbmU7XG5cbiAgICAgIGZ1bmN0aW9uIGdldE5leHRMaW5lKCkge1xuICAgICAgICByZXR1cm4gcmVtYWluaW5nTGluZXNJbmRleCA8IHJlbWFpbmluZ0xpbmVzLmxlbmd0aCA/XG4gICAgICAgICAgICByZW1haW5pbmdMaW5lc1tyZW1haW5pbmdMaW5lc0luZGV4KytdIDogdW5kZWZpbmVkO1xuICAgICAgfVxuICAgIH07XG5cbiAgICAvLyBXZSBuZWVkIHRvIHJlbWVtYmVyIHRoZSBwb3NpdGlvbiBvZiBcInJlbWFpbmluZ0xpbmVzXCJcbiAgICB2YXIgbGFzdEdlbmVyYXRlZExpbmUgPSAxLCBsYXN0R2VuZXJhdGVkQ29sdW1uID0gMDtcblxuICAgIC8vIFRoZSBnZW5lcmF0ZSBTb3VyY2VOb2RlcyB3ZSBuZWVkIGEgY29kZSByYW5nZS5cbiAgICAvLyBUbyBleHRyYWN0IGl0IGN1cnJlbnQgYW5kIGxhc3QgbWFwcGluZyBpcyB1c2VkLlxuICAgIC8vIEhlcmUgd2Ugc3RvcmUgdGhlIGxhc3QgbWFwcGluZy5cbiAgICB2YXIgbGFzdE1hcHBpbmcgPSBudWxsO1xuXG4gICAgYVNvdXJjZU1hcENvbnN1bWVyLmVhY2hNYXBwaW5nKGZ1bmN0aW9uIChtYXBwaW5nKSB7XG4gICAgICBpZiAobGFzdE1hcHBpbmcgIT09IG51bGwpIHtcbiAgICAgICAgLy8gV2UgYWRkIHRoZSBjb2RlIGZyb20gXCJsYXN0TWFwcGluZ1wiIHRvIFwibWFwcGluZ1wiOlxuICAgICAgICAvLyBGaXJzdCBjaGVjayBpZiB0aGVyZSBpcyBhIG5ldyBsaW5lIGluIGJldHdlZW4uXG4gICAgICAgIGlmIChsYXN0R2VuZXJhdGVkTGluZSA8IG1hcHBpbmcuZ2VuZXJhdGVkTGluZSkge1xuICAgICAgICAgIC8vIEFzc29jaWF0ZSBmaXJzdCBsaW5lIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgICAgYWRkTWFwcGluZ1dpdGhDb2RlKGxhc3RNYXBwaW5nLCBzaGlmdE5leHRMaW5lKCkpO1xuICAgICAgICAgIGxhc3RHZW5lcmF0ZWRMaW5lKys7XG4gICAgICAgICAgbGFzdEdlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgICAgICAgLy8gVGhlIHJlbWFpbmluZyBjb2RlIGlzIGFkZGVkIHdpdGhvdXQgbWFwcGluZ1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIFRoZXJlIGlzIG5vIG5ldyBsaW5lIGluIGJldHdlZW4uXG4gICAgICAgICAgLy8gQXNzb2NpYXRlIHRoZSBjb2RlIGJldHdlZW4gXCJsYXN0R2VuZXJhdGVkQ29sdW1uXCIgYW5kXG4gICAgICAgICAgLy8gXCJtYXBwaW5nLmdlbmVyYXRlZENvbHVtblwiIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgICAgdmFyIG5leHRMaW5lID0gcmVtYWluaW5nTGluZXNbcmVtYWluaW5nTGluZXNJbmRleF07XG4gICAgICAgICAgdmFyIGNvZGUgPSBuZXh0TGluZS5zdWJzdHIoMCwgbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4gLVxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGxhc3RHZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgICAgIHJlbWFpbmluZ0xpbmVzW3JlbWFpbmluZ0xpbmVzSW5kZXhdID0gbmV4dExpbmUuc3Vic3RyKG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uIC1cbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uKTtcbiAgICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uID0gbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW47XG4gICAgICAgICAgYWRkTWFwcGluZ1dpdGhDb2RlKGxhc3RNYXBwaW5nLCBjb2RlKTtcbiAgICAgICAgICAvLyBObyBtb3JlIHJlbWFpbmluZyBjb2RlLCBjb250aW51ZVxuICAgICAgICAgIGxhc3RNYXBwaW5nID0gbWFwcGluZztcbiAgICAgICAgICByZXR1cm47XG4gICAgICAgIH1cbiAgICAgIH1cbiAgICAgIC8vIFdlIGFkZCB0aGUgZ2VuZXJhdGVkIGNvZGUgdW50aWwgdGhlIGZpcnN0IG1hcHBpbmdcbiAgICAgIC8vIHRvIHRoZSBTb3VyY2VOb2RlIHdpdGhvdXQgYW55IG1hcHBpbmcuXG4gICAgICAvLyBFYWNoIGxpbmUgaXMgYWRkZWQgYXMgc2VwYXJhdGUgc3RyaW5nLlxuICAgICAgd2hpbGUgKGxhc3RHZW5lcmF0ZWRMaW5lIDwgbWFwcGluZy5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgIG5vZGUuYWRkKHNoaWZ0TmV4dExpbmUoKSk7XG4gICAgICAgIGxhc3RHZW5lcmF0ZWRMaW5lKys7XG4gICAgICB9XG4gICAgICBpZiAobGFzdEdlbmVyYXRlZENvbHVtbiA8IG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uKSB7XG4gICAgICAgIHZhciBuZXh0TGluZSA9IHJlbWFpbmluZ0xpbmVzW3JlbWFpbmluZ0xpbmVzSW5kZXhdO1xuICAgICAgICBub2RlLmFkZChuZXh0TGluZS5zdWJzdHIoMCwgbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4pKTtcbiAgICAgICAgcmVtYWluaW5nTGluZXNbcmVtYWluaW5nTGluZXNJbmRleF0gPSBuZXh0TGluZS5zdWJzdHIobWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uID0gbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW47XG4gICAgICB9XG4gICAgICBsYXN0TWFwcGluZyA9IG1hcHBpbmc7XG4gICAgfSwgdGhpcyk7XG4gICAgLy8gV2UgaGF2ZSBwcm9jZXNzZWQgYWxsIG1hcHBpbmdzLlxuICAgIGlmIChyZW1haW5pbmdMaW5lc0luZGV4IDwgcmVtYWluaW5nTGluZXMubGVuZ3RoKSB7XG4gICAgICBpZiAobGFzdE1hcHBpbmcpIHtcbiAgICAgICAgLy8gQXNzb2NpYXRlIHRoZSByZW1haW5pbmcgY29kZSBpbiB0aGUgY3VycmVudCBsaW5lIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgIGFkZE1hcHBpbmdXaXRoQ29kZShsYXN0TWFwcGluZywgc2hpZnROZXh0TGluZSgpKTtcbiAgICAgIH1cbiAgICAgIC8vIGFuZCBhZGQgdGhlIHJlbWFpbmluZyBsaW5lcyB3aXRob3V0IGFueSBtYXBwaW5nXG4gICAgICBub2RlLmFkZChyZW1haW5pbmdMaW5lcy5zcGxpY2UocmVtYWluaW5nTGluZXNJbmRleCkuam9pbihcIlwiKSk7XG4gICAgfVxuXG4gICAgLy8gQ29weSBzb3VyY2VzQ29udGVudCBpbnRvIFNvdXJjZU5vZGVcbiAgICBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlcy5mb3JFYWNoKGZ1bmN0aW9uIChzb3VyY2VGaWxlKSB7XG4gICAgICB2YXIgY29udGVudCA9IGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKHNvdXJjZUZpbGUpO1xuICAgICAgaWYgKGNvbnRlbnQgIT0gbnVsbCkge1xuICAgICAgICBpZiAoYVJlbGF0aXZlUGF0aCAhPSBudWxsKSB7XG4gICAgICAgICAgc291cmNlRmlsZSA9IHV0aWwuam9pbihhUmVsYXRpdmVQYXRoLCBzb3VyY2VGaWxlKTtcbiAgICAgICAgfVxuICAgICAgICBub2RlLnNldFNvdXJjZUNvbnRlbnQoc291cmNlRmlsZSwgY29udGVudCk7XG4gICAgICB9XG4gICAgfSk7XG5cbiAgICByZXR1cm4gbm9kZTtcblxuICAgIGZ1bmN0aW9uIGFkZE1hcHBpbmdXaXRoQ29kZShtYXBwaW5nLCBjb2RlKSB7XG4gICAgICBpZiAobWFwcGluZyA9PT0gbnVsbCB8fCBtYXBwaW5nLnNvdXJjZSA9PT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIG5vZGUuYWRkKGNvZGUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgdmFyIHNvdXJjZSA9IGFSZWxhdGl2ZVBhdGhcbiAgICAgICAgICA/IHV0aWwuam9pbihhUmVsYXRpdmVQYXRoLCBtYXBwaW5nLnNvdXJjZSlcbiAgICAgICAgICA6IG1hcHBpbmcuc291cmNlO1xuICAgICAgICBub2RlLmFkZChuZXcgU291cmNlTm9kZShtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgbWFwcGluZy5vcmlnaW5hbENvbHVtbixcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgc291cmNlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBjb2RlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBtYXBwaW5nLm5hbWUpKTtcbiAgICAgIH1cbiAgICB9XG4gIH07XG5cbi8qKlxuICogQWRkIGEgY2h1bmsgb2YgZ2VuZXJhdGVkIEpTIHRvIHRoaXMgc291cmNlIG5vZGUuXG4gKlxuICogQHBhcmFtIGFDaHVuayBBIHN0cmluZyBzbmlwcGV0IG9mIGdlbmVyYXRlZCBKUyBjb2RlLCBhbm90aGVyIGluc3RhbmNlIG9mXG4gKiAgICAgICAgU291cmNlTm9kZSwgb3IgYW4gYXJyYXkgd2hlcmUgZWFjaCBtZW1iZXIgaXMgb25lIG9mIHRob3NlIHRoaW5ncy5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUuYWRkID0gZnVuY3Rpb24gU291cmNlTm9kZV9hZGQoYUNodW5rKSB7XG4gIGlmIChBcnJheS5pc0FycmF5KGFDaHVuaykpIHtcbiAgICBhQ2h1bmsuZm9yRWFjaChmdW5jdGlvbiAoY2h1bmspIHtcbiAgICAgIHRoaXMuYWRkKGNodW5rKTtcbiAgICB9LCB0aGlzKTtcbiAgfVxuICBlbHNlIGlmIChhQ2h1bmtbaXNTb3VyY2VOb2RlXSB8fCB0eXBlb2YgYUNodW5rID09PSBcInN0cmluZ1wiKSB7XG4gICAgaWYgKGFDaHVuaykge1xuICAgICAgdGhpcy5jaGlsZHJlbi5wdXNoKGFDaHVuayk7XG4gICAgfVxuICB9XG4gIGVsc2Uge1xuICAgIHRocm93IG5ldyBUeXBlRXJyb3IoXG4gICAgICBcIkV4cGVjdGVkIGEgU291cmNlTm9kZSwgc3RyaW5nLCBvciBhbiBhcnJheSBvZiBTb3VyY2VOb2RlcyBhbmQgc3RyaW5ncy4gR290IFwiICsgYUNodW5rXG4gICAgKTtcbiAgfVxuICByZXR1cm4gdGhpcztcbn07XG5cbi8qKlxuICogQWRkIGEgY2h1bmsgb2YgZ2VuZXJhdGVkIEpTIHRvIHRoZSBiZWdpbm5pbmcgb2YgdGhpcyBzb3VyY2Ugbm9kZS5cbiAqXG4gKiBAcGFyYW0gYUNodW5rIEEgc3RyaW5nIHNuaXBwZXQgb2YgZ2VuZXJhdGVkIEpTIGNvZGUsIGFub3RoZXIgaW5zdGFuY2Ugb2ZcbiAqICAgICAgICBTb3VyY2VOb2RlLCBvciBhbiBhcnJheSB3aGVyZSBlYWNoIG1lbWJlciBpcyBvbmUgb2YgdGhvc2UgdGhpbmdzLlxuICovXG5Tb3VyY2VOb2RlLnByb3RvdHlwZS5wcmVwZW5kID0gZnVuY3Rpb24gU291cmNlTm9kZV9wcmVwZW5kKGFDaHVuaykge1xuICBpZiAoQXJyYXkuaXNBcnJheShhQ2h1bmspKSB7XG4gICAgZm9yICh2YXIgaSA9IGFDaHVuay5sZW5ndGgtMTsgaSA+PSAwOyBpLS0pIHtcbiAgICAgIHRoaXMucHJlcGVuZChhQ2h1bmtbaV0pO1xuICAgIH1cbiAgfVxuICBlbHNlIGlmIChhQ2h1bmtbaXNTb3VyY2VOb2RlXSB8fCB0eXBlb2YgYUNodW5rID09PSBcInN0cmluZ1wiKSB7XG4gICAgdGhpcy5jaGlsZHJlbi51bnNoaWZ0KGFDaHVuayk7XG4gIH1cbiAgZWxzZSB7XG4gICAgdGhyb3cgbmV3IFR5cGVFcnJvcihcbiAgICAgIFwiRXhwZWN0ZWQgYSBTb3VyY2VOb2RlLCBzdHJpbmcsIG9yIGFuIGFycmF5IG9mIFNvdXJjZU5vZGVzIGFuZCBzdHJpbmdzLiBHb3QgXCIgKyBhQ2h1bmtcbiAgICApO1xuICB9XG4gIHJldHVybiB0aGlzO1xufTtcblxuLyoqXG4gKiBXYWxrIG92ZXIgdGhlIHRyZWUgb2YgSlMgc25pcHBldHMgaW4gdGhpcyBub2RlIGFuZCBpdHMgY2hpbGRyZW4uIFRoZVxuICogd2Fsa2luZyBmdW5jdGlvbiBpcyBjYWxsZWQgb25jZSBmb3IgZWFjaCBzbmlwcGV0IG9mIEpTIGFuZCBpcyBwYXNzZWQgdGhhdFxuICogc25pcHBldCBhbmQgdGhlIGl0cyBvcmlnaW5hbCBhc3NvY2lhdGVkIHNvdXJjZSdzIGxpbmUvY29sdW1uIGxvY2F0aW9uLlxuICpcbiAqIEBwYXJhbSBhRm4gVGhlIHRyYXZlcnNhbCBmdW5jdGlvbi5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUud2FsayA9IGZ1bmN0aW9uIFNvdXJjZU5vZGVfd2FsayhhRm4pIHtcbiAgdmFyIGNodW5rO1xuICBmb3IgKHZhciBpID0gMCwgbGVuID0gdGhpcy5jaGlsZHJlbi5sZW5ndGg7IGkgPCBsZW47IGkrKykge1xuICAgIGNodW5rID0gdGhpcy5jaGlsZHJlbltpXTtcbiAgICBpZiAoY2h1bmtbaXNTb3VyY2VOb2RlXSkge1xuICAgICAgY2h1bmsud2FsayhhRm4pO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIGlmIChjaHVuayAhPT0gJycpIHtcbiAgICAgICAgYUZuKGNodW5rLCB7IHNvdXJjZTogdGhpcy5zb3VyY2UsXG4gICAgICAgICAgICAgICAgICAgICBsaW5lOiB0aGlzLmxpbmUsXG4gICAgICAgICAgICAgICAgICAgICBjb2x1bW46IHRoaXMuY29sdW1uLFxuICAgICAgICAgICAgICAgICAgICAgbmFtZTogdGhpcy5uYW1lIH0pO1xuICAgICAgfVxuICAgIH1cbiAgfVxufTtcblxuLyoqXG4gKiBMaWtlIGBTdHJpbmcucHJvdG90eXBlLmpvaW5gIGV4Y2VwdCBmb3IgU291cmNlTm9kZXMuIEluc2VydHMgYGFTdHJgIGJldHdlZW5cbiAqIGVhY2ggb2YgYHRoaXMuY2hpbGRyZW5gLlxuICpcbiAqIEBwYXJhbSBhU2VwIFRoZSBzZXBhcmF0b3IuXG4gKi9cblNvdXJjZU5vZGUucHJvdG90eXBlLmpvaW4gPSBmdW5jdGlvbiBTb3VyY2VOb2RlX2pvaW4oYVNlcCkge1xuICB2YXIgbmV3Q2hpbGRyZW47XG4gIHZhciBpO1xuICB2YXIgbGVuID0gdGhpcy5jaGlsZHJlbi5sZW5ndGg7XG4gIGlmIChsZW4gPiAwKSB7XG4gICAgbmV3Q2hpbGRyZW4gPSBbXTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgbGVuLTE7IGkrKykge1xuICAgICAgbmV3Q2hpbGRyZW4ucHVzaCh0aGlzLmNoaWxkcmVuW2ldKTtcbiAgICAgIG5ld0NoaWxkcmVuLnB1c2goYVNlcCk7XG4gICAgfVxuICAgIG5ld0NoaWxkcmVuLnB1c2godGhpcy5jaGlsZHJlbltpXSk7XG4gICAgdGhpcy5jaGlsZHJlbiA9IG5ld0NoaWxkcmVuO1xuICB9XG4gIHJldHVybiB0aGlzO1xufTtcblxuLyoqXG4gKiBDYWxsIFN0cmluZy5wcm90b3R5cGUucmVwbGFjZSBvbiB0aGUgdmVyeSByaWdodC1tb3N0IHNvdXJjZSBzbmlwcGV0LiBVc2VmdWxcbiAqIGZvciB0cmltbWluZyB3aGl0ZXNwYWNlIGZyb20gdGhlIGVuZCBvZiBhIHNvdXJjZSBub2RlLCBldGMuXG4gKlxuICogQHBhcmFtIGFQYXR0ZXJuIFRoZSBwYXR0ZXJuIHRvIHJlcGxhY2UuXG4gKiBAcGFyYW0gYVJlcGxhY2VtZW50IFRoZSB0aGluZyB0byByZXBsYWNlIHRoZSBwYXR0ZXJuIHdpdGguXG4gKi9cblNvdXJjZU5vZGUucHJvdG90eXBlLnJlcGxhY2VSaWdodCA9IGZ1bmN0aW9uIFNvdXJjZU5vZGVfcmVwbGFjZVJpZ2h0KGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpIHtcbiAgdmFyIGxhc3RDaGlsZCA9IHRoaXMuY2hpbGRyZW5bdGhpcy5jaGlsZHJlbi5sZW5ndGggLSAxXTtcbiAgaWYgKGxhc3RDaGlsZFtpc1NvdXJjZU5vZGVdKSB7XG4gICAgbGFzdENoaWxkLnJlcGxhY2VSaWdodChhUGF0dGVybiwgYVJlcGxhY2VtZW50KTtcbiAgfVxuICBlbHNlIGlmICh0eXBlb2YgbGFzdENoaWxkID09PSAnc3RyaW5nJykge1xuICAgIHRoaXMuY2hpbGRyZW5bdGhpcy5jaGlsZHJlbi5sZW5ndGggLSAxXSA9IGxhc3RDaGlsZC5yZXBsYWNlKGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpO1xuICB9XG4gIGVsc2Uge1xuICAgIHRoaXMuY2hpbGRyZW4ucHVzaCgnJy5yZXBsYWNlKGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpKTtcbiAgfVxuICByZXR1cm4gdGhpcztcbn07XG5cbi8qKlxuICogU2V0IHRoZSBzb3VyY2UgY29udGVudCBmb3IgYSBzb3VyY2UgZmlsZS4gVGhpcyB3aWxsIGJlIGFkZGVkIHRvIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3JcbiAqIGluIHRoZSBzb3VyY2VzQ29udGVudCBmaWVsZC5cbiAqXG4gKiBAcGFyYW0gYVNvdXJjZUZpbGUgVGhlIGZpbGVuYW1lIG9mIHRoZSBzb3VyY2UgZmlsZVxuICogQHBhcmFtIGFTb3VyY2VDb250ZW50IFRoZSBjb250ZW50IG9mIHRoZSBzb3VyY2UgZmlsZVxuICovXG5Tb3VyY2VOb2RlLnByb3RvdHlwZS5zZXRTb3VyY2VDb250ZW50ID1cbiAgZnVuY3Rpb24gU291cmNlTm9kZV9zZXRTb3VyY2VDb250ZW50KGFTb3VyY2VGaWxlLCBhU291cmNlQ29udGVudCkge1xuICAgIHRoaXMuc291cmNlQ29udGVudHNbdXRpbC50b1NldFN0cmluZyhhU291cmNlRmlsZSldID0gYVNvdXJjZUNvbnRlbnQ7XG4gIH07XG5cbi8qKlxuICogV2FsayBvdmVyIHRoZSB0cmVlIG9mIFNvdXJjZU5vZGVzLiBUaGUgd2Fsa2luZyBmdW5jdGlvbiBpcyBjYWxsZWQgZm9yIGVhY2hcbiAqIHNvdXJjZSBmaWxlIGNvbnRlbnQgYW5kIGlzIHBhc3NlZCB0aGUgZmlsZW5hbWUgYW5kIHNvdXJjZSBjb250ZW50LlxuICpcbiAqIEBwYXJhbSBhRm4gVGhlIHRyYXZlcnNhbCBmdW5jdGlvbi5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUud2Fsa1NvdXJjZUNvbnRlbnRzID1cbiAgZnVuY3Rpb24gU291cmNlTm9kZV93YWxrU291cmNlQ29udGVudHMoYUZuKSB7XG4gICAgZm9yICh2YXIgaSA9IDAsIGxlbiA9IHRoaXMuY2hpbGRyZW4ubGVuZ3RoOyBpIDwgbGVuOyBpKyspIHtcbiAgICAgIGlmICh0aGlzLmNoaWxkcmVuW2ldW2lzU291cmNlTm9kZV0pIHtcbiAgICAgICAgdGhpcy5jaGlsZHJlbltpXS53YWxrU291cmNlQ29udGVudHMoYUZuKTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICB2YXIgc291cmNlcyA9IE9iamVjdC5rZXlzKHRoaXMuc291cmNlQ29udGVudHMpO1xuICAgIGZvciAodmFyIGkgPSAwLCBsZW4gPSBzb3VyY2VzLmxlbmd0aDsgaSA8IGxlbjsgaSsrKSB7XG4gICAgICBhRm4odXRpbC5mcm9tU2V0U3RyaW5nKHNvdXJjZXNbaV0pLCB0aGlzLnNvdXJjZUNvbnRlbnRzW3NvdXJjZXNbaV1dKTtcbiAgICB9XG4gIH07XG5cbi8qKlxuICogUmV0dXJuIHRoZSBzdHJpbmcgcmVwcmVzZW50YXRpb24gb2YgdGhpcyBzb3VyY2Ugbm9kZS4gV2Fsa3Mgb3ZlciB0aGUgdHJlZVxuICogYW5kIGNvbmNhdGVuYXRlcyBhbGwgdGhlIHZhcmlvdXMgc25pcHBldHMgdG9nZXRoZXIgdG8gb25lIHN0cmluZy5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUudG9TdHJpbmcgPSBmdW5jdGlvbiBTb3VyY2VOb2RlX3RvU3RyaW5nKCkge1xuICB2YXIgc3RyID0gXCJcIjtcbiAgdGhpcy53YWxrKGZ1bmN0aW9uIChjaHVuaykge1xuICAgIHN0ciArPSBjaHVuaztcbiAgfSk7XG4gIHJldHVybiBzdHI7XG59O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIHN0cmluZyByZXByZXNlbnRhdGlvbiBvZiB0aGlzIHNvdXJjZSBub2RlIGFsb25nIHdpdGggYSBzb3VyY2VcbiAqIG1hcC5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUudG9TdHJpbmdXaXRoU291cmNlTWFwID0gZnVuY3Rpb24gU291cmNlTm9kZV90b1N0cmluZ1dpdGhTb3VyY2VNYXAoYUFyZ3MpIHtcbiAgdmFyIGdlbmVyYXRlZCA9IHtcbiAgICBjb2RlOiBcIlwiLFxuICAgIGxpbmU6IDEsXG4gICAgY29sdW1uOiAwXG4gIH07XG4gIHZhciBtYXAgPSBuZXcgU291cmNlTWFwR2VuZXJhdG9yKGFBcmdzKTtcbiAgdmFyIHNvdXJjZU1hcHBpbmdBY3RpdmUgPSBmYWxzZTtcbiAgdmFyIGxhc3RPcmlnaW5hbFNvdXJjZSA9IG51bGw7XG4gIHZhciBsYXN0T3JpZ2luYWxMaW5lID0gbnVsbDtcbiAgdmFyIGxhc3RPcmlnaW5hbENvbHVtbiA9IG51bGw7XG4gIHZhciBsYXN0T3JpZ2luYWxOYW1lID0gbnVsbDtcbiAgdGhpcy53YWxrKGZ1bmN0aW9uIChjaHVuaywgb3JpZ2luYWwpIHtcbiAgICBnZW5lcmF0ZWQuY29kZSArPSBjaHVuaztcbiAgICBpZiAob3JpZ2luYWwuc291cmNlICE9PSBudWxsXG4gICAgICAgICYmIG9yaWdpbmFsLmxpbmUgIT09IG51bGxcbiAgICAgICAgJiYgb3JpZ2luYWwuY29sdW1uICE9PSBudWxsKSB7XG4gICAgICBpZihsYXN0T3JpZ2luYWxTb3VyY2UgIT09IG9yaWdpbmFsLnNvdXJjZVxuICAgICAgICAgfHwgbGFzdE9yaWdpbmFsTGluZSAhPT0gb3JpZ2luYWwubGluZVxuICAgICAgICAgfHwgbGFzdE9yaWdpbmFsQ29sdW1uICE9PSBvcmlnaW5hbC5jb2x1bW5cbiAgICAgICAgIHx8IGxhc3RPcmlnaW5hbE5hbWUgIT09IG9yaWdpbmFsLm5hbWUpIHtcbiAgICAgICAgbWFwLmFkZE1hcHBpbmcoe1xuICAgICAgICAgIHNvdXJjZTogb3JpZ2luYWwuc291cmNlLFxuICAgICAgICAgIG9yaWdpbmFsOiB7XG4gICAgICAgICAgICBsaW5lOiBvcmlnaW5hbC5saW5lLFxuICAgICAgICAgICAgY29sdW1uOiBvcmlnaW5hbC5jb2x1bW5cbiAgICAgICAgICB9LFxuICAgICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgICAgbGluZTogZ2VuZXJhdGVkLmxpbmUsXG4gICAgICAgICAgICBjb2x1bW46IGdlbmVyYXRlZC5jb2x1bW5cbiAgICAgICAgICB9LFxuICAgICAgICAgIG5hbWU6IG9yaWdpbmFsLm5hbWVcbiAgICAgICAgfSk7XG4gICAgICB9XG4gICAgICBsYXN0T3JpZ2luYWxTb3VyY2UgPSBvcmlnaW5hbC5zb3VyY2U7XG4gICAgICBsYXN0T3JpZ2luYWxMaW5lID0gb3JpZ2luYWwubGluZTtcbiAgICAgIGxhc3RPcmlnaW5hbENvbHVtbiA9IG9yaWdpbmFsLmNvbHVtbjtcbiAgICAgIGxhc3RPcmlnaW5hbE5hbWUgPSBvcmlnaW5hbC5uYW1lO1xuICAgICAgc291cmNlTWFwcGluZ0FjdGl2ZSA9IHRydWU7XG4gICAgfSBlbHNlIGlmIChzb3VyY2VNYXBwaW5nQWN0aXZlKSB7XG4gICAgICBtYXAuYWRkTWFwcGluZyh7XG4gICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgIGxpbmU6IGdlbmVyYXRlZC5saW5lLFxuICAgICAgICAgIGNvbHVtbjogZ2VuZXJhdGVkLmNvbHVtblxuICAgICAgICB9XG4gICAgICB9KTtcbiAgICAgIGxhc3RPcmlnaW5hbFNvdXJjZSA9IG51bGw7XG4gICAgICBzb3VyY2VNYXBwaW5nQWN0aXZlID0gZmFsc2U7XG4gICAgfVxuICAgIGZvciAodmFyIGlkeCA9IDAsIGxlbmd0aCA9IGNodW5rLmxlbmd0aDsgaWR4IDwgbGVuZ3RoOyBpZHgrKykge1xuICAgICAgaWYgKGNodW5rLmNoYXJDb2RlQXQoaWR4KSA9PT0gTkVXTElORV9DT0RFKSB7XG4gICAgICAgIGdlbmVyYXRlZC5saW5lKys7XG4gICAgICAgIGdlbmVyYXRlZC5jb2x1bW4gPSAwO1xuICAgICAgICAvLyBNYXBwaW5ncyBlbmQgYXQgZW9sXG4gICAgICAgIGlmIChpZHggKyAxID09PSBsZW5ndGgpIHtcbiAgICAgICAgICBsYXN0T3JpZ2luYWxTb3VyY2UgPSBudWxsO1xuICAgICAgICAgIHNvdXJjZU1hcHBpbmdBY3RpdmUgPSBmYWxzZTtcbiAgICAgICAgfSBlbHNlIGlmIChzb3VyY2VNYXBwaW5nQWN0aXZlKSB7XG4gICAgICAgICAgbWFwLmFkZE1hcHBpbmcoe1xuICAgICAgICAgICAgc291cmNlOiBvcmlnaW5hbC5zb3VyY2UsXG4gICAgICAgICAgICBvcmlnaW5hbDoge1xuICAgICAgICAgICAgICBsaW5lOiBvcmlnaW5hbC5saW5lLFxuICAgICAgICAgICAgICBjb2x1bW46IG9yaWdpbmFsLmNvbHVtblxuICAgICAgICAgICAgfSxcbiAgICAgICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgICAgICBsaW5lOiBnZW5lcmF0ZWQubGluZSxcbiAgICAgICAgICAgICAgY29sdW1uOiBnZW5lcmF0ZWQuY29sdW1uXG4gICAgICAgICAgICB9LFxuICAgICAgICAgICAgbmFtZTogb3JpZ2luYWwubmFtZVxuICAgICAgICAgIH0pO1xuICAgICAgICB9XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBnZW5lcmF0ZWQuY29sdW1uKys7XG4gICAgICB9XG4gICAgfVxuICB9KTtcbiAgdGhpcy53YWxrU291cmNlQ29udGVudHMoZnVuY3Rpb24gKHNvdXJjZUZpbGUsIHNvdXJjZUNvbnRlbnQpIHtcbiAgICBtYXAuc2V0U291cmNlQ29udGVudChzb3VyY2VGaWxlLCBzb3VyY2VDb250ZW50KTtcbiAgfSk7XG5cbiAgcmV0dXJuIHsgY29kZTogZ2VuZXJhdGVkLmNvZGUsIG1hcDogbWFwIH07XG59O1xuXG5leHBvcnRzLlNvdXJjZU5vZGUgPSBTb3VyY2VOb2RlO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvc291cmNlLW5vZGUuanNcbi8vIG1vZHVsZSBpZCA9IDEwXG4vLyBtb2R1bGUgY2h1bmtzID0gMCJdLCJzb3VyY2VSb290IjoiIn0=
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/source-map/dist/source-map.js b/node_modules/@babel/core/node_modules/source-map/dist/source-map.js
new file mode 100644
index 00000000..4e630e29
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/dist/source-map.js
@@ -0,0 +1,3090 @@
+(function webpackUniversalModuleDefinition(root, factory) {
+	if(typeof exports === 'object' && typeof module === 'object')
+		module.exports = factory();
+	else if(typeof define === 'function' && define.amd)
+		define([], factory);
+	else if(typeof exports === 'object')
+		exports["sourceMap"] = factory();
+	else
+		root["sourceMap"] = factory();
+})(this, function() {
+return /******/ (function(modules) { // webpackBootstrap
+/******/ 	// The module cache
+/******/ 	var installedModules = {};
+
+/******/ 	// The require function
+/******/ 	function __webpack_require__(moduleId) {
+
+/******/ 		// Check if module is in cache
+/******/ 		if(installedModules[moduleId])
+/******/ 			return installedModules[moduleId].exports;
+
+/******/ 		// Create a new module (and put it into the cache)
+/******/ 		var module = installedModules[moduleId] = {
+/******/ 			exports: {},
+/******/ 			id: moduleId,
+/******/ 			loaded: false
+/******/ 		};
+
+/******/ 		// Execute the module function
+/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+
+/******/ 		// Flag the module as loaded
+/******/ 		module.loaded = true;
+
+/******/ 		// Return the exports of the module
+/******/ 		return module.exports;
+/******/ 	}
+
+
+/******/ 	// expose the modules object (__webpack_modules__)
+/******/ 	__webpack_require__.m = modules;
+
+/******/ 	// expose the module cache
+/******/ 	__webpack_require__.c = installedModules;
+
+/******/ 	// __webpack_public_path__
+/******/ 	__webpack_require__.p = "";
+
+/******/ 	// Load entry module and return exports
+/******/ 	return __webpack_require__(0);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*
+	 * Copyright 2009-2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE.txt or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+	exports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;
+	exports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer;
+	exports.SourceNode = __webpack_require__(10).SourceNode;
+
+
+/***/ }),
+/* 1 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	var base64VLQ = __webpack_require__(2);
+	var util = __webpack_require__(4);
+	var ArraySet = __webpack_require__(5).ArraySet;
+	var MappingList = __webpack_require__(6).MappingList;
+
+	/**
+	 * An instance of the SourceMapGenerator represents a source map which is
+	 * being built incrementally. You may pass an object with the following
+	 * properties:
+	 *
+	 *   - file: The filename of the generated source.
+	 *   - sourceRoot: A root for all relative URLs in this source map.
+	 */
+	function SourceMapGenerator(aArgs) {
+	  if (!aArgs) {
+	    aArgs = {};
+	  }
+	  this._file = util.getArg(aArgs, 'file', null);
+	  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
+	  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);
+	  this._sources = new ArraySet();
+	  this._names = new ArraySet();
+	  this._mappings = new MappingList();
+	  this._sourcesContents = null;
+	}
+
+	SourceMapGenerator.prototype._version = 3;
+
+	/**
+	 * Creates a new SourceMapGenerator based on a SourceMapConsumer
+	 *
+	 * @param aSourceMapConsumer The SourceMap.
+	 */
+	SourceMapGenerator.fromSourceMap =
+	  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
+	    var sourceRoot = aSourceMapConsumer.sourceRoot;
+	    var generator = new SourceMapGenerator({
+	      file: aSourceMapConsumer.file,
+	      sourceRoot: sourceRoot
+	    });
+	    aSourceMapConsumer.eachMapping(function (mapping) {
+	      var newMapping = {
+	        generated: {
+	          line: mapping.generatedLine,
+	          column: mapping.generatedColumn
+	        }
+	      };
+
+	      if (mapping.source != null) {
+	        newMapping.source = mapping.source;
+	        if (sourceRoot != null) {
+	          newMapping.source = util.relative(sourceRoot, newMapping.source);
+	        }
+
+	        newMapping.original = {
+	          line: mapping.originalLine,
+	          column: mapping.originalColumn
+	        };
+
+	        if (mapping.name != null) {
+	          newMapping.name = mapping.name;
+	        }
+	      }
+
+	      generator.addMapping(newMapping);
+	    });
+	    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+	      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+	      if (content != null) {
+	        generator.setSourceContent(sourceFile, content);
+	      }
+	    });
+	    return generator;
+	  };
+
+	/**
+	 * Add a single mapping from original source line and column to the generated
+	 * source's line and column for this source map being created. The mapping
+	 * object should have the following properties:
+	 *
+	 *   - generated: An object with the generated line and column positions.
+	 *   - original: An object with the original line and column positions.
+	 *   - source: The original source file (relative to the sourceRoot).
+	 *   - name: An optional original token name for this mapping.
+	 */
+	SourceMapGenerator.prototype.addMapping =
+	  function SourceMapGenerator_addMapping(aArgs) {
+	    var generated = util.getArg(aArgs, 'generated');
+	    var original = util.getArg(aArgs, 'original', null);
+	    var source = util.getArg(aArgs, 'source', null);
+	    var name = util.getArg(aArgs, 'name', null);
+
+	    if (!this._skipValidation) {
+	      this._validateMapping(generated, original, source, name);
+	    }
+
+	    if (source != null) {
+	      source = String(source);
+	      if (!this._sources.has(source)) {
+	        this._sources.add(source);
+	      }
+	    }
+
+	    if (name != null) {
+	      name = String(name);
+	      if (!this._names.has(name)) {
+	        this._names.add(name);
+	      }
+	    }
+
+	    this._mappings.add({
+	      generatedLine: generated.line,
+	      generatedColumn: generated.column,
+	      originalLine: original != null && original.line,
+	      originalColumn: original != null && original.column,
+	      source: source,
+	      name: name
+	    });
+	  };
+
+	/**
+	 * Set the source content for a source file.
+	 */
+	SourceMapGenerator.prototype.setSourceContent =
+	  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
+	    var source = aSourceFile;
+	    if (this._sourceRoot != null) {
+	      source = util.relative(this._sourceRoot, source);
+	    }
+
+	    if (aSourceContent != null) {
+	      // Add the source content to the _sourcesContents map.
+	      // Create a new _sourcesContents map if the property is null.
+	      if (!this._sourcesContents) {
+	        this._sourcesContents = Object.create(null);
+	      }
+	      this._sourcesContents[util.toSetString(source)] = aSourceContent;
+	    } else if (this._sourcesContents) {
+	      // Remove the source file from the _sourcesContents map.
+	      // If the _sourcesContents map is empty, set the property to null.
+	      delete this._sourcesContents[util.toSetString(source)];
+	      if (Object.keys(this._sourcesContents).length === 0) {
+	        this._sourcesContents = null;
+	      }
+	    }
+	  };
+
+	/**
+	 * Applies the mappings of a sub-source-map for a specific source file to the
+	 * source map being generated. Each mapping to the supplied source file is
+	 * rewritten using the supplied source map. Note: The resolution for the
+	 * resulting mappings is the minimium of this map and the supplied map.
+	 *
+	 * @param aSourceMapConsumer The source map to be applied.
+	 * @param aSourceFile Optional. The filename of the source file.
+	 *        If omitted, SourceMapConsumer's file property will be used.
+	 * @param aSourceMapPath Optional. The dirname of the path to the source map
+	 *        to be applied. If relative, it is relative to the SourceMapConsumer.
+	 *        This parameter is needed when the two source maps aren't in the same
+	 *        directory, and the source map to be applied contains relative source
+	 *        paths. If so, those relative source paths need to be rewritten
+	 *        relative to the SourceMapGenerator.
+	 */
+	SourceMapGenerator.prototype.applySourceMap =
+	  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
+	    var sourceFile = aSourceFile;
+	    // If aSourceFile is omitted, we will use the file property of the SourceMap
+	    if (aSourceFile == null) {
+	      if (aSourceMapConsumer.file == null) {
+	        throw new Error(
+	          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
+	          'or the source map\'s "file" property. Both were omitted.'
+	        );
+	      }
+	      sourceFile = aSourceMapConsumer.file;
+	    }
+	    var sourceRoot = this._sourceRoot;
+	    // Make "sourceFile" relative if an absolute Url is passed.
+	    if (sourceRoot != null) {
+	      sourceFile = util.relative(sourceRoot, sourceFile);
+	    }
+	    // Applying the SourceMap can add and remove items from the sources and
+	    // the names array.
+	    var newSources = new ArraySet();
+	    var newNames = new ArraySet();
+
+	    // Find mappings for the "sourceFile"
+	    this._mappings.unsortedForEach(function (mapping) {
+	      if (mapping.source === sourceFile && mapping.originalLine != null) {
+	        // Check if it can be mapped by the source map, then update the mapping.
+	        var original = aSourceMapConsumer.originalPositionFor({
+	          line: mapping.originalLine,
+	          column: mapping.originalColumn
+	        });
+	        if (original.source != null) {
+	          // Copy mapping
+	          mapping.source = original.source;
+	          if (aSourceMapPath != null) {
+	            mapping.source = util.join(aSourceMapPath, mapping.source)
+	          }
+	          if (sourceRoot != null) {
+	            mapping.source = util.relative(sourceRoot, mapping.source);
+	          }
+	          mapping.originalLine = original.line;
+	          mapping.originalColumn = original.column;
+	          if (original.name != null) {
+	            mapping.name = original.name;
+	          }
+	        }
+	      }
+
+	      var source = mapping.source;
+	      if (source != null && !newSources.has(source)) {
+	        newSources.add(source);
+	      }
+
+	      var name = mapping.name;
+	      if (name != null && !newNames.has(name)) {
+	        newNames.add(name);
+	      }
+
+	    }, this);
+	    this._sources = newSources;
+	    this._names = newNames;
+
+	    // Copy sourcesContents of applied map.
+	    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+	      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+	      if (content != null) {
+	        if (aSourceMapPath != null) {
+	          sourceFile = util.join(aSourceMapPath, sourceFile);
+	        }
+	        if (sourceRoot != null) {
+	          sourceFile = util.relative(sourceRoot, sourceFile);
+	        }
+	        this.setSourceContent(sourceFile, content);
+	      }
+	    }, this);
+	  };
+
+	/**
+	 * A mapping can have one of the three levels of data:
+	 *
+	 *   1. Just the generated position.
+	 *   2. The Generated position, original position, and original source.
+	 *   3. Generated and original position, original source, as well as a name
+	 *      token.
+	 *
+	 * To maintain consistency, we validate that any new mapping being added falls
+	 * in to one of these categories.
+	 */
+	SourceMapGenerator.prototype._validateMapping =
+	  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
+	                                              aName) {
+	    // When aOriginal is truthy but has empty values for .line and .column,
+	    // it is most likely a programmer error. In this case we throw a very
+	    // specific error message to try to guide them the right way.
+	    // For example: https://github.com/Polymer/polymer-bundler/pull/519
+	    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {
+	        throw new Error(
+	            'original.line and original.column are not numbers -- you probably meant to omit ' +
+	            'the original mapping entirely and only map the generated position. If so, pass ' +
+	            'null for the original mapping instead of an object with empty or null values.'
+	        );
+	    }
+
+	    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+	        && aGenerated.line > 0 && aGenerated.column >= 0
+	        && !aOriginal && !aSource && !aName) {
+	      // Case 1.
+	      return;
+	    }
+	    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+	             && aOriginal && 'line' in aOriginal && 'column' in aOriginal
+	             && aGenerated.line > 0 && aGenerated.column >= 0
+	             && aOriginal.line > 0 && aOriginal.column >= 0
+	             && aSource) {
+	      // Cases 2 and 3.
+	      return;
+	    }
+	    else {
+	      throw new Error('Invalid mapping: ' + JSON.stringify({
+	        generated: aGenerated,
+	        source: aSource,
+	        original: aOriginal,
+	        name: aName
+	      }));
+	    }
+	  };
+
+	/**
+	 * Serialize the accumulated mappings in to the stream of base 64 VLQs
+	 * specified by the source map format.
+	 */
+	SourceMapGenerator.prototype._serializeMappings =
+	  function SourceMapGenerator_serializeMappings() {
+	    var previousGeneratedColumn = 0;
+	    var previousGeneratedLine = 1;
+	    var previousOriginalColumn = 0;
+	    var previousOriginalLine = 0;
+	    var previousName = 0;
+	    var previousSource = 0;
+	    var result = '';
+	    var next;
+	    var mapping;
+	    var nameIdx;
+	    var sourceIdx;
+
+	    var mappings = this._mappings.toArray();
+	    for (var i = 0, len = mappings.length; i < len; i++) {
+	      mapping = mappings[i];
+	      next = ''
+
+	      if (mapping.generatedLine !== previousGeneratedLine) {
+	        previousGeneratedColumn = 0;
+	        while (mapping.generatedLine !== previousGeneratedLine) {
+	          next += ';';
+	          previousGeneratedLine++;
+	        }
+	      }
+	      else {
+	        if (i > 0) {
+	          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {
+	            continue;
+	          }
+	          next += ',';
+	        }
+	      }
+
+	      next += base64VLQ.encode(mapping.generatedColumn
+	                                 - previousGeneratedColumn);
+	      previousGeneratedColumn = mapping.generatedColumn;
+
+	      if (mapping.source != null) {
+	        sourceIdx = this._sources.indexOf(mapping.source);
+	        next += base64VLQ.encode(sourceIdx - previousSource);
+	        previousSource = sourceIdx;
+
+	        // lines are stored 0-based in SourceMap spec version 3
+	        next += base64VLQ.encode(mapping.originalLine - 1
+	                                   - previousOriginalLine);
+	        previousOriginalLine = mapping.originalLine - 1;
+
+	        next += base64VLQ.encode(mapping.originalColumn
+	                                   - previousOriginalColumn);
+	        previousOriginalColumn = mapping.originalColumn;
+
+	        if (mapping.name != null) {
+	          nameIdx = this._names.indexOf(mapping.name);
+	          next += base64VLQ.encode(nameIdx - previousName);
+	          previousName = nameIdx;
+	        }
+	      }
+
+	      result += next;
+	    }
+
+	    return result;
+	  };
+
+	SourceMapGenerator.prototype._generateSourcesContent =
+	  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
+	    return aSources.map(function (source) {
+	      if (!this._sourcesContents) {
+	        return null;
+	      }
+	      if (aSourceRoot != null) {
+	        source = util.relative(aSourceRoot, source);
+	      }
+	      var key = util.toSetString(source);
+	      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)
+	        ? this._sourcesContents[key]
+	        : null;
+	    }, this);
+	  };
+
+	/**
+	 * Externalize the source map.
+	 */
+	SourceMapGenerator.prototype.toJSON =
+	  function SourceMapGenerator_toJSON() {
+	    var map = {
+	      version: this._version,
+	      sources: this._sources.toArray(),
+	      names: this._names.toArray(),
+	      mappings: this._serializeMappings()
+	    };
+	    if (this._file != null) {
+	      map.file = this._file;
+	    }
+	    if (this._sourceRoot != null) {
+	      map.sourceRoot = this._sourceRoot;
+	    }
+	    if (this._sourcesContents) {
+	      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
+	    }
+
+	    return map;
+	  };
+
+	/**
+	 * Render the source map being generated to a string.
+	 */
+	SourceMapGenerator.prototype.toString =
+	  function SourceMapGenerator_toString() {
+	    return JSON.stringify(this.toJSON());
+	  };
+
+	exports.SourceMapGenerator = SourceMapGenerator;
+
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 *
+	 * Based on the Base 64 VLQ implementation in Closure Compiler:
+	 * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
+	 *
+	 * Copyright 2011 The Closure Compiler Authors. All rights reserved.
+	 * Redistribution and use in source and binary forms, with or without
+	 * modification, are permitted provided that the following conditions are
+	 * met:
+	 *
+	 *  * Redistributions of source code must retain the above copyright
+	 *    notice, this list of conditions and the following disclaimer.
+	 *  * Redistributions in binary form must reproduce the above
+	 *    copyright notice, this list of conditions and the following
+	 *    disclaimer in the documentation and/or other materials provided
+	 *    with the distribution.
+	 *  * Neither the name of Google Inc. nor the names of its
+	 *    contributors may be used to endorse or promote products derived
+	 *    from this software without specific prior written permission.
+	 *
+	 * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+	 * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+	 * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+	 * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+	 * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+	 * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+	 * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+	 * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+	 * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+	 * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+	 * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+	 */
+
+	var base64 = __webpack_require__(3);
+
+	// A single base 64 digit can contain 6 bits of data. For the base 64 variable
+	// length quantities we use in the source map spec, the first bit is the sign,
+	// the next four bits are the actual value, and the 6th bit is the
+	// continuation bit. The continuation bit tells us whether there are more
+	// digits in this value following this digit.
+	//
+	//   Continuation
+	//   |    Sign
+	//   |    |
+	//   V    V
+	//   101011
+
+	var VLQ_BASE_SHIFT = 5;
+
+	// binary: 100000
+	var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
+
+	// binary: 011111
+	var VLQ_BASE_MASK = VLQ_BASE - 1;
+
+	// binary: 100000
+	var VLQ_CONTINUATION_BIT = VLQ_BASE;
+
+	/**
+	 * Converts from a two-complement value to a value where the sign bit is
+	 * placed in the least significant bit.  For example, as decimals:
+	 *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
+	 *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
+	 */
+	function toVLQSigned(aValue) {
+	  return aValue < 0
+	    ? ((-aValue) << 1) + 1
+	    : (aValue << 1) + 0;
+	}
+
+	/**
+	 * Converts to a two-complement value from a value where the sign bit is
+	 * placed in the least significant bit.  For example, as decimals:
+	 *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1
+	 *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2
+	 */
+	function fromVLQSigned(aValue) {
+	  var isNegative = (aValue & 1) === 1;
+	  var shifted = aValue >> 1;
+	  return isNegative
+	    ? -shifted
+	    : shifted;
+	}
+
+	/**
+	 * Returns the base 64 VLQ encoded value.
+	 */
+	exports.encode = function base64VLQ_encode(aValue) {
+	  var encoded = "";
+	  var digit;
+
+	  var vlq = toVLQSigned(aValue);
+
+	  do {
+	    digit = vlq & VLQ_BASE_MASK;
+	    vlq >>>= VLQ_BASE_SHIFT;
+	    if (vlq > 0) {
+	      // There are still more digits in this value, so we must make sure the
+	      // continuation bit is marked.
+	      digit |= VLQ_CONTINUATION_BIT;
+	    }
+	    encoded += base64.encode(digit);
+	  } while (vlq > 0);
+
+	  return encoded;
+	};
+
+	/**
+	 * Decodes the next base 64 VLQ value from the given string and returns the
+	 * value and the rest of the string via the out parameter.
+	 */
+	exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {
+	  var strLen = aStr.length;
+	  var result = 0;
+	  var shift = 0;
+	  var continuation, digit;
+
+	  do {
+	    if (aIndex >= strLen) {
+	      throw new Error("Expected more digits in base 64 VLQ value.");
+	    }
+
+	    digit = base64.decode(aStr.charCodeAt(aIndex++));
+	    if (digit === -1) {
+	      throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1));
+	    }
+
+	    continuation = !!(digit & VLQ_CONTINUATION_BIT);
+	    digit &= VLQ_BASE_MASK;
+	    result = result + (digit << shift);
+	    shift += VLQ_BASE_SHIFT;
+	  } while (continuation);
+
+	  aOutParam.value = fromVLQSigned(result);
+	  aOutParam.rest = aIndex;
+	};
+
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');
+
+	/**
+	 * Encode an integer in the range of 0 to 63 to a single base 64 digit.
+	 */
+	exports.encode = function (number) {
+	  if (0 <= number && number < intToCharMap.length) {
+	    return intToCharMap[number];
+	  }
+	  throw new TypeError("Must be between 0 and 63: " + number);
+	};
+
+	/**
+	 * Decode a single base 64 character code digit to an integer. Returns -1 on
+	 * failure.
+	 */
+	exports.decode = function (charCode) {
+	  var bigA = 65;     // 'A'
+	  var bigZ = 90;     // 'Z'
+
+	  var littleA = 97;  // 'a'
+	  var littleZ = 122; // 'z'
+
+	  var zero = 48;     // '0'
+	  var nine = 57;     // '9'
+
+	  var plus = 43;     // '+'
+	  var slash = 47;    // '/'
+
+	  var littleOffset = 26;
+	  var numberOffset = 52;
+
+	  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ
+	  if (bigA <= charCode && charCode <= bigZ) {
+	    return (charCode - bigA);
+	  }
+
+	  // 26 - 51: abcdefghijklmnopqrstuvwxyz
+	  if (littleA <= charCode && charCode <= littleZ) {
+	    return (charCode - littleA + littleOffset);
+	  }
+
+	  // 52 - 61: 0123456789
+	  if (zero <= charCode && charCode <= nine) {
+	    return (charCode - zero + numberOffset);
+	  }
+
+	  // 62: +
+	  if (charCode == plus) {
+	    return 62;
+	  }
+
+	  // 63: /
+	  if (charCode == slash) {
+	    return 63;
+	  }
+
+	  // Invalid base64 digit.
+	  return -1;
+	};
+
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	/**
+	 * This is a helper function for getting values from parameter/options
+	 * objects.
+	 *
+	 * @param args The object we are extracting values from
+	 * @param name The name of the property we are getting.
+	 * @param defaultValue An optional value to return if the property is missing
+	 * from the object. If this is not specified and the property is missing, an
+	 * error will be thrown.
+	 */
+	function getArg(aArgs, aName, aDefaultValue) {
+	  if (aName in aArgs) {
+	    return aArgs[aName];
+	  } else if (arguments.length === 3) {
+	    return aDefaultValue;
+	  } else {
+	    throw new Error('"' + aName + '" is a required argument.');
+	  }
+	}
+	exports.getArg = getArg;
+
+	var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.]*)(?::(\d+))?(\S*)$/;
+	var dataUrlRegexp = /^data:.+\,.+$/;
+
+	function urlParse(aUrl) {
+	  var match = aUrl.match(urlRegexp);
+	  if (!match) {
+	    return null;
+	  }
+	  return {
+	    scheme: match[1],
+	    auth: match[2],
+	    host: match[3],
+	    port: match[4],
+	    path: match[5]
+	  };
+	}
+	exports.urlParse = urlParse;
+
+	function urlGenerate(aParsedUrl) {
+	  var url = '';
+	  if (aParsedUrl.scheme) {
+	    url += aParsedUrl.scheme + ':';
+	  }
+	  url += '//';
+	  if (aParsedUrl.auth) {
+	    url += aParsedUrl.auth + '@';
+	  }
+	  if (aParsedUrl.host) {
+	    url += aParsedUrl.host;
+	  }
+	  if (aParsedUrl.port) {
+	    url += ":" + aParsedUrl.port
+	  }
+	  if (aParsedUrl.path) {
+	    url += aParsedUrl.path;
+	  }
+	  return url;
+	}
+	exports.urlGenerate = urlGenerate;
+
+	/**
+	 * Normalizes a path, or the path portion of a URL:
+	 *
+	 * - Replaces consecutive slashes with one slash.
+	 * - Removes unnecessary '.' parts.
+	 * - Removes unnecessary '<dir>/..' parts.
+	 *
+	 * Based on code in the Node.js 'path' core module.
+	 *
+	 * @param aPath The path or url to normalize.
+	 */
+	function normalize(aPath) {
+	  var path = aPath;
+	  var url = urlParse(aPath);
+	  if (url) {
+	    if (!url.path) {
+	      return aPath;
+	    }
+	    path = url.path;
+	  }
+	  var isAbsolute = exports.isAbsolute(path);
+
+	  var parts = path.split(/\/+/);
+	  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
+	    part = parts[i];
+	    if (part === '.') {
+	      parts.splice(i, 1);
+	    } else if (part === '..') {
+	      up++;
+	    } else if (up > 0) {
+	      if (part === '') {
+	        // The first part is blank if the path is absolute. Trying to go
+	        // above the root is a no-op. Therefore we can remove all '..' parts
+	        // directly after the root.
+	        parts.splice(i + 1, up);
+	        up = 0;
+	      } else {
+	        parts.splice(i, 2);
+	        up--;
+	      }
+	    }
+	  }
+	  path = parts.join('/');
+
+	  if (path === '') {
+	    path = isAbsolute ? '/' : '.';
+	  }
+
+	  if (url) {
+	    url.path = path;
+	    return urlGenerate(url);
+	  }
+	  return path;
+	}
+	exports.normalize = normalize;
+
+	/**
+	 * Joins two paths/URLs.
+	 *
+	 * @param aRoot The root path or URL.
+	 * @param aPath The path or URL to be joined with the root.
+	 *
+	 * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
+	 *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended
+	 *   first.
+	 * - Otherwise aPath is a path. If aRoot is a URL, then its path portion
+	 *   is updated with the result and aRoot is returned. Otherwise the result
+	 *   is returned.
+	 *   - If aPath is absolute, the result is aPath.
+	 *   - Otherwise the two paths are joined with a slash.
+	 * - Joining for example 'http://' and 'www.example.com' is also supported.
+	 */
+	function join(aRoot, aPath) {
+	  if (aRoot === "") {
+	    aRoot = ".";
+	  }
+	  if (aPath === "") {
+	    aPath = ".";
+	  }
+	  var aPathUrl = urlParse(aPath);
+	  var aRootUrl = urlParse(aRoot);
+	  if (aRootUrl) {
+	    aRoot = aRootUrl.path || '/';
+	  }
+
+	  // `join(foo, '//www.example.org')`
+	  if (aPathUrl && !aPathUrl.scheme) {
+	    if (aRootUrl) {
+	      aPathUrl.scheme = aRootUrl.scheme;
+	    }
+	    return urlGenerate(aPathUrl);
+	  }
+
+	  if (aPathUrl || aPath.match(dataUrlRegexp)) {
+	    return aPath;
+	  }
+
+	  // `join('http://', 'www.example.com')`
+	  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
+	    aRootUrl.host = aPath;
+	    return urlGenerate(aRootUrl);
+	  }
+
+	  var joined = aPath.charAt(0) === '/'
+	    ? aPath
+	    : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
+
+	  if (aRootUrl) {
+	    aRootUrl.path = joined;
+	    return urlGenerate(aRootUrl);
+	  }
+	  return joined;
+	}
+	exports.join = join;
+
+	exports.isAbsolute = function (aPath) {
+	  return aPath.charAt(0) === '/' || !!aPath.match(urlRegexp);
+	};
+
+	/**
+	 * Make a path relative to a URL or another path.
+	 *
+	 * @param aRoot The root path or URL.
+	 * @param aPath The path or URL to be made relative to aRoot.
+	 */
+	function relative(aRoot, aPath) {
+	  if (aRoot === "") {
+	    aRoot = ".";
+	  }
+
+	  aRoot = aRoot.replace(/\/$/, '');
+
+	  // It is possible for the path to be above the root. In this case, simply
+	  // checking whether the root is a prefix of the path won't work. Instead, we
+	  // need to remove components from the root one by one, until either we find
+	  // a prefix that fits, or we run out of components to remove.
+	  var level = 0;
+	  while (aPath.indexOf(aRoot + '/') !== 0) {
+	    var index = aRoot.lastIndexOf("/");
+	    if (index < 0) {
+	      return aPath;
+	    }
+
+	    // If the only part of the root that is left is the scheme (i.e. http://,
+	    // file:///, etc.), one or more slashes (/), or simply nothing at all, we
+	    // have exhausted all components, so the path is not relative to the root.
+	    aRoot = aRoot.slice(0, index);
+	    if (aRoot.match(/^([^\/]+:\/)?\/*$/)) {
+	      return aPath;
+	    }
+
+	    ++level;
+	  }
+
+	  // Make sure we add a "../" for each component we removed from the root.
+	  return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1);
+	}
+	exports.relative = relative;
+
+	var supportsNullProto = (function () {
+	  var obj = Object.create(null);
+	  return !('__proto__' in obj);
+	}());
+
+	function identity (s) {
+	  return s;
+	}
+
+	/**
+	 * Because behavior goes wacky when you set `__proto__` on objects, we
+	 * have to prefix all the strings in our set with an arbitrary character.
+	 *
+	 * See https://github.com/mozilla/source-map/pull/31 and
+	 * https://github.com/mozilla/source-map/issues/30
+	 *
+	 * @param String aStr
+	 */
+	function toSetString(aStr) {
+	  if (isProtoString(aStr)) {
+	    return '$' + aStr;
+	  }
+
+	  return aStr;
+	}
+	exports.toSetString = supportsNullProto ? identity : toSetString;
+
+	function fromSetString(aStr) {
+	  if (isProtoString(aStr)) {
+	    return aStr.slice(1);
+	  }
+
+	  return aStr;
+	}
+	exports.fromSetString = supportsNullProto ? identity : fromSetString;
+
+	function isProtoString(s) {
+	  if (!s) {
+	    return false;
+	  }
+
+	  var length = s.length;
+
+	  if (length < 9 /* "__proto__".length */) {
+	    return false;
+	  }
+
+	  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||
+	      s.charCodeAt(length - 2) !== 95  /* '_' */ ||
+	      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||
+	      s.charCodeAt(length - 4) !== 116 /* 't' */ ||
+	      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||
+	      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||
+	      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||
+	      s.charCodeAt(length - 8) !== 95  /* '_' */ ||
+	      s.charCodeAt(length - 9) !== 95  /* '_' */) {
+	    return false;
+	  }
+
+	  for (var i = length - 10; i >= 0; i--) {
+	    if (s.charCodeAt(i) !== 36 /* '$' */) {
+	      return false;
+	    }
+	  }
+
+	  return true;
+	}
+
+	/**
+	 * Comparator between two mappings where the original positions are compared.
+	 *
+	 * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+	 * mappings with the same original source/line/column, but different generated
+	 * line and column the same. Useful when searching for a mapping with a
+	 * stubbed out mapping.
+	 */
+	function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
+	  var cmp = mappingA.source - mappingB.source;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.originalLine - mappingB.originalLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.originalColumn - mappingB.originalColumn;
+	  if (cmp !== 0 || onlyCompareOriginal) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.generatedLine - mappingB.generatedLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  return mappingA.name - mappingB.name;
+	}
+	exports.compareByOriginalPositions = compareByOriginalPositions;
+
+	/**
+	 * Comparator between two mappings with deflated source and name indices where
+	 * the generated positions are compared.
+	 *
+	 * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+	 * mappings with the same generated line and column, but different
+	 * source/name/original line and column the same. Useful when searching for a
+	 * mapping with a stubbed out mapping.
+	 */
+	function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {
+	  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+	  if (cmp !== 0 || onlyCompareGenerated) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.source - mappingB.source;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.originalLine - mappingB.originalLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.originalColumn - mappingB.originalColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  return mappingA.name - mappingB.name;
+	}
+	exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;
+
+	function strcmp(aStr1, aStr2) {
+	  if (aStr1 === aStr2) {
+	    return 0;
+	  }
+
+	  if (aStr1 > aStr2) {
+	    return 1;
+	  }
+
+	  return -1;
+	}
+
+	/**
+	 * Comparator between two mappings with inflated source and name strings where
+	 * the generated positions are compared.
+	 */
+	function compareByGeneratedPositionsInflated(mappingA, mappingB) {
+	  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = strcmp(mappingA.source, mappingB.source);
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.originalLine - mappingB.originalLine;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  cmp = mappingA.originalColumn - mappingB.originalColumn;
+	  if (cmp !== 0) {
+	    return cmp;
+	  }
+
+	  return strcmp(mappingA.name, mappingB.name);
+	}
+	exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;
+
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	var util = __webpack_require__(4);
+	var has = Object.prototype.hasOwnProperty;
+	var hasNativeMap = typeof Map !== "undefined";
+
+	/**
+	 * A data structure which is a combination of an array and a set. Adding a new
+	 * member is O(1), testing for membership is O(1), and finding the index of an
+	 * element is O(1). Removing elements from the set is not supported. Only
+	 * strings are supported for membership.
+	 */
+	function ArraySet() {
+	  this._array = [];
+	  this._set = hasNativeMap ? new Map() : Object.create(null);
+	}
+
+	/**
+	 * Static method for creating ArraySet instances from an existing array.
+	 */
+	ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
+	  var set = new ArraySet();
+	  for (var i = 0, len = aArray.length; i < len; i++) {
+	    set.add(aArray[i], aAllowDuplicates);
+	  }
+	  return set;
+	};
+
+	/**
+	 * Return how many unique items are in this ArraySet. If duplicates have been
+	 * added, than those do not count towards the size.
+	 *
+	 * @returns Number
+	 */
+	ArraySet.prototype.size = function ArraySet_size() {
+	  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;
+	};
+
+	/**
+	 * Add the given string to this set.
+	 *
+	 * @param String aStr
+	 */
+	ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
+	  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);
+	  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);
+	  var idx = this._array.length;
+	  if (!isDuplicate || aAllowDuplicates) {
+	    this._array.push(aStr);
+	  }
+	  if (!isDuplicate) {
+	    if (hasNativeMap) {
+	      this._set.set(aStr, idx);
+	    } else {
+	      this._set[sStr] = idx;
+	    }
+	  }
+	};
+
+	/**
+	 * Is the given string a member of this set?
+	 *
+	 * @param String aStr
+	 */
+	ArraySet.prototype.has = function ArraySet_has(aStr) {
+	  if (hasNativeMap) {
+	    return this._set.has(aStr);
+	  } else {
+	    var sStr = util.toSetString(aStr);
+	    return has.call(this._set, sStr);
+	  }
+	};
+
+	/**
+	 * What is the index of the given string in the array?
+	 *
+	 * @param String aStr
+	 */
+	ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
+	  if (hasNativeMap) {
+	    var idx = this._set.get(aStr);
+	    if (idx >= 0) {
+	        return idx;
+	    }
+	  } else {
+	    var sStr = util.toSetString(aStr);
+	    if (has.call(this._set, sStr)) {
+	      return this._set[sStr];
+	    }
+	  }
+
+	  throw new Error('"' + aStr + '" is not in the set.');
+	};
+
+	/**
+	 * What is the element at the given index?
+	 *
+	 * @param Number aIdx
+	 */
+	ArraySet.prototype.at = function ArraySet_at(aIdx) {
+	  if (aIdx >= 0 && aIdx < this._array.length) {
+	    return this._array[aIdx];
+	  }
+	  throw new Error('No element indexed by ' + aIdx);
+	};
+
+	/**
+	 * Returns the array representation of this set (which has the proper indices
+	 * indicated by indexOf). Note that this is a copy of the internal array used
+	 * for storing the members so that no one can mess with internal state.
+	 */
+	ArraySet.prototype.toArray = function ArraySet_toArray() {
+	  return this._array.slice();
+	};
+
+	exports.ArraySet = ArraySet;
+
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2014 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	var util = __webpack_require__(4);
+
+	/**
+	 * Determine whether mappingB is after mappingA with respect to generated
+	 * position.
+	 */
+	function generatedPositionAfter(mappingA, mappingB) {
+	  // Optimized for most common case
+	  var lineA = mappingA.generatedLine;
+	  var lineB = mappingB.generatedLine;
+	  var columnA = mappingA.generatedColumn;
+	  var columnB = mappingB.generatedColumn;
+	  return lineB > lineA || lineB == lineA && columnB >= columnA ||
+	         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;
+	}
+
+	/**
+	 * A data structure to provide a sorted view of accumulated mappings in a
+	 * performance conscious manner. It trades a neglibable overhead in general
+	 * case for a large speedup in case of mappings being added in order.
+	 */
+	function MappingList() {
+	  this._array = [];
+	  this._sorted = true;
+	  // Serves as infimum
+	  this._last = {generatedLine: -1, generatedColumn: 0};
+	}
+
+	/**
+	 * Iterate through internal items. This method takes the same arguments that
+	 * `Array.prototype.forEach` takes.
+	 *
+	 * NOTE: The order of the mappings is NOT guaranteed.
+	 */
+	MappingList.prototype.unsortedForEach =
+	  function MappingList_forEach(aCallback, aThisArg) {
+	    this._array.forEach(aCallback, aThisArg);
+	  };
+
+	/**
+	 * Add the given source mapping.
+	 *
+	 * @param Object aMapping
+	 */
+	MappingList.prototype.add = function MappingList_add(aMapping) {
+	  if (generatedPositionAfter(this._last, aMapping)) {
+	    this._last = aMapping;
+	    this._array.push(aMapping);
+	  } else {
+	    this._sorted = false;
+	    this._array.push(aMapping);
+	  }
+	};
+
+	/**
+	 * Returns the flat, sorted array of mappings. The mappings are sorted by
+	 * generated position.
+	 *
+	 * WARNING: This method returns internal data without copying, for
+	 * performance. The return value must NOT be mutated, and should be treated as
+	 * an immutable borrow. If you want to take ownership, you must make your own
+	 * copy.
+	 */
+	MappingList.prototype.toArray = function MappingList_toArray() {
+	  if (!this._sorted) {
+	    this._array.sort(util.compareByGeneratedPositionsInflated);
+	    this._sorted = true;
+	  }
+	  return this._array;
+	};
+
+	exports.MappingList = MappingList;
+
+
+/***/ }),
+/* 7 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	var util = __webpack_require__(4);
+	var binarySearch = __webpack_require__(8);
+	var ArraySet = __webpack_require__(5).ArraySet;
+	var base64VLQ = __webpack_require__(2);
+	var quickSort = __webpack_require__(9).quickSort;
+
+	function SourceMapConsumer(aSourceMap) {
+	  var sourceMap = aSourceMap;
+	  if (typeof aSourceMap === 'string') {
+	    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+	  }
+
+	  return sourceMap.sections != null
+	    ? new IndexedSourceMapConsumer(sourceMap)
+	    : new BasicSourceMapConsumer(sourceMap);
+	}
+
+	SourceMapConsumer.fromSourceMap = function(aSourceMap) {
+	  return BasicSourceMapConsumer.fromSourceMap(aSourceMap);
+	}
+
+	/**
+	 * The version of the source mapping spec that we are consuming.
+	 */
+	SourceMapConsumer.prototype._version = 3;
+
+	// `__generatedMappings` and `__originalMappings` are arrays that hold the
+	// parsed mapping coordinates from the source map's "mappings" attribute. They
+	// are lazily instantiated, accessed via the `_generatedMappings` and
+	// `_originalMappings` getters respectively, and we only parse the mappings
+	// and create these arrays once queried for a source location. We jump through
+	// these hoops because there can be many thousands of mappings, and parsing
+	// them is expensive, so we only want to do it if we must.
+	//
+	// Each object in the arrays is of the form:
+	//
+	//     {
+	//       generatedLine: The line number in the generated code,
+	//       generatedColumn: The column number in the generated code,
+	//       source: The path to the original source file that generated this
+	//               chunk of code,
+	//       originalLine: The line number in the original source that
+	//                     corresponds to this chunk of generated code,
+	//       originalColumn: The column number in the original source that
+	//                       corresponds to this chunk of generated code,
+	//       name: The name of the original symbol which generated this chunk of
+	//             code.
+	//     }
+	//
+	// All properties except for `generatedLine` and `generatedColumn` can be
+	// `null`.
+	//
+	// `_generatedMappings` is ordered by the generated positions.
+	//
+	// `_originalMappings` is ordered by the original positions.
+
+	SourceMapConsumer.prototype.__generatedMappings = null;
+	Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {
+	  get: function () {
+	    if (!this.__generatedMappings) {
+	      this._parseMappings(this._mappings, this.sourceRoot);
+	    }
+
+	    return this.__generatedMappings;
+	  }
+	});
+
+	SourceMapConsumer.prototype.__originalMappings = null;
+	Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {
+	  get: function () {
+	    if (!this.__originalMappings) {
+	      this._parseMappings(this._mappings, this.sourceRoot);
+	    }
+
+	    return this.__originalMappings;
+	  }
+	});
+
+	SourceMapConsumer.prototype._charIsMappingSeparator =
+	  function SourceMapConsumer_charIsMappingSeparator(aStr, index) {
+	    var c = aStr.charAt(index);
+	    return c === ";" || c === ",";
+	  };
+
+	/**
+	 * Parse the mappings in a string in to a data structure which we can easily
+	 * query (the ordered arrays in the `this.__generatedMappings` and
+	 * `this.__originalMappings` properties).
+	 */
+	SourceMapConsumer.prototype._parseMappings =
+	  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+	    throw new Error("Subclasses must implement _parseMappings");
+	  };
+
+	SourceMapConsumer.GENERATED_ORDER = 1;
+	SourceMapConsumer.ORIGINAL_ORDER = 2;
+
+	SourceMapConsumer.GREATEST_LOWER_BOUND = 1;
+	SourceMapConsumer.LEAST_UPPER_BOUND = 2;
+
+	/**
+	 * Iterate over each mapping between an original source/line/column and a
+	 * generated line/column in this source map.
+	 *
+	 * @param Function aCallback
+	 *        The function that is called with each mapping.
+	 * @param Object aContext
+	 *        Optional. If specified, this object will be the value of `this` every
+	 *        time that `aCallback` is called.
+	 * @param aOrder
+	 *        Either `SourceMapConsumer.GENERATED_ORDER` or
+	 *        `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to
+	 *        iterate over the mappings sorted by the generated file's line/column
+	 *        order or the original's source/line/column order, respectively. Defaults to
+	 *        `SourceMapConsumer.GENERATED_ORDER`.
+	 */
+	SourceMapConsumer.prototype.eachMapping =
+	  function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {
+	    var context = aContext || null;
+	    var order = aOrder || SourceMapConsumer.GENERATED_ORDER;
+
+	    var mappings;
+	    switch (order) {
+	    case SourceMapConsumer.GENERATED_ORDER:
+	      mappings = this._generatedMappings;
+	      break;
+	    case SourceMapConsumer.ORIGINAL_ORDER:
+	      mappings = this._originalMappings;
+	      break;
+	    default:
+	      throw new Error("Unknown order of iteration.");
+	    }
+
+	    var sourceRoot = this.sourceRoot;
+	    mappings.map(function (mapping) {
+	      var source = mapping.source === null ? null : this._sources.at(mapping.source);
+	      if (source != null && sourceRoot != null) {
+	        source = util.join(sourceRoot, source);
+	      }
+	      return {
+	        source: source,
+	        generatedLine: mapping.generatedLine,
+	        generatedColumn: mapping.generatedColumn,
+	        originalLine: mapping.originalLine,
+	        originalColumn: mapping.originalColumn,
+	        name: mapping.name === null ? null : this._names.at(mapping.name)
+	      };
+	    }, this).forEach(aCallback, context);
+	  };
+
+	/**
+	 * Returns all generated line and column information for the original source,
+	 * line, and column provided. If no column is provided, returns all mappings
+	 * corresponding to a either the line we are searching for or the next
+	 * closest line that has any mappings. Otherwise, returns all mappings
+	 * corresponding to the given line and either the column we are searching for
+	 * or the next closest column that has any offsets.
+	 *
+	 * The only argument is an object with the following properties:
+	 *
+	 *   - source: The filename of the original source.
+	 *   - line: The line number in the original source.
+	 *   - column: Optional. the column number in the original source.
+	 *
+	 * and an array of objects is returned, each with the following properties:
+	 *
+	 *   - line: The line number in the generated source, or null.
+	 *   - column: The column number in the generated source, or null.
+	 */
+	SourceMapConsumer.prototype.allGeneratedPositionsFor =
+	  function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {
+	    var line = util.getArg(aArgs, 'line');
+
+	    // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping
+	    // returns the index of the closest mapping less than the needle. By
+	    // setting needle.originalColumn to 0, we thus find the last mapping for
+	    // the given line, provided such a mapping exists.
+	    var needle = {
+	      source: util.getArg(aArgs, 'source'),
+	      originalLine: line,
+	      originalColumn: util.getArg(aArgs, 'column', 0)
+	    };
+
+	    if (this.sourceRoot != null) {
+	      needle.source = util.relative(this.sourceRoot, needle.source);
+	    }
+	    if (!this._sources.has(needle.source)) {
+	      return [];
+	    }
+	    needle.source = this._sources.indexOf(needle.source);
+
+	    var mappings = [];
+
+	    var index = this._findMapping(needle,
+	                                  this._originalMappings,
+	                                  "originalLine",
+	                                  "originalColumn",
+	                                  util.compareByOriginalPositions,
+	                                  binarySearch.LEAST_UPPER_BOUND);
+	    if (index >= 0) {
+	      var mapping = this._originalMappings[index];
+
+	      if (aArgs.column === undefined) {
+	        var originalLine = mapping.originalLine;
+
+	        // Iterate until either we run out of mappings, or we run into
+	        // a mapping for a different line than the one we found. Since
+	        // mappings are sorted, this is guaranteed to find all mappings for
+	        // the line we found.
+	        while (mapping && mapping.originalLine === originalLine) {
+	          mappings.push({
+	            line: util.getArg(mapping, 'generatedLine', null),
+	            column: util.getArg(mapping, 'generatedColumn', null),
+	            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+	          });
+
+	          mapping = this._originalMappings[++index];
+	        }
+	      } else {
+	        var originalColumn = mapping.originalColumn;
+
+	        // Iterate until either we run out of mappings, or we run into
+	        // a mapping for a different line than the one we were searching for.
+	        // Since mappings are sorted, this is guaranteed to find all mappings for
+	        // the line we are searching for.
+	        while (mapping &&
+	               mapping.originalLine === line &&
+	               mapping.originalColumn == originalColumn) {
+	          mappings.push({
+	            line: util.getArg(mapping, 'generatedLine', null),
+	            column: util.getArg(mapping, 'generatedColumn', null),
+	            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+	          });
+
+	          mapping = this._originalMappings[++index];
+	        }
+	      }
+	    }
+
+	    return mappings;
+	  };
+
+	exports.SourceMapConsumer = SourceMapConsumer;
+
+	/**
+	 * A BasicSourceMapConsumer instance represents a parsed source map which we can
+	 * query for information about the original file positions by giving it a file
+	 * position in the generated source.
+	 *
+	 * The only parameter is the raw source map (either as a JSON string, or
+	 * already parsed to an object). According to the spec, source maps have the
+	 * following attributes:
+	 *
+	 *   - version: Which version of the source map spec this map is following.
+	 *   - sources: An array of URLs to the original source files.
+	 *   - names: An array of identifiers which can be referrenced by individual mappings.
+	 *   - sourceRoot: Optional. The URL root from which all sources are relative.
+	 *   - sourcesContent: Optional. An array of contents of the original source files.
+	 *   - mappings: A string of base64 VLQs which contain the actual mappings.
+	 *   - file: Optional. The generated file this source map is associated with.
+	 *
+	 * Here is an example source map, taken from the source map spec[0]:
+	 *
+	 *     {
+	 *       version : 3,
+	 *       file: "out.js",
+	 *       sourceRoot : "",
+	 *       sources: ["foo.js", "bar.js"],
+	 *       names: ["src", "maps", "are", "fun"],
+	 *       mappings: "AA,AB;;ABCDE;"
+	 *     }
+	 *
+	 * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#
+	 */
+	function BasicSourceMapConsumer(aSourceMap) {
+	  var sourceMap = aSourceMap;
+	  if (typeof aSourceMap === 'string') {
+	    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+	  }
+
+	  var version = util.getArg(sourceMap, 'version');
+	  var sources = util.getArg(sourceMap, 'sources');
+	  // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which
+	  // requires the array) to play nice here.
+	  var names = util.getArg(sourceMap, 'names', []);
+	  var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);
+	  var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);
+	  var mappings = util.getArg(sourceMap, 'mappings');
+	  var file = util.getArg(sourceMap, 'file', null);
+
+	  // Once again, Sass deviates from the spec and supplies the version as a
+	  // string rather than a number, so we use loose equality checking here.
+	  if (version != this._version) {
+	    throw new Error('Unsupported version: ' + version);
+	  }
+
+	  sources = sources
+	    .map(String)
+	    // Some source maps produce relative source paths like "./foo.js" instead of
+	    // "foo.js".  Normalize these first so that future comparisons will succeed.
+	    // See bugzil.la/1090768.
+	    .map(util.normalize)
+	    // Always ensure that absolute sources are internally stored relative to
+	    // the source root, if the source root is absolute. Not doing this would
+	    // be particularly problematic when the source root is a prefix of the
+	    // source (valid, but why??). See github issue #199 and bugzil.la/1188982.
+	    .map(function (source) {
+	      return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)
+	        ? util.relative(sourceRoot, source)
+	        : source;
+	    });
+
+	  // Pass `true` below to allow duplicate names and sources. While source maps
+	  // are intended to be compressed and deduplicated, the TypeScript compiler
+	  // sometimes generates source maps with duplicates in them. See Github issue
+	  // #72 and bugzil.la/889492.
+	  this._names = ArraySet.fromArray(names.map(String), true);
+	  this._sources = ArraySet.fromArray(sources, true);
+
+	  this.sourceRoot = sourceRoot;
+	  this.sourcesContent = sourcesContent;
+	  this._mappings = mappings;
+	  this.file = file;
+	}
+
+	BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
+	BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;
+
+	/**
+	 * Create a BasicSourceMapConsumer from a SourceMapGenerator.
+	 *
+	 * @param SourceMapGenerator aSourceMap
+	 *        The source map that will be consumed.
+	 * @returns BasicSourceMapConsumer
+	 */
+	BasicSourceMapConsumer.fromSourceMap =
+	  function SourceMapConsumer_fromSourceMap(aSourceMap) {
+	    var smc = Object.create(BasicSourceMapConsumer.prototype);
+
+	    var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);
+	    var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);
+	    smc.sourceRoot = aSourceMap._sourceRoot;
+	    smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),
+	                                                            smc.sourceRoot);
+	    smc.file = aSourceMap._file;
+
+	    // Because we are modifying the entries (by converting string sources and
+	    // names to indices into the sources and names ArraySets), we have to make
+	    // a copy of the entry or else bad things happen. Shared mutable state
+	    // strikes again! See github issue #191.
+
+	    var generatedMappings = aSourceMap._mappings.toArray().slice();
+	    var destGeneratedMappings = smc.__generatedMappings = [];
+	    var destOriginalMappings = smc.__originalMappings = [];
+
+	    for (var i = 0, length = generatedMappings.length; i < length; i++) {
+	      var srcMapping = generatedMappings[i];
+	      var destMapping = new Mapping;
+	      destMapping.generatedLine = srcMapping.generatedLine;
+	      destMapping.generatedColumn = srcMapping.generatedColumn;
+
+	      if (srcMapping.source) {
+	        destMapping.source = sources.indexOf(srcMapping.source);
+	        destMapping.originalLine = srcMapping.originalLine;
+	        destMapping.originalColumn = srcMapping.originalColumn;
+
+	        if (srcMapping.name) {
+	          destMapping.name = names.indexOf(srcMapping.name);
+	        }
+
+	        destOriginalMappings.push(destMapping);
+	      }
+
+	      destGeneratedMappings.push(destMapping);
+	    }
+
+	    quickSort(smc.__originalMappings, util.compareByOriginalPositions);
+
+	    return smc;
+	  };
+
+	/**
+	 * The version of the source mapping spec that we are consuming.
+	 */
+	BasicSourceMapConsumer.prototype._version = 3;
+
+	/**
+	 * The list of original sources.
+	 */
+	Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {
+	  get: function () {
+	    return this._sources.toArray().map(function (s) {
+	      return this.sourceRoot != null ? util.join(this.sourceRoot, s) : s;
+	    }, this);
+	  }
+	});
+
+	/**
+	 * Provide the JIT with a nice shape / hidden class.
+	 */
+	function Mapping() {
+	  this.generatedLine = 0;
+	  this.generatedColumn = 0;
+	  this.source = null;
+	  this.originalLine = null;
+	  this.originalColumn = null;
+	  this.name = null;
+	}
+
+	/**
+	 * Parse the mappings in a string in to a data structure which we can easily
+	 * query (the ordered arrays in the `this.__generatedMappings` and
+	 * `this.__originalMappings` properties).
+	 */
+	BasicSourceMapConsumer.prototype._parseMappings =
+	  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+	    var generatedLine = 1;
+	    var previousGeneratedColumn = 0;
+	    var previousOriginalLine = 0;
+	    var previousOriginalColumn = 0;
+	    var previousSource = 0;
+	    var previousName = 0;
+	    var length = aStr.length;
+	    var index = 0;
+	    var cachedSegments = {};
+	    var temp = {};
+	    var originalMappings = [];
+	    var generatedMappings = [];
+	    var mapping, str, segment, end, value;
+
+	    while (index < length) {
+	      if (aStr.charAt(index) === ';') {
+	        generatedLine++;
+	        index++;
+	        previousGeneratedColumn = 0;
+	      }
+	      else if (aStr.charAt(index) === ',') {
+	        index++;
+	      }
+	      else {
+	        mapping = new Mapping();
+	        mapping.generatedLine = generatedLine;
+
+	        // Because each offset is encoded relative to the previous one,
+	        // many segments often have the same encoding. We can exploit this
+	        // fact by caching the parsed variable length fields of each segment,
+	        // allowing us to avoid a second parse if we encounter the same
+	        // segment again.
+	        for (end = index; end < length; end++) {
+	          if (this._charIsMappingSeparator(aStr, end)) {
+	            break;
+	          }
+	        }
+	        str = aStr.slice(index, end);
+
+	        segment = cachedSegments[str];
+	        if (segment) {
+	          index += str.length;
+	        } else {
+	          segment = [];
+	          while (index < end) {
+	            base64VLQ.decode(aStr, index, temp);
+	            value = temp.value;
+	            index = temp.rest;
+	            segment.push(value);
+	          }
+
+	          if (segment.length === 2) {
+	            throw new Error('Found a source, but no line and column');
+	          }
+
+	          if (segment.length === 3) {
+	            throw new Error('Found a source and line, but no column');
+	          }
+
+	          cachedSegments[str] = segment;
+	        }
+
+	        // Generated column.
+	        mapping.generatedColumn = previousGeneratedColumn + segment[0];
+	        previousGeneratedColumn = mapping.generatedColumn;
+
+	        if (segment.length > 1) {
+	          // Original source.
+	          mapping.source = previousSource + segment[1];
+	          previousSource += segment[1];
+
+	          // Original line.
+	          mapping.originalLine = previousOriginalLine + segment[2];
+	          previousOriginalLine = mapping.originalLine;
+	          // Lines are stored 0-based
+	          mapping.originalLine += 1;
+
+	          // Original column.
+	          mapping.originalColumn = previousOriginalColumn + segment[3];
+	          previousOriginalColumn = mapping.originalColumn;
+
+	          if (segment.length > 4) {
+	            // Original name.
+	            mapping.name = previousName + segment[4];
+	            previousName += segment[4];
+	          }
+	        }
+
+	        generatedMappings.push(mapping);
+	        if (typeof mapping.originalLine === 'number') {
+	          originalMappings.push(mapping);
+	        }
+	      }
+	    }
+
+	    quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);
+	    this.__generatedMappings = generatedMappings;
+
+	    quickSort(originalMappings, util.compareByOriginalPositions);
+	    this.__originalMappings = originalMappings;
+	  };
+
+	/**
+	 * Find the mapping that best matches the hypothetical "needle" mapping that
+	 * we are searching for in the given "haystack" of mappings.
+	 */
+	BasicSourceMapConsumer.prototype._findMapping =
+	  function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,
+	                                         aColumnName, aComparator, aBias) {
+	    // To return the position we are searching for, we must first find the
+	    // mapping for the given position and then return the opposite position it
+	    // points to. Because the mappings are sorted, we can use binary search to
+	    // find the best mapping.
+
+	    if (aNeedle[aLineName] <= 0) {
+	      throw new TypeError('Line must be greater than or equal to 1, got '
+	                          + aNeedle[aLineName]);
+	    }
+	    if (aNeedle[aColumnName] < 0) {
+	      throw new TypeError('Column must be greater than or equal to 0, got '
+	                          + aNeedle[aColumnName]);
+	    }
+
+	    return binarySearch.search(aNeedle, aMappings, aComparator, aBias);
+	  };
+
+	/**
+	 * Compute the last column for each generated mapping. The last column is
+	 * inclusive.
+	 */
+	BasicSourceMapConsumer.prototype.computeColumnSpans =
+	  function SourceMapConsumer_computeColumnSpans() {
+	    for (var index = 0; index < this._generatedMappings.length; ++index) {
+	      var mapping = this._generatedMappings[index];
+
+	      // Mappings do not contain a field for the last generated columnt. We
+	      // can come up with an optimistic estimate, however, by assuming that
+	      // mappings are contiguous (i.e. given two consecutive mappings, the
+	      // first mapping ends where the second one starts).
+	      if (index + 1 < this._generatedMappings.length) {
+	        var nextMapping = this._generatedMappings[index + 1];
+
+	        if (mapping.generatedLine === nextMapping.generatedLine) {
+	          mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;
+	          continue;
+	        }
+	      }
+
+	      // The last mapping for each line spans the entire line.
+	      mapping.lastGeneratedColumn = Infinity;
+	    }
+	  };
+
+	/**
+	 * Returns the original source, line, and column information for the generated
+	 * source's line and column positions provided. The only argument is an object
+	 * with the following properties:
+	 *
+	 *   - line: The line number in the generated source.
+	 *   - column: The column number in the generated source.
+	 *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
+	 *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - source: The original source file, or null.
+	 *   - line: The line number in the original source, or null.
+	 *   - column: The column number in the original source, or null.
+	 *   - name: The original identifier, or null.
+	 */
+	BasicSourceMapConsumer.prototype.originalPositionFor =
+	  function SourceMapConsumer_originalPositionFor(aArgs) {
+	    var needle = {
+	      generatedLine: util.getArg(aArgs, 'line'),
+	      generatedColumn: util.getArg(aArgs, 'column')
+	    };
+
+	    var index = this._findMapping(
+	      needle,
+	      this._generatedMappings,
+	      "generatedLine",
+	      "generatedColumn",
+	      util.compareByGeneratedPositionsDeflated,
+	      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
+	    );
+
+	    if (index >= 0) {
+	      var mapping = this._generatedMappings[index];
+
+	      if (mapping.generatedLine === needle.generatedLine) {
+	        var source = util.getArg(mapping, 'source', null);
+	        if (source !== null) {
+	          source = this._sources.at(source);
+	          if (this.sourceRoot != null) {
+	            source = util.join(this.sourceRoot, source);
+	          }
+	        }
+	        var name = util.getArg(mapping, 'name', null);
+	        if (name !== null) {
+	          name = this._names.at(name);
+	        }
+	        return {
+	          source: source,
+	          line: util.getArg(mapping, 'originalLine', null),
+	          column: util.getArg(mapping, 'originalColumn', null),
+	          name: name
+	        };
+	      }
+	    }
+
+	    return {
+	      source: null,
+	      line: null,
+	      column: null,
+	      name: null
+	    };
+	  };
+
+	/**
+	 * Return true if we have the source content for every source in the source
+	 * map, false otherwise.
+	 */
+	BasicSourceMapConsumer.prototype.hasContentsOfAllSources =
+	  function BasicSourceMapConsumer_hasContentsOfAllSources() {
+	    if (!this.sourcesContent) {
+	      return false;
+	    }
+	    return this.sourcesContent.length >= this._sources.size() &&
+	      !this.sourcesContent.some(function (sc) { return sc == null; });
+	  };
+
+	/**
+	 * Returns the original source content. The only argument is the url of the
+	 * original source file. Returns null if no original source content is
+	 * available.
+	 */
+	BasicSourceMapConsumer.prototype.sourceContentFor =
+	  function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
+	    if (!this.sourcesContent) {
+	      return null;
+	    }
+
+	    if (this.sourceRoot != null) {
+	      aSource = util.relative(this.sourceRoot, aSource);
+	    }
+
+	    if (this._sources.has(aSource)) {
+	      return this.sourcesContent[this._sources.indexOf(aSource)];
+	    }
+
+	    var url;
+	    if (this.sourceRoot != null
+	        && (url = util.urlParse(this.sourceRoot))) {
+	      // XXX: file:// URIs and absolute paths lead to unexpected behavior for
+	      // many users. We can help them out when they expect file:// URIs to
+	      // behave like it would if they were running a local HTTP server. See
+	      // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.
+	      var fileUriAbsPath = aSource.replace(/^file:\/\//, "");
+	      if (url.scheme == "file"
+	          && this._sources.has(fileUriAbsPath)) {
+	        return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]
+	      }
+
+	      if ((!url.path || url.path == "/")
+	          && this._sources.has("/" + aSource)) {
+	        return this.sourcesContent[this._sources.indexOf("/" + aSource)];
+	      }
+	    }
+
+	    // This function is used recursively from
+	    // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we
+	    // don't want to throw if we can't find the source - we just want to
+	    // return null, so we provide a flag to exit gracefully.
+	    if (nullOnMissing) {
+	      return null;
+	    }
+	    else {
+	      throw new Error('"' + aSource + '" is not in the SourceMap.');
+	    }
+	  };
+
+	/**
+	 * Returns the generated line and column information for the original source,
+	 * line, and column positions provided. The only argument is an object with
+	 * the following properties:
+	 *
+	 *   - source: The filename of the original source.
+	 *   - line: The line number in the original source.
+	 *   - column: The column number in the original source.
+	 *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
+	 *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - line: The line number in the generated source, or null.
+	 *   - column: The column number in the generated source, or null.
+	 */
+	BasicSourceMapConsumer.prototype.generatedPositionFor =
+	  function SourceMapConsumer_generatedPositionFor(aArgs) {
+	    var source = util.getArg(aArgs, 'source');
+	    if (this.sourceRoot != null) {
+	      source = util.relative(this.sourceRoot, source);
+	    }
+	    if (!this._sources.has(source)) {
+	      return {
+	        line: null,
+	        column: null,
+	        lastColumn: null
+	      };
+	    }
+	    source = this._sources.indexOf(source);
+
+	    var needle = {
+	      source: source,
+	      originalLine: util.getArg(aArgs, 'line'),
+	      originalColumn: util.getArg(aArgs, 'column')
+	    };
+
+	    var index = this._findMapping(
+	      needle,
+	      this._originalMappings,
+	      "originalLine",
+	      "originalColumn",
+	      util.compareByOriginalPositions,
+	      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
+	    );
+
+	    if (index >= 0) {
+	      var mapping = this._originalMappings[index];
+
+	      if (mapping.source === needle.source) {
+	        return {
+	          line: util.getArg(mapping, 'generatedLine', null),
+	          column: util.getArg(mapping, 'generatedColumn', null),
+	          lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+	        };
+	      }
+	    }
+
+	    return {
+	      line: null,
+	      column: null,
+	      lastColumn: null
+	    };
+	  };
+
+	exports.BasicSourceMapConsumer = BasicSourceMapConsumer;
+
+	/**
+	 * An IndexedSourceMapConsumer instance represents a parsed source map which
+	 * we can query for information. It differs from BasicSourceMapConsumer in
+	 * that it takes "indexed" source maps (i.e. ones with a "sections" field) as
+	 * input.
+	 *
+	 * The only parameter is a raw source map (either as a JSON string, or already
+	 * parsed to an object). According to the spec for indexed source maps, they
+	 * have the following attributes:
+	 *
+	 *   - version: Which version of the source map spec this map is following.
+	 *   - file: Optional. The generated file this source map is associated with.
+	 *   - sections: A list of section definitions.
+	 *
+	 * Each value under the "sections" field has two fields:
+	 *   - offset: The offset into the original specified at which this section
+	 *       begins to apply, defined as an object with a "line" and "column"
+	 *       field.
+	 *   - map: A source map definition. This source map could also be indexed,
+	 *       but doesn't have to be.
+	 *
+	 * Instead of the "map" field, it's also possible to have a "url" field
+	 * specifying a URL to retrieve a source map from, but that's currently
+	 * unsupported.
+	 *
+	 * Here's an example source map, taken from the source map spec[0], but
+	 * modified to omit a section which uses the "url" field.
+	 *
+	 *  {
+	 *    version : 3,
+	 *    file: "app.js",
+	 *    sections: [{
+	 *      offset: {line:100, column:10},
+	 *      map: {
+	 *        version : 3,
+	 *        file: "section.js",
+	 *        sources: ["foo.js", "bar.js"],
+	 *        names: ["src", "maps", "are", "fun"],
+	 *        mappings: "AAAA,E;;ABCDE;"
+	 *      }
+	 *    }],
+	 *  }
+	 *
+	 * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt
+	 */
+	function IndexedSourceMapConsumer(aSourceMap) {
+	  var sourceMap = aSourceMap;
+	  if (typeof aSourceMap === 'string') {
+	    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+	  }
+
+	  var version = util.getArg(sourceMap, 'version');
+	  var sections = util.getArg(sourceMap, 'sections');
+
+	  if (version != this._version) {
+	    throw new Error('Unsupported version: ' + version);
+	  }
+
+	  this._sources = new ArraySet();
+	  this._names = new ArraySet();
+
+	  var lastOffset = {
+	    line: -1,
+	    column: 0
+	  };
+	  this._sections = sections.map(function (s) {
+	    if (s.url) {
+	      // The url field will require support for asynchronicity.
+	      // See https://github.com/mozilla/source-map/issues/16
+	      throw new Error('Support for url field in sections not implemented.');
+	    }
+	    var offset = util.getArg(s, 'offset');
+	    var offsetLine = util.getArg(offset, 'line');
+	    var offsetColumn = util.getArg(offset, 'column');
+
+	    if (offsetLine < lastOffset.line ||
+	        (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {
+	      throw new Error('Section offsets must be ordered and non-overlapping.');
+	    }
+	    lastOffset = offset;
+
+	    return {
+	      generatedOffset: {
+	        // The offset fields are 0-based, but we use 1-based indices when
+	        // encoding/decoding from VLQ.
+	        generatedLine: offsetLine + 1,
+	        generatedColumn: offsetColumn + 1
+	      },
+	      consumer: new SourceMapConsumer(util.getArg(s, 'map'))
+	    }
+	  });
+	}
+
+	IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
+	IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;
+
+	/**
+	 * The version of the source mapping spec that we are consuming.
+	 */
+	IndexedSourceMapConsumer.prototype._version = 3;
+
+	/**
+	 * The list of original sources.
+	 */
+	Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {
+	  get: function () {
+	    var sources = [];
+	    for (var i = 0; i < this._sections.length; i++) {
+	      for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {
+	        sources.push(this._sections[i].consumer.sources[j]);
+	      }
+	    }
+	    return sources;
+	  }
+	});
+
+	/**
+	 * Returns the original source, line, and column information for the generated
+	 * source's line and column positions provided. The only argument is an object
+	 * with the following properties:
+	 *
+	 *   - line: The line number in the generated source.
+	 *   - column: The column number in the generated source.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - source: The original source file, or null.
+	 *   - line: The line number in the original source, or null.
+	 *   - column: The column number in the original source, or null.
+	 *   - name: The original identifier, or null.
+	 */
+	IndexedSourceMapConsumer.prototype.originalPositionFor =
+	  function IndexedSourceMapConsumer_originalPositionFor(aArgs) {
+	    var needle = {
+	      generatedLine: util.getArg(aArgs, 'line'),
+	      generatedColumn: util.getArg(aArgs, 'column')
+	    };
+
+	    // Find the section containing the generated position we're trying to map
+	    // to an original position.
+	    var sectionIndex = binarySearch.search(needle, this._sections,
+	      function(needle, section) {
+	        var cmp = needle.generatedLine - section.generatedOffset.generatedLine;
+	        if (cmp) {
+	          return cmp;
+	        }
+
+	        return (needle.generatedColumn -
+	                section.generatedOffset.generatedColumn);
+	      });
+	    var section = this._sections[sectionIndex];
+
+	    if (!section) {
+	      return {
+	        source: null,
+	        line: null,
+	        column: null,
+	        name: null
+	      };
+	    }
+
+	    return section.consumer.originalPositionFor({
+	      line: needle.generatedLine -
+	        (section.generatedOffset.generatedLine - 1),
+	      column: needle.generatedColumn -
+	        (section.generatedOffset.generatedLine === needle.generatedLine
+	         ? section.generatedOffset.generatedColumn - 1
+	         : 0),
+	      bias: aArgs.bias
+	    });
+	  };
+
+	/**
+	 * Return true if we have the source content for every source in the source
+	 * map, false otherwise.
+	 */
+	IndexedSourceMapConsumer.prototype.hasContentsOfAllSources =
+	  function IndexedSourceMapConsumer_hasContentsOfAllSources() {
+	    return this._sections.every(function (s) {
+	      return s.consumer.hasContentsOfAllSources();
+	    });
+	  };
+
+	/**
+	 * Returns the original source content. The only argument is the url of the
+	 * original source file. Returns null if no original source content is
+	 * available.
+	 */
+	IndexedSourceMapConsumer.prototype.sourceContentFor =
+	  function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
+	    for (var i = 0; i < this._sections.length; i++) {
+	      var section = this._sections[i];
+
+	      var content = section.consumer.sourceContentFor(aSource, true);
+	      if (content) {
+	        return content;
+	      }
+	    }
+	    if (nullOnMissing) {
+	      return null;
+	    }
+	    else {
+	      throw new Error('"' + aSource + '" is not in the SourceMap.');
+	    }
+	  };
+
+	/**
+	 * Returns the generated line and column information for the original source,
+	 * line, and column positions provided. The only argument is an object with
+	 * the following properties:
+	 *
+	 *   - source: The filename of the original source.
+	 *   - line: The line number in the original source.
+	 *   - column: The column number in the original source.
+	 *
+	 * and an object is returned with the following properties:
+	 *
+	 *   - line: The line number in the generated source, or null.
+	 *   - column: The column number in the generated source, or null.
+	 */
+	IndexedSourceMapConsumer.prototype.generatedPositionFor =
+	  function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {
+	    for (var i = 0; i < this._sections.length; i++) {
+	      var section = this._sections[i];
+
+	      // Only consider this section if the requested source is in the list of
+	      // sources of the consumer.
+	      if (section.consumer.sources.indexOf(util.getArg(aArgs, 'source')) === -1) {
+	        continue;
+	      }
+	      var generatedPosition = section.consumer.generatedPositionFor(aArgs);
+	      if (generatedPosition) {
+	        var ret = {
+	          line: generatedPosition.line +
+	            (section.generatedOffset.generatedLine - 1),
+	          column: generatedPosition.column +
+	            (section.generatedOffset.generatedLine === generatedPosition.line
+	             ? section.generatedOffset.generatedColumn - 1
+	             : 0)
+	        };
+	        return ret;
+	      }
+	    }
+
+	    return {
+	      line: null,
+	      column: null
+	    };
+	  };
+
+	/**
+	 * Parse the mappings in a string in to a data structure which we can easily
+	 * query (the ordered arrays in the `this.__generatedMappings` and
+	 * `this.__originalMappings` properties).
+	 */
+	IndexedSourceMapConsumer.prototype._parseMappings =
+	  function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+	    this.__generatedMappings = [];
+	    this.__originalMappings = [];
+	    for (var i = 0; i < this._sections.length; i++) {
+	      var section = this._sections[i];
+	      var sectionMappings = section.consumer._generatedMappings;
+	      for (var j = 0; j < sectionMappings.length; j++) {
+	        var mapping = sectionMappings[j];
+
+	        var source = section.consumer._sources.at(mapping.source);
+	        if (section.consumer.sourceRoot !== null) {
+	          source = util.join(section.consumer.sourceRoot, source);
+	        }
+	        this._sources.add(source);
+	        source = this._sources.indexOf(source);
+
+	        var name = section.consumer._names.at(mapping.name);
+	        this._names.add(name);
+	        name = this._names.indexOf(name);
+
+	        // The mappings coming from the consumer for the section have
+	        // generated positions relative to the start of the section, so we
+	        // need to offset them to be relative to the start of the concatenated
+	        // generated file.
+	        var adjustedMapping = {
+	          source: source,
+	          generatedLine: mapping.generatedLine +
+	            (section.generatedOffset.generatedLine - 1),
+	          generatedColumn: mapping.generatedColumn +
+	            (section.generatedOffset.generatedLine === mapping.generatedLine
+	            ? section.generatedOffset.generatedColumn - 1
+	            : 0),
+	          originalLine: mapping.originalLine,
+	          originalColumn: mapping.originalColumn,
+	          name: name
+	        };
+
+	        this.__generatedMappings.push(adjustedMapping);
+	        if (typeof adjustedMapping.originalLine === 'number') {
+	          this.__originalMappings.push(adjustedMapping);
+	        }
+	      }
+	    }
+
+	    quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);
+	    quickSort(this.__originalMappings, util.compareByOriginalPositions);
+	  };
+
+	exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	exports.GREATEST_LOWER_BOUND = 1;
+	exports.LEAST_UPPER_BOUND = 2;
+
+	/**
+	 * Recursive implementation of binary search.
+	 *
+	 * @param aLow Indices here and lower do not contain the needle.
+	 * @param aHigh Indices here and higher do not contain the needle.
+	 * @param aNeedle The element being searched for.
+	 * @param aHaystack The non-empty array being searched.
+	 * @param aCompare Function which takes two elements and returns -1, 0, or 1.
+	 * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+	 *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 */
+	function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {
+	  // This function terminates when one of the following is true:
+	  //
+	  //   1. We find the exact element we are looking for.
+	  //
+	  //   2. We did not find the exact element, but we can return the index of
+	  //      the next-closest element.
+	  //
+	  //   3. We did not find the exact element, and there is no next-closest
+	  //      element than the one we are searching for, so we return -1.
+	  var mid = Math.floor((aHigh - aLow) / 2) + aLow;
+	  var cmp = aCompare(aNeedle, aHaystack[mid], true);
+	  if (cmp === 0) {
+	    // Found the element we are looking for.
+	    return mid;
+	  }
+	  else if (cmp > 0) {
+	    // Our needle is greater than aHaystack[mid].
+	    if (aHigh - mid > 1) {
+	      // The element is in the upper half.
+	      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);
+	    }
+
+	    // The exact needle element was not found in this haystack. Determine if
+	    // we are in termination case (3) or (2) and return the appropriate thing.
+	    if (aBias == exports.LEAST_UPPER_BOUND) {
+	      return aHigh < aHaystack.length ? aHigh : -1;
+	    } else {
+	      return mid;
+	    }
+	  }
+	  else {
+	    // Our needle is less than aHaystack[mid].
+	    if (mid - aLow > 1) {
+	      // The element is in the lower half.
+	      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);
+	    }
+
+	    // we are in termination case (3) or (2) and return the appropriate thing.
+	    if (aBias == exports.LEAST_UPPER_BOUND) {
+	      return mid;
+	    } else {
+	      return aLow < 0 ? -1 : aLow;
+	    }
+	  }
+	}
+
+	/**
+	 * This is an implementation of binary search which will always try and return
+	 * the index of the closest element if there is no exact hit. This is because
+	 * mappings between original and generated line/col pairs are single points,
+	 * and there is an implicit region between each of them, so a miss just means
+	 * that you aren't on the very start of a region.
+	 *
+	 * @param aNeedle The element you are looking for.
+	 * @param aHaystack The array that is being searched.
+	 * @param aCompare A function which takes the needle and an element in the
+	 *     array and returns -1, 0, or 1 depending on whether the needle is less
+	 *     than, equal to, or greater than the element, respectively.
+	 * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+	 *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+	 *     closest element that is smaller than or greater than the one we are
+	 *     searching for, respectively, if the exact element cannot be found.
+	 *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.
+	 */
+	exports.search = function search(aNeedle, aHaystack, aCompare, aBias) {
+	  if (aHaystack.length === 0) {
+	    return -1;
+	  }
+
+	  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,
+	                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);
+	  if (index < 0) {
+	    return -1;
+	  }
+
+	  // We have found either the exact element, or the next-closest element than
+	  // the one we are searching for. However, there may be more than one such
+	  // element. Make sure we always return the smallest of these.
+	  while (index - 1 >= 0) {
+	    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {
+	      break;
+	    }
+	    --index;
+	  }
+
+	  return index;
+	};
+
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	// It turns out that some (most?) JavaScript engines don't self-host
+	// `Array.prototype.sort`. This makes sense because C++ will likely remain
+	// faster than JS when doing raw CPU-intensive sorting. However, when using a
+	// custom comparator function, calling back and forth between the VM's C++ and
+	// JIT'd JS is rather slow *and* loses JIT type information, resulting in
+	// worse generated code for the comparator function than would be optimal. In
+	// fact, when sorting with a comparator, these costs outweigh the benefits of
+	// sorting in C++. By using our own JS-implemented Quick Sort (below), we get
+	// a ~3500ms mean speed-up in `bench/bench.html`.
+
+	/**
+	 * Swap the elements indexed by `x` and `y` in the array `ary`.
+	 *
+	 * @param {Array} ary
+	 *        The array.
+	 * @param {Number} x
+	 *        The index of the first item.
+	 * @param {Number} y
+	 *        The index of the second item.
+	 */
+	function swap(ary, x, y) {
+	  var temp = ary[x];
+	  ary[x] = ary[y];
+	  ary[y] = temp;
+	}
+
+	/**
+	 * Returns a random integer within the range `low .. high` inclusive.
+	 *
+	 * @param {Number} low
+	 *        The lower bound on the range.
+	 * @param {Number} high
+	 *        The upper bound on the range.
+	 */
+	function randomIntInRange(low, high) {
+	  return Math.round(low + (Math.random() * (high - low)));
+	}
+
+	/**
+	 * The Quick Sort algorithm.
+	 *
+	 * @param {Array} ary
+	 *        An array to sort.
+	 * @param {function} comparator
+	 *        Function to use to compare two items.
+	 * @param {Number} p
+	 *        Start index of the array
+	 * @param {Number} r
+	 *        End index of the array
+	 */
+	function doQuickSort(ary, comparator, p, r) {
+	  // If our lower bound is less than our upper bound, we (1) partition the
+	  // array into two pieces and (2) recurse on each half. If it is not, this is
+	  // the empty array and our base case.
+
+	  if (p < r) {
+	    // (1) Partitioning.
+	    //
+	    // The partitioning chooses a pivot between `p` and `r` and moves all
+	    // elements that are less than or equal to the pivot to the before it, and
+	    // all the elements that are greater than it after it. The effect is that
+	    // once partition is done, the pivot is in the exact place it will be when
+	    // the array is put in sorted order, and it will not need to be moved
+	    // again. This runs in O(n) time.
+
+	    // Always choose a random pivot so that an input array which is reverse
+	    // sorted does not cause O(n^2) running time.
+	    var pivotIndex = randomIntInRange(p, r);
+	    var i = p - 1;
+
+	    swap(ary, pivotIndex, r);
+	    var pivot = ary[r];
+
+	    // Immediately after `j` is incremented in this loop, the following hold
+	    // true:
+	    //
+	    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.
+	    //
+	    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.
+	    for (var j = p; j < r; j++) {
+	      if (comparator(ary[j], pivot) <= 0) {
+	        i += 1;
+	        swap(ary, i, j);
+	      }
+	    }
+
+	    swap(ary, i + 1, j);
+	    var q = i + 1;
+
+	    // (2) Recurse on each half.
+
+	    doQuickSort(ary, comparator, p, q - 1);
+	    doQuickSort(ary, comparator, q + 1, r);
+	  }
+	}
+
+	/**
+	 * Sort the given array in-place with the given comparator function.
+	 *
+	 * @param {Array} ary
+	 *        An array to sort.
+	 * @param {function} comparator
+	 *        Function to use to compare two items.
+	 */
+	exports.quickSort = function (ary, comparator) {
+	  doQuickSort(ary, comparator, 0, ary.length - 1);
+	};
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/* -*- Mode: js; js-indent-level: 2; -*- */
+	/*
+	 * Copyright 2011 Mozilla Foundation and contributors
+	 * Licensed under the New BSD license. See LICENSE or:
+	 * http://opensource.org/licenses/BSD-3-Clause
+	 */
+
+	var SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;
+	var util = __webpack_require__(4);
+
+	// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other
+	// operating systems these days (capturing the result).
+	var REGEX_NEWLINE = /(\r?\n)/;
+
+	// Newline character code for charCodeAt() comparisons
+	var NEWLINE_CODE = 10;
+
+	// Private symbol for identifying `SourceNode`s when multiple versions of
+	// the source-map library are loaded. This MUST NOT CHANGE across
+	// versions!
+	var isSourceNode = "$$$isSourceNode$$$";
+
+	/**
+	 * SourceNodes provide a way to abstract over interpolating/concatenating
+	 * snippets of generated JavaScript source code while maintaining the line and
+	 * column information associated with the original source code.
+	 *
+	 * @param aLine The original line number.
+	 * @param aColumn The original column number.
+	 * @param aSource The original source's filename.
+	 * @param aChunks Optional. An array of strings which are snippets of
+	 *        generated JS, or other SourceNodes.
+	 * @param aName The original identifier.
+	 */
+	function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
+	  this.children = [];
+	  this.sourceContents = {};
+	  this.line = aLine == null ? null : aLine;
+	  this.column = aColumn == null ? null : aColumn;
+	  this.source = aSource == null ? null : aSource;
+	  this.name = aName == null ? null : aName;
+	  this[isSourceNode] = true;
+	  if (aChunks != null) this.add(aChunks);
+	}
+
+	/**
+	 * Creates a SourceNode from generated code and a SourceMapConsumer.
+	 *
+	 * @param aGeneratedCode The generated code
+	 * @param aSourceMapConsumer The SourceMap for the generated code
+	 * @param aRelativePath Optional. The path that relative sources in the
+	 *        SourceMapConsumer should be relative to.
+	 */
+	SourceNode.fromStringWithSourceMap =
+	  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {
+	    // The SourceNode we want to fill with the generated code
+	    // and the SourceMap
+	    var node = new SourceNode();
+
+	    // All even indices of this array are one line of the generated code,
+	    // while all odd indices are the newlines between two adjacent lines
+	    // (since `REGEX_NEWLINE` captures its match).
+	    // Processed fragments are accessed by calling `shiftNextLine`.
+	    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);
+	    var remainingLinesIndex = 0;
+	    var shiftNextLine = function() {
+	      var lineContents = getNextLine();
+	      // The last line of a file might not have a newline.
+	      var newLine = getNextLine() || "";
+	      return lineContents + newLine;
+
+	      function getNextLine() {
+	        return remainingLinesIndex < remainingLines.length ?
+	            remainingLines[remainingLinesIndex++] : undefined;
+	      }
+	    };
+
+	    // We need to remember the position of "remainingLines"
+	    var lastGeneratedLine = 1, lastGeneratedColumn = 0;
+
+	    // The generate SourceNodes we need a code range.
+	    // To extract it current and last mapping is used.
+	    // Here we store the last mapping.
+	    var lastMapping = null;
+
+	    aSourceMapConsumer.eachMapping(function (mapping) {
+	      if (lastMapping !== null) {
+	        // We add the code from "lastMapping" to "mapping":
+	        // First check if there is a new line in between.
+	        if (lastGeneratedLine < mapping.generatedLine) {
+	          // Associate first line with "lastMapping"
+	          addMappingWithCode(lastMapping, shiftNextLine());
+	          lastGeneratedLine++;
+	          lastGeneratedColumn = 0;
+	          // The remaining code is added without mapping
+	        } else {
+	          // There is no new line in between.
+	          // Associate the code between "lastGeneratedColumn" and
+	          // "mapping.generatedColumn" with "lastMapping"
+	          var nextLine = remainingLines[remainingLinesIndex];
+	          var code = nextLine.substr(0, mapping.generatedColumn -
+	                                        lastGeneratedColumn);
+	          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -
+	                                              lastGeneratedColumn);
+	          lastGeneratedColumn = mapping.generatedColumn;
+	          addMappingWithCode(lastMapping, code);
+	          // No more remaining code, continue
+	          lastMapping = mapping;
+	          return;
+	        }
+	      }
+	      // We add the generated code until the first mapping
+	      // to the SourceNode without any mapping.
+	      // Each line is added as separate string.
+	      while (lastGeneratedLine < mapping.generatedLine) {
+	        node.add(shiftNextLine());
+	        lastGeneratedLine++;
+	      }
+	      if (lastGeneratedColumn < mapping.generatedColumn) {
+	        var nextLine = remainingLines[remainingLinesIndex];
+	        node.add(nextLine.substr(0, mapping.generatedColumn));
+	        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);
+	        lastGeneratedColumn = mapping.generatedColumn;
+	      }
+	      lastMapping = mapping;
+	    }, this);
+	    // We have processed all mappings.
+	    if (remainingLinesIndex < remainingLines.length) {
+	      if (lastMapping) {
+	        // Associate the remaining code in the current line with "lastMapping"
+	        addMappingWithCode(lastMapping, shiftNextLine());
+	      }
+	      // and add the remaining lines without any mapping
+	      node.add(remainingLines.splice(remainingLinesIndex).join(""));
+	    }
+
+	    // Copy sourcesContent into SourceNode
+	    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+	      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+	      if (content != null) {
+	        if (aRelativePath != null) {
+	          sourceFile = util.join(aRelativePath, sourceFile);
+	        }
+	        node.setSourceContent(sourceFile, content);
+	      }
+	    });
+
+	    return node;
+
+	    function addMappingWithCode(mapping, code) {
+	      if (mapping === null || mapping.source === undefined) {
+	        node.add(code);
+	      } else {
+	        var source = aRelativePath
+	          ? util.join(aRelativePath, mapping.source)
+	          : mapping.source;
+	        node.add(new SourceNode(mapping.originalLine,
+	                                mapping.originalColumn,
+	                                source,
+	                                code,
+	                                mapping.name));
+	      }
+	    }
+	  };
+
+	/**
+	 * Add a chunk of generated JS to this source node.
+	 *
+	 * @param aChunk A string snippet of generated JS code, another instance of
+	 *        SourceNode, or an array where each member is one of those things.
+	 */
+	SourceNode.prototype.add = function SourceNode_add(aChunk) {
+	  if (Array.isArray(aChunk)) {
+	    aChunk.forEach(function (chunk) {
+	      this.add(chunk);
+	    }, this);
+	  }
+	  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+	    if (aChunk) {
+	      this.children.push(aChunk);
+	    }
+	  }
+	  else {
+	    throw new TypeError(
+	      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+	    );
+	  }
+	  return this;
+	};
+
+	/**
+	 * Add a chunk of generated JS to the beginning of this source node.
+	 *
+	 * @param aChunk A string snippet of generated JS code, another instance of
+	 *        SourceNode, or an array where each member is one of those things.
+	 */
+	SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
+	  if (Array.isArray(aChunk)) {
+	    for (var i = aChunk.length-1; i >= 0; i--) {
+	      this.prepend(aChunk[i]);
+	    }
+	  }
+	  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+	    this.children.unshift(aChunk);
+	  }
+	  else {
+	    throw new TypeError(
+	      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+	    );
+	  }
+	  return this;
+	};
+
+	/**
+	 * Walk over the tree of JS snippets in this node and its children. The
+	 * walking function is called once for each snippet of JS and is passed that
+	 * snippet and the its original associated source's line/column location.
+	 *
+	 * @param aFn The traversal function.
+	 */
+	SourceNode.prototype.walk = function SourceNode_walk(aFn) {
+	  var chunk;
+	  for (var i = 0, len = this.children.length; i < len; i++) {
+	    chunk = this.children[i];
+	    if (chunk[isSourceNode]) {
+	      chunk.walk(aFn);
+	    }
+	    else {
+	      if (chunk !== '') {
+	        aFn(chunk, { source: this.source,
+	                     line: this.line,
+	                     column: this.column,
+	                     name: this.name });
+	      }
+	    }
+	  }
+	};
+
+	/**
+	 * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
+	 * each of `this.children`.
+	 *
+	 * @param aSep The separator.
+	 */
+	SourceNode.prototype.join = function SourceNode_join(aSep) {
+	  var newChildren;
+	  var i;
+	  var len = this.children.length;
+	  if (len > 0) {
+	    newChildren = [];
+	    for (i = 0; i < len-1; i++) {
+	      newChildren.push(this.children[i]);
+	      newChildren.push(aSep);
+	    }
+	    newChildren.push(this.children[i]);
+	    this.children = newChildren;
+	  }
+	  return this;
+	};
+
+	/**
+	 * Call String.prototype.replace on the very right-most source snippet. Useful
+	 * for trimming whitespace from the end of a source node, etc.
+	 *
+	 * @param aPattern The pattern to replace.
+	 * @param aReplacement The thing to replace the pattern with.
+	 */
+	SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
+	  var lastChild = this.children[this.children.length - 1];
+	  if (lastChild[isSourceNode]) {
+	    lastChild.replaceRight(aPattern, aReplacement);
+	  }
+	  else if (typeof lastChild === 'string') {
+	    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
+	  }
+	  else {
+	    this.children.push(''.replace(aPattern, aReplacement));
+	  }
+	  return this;
+	};
+
+	/**
+	 * Set the source content for a source file. This will be added to the SourceMapGenerator
+	 * in the sourcesContent field.
+	 *
+	 * @param aSourceFile The filename of the source file
+	 * @param aSourceContent The content of the source file
+	 */
+	SourceNode.prototype.setSourceContent =
+	  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
+	    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
+	  };
+
+	/**
+	 * Walk over the tree of SourceNodes. The walking function is called for each
+	 * source file content and is passed the filename and source content.
+	 *
+	 * @param aFn The traversal function.
+	 */
+	SourceNode.prototype.walkSourceContents =
+	  function SourceNode_walkSourceContents(aFn) {
+	    for (var i = 0, len = this.children.length; i < len; i++) {
+	      if (this.children[i][isSourceNode]) {
+	        this.children[i].walkSourceContents(aFn);
+	      }
+	    }
+
+	    var sources = Object.keys(this.sourceContents);
+	    for (var i = 0, len = sources.length; i < len; i++) {
+	      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
+	    }
+	  };
+
+	/**
+	 * Return the string representation of this source node. Walks over the tree
+	 * and concatenates all the various snippets together to one string.
+	 */
+	SourceNode.prototype.toString = function SourceNode_toString() {
+	  var str = "";
+	  this.walk(function (chunk) {
+	    str += chunk;
+	  });
+	  return str;
+	};
+
+	/**
+	 * Returns the string representation of this source node along with a source
+	 * map.
+	 */
+	SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
+	  var generated = {
+	    code: "",
+	    line: 1,
+	    column: 0
+	  };
+	  var map = new SourceMapGenerator(aArgs);
+	  var sourceMappingActive = false;
+	  var lastOriginalSource = null;
+	  var lastOriginalLine = null;
+	  var lastOriginalColumn = null;
+	  var lastOriginalName = null;
+	  this.walk(function (chunk, original) {
+	    generated.code += chunk;
+	    if (original.source !== null
+	        && original.line !== null
+	        && original.column !== null) {
+	      if(lastOriginalSource !== original.source
+	         || lastOriginalLine !== original.line
+	         || lastOriginalColumn !== original.column
+	         || lastOriginalName !== original.name) {
+	        map.addMapping({
+	          source: original.source,
+	          original: {
+	            line: original.line,
+	            column: original.column
+	          },
+	          generated: {
+	            line: generated.line,
+	            column: generated.column
+	          },
+	          name: original.name
+	        });
+	      }
+	      lastOriginalSource = original.source;
+	      lastOriginalLine = original.line;
+	      lastOriginalColumn = original.column;
+	      lastOriginalName = original.name;
+	      sourceMappingActive = true;
+	    } else if (sourceMappingActive) {
+	      map.addMapping({
+	        generated: {
+	          line: generated.line,
+	          column: generated.column
+	        }
+	      });
+	      lastOriginalSource = null;
+	      sourceMappingActive = false;
+	    }
+	    for (var idx = 0, length = chunk.length; idx < length; idx++) {
+	      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {
+	        generated.line++;
+	        generated.column = 0;
+	        // Mappings end at eol
+	        if (idx + 1 === length) {
+	          lastOriginalSource = null;
+	          sourceMappingActive = false;
+	        } else if (sourceMappingActive) {
+	          map.addMapping({
+	            source: original.source,
+	            original: {
+	              line: original.line,
+	              column: original.column
+	            },
+	            generated: {
+	              line: generated.line,
+	              column: generated.column
+	            },
+	            name: original.name
+	          });
+	        }
+	      } else {
+	        generated.column++;
+	      }
+	    }
+	  });
+	  this.walkSourceContents(function (sourceFile, sourceContent) {
+	    map.setSourceContent(sourceFile, sourceContent);
+	  });
+
+	  return { code: generated.code, map: map };
+	};
+
+	exports.SourceNode = SourceNode;
+
+
+/***/ })
+/******/ ])
+});
+;
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/source-map/dist/source-map.min.js b/node_modules/@babel/core/node_modules/source-map/dist/source-map.min.js
new file mode 100644
index 00000000..f2a46bd0
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/dist/source-map.min.js
@@ -0,0 +1,2 @@
+!function(e,n){"object"==typeof exports&&"object"==typeof module?module.exports=n():"function"==typeof define&&define.amd?define([],n):"object"==typeof exports?exports.sourceMap=n():e.sourceMap=n()}(this,function(){return function(e){function n(t){if(r[t])return r[t].exports;var o=r[t]={exports:{},id:t,loaded:!1};return e[t].call(o.exports,o,o.exports,n),o.loaded=!0,o.exports}var r={};return n.m=e,n.c=r,n.p="",n(0)}([function(e,n,r){n.SourceMapGenerator=r(1).SourceMapGenerator,n.SourceMapConsumer=r(7).SourceMapConsumer,n.SourceNode=r(10).SourceNode},function(e,n,r){function t(e){e||(e={}),this._file=i.getArg(e,"file",null),this._sourceRoot=i.getArg(e,"sourceRoot",null),this._skipValidation=i.getArg(e,"skipValidation",!1),this._sources=new s,this._names=new s,this._mappings=new a,this._sourcesContents=null}var o=r(2),i=r(4),s=r(5).ArraySet,a=r(6).MappingList;t.prototype._version=3,t.fromSourceMap=function(e){var n=e.sourceRoot,r=new t({file:e.file,sourceRoot:n});return e.eachMapping(function(e){var t={generated:{line:e.generatedLine,column:e.generatedColumn}};null!=e.source&&(t.source=e.source,null!=n&&(t.source=i.relative(n,t.source)),t.original={line:e.originalLine,column:e.originalColumn},null!=e.name&&(t.name=e.name)),r.addMapping(t)}),e.sources.forEach(function(n){var t=e.sourceContentFor(n);null!=t&&r.setSourceContent(n,t)}),r},t.prototype.addMapping=function(e){var n=i.getArg(e,"generated"),r=i.getArg(e,"original",null),t=i.getArg(e,"source",null),o=i.getArg(e,"name",null);this._skipValidation||this._validateMapping(n,r,t,o),null!=t&&(t=String(t),this._sources.has(t)||this._sources.add(t)),null!=o&&(o=String(o),this._names.has(o)||this._names.add(o)),this._mappings.add({generatedLine:n.line,generatedColumn:n.column,originalLine:null!=r&&r.line,originalColumn:null!=r&&r.column,source:t,name:o})},t.prototype.setSourceContent=function(e,n){var r=e;null!=this._sourceRoot&&(r=i.relative(this._sourceRoot,r)),null!=n?(this._sourcesContents||(this._sourcesContents=Object.create(null)),this._sourcesContents[i.toSetString(r)]=n):this._sourcesContents&&(delete this._sourcesContents[i.toSetString(r)],0===Object.keys(this._sourcesContents).length&&(this._sourcesContents=null))},t.prototype.applySourceMap=function(e,n,r){var t=n;if(null==n){if(null==e.file)throw new Error('SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, or the source map\'s "file" property. Both were omitted.');t=e.file}var o=this._sourceRoot;null!=o&&(t=i.relative(o,t));var a=new s,u=new s;this._mappings.unsortedForEach(function(n){if(n.source===t&&null!=n.originalLine){var s=e.originalPositionFor({line:n.originalLine,column:n.originalColumn});null!=s.source&&(n.source=s.source,null!=r&&(n.source=i.join(r,n.source)),null!=o&&(n.source=i.relative(o,n.source)),n.originalLine=s.line,n.originalColumn=s.column,null!=s.name&&(n.name=s.name))}var l=n.source;null==l||a.has(l)||a.add(l);var c=n.name;null==c||u.has(c)||u.add(c)},this),this._sources=a,this._names=u,e.sources.forEach(function(n){var t=e.sourceContentFor(n);null!=t&&(null!=r&&(n=i.join(r,n)),null!=o&&(n=i.relative(o,n)),this.setSourceContent(n,t))},this)},t.prototype._validateMapping=function(e,n,r,t){if(n&&"number"!=typeof n.line&&"number"!=typeof n.column)throw new Error("original.line and original.column are not numbers -- you probably meant to omit the original mapping entirely and only map the generated position. If so, pass null for the original mapping instead of an object with empty or null values.");if((!(e&&"line"in e&&"column"in e&&e.line>0&&e.column>=0)||n||r||t)&&!(e&&"line"in e&&"column"in e&&n&&"line"in n&&"column"in n&&e.line>0&&e.column>=0&&n.line>0&&n.column>=0&&r))throw new Error("Invalid mapping: "+JSON.stringify({generated:e,source:r,original:n,name:t}))},t.prototype._serializeMappings=function(){for(var e,n,r,t,s=0,a=1,u=0,l=0,c=0,g=0,p="",h=this._mappings.toArray(),f=0,d=h.length;f<d;f++){if(n=h[f],e="",n.generatedLine!==a)for(s=0;n.generatedLine!==a;)e+=";",a++;else if(f>0){if(!i.compareByGeneratedPositionsInflated(n,h[f-1]))continue;e+=","}e+=o.encode(n.generatedColumn-s),s=n.generatedColumn,null!=n.source&&(t=this._sources.indexOf(n.source),e+=o.encode(t-g),g=t,e+=o.encode(n.originalLine-1-l),l=n.originalLine-1,e+=o.encode(n.originalColumn-u),u=n.originalColumn,null!=n.name&&(r=this._names.indexOf(n.name),e+=o.encode(r-c),c=r)),p+=e}return p},t.prototype._generateSourcesContent=function(e,n){return e.map(function(e){if(!this._sourcesContents)return null;null!=n&&(e=i.relative(n,e));var r=i.toSetString(e);return Object.prototype.hasOwnProperty.call(this._sourcesContents,r)?this._sourcesContents[r]:null},this)},t.prototype.toJSON=function(){var e={version:this._version,sources:this._sources.toArray(),names:this._names.toArray(),mappings:this._serializeMappings()};return null!=this._file&&(e.file=this._file),null!=this._sourceRoot&&(e.sourceRoot=this._sourceRoot),this._sourcesContents&&(e.sourcesContent=this._generateSourcesContent(e.sources,e.sourceRoot)),e},t.prototype.toString=function(){return JSON.stringify(this.toJSON())},n.SourceMapGenerator=t},function(e,n,r){function t(e){return e<0?(-e<<1)+1:(e<<1)+0}function o(e){var n=1===(1&e),r=e>>1;return n?-r:r}var i=r(3),s=5,a=1<<s,u=a-1,l=a;n.encode=function(e){var n,r="",o=t(e);do n=o&u,o>>>=s,o>0&&(n|=l),r+=i.encode(n);while(o>0);return r},n.decode=function(e,n,r){var t,a,c=e.length,g=0,p=0;do{if(n>=c)throw new Error("Expected more digits in base 64 VLQ value.");if(a=i.decode(e.charCodeAt(n++)),a===-1)throw new Error("Invalid base64 digit: "+e.charAt(n-1));t=!!(a&l),a&=u,g+=a<<p,p+=s}while(t);r.value=o(g),r.rest=n}},function(e,n){var r="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".split("");n.encode=function(e){if(0<=e&&e<r.length)return r[e];throw new TypeError("Must be between 0 and 63: "+e)},n.decode=function(e){var n=65,r=90,t=97,o=122,i=48,s=57,a=43,u=47,l=26,c=52;return n<=e&&e<=r?e-n:t<=e&&e<=o?e-t+l:i<=e&&e<=s?e-i+c:e==a?62:e==u?63:-1}},function(e,n){function r(e,n,r){if(n in e)return e[n];if(3===arguments.length)return r;throw new Error('"'+n+'" is a required argument.')}function t(e){var n=e.match(m);return n?{scheme:n[1],auth:n[2],host:n[3],port:n[4],path:n[5]}:null}function o(e){var n="";return e.scheme&&(n+=e.scheme+":"),n+="//",e.auth&&(n+=e.auth+"@"),e.host&&(n+=e.host),e.port&&(n+=":"+e.port),e.path&&(n+=e.path),n}function i(e){var r=e,i=t(e);if(i){if(!i.path)return e;r=i.path}for(var s,a=n.isAbsolute(r),u=r.split(/\/+/),l=0,c=u.length-1;c>=0;c--)s=u[c],"."===s?u.splice(c,1):".."===s?l++:l>0&&(""===s?(u.splice(c+1,l),l=0):(u.splice(c,2),l--));return r=u.join("/"),""===r&&(r=a?"/":"."),i?(i.path=r,o(i)):r}function s(e,n){""===e&&(e="."),""===n&&(n=".");var r=t(n),s=t(e);if(s&&(e=s.path||"/"),r&&!r.scheme)return s&&(r.scheme=s.scheme),o(r);if(r||n.match(_))return n;if(s&&!s.host&&!s.path)return s.host=n,o(s);var a="/"===n.charAt(0)?n:i(e.replace(/\/+$/,"")+"/"+n);return s?(s.path=a,o(s)):a}function a(e,n){""===e&&(e="."),e=e.replace(/\/$/,"");for(var r=0;0!==n.indexOf(e+"/");){var t=e.lastIndexOf("/");if(t<0)return n;if(e=e.slice(0,t),e.match(/^([^\/]+:\/)?\/*$/))return n;++r}return Array(r+1).join("../")+n.substr(e.length+1)}function u(e){return e}function l(e){return g(e)?"$"+e:e}function c(e){return g(e)?e.slice(1):e}function g(e){if(!e)return!1;var n=e.length;if(n<9)return!1;if(95!==e.charCodeAt(n-1)||95!==e.charCodeAt(n-2)||111!==e.charCodeAt(n-3)||116!==e.charCodeAt(n-4)||111!==e.charCodeAt(n-5)||114!==e.charCodeAt(n-6)||112!==e.charCodeAt(n-7)||95!==e.charCodeAt(n-8)||95!==e.charCodeAt(n-9))return!1;for(var r=n-10;r>=0;r--)if(36!==e.charCodeAt(r))return!1;return!0}function p(e,n,r){var t=e.source-n.source;return 0!==t?t:(t=e.originalLine-n.originalLine,0!==t?t:(t=e.originalColumn-n.originalColumn,0!==t||r?t:(t=e.generatedColumn-n.generatedColumn,0!==t?t:(t=e.generatedLine-n.generatedLine,0!==t?t:e.name-n.name))))}function h(e,n,r){var t=e.generatedLine-n.generatedLine;return 0!==t?t:(t=e.generatedColumn-n.generatedColumn,0!==t||r?t:(t=e.source-n.source,0!==t?t:(t=e.originalLine-n.originalLine,0!==t?t:(t=e.originalColumn-n.originalColumn,0!==t?t:e.name-n.name))))}function f(e,n){return e===n?0:e>n?1:-1}function d(e,n){var r=e.generatedLine-n.generatedLine;return 0!==r?r:(r=e.generatedColumn-n.generatedColumn,0!==r?r:(r=f(e.source,n.source),0!==r?r:(r=e.originalLine-n.originalLine,0!==r?r:(r=e.originalColumn-n.originalColumn,0!==r?r:f(e.name,n.name)))))}n.getArg=r;var m=/^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.]*)(?::(\d+))?(\S*)$/,_=/^data:.+\,.+$/;n.urlParse=t,n.urlGenerate=o,n.normalize=i,n.join=s,n.isAbsolute=function(e){return"/"===e.charAt(0)||!!e.match(m)},n.relative=a;var v=function(){var e=Object.create(null);return!("__proto__"in e)}();n.toSetString=v?u:l,n.fromSetString=v?u:c,n.compareByOriginalPositions=p,n.compareByGeneratedPositionsDeflated=h,n.compareByGeneratedPositionsInflated=d},function(e,n,r){function t(){this._array=[],this._set=s?new Map:Object.create(null)}var o=r(4),i=Object.prototype.hasOwnProperty,s="undefined"!=typeof Map;t.fromArray=function(e,n){for(var r=new t,o=0,i=e.length;o<i;o++)r.add(e[o],n);return r},t.prototype.size=function(){return s?this._set.size:Object.getOwnPropertyNames(this._set).length},t.prototype.add=function(e,n){var r=s?e:o.toSetString(e),t=s?this.has(e):i.call(this._set,r),a=this._array.length;t&&!n||this._array.push(e),t||(s?this._set.set(e,a):this._set[r]=a)},t.prototype.has=function(e){if(s)return this._set.has(e);var n=o.toSetString(e);return i.call(this._set,n)},t.prototype.indexOf=function(e){if(s){var n=this._set.get(e);if(n>=0)return n}else{var r=o.toSetString(e);if(i.call(this._set,r))return this._set[r]}throw new Error('"'+e+'" is not in the set.')},t.prototype.at=function(e){if(e>=0&&e<this._array.length)return this._array[e];throw new Error("No element indexed by "+e)},t.prototype.toArray=function(){return this._array.slice()},n.ArraySet=t},function(e,n,r){function t(e,n){var r=e.generatedLine,t=n.generatedLine,o=e.generatedColumn,s=n.generatedColumn;return t>r||t==r&&s>=o||i.compareByGeneratedPositionsInflated(e,n)<=0}function o(){this._array=[],this._sorted=!0,this._last={generatedLine:-1,generatedColumn:0}}var i=r(4);o.prototype.unsortedForEach=function(e,n){this._array.forEach(e,n)},o.prototype.add=function(e){t(this._last,e)?(this._last=e,this._array.push(e)):(this._sorted=!1,this._array.push(e))},o.prototype.toArray=function(){return this._sorted||(this._array.sort(i.compareByGeneratedPositionsInflated),this._sorted=!0),this._array},n.MappingList=o},function(e,n,r){function t(e){var n=e;return"string"==typeof e&&(n=JSON.parse(e.replace(/^\)\]\}'/,""))),null!=n.sections?new s(n):new o(n)}function o(e){var n=e;"string"==typeof e&&(n=JSON.parse(e.replace(/^\)\]\}'/,"")));var r=a.getArg(n,"version"),t=a.getArg(n,"sources"),o=a.getArg(n,"names",[]),i=a.getArg(n,"sourceRoot",null),s=a.getArg(n,"sourcesContent",null),u=a.getArg(n,"mappings"),c=a.getArg(n,"file",null);if(r!=this._version)throw new Error("Unsupported version: "+r);t=t.map(String).map(a.normalize).map(function(e){return i&&a.isAbsolute(i)&&a.isAbsolute(e)?a.relative(i,e):e}),this._names=l.fromArray(o.map(String),!0),this._sources=l.fromArray(t,!0),this.sourceRoot=i,this.sourcesContent=s,this._mappings=u,this.file=c}function i(){this.generatedLine=0,this.generatedColumn=0,this.source=null,this.originalLine=null,this.originalColumn=null,this.name=null}function s(e){var n=e;"string"==typeof e&&(n=JSON.parse(e.replace(/^\)\]\}'/,"")));var r=a.getArg(n,"version"),o=a.getArg(n,"sections");if(r!=this._version)throw new Error("Unsupported version: "+r);this._sources=new l,this._names=new l;var i={line:-1,column:0};this._sections=o.map(function(e){if(e.url)throw new Error("Support for url field in sections not implemented.");var n=a.getArg(e,"offset"),r=a.getArg(n,"line"),o=a.getArg(n,"column");if(r<i.line||r===i.line&&o<i.column)throw new Error("Section offsets must be ordered and non-overlapping.");return i=n,{generatedOffset:{generatedLine:r+1,generatedColumn:o+1},consumer:new t(a.getArg(e,"map"))}})}var a=r(4),u=r(8),l=r(5).ArraySet,c=r(2),g=r(9).quickSort;t.fromSourceMap=function(e){return o.fromSourceMap(e)},t.prototype._version=3,t.prototype.__generatedMappings=null,Object.defineProperty(t.prototype,"_generatedMappings",{get:function(){return this.__generatedMappings||this._parseMappings(this._mappings,this.sourceRoot),this.__generatedMappings}}),t.prototype.__originalMappings=null,Object.defineProperty(t.prototype,"_originalMappings",{get:function(){return this.__originalMappings||this._parseMappings(this._mappings,this.sourceRoot),this.__originalMappings}}),t.prototype._charIsMappingSeparator=function(e,n){var r=e.charAt(n);return";"===r||","===r},t.prototype._parseMappings=function(e,n){throw new Error("Subclasses must implement _parseMappings")},t.GENERATED_ORDER=1,t.ORIGINAL_ORDER=2,t.GREATEST_LOWER_BOUND=1,t.LEAST_UPPER_BOUND=2,t.prototype.eachMapping=function(e,n,r){var o,i=n||null,s=r||t.GENERATED_ORDER;switch(s){case t.GENERATED_ORDER:o=this._generatedMappings;break;case t.ORIGINAL_ORDER:o=this._originalMappings;break;default:throw new Error("Unknown order of iteration.")}var u=this.sourceRoot;o.map(function(e){var n=null===e.source?null:this._sources.at(e.source);return null!=n&&null!=u&&(n=a.join(u,n)),{source:n,generatedLine:e.generatedLine,generatedColumn:e.generatedColumn,originalLine:e.originalLine,originalColumn:e.originalColumn,name:null===e.name?null:this._names.at(e.name)}},this).forEach(e,i)},t.prototype.allGeneratedPositionsFor=function(e){var n=a.getArg(e,"line"),r={source:a.getArg(e,"source"),originalLine:n,originalColumn:a.getArg(e,"column",0)};if(null!=this.sourceRoot&&(r.source=a.relative(this.sourceRoot,r.source)),!this._sources.has(r.source))return[];r.source=this._sources.indexOf(r.source);var t=[],o=this._findMapping(r,this._originalMappings,"originalLine","originalColumn",a.compareByOriginalPositions,u.LEAST_UPPER_BOUND);if(o>=0){var i=this._originalMappings[o];if(void 0===e.column)for(var s=i.originalLine;i&&i.originalLine===s;)t.push({line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}),i=this._originalMappings[++o];else for(var l=i.originalColumn;i&&i.originalLine===n&&i.originalColumn==l;)t.push({line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}),i=this._originalMappings[++o]}return t},n.SourceMapConsumer=t,o.prototype=Object.create(t.prototype),o.prototype.consumer=t,o.fromSourceMap=function(e){var n=Object.create(o.prototype),r=n._names=l.fromArray(e._names.toArray(),!0),t=n._sources=l.fromArray(e._sources.toArray(),!0);n.sourceRoot=e._sourceRoot,n.sourcesContent=e._generateSourcesContent(n._sources.toArray(),n.sourceRoot),n.file=e._file;for(var s=e._mappings.toArray().slice(),u=n.__generatedMappings=[],c=n.__originalMappings=[],p=0,h=s.length;p<h;p++){var f=s[p],d=new i;d.generatedLine=f.generatedLine,d.generatedColumn=f.generatedColumn,f.source&&(d.source=t.indexOf(f.source),d.originalLine=f.originalLine,d.originalColumn=f.originalColumn,f.name&&(d.name=r.indexOf(f.name)),c.push(d)),u.push(d)}return g(n.__originalMappings,a.compareByOriginalPositions),n},o.prototype._version=3,Object.defineProperty(o.prototype,"sources",{get:function(){return this._sources.toArray().map(function(e){return null!=this.sourceRoot?a.join(this.sourceRoot,e):e},this)}}),o.prototype._parseMappings=function(e,n){for(var r,t,o,s,u,l=1,p=0,h=0,f=0,d=0,m=0,_=e.length,v=0,y={},C={},A=[],S=[];v<_;)if(";"===e.charAt(v))l++,v++,p=0;else if(","===e.charAt(v))v++;else{for(r=new i,r.generatedLine=l,s=v;s<_&&!this._charIsMappingSeparator(e,s);s++);if(t=e.slice(v,s),o=y[t])v+=t.length;else{for(o=[];v<s;)c.decode(e,v,C),u=C.value,v=C.rest,o.push(u);if(2===o.length)throw new Error("Found a source, but no line and column");if(3===o.length)throw new Error("Found a source and line, but no column");y[t]=o}r.generatedColumn=p+o[0],p=r.generatedColumn,o.length>1&&(r.source=d+o[1],d+=o[1],r.originalLine=h+o[2],h=r.originalLine,r.originalLine+=1,r.originalColumn=f+o[3],f=r.originalColumn,o.length>4&&(r.name=m+o[4],m+=o[4])),S.push(r),"number"==typeof r.originalLine&&A.push(r)}g(S,a.compareByGeneratedPositionsDeflated),this.__generatedMappings=S,g(A,a.compareByOriginalPositions),this.__originalMappings=A},o.prototype._findMapping=function(e,n,r,t,o,i){if(e[r]<=0)throw new TypeError("Line must be greater than or equal to 1, got "+e[r]);if(e[t]<0)throw new TypeError("Column must be greater than or equal to 0, got "+e[t]);return u.search(e,n,o,i)},o.prototype.computeColumnSpans=function(){for(var e=0;e<this._generatedMappings.length;++e){var n=this._generatedMappings[e];if(e+1<this._generatedMappings.length){var r=this._generatedMappings[e+1];if(n.generatedLine===r.generatedLine){n.lastGeneratedColumn=r.generatedColumn-1;continue}}n.lastGeneratedColumn=1/0}},o.prototype.originalPositionFor=function(e){var n={generatedLine:a.getArg(e,"line"),generatedColumn:a.getArg(e,"column")},r=this._findMapping(n,this._generatedMappings,"generatedLine","generatedColumn",a.compareByGeneratedPositionsDeflated,a.getArg(e,"bias",t.GREATEST_LOWER_BOUND));if(r>=0){var o=this._generatedMappings[r];if(o.generatedLine===n.generatedLine){var i=a.getArg(o,"source",null);null!==i&&(i=this._sources.at(i),null!=this.sourceRoot&&(i=a.join(this.sourceRoot,i)));var s=a.getArg(o,"name",null);return null!==s&&(s=this._names.at(s)),{source:i,line:a.getArg(o,"originalLine",null),column:a.getArg(o,"originalColumn",null),name:s}}}return{source:null,line:null,column:null,name:null}},o.prototype.hasContentsOfAllSources=function(){return!!this.sourcesContent&&(this.sourcesContent.length>=this._sources.size()&&!this.sourcesContent.some(function(e){return null==e}))},o.prototype.sourceContentFor=function(e,n){if(!this.sourcesContent)return null;if(null!=this.sourceRoot&&(e=a.relative(this.sourceRoot,e)),this._sources.has(e))return this.sourcesContent[this._sources.indexOf(e)];var r;if(null!=this.sourceRoot&&(r=a.urlParse(this.sourceRoot))){var t=e.replace(/^file:\/\//,"");if("file"==r.scheme&&this._sources.has(t))return this.sourcesContent[this._sources.indexOf(t)];if((!r.path||"/"==r.path)&&this._sources.has("/"+e))return this.sourcesContent[this._sources.indexOf("/"+e)]}if(n)return null;throw new Error('"'+e+'" is not in the SourceMap.')},o.prototype.generatedPositionFor=function(e){var n=a.getArg(e,"source");if(null!=this.sourceRoot&&(n=a.relative(this.sourceRoot,n)),!this._sources.has(n))return{line:null,column:null,lastColumn:null};n=this._sources.indexOf(n);var r={source:n,originalLine:a.getArg(e,"line"),originalColumn:a.getArg(e,"column")},o=this._findMapping(r,this._originalMappings,"originalLine","originalColumn",a.compareByOriginalPositions,a.getArg(e,"bias",t.GREATEST_LOWER_BOUND));if(o>=0){var i=this._originalMappings[o];if(i.source===r.source)return{line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}}return{line:null,column:null,lastColumn:null}},n.BasicSourceMapConsumer=o,s.prototype=Object.create(t.prototype),s.prototype.constructor=t,s.prototype._version=3,Object.defineProperty(s.prototype,"sources",{get:function(){for(var e=[],n=0;n<this._sections.length;n++)for(var r=0;r<this._sections[n].consumer.sources.length;r++)e.push(this._sections[n].consumer.sources[r]);return e}}),s.prototype.originalPositionFor=function(e){var n={generatedLine:a.getArg(e,"line"),generatedColumn:a.getArg(e,"column")},r=u.search(n,this._sections,function(e,n){var r=e.generatedLine-n.generatedOffset.generatedLine;return r?r:e.generatedColumn-n.generatedOffset.generatedColumn}),t=this._sections[r];return t?t.consumer.originalPositionFor({line:n.generatedLine-(t.generatedOffset.generatedLine-1),column:n.generatedColumn-(t.generatedOffset.generatedLine===n.generatedLine?t.generatedOffset.generatedColumn-1:0),bias:e.bias}):{source:null,line:null,column:null,name:null}},s.prototype.hasContentsOfAllSources=function(){return this._sections.every(function(e){return e.consumer.hasContentsOfAllSources()})},s.prototype.sourceContentFor=function(e,n){for(var r=0;r<this._sections.length;r++){var t=this._sections[r],o=t.consumer.sourceContentFor(e,!0);if(o)return o}if(n)return null;throw new Error('"'+e+'" is not in the SourceMap.')},s.prototype.generatedPositionFor=function(e){for(var n=0;n<this._sections.length;n++){var r=this._sections[n];if(r.consumer.sources.indexOf(a.getArg(e,"source"))!==-1){var t=r.consumer.generatedPositionFor(e);if(t){var o={line:t.line+(r.generatedOffset.generatedLine-1),column:t.column+(r.generatedOffset.generatedLine===t.line?r.generatedOffset.generatedColumn-1:0)};return o}}}return{line:null,column:null}},s.prototype._parseMappings=function(e,n){this.__generatedMappings=[],this.__originalMappings=[];for(var r=0;r<this._sections.length;r++)for(var t=this._sections[r],o=t.consumer._generatedMappings,i=0;i<o.length;i++){var s=o[i],u=t.consumer._sources.at(s.source);null!==t.consumer.sourceRoot&&(u=a.join(t.consumer.sourceRoot,u)),this._sources.add(u),u=this._sources.indexOf(u);var l=t.consumer._names.at(s.name);this._names.add(l),l=this._names.indexOf(l);var c={source:u,generatedLine:s.generatedLine+(t.generatedOffset.generatedLine-1),generatedColumn:s.generatedColumn+(t.generatedOffset.generatedLine===s.generatedLine?t.generatedOffset.generatedColumn-1:0),originalLine:s.originalLine,originalColumn:s.originalColumn,name:l};this.__generatedMappings.push(c),"number"==typeof c.originalLine&&this.__originalMappings.push(c)}g(this.__generatedMappings,a.compareByGeneratedPositionsDeflated),g(this.__originalMappings,a.compareByOriginalPositions)},n.IndexedSourceMapConsumer=s},function(e,n){function r(e,t,o,i,s,a){var u=Math.floor((t-e)/2)+e,l=s(o,i[u],!0);return 0===l?u:l>0?t-u>1?r(u,t,o,i,s,a):a==n.LEAST_UPPER_BOUND?t<i.length?t:-1:u:u-e>1?r(e,u,o,i,s,a):a==n.LEAST_UPPER_BOUND?u:e<0?-1:e}n.GREATEST_LOWER_BOUND=1,n.LEAST_UPPER_BOUND=2,n.search=function(e,t,o,i){if(0===t.length)return-1;var s=r(-1,t.length,e,t,o,i||n.GREATEST_LOWER_BOUND);if(s<0)return-1;for(;s-1>=0&&0===o(t[s],t[s-1],!0);)--s;return s}},function(e,n){function r(e,n,r){var t=e[n];e[n]=e[r],e[r]=t}function t(e,n){return Math.round(e+Math.random()*(n-e))}function o(e,n,i,s){if(i<s){var a=t(i,s),u=i-1;r(e,a,s);for(var l=e[s],c=i;c<s;c++)n(e[c],l)<=0&&(u+=1,r(e,u,c));r(e,u+1,c);var g=u+1;o(e,n,i,g-1),o(e,n,g+1,s)}}n.quickSort=function(e,n){o(e,n,0,e.length-1)}},function(e,n,r){function t(e,n,r,t,o){this.children=[],this.sourceContents={},this.line=null==e?null:e,this.column=null==n?null:n,this.source=null==r?null:r,this.name=null==o?null:o,this[u]=!0,null!=t&&this.add(t)}var o=r(1).SourceMapGenerator,i=r(4),s=/(\r?\n)/,a=10,u="$$$isSourceNode$$$";t.fromStringWithSourceMap=function(e,n,r){function o(e,n){if(null===e||void 0===e.source)a.add(n);else{var o=r?i.join(r,e.source):e.source;a.add(new t(e.originalLine,e.originalColumn,o,n,e.name))}}var a=new t,u=e.split(s),l=0,c=function(){function e(){return l<u.length?u[l++]:void 0}var n=e(),r=e()||"";return n+r},g=1,p=0,h=null;return n.eachMapping(function(e){if(null!==h){if(!(g<e.generatedLine)){var n=u[l],r=n.substr(0,e.generatedColumn-p);return u[l]=n.substr(e.generatedColumn-p),p=e.generatedColumn,o(h,r),void(h=e)}o(h,c()),g++,p=0}for(;g<e.generatedLine;)a.add(c()),g++;if(p<e.generatedColumn){var n=u[l];a.add(n.substr(0,e.generatedColumn)),u[l]=n.substr(e.generatedColumn),p=e.generatedColumn}h=e},this),l<u.length&&(h&&o(h,c()),a.add(u.splice(l).join(""))),n.sources.forEach(function(e){var t=n.sourceContentFor(e);null!=t&&(null!=r&&(e=i.join(r,e)),a.setSourceContent(e,t))}),a},t.prototype.add=function(e){if(Array.isArray(e))e.forEach(function(e){this.add(e)},this);else{if(!e[u]&&"string"!=typeof e)throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+e);e&&this.children.push(e)}return this},t.prototype.prepend=function(e){if(Array.isArray(e))for(var n=e.length-1;n>=0;n--)this.prepend(e[n]);else{if(!e[u]&&"string"!=typeof e)throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+e);this.children.unshift(e)}return this},t.prototype.walk=function(e){for(var n,r=0,t=this.children.length;r<t;r++)n=this.children[r],n[u]?n.walk(e):""!==n&&e(n,{source:this.source,line:this.line,column:this.column,name:this.name})},t.prototype.join=function(e){var n,r,t=this.children.length;if(t>0){for(n=[],r=0;r<t-1;r++)n.push(this.children[r]),n.push(e);n.push(this.children[r]),this.children=n}return this},t.prototype.replaceRight=function(e,n){var r=this.children[this.children.length-1];return r[u]?r.replaceRight(e,n):"string"==typeof r?this.children[this.children.length-1]=r.replace(e,n):this.children.push("".replace(e,n)),this},t.prototype.setSourceContent=function(e,n){this.sourceContents[i.toSetString(e)]=n},t.prototype.walkSourceContents=function(e){for(var n=0,r=this.children.length;n<r;n++)this.children[n][u]&&this.children[n].walkSourceContents(e);for(var t=Object.keys(this.sourceContents),n=0,r=t.length;n<r;n++)e(i.fromSetString(t[n]),this.sourceContents[t[n]])},t.prototype.toString=function(){var e="";return this.walk(function(n){e+=n}),e},t.prototype.toStringWithSourceMap=function(e){var n={code:"",line:1,column:0},r=new o(e),t=!1,i=null,s=null,u=null,l=null;return this.walk(function(e,o){n.code+=e,null!==o.source&&null!==o.line&&null!==o.column?(i===o.source&&s===o.line&&u===o.column&&l===o.name||r.addMapping({source:o.source,original:{line:o.line,column:o.column},generated:{line:n.line,column:n.column},name:o.name}),i=o.source,s=o.line,u=o.column,l=o.name,t=!0):t&&(r.addMapping({generated:{line:n.line,column:n.column}}),i=null,t=!1);for(var c=0,g=e.length;c<g;c++)e.charCodeAt(c)===a?(n.line++,n.column=0,c+1===g?(i=null,t=!1):t&&r.addMapping({source:o.source,original:{line:o.line,column:o.column},generated:{line:n.line,column:n.column},name:o.name})):n.column++}),this.walkSourceContents(function(e,n){r.setSourceContent(e,n)}),{code:n.code,map:r}},n.SourceNode=t}])});
+//# sourceMappingURL=source-map.min.js.map
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/source-map/dist/source-map.min.js.map b/node_modules/@babel/core/node_modules/source-map/dist/source-map.min.js.map
new file mode 100644
index 00000000..588b70cb
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/dist/source-map.min.js.map
@@ -0,0 +1 @@
+{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///source-map.min.js","webpack:///webpack/bootstrap 42c329f865e32e011afb","webpack:///./source-map.js","webpack:///./lib/source-map-generator.js","webpack:///./lib/base64-vlq.js","webpack:///./lib/base64.js","webpack:///./lib/util.js","webpack:///./lib/array-set.js","webpack:///./lib/mapping-list.js","webpack:///./lib/source-map-consumer.js","webpack:///./lib/binary-search.js","webpack:///./lib/quick-sort.js","webpack:///./lib/source-node.js"],"names":["root","factory","exports","module","define","amd","this","modules","__webpack_require__","moduleId","installedModules","id","loaded","call","m","c","p","SourceMapGenerator","SourceMapConsumer","SourceNode","aArgs","_file","util","getArg","_sourceRoot","_skipValidation","_sources","ArraySet","_names","_mappings","MappingList","_sourcesContents","base64VLQ","prototype","_version","fromSourceMap","aSourceMapConsumer","sourceRoot","generator","file","eachMapping","mapping","newMapping","generated","line","generatedLine","column","generatedColumn","source","relative","original","originalLine","originalColumn","name","addMapping","sources","forEach","sourceFile","content","sourceContentFor","setSourceContent","_validateMapping","String","has","add","aSourceFile","aSourceContent","Object","create","toSetString","keys","length","applySourceMap","aSourceMapPath","Error","newSources","newNames","unsortedForEach","originalPositionFor","join","aGenerated","aOriginal","aSource","aName","JSON","stringify","_serializeMappings","next","nameIdx","sourceIdx","previousGeneratedColumn","previousGeneratedLine","previousOriginalColumn","previousOriginalLine","previousName","previousSource","result","mappings","toArray","i","len","compareByGeneratedPositionsInflated","encode","indexOf","_generateSourcesContent","aSources","aSourceRoot","map","key","hasOwnProperty","toJSON","version","names","sourcesContent","toString","toVLQSigned","aValue","fromVLQSigned","isNegative","shifted","base64","VLQ_BASE_SHIFT","VLQ_BASE","VLQ_BASE_MASK","VLQ_CONTINUATION_BIT","digit","encoded","vlq","decode","aStr","aIndex","aOutParam","continuation","strLen","shift","charCodeAt","charAt","value","rest","intToCharMap","split","number","TypeError","charCode","bigA","bigZ","littleA","littleZ","zero","nine","plus","slash","littleOffset","numberOffset","aDefaultValue","arguments","urlParse","aUrl","match","urlRegexp","scheme","auth","host","port","path","urlGenerate","aParsedUrl","url","normalize","aPath","part","isAbsolute","parts","up","splice","aRoot","aPathUrl","aRootUrl","dataUrlRegexp","joined","replace","level","index","lastIndexOf","slice","Array","substr","identity","s","isProtoString","fromSetString","compareByOriginalPositions","mappingA","mappingB","onlyCompareOriginal","cmp","compareByGeneratedPositionsDeflated","onlyCompareGenerated","strcmp","aStr1","aStr2","supportsNullProto","obj","_array","_set","hasNativeMap","Map","fromArray","aArray","aAllowDuplicates","set","size","getOwnPropertyNames","sStr","isDuplicate","idx","push","get","at","aIdx","generatedPositionAfter","lineA","lineB","columnA","columnB","_sorted","_last","aCallback","aThisArg","aMapping","sort","aSourceMap","sourceMap","parse","sections","IndexedSourceMapConsumer","BasicSourceMapConsumer","Mapping","lastOffset","_sections","offset","offsetLine","offsetColumn","generatedOffset","consumer","binarySearch","quickSort","__generatedMappings","defineProperty","_parseMappings","__originalMappings","_charIsMappingSeparator","GENERATED_ORDER","ORIGINAL_ORDER","GREATEST_LOWER_BOUND","LEAST_UPPER_BOUND","aContext","aOrder","context","order","_generatedMappings","_originalMappings","allGeneratedPositionsFor","needle","_findMapping","undefined","lastColumn","smc","generatedMappings","destGeneratedMappings","destOriginalMappings","srcMapping","destMapping","str","segment","end","cachedSegments","temp","originalMappings","aNeedle","aMappings","aLineName","aColumnName","aComparator","aBias","search","computeColumnSpans","nextMapping","lastGeneratedColumn","Infinity","hasContentsOfAllSources","some","sc","nullOnMissing","fileUriAbsPath","generatedPositionFor","constructor","j","sectionIndex","section","bias","every","generatedPosition","ret","sectionMappings","adjustedMapping","recursiveSearch","aLow","aHigh","aHaystack","aCompare","mid","Math","floor","swap","ary","x","y","randomIntInRange","low","high","round","random","doQuickSort","comparator","r","pivotIndex","pivot","q","aLine","aColumn","aChunks","children","sourceContents","isSourceNode","REGEX_NEWLINE","NEWLINE_CODE","fromStringWithSourceMap","aGeneratedCode","aRelativePath","addMappingWithCode","code","node","remainingLines","remainingLinesIndex","shiftNextLine","getNextLine","lineContents","newLine","lastGeneratedLine","lastMapping","nextLine","aChunk","isArray","chunk","prepend","unshift","walk","aFn","aSep","newChildren","replaceRight","aPattern","aReplacement","lastChild","walkSourceContents","toStringWithSourceMap","sourceMappingActive","lastOriginalSource","lastOriginalLine","lastOriginalColumn","lastOriginalName","sourceContent"],"mappings":"CAAA,SAAAA,EAAAC,GACA,gBAAAC,UAAA,gBAAAC,QACAA,OAAAD,QAAAD,IACA,kBAAAG,gBAAAC,IACAD,UAAAH,GACA,gBAAAC,SACAA,QAAA,UAAAD,IAEAD,EAAA,UAAAC,KACCK,KAAA,WACD,MCAgB,UAAUC,GCN1B,QAAAC,GAAAC,GAGA,GAAAC,EAAAD,GACA,MAAAC,GAAAD,GAAAP,OAGA,IAAAC,GAAAO,EAAAD,IACAP,WACAS,GAAAF,EACAG,QAAA,EAUA,OANAL,GAAAE,GAAAI,KAAAV,EAAAD,QAAAC,IAAAD,QAAAM,GAGAL,EAAAS,QAAA,EAGAT,EAAAD,QAvBA,GAAAQ,KAqCA,OATAF,GAAAM,EAAAP,EAGAC,EAAAO,EAAAL,EAGAF,EAAAQ,EAAA,GAGAR,EAAA,KDgBM,SAAUL,EAAQD,EAASM,GEjDjCN,EAAAe,mBAAAT,EAAA,GAAAS,mBACAf,EAAAgB,kBAAAV,EAAA,GAAAU,kBACAhB,EAAAiB,WAAAX,EAAA,IAAAW,YF6DM,SAAUhB,EAAQD,EAASM,GGhDjC,QAAAS,GAAAG,GACAA,IACAA,MAEAd,KAAAe,MAAAC,EAAAC,OAAAH,EAAA,aACAd,KAAAkB,YAAAF,EAAAC,OAAAH,EAAA,mBACAd,KAAAmB,gBAAAH,EAAAC,OAAAH,EAAA,qBACAd,KAAAoB,SAAA,GAAAC,GACArB,KAAAsB,OAAA,GAAAD,GACArB,KAAAuB,UAAA,GAAAC,GACAxB,KAAAyB,iBAAA,KAvBA,GAAAC,GAAAxB,EAAA,GACAc,EAAAd,EAAA,GACAmB,EAAAnB,EAAA,GAAAmB,SACAG,EAAAtB,EAAA,GAAAsB,WAuBAb,GAAAgB,UAAAC,SAAA,EAOAjB,EAAAkB,cACA,SAAAC,GACA,GAAAC,GAAAD,EAAAC,WACAC,EAAA,GAAArB,IACAsB,KAAAH,EAAAG,KACAF,cAkCA,OAhCAD,GAAAI,YAAA,SAAAC,GACA,GAAAC,IACAC,WACAC,KAAAH,EAAAI,cACAC,OAAAL,EAAAM,iBAIA,OAAAN,EAAAO,SACAN,EAAAM,OAAAP,EAAAO,OACA,MAAAX,IACAK,EAAAM,OAAA1B,EAAA2B,SAAAZ,EAAAK,EAAAM,SAGAN,EAAAQ,UACAN,KAAAH,EAAAU,aACAL,OAAAL,EAAAW,gBAGA,MAAAX,EAAAY,OACAX,EAAAW,KAAAZ,EAAAY,OAIAf,EAAAgB,WAAAZ,KAEAN,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAC,GAAAtB,EAAAuB,iBAAAF,EACA,OAAAC,GACApB,EAAAsB,iBAAAH,EAAAC,KAGApB,GAaArB,EAAAgB,UAAAqB,WACA,SAAAlC,GACA,GAAAuB,GAAArB,EAAAC,OAAAH,EAAA,aACA8B,EAAA5B,EAAAC,OAAAH,EAAA,iBACA4B,EAAA1B,EAAAC,OAAAH,EAAA,eACAiC,EAAA/B,EAAAC,OAAAH,EAAA,YAEAd,MAAAmB,iBACAnB,KAAAuD,iBAAAlB,EAAAO,EAAAF,EAAAK,GAGA,MAAAL,IACAA,EAAAc,OAAAd,GACA1C,KAAAoB,SAAAqC,IAAAf,IACA1C,KAAAoB,SAAAsC,IAAAhB,IAIA,MAAAK,IACAA,EAAAS,OAAAT,GACA/C,KAAAsB,OAAAmC,IAAAV,IACA/C,KAAAsB,OAAAoC,IAAAX,IAIA/C,KAAAuB,UAAAmC,KACAnB,cAAAF,EAAAC,KACAG,gBAAAJ,EAAAG,OACAK,aAAA,MAAAD,KAAAN,KACAQ,eAAA,MAAAF,KAAAJ,OACAE,SACAK,UAOApC,EAAAgB,UAAA2B,iBACA,SAAAK,EAAAC,GACA,GAAAlB,GAAAiB,CACA,OAAA3D,KAAAkB,cACAwB,EAAA1B,EAAA2B,SAAA3C,KAAAkB,YAAAwB,IAGA,MAAAkB,GAGA5D,KAAAyB,mBACAzB,KAAAyB,iBAAAoC,OAAAC,OAAA,OAEA9D,KAAAyB,iBAAAT,EAAA+C,YAAArB,IAAAkB,GACK5D,KAAAyB,yBAGLzB,MAAAyB,iBAAAT,EAAA+C,YAAArB,IACA,IAAAmB,OAAAG,KAAAhE,KAAAyB,kBAAAwC,SACAjE,KAAAyB,iBAAA,QAqBAd,EAAAgB,UAAAuC,eACA,SAAApC,EAAA6B,EAAAQ,GACA,GAAAhB,GAAAQ,CAEA,UAAAA,EAAA,CACA,SAAA7B,EAAAG,KACA,SAAAmC,OACA,gJAIAjB,GAAArB,EAAAG,KAEA,GAAAF,GAAA/B,KAAAkB,WAEA,OAAAa,IACAoB,EAAAnC,EAAA2B,SAAAZ,EAAAoB,GAIA,IAAAkB,GAAA,GAAAhD,GACAiD,EAAA,GAAAjD,EAGArB,MAAAuB,UAAAgD,gBAAA,SAAApC,GACA,GAAAA,EAAAO,SAAAS,GAAA,MAAAhB,EAAAU,aAAA,CAEA,GAAAD,GAAAd,EAAA0C,qBACAlC,KAAAH,EAAAU,aACAL,OAAAL,EAAAW,gBAEA,OAAAF,EAAAF,SAEAP,EAAAO,OAAAE,EAAAF,OACA,MAAAyB,IACAhC,EAAAO,OAAA1B,EAAAyD,KAAAN,EAAAhC,EAAAO,SAEA,MAAAX,IACAI,EAAAO,OAAA1B,EAAA2B,SAAAZ,EAAAI,EAAAO,SAEAP,EAAAU,aAAAD,EAAAN,KACAH,EAAAW,eAAAF,EAAAJ,OACA,MAAAI,EAAAG,OACAZ,EAAAY,KAAAH,EAAAG,OAKA,GAAAL,GAAAP,EAAAO,MACA,OAAAA,GAAA2B,EAAAZ,IAAAf,IACA2B,EAAAX,IAAAhB,EAGA,IAAAK,GAAAZ,EAAAY,IACA,OAAAA,GAAAuB,EAAAb,IAAAV,IACAuB,EAAAZ,IAAAX,IAGK/C,MACLA,KAAAoB,SAAAiD,EACArE,KAAAsB,OAAAgD,EAGAxC,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAC,GAAAtB,EAAAuB,iBAAAF,EACA,OAAAC,IACA,MAAAe,IACAhB,EAAAnC,EAAAyD,KAAAN,EAAAhB,IAEA,MAAApB,IACAoB,EAAAnC,EAAA2B,SAAAZ,EAAAoB,IAEAnD,KAAAsD,iBAAAH,EAAAC,KAEKpD,OAcLW,EAAAgB,UAAA4B,iBACA,SAAAmB,EAAAC,EAAAC,EACAC,GAKA,GAAAF,GAAA,gBAAAA,GAAArC,MAAA,gBAAAqC,GAAAnC,OACA,SAAA4B,OACA,+OAMA,OAAAM,GAAA,QAAAA,IAAA,UAAAA,IACAA,EAAApC,KAAA,GAAAoC,EAAAlC,QAAA,IACAmC,GAAAC,GAAAC,MAIAH,GAAA,QAAAA,IAAA,UAAAA,IACAC,GAAA,QAAAA,IAAA,UAAAA,IACAD,EAAApC,KAAA,GAAAoC,EAAAlC,QAAA,GACAmC,EAAArC,KAAA,GAAAqC,EAAAnC,QAAA,GACAoC,GAKA,SAAAR,OAAA,oBAAAU,KAAAC,WACA1C,UAAAqC,EACAhC,OAAAkC,EACAhC,SAAA+B,EACA5B,KAAA8B,MASAlE,EAAAgB,UAAAqD,mBACA,WAcA,OANAC,GACA9C,EACA+C,EACAC,EAVAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,GAMAC,EAAA3F,KAAAuB,UAAAqE,UACAC,EAAA,EAAAC,EAAAH,EAAA1B,OAA0C4B,EAAAC,EAASD,IAAA,CAInD,GAHA1D,EAAAwD,EAAAE,GACAZ,EAAA,GAEA9C,EAAAI,gBAAA8C,EAEA,IADAD,EAAA,EACAjD,EAAAI,gBAAA8C,GACAJ,GAAA,IACAI,QAIA,IAAAQ,EAAA,GACA,IAAA7E,EAAA+E,oCAAA5D,EAAAwD,EAAAE,EAAA,IACA,QAEAZ,IAAA,IAIAA,GAAAvD,EAAAsE,OAAA7D,EAAAM,gBACA2C,GACAA,EAAAjD,EAAAM,gBAEA,MAAAN,EAAAO,SACAyC,EAAAnF,KAAAoB,SAAA6E,QAAA9D,EAAAO,QACAuC,GAAAvD,EAAAsE,OAAAb,EAAAM,GACAA,EAAAN,EAGAF,GAAAvD,EAAAsE,OAAA7D,EAAAU,aAAA,EACA0C,GACAA,EAAApD,EAAAU,aAAA,EAEAoC,GAAAvD,EAAAsE,OAAA7D,EAAAW,eACAwC,GACAA,EAAAnD,EAAAW,eAEA,MAAAX,EAAAY,OACAmC,EAAAlF,KAAAsB,OAAA2E,QAAA9D,EAAAY,MACAkC,GAAAvD,EAAAsE,OAAAd,EAAAM,GACAA,EAAAN,IAIAQ,GAAAT,EAGA,MAAAS,IAGA/E,EAAAgB,UAAAuE,wBACA,SAAAC,EAAAC,GACA,MAAAD,GAAAE,IAAA,SAAA3D,GACA,IAAA1C,KAAAyB,iBACA,WAEA,OAAA2E,IACA1D,EAAA1B,EAAA2B,SAAAyD,EAAA1D,GAEA,IAAA4D,GAAAtF,EAAA+C,YAAArB,EACA,OAAAmB,QAAAlC,UAAA4E,eAAAhG,KAAAP,KAAAyB,iBAAA6E,GACAtG,KAAAyB,iBAAA6E,GACA,MACKtG,OAMLW,EAAAgB,UAAA6E,OACA,WACA,GAAAH,IACAI,QAAAzG,KAAA4B,SACAqB,QAAAjD,KAAAoB,SAAAwE,UACAc,MAAA1G,KAAAsB,OAAAsE,UACAD,SAAA3F,KAAAgF,qBAYA,OAVA,OAAAhF,KAAAe,QACAsF,EAAApE,KAAAjC,KAAAe,OAEA,MAAAf,KAAAkB,cACAmF,EAAAtE,WAAA/B,KAAAkB,aAEAlB,KAAAyB,mBACA4E,EAAAM,eAAA3G,KAAAkG,wBAAAG,EAAApD,QAAAoD,EAAAtE,aAGAsE,GAMA1F,EAAAgB,UAAAiF,SACA,WACA,MAAA9B,MAAAC,UAAA/E,KAAAwG,WAGA5G,EAAAe,sBH2EM,SAAUd,EAAQD,EAASM,GItajC,QAAA2G,GAAAC,GACA,MAAAA,GAAA,IACAA,GAAA,MACAA,GAAA,KASA,QAAAC,GAAAD,GACA,GAAAE,GAAA,OAAAF,GACAG,EAAAH,GAAA,CACA,OAAAE,IACAC,EACAA,EAhDA,GAAAC,GAAAhH,EAAA,GAcAiH,EAAA,EAGAC,EAAA,GAAAD,EAGAE,EAAAD,EAAA,EAGAE,EAAAF,CA+BAxH,GAAAoG,OAAA,SAAAc,GACA,GACAS,GADAC,EAAA,GAGAC,EAAAZ,EAAAC,EAEA,GACAS,GAAAE,EAAAJ,EACAI,KAAAN,EACAM,EAAA,IAGAF,GAAAD,GAEAE,GAAAN,EAAAlB,OAAAuB,SACGE,EAAA,EAEH,OAAAD,IAOA5H,EAAA8H,OAAA,SAAAC,EAAAC,EAAAC,GACA,GAGAC,GAAAP,EAHAQ,EAAAJ,EAAA1D,OACAyB,EAAA,EACAsC,EAAA,CAGA,IACA,GAAAJ,GAAAG,EACA,SAAA3D,OAAA,6CAIA,IADAmD,EAAAL,EAAAQ,OAAAC,EAAAM,WAAAL,MACAL,KAAA,EACA,SAAAnD,OAAA,yBAAAuD,EAAAO,OAAAN,EAAA,GAGAE,MAAAP,EAAAD,GACAC,GAAAF,EACA3B,GAAA6B,GAAAS,EACAA,GAAAb,QACGW,EAEHD,GAAAM,MAAApB,EAAArB,GACAmC,EAAAO,KAAAR,IJkfM,SAAU/H,EAAQD,GKrnBxB,GAAAyI,GAAA,mEAAAC,MAAA,GAKA1I,GAAAoG,OAAA,SAAAuC,GACA,MAAAA,KAAAF,EAAApE,OACA,MAAAoE,GAAAE,EAEA,UAAAC,WAAA,6BAAAD,IAOA3I,EAAA8H,OAAA,SAAAe,GACA,GAAAC,GAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,IAEAC,EAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,EAGA,OAAAT,IAAAD,MAAAE,EACAF,EAAAC,EAIAE,GAAAH,MAAAI,EACAJ,EAAAG,EAAAM,EAIAJ,GAAAL,MAAAM,EACAN,EAAAK,EAAAK,EAIAV,GAAAO,EACA,GAIAP,GAAAQ,EACA,IAIA,ILooBM,SAAUpJ,EAAQD,GMprBxB,QAAAqB,GAAAH,EAAA+D,EAAAuE,GACA,GAAAvE,IAAA/D,GACA,MAAAA,GAAA+D,EACG,QAAAwE,UAAApF,OACH,MAAAmF,EAEA,UAAAhF,OAAA,IAAAS,EAAA,6BAQA,QAAAyE,GAAAC,GACA,GAAAC,GAAAD,EAAAC,MAAAC,EACA,OAAAD,IAIAE,OAAAF,EAAA,GACAG,KAAAH,EAAA,GACAI,KAAAJ,EAAA,GACAK,KAAAL,EAAA,GACAM,KAAAN,EAAA,IAPA,KAYA,QAAAO,GAAAC,GACA,GAAAC,GAAA,EAiBA,OAhBAD,GAAAN,SACAO,GAAAD,EAAAN,OAAA,KAEAO,GAAA,KACAD,EAAAL,OACAM,GAAAD,EAAAL,KAAA,KAEAK,EAAAJ,OACAK,GAAAD,EAAAJ,MAEAI,EAAAH,OACAI,GAAA,IAAAD,EAAAH,MAEAG,EAAAF,OACAG,GAAAD,EAAAF,MAEAG,EAeA,QAAAC,GAAAC,GACA,GAAAL,GAAAK,EACAF,EAAAX,EAAAa,EACA,IAAAF,EAAA,CACA,IAAAA,EAAAH,KACA,MAAAK,EAEAL,GAAAG,EAAAH,KAKA,OAAAM,GAHAC,EAAAzK,EAAAyK,WAAAP,GAEAQ,EAAAR,EAAAxB,MAAA,OACAiC,EAAA,EAAA1E,EAAAyE,EAAArG,OAAA,EAA8C4B,GAAA,EAAQA,IACtDuE,EAAAE,EAAAzE,GACA,MAAAuE,EACAE,EAAAE,OAAA3E,EAAA,GACK,OAAAuE,EACLG,IACKA,EAAA,IACL,KAAAH,GAIAE,EAAAE,OAAA3E,EAAA,EAAA0E,GACAA,EAAA,IAEAD,EAAAE,OAAA3E,EAAA,GACA0E,KAUA,OANAT,GAAAQ,EAAA7F,KAAA,KAEA,KAAAqF,IACAA,EAAAO,EAAA,SAGAJ,GACAA,EAAAH,OACAC,EAAAE,IAEAH,EAoBA,QAAArF,GAAAgG,EAAAN,GACA,KAAAM,IACAA,EAAA,KAEA,KAAAN,IACAA,EAAA,IAEA,IAAAO,GAAApB,EAAAa,GACAQ,EAAArB,EAAAmB,EAMA,IALAE,IACAF,EAAAE,EAAAb,MAAA,KAIAY,MAAAhB,OAIA,MAHAiB,KACAD,EAAAhB,OAAAiB,EAAAjB,QAEAK,EAAAW,EAGA,IAAAA,GAAAP,EAAAX,MAAAoB,GACA,MAAAT,EAIA,IAAAQ,MAAAf,OAAAe,EAAAb,KAEA,MADAa,GAAAf,KAAAO,EACAJ,EAAAY,EAGA,IAAAE,GAAA,MAAAV,EAAAjC,OAAA,GACAiC,EACAD,EAAAO,EAAAK,QAAA,eAAAX,EAEA,OAAAQ,IACAA,EAAAb,KAAAe,EACAd,EAAAY,IAEAE,EAcA,QAAAlI,GAAA8H,EAAAN,GACA,KAAAM,IACAA,EAAA,KAGAA,IAAAK,QAAA,SAOA,KADA,GAAAC,GAAA,EACA,IAAAZ,EAAAlE,QAAAwE,EAAA,OACA,GAAAO,GAAAP,EAAAQ,YAAA,IACA,IAAAD,EAAA,EACA,MAAAb,EAOA,IADAM,IAAAS,MAAA,EAAAF,GACAP,EAAAjB,MAAA,qBACA,MAAAW,KAGAY,EAIA,MAAAI,OAAAJ,EAAA,GAAAtG,KAAA,OAAA0F,EAAAiB,OAAAX,EAAAxG,OAAA,GASA,QAAAoH,GAAAC,GACA,MAAAA,GAYA,QAAAvH,GAAA4D,GACA,MAAA4D,GAAA5D,GACA,IAAAA,EAGAA,EAIA,QAAA6D,GAAA7D,GACA,MAAA4D,GAAA5D,GACAA,EAAAuD,MAAA,GAGAvD,EAIA,QAAA4D,GAAAD,GACA,IAAAA,EACA,QAGA,IAAArH,GAAAqH,EAAArH,MAEA,IAAAA,EAAA,EACA,QAGA,SAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,GACA,QAGA,QAAA4B,GAAA5B,EAAA,GAA2B4B,GAAA,EAAQA,IACnC,QAAAyF,EAAArD,WAAApC,GACA,QAIA,UAWA,QAAA4F,GAAAC,EAAAC,EAAAC,GACA,GAAAC,GAAAH,EAAAhJ,OAAAiJ,EAAAjJ,MACA,YAAAmJ,EACAA,GAGAA,EAAAH,EAAA7I,aAAA8I,EAAA9I,aACA,IAAAgJ,EACAA,GAGAA,EAAAH,EAAA5I,eAAA6I,EAAA7I,eACA,IAAA+I,GAAAD,EACAC,GAGAA,EAAAH,EAAAjJ,gBAAAkJ,EAAAlJ,gBACA,IAAAoJ,EACAA,GAGAA,EAAAH,EAAAnJ,cAAAoJ,EAAApJ,cACA,IAAAsJ,EACAA,EAGAH,EAAA3I,KAAA4I,EAAA5I,SAaA,QAAA+I,GAAAJ,EAAAC,EAAAI,GACA,GAAAF,GAAAH,EAAAnJ,cAAAoJ,EAAApJ,aACA,YAAAsJ,EACAA,GAGAA,EAAAH,EAAAjJ,gBAAAkJ,EAAAlJ,gBACA,IAAAoJ,GAAAE,EACAF,GAGAA,EAAAH,EAAAhJ,OAAAiJ,EAAAjJ,OACA,IAAAmJ,EACAA,GAGAA,EAAAH,EAAA7I,aAAA8I,EAAA9I,aACA,IAAAgJ,EACAA,GAGAA,EAAAH,EAAA5I,eAAA6I,EAAA7I,eACA,IAAA+I,EACAA,EAGAH,EAAA3I,KAAA4I,EAAA5I,SAIA,QAAAiJ,GAAAC,EAAAC,GACA,MAAAD,KAAAC,EACA,EAGAD,EAAAC,EACA,GAGA,EAOA,QAAAnG,GAAA2F,EAAAC,GACA,GAAAE,GAAAH,EAAAnJ,cAAAoJ,EAAApJ,aACA,YAAAsJ,EACAA,GAGAA,EAAAH,EAAAjJ,gBAAAkJ,EAAAlJ,gBACA,IAAAoJ,EACAA,GAGAA,EAAAG,EAAAN,EAAAhJ,OAAAiJ,EAAAjJ,QACA,IAAAmJ,EACAA,GAGAA,EAAAH,EAAA7I,aAAA8I,EAAA9I,aACA,IAAAgJ,EACAA,GAGAA,EAAAH,EAAA5I,eAAA6I,EAAA7I,eACA,IAAA+I,EACAA,EAGAG,EAAAN,EAAA3I,KAAA4I,EAAA5I,UApYAnD,EAAAqB,QAEA,IAAAwI,GAAA,iEACAmB,EAAA,eAeAhL,GAAA0J,WAsBA1J,EAAAmK,cAwDAnK,EAAAsK,YA2DAtK,EAAA6E,OAEA7E,EAAAyK,WAAA,SAAAF,GACA,YAAAA,EAAAjC,OAAA,MAAAiC,EAAAX,MAAAC,IAyCA7J,EAAA+C,UAEA,IAAAwJ,GAAA,WACA,GAAAC,GAAAvI,OAAAC,OAAA,KACA,sBAAAsI,MAuBAxM,GAAAmE,YAAAoI,EAAAd,EAAAtH,EASAnE,EAAA4L,cAAAW,EAAAd,EAAAG,EAsEA5L,EAAA6L,6BAuCA7L,EAAAkM,sCA8CAlM,EAAAmG,uCN4sBM,SAAUlG,EAAQD,EAASM,GO3lCjC,QAAAmB,KACArB,KAAAqM,UACArM,KAAAsM,KAAAC,EAAA,GAAAC,KAAA3I,OAAAC,OAAA,MAZA,GAAA9C,GAAAd,EAAA,GACAuD,EAAAI,OAAAlC,UAAA4E,eACAgG,EAAA,mBAAAC,IAgBAnL,GAAAoL,UAAA,SAAAC,EAAAC,GAEA,OADAC,GAAA,GAAAvL,GACAwE,EAAA,EAAAC,EAAA4G,EAAAzI,OAAsC4B,EAAAC,EAASD,IAC/C+G,EAAAlJ,IAAAgJ,EAAA7G,GAAA8G,EAEA,OAAAC,IASAvL,EAAAM,UAAAkL,KAAA,WACA,MAAAN,GAAAvM,KAAAsM,KAAAO,KAAAhJ,OAAAiJ,oBAAA9M,KAAAsM,MAAArI,QAQA5C,EAAAM,UAAA+B,IAAA,SAAAiE,EAAAgF,GACA,GAAAI,GAAAR,EAAA5E,EAAA3G,EAAA+C,YAAA4D,GACAqF,EAAAT,EAAAvM,KAAAyD,IAAAkE,GAAAlE,EAAAlD,KAAAP,KAAAsM,KAAAS,GACAE,EAAAjN,KAAAqM,OAAApI,MACA+I,KAAAL,GACA3M,KAAAqM,OAAAa,KAAAvF,GAEAqF,IACAT,EACAvM,KAAAsM,KAAAM,IAAAjF,EAAAsF,GAEAjN,KAAAsM,KAAAS,GAAAE,IAUA5L,EAAAM,UAAA8B,IAAA,SAAAkE,GACA,GAAA4E,EACA,MAAAvM,MAAAsM,KAAA7I,IAAAkE,EAEA,IAAAoF,GAAA/L,EAAA+C,YAAA4D,EACA,OAAAlE,GAAAlD,KAAAP,KAAAsM,KAAAS,IASA1L,EAAAM,UAAAsE,QAAA,SAAA0B,GACA,GAAA4E,EAAA,CACA,GAAAU,GAAAjN,KAAAsM,KAAAa,IAAAxF,EACA,IAAAsF,GAAA,EACA,MAAAA,OAEG,CACH,GAAAF,GAAA/L,EAAA+C,YAAA4D,EACA,IAAAlE,EAAAlD,KAAAP,KAAAsM,KAAAS,GACA,MAAA/M,MAAAsM,KAAAS,GAIA,SAAA3I,OAAA,IAAAuD,EAAA,yBAQAtG,EAAAM,UAAAyL,GAAA,SAAAC,GACA,GAAAA,GAAA,GAAAA,EAAArN,KAAAqM,OAAApI,OACA,MAAAjE,MAAAqM,OAAAgB,EAEA,UAAAjJ,OAAA,yBAAAiJ,IAQAhM,EAAAM,UAAAiE,QAAA,WACA,MAAA5F,MAAAqM,OAAAnB,SAGAtL,EAAAyB,YPmnCM,SAAUxB,EAAQD,EAASM,GQ9tCjC,QAAAoN,GAAA5B,EAAAC,GAEA,GAAA4B,GAAA7B,EAAAnJ,cACAiL,EAAA7B,EAAApJ,cACAkL,EAAA/B,EAAAjJ,gBACAiL,EAAA/B,EAAAlJ,eACA,OAAA+K,GAAAD,GAAAC,GAAAD,GAAAG,GAAAD,GACAzM,EAAA+E,oCAAA2F,EAAAC,IAAA,EAQA,QAAAnK,KACAxB,KAAAqM,UACArM,KAAA2N,SAAA,EAEA3N,KAAA4N,OAAgBrL,eAAA,EAAAE,gBAAA,GAzBhB,GAAAzB,GAAAd,EAAA,EAkCAsB,GAAAG,UAAA4C,gBACA,SAAAsJ,EAAAC,GACA9N,KAAAqM,OAAAnJ,QAAA2K,EAAAC,IAQAtM,EAAAG,UAAA+B,IAAA,SAAAqK,GACAT,EAAAtN,KAAA4N,MAAAG,IACA/N,KAAA4N,MAAAG,EACA/N,KAAAqM,OAAAa,KAAAa,KAEA/N,KAAA2N,SAAA,EACA3N,KAAAqM,OAAAa,KAAAa,KAaAvM,EAAAG,UAAAiE,QAAA,WAKA,MAJA5F,MAAA2N,UACA3N,KAAAqM,OAAA2B,KAAAhN,EAAA+E,qCACA/F,KAAA2N,SAAA,GAEA3N,KAAAqM,QAGAzM,EAAA4B,eRkvCM,SAAU3B,EAAQD,EAASM,GSnzCjC,QAAAU,GAAAqN,GACA,GAAAC,GAAAD,CAKA,OAJA,gBAAAA,KACAC,EAAApJ,KAAAqJ,MAAAF,EAAAnD,QAAA,WAAsD,MAGtD,MAAAoD,EAAAE,SACA,GAAAC,GAAAH,GACA,GAAAI,GAAAJ,GAoQA,QAAAI,GAAAL,GACA,GAAAC,GAAAD,CACA,iBAAAA,KACAC,EAAApJ,KAAAqJ,MAAAF,EAAAnD,QAAA,WAAsD,KAGtD,IAAArE,GAAAzF,EAAAC,OAAAiN,EAAA,WACAjL,EAAAjC,EAAAC,OAAAiN,EAAA,WAGAxH,EAAA1F,EAAAC,OAAAiN,EAAA,YACAnM,EAAAf,EAAAC,OAAAiN,EAAA,mBACAvH,EAAA3F,EAAAC,OAAAiN,EAAA,uBACAvI,EAAA3E,EAAAC,OAAAiN,EAAA,YACAjM,EAAAjB,EAAAC,OAAAiN,EAAA,YAIA,IAAAzH,GAAAzG,KAAA4B,SACA,SAAAwC,OAAA,wBAAAqC,EAGAxD,KACAoD,IAAA7C,QAIA6C,IAAArF,EAAAkJ,WAKA7D,IAAA,SAAA3D,GACA,MAAAX,IAAAf,EAAAqJ,WAAAtI,IAAAf,EAAAqJ,WAAA3H,GACA1B,EAAA2B,SAAAZ,EAAAW,GACAA,IAOA1C,KAAAsB,OAAAD,EAAAoL,UAAA/F,EAAAL,IAAA7C,SAAA,GACAxD,KAAAoB,SAAAC,EAAAoL,UAAAxJ,GAAA,GAEAjD,KAAA+B,aACA/B,KAAA2G,iBACA3G,KAAAuB,UAAAoE,EACA3F,KAAAiC,OA8EA,QAAAsM,KACAvO,KAAAuC,cAAA,EACAvC,KAAAyC,gBAAA,EACAzC,KAAA0C,OAAA,KACA1C,KAAA6C,aAAA,KACA7C,KAAA8C,eAAA,KACA9C,KAAA+C,KAAA,KAyZA,QAAAsL,GAAAJ,GACA,GAAAC,GAAAD,CACA,iBAAAA,KACAC,EAAApJ,KAAAqJ,MAAAF,EAAAnD,QAAA,WAAsD,KAGtD,IAAArE,GAAAzF,EAAAC,OAAAiN,EAAA,WACAE,EAAApN,EAAAC,OAAAiN,EAAA,WAEA,IAAAzH,GAAAzG,KAAA4B,SACA,SAAAwC,OAAA,wBAAAqC,EAGAzG,MAAAoB,SAAA,GAAAC,GACArB,KAAAsB,OAAA,GAAAD,EAEA,IAAAmN,IACAlM,MAAA,EACAE,OAAA,EAEAxC,MAAAyO,UAAAL,EAAA/H,IAAA,SAAAiF,GACA,GAAAA,EAAArB,IAGA,SAAA7F,OAAA,qDAEA,IAAAsK,GAAA1N,EAAAC,OAAAqK,EAAA,UACAqD,EAAA3N,EAAAC,OAAAyN,EAAA,QACAE,EAAA5N,EAAAC,OAAAyN,EAAA,SAEA,IAAAC,EAAAH,EAAAlM,MACAqM,IAAAH,EAAAlM,MAAAsM,EAAAJ,EAAAhM,OACA,SAAA4B,OAAA,uDAIA,OAFAoK,GAAAE,GAGAG,iBAGAtM,cAAAoM,EAAA,EACAlM,gBAAAmM,EAAA,GAEAE,SAAA,GAAAlO,GAAAI,EAAAC,OAAAqK,EAAA,WA11BA,GAAAtK,GAAAd,EAAA,GACA6O,EAAA7O,EAAA,GACAmB,EAAAnB,EAAA,GAAAmB,SACAK,EAAAxB,EAAA,GACA8O,EAAA9O,EAAA,GAAA8O,SAaApO,GAAAiB,cAAA,SAAAoM,GACA,MAAAK,GAAAzM,cAAAoM,IAMArN,EAAAe,UAAAC,SAAA,EAgCAhB,EAAAe,UAAAsN,oBAAA,KACApL,OAAAqL,eAAAtO,EAAAe,UAAA,sBACAwL,IAAA,WAKA,MAJAnN,MAAAiP,qBACAjP,KAAAmP,eAAAnP,KAAAuB,UAAAvB,KAAA+B,YAGA/B,KAAAiP,uBAIArO,EAAAe,UAAAyN,mBAAA,KACAvL,OAAAqL,eAAAtO,EAAAe,UAAA,qBACAwL,IAAA,WAKA,MAJAnN,MAAAoP,oBACApP,KAAAmP,eAAAnP,KAAAuB,UAAAvB,KAAA+B,YAGA/B,KAAAoP,sBAIAxO,EAAAe,UAAA0N,wBACA,SAAA1H,EAAAqD,GACA,GAAAvK,GAAAkH,EAAAO,OAAA8C,EACA,aAAAvK,GAAmB,MAAAA,GAQnBG,EAAAe,UAAAwN,eACA,SAAAxH,EAAAvB,GACA,SAAAhC,OAAA,6CAGAxD,EAAA0O,gBAAA,EACA1O,EAAA2O,eAAA,EAEA3O,EAAA4O,qBAAA,EACA5O,EAAA6O,kBAAA,EAkBA7O,EAAAe,UAAAO,YACA,SAAA2L,EAAA6B,EAAAC,GACA,GAGAhK,GAHAiK,EAAAF,GAAA,KACAG,EAAAF,GAAA/O,EAAA0O,eAGA,QAAAO,GACA,IAAAjP,GAAA0O,gBACA3J,EAAA3F,KAAA8P,kBACA,MACA,KAAAlP,GAAA2O,eACA5J,EAAA3F,KAAA+P,iBACA,MACA,SACA,SAAA3L,OAAA,+BAGA,GAAArC,GAAA/B,KAAA+B,UACA4D,GAAAU,IAAA,SAAAlE,GACA,GAAAO,GAAA,OAAAP,EAAAO,OAAA,KAAA1C,KAAAoB,SAAAgM,GAAAjL,EAAAO,OAIA,OAHA,OAAAA,GAAA,MAAAX,IACAW,EAAA1B,EAAAyD,KAAA1C,EAAAW,KAGAA,SACAH,cAAAJ,EAAAI,cACAE,gBAAAN,EAAAM,gBACAI,aAAAV,EAAAU,aACAC,eAAAX,EAAAW,eACAC,KAAA,OAAAZ,EAAAY,KAAA,KAAA/C,KAAAsB,OAAA8L,GAAAjL,EAAAY,QAEK/C,MAAAkD,QAAA2K,EAAA+B,IAsBLhP,EAAAe,UAAAqO,yBACA,SAAAlP,GACA,GAAAwB,GAAAtB,EAAAC,OAAAH,EAAA,QAMAmP,GACAvN,OAAA1B,EAAAC,OAAAH,EAAA,UACA+B,aAAAP,EACAQ,eAAA9B,EAAAC,OAAAH,EAAA,YAMA,IAHA,MAAAd,KAAA+B,aACAkO,EAAAvN,OAAA1B,EAAA2B,SAAA3C,KAAA+B,WAAAkO,EAAAvN,UAEA1C,KAAAoB,SAAAqC,IAAAwM,EAAAvN,QACA,QAEAuN,GAAAvN,OAAA1C,KAAAoB,SAAA6E,QAAAgK,EAAAvN,OAEA,IAAAiD,MAEAqF,EAAAhL,KAAAkQ,aAAAD,EACAjQ,KAAA+P,kBACA,eACA,iBACA/O,EAAAyK,2BACAsD,EAAAU,kBACA,IAAAzE,GAAA,GACA,GAAA7I,GAAAnC,KAAA+P,kBAAA/E,EAEA,IAAAmF,SAAArP,EAAA0B,OAOA,IANA,GAAAK,GAAAV,EAAAU,aAMAV,KAAAU,kBACA8C,EAAAuH,MACA5K,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAiO,WAAApP,EAAAC,OAAAkB,EAAA,8BAGAA,EAAAnC,KAAA+P,oBAAA/E,OASA,KANA,GAAAlI,GAAAX,EAAAW,eAMAX,GACAA,EAAAU,eAAAP,GACAH,EAAAW,mBACA6C,EAAAuH,MACA5K,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAiO,WAAApP,EAAAC,OAAAkB,EAAA,8BAGAA,EAAAnC,KAAA+P,oBAAA/E,GAKA,MAAArF,IAGA/F,EAAAgB,oBAmFA0N,EAAA3M,UAAAkC,OAAAC,OAAAlD,EAAAe,WACA2M,EAAA3M,UAAAmN,SAAAlO,EASA0N,EAAAzM,cACA,SAAAoM,GACA,GAAAoC,GAAAxM,OAAAC,OAAAwK,EAAA3M,WAEA+E,EAAA2J,EAAA/O,OAAAD,EAAAoL,UAAAwB,EAAA3M,OAAAsE,WAAA,GACA3C,EAAAoN,EAAAjP,SAAAC,EAAAoL,UAAAwB,EAAA7M,SAAAwE,WAAA,EACAyK,GAAAtO,WAAAkM,EAAA/M,YACAmP,EAAA1J,eAAAsH,EAAA/H,wBAAAmK,EAAAjP,SAAAwE,UACAyK,EAAAtO,YACAsO,EAAApO,KAAAgM,EAAAlN,KAWA,QAJAuP,GAAArC,EAAA1M,UAAAqE,UAAAsF,QACAqF,EAAAF,EAAApB,uBACAuB,EAAAH,EAAAjB,sBAEAvJ,EAAA,EAAA5B,EAAAqM,EAAArM,OAAsD4B,EAAA5B,EAAY4B,IAAA,CAClE,GAAA4K,GAAAH,EAAAzK,GACA6K,EAAA,GAAAnC,EACAmC,GAAAnO,cAAAkO,EAAAlO,cACAmO,EAAAjO,gBAAAgO,EAAAhO,gBAEAgO,EAAA/N,SACAgO,EAAAhO,OAAAO,EAAAgD,QAAAwK,EAAA/N,QACAgO,EAAA7N,aAAA4N,EAAA5N,aACA6N,EAAA5N,eAAA2N,EAAA3N,eAEA2N,EAAA1N,OACA2N,EAAA3N,KAAA2D,EAAAT,QAAAwK,EAAA1N,OAGAyN,EAAAtD,KAAAwD,IAGAH,EAAArD,KAAAwD,GAKA,MAFA1B,GAAAqB,EAAAjB,mBAAApO,EAAAyK,4BAEA4E,GAMA/B,EAAA3M,UAAAC,SAAA,EAKAiC,OAAAqL,eAAAZ,EAAA3M,UAAA,WACAwL,IAAA,WACA,MAAAnN,MAAAoB,SAAAwE,UAAAS,IAAA,SAAAiF,GACA,aAAAtL,KAAA+B,WAAAf,EAAAyD,KAAAzE,KAAA+B,WAAAuJ,MACKtL,SAqBLsO,EAAA3M,UAAAwN,eACA,SAAAxH,EAAAvB,GAeA,IAdA,GAYAjE,GAAAwO,EAAAC,EAAAC,EAAA1I,EAZA5F,EAAA,EACA6C,EAAA,EACAG,EAAA,EACAD,EAAA,EACAG,EAAA,EACAD,EAAA,EACAvB,EAAA0D,EAAA1D,OACA+G,EAAA,EACA8F,KACAC,KACAC,KACAV,KAGAtF,EAAA/G,GACA,SAAA0D,EAAAO,OAAA8C,GACAzI,IACAyI,IACA5F,EAAA,MAEA,UAAAuC,EAAAO,OAAA8C,GACAA,QAEA,CASA,IARA7I,EAAA,GAAAoM,GACApM,EAAAI,gBAOAsO,EAAA7F,EAAyB6F,EAAA5M,IACzBjE,KAAAqP,wBAAA1H,EAAAkJ,GADuCA,KAQvC,GAHAF,EAAAhJ,EAAAuD,MAAAF,EAAA6F,GAEAD,EAAAE,EAAAH,GAEA3F,GAAA2F,EAAA1M,WACS,CAET,IADA2M,KACA5F,EAAA6F,GACAnP,EAAAgG,OAAAC,EAAAqD,EAAA+F,GACA5I,EAAA4I,EAAA5I,MACA6C,EAAA+F,EAAA3I,KACAwI,EAAA1D,KAAA/E,EAGA,QAAAyI,EAAA3M,OACA,SAAAG,OAAA,yCAGA,QAAAwM,EAAA3M,OACA,SAAAG,OAAA,yCAGA0M,GAAAH,GAAAC,EAIAzO,EAAAM,gBAAA2C,EAAAwL,EAAA,GACAxL,EAAAjD,EAAAM,gBAEAmO,EAAA3M,OAAA,IAEA9B,EAAAO,OAAA+C,EAAAmL,EAAA,GACAnL,GAAAmL,EAAA,GAGAzO,EAAAU,aAAA0C,EAAAqL,EAAA,GACArL,EAAApD,EAAAU,aAEAV,EAAAU,cAAA,EAGAV,EAAAW,eAAAwC,EAAAsL,EAAA,GACAtL,EAAAnD,EAAAW,eAEA8N,EAAA3M,OAAA,IAEA9B,EAAAY,KAAAyC,EAAAoL,EAAA,GACApL,GAAAoL,EAAA,KAIAN,EAAApD,KAAA/K,GACA,gBAAAA,GAAAU,cACAmO,EAAA9D,KAAA/K,GAKA6M,EAAAsB,EAAAtP,EAAA8K,qCACA9L,KAAAiP,oBAAAqB,EAEAtB,EAAAgC,EAAAhQ,EAAAyK,4BACAzL,KAAAoP,mBAAA4B,GAOA1C,EAAA3M,UAAAuO,aACA,SAAAe,EAAAC,EAAAC,EACAC,EAAAC,EAAAC,GAMA,GAAAL,EAAAE,IAAA,EACA,SAAA3I,WAAA,gDACAyI,EAAAE,GAEA,IAAAF,EAAAG,GAAA,EACA,SAAA5I,WAAA,kDACAyI,EAAAG,GAGA,OAAArC,GAAAwC,OAAAN,EAAAC,EAAAG,EAAAC,IAOAhD,EAAA3M,UAAA6P,mBACA,WACA,OAAAxG,GAAA,EAAuBA,EAAAhL,KAAA8P,mBAAA7L,SAAwC+G,EAAA,CAC/D,GAAA7I,GAAAnC,KAAA8P,mBAAA9E,EAMA,IAAAA,EAAA,EAAAhL,KAAA8P,mBAAA7L,OAAA,CACA,GAAAwN,GAAAzR,KAAA8P,mBAAA9E,EAAA,EAEA,IAAA7I,EAAAI,gBAAAkP,EAAAlP,cAAA,CACAJ,EAAAuP,oBAAAD,EAAAhP,gBAAA,CACA,WAKAN,EAAAuP,oBAAAC,MAwBArD,EAAA3M,UAAA6C,oBACA,SAAA1D,GACA,GAAAmP,IACA1N,cAAAvB,EAAAC,OAAAH,EAAA,QACA2B,gBAAAzB,EAAAC,OAAAH,EAAA,WAGAkK,EAAAhL,KAAAkQ,aACAD,EACAjQ,KAAA8P,mBACA,gBACA,kBACA9O,EAAA8K,oCACA9K,EAAAC,OAAAH,EAAA,OAAAF,EAAA4O,sBAGA,IAAAxE,GAAA,GACA,GAAA7I,GAAAnC,KAAA8P,mBAAA9E,EAEA,IAAA7I,EAAAI,gBAAA0N,EAAA1N,cAAA,CACA,GAAAG,GAAA1B,EAAAC,OAAAkB,EAAA,cACA,QAAAO,IACAA,EAAA1C,KAAAoB,SAAAgM,GAAA1K,GACA,MAAA1C,KAAA+B,aACAW,EAAA1B,EAAAyD,KAAAzE,KAAA+B,WAAAW,IAGA,IAAAK,GAAA/B,EAAAC,OAAAkB,EAAA,YAIA,OAHA,QAAAY,IACAA,EAAA/C,KAAAsB,OAAA8L,GAAArK,KAGAL,SACAJ,KAAAtB,EAAAC,OAAAkB,EAAA,qBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,uBACAY,SAKA,OACAL,OAAA,KACAJ,KAAA,KACAE,OAAA,KACAO,KAAA,OAQAuL,EAAA3M,UAAAiQ,wBACA,WACA,QAAA5R,KAAA2G,iBAGA3G,KAAA2G,eAAA1C,QAAAjE,KAAAoB,SAAAyL,SACA7M,KAAA2G,eAAAkL,KAAA,SAAAC,GAA+C,aAAAA,MAQ/CxD,EAAA3M,UAAA0B,iBACA,SAAAuB,EAAAmN,GACA,IAAA/R,KAAA2G,eACA,WAOA,IAJA,MAAA3G,KAAA+B,aACA6C,EAAA5D,EAAA2B,SAAA3C,KAAA+B,WAAA6C,IAGA5E,KAAAoB,SAAAqC,IAAAmB,GACA,MAAA5E,MAAA2G,eAAA3G,KAAAoB,SAAA6E,QAAArB,GAGA,IAAAqF,EACA,UAAAjK,KAAA+B,aACAkI,EAAAjJ,EAAAsI,SAAAtJ,KAAA+B,aAAA,CAKA,GAAAiQ,GAAApN,EAAAkG,QAAA,gBACA,YAAAb,EAAAP,QACA1J,KAAAoB,SAAAqC,IAAAuO,GACA,MAAAhS,MAAA2G,eAAA3G,KAAAoB,SAAA6E,QAAA+L,GAGA,MAAA/H,EAAAH,MAAA,KAAAG,EAAAH,OACA9J,KAAAoB,SAAAqC,IAAA,IAAAmB,GACA,MAAA5E,MAAA2G,eAAA3G,KAAAoB,SAAA6E,QAAA,IAAArB,IAQA,GAAAmN,EACA,WAGA,UAAA3N,OAAA,IAAAQ,EAAA,+BAuBA0J,EAAA3M,UAAAsQ,qBACA,SAAAnR,GACA,GAAA4B,GAAA1B,EAAAC,OAAAH,EAAA,SAIA,IAHA,MAAAd,KAAA+B,aACAW,EAAA1B,EAAA2B,SAAA3C,KAAA+B,WAAAW,KAEA1C,KAAAoB,SAAAqC,IAAAf,GACA,OACAJ,KAAA,KACAE,OAAA,KACA4N,WAAA,KAGA1N,GAAA1C,KAAAoB,SAAA6E,QAAAvD,EAEA,IAAAuN,IACAvN,SACAG,aAAA7B,EAAAC,OAAAH,EAAA,QACAgC,eAAA9B,EAAAC,OAAAH,EAAA,WAGAkK,EAAAhL,KAAAkQ,aACAD,EACAjQ,KAAA+P,kBACA,eACA,iBACA/O,EAAAyK,2BACAzK,EAAAC,OAAAH,EAAA,OAAAF,EAAA4O,sBAGA,IAAAxE,GAAA,GACA,GAAA7I,GAAAnC,KAAA+P,kBAAA/E,EAEA,IAAA7I,EAAAO,SAAAuN,EAAAvN,OACA,OACAJ,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAiO,WAAApP,EAAAC,OAAAkB,EAAA,6BAKA,OACAG,KAAA,KACAE,OAAA,KACA4N,WAAA,OAIAxQ,EAAA0O,yBA+FAD,EAAA1M,UAAAkC,OAAAC,OAAAlD,EAAAe,WACA0M,EAAA1M,UAAAuQ,YAAAtR,EAKAyN,EAAA1M,UAAAC,SAAA,EAKAiC,OAAAqL,eAAAb,EAAA1M,UAAA,WACAwL,IAAA,WAEA,OADAlK,MACA4C,EAAA,EAAmBA,EAAA7F,KAAAyO,UAAAxK,OAA2B4B,IAC9C,OAAAsM,GAAA,EAAqBA,EAAAnS,KAAAyO,UAAA5I,GAAAiJ,SAAA7L,QAAAgB,OAA+CkO,IACpElP,EAAAiK,KAAAlN,KAAAyO,UAAA5I,GAAAiJ,SAAA7L,QAAAkP,GAGA,OAAAlP,MAmBAoL,EAAA1M,UAAA6C,oBACA,SAAA1D,GACA,GAAAmP,IACA1N,cAAAvB,EAAAC,OAAAH,EAAA,QACA2B,gBAAAzB,EAAAC,OAAAH,EAAA,WAKAsR,EAAArD,EAAAwC,OAAAtB,EAAAjQ,KAAAyO,UACA,SAAAwB,EAAAoC,GACA,GAAAxG,GAAAoE,EAAA1N,cAAA8P,EAAAxD,gBAAAtM,aACA,OAAAsJ,GACAA,EAGAoE,EAAAxN,gBACA4P,EAAAxD,gBAAApM,kBAEA4P,EAAArS,KAAAyO,UAAA2D,EAEA,OAAAC,GASAA,EAAAvD,SAAAtK,qBACAlC,KAAA2N,EAAA1N,eACA8P,EAAAxD,gBAAAtM,cAAA,GACAC,OAAAyN,EAAAxN,iBACA4P,EAAAxD,gBAAAtM,gBAAA0N,EAAA1N,cACA8P,EAAAxD,gBAAApM,gBAAA,EACA,GACA6P,KAAAxR,EAAAwR,QAdA5P,OAAA,KACAJ,KAAA,KACAE,OAAA,KACAO,KAAA,OAmBAsL,EAAA1M,UAAAiQ,wBACA,WACA,MAAA5R,MAAAyO,UAAA8D,MAAA,SAAAjH,GACA,MAAAA,GAAAwD,SAAA8C,6BASAvD,EAAA1M,UAAA0B,iBACA,SAAAuB,EAAAmN,GACA,OAAAlM,GAAA,EAAmBA,EAAA7F,KAAAyO,UAAAxK,OAA2B4B,IAAA,CAC9C,GAAAwM,GAAArS,KAAAyO,UAAA5I,GAEAzC,EAAAiP,EAAAvD,SAAAzL,iBAAAuB,GAAA,EACA,IAAAxB,EACA,MAAAA,GAGA,GAAA2O,EACA,WAGA,UAAA3N,OAAA,IAAAQ,EAAA,+BAkBAyJ,EAAA1M,UAAAsQ,qBACA,SAAAnR,GACA,OAAA+E,GAAA,EAAmBA,EAAA7F,KAAAyO,UAAAxK,OAA2B4B,IAAA,CAC9C,GAAAwM,GAAArS,KAAAyO,UAAA5I,EAIA,IAAAwM,EAAAvD,SAAA7L,QAAAgD,QAAAjF,EAAAC,OAAAH,EAAA,iBAGA,GAAA0R,GAAAH,EAAAvD,SAAAmD,qBAAAnR,EACA,IAAA0R,EAAA,CACA,GAAAC,IACAnQ,KAAAkQ,EAAAlQ,MACA+P,EAAAxD,gBAAAtM,cAAA,GACAC,OAAAgQ,EAAAhQ,QACA6P,EAAAxD,gBAAAtM,gBAAAiQ,EAAAlQ,KACA+P,EAAAxD,gBAAApM,gBAAA,EACA,GAEA,OAAAgQ,KAIA,OACAnQ,KAAA,KACAE,OAAA,OASA6L,EAAA1M,UAAAwN,eACA,SAAAxH,EAAAvB,GACApG,KAAAiP,uBACAjP,KAAAoP,qBACA,QAAAvJ,GAAA,EAAmBA,EAAA7F,KAAAyO,UAAAxK,OAA2B4B,IAG9C,OAFAwM,GAAArS,KAAAyO,UAAA5I,GACA6M,EAAAL,EAAAvD,SAAAgB,mBACAqC,EAAA,EAAqBA,EAAAO,EAAAzO,OAA4BkO,IAAA,CACjD,GAAAhQ,GAAAuQ,EAAAP,GAEAzP,EAAA2P,EAAAvD,SAAA1N,SAAAgM,GAAAjL,EAAAO,OACA,QAAA2P,EAAAvD,SAAA/M,aACAW,EAAA1B,EAAAyD,KAAA4N,EAAAvD,SAAA/M,WAAAW,IAEA1C,KAAAoB,SAAAsC,IAAAhB,GACAA,EAAA1C,KAAAoB,SAAA6E,QAAAvD,EAEA,IAAAK,GAAAsP,EAAAvD,SAAAxN,OAAA8L,GAAAjL,EAAAY,KACA/C,MAAAsB,OAAAoC,IAAAX,GACAA,EAAA/C,KAAAsB,OAAA2E,QAAAlD,EAMA,IAAA4P,IACAjQ,SACAH,cAAAJ,EAAAI,eACA8P,EAAAxD,gBAAAtM,cAAA,GACAE,gBAAAN,EAAAM,iBACA4P,EAAAxD,gBAAAtM,gBAAAJ,EAAAI,cACA8P,EAAAxD,gBAAApM,gBAAA,EACA,GACAI,aAAAV,EAAAU,aACAC,eAAAX,EAAAW,eACAC,OAGA/C,MAAAiP,oBAAA/B,KAAAyF,GACA,gBAAAA,GAAA9P,cACA7C,KAAAoP,mBAAAlC,KAAAyF,GAKA3D,EAAAhP,KAAAiP,oBAAAjO,EAAA8K,qCACAkD,EAAAhP,KAAAoP,mBAAApO,EAAAyK,6BAGA7L,EAAAyO,4BTu0CM,SAAUxO,EAAQD,GUz2ExB,QAAAgT,GAAAC,EAAAC,EAAA7B,EAAA8B,EAAAC,EAAA1B,GAUA,GAAA2B,GAAAC,KAAAC,OAAAL,EAAAD,GAAA,GAAAA,EACAhH,EAAAmH,EAAA/B,EAAA8B,EAAAE,IAAA,EACA,YAAApH,EAEAoH,EAEApH,EAAA,EAEAiH,EAAAG,EAAA,EAEAL,EAAAK,EAAAH,EAAA7B,EAAA8B,EAAAC,EAAA1B,GAKAA,GAAA1R,EAAA6P,kBACAqD,EAAAC,EAAA9O,OAAA6O,GAAA,EAEAG,EAKAA,EAAAJ,EAAA,EAEAD,EAAAC,EAAAI,EAAAhC,EAAA8B,EAAAC,EAAA1B,GAIAA,GAAA1R,EAAA6P,kBACAwD,EAEAJ,EAAA,KAAAA,EA1DAjT,EAAA4P,qBAAA,EACA5P,EAAA6P,kBAAA,EAgFA7P,EAAA2R,OAAA,SAAAN,EAAA8B,EAAAC,EAAA1B,GACA,OAAAyB,EAAA9O,OACA,QAGA,IAAA+G,GAAA4H,GAAA,EAAAG,EAAA9O,OAAAgN,EAAA8B,EACAC,EAAA1B,GAAA1R,EAAA4P,qBACA,IAAAxE,EAAA,EACA,QAMA,MAAAA,EAAA,MACA,IAAAgI,EAAAD,EAAA/H,GAAA+H,EAAA/H,EAAA,UAGAA,CAGA,OAAAA,KVw4EM,SAAUnL,EAAQD,GW19ExB,QAAAwT,GAAAC,EAAAC,EAAAC,GACA,GAAAxC,GAAAsC,EAAAC,EACAD,GAAAC,GAAAD,EAAAE,GACAF,EAAAE,GAAAxC,EAWA,QAAAyC,GAAAC,EAAAC,GACA,MAAAR,MAAAS,MAAAF,EAAAP,KAAAU,UAAAF,EAAAD,IAeA,QAAAI,GAAAR,EAAAS,EAAApT,EAAAqT,GAKA,GAAArT,EAAAqT,EAAA,CAYA,GAAAC,GAAAR,EAAA9S,EAAAqT,GACAlO,EAAAnF,EAAA,CAEA0S,GAAAC,EAAAW,EAAAD,EASA,QARAE,GAAAZ,EAAAU,GAQA5B,EAAAzR,EAAmByR,EAAA4B,EAAO5B,IAC1B2B,EAAAT,EAAAlB,GAAA8B,IAAA,IACApO,GAAA,EACAuN,EAAAC,EAAAxN,EAAAsM,GAIAiB,GAAAC,EAAAxN,EAAA,EAAAsM,EACA,IAAA+B,GAAArO,EAAA,CAIAgO,GAAAR,EAAAS,EAAApT,EAAAwT,EAAA,GACAL,EAAAR,EAAAS,EAAAI,EAAA,EAAAH,IAYAnU,EAAAoP,UAAA,SAAAqE,EAAAS,GACAD,EAAAR,EAAAS,EAAA,EAAAT,EAAApP,OAAA,KX6/EM,SAAUpE,EAAQD,EAASM,GY3kFjC,QAAAW,GAAAsT,EAAAC,EAAAxP,EAAAyP,EAAAxP,GACA7E,KAAAsU,YACAtU,KAAAuU,kBACAvU,KAAAsC,KAAA,MAAA6R,EAAA,KAAAA,EACAnU,KAAAwC,OAAA,MAAA4R,EAAA,KAAAA,EACApU,KAAA0C,OAAA,MAAAkC,EAAA,KAAAA,EACA5E,KAAA+C,KAAA,MAAA8B,EAAA,KAAAA,EACA7E,KAAAwU,IAAA,EACA,MAAAH,GAAArU,KAAA0D,IAAA2Q,GAnCA,GAAA1T,GAAAT,EAAA,GAAAS,mBACAK,EAAAd,EAAA,GAIAuU,EAAA,UAGAC,EAAA,GAKAF,EAAA,oBAiCA3T,GAAA8T,wBACA,SAAAC,EAAA9S,EAAA+S,GA+FA,QAAAC,GAAA3S,EAAA4S,GACA,UAAA5S,GAAAgO,SAAAhO,EAAAO,OACAsS,EAAAtR,IAAAqR,OACO,CACP,GAAArS,GAAAmS,EACA7T,EAAAyD,KAAAoQ,EAAA1S,EAAAO,QACAP,EAAAO,MACAsS,GAAAtR,IAAA,GAAA7C,GAAAsB,EAAAU,aACAV,EAAAW,eACAJ,EACAqS,EACA5S,EAAAY,QAvGA,GAAAiS,GAAA,GAAAnU,GAMAoU,EAAAL,EAAAtM,MAAAmM,GACAS,EAAA,EACAC,EAAA,WAMA,QAAAC,KACA,MAAAF,GAAAD,EAAAhR,OACAgR,EAAAC,KAAA/E,OAPA,GAAAkF,GAAAD,IAEAE,EAAAF,KAAA,EACA,OAAAC,GAAAC,GASAC,EAAA,EAAA7D,EAAA,EAKA8D,EAAA,IAgEA,OA9DA1T,GAAAI,YAAA,SAAAC,GACA,UAAAqT,EAAA,CAGA,KAAAD,EAAApT,EAAAI,eAMS,CAIT,GAAAkT,GAAAR,EAAAC,GACAH,EAAAU,EAAArK,OAAA,EAAAjJ,EAAAM,gBACAiP,EAOA,OANAuD,GAAAC,GAAAO,EAAArK,OAAAjJ,EAAAM,gBACAiP,GACAA,EAAAvP,EAAAM,gBACAqS,EAAAU,EAAAT,QAEAS,EAAArT,GAhBA2S,EAAAU,EAAAL,KACAI,IACA7D,EAAA,EAqBA,KAAA6D,EAAApT,EAAAI,eACAyS,EAAAtR,IAAAyR,KACAI,GAEA,IAAA7D,EAAAvP,EAAAM,gBAAA,CACA,GAAAgT,GAAAR,EAAAC,EACAF,GAAAtR,IAAA+R,EAAArK,OAAA,EAAAjJ,EAAAM,kBACAwS,EAAAC,GAAAO,EAAArK,OAAAjJ,EAAAM,iBACAiP,EAAAvP,EAAAM,gBAEA+S,EAAArT,GACKnC,MAELkV,EAAAD,EAAAhR,SACAuR,GAEAV,EAAAU,EAAAL,KAGAH,EAAAtR,IAAAuR,EAAAzK,OAAA0K,GAAAzQ,KAAA,MAIA3C,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAC,GAAAtB,EAAAuB,iBAAAF,EACA,OAAAC,IACA,MAAAyR,IACA1R,EAAAnC,EAAAyD,KAAAoQ,EAAA1R,IAEA6R,EAAA1R,iBAAAH,EAAAC,MAIA4R,GAwBAnU,EAAAc,UAAA+B,IAAA,SAAAgS,GACA,GAAAvK,MAAAwK,QAAAD,GACAA,EAAAxS,QAAA,SAAA0S,GACA5V,KAAA0D,IAAAkS,IACK5V,UAEL,KAAA0V,EAAAlB,IAAA,gBAAAkB,GAMA,SAAAlN,WACA,8EAAAkN,EANAA,IACA1V,KAAAsU,SAAApH,KAAAwI,GAQA,MAAA1V,OASAa,EAAAc,UAAAkU,QAAA,SAAAH,GACA,GAAAvK,MAAAwK,QAAAD,GACA,OAAA7P,GAAA6P,EAAAzR,OAAA,EAAiC4B,GAAA,EAAQA,IACzC7F,KAAA6V,QAAAH,EAAA7P,QAGA,KAAA6P,EAAAlB,IAAA,gBAAAkB,GAIA,SAAAlN,WACA,8EAAAkN,EAJA1V,MAAAsU,SAAAwB,QAAAJ,GAOA,MAAA1V,OAUAa,EAAAc,UAAAoU,KAAA,SAAAC,GAEA,OADAJ,GACA/P,EAAA,EAAAC,EAAA9F,KAAAsU,SAAArQ,OAA6C4B,EAAAC,EAASD,IACtD+P,EAAA5V,KAAAsU,SAAAzO,GACA+P,EAAApB,GACAoB,EAAAG,KAAAC,GAGA,KAAAJ,GACAI,EAAAJ,GAAoBlT,OAAA1C,KAAA0C,OACpBJ,KAAAtC,KAAAsC,KACAE,OAAAxC,KAAAwC,OACAO,KAAA/C,KAAA+C,QAYAlC,EAAAc,UAAA8C,KAAA,SAAAwR,GACA,GAAAC,GACArQ,EACAC,EAAA9F,KAAAsU,SAAArQ,MACA,IAAA6B,EAAA,GAEA,IADAoQ,KACArQ,EAAA,EAAeA,EAAAC,EAAA,EAAWD,IAC1BqQ,EAAAhJ,KAAAlN,KAAAsU,SAAAzO,IACAqQ,EAAAhJ,KAAA+I,EAEAC,GAAAhJ,KAAAlN,KAAAsU,SAAAzO,IACA7F,KAAAsU,SAAA4B,EAEA,MAAAlW,OAUAa,EAAAc,UAAAwU,aAAA,SAAAC,EAAAC,GACA,GAAAC,GAAAtW,KAAAsU,SAAAtU,KAAAsU,SAAArQ,OAAA,EAUA,OATAqS,GAAA9B,GACA8B,EAAAH,aAAAC,EAAAC,GAEA,gBAAAC,GACAtW,KAAAsU,SAAAtU,KAAAsU,SAAArQ,OAAA,GAAAqS,EAAAxL,QAAAsL,EAAAC,GAGArW,KAAAsU,SAAApH,KAAA,GAAApC,QAAAsL,EAAAC,IAEArW,MAUAa,EAAAc,UAAA2B,iBACA,SAAAK,EAAAC,GACA5D,KAAAuU,eAAAvT,EAAA+C,YAAAJ,IAAAC,GASA/C,EAAAc,UAAA4U,mBACA,SAAAP,GACA,OAAAnQ,GAAA,EAAAC,EAAA9F,KAAAsU,SAAArQ,OAA+C4B,EAAAC,EAASD,IACxD7F,KAAAsU,SAAAzO,GAAA2O,IACAxU,KAAAsU,SAAAzO,GAAA0Q,mBAAAP,EAKA,QADA/S,GAAAY,OAAAG,KAAAhE,KAAAuU,gBACA1O,EAAA,EAAAC,EAAA7C,EAAAgB,OAAyC4B,EAAAC,EAASD,IAClDmQ,EAAAhV,EAAAwK,cAAAvI,EAAA4C,IAAA7F,KAAAuU,eAAAtR,EAAA4C,MAQAhF,EAAAc,UAAAiF,SAAA,WACA,GAAA+J,GAAA,EAIA,OAHA3Q,MAAA+V,KAAA,SAAAH,GACAjF,GAAAiF,IAEAjF,GAOA9P,EAAAc,UAAA6U,sBAAA,SAAA1V,GACA,GAAAuB,IACA0S,KAAA,GACAzS,KAAA,EACAE,OAAA,GAEA6D,EAAA,GAAA1F,GAAAG,GACA2V,GAAA,EACAC,EAAA,KACAC,EAAA,KACAC,EAAA,KACAC,EAAA,IAqEA,OApEA7W,MAAA+V,KAAA,SAAAH,EAAAhT,GACAP,EAAA0S,MAAAa,EACA,OAAAhT,EAAAF,QACA,OAAAE,EAAAN,MACA,OAAAM,EAAAJ,QACAkU,IAAA9T,EAAAF,QACAiU,IAAA/T,EAAAN,MACAsU,IAAAhU,EAAAJ,QACAqU,IAAAjU,EAAAG,MACAsD,EAAArD,YACAN,OAAAE,EAAAF,OACAE,UACAN,KAAAM,EAAAN,KACAE,OAAAI,EAAAJ,QAEAH,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,QAEAO,KAAAH,EAAAG,OAGA2T,EAAA9T,EAAAF,OACAiU,EAAA/T,EAAAN,KACAsU,EAAAhU,EAAAJ,OACAqU,EAAAjU,EAAAG,KACA0T,GAAA,GACKA,IACLpQ,EAAArD,YACAX,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,UAGAkU,EAAA,KACAD,GAAA,EAEA,QAAAxJ,GAAA,EAAAhJ,EAAA2R,EAAA3R,OAA4CgJ,EAAAhJ,EAAcgJ,IAC1D2I,EAAA3N,WAAAgF,KAAAyH,GACArS,EAAAC,OACAD,EAAAG,OAAA,EAEAyK,EAAA,IAAAhJ,GACAyS,EAAA,KACAD,GAAA,GACSA,GACTpQ,EAAArD,YACAN,OAAAE,EAAAF,OACAE,UACAN,KAAAM,EAAAN,KACAE,OAAAI,EAAAJ,QAEAH,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,QAEAO,KAAAH,EAAAG,QAIAV,EAAAG,WAIAxC,KAAAuW,mBAAA,SAAApT,EAAA2T,GACAzQ,EAAA/C,iBAAAH,EAAA2T,MAGU/B,KAAA1S,EAAA0S,KAAA1O,QAGVzG,EAAAiB","file":"source-map.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"sourceMap\"] = factory();\n\telse\n\t\troot[\"sourceMap\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition","(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"sourceMap\"] = factory();\n\telse\n\t\troot[\"sourceMap\"] = factory();\n})(this, function() {\nreturn /******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId])\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\texports: {},\n/******/ \t\t\tid: moduleId,\n/******/ \t\t\tloaded: false\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.loaded = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(0);\n/******/ })\n/************************************************************************/\n/******/ ([\n/* 0 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/*\n\t * Copyright 2009-2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE.txt or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\texports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;\n\texports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer;\n\texports.SourceNode = __webpack_require__(10).SourceNode;\n\n\n/***/ }),\n/* 1 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar base64VLQ = __webpack_require__(2);\n\tvar util = __webpack_require__(4);\n\tvar ArraySet = __webpack_require__(5).ArraySet;\n\tvar MappingList = __webpack_require__(6).MappingList;\n\t\n\t/**\n\t * An instance of the SourceMapGenerator represents a source map which is\n\t * being built incrementally. You may pass an object with the following\n\t * properties:\n\t *\n\t *   - file: The filename of the generated source.\n\t *   - sourceRoot: A root for all relative URLs in this source map.\n\t */\n\tfunction SourceMapGenerator(aArgs) {\n\t  if (!aArgs) {\n\t    aArgs = {};\n\t  }\n\t  this._file = util.getArg(aArgs, 'file', null);\n\t  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);\n\t  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);\n\t  this._sources = new ArraySet();\n\t  this._names = new ArraySet();\n\t  this._mappings = new MappingList();\n\t  this._sourcesContents = null;\n\t}\n\t\n\tSourceMapGenerator.prototype._version = 3;\n\t\n\t/**\n\t * Creates a new SourceMapGenerator based on a SourceMapConsumer\n\t *\n\t * @param aSourceMapConsumer The SourceMap.\n\t */\n\tSourceMapGenerator.fromSourceMap =\n\t  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {\n\t    var sourceRoot = aSourceMapConsumer.sourceRoot;\n\t    var generator = new SourceMapGenerator({\n\t      file: aSourceMapConsumer.file,\n\t      sourceRoot: sourceRoot\n\t    });\n\t    aSourceMapConsumer.eachMapping(function (mapping) {\n\t      var newMapping = {\n\t        generated: {\n\t          line: mapping.generatedLine,\n\t          column: mapping.generatedColumn\n\t        }\n\t      };\n\t\n\t      if (mapping.source != null) {\n\t        newMapping.source = mapping.source;\n\t        if (sourceRoot != null) {\n\t          newMapping.source = util.relative(sourceRoot, newMapping.source);\n\t        }\n\t\n\t        newMapping.original = {\n\t          line: mapping.originalLine,\n\t          column: mapping.originalColumn\n\t        };\n\t\n\t        if (mapping.name != null) {\n\t          newMapping.name = mapping.name;\n\t        }\n\t      }\n\t\n\t      generator.addMapping(newMapping);\n\t    });\n\t    aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t      var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t      if (content != null) {\n\t        generator.setSourceContent(sourceFile, content);\n\t      }\n\t    });\n\t    return generator;\n\t  };\n\t\n\t/**\n\t * Add a single mapping from original source line and column to the generated\n\t * source's line and column for this source map being created. The mapping\n\t * object should have the following properties:\n\t *\n\t *   - generated: An object with the generated line and column positions.\n\t *   - original: An object with the original line and column positions.\n\t *   - source: The original source file (relative to the sourceRoot).\n\t *   - name: An optional original token name for this mapping.\n\t */\n\tSourceMapGenerator.prototype.addMapping =\n\t  function SourceMapGenerator_addMapping(aArgs) {\n\t    var generated = util.getArg(aArgs, 'generated');\n\t    var original = util.getArg(aArgs, 'original', null);\n\t    var source = util.getArg(aArgs, 'source', null);\n\t    var name = util.getArg(aArgs, 'name', null);\n\t\n\t    if (!this._skipValidation) {\n\t      this._validateMapping(generated, original, source, name);\n\t    }\n\t\n\t    if (source != null) {\n\t      source = String(source);\n\t      if (!this._sources.has(source)) {\n\t        this._sources.add(source);\n\t      }\n\t    }\n\t\n\t    if (name != null) {\n\t      name = String(name);\n\t      if (!this._names.has(name)) {\n\t        this._names.add(name);\n\t      }\n\t    }\n\t\n\t    this._mappings.add({\n\t      generatedLine: generated.line,\n\t      generatedColumn: generated.column,\n\t      originalLine: original != null && original.line,\n\t      originalColumn: original != null && original.column,\n\t      source: source,\n\t      name: name\n\t    });\n\t  };\n\t\n\t/**\n\t * Set the source content for a source file.\n\t */\n\tSourceMapGenerator.prototype.setSourceContent =\n\t  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {\n\t    var source = aSourceFile;\n\t    if (this._sourceRoot != null) {\n\t      source = util.relative(this._sourceRoot, source);\n\t    }\n\t\n\t    if (aSourceContent != null) {\n\t      // Add the source content to the _sourcesContents map.\n\t      // Create a new _sourcesContents map if the property is null.\n\t      if (!this._sourcesContents) {\n\t        this._sourcesContents = Object.create(null);\n\t      }\n\t      this._sourcesContents[util.toSetString(source)] = aSourceContent;\n\t    } else if (this._sourcesContents) {\n\t      // Remove the source file from the _sourcesContents map.\n\t      // If the _sourcesContents map is empty, set the property to null.\n\t      delete this._sourcesContents[util.toSetString(source)];\n\t      if (Object.keys(this._sourcesContents).length === 0) {\n\t        this._sourcesContents = null;\n\t      }\n\t    }\n\t  };\n\t\n\t/**\n\t * Applies the mappings of a sub-source-map for a specific source file to the\n\t * source map being generated. Each mapping to the supplied source file is\n\t * rewritten using the supplied source map. Note: The resolution for the\n\t * resulting mappings is the minimium of this map and the supplied map.\n\t *\n\t * @param aSourceMapConsumer The source map to be applied.\n\t * @param aSourceFile Optional. The filename of the source file.\n\t *        If omitted, SourceMapConsumer's file property will be used.\n\t * @param aSourceMapPath Optional. The dirname of the path to the source map\n\t *        to be applied. If relative, it is relative to the SourceMapConsumer.\n\t *        This parameter is needed when the two source maps aren't in the same\n\t *        directory, and the source map to be applied contains relative source\n\t *        paths. If so, those relative source paths need to be rewritten\n\t *        relative to the SourceMapGenerator.\n\t */\n\tSourceMapGenerator.prototype.applySourceMap =\n\t  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {\n\t    var sourceFile = aSourceFile;\n\t    // If aSourceFile is omitted, we will use the file property of the SourceMap\n\t    if (aSourceFile == null) {\n\t      if (aSourceMapConsumer.file == null) {\n\t        throw new Error(\n\t          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +\n\t          'or the source map\\'s \"file\" property. Both were omitted.'\n\t        );\n\t      }\n\t      sourceFile = aSourceMapConsumer.file;\n\t    }\n\t    var sourceRoot = this._sourceRoot;\n\t    // Make \"sourceFile\" relative if an absolute Url is passed.\n\t    if (sourceRoot != null) {\n\t      sourceFile = util.relative(sourceRoot, sourceFile);\n\t    }\n\t    // Applying the SourceMap can add and remove items from the sources and\n\t    // the names array.\n\t    var newSources = new ArraySet();\n\t    var newNames = new ArraySet();\n\t\n\t    // Find mappings for the \"sourceFile\"\n\t    this._mappings.unsortedForEach(function (mapping) {\n\t      if (mapping.source === sourceFile && mapping.originalLine != null) {\n\t        // Check if it can be mapped by the source map, then update the mapping.\n\t        var original = aSourceMapConsumer.originalPositionFor({\n\t          line: mapping.originalLine,\n\t          column: mapping.originalColumn\n\t        });\n\t        if (original.source != null) {\n\t          // Copy mapping\n\t          mapping.source = original.source;\n\t          if (aSourceMapPath != null) {\n\t            mapping.source = util.join(aSourceMapPath, mapping.source)\n\t          }\n\t          if (sourceRoot != null) {\n\t            mapping.source = util.relative(sourceRoot, mapping.source);\n\t          }\n\t          mapping.originalLine = original.line;\n\t          mapping.originalColumn = original.column;\n\t          if (original.name != null) {\n\t            mapping.name = original.name;\n\t          }\n\t        }\n\t      }\n\t\n\t      var source = mapping.source;\n\t      if (source != null && !newSources.has(source)) {\n\t        newSources.add(source);\n\t      }\n\t\n\t      var name = mapping.name;\n\t      if (name != null && !newNames.has(name)) {\n\t        newNames.add(name);\n\t      }\n\t\n\t    }, this);\n\t    this._sources = newSources;\n\t    this._names = newNames;\n\t\n\t    // Copy sourcesContents of applied map.\n\t    aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t      var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t      if (content != null) {\n\t        if (aSourceMapPath != null) {\n\t          sourceFile = util.join(aSourceMapPath, sourceFile);\n\t        }\n\t        if (sourceRoot != null) {\n\t          sourceFile = util.relative(sourceRoot, sourceFile);\n\t        }\n\t        this.setSourceContent(sourceFile, content);\n\t      }\n\t    }, this);\n\t  };\n\t\n\t/**\n\t * A mapping can have one of the three levels of data:\n\t *\n\t *   1. Just the generated position.\n\t *   2. The Generated position, original position, and original source.\n\t *   3. Generated and original position, original source, as well as a name\n\t *      token.\n\t *\n\t * To maintain consistency, we validate that any new mapping being added falls\n\t * in to one of these categories.\n\t */\n\tSourceMapGenerator.prototype._validateMapping =\n\t  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,\n\t                                              aName) {\n\t    // When aOriginal is truthy but has empty values for .line and .column,\n\t    // it is most likely a programmer error. In this case we throw a very\n\t    // specific error message to try to guide them the right way.\n\t    // For example: https://github.com/Polymer/polymer-bundler/pull/519\n\t    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {\n\t        throw new Error(\n\t            'original.line and original.column are not numbers -- you probably meant to omit ' +\n\t            'the original mapping entirely and only map the generated position. If so, pass ' +\n\t            'null for the original mapping instead of an object with empty or null values.'\n\t        );\n\t    }\n\t\n\t    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n\t        && aGenerated.line > 0 && aGenerated.column >= 0\n\t        && !aOriginal && !aSource && !aName) {\n\t      // Case 1.\n\t      return;\n\t    }\n\t    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n\t             && aOriginal && 'line' in aOriginal && 'column' in aOriginal\n\t             && aGenerated.line > 0 && aGenerated.column >= 0\n\t             && aOriginal.line > 0 && aOriginal.column >= 0\n\t             && aSource) {\n\t      // Cases 2 and 3.\n\t      return;\n\t    }\n\t    else {\n\t      throw new Error('Invalid mapping: ' + JSON.stringify({\n\t        generated: aGenerated,\n\t        source: aSource,\n\t        original: aOriginal,\n\t        name: aName\n\t      }));\n\t    }\n\t  };\n\t\n\t/**\n\t * Serialize the accumulated mappings in to the stream of base 64 VLQs\n\t * specified by the source map format.\n\t */\n\tSourceMapGenerator.prototype._serializeMappings =\n\t  function SourceMapGenerator_serializeMappings() {\n\t    var previousGeneratedColumn = 0;\n\t    var previousGeneratedLine = 1;\n\t    var previousOriginalColumn = 0;\n\t    var previousOriginalLine = 0;\n\t    var previousName = 0;\n\t    var previousSource = 0;\n\t    var result = '';\n\t    var next;\n\t    var mapping;\n\t    var nameIdx;\n\t    var sourceIdx;\n\t\n\t    var mappings = this._mappings.toArray();\n\t    for (var i = 0, len = mappings.length; i < len; i++) {\n\t      mapping = mappings[i];\n\t      next = ''\n\t\n\t      if (mapping.generatedLine !== previousGeneratedLine) {\n\t        previousGeneratedColumn = 0;\n\t        while (mapping.generatedLine !== previousGeneratedLine) {\n\t          next += ';';\n\t          previousGeneratedLine++;\n\t        }\n\t      }\n\t      else {\n\t        if (i > 0) {\n\t          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {\n\t            continue;\n\t          }\n\t          next += ',';\n\t        }\n\t      }\n\t\n\t      next += base64VLQ.encode(mapping.generatedColumn\n\t                                 - previousGeneratedColumn);\n\t      previousGeneratedColumn = mapping.generatedColumn;\n\t\n\t      if (mapping.source != null) {\n\t        sourceIdx = this._sources.indexOf(mapping.source);\n\t        next += base64VLQ.encode(sourceIdx - previousSource);\n\t        previousSource = sourceIdx;\n\t\n\t        // lines are stored 0-based in SourceMap spec version 3\n\t        next += base64VLQ.encode(mapping.originalLine - 1\n\t                                   - previousOriginalLine);\n\t        previousOriginalLine = mapping.originalLine - 1;\n\t\n\t        next += base64VLQ.encode(mapping.originalColumn\n\t                                   - previousOriginalColumn);\n\t        previousOriginalColumn = mapping.originalColumn;\n\t\n\t        if (mapping.name != null) {\n\t          nameIdx = this._names.indexOf(mapping.name);\n\t          next += base64VLQ.encode(nameIdx - previousName);\n\t          previousName = nameIdx;\n\t        }\n\t      }\n\t\n\t      result += next;\n\t    }\n\t\n\t    return result;\n\t  };\n\t\n\tSourceMapGenerator.prototype._generateSourcesContent =\n\t  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {\n\t    return aSources.map(function (source) {\n\t      if (!this._sourcesContents) {\n\t        return null;\n\t      }\n\t      if (aSourceRoot != null) {\n\t        source = util.relative(aSourceRoot, source);\n\t      }\n\t      var key = util.toSetString(source);\n\t      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)\n\t        ? this._sourcesContents[key]\n\t        : null;\n\t    }, this);\n\t  };\n\t\n\t/**\n\t * Externalize the source map.\n\t */\n\tSourceMapGenerator.prototype.toJSON =\n\t  function SourceMapGenerator_toJSON() {\n\t    var map = {\n\t      version: this._version,\n\t      sources: this._sources.toArray(),\n\t      names: this._names.toArray(),\n\t      mappings: this._serializeMappings()\n\t    };\n\t    if (this._file != null) {\n\t      map.file = this._file;\n\t    }\n\t    if (this._sourceRoot != null) {\n\t      map.sourceRoot = this._sourceRoot;\n\t    }\n\t    if (this._sourcesContents) {\n\t      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);\n\t    }\n\t\n\t    return map;\n\t  };\n\t\n\t/**\n\t * Render the source map being generated to a string.\n\t */\n\tSourceMapGenerator.prototype.toString =\n\t  function SourceMapGenerator_toString() {\n\t    return JSON.stringify(this.toJSON());\n\t  };\n\t\n\texports.SourceMapGenerator = SourceMapGenerator;\n\n\n/***/ }),\n/* 2 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t *\n\t * Based on the Base 64 VLQ implementation in Closure Compiler:\n\t * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java\n\t *\n\t * Copyright 2011 The Closure Compiler Authors. All rights reserved.\n\t * Redistribution and use in source and binary forms, with or without\n\t * modification, are permitted provided that the following conditions are\n\t * met:\n\t *\n\t *  * Redistributions of source code must retain the above copyright\n\t *    notice, this list of conditions and the following disclaimer.\n\t *  * Redistributions in binary form must reproduce the above\n\t *    copyright notice, this list of conditions and the following\n\t *    disclaimer in the documentation and/or other materials provided\n\t *    with the distribution.\n\t *  * Neither the name of Google Inc. nor the names of its\n\t *    contributors may be used to endorse or promote products derived\n\t *    from this software without specific prior written permission.\n\t *\n\t * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n\t * \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n\t * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n\t * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n\t * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n\t * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n\t * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n\t * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n\t * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n\t * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n\t * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\t */\n\t\n\tvar base64 = __webpack_require__(3);\n\t\n\t// A single base 64 digit can contain 6 bits of data. For the base 64 variable\n\t// length quantities we use in the source map spec, the first bit is the sign,\n\t// the next four bits are the actual value, and the 6th bit is the\n\t// continuation bit. The continuation bit tells us whether there are more\n\t// digits in this value following this digit.\n\t//\n\t//   Continuation\n\t//   |    Sign\n\t//   |    |\n\t//   V    V\n\t//   101011\n\t\n\tvar VLQ_BASE_SHIFT = 5;\n\t\n\t// binary: 100000\n\tvar VLQ_BASE = 1 << VLQ_BASE_SHIFT;\n\t\n\t// binary: 011111\n\tvar VLQ_BASE_MASK = VLQ_BASE - 1;\n\t\n\t// binary: 100000\n\tvar VLQ_CONTINUATION_BIT = VLQ_BASE;\n\t\n\t/**\n\t * Converts from a two-complement value to a value where the sign bit is\n\t * placed in the least significant bit.  For example, as decimals:\n\t *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)\n\t *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)\n\t */\n\tfunction toVLQSigned(aValue) {\n\t  return aValue < 0\n\t    ? ((-aValue) << 1) + 1\n\t    : (aValue << 1) + 0;\n\t}\n\t\n\t/**\n\t * Converts to a two-complement value from a value where the sign bit is\n\t * placed in the least significant bit.  For example, as decimals:\n\t *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1\n\t *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2\n\t */\n\tfunction fromVLQSigned(aValue) {\n\t  var isNegative = (aValue & 1) === 1;\n\t  var shifted = aValue >> 1;\n\t  return isNegative\n\t    ? -shifted\n\t    : shifted;\n\t}\n\t\n\t/**\n\t * Returns the base 64 VLQ encoded value.\n\t */\n\texports.encode = function base64VLQ_encode(aValue) {\n\t  var encoded = \"\";\n\t  var digit;\n\t\n\t  var vlq = toVLQSigned(aValue);\n\t\n\t  do {\n\t    digit = vlq & VLQ_BASE_MASK;\n\t    vlq >>>= VLQ_BASE_SHIFT;\n\t    if (vlq > 0) {\n\t      // There are still more digits in this value, so we must make sure the\n\t      // continuation bit is marked.\n\t      digit |= VLQ_CONTINUATION_BIT;\n\t    }\n\t    encoded += base64.encode(digit);\n\t  } while (vlq > 0);\n\t\n\t  return encoded;\n\t};\n\t\n\t/**\n\t * Decodes the next base 64 VLQ value from the given string and returns the\n\t * value and the rest of the string via the out parameter.\n\t */\n\texports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {\n\t  var strLen = aStr.length;\n\t  var result = 0;\n\t  var shift = 0;\n\t  var continuation, digit;\n\t\n\t  do {\n\t    if (aIndex >= strLen) {\n\t      throw new Error(\"Expected more digits in base 64 VLQ value.\");\n\t    }\n\t\n\t    digit = base64.decode(aStr.charCodeAt(aIndex++));\n\t    if (digit === -1) {\n\t      throw new Error(\"Invalid base64 digit: \" + aStr.charAt(aIndex - 1));\n\t    }\n\t\n\t    continuation = !!(digit & VLQ_CONTINUATION_BIT);\n\t    digit &= VLQ_BASE_MASK;\n\t    result = result + (digit << shift);\n\t    shift += VLQ_BASE_SHIFT;\n\t  } while (continuation);\n\t\n\t  aOutParam.value = fromVLQSigned(result);\n\t  aOutParam.rest = aIndex;\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\t\n\t/**\n\t * Encode an integer in the range of 0 to 63 to a single base 64 digit.\n\t */\n\texports.encode = function (number) {\n\t  if (0 <= number && number < intToCharMap.length) {\n\t    return intToCharMap[number];\n\t  }\n\t  throw new TypeError(\"Must be between 0 and 63: \" + number);\n\t};\n\t\n\t/**\n\t * Decode a single base 64 character code digit to an integer. Returns -1 on\n\t * failure.\n\t */\n\texports.decode = function (charCode) {\n\t  var bigA = 65;     // 'A'\n\t  var bigZ = 90;     // 'Z'\n\t\n\t  var littleA = 97;  // 'a'\n\t  var littleZ = 122; // 'z'\n\t\n\t  var zero = 48;     // '0'\n\t  var nine = 57;     // '9'\n\t\n\t  var plus = 43;     // '+'\n\t  var slash = 47;    // '/'\n\t\n\t  var littleOffset = 26;\n\t  var numberOffset = 52;\n\t\n\t  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ\n\t  if (bigA <= charCode && charCode <= bigZ) {\n\t    return (charCode - bigA);\n\t  }\n\t\n\t  // 26 - 51: abcdefghijklmnopqrstuvwxyz\n\t  if (littleA <= charCode && charCode <= littleZ) {\n\t    return (charCode - littleA + littleOffset);\n\t  }\n\t\n\t  // 52 - 61: 0123456789\n\t  if (zero <= charCode && charCode <= nine) {\n\t    return (charCode - zero + numberOffset);\n\t  }\n\t\n\t  // 62: +\n\t  if (charCode == plus) {\n\t    return 62;\n\t  }\n\t\n\t  // 63: /\n\t  if (charCode == slash) {\n\t    return 63;\n\t  }\n\t\n\t  // Invalid base64 digit.\n\t  return -1;\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\t/**\n\t * This is a helper function for getting values from parameter/options\n\t * objects.\n\t *\n\t * @param args The object we are extracting values from\n\t * @param name The name of the property we are getting.\n\t * @param defaultValue An optional value to return if the property is missing\n\t * from the object. If this is not specified and the property is missing, an\n\t * error will be thrown.\n\t */\n\tfunction getArg(aArgs, aName, aDefaultValue) {\n\t  if (aName in aArgs) {\n\t    return aArgs[aName];\n\t  } else if (arguments.length === 3) {\n\t    return aDefaultValue;\n\t  } else {\n\t    throw new Error('\"' + aName + '\" is a required argument.');\n\t  }\n\t}\n\texports.getArg = getArg;\n\t\n\tvar urlRegexp = /^(?:([\\w+\\-.]+):)?\\/\\/(?:(\\w+:\\w+)@)?([\\w.]*)(?::(\\d+))?(\\S*)$/;\n\tvar dataUrlRegexp = /^data:.+\\,.+$/;\n\t\n\tfunction urlParse(aUrl) {\n\t  var match = aUrl.match(urlRegexp);\n\t  if (!match) {\n\t    return null;\n\t  }\n\t  return {\n\t    scheme: match[1],\n\t    auth: match[2],\n\t    host: match[3],\n\t    port: match[4],\n\t    path: match[5]\n\t  };\n\t}\n\texports.urlParse = urlParse;\n\t\n\tfunction urlGenerate(aParsedUrl) {\n\t  var url = '';\n\t  if (aParsedUrl.scheme) {\n\t    url += aParsedUrl.scheme + ':';\n\t  }\n\t  url += '//';\n\t  if (aParsedUrl.auth) {\n\t    url += aParsedUrl.auth + '@';\n\t  }\n\t  if (aParsedUrl.host) {\n\t    url += aParsedUrl.host;\n\t  }\n\t  if (aParsedUrl.port) {\n\t    url += \":\" + aParsedUrl.port\n\t  }\n\t  if (aParsedUrl.path) {\n\t    url += aParsedUrl.path;\n\t  }\n\t  return url;\n\t}\n\texports.urlGenerate = urlGenerate;\n\t\n\t/**\n\t * Normalizes a path, or the path portion of a URL:\n\t *\n\t * - Replaces consecutive slashes with one slash.\n\t * - Removes unnecessary '.' parts.\n\t * - Removes unnecessary '<dir>/..' parts.\n\t *\n\t * Based on code in the Node.js 'path' core module.\n\t *\n\t * @param aPath The path or url to normalize.\n\t */\n\tfunction normalize(aPath) {\n\t  var path = aPath;\n\t  var url = urlParse(aPath);\n\t  if (url) {\n\t    if (!url.path) {\n\t      return aPath;\n\t    }\n\t    path = url.path;\n\t  }\n\t  var isAbsolute = exports.isAbsolute(path);\n\t\n\t  var parts = path.split(/\\/+/);\n\t  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {\n\t    part = parts[i];\n\t    if (part === '.') {\n\t      parts.splice(i, 1);\n\t    } else if (part === '..') {\n\t      up++;\n\t    } else if (up > 0) {\n\t      if (part === '') {\n\t        // The first part is blank if the path is absolute. Trying to go\n\t        // above the root is a no-op. Therefore we can remove all '..' parts\n\t        // directly after the root.\n\t        parts.splice(i + 1, up);\n\t        up = 0;\n\t      } else {\n\t        parts.splice(i, 2);\n\t        up--;\n\t      }\n\t    }\n\t  }\n\t  path = parts.join('/');\n\t\n\t  if (path === '') {\n\t    path = isAbsolute ? '/' : '.';\n\t  }\n\t\n\t  if (url) {\n\t    url.path = path;\n\t    return urlGenerate(url);\n\t  }\n\t  return path;\n\t}\n\texports.normalize = normalize;\n\t\n\t/**\n\t * Joins two paths/URLs.\n\t *\n\t * @param aRoot The root path or URL.\n\t * @param aPath The path or URL to be joined with the root.\n\t *\n\t * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a\n\t *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended\n\t *   first.\n\t * - Otherwise aPath is a path. If aRoot is a URL, then its path portion\n\t *   is updated with the result and aRoot is returned. Otherwise the result\n\t *   is returned.\n\t *   - If aPath is absolute, the result is aPath.\n\t *   - Otherwise the two paths are joined with a slash.\n\t * - Joining for example 'http://' and 'www.example.com' is also supported.\n\t */\n\tfunction join(aRoot, aPath) {\n\t  if (aRoot === \"\") {\n\t    aRoot = \".\";\n\t  }\n\t  if (aPath === \"\") {\n\t    aPath = \".\";\n\t  }\n\t  var aPathUrl = urlParse(aPath);\n\t  var aRootUrl = urlParse(aRoot);\n\t  if (aRootUrl) {\n\t    aRoot = aRootUrl.path || '/';\n\t  }\n\t\n\t  // `join(foo, '//www.example.org')`\n\t  if (aPathUrl && !aPathUrl.scheme) {\n\t    if (aRootUrl) {\n\t      aPathUrl.scheme = aRootUrl.scheme;\n\t    }\n\t    return urlGenerate(aPathUrl);\n\t  }\n\t\n\t  if (aPathUrl || aPath.match(dataUrlRegexp)) {\n\t    return aPath;\n\t  }\n\t\n\t  // `join('http://', 'www.example.com')`\n\t  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {\n\t    aRootUrl.host = aPath;\n\t    return urlGenerate(aRootUrl);\n\t  }\n\t\n\t  var joined = aPath.charAt(0) === '/'\n\t    ? aPath\n\t    : normalize(aRoot.replace(/\\/+$/, '') + '/' + aPath);\n\t\n\t  if (aRootUrl) {\n\t    aRootUrl.path = joined;\n\t    return urlGenerate(aRootUrl);\n\t  }\n\t  return joined;\n\t}\n\texports.join = join;\n\t\n\texports.isAbsolute = function (aPath) {\n\t  return aPath.charAt(0) === '/' || !!aPath.match(urlRegexp);\n\t};\n\t\n\t/**\n\t * Make a path relative to a URL or another path.\n\t *\n\t * @param aRoot The root path or URL.\n\t * @param aPath The path or URL to be made relative to aRoot.\n\t */\n\tfunction relative(aRoot, aPath) {\n\t  if (aRoot === \"\") {\n\t    aRoot = \".\";\n\t  }\n\t\n\t  aRoot = aRoot.replace(/\\/$/, '');\n\t\n\t  // It is possible for the path to be above the root. In this case, simply\n\t  // checking whether the root is a prefix of the path won't work. Instead, we\n\t  // need to remove components from the root one by one, until either we find\n\t  // a prefix that fits, or we run out of components to remove.\n\t  var level = 0;\n\t  while (aPath.indexOf(aRoot + '/') !== 0) {\n\t    var index = aRoot.lastIndexOf(\"/\");\n\t    if (index < 0) {\n\t      return aPath;\n\t    }\n\t\n\t    // If the only part of the root that is left is the scheme (i.e. http://,\n\t    // file:///, etc.), one or more slashes (/), or simply nothing at all, we\n\t    // have exhausted all components, so the path is not relative to the root.\n\t    aRoot = aRoot.slice(0, index);\n\t    if (aRoot.match(/^([^\\/]+:\\/)?\\/*$/)) {\n\t      return aPath;\n\t    }\n\t\n\t    ++level;\n\t  }\n\t\n\t  // Make sure we add a \"../\" for each component we removed from the root.\n\t  return Array(level + 1).join(\"../\") + aPath.substr(aRoot.length + 1);\n\t}\n\texports.relative = relative;\n\t\n\tvar supportsNullProto = (function () {\n\t  var obj = Object.create(null);\n\t  return !('__proto__' in obj);\n\t}());\n\t\n\tfunction identity (s) {\n\t  return s;\n\t}\n\t\n\t/**\n\t * Because behavior goes wacky when you set `__proto__` on objects, we\n\t * have to prefix all the strings in our set with an arbitrary character.\n\t *\n\t * See https://github.com/mozilla/source-map/pull/31 and\n\t * https://github.com/mozilla/source-map/issues/30\n\t *\n\t * @param String aStr\n\t */\n\tfunction toSetString(aStr) {\n\t  if (isProtoString(aStr)) {\n\t    return '$' + aStr;\n\t  }\n\t\n\t  return aStr;\n\t}\n\texports.toSetString = supportsNullProto ? identity : toSetString;\n\t\n\tfunction fromSetString(aStr) {\n\t  if (isProtoString(aStr)) {\n\t    return aStr.slice(1);\n\t  }\n\t\n\t  return aStr;\n\t}\n\texports.fromSetString = supportsNullProto ? identity : fromSetString;\n\t\n\tfunction isProtoString(s) {\n\t  if (!s) {\n\t    return false;\n\t  }\n\t\n\t  var length = s.length;\n\t\n\t  if (length < 9 /* \"__proto__\".length */) {\n\t    return false;\n\t  }\n\t\n\t  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||\n\t      s.charCodeAt(length - 2) !== 95  /* '_' */ ||\n\t      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||\n\t      s.charCodeAt(length - 4) !== 116 /* 't' */ ||\n\t      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||\n\t      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||\n\t      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||\n\t      s.charCodeAt(length - 8) !== 95  /* '_' */ ||\n\t      s.charCodeAt(length - 9) !== 95  /* '_' */) {\n\t    return false;\n\t  }\n\t\n\t  for (var i = length - 10; i >= 0; i--) {\n\t    if (s.charCodeAt(i) !== 36 /* '$' */) {\n\t      return false;\n\t    }\n\t  }\n\t\n\t  return true;\n\t}\n\t\n\t/**\n\t * Comparator between two mappings where the original positions are compared.\n\t *\n\t * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n\t * mappings with the same original source/line/column, but different generated\n\t * line and column the same. Useful when searching for a mapping with a\n\t * stubbed out mapping.\n\t */\n\tfunction compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {\n\t  var cmp = mappingA.source - mappingB.source;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.originalLine - mappingB.originalLine;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t  if (cmp !== 0 || onlyCompareOriginal) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  return mappingA.name - mappingB.name;\n\t}\n\texports.compareByOriginalPositions = compareByOriginalPositions;\n\t\n\t/**\n\t * Comparator between two mappings with deflated source and name indices where\n\t * the generated positions are compared.\n\t *\n\t * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n\t * mappings with the same generated line and column, but different\n\t * source/name/original line and column the same. Useful when searching for a\n\t * mapping with a stubbed out mapping.\n\t */\n\tfunction compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {\n\t  var cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t  if (cmp !== 0 || onlyCompareGenerated) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.source - mappingB.source;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.originalLine - mappingB.originalLine;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  return mappingA.name - mappingB.name;\n\t}\n\texports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;\n\t\n\tfunction strcmp(aStr1, aStr2) {\n\t  if (aStr1 === aStr2) {\n\t    return 0;\n\t  }\n\t\n\t  if (aStr1 > aStr2) {\n\t    return 1;\n\t  }\n\t\n\t  return -1;\n\t}\n\t\n\t/**\n\t * Comparator between two mappings with inflated source and name strings where\n\t * the generated positions are compared.\n\t */\n\tfunction compareByGeneratedPositionsInflated(mappingA, mappingB) {\n\t  var cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = strcmp(mappingA.source, mappingB.source);\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.originalLine - mappingB.originalLine;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t  if (cmp !== 0) {\n\t    return cmp;\n\t  }\n\t\n\t  return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\tvar has = Object.prototype.hasOwnProperty;\n\tvar hasNativeMap = typeof Map !== \"undefined\";\n\t\n\t/**\n\t * A data structure which is a combination of an array and a set. Adding a new\n\t * member is O(1), testing for membership is O(1), and finding the index of an\n\t * element is O(1). Removing elements from the set is not supported. Only\n\t * strings are supported for membership.\n\t */\n\tfunction ArraySet() {\n\t  this._array = [];\n\t  this._set = hasNativeMap ? new Map() : Object.create(null);\n\t}\n\t\n\t/**\n\t * Static method for creating ArraySet instances from an existing array.\n\t */\n\tArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {\n\t  var set = new ArraySet();\n\t  for (var i = 0, len = aArray.length; i < len; i++) {\n\t    set.add(aArray[i], aAllowDuplicates);\n\t  }\n\t  return set;\n\t};\n\t\n\t/**\n\t * Return how many unique items are in this ArraySet. If duplicates have been\n\t * added, than those do not count towards the size.\n\t *\n\t * @returns Number\n\t */\n\tArraySet.prototype.size = function ArraySet_size() {\n\t  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;\n\t};\n\t\n\t/**\n\t * Add the given string to this set.\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {\n\t  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);\n\t  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);\n\t  var idx = this._array.length;\n\t  if (!isDuplicate || aAllowDuplicates) {\n\t    this._array.push(aStr);\n\t  }\n\t  if (!isDuplicate) {\n\t    if (hasNativeMap) {\n\t      this._set.set(aStr, idx);\n\t    } else {\n\t      this._set[sStr] = idx;\n\t    }\n\t  }\n\t};\n\t\n\t/**\n\t * Is the given string a member of this set?\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.has = function ArraySet_has(aStr) {\n\t  if (hasNativeMap) {\n\t    return this._set.has(aStr);\n\t  } else {\n\t    var sStr = util.toSetString(aStr);\n\t    return has.call(this._set, sStr);\n\t  }\n\t};\n\t\n\t/**\n\t * What is the index of the given string in the array?\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {\n\t  if (hasNativeMap) {\n\t    var idx = this._set.get(aStr);\n\t    if (idx >= 0) {\n\t        return idx;\n\t    }\n\t  } else {\n\t    var sStr = util.toSetString(aStr);\n\t    if (has.call(this._set, sStr)) {\n\t      return this._set[sStr];\n\t    }\n\t  }\n\t\n\t  throw new Error('\"' + aStr + '\" is not in the set.');\n\t};\n\t\n\t/**\n\t * What is the element at the given index?\n\t *\n\t * @param Number aIdx\n\t */\n\tArraySet.prototype.at = function ArraySet_at(aIdx) {\n\t  if (aIdx >= 0 && aIdx < this._array.length) {\n\t    return this._array[aIdx];\n\t  }\n\t  throw new Error('No element indexed by ' + aIdx);\n\t};\n\t\n\t/**\n\t * Returns the array representation of this set (which has the proper indices\n\t * indicated by indexOf). Note that this is a copy of the internal array used\n\t * for storing the members so that no one can mess with internal state.\n\t */\n\tArraySet.prototype.toArray = function ArraySet_toArray() {\n\t  return this._array.slice();\n\t};\n\t\n\texports.ArraySet = ArraySet;\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2014 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\t\n\t/**\n\t * Determine whether mappingB is after mappingA with respect to generated\n\t * position.\n\t */\n\tfunction generatedPositionAfter(mappingA, mappingB) {\n\t  // Optimized for most common case\n\t  var lineA = mappingA.generatedLine;\n\t  var lineB = mappingB.generatedLine;\n\t  var columnA = mappingA.generatedColumn;\n\t  var columnB = mappingB.generatedColumn;\n\t  return lineB > lineA || lineB == lineA && columnB >= columnA ||\n\t         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;\n\t}\n\t\n\t/**\n\t * A data structure to provide a sorted view of accumulated mappings in a\n\t * performance conscious manner. It trades a neglibable overhead in general\n\t * case for a large speedup in case of mappings being added in order.\n\t */\n\tfunction MappingList() {\n\t  this._array = [];\n\t  this._sorted = true;\n\t  // Serves as infimum\n\t  this._last = {generatedLine: -1, generatedColumn: 0};\n\t}\n\t\n\t/**\n\t * Iterate through internal items. This method takes the same arguments that\n\t * `Array.prototype.forEach` takes.\n\t *\n\t * NOTE: The order of the mappings is NOT guaranteed.\n\t */\n\tMappingList.prototype.unsortedForEach =\n\t  function MappingList_forEach(aCallback, aThisArg) {\n\t    this._array.forEach(aCallback, aThisArg);\n\t  };\n\t\n\t/**\n\t * Add the given source mapping.\n\t *\n\t * @param Object aMapping\n\t */\n\tMappingList.prototype.add = function MappingList_add(aMapping) {\n\t  if (generatedPositionAfter(this._last, aMapping)) {\n\t    this._last = aMapping;\n\t    this._array.push(aMapping);\n\t  } else {\n\t    this._sorted = false;\n\t    this._array.push(aMapping);\n\t  }\n\t};\n\t\n\t/**\n\t * Returns the flat, sorted array of mappings. The mappings are sorted by\n\t * generated position.\n\t *\n\t * WARNING: This method returns internal data without copying, for\n\t * performance. The return value must NOT be mutated, and should be treated as\n\t * an immutable borrow. If you want to take ownership, you must make your own\n\t * copy.\n\t */\n\tMappingList.prototype.toArray = function MappingList_toArray() {\n\t  if (!this._sorted) {\n\t    this._array.sort(util.compareByGeneratedPositionsInflated);\n\t    this._sorted = true;\n\t  }\n\t  return this._array;\n\t};\n\t\n\texports.MappingList = MappingList;\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\tvar binarySearch = __webpack_require__(8);\n\tvar ArraySet = __webpack_require__(5).ArraySet;\n\tvar base64VLQ = __webpack_require__(2);\n\tvar quickSort = __webpack_require__(9).quickSort;\n\t\n\tfunction SourceMapConsumer(aSourceMap) {\n\t  var sourceMap = aSourceMap;\n\t  if (typeof aSourceMap === 'string') {\n\t    sourceMap = JSON.parse(aSourceMap.replace(/^\\)\\]\\}'/, ''));\n\t  }\n\t\n\t  return sourceMap.sections != null\n\t    ? new IndexedSourceMapConsumer(sourceMap)\n\t    : new BasicSourceMapConsumer(sourceMap);\n\t}\n\t\n\tSourceMapConsumer.fromSourceMap = function(aSourceMap) {\n\t  return BasicSourceMapConsumer.fromSourceMap(aSourceMap);\n\t}\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tSourceMapConsumer.prototype._version = 3;\n\t\n\t// `__generatedMappings` and `__originalMappings` are arrays that hold the\n\t// parsed mapping coordinates from the source map's \"mappings\" attribute. They\n\t// are lazily instantiated, accessed via the `_generatedMappings` and\n\t// `_originalMappings` getters respectively, and we only parse the mappings\n\t// and create these arrays once queried for a source location. We jump through\n\t// these hoops because there can be many thousands of mappings, and parsing\n\t// them is expensive, so we only want to do it if we must.\n\t//\n\t// Each object in the arrays is of the form:\n\t//\n\t//     {\n\t//       generatedLine: The line number in the generated code,\n\t//       generatedColumn: The column number in the generated code,\n\t//       source: The path to the original source file that generated this\n\t//               chunk of code,\n\t//       originalLine: The line number in the original source that\n\t//                     corresponds to this chunk of generated code,\n\t//       originalColumn: The column number in the original source that\n\t//                       corresponds to this chunk of generated code,\n\t//       name: The name of the original symbol which generated this chunk of\n\t//             code.\n\t//     }\n\t//\n\t// All properties except for `generatedLine` and `generatedColumn` can be\n\t// `null`.\n\t//\n\t// `_generatedMappings` is ordered by the generated positions.\n\t//\n\t// `_originalMappings` is ordered by the original positions.\n\t\n\tSourceMapConsumer.prototype.__generatedMappings = null;\n\tObject.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {\n\t  get: function () {\n\t    if (!this.__generatedMappings) {\n\t      this._parseMappings(this._mappings, this.sourceRoot);\n\t    }\n\t\n\t    return this.__generatedMappings;\n\t  }\n\t});\n\t\n\tSourceMapConsumer.prototype.__originalMappings = null;\n\tObject.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {\n\t  get: function () {\n\t    if (!this.__originalMappings) {\n\t      this._parseMappings(this._mappings, this.sourceRoot);\n\t    }\n\t\n\t    return this.__originalMappings;\n\t  }\n\t});\n\t\n\tSourceMapConsumer.prototype._charIsMappingSeparator =\n\t  function SourceMapConsumer_charIsMappingSeparator(aStr, index) {\n\t    var c = aStr.charAt(index);\n\t    return c === \";\" || c === \",\";\n\t  };\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tSourceMapConsumer.prototype._parseMappings =\n\t  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t    throw new Error(\"Subclasses must implement _parseMappings\");\n\t  };\n\t\n\tSourceMapConsumer.GENERATED_ORDER = 1;\n\tSourceMapConsumer.ORIGINAL_ORDER = 2;\n\t\n\tSourceMapConsumer.GREATEST_LOWER_BOUND = 1;\n\tSourceMapConsumer.LEAST_UPPER_BOUND = 2;\n\t\n\t/**\n\t * Iterate over each mapping between an original source/line/column and a\n\t * generated line/column in this source map.\n\t *\n\t * @param Function aCallback\n\t *        The function that is called with each mapping.\n\t * @param Object aContext\n\t *        Optional. If specified, this object will be the value of `this` every\n\t *        time that `aCallback` is called.\n\t * @param aOrder\n\t *        Either `SourceMapConsumer.GENERATED_ORDER` or\n\t *        `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to\n\t *        iterate over the mappings sorted by the generated file's line/column\n\t *        order or the original's source/line/column order, respectively. Defaults to\n\t *        `SourceMapConsumer.GENERATED_ORDER`.\n\t */\n\tSourceMapConsumer.prototype.eachMapping =\n\t  function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {\n\t    var context = aContext || null;\n\t    var order = aOrder || SourceMapConsumer.GENERATED_ORDER;\n\t\n\t    var mappings;\n\t    switch (order) {\n\t    case SourceMapConsumer.GENERATED_ORDER:\n\t      mappings = this._generatedMappings;\n\t      break;\n\t    case SourceMapConsumer.ORIGINAL_ORDER:\n\t      mappings = this._originalMappings;\n\t      break;\n\t    default:\n\t      throw new Error(\"Unknown order of iteration.\");\n\t    }\n\t\n\t    var sourceRoot = this.sourceRoot;\n\t    mappings.map(function (mapping) {\n\t      var source = mapping.source === null ? null : this._sources.at(mapping.source);\n\t      if (source != null && sourceRoot != null) {\n\t        source = util.join(sourceRoot, source);\n\t      }\n\t      return {\n\t        source: source,\n\t        generatedLine: mapping.generatedLine,\n\t        generatedColumn: mapping.generatedColumn,\n\t        originalLine: mapping.originalLine,\n\t        originalColumn: mapping.originalColumn,\n\t        name: mapping.name === null ? null : this._names.at(mapping.name)\n\t      };\n\t    }, this).forEach(aCallback, context);\n\t  };\n\t\n\t/**\n\t * Returns all generated line and column information for the original source,\n\t * line, and column provided. If no column is provided, returns all mappings\n\t * corresponding to a either the line we are searching for or the next\n\t * closest line that has any mappings. Otherwise, returns all mappings\n\t * corresponding to the given line and either the column we are searching for\n\t * or the next closest column that has any offsets.\n\t *\n\t * The only argument is an object with the following properties:\n\t *\n\t *   - source: The filename of the original source.\n\t *   - line: The line number in the original source.\n\t *   - column: Optional. the column number in the original source.\n\t *\n\t * and an array of objects is returned, each with the following properties:\n\t *\n\t *   - line: The line number in the generated source, or null.\n\t *   - column: The column number in the generated source, or null.\n\t */\n\tSourceMapConsumer.prototype.allGeneratedPositionsFor =\n\t  function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {\n\t    var line = util.getArg(aArgs, 'line');\n\t\n\t    // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping\n\t    // returns the index of the closest mapping less than the needle. By\n\t    // setting needle.originalColumn to 0, we thus find the last mapping for\n\t    // the given line, provided such a mapping exists.\n\t    var needle = {\n\t      source: util.getArg(aArgs, 'source'),\n\t      originalLine: line,\n\t      originalColumn: util.getArg(aArgs, 'column', 0)\n\t    };\n\t\n\t    if (this.sourceRoot != null) {\n\t      needle.source = util.relative(this.sourceRoot, needle.source);\n\t    }\n\t    if (!this._sources.has(needle.source)) {\n\t      return [];\n\t    }\n\t    needle.source = this._sources.indexOf(needle.source);\n\t\n\t    var mappings = [];\n\t\n\t    var index = this._findMapping(needle,\n\t                                  this._originalMappings,\n\t                                  \"originalLine\",\n\t                                  \"originalColumn\",\n\t                                  util.compareByOriginalPositions,\n\t                                  binarySearch.LEAST_UPPER_BOUND);\n\t    if (index >= 0) {\n\t      var mapping = this._originalMappings[index];\n\t\n\t      if (aArgs.column === undefined) {\n\t        var originalLine = mapping.originalLine;\n\t\n\t        // Iterate until either we run out of mappings, or we run into\n\t        // a mapping for a different line than the one we found. Since\n\t        // mappings are sorted, this is guaranteed to find all mappings for\n\t        // the line we found.\n\t        while (mapping && mapping.originalLine === originalLine) {\n\t          mappings.push({\n\t            line: util.getArg(mapping, 'generatedLine', null),\n\t            column: util.getArg(mapping, 'generatedColumn', null),\n\t            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t          });\n\t\n\t          mapping = this._originalMappings[++index];\n\t        }\n\t      } else {\n\t        var originalColumn = mapping.originalColumn;\n\t\n\t        // Iterate until either we run out of mappings, or we run into\n\t        // a mapping for a different line than the one we were searching for.\n\t        // Since mappings are sorted, this is guaranteed to find all mappings for\n\t        // the line we are searching for.\n\t        while (mapping &&\n\t               mapping.originalLine === line &&\n\t               mapping.originalColumn == originalColumn) {\n\t          mappings.push({\n\t            line: util.getArg(mapping, 'generatedLine', null),\n\t            column: util.getArg(mapping, 'generatedColumn', null),\n\t            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t          });\n\t\n\t          mapping = this._originalMappings[++index];\n\t        }\n\t      }\n\t    }\n\t\n\t    return mappings;\n\t  };\n\t\n\texports.SourceMapConsumer = SourceMapConsumer;\n\t\n\t/**\n\t * A BasicSourceMapConsumer instance represents a parsed source map which we can\n\t * query for information about the original file positions by giving it a file\n\t * position in the generated source.\n\t *\n\t * The only parameter is the raw source map (either as a JSON string, or\n\t * already parsed to an object). According to the spec, source maps have the\n\t * following attributes:\n\t *\n\t *   - version: Which version of the source map spec this map is following.\n\t *   - sources: An array of URLs to the original source files.\n\t *   - names: An array of identifiers which can be referrenced by individual mappings.\n\t *   - sourceRoot: Optional. The URL root from which all sources are relative.\n\t *   - sourcesContent: Optional. An array of contents of the original source files.\n\t *   - mappings: A string of base64 VLQs which contain the actual mappings.\n\t *   - file: Optional. The generated file this source map is associated with.\n\t *\n\t * Here is an example source map, taken from the source map spec[0]:\n\t *\n\t *     {\n\t *       version : 3,\n\t *       file: \"out.js\",\n\t *       sourceRoot : \"\",\n\t *       sources: [\"foo.js\", \"bar.js\"],\n\t *       names: [\"src\", \"maps\", \"are\", \"fun\"],\n\t *       mappings: \"AA,AB;;ABCDE;\"\n\t *     }\n\t *\n\t * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#\n\t */\n\tfunction BasicSourceMapConsumer(aSourceMap) {\n\t  var sourceMap = aSourceMap;\n\t  if (typeof aSourceMap === 'string') {\n\t    sourceMap = JSON.parse(aSourceMap.replace(/^\\)\\]\\}'/, ''));\n\t  }\n\t\n\t  var version = util.getArg(sourceMap, 'version');\n\t  var sources = util.getArg(sourceMap, 'sources');\n\t  // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which\n\t  // requires the array) to play nice here.\n\t  var names = util.getArg(sourceMap, 'names', []);\n\t  var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);\n\t  var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);\n\t  var mappings = util.getArg(sourceMap, 'mappings');\n\t  var file = util.getArg(sourceMap, 'file', null);\n\t\n\t  // Once again, Sass deviates from the spec and supplies the version as a\n\t  // string rather than a number, so we use loose equality checking here.\n\t  if (version != this._version) {\n\t    throw new Error('Unsupported version: ' + version);\n\t  }\n\t\n\t  sources = sources\n\t    .map(String)\n\t    // Some source maps produce relative source paths like \"./foo.js\" instead of\n\t    // \"foo.js\".  Normalize these first so that future comparisons will succeed.\n\t    // See bugzil.la/1090768.\n\t    .map(util.normalize)\n\t    // Always ensure that absolute sources are internally stored relative to\n\t    // the source root, if the source root is absolute. Not doing this would\n\t    // be particularly problematic when the source root is a prefix of the\n\t    // source (valid, but why??). See github issue #199 and bugzil.la/1188982.\n\t    .map(function (source) {\n\t      return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)\n\t        ? util.relative(sourceRoot, source)\n\t        : source;\n\t    });\n\t\n\t  // Pass `true` below to allow duplicate names and sources. While source maps\n\t  // are intended to be compressed and deduplicated, the TypeScript compiler\n\t  // sometimes generates source maps with duplicates in them. See Github issue\n\t  // #72 and bugzil.la/889492.\n\t  this._names = ArraySet.fromArray(names.map(String), true);\n\t  this._sources = ArraySet.fromArray(sources, true);\n\t\n\t  this.sourceRoot = sourceRoot;\n\t  this.sourcesContent = sourcesContent;\n\t  this._mappings = mappings;\n\t  this.file = file;\n\t}\n\t\n\tBasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\n\tBasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;\n\t\n\t/**\n\t * Create a BasicSourceMapConsumer from a SourceMapGenerator.\n\t *\n\t * @param SourceMapGenerator aSourceMap\n\t *        The source map that will be consumed.\n\t * @returns BasicSourceMapConsumer\n\t */\n\tBasicSourceMapConsumer.fromSourceMap =\n\t  function SourceMapConsumer_fromSourceMap(aSourceMap) {\n\t    var smc = Object.create(BasicSourceMapConsumer.prototype);\n\t\n\t    var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);\n\t    var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);\n\t    smc.sourceRoot = aSourceMap._sourceRoot;\n\t    smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),\n\t                                                            smc.sourceRoot);\n\t    smc.file = aSourceMap._file;\n\t\n\t    // Because we are modifying the entries (by converting string sources and\n\t    // names to indices into the sources and names ArraySets), we have to make\n\t    // a copy of the entry or else bad things happen. Shared mutable state\n\t    // strikes again! See github issue #191.\n\t\n\t    var generatedMappings = aSourceMap._mappings.toArray().slice();\n\t    var destGeneratedMappings = smc.__generatedMappings = [];\n\t    var destOriginalMappings = smc.__originalMappings = [];\n\t\n\t    for (var i = 0, length = generatedMappings.length; i < length; i++) {\n\t      var srcMapping = generatedMappings[i];\n\t      var destMapping = new Mapping;\n\t      destMapping.generatedLine = srcMapping.generatedLine;\n\t      destMapping.generatedColumn = srcMapping.generatedColumn;\n\t\n\t      if (srcMapping.source) {\n\t        destMapping.source = sources.indexOf(srcMapping.source);\n\t        destMapping.originalLine = srcMapping.originalLine;\n\t        destMapping.originalColumn = srcMapping.originalColumn;\n\t\n\t        if (srcMapping.name) {\n\t          destMapping.name = names.indexOf(srcMapping.name);\n\t        }\n\t\n\t        destOriginalMappings.push(destMapping);\n\t      }\n\t\n\t      destGeneratedMappings.push(destMapping);\n\t    }\n\t\n\t    quickSort(smc.__originalMappings, util.compareByOriginalPositions);\n\t\n\t    return smc;\n\t  };\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tBasicSourceMapConsumer.prototype._version = 3;\n\t\n\t/**\n\t * The list of original sources.\n\t */\n\tObject.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {\n\t  get: function () {\n\t    return this._sources.toArray().map(function (s) {\n\t      return this.sourceRoot != null ? util.join(this.sourceRoot, s) : s;\n\t    }, this);\n\t  }\n\t});\n\t\n\t/**\n\t * Provide the JIT with a nice shape / hidden class.\n\t */\n\tfunction Mapping() {\n\t  this.generatedLine = 0;\n\t  this.generatedColumn = 0;\n\t  this.source = null;\n\t  this.originalLine = null;\n\t  this.originalColumn = null;\n\t  this.name = null;\n\t}\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tBasicSourceMapConsumer.prototype._parseMappings =\n\t  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t    var generatedLine = 1;\n\t    var previousGeneratedColumn = 0;\n\t    var previousOriginalLine = 0;\n\t    var previousOriginalColumn = 0;\n\t    var previousSource = 0;\n\t    var previousName = 0;\n\t    var length = aStr.length;\n\t    var index = 0;\n\t    var cachedSegments = {};\n\t    var temp = {};\n\t    var originalMappings = [];\n\t    var generatedMappings = [];\n\t    var mapping, str, segment, end, value;\n\t\n\t    while (index < length) {\n\t      if (aStr.charAt(index) === ';') {\n\t        generatedLine++;\n\t        index++;\n\t        previousGeneratedColumn = 0;\n\t      }\n\t      else if (aStr.charAt(index) === ',') {\n\t        index++;\n\t      }\n\t      else {\n\t        mapping = new Mapping();\n\t        mapping.generatedLine = generatedLine;\n\t\n\t        // Because each offset is encoded relative to the previous one,\n\t        // many segments often have the same encoding. We can exploit this\n\t        // fact by caching the parsed variable length fields of each segment,\n\t        // allowing us to avoid a second parse if we encounter the same\n\t        // segment again.\n\t        for (end = index; end < length; end++) {\n\t          if (this._charIsMappingSeparator(aStr, end)) {\n\t            break;\n\t          }\n\t        }\n\t        str = aStr.slice(index, end);\n\t\n\t        segment = cachedSegments[str];\n\t        if (segment) {\n\t          index += str.length;\n\t        } else {\n\t          segment = [];\n\t          while (index < end) {\n\t            base64VLQ.decode(aStr, index, temp);\n\t            value = temp.value;\n\t            index = temp.rest;\n\t            segment.push(value);\n\t          }\n\t\n\t          if (segment.length === 2) {\n\t            throw new Error('Found a source, but no line and column');\n\t          }\n\t\n\t          if (segment.length === 3) {\n\t            throw new Error('Found a source and line, but no column');\n\t          }\n\t\n\t          cachedSegments[str] = segment;\n\t        }\n\t\n\t        // Generated column.\n\t        mapping.generatedColumn = previousGeneratedColumn + segment[0];\n\t        previousGeneratedColumn = mapping.generatedColumn;\n\t\n\t        if (segment.length > 1) {\n\t          // Original source.\n\t          mapping.source = previousSource + segment[1];\n\t          previousSource += segment[1];\n\t\n\t          // Original line.\n\t          mapping.originalLine = previousOriginalLine + segment[2];\n\t          previousOriginalLine = mapping.originalLine;\n\t          // Lines are stored 0-based\n\t          mapping.originalLine += 1;\n\t\n\t          // Original column.\n\t          mapping.originalColumn = previousOriginalColumn + segment[3];\n\t          previousOriginalColumn = mapping.originalColumn;\n\t\n\t          if (segment.length > 4) {\n\t            // Original name.\n\t            mapping.name = previousName + segment[4];\n\t            previousName += segment[4];\n\t          }\n\t        }\n\t\n\t        generatedMappings.push(mapping);\n\t        if (typeof mapping.originalLine === 'number') {\n\t          originalMappings.push(mapping);\n\t        }\n\t      }\n\t    }\n\t\n\t    quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);\n\t    this.__generatedMappings = generatedMappings;\n\t\n\t    quickSort(originalMappings, util.compareByOriginalPositions);\n\t    this.__originalMappings = originalMappings;\n\t  };\n\t\n\t/**\n\t * Find the mapping that best matches the hypothetical \"needle\" mapping that\n\t * we are searching for in the given \"haystack\" of mappings.\n\t */\n\tBasicSourceMapConsumer.prototype._findMapping =\n\t  function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,\n\t                                         aColumnName, aComparator, aBias) {\n\t    // To return the position we are searching for, we must first find the\n\t    // mapping for the given position and then return the opposite position it\n\t    // points to. Because the mappings are sorted, we can use binary search to\n\t    // find the best mapping.\n\t\n\t    if (aNeedle[aLineName] <= 0) {\n\t      throw new TypeError('Line must be greater than or equal to 1, got '\n\t                          + aNeedle[aLineName]);\n\t    }\n\t    if (aNeedle[aColumnName] < 0) {\n\t      throw new TypeError('Column must be greater than or equal to 0, got '\n\t                          + aNeedle[aColumnName]);\n\t    }\n\t\n\t    return binarySearch.search(aNeedle, aMappings, aComparator, aBias);\n\t  };\n\t\n\t/**\n\t * Compute the last column for each generated mapping. The last column is\n\t * inclusive.\n\t */\n\tBasicSourceMapConsumer.prototype.computeColumnSpans =\n\t  function SourceMapConsumer_computeColumnSpans() {\n\t    for (var index = 0; index < this._generatedMappings.length; ++index) {\n\t      var mapping = this._generatedMappings[index];\n\t\n\t      // Mappings do not contain a field for the last generated columnt. We\n\t      // can come up with an optimistic estimate, however, by assuming that\n\t      // mappings are contiguous (i.e. given two consecutive mappings, the\n\t      // first mapping ends where the second one starts).\n\t      if (index + 1 < this._generatedMappings.length) {\n\t        var nextMapping = this._generatedMappings[index + 1];\n\t\n\t        if (mapping.generatedLine === nextMapping.generatedLine) {\n\t          mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;\n\t          continue;\n\t        }\n\t      }\n\t\n\t      // The last mapping for each line spans the entire line.\n\t      mapping.lastGeneratedColumn = Infinity;\n\t    }\n\t  };\n\t\n\t/**\n\t * Returns the original source, line, and column information for the generated\n\t * source's line and column positions provided. The only argument is an object\n\t * with the following properties:\n\t *\n\t *   - line: The line number in the generated source.\n\t *   - column: The column number in the generated source.\n\t *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n\t *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t *     closest element that is smaller than or greater than the one we are\n\t *     searching for, respectively, if the exact element cannot be found.\n\t *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t *   - source: The original source file, or null.\n\t *   - line: The line number in the original source, or null.\n\t *   - column: The column number in the original source, or null.\n\t *   - name: The original identifier, or null.\n\t */\n\tBasicSourceMapConsumer.prototype.originalPositionFor =\n\t  function SourceMapConsumer_originalPositionFor(aArgs) {\n\t    var needle = {\n\t      generatedLine: util.getArg(aArgs, 'line'),\n\t      generatedColumn: util.getArg(aArgs, 'column')\n\t    };\n\t\n\t    var index = this._findMapping(\n\t      needle,\n\t      this._generatedMappings,\n\t      \"generatedLine\",\n\t      \"generatedColumn\",\n\t      util.compareByGeneratedPositionsDeflated,\n\t      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n\t    );\n\t\n\t    if (index >= 0) {\n\t      var mapping = this._generatedMappings[index];\n\t\n\t      if (mapping.generatedLine === needle.generatedLine) {\n\t        var source = util.getArg(mapping, 'source', null);\n\t        if (source !== null) {\n\t          source = this._sources.at(source);\n\t          if (this.sourceRoot != null) {\n\t            source = util.join(this.sourceRoot, source);\n\t          }\n\t        }\n\t        var name = util.getArg(mapping, 'name', null);\n\t        if (name !== null) {\n\t          name = this._names.at(name);\n\t        }\n\t        return {\n\t          source: source,\n\t          line: util.getArg(mapping, 'originalLine', null),\n\t          column: util.getArg(mapping, 'originalColumn', null),\n\t          name: name\n\t        };\n\t      }\n\t    }\n\t\n\t    return {\n\t      source: null,\n\t      line: null,\n\t      column: null,\n\t      name: null\n\t    };\n\t  };\n\t\n\t/**\n\t * Return true if we have the source content for every source in the source\n\t * map, false otherwise.\n\t */\n\tBasicSourceMapConsumer.prototype.hasContentsOfAllSources =\n\t  function BasicSourceMapConsumer_hasContentsOfAllSources() {\n\t    if (!this.sourcesContent) {\n\t      return false;\n\t    }\n\t    return this.sourcesContent.length >= this._sources.size() &&\n\t      !this.sourcesContent.some(function (sc) { return sc == null; });\n\t  };\n\t\n\t/**\n\t * Returns the original source content. The only argument is the url of the\n\t * original source file. Returns null if no original source content is\n\t * available.\n\t */\n\tBasicSourceMapConsumer.prototype.sourceContentFor =\n\t  function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n\t    if (!this.sourcesContent) {\n\t      return null;\n\t    }\n\t\n\t    if (this.sourceRoot != null) {\n\t      aSource = util.relative(this.sourceRoot, aSource);\n\t    }\n\t\n\t    if (this._sources.has(aSource)) {\n\t      return this.sourcesContent[this._sources.indexOf(aSource)];\n\t    }\n\t\n\t    var url;\n\t    if (this.sourceRoot != null\n\t        && (url = util.urlParse(this.sourceRoot))) {\n\t      // XXX: file:// URIs and absolute paths lead to unexpected behavior for\n\t      // many users. We can help them out when they expect file:// URIs to\n\t      // behave like it would if they were running a local HTTP server. See\n\t      // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.\n\t      var fileUriAbsPath = aSource.replace(/^file:\\/\\//, \"\");\n\t      if (url.scheme == \"file\"\n\t          && this._sources.has(fileUriAbsPath)) {\n\t        return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]\n\t      }\n\t\n\t      if ((!url.path || url.path == \"/\")\n\t          && this._sources.has(\"/\" + aSource)) {\n\t        return this.sourcesContent[this._sources.indexOf(\"/\" + aSource)];\n\t      }\n\t    }\n\t\n\t    // This function is used recursively from\n\t    // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we\n\t    // don't want to throw if we can't find the source - we just want to\n\t    // return null, so we provide a flag to exit gracefully.\n\t    if (nullOnMissing) {\n\t      return null;\n\t    }\n\t    else {\n\t      throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n\t    }\n\t  };\n\t\n\t/**\n\t * Returns the generated line and column information for the original source,\n\t * line, and column positions provided. The only argument is an object with\n\t * the following properties:\n\t *\n\t *   - source: The filename of the original source.\n\t *   - line: The line number in the original source.\n\t *   - column: The column number in the original source.\n\t *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n\t *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t *     closest element that is smaller than or greater than the one we are\n\t *     searching for, respectively, if the exact element cannot be found.\n\t *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t *   - line: The line number in the generated source, or null.\n\t *   - column: The column number in the generated source, or null.\n\t */\n\tBasicSourceMapConsumer.prototype.generatedPositionFor =\n\t  function SourceMapConsumer_generatedPositionFor(aArgs) {\n\t    var source = util.getArg(aArgs, 'source');\n\t    if (this.sourceRoot != null) {\n\t      source = util.relative(this.sourceRoot, source);\n\t    }\n\t    if (!this._sources.has(source)) {\n\t      return {\n\t        line: null,\n\t        column: null,\n\t        lastColumn: null\n\t      };\n\t    }\n\t    source = this._sources.indexOf(source);\n\t\n\t    var needle = {\n\t      source: source,\n\t      originalLine: util.getArg(aArgs, 'line'),\n\t      originalColumn: util.getArg(aArgs, 'column')\n\t    };\n\t\n\t    var index = this._findMapping(\n\t      needle,\n\t      this._originalMappings,\n\t      \"originalLine\",\n\t      \"originalColumn\",\n\t      util.compareByOriginalPositions,\n\t      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n\t    );\n\t\n\t    if (index >= 0) {\n\t      var mapping = this._originalMappings[index];\n\t\n\t      if (mapping.source === needle.source) {\n\t        return {\n\t          line: util.getArg(mapping, 'generatedLine', null),\n\t          column: util.getArg(mapping, 'generatedColumn', null),\n\t          lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t        };\n\t      }\n\t    }\n\t\n\t    return {\n\t      line: null,\n\t      column: null,\n\t      lastColumn: null\n\t    };\n\t  };\n\t\n\texports.BasicSourceMapConsumer = BasicSourceMapConsumer;\n\t\n\t/**\n\t * An IndexedSourceMapConsumer instance represents a parsed source map which\n\t * we can query for information. It differs from BasicSourceMapConsumer in\n\t * that it takes \"indexed\" source maps (i.e. ones with a \"sections\" field) as\n\t * input.\n\t *\n\t * The only parameter is a raw source map (either as a JSON string, or already\n\t * parsed to an object). According to the spec for indexed source maps, they\n\t * have the following attributes:\n\t *\n\t *   - version: Which version of the source map spec this map is following.\n\t *   - file: Optional. The generated file this source map is associated with.\n\t *   - sections: A list of section definitions.\n\t *\n\t * Each value under the \"sections\" field has two fields:\n\t *   - offset: The offset into the original specified at which this section\n\t *       begins to apply, defined as an object with a \"line\" and \"column\"\n\t *       field.\n\t *   - map: A source map definition. This source map could also be indexed,\n\t *       but doesn't have to be.\n\t *\n\t * Instead of the \"map\" field, it's also possible to have a \"url\" field\n\t * specifying a URL to retrieve a source map from, but that's currently\n\t * unsupported.\n\t *\n\t * Here's an example source map, taken from the source map spec[0], but\n\t * modified to omit a section which uses the \"url\" field.\n\t *\n\t *  {\n\t *    version : 3,\n\t *    file: \"app.js\",\n\t *    sections: [{\n\t *      offset: {line:100, column:10},\n\t *      map: {\n\t *        version : 3,\n\t *        file: \"section.js\",\n\t *        sources: [\"foo.js\", \"bar.js\"],\n\t *        names: [\"src\", \"maps\", \"are\", \"fun\"],\n\t *        mappings: \"AAAA,E;;ABCDE;\"\n\t *      }\n\t *    }],\n\t *  }\n\t *\n\t * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt\n\t */\n\tfunction IndexedSourceMapConsumer(aSourceMap) {\n\t  var sourceMap = aSourceMap;\n\t  if (typeof aSourceMap === 'string') {\n\t    sourceMap = JSON.parse(aSourceMap.replace(/^\\)\\]\\}'/, ''));\n\t  }\n\t\n\t  var version = util.getArg(sourceMap, 'version');\n\t  var sections = util.getArg(sourceMap, 'sections');\n\t\n\t  if (version != this._version) {\n\t    throw new Error('Unsupported version: ' + version);\n\t  }\n\t\n\t  this._sources = new ArraySet();\n\t  this._names = new ArraySet();\n\t\n\t  var lastOffset = {\n\t    line: -1,\n\t    column: 0\n\t  };\n\t  this._sections = sections.map(function (s) {\n\t    if (s.url) {\n\t      // The url field will require support for asynchronicity.\n\t      // See https://github.com/mozilla/source-map/issues/16\n\t      throw new Error('Support for url field in sections not implemented.');\n\t    }\n\t    var offset = util.getArg(s, 'offset');\n\t    var offsetLine = util.getArg(offset, 'line');\n\t    var offsetColumn = util.getArg(offset, 'column');\n\t\n\t    if (offsetLine < lastOffset.line ||\n\t        (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {\n\t      throw new Error('Section offsets must be ordered and non-overlapping.');\n\t    }\n\t    lastOffset = offset;\n\t\n\t    return {\n\t      generatedOffset: {\n\t        // The offset fields are 0-based, but we use 1-based indices when\n\t        // encoding/decoding from VLQ.\n\t        generatedLine: offsetLine + 1,\n\t        generatedColumn: offsetColumn + 1\n\t      },\n\t      consumer: new SourceMapConsumer(util.getArg(s, 'map'))\n\t    }\n\t  });\n\t}\n\t\n\tIndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\n\tIndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tIndexedSourceMapConsumer.prototype._version = 3;\n\t\n\t/**\n\t * The list of original sources.\n\t */\n\tObject.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {\n\t  get: function () {\n\t    var sources = [];\n\t    for (var i = 0; i < this._sections.length; i++) {\n\t      for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {\n\t        sources.push(this._sections[i].consumer.sources[j]);\n\t      }\n\t    }\n\t    return sources;\n\t  }\n\t});\n\t\n\t/**\n\t * Returns the original source, line, and column information for the generated\n\t * source's line and column positions provided. The only argument is an object\n\t * with the following properties:\n\t *\n\t *   - line: The line number in the generated source.\n\t *   - column: The column number in the generated source.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t *   - source: The original source file, or null.\n\t *   - line: The line number in the original source, or null.\n\t *   - column: The column number in the original source, or null.\n\t *   - name: The original identifier, or null.\n\t */\n\tIndexedSourceMapConsumer.prototype.originalPositionFor =\n\t  function IndexedSourceMapConsumer_originalPositionFor(aArgs) {\n\t    var needle = {\n\t      generatedLine: util.getArg(aArgs, 'line'),\n\t      generatedColumn: util.getArg(aArgs, 'column')\n\t    };\n\t\n\t    // Find the section containing the generated position we're trying to map\n\t    // to an original position.\n\t    var sectionIndex = binarySearch.search(needle, this._sections,\n\t      function(needle, section) {\n\t        var cmp = needle.generatedLine - section.generatedOffset.generatedLine;\n\t        if (cmp) {\n\t          return cmp;\n\t        }\n\t\n\t        return (needle.generatedColumn -\n\t                section.generatedOffset.generatedColumn);\n\t      });\n\t    var section = this._sections[sectionIndex];\n\t\n\t    if (!section) {\n\t      return {\n\t        source: null,\n\t        line: null,\n\t        column: null,\n\t        name: null\n\t      };\n\t    }\n\t\n\t    return section.consumer.originalPositionFor({\n\t      line: needle.generatedLine -\n\t        (section.generatedOffset.generatedLine - 1),\n\t      column: needle.generatedColumn -\n\t        (section.generatedOffset.generatedLine === needle.generatedLine\n\t         ? section.generatedOffset.generatedColumn - 1\n\t         : 0),\n\t      bias: aArgs.bias\n\t    });\n\t  };\n\t\n\t/**\n\t * Return true if we have the source content for every source in the source\n\t * map, false otherwise.\n\t */\n\tIndexedSourceMapConsumer.prototype.hasContentsOfAllSources =\n\t  function IndexedSourceMapConsumer_hasContentsOfAllSources() {\n\t    return this._sections.every(function (s) {\n\t      return s.consumer.hasContentsOfAllSources();\n\t    });\n\t  };\n\t\n\t/**\n\t * Returns the original source content. The only argument is the url of the\n\t * original source file. Returns null if no original source content is\n\t * available.\n\t */\n\tIndexedSourceMapConsumer.prototype.sourceContentFor =\n\t  function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n\t    for (var i = 0; i < this._sections.length; i++) {\n\t      var section = this._sections[i];\n\t\n\t      var content = section.consumer.sourceContentFor(aSource, true);\n\t      if (content) {\n\t        return content;\n\t      }\n\t    }\n\t    if (nullOnMissing) {\n\t      return null;\n\t    }\n\t    else {\n\t      throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n\t    }\n\t  };\n\t\n\t/**\n\t * Returns the generated line and column information for the original source,\n\t * line, and column positions provided. The only argument is an object with\n\t * the following properties:\n\t *\n\t *   - source: The filename of the original source.\n\t *   - line: The line number in the original source.\n\t *   - column: The column number in the original source.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t *   - line: The line number in the generated source, or null.\n\t *   - column: The column number in the generated source, or null.\n\t */\n\tIndexedSourceMapConsumer.prototype.generatedPositionFor =\n\t  function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {\n\t    for (var i = 0; i < this._sections.length; i++) {\n\t      var section = this._sections[i];\n\t\n\t      // Only consider this section if the requested source is in the list of\n\t      // sources of the consumer.\n\t      if (section.consumer.sources.indexOf(util.getArg(aArgs, 'source')) === -1) {\n\t        continue;\n\t      }\n\t      var generatedPosition = section.consumer.generatedPositionFor(aArgs);\n\t      if (generatedPosition) {\n\t        var ret = {\n\t          line: generatedPosition.line +\n\t            (section.generatedOffset.generatedLine - 1),\n\t          column: generatedPosition.column +\n\t            (section.generatedOffset.generatedLine === generatedPosition.line\n\t             ? section.generatedOffset.generatedColumn - 1\n\t             : 0)\n\t        };\n\t        return ret;\n\t      }\n\t    }\n\t\n\t    return {\n\t      line: null,\n\t      column: null\n\t    };\n\t  };\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tIndexedSourceMapConsumer.prototype._parseMappings =\n\t  function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t    this.__generatedMappings = [];\n\t    this.__originalMappings = [];\n\t    for (var i = 0; i < this._sections.length; i++) {\n\t      var section = this._sections[i];\n\t      var sectionMappings = section.consumer._generatedMappings;\n\t      for (var j = 0; j < sectionMappings.length; j++) {\n\t        var mapping = sectionMappings[j];\n\t\n\t        var source = section.consumer._sources.at(mapping.source);\n\t        if (section.consumer.sourceRoot !== null) {\n\t          source = util.join(section.consumer.sourceRoot, source);\n\t        }\n\t        this._sources.add(source);\n\t        source = this._sources.indexOf(source);\n\t\n\t        var name = section.consumer._names.at(mapping.name);\n\t        this._names.add(name);\n\t        name = this._names.indexOf(name);\n\t\n\t        // The mappings coming from the consumer for the section have\n\t        // generated positions relative to the start of the section, so we\n\t        // need to offset them to be relative to the start of the concatenated\n\t        // generated file.\n\t        var adjustedMapping = {\n\t          source: source,\n\t          generatedLine: mapping.generatedLine +\n\t            (section.generatedOffset.generatedLine - 1),\n\t          generatedColumn: mapping.generatedColumn +\n\t            (section.generatedOffset.generatedLine === mapping.generatedLine\n\t            ? section.generatedOffset.generatedColumn - 1\n\t            : 0),\n\t          originalLine: mapping.originalLine,\n\t          originalColumn: mapping.originalColumn,\n\t          name: name\n\t        };\n\t\n\t        this.__generatedMappings.push(adjustedMapping);\n\t        if (typeof adjustedMapping.originalLine === 'number') {\n\t          this.__originalMappings.push(adjustedMapping);\n\t        }\n\t      }\n\t    }\n\t\n\t    quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);\n\t    quickSort(this.__originalMappings, util.compareByOriginalPositions);\n\t  };\n\t\n\texports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\texports.GREATEST_LOWER_BOUND = 1;\n\texports.LEAST_UPPER_BOUND = 2;\n\t\n\t/**\n\t * Recursive implementation of binary search.\n\t *\n\t * @param aLow Indices here and lower do not contain the needle.\n\t * @param aHigh Indices here and higher do not contain the needle.\n\t * @param aNeedle The element being searched for.\n\t * @param aHaystack The non-empty array being searched.\n\t * @param aCompare Function which takes two elements and returns -1, 0, or 1.\n\t * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n\t *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t *     closest element that is smaller than or greater than the one we are\n\t *     searching for, respectively, if the exact element cannot be found.\n\t */\n\tfunction recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {\n\t  // This function terminates when one of the following is true:\n\t  //\n\t  //   1. We find the exact element we are looking for.\n\t  //\n\t  //   2. We did not find the exact element, but we can return the index of\n\t  //      the next-closest element.\n\t  //\n\t  //   3. We did not find the exact element, and there is no next-closest\n\t  //      element than the one we are searching for, so we return -1.\n\t  var mid = Math.floor((aHigh - aLow) / 2) + aLow;\n\t  var cmp = aCompare(aNeedle, aHaystack[mid], true);\n\t  if (cmp === 0) {\n\t    // Found the element we are looking for.\n\t    return mid;\n\t  }\n\t  else if (cmp > 0) {\n\t    // Our needle is greater than aHaystack[mid].\n\t    if (aHigh - mid > 1) {\n\t      // The element is in the upper half.\n\t      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);\n\t    }\n\t\n\t    // The exact needle element was not found in this haystack. Determine if\n\t    // we are in termination case (3) or (2) and return the appropriate thing.\n\t    if (aBias == exports.LEAST_UPPER_BOUND) {\n\t      return aHigh < aHaystack.length ? aHigh : -1;\n\t    } else {\n\t      return mid;\n\t    }\n\t  }\n\t  else {\n\t    // Our needle is less than aHaystack[mid].\n\t    if (mid - aLow > 1) {\n\t      // The element is in the lower half.\n\t      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);\n\t    }\n\t\n\t    // we are in termination case (3) or (2) and return the appropriate thing.\n\t    if (aBias == exports.LEAST_UPPER_BOUND) {\n\t      return mid;\n\t    } else {\n\t      return aLow < 0 ? -1 : aLow;\n\t    }\n\t  }\n\t}\n\t\n\t/**\n\t * This is an implementation of binary search which will always try and return\n\t * the index of the closest element if there is no exact hit. This is because\n\t * mappings between original and generated line/col pairs are single points,\n\t * and there is an implicit region between each of them, so a miss just means\n\t * that you aren't on the very start of a region.\n\t *\n\t * @param aNeedle The element you are looking for.\n\t * @param aHaystack The array that is being searched.\n\t * @param aCompare A function which takes the needle and an element in the\n\t *     array and returns -1, 0, or 1 depending on whether the needle is less\n\t *     than, equal to, or greater than the element, respectively.\n\t * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n\t *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t *     closest element that is smaller than or greater than the one we are\n\t *     searching for, respectively, if the exact element cannot be found.\n\t *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.\n\t */\n\texports.search = function search(aNeedle, aHaystack, aCompare, aBias) {\n\t  if (aHaystack.length === 0) {\n\t    return -1;\n\t  }\n\t\n\t  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,\n\t                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);\n\t  if (index < 0) {\n\t    return -1;\n\t  }\n\t\n\t  // We have found either the exact element, or the next-closest element than\n\t  // the one we are searching for. However, there may be more than one such\n\t  // element. Make sure we always return the smallest of these.\n\t  while (index - 1 >= 0) {\n\t    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {\n\t      break;\n\t    }\n\t    --index;\n\t  }\n\t\n\t  return index;\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\t// It turns out that some (most?) JavaScript engines don't self-host\n\t// `Array.prototype.sort`. This makes sense because C++ will likely remain\n\t// faster than JS when doing raw CPU-intensive sorting. However, when using a\n\t// custom comparator function, calling back and forth between the VM's C++ and\n\t// JIT'd JS is rather slow *and* loses JIT type information, resulting in\n\t// worse generated code for the comparator function than would be optimal. In\n\t// fact, when sorting with a comparator, these costs outweigh the benefits of\n\t// sorting in C++. By using our own JS-implemented Quick Sort (below), we get\n\t// a ~3500ms mean speed-up in `bench/bench.html`.\n\t\n\t/**\n\t * Swap the elements indexed by `x` and `y` in the array `ary`.\n\t *\n\t * @param {Array} ary\n\t *        The array.\n\t * @param {Number} x\n\t *        The index of the first item.\n\t * @param {Number} y\n\t *        The index of the second item.\n\t */\n\tfunction swap(ary, x, y) {\n\t  var temp = ary[x];\n\t  ary[x] = ary[y];\n\t  ary[y] = temp;\n\t}\n\t\n\t/**\n\t * Returns a random integer within the range `low .. high` inclusive.\n\t *\n\t * @param {Number} low\n\t *        The lower bound on the range.\n\t * @param {Number} high\n\t *        The upper bound on the range.\n\t */\n\tfunction randomIntInRange(low, high) {\n\t  return Math.round(low + (Math.random() * (high - low)));\n\t}\n\t\n\t/**\n\t * The Quick Sort algorithm.\n\t *\n\t * @param {Array} ary\n\t *        An array to sort.\n\t * @param {function} comparator\n\t *        Function to use to compare two items.\n\t * @param {Number} p\n\t *        Start index of the array\n\t * @param {Number} r\n\t *        End index of the array\n\t */\n\tfunction doQuickSort(ary, comparator, p, r) {\n\t  // If our lower bound is less than our upper bound, we (1) partition the\n\t  // array into two pieces and (2) recurse on each half. If it is not, this is\n\t  // the empty array and our base case.\n\t\n\t  if (p < r) {\n\t    // (1) Partitioning.\n\t    //\n\t    // The partitioning chooses a pivot between `p` and `r` and moves all\n\t    // elements that are less than or equal to the pivot to the before it, and\n\t    // all the elements that are greater than it after it. The effect is that\n\t    // once partition is done, the pivot is in the exact place it will be when\n\t    // the array is put in sorted order, and it will not need to be moved\n\t    // again. This runs in O(n) time.\n\t\n\t    // Always choose a random pivot so that an input array which is reverse\n\t    // sorted does not cause O(n^2) running time.\n\t    var pivotIndex = randomIntInRange(p, r);\n\t    var i = p - 1;\n\t\n\t    swap(ary, pivotIndex, r);\n\t    var pivot = ary[r];\n\t\n\t    // Immediately after `j` is incremented in this loop, the following hold\n\t    // true:\n\t    //\n\t    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.\n\t    //\n\t    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.\n\t    for (var j = p; j < r; j++) {\n\t      if (comparator(ary[j], pivot) <= 0) {\n\t        i += 1;\n\t        swap(ary, i, j);\n\t      }\n\t    }\n\t\n\t    swap(ary, i + 1, j);\n\t    var q = i + 1;\n\t\n\t    // (2) Recurse on each half.\n\t\n\t    doQuickSort(ary, comparator, p, q - 1);\n\t    doQuickSort(ary, comparator, q + 1, r);\n\t  }\n\t}\n\t\n\t/**\n\t * Sort the given array in-place with the given comparator function.\n\t *\n\t * @param {Array} ary\n\t *        An array to sort.\n\t * @param {function} comparator\n\t *        Function to use to compare two items.\n\t */\n\texports.quickSort = function (ary, comparator) {\n\t  doQuickSort(ary, comparator, 0, ary.length - 1);\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;\n\tvar util = __webpack_require__(4);\n\t\n\t// Matches a Windows-style `\\r\\n` newline or a `\\n` newline used by all other\n\t// operating systems these days (capturing the result).\n\tvar REGEX_NEWLINE = /(\\r?\\n)/;\n\t\n\t// Newline character code for charCodeAt() comparisons\n\tvar NEWLINE_CODE = 10;\n\t\n\t// Private symbol for identifying `SourceNode`s when multiple versions of\n\t// the source-map library are loaded. This MUST NOT CHANGE across\n\t// versions!\n\tvar isSourceNode = \"$$$isSourceNode$$$\";\n\t\n\t/**\n\t * SourceNodes provide a way to abstract over interpolating/concatenating\n\t * snippets of generated JavaScript source code while maintaining the line and\n\t * column information associated with the original source code.\n\t *\n\t * @param aLine The original line number.\n\t * @param aColumn The original column number.\n\t * @param aSource The original source's filename.\n\t * @param aChunks Optional. An array of strings which are snippets of\n\t *        generated JS, or other SourceNodes.\n\t * @param aName The original identifier.\n\t */\n\tfunction SourceNode(aLine, aColumn, aSource, aChunks, aName) {\n\t  this.children = [];\n\t  this.sourceContents = {};\n\t  this.line = aLine == null ? null : aLine;\n\t  this.column = aColumn == null ? null : aColumn;\n\t  this.source = aSource == null ? null : aSource;\n\t  this.name = aName == null ? null : aName;\n\t  this[isSourceNode] = true;\n\t  if (aChunks != null) this.add(aChunks);\n\t}\n\t\n\t/**\n\t * Creates a SourceNode from generated code and a SourceMapConsumer.\n\t *\n\t * @param aGeneratedCode The generated code\n\t * @param aSourceMapConsumer The SourceMap for the generated code\n\t * @param aRelativePath Optional. The path that relative sources in the\n\t *        SourceMapConsumer should be relative to.\n\t */\n\tSourceNode.fromStringWithSourceMap =\n\t  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {\n\t    // The SourceNode we want to fill with the generated code\n\t    // and the SourceMap\n\t    var node = new SourceNode();\n\t\n\t    // All even indices of this array are one line of the generated code,\n\t    // while all odd indices are the newlines between two adjacent lines\n\t    // (since `REGEX_NEWLINE` captures its match).\n\t    // Processed fragments are accessed by calling `shiftNextLine`.\n\t    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);\n\t    var remainingLinesIndex = 0;\n\t    var shiftNextLine = function() {\n\t      var lineContents = getNextLine();\n\t      // The last line of a file might not have a newline.\n\t      var newLine = getNextLine() || \"\";\n\t      return lineContents + newLine;\n\t\n\t      function getNextLine() {\n\t        return remainingLinesIndex < remainingLines.length ?\n\t            remainingLines[remainingLinesIndex++] : undefined;\n\t      }\n\t    };\n\t\n\t    // We need to remember the position of \"remainingLines\"\n\t    var lastGeneratedLine = 1, lastGeneratedColumn = 0;\n\t\n\t    // The generate SourceNodes we need a code range.\n\t    // To extract it current and last mapping is used.\n\t    // Here we store the last mapping.\n\t    var lastMapping = null;\n\t\n\t    aSourceMapConsumer.eachMapping(function (mapping) {\n\t      if (lastMapping !== null) {\n\t        // We add the code from \"lastMapping\" to \"mapping\":\n\t        // First check if there is a new line in between.\n\t        if (lastGeneratedLine < mapping.generatedLine) {\n\t          // Associate first line with \"lastMapping\"\n\t          addMappingWithCode(lastMapping, shiftNextLine());\n\t          lastGeneratedLine++;\n\t          lastGeneratedColumn = 0;\n\t          // The remaining code is added without mapping\n\t        } else {\n\t          // There is no new line in between.\n\t          // Associate the code between \"lastGeneratedColumn\" and\n\t          // \"mapping.generatedColumn\" with \"lastMapping\"\n\t          var nextLine = remainingLines[remainingLinesIndex];\n\t          var code = nextLine.substr(0, mapping.generatedColumn -\n\t                                        lastGeneratedColumn);\n\t          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -\n\t                                              lastGeneratedColumn);\n\t          lastGeneratedColumn = mapping.generatedColumn;\n\t          addMappingWithCode(lastMapping, code);\n\t          // No more remaining code, continue\n\t          lastMapping = mapping;\n\t          return;\n\t        }\n\t      }\n\t      // We add the generated code until the first mapping\n\t      // to the SourceNode without any mapping.\n\t      // Each line is added as separate string.\n\t      while (lastGeneratedLine < mapping.generatedLine) {\n\t        node.add(shiftNextLine());\n\t        lastGeneratedLine++;\n\t      }\n\t      if (lastGeneratedColumn < mapping.generatedColumn) {\n\t        var nextLine = remainingLines[remainingLinesIndex];\n\t        node.add(nextLine.substr(0, mapping.generatedColumn));\n\t        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);\n\t        lastGeneratedColumn = mapping.generatedColumn;\n\t      }\n\t      lastMapping = mapping;\n\t    }, this);\n\t    // We have processed all mappings.\n\t    if (remainingLinesIndex < remainingLines.length) {\n\t      if (lastMapping) {\n\t        // Associate the remaining code in the current line with \"lastMapping\"\n\t        addMappingWithCode(lastMapping, shiftNextLine());\n\t      }\n\t      // and add the remaining lines without any mapping\n\t      node.add(remainingLines.splice(remainingLinesIndex).join(\"\"));\n\t    }\n\t\n\t    // Copy sourcesContent into SourceNode\n\t    aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t      var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t      if (content != null) {\n\t        if (aRelativePath != null) {\n\t          sourceFile = util.join(aRelativePath, sourceFile);\n\t        }\n\t        node.setSourceContent(sourceFile, content);\n\t      }\n\t    });\n\t\n\t    return node;\n\t\n\t    function addMappingWithCode(mapping, code) {\n\t      if (mapping === null || mapping.source === undefined) {\n\t        node.add(code);\n\t      } else {\n\t        var source = aRelativePath\n\t          ? util.join(aRelativePath, mapping.source)\n\t          : mapping.source;\n\t        node.add(new SourceNode(mapping.originalLine,\n\t                                mapping.originalColumn,\n\t                                source,\n\t                                code,\n\t                                mapping.name));\n\t      }\n\t    }\n\t  };\n\t\n\t/**\n\t * Add a chunk of generated JS to this source node.\n\t *\n\t * @param aChunk A string snippet of generated JS code, another instance of\n\t *        SourceNode, or an array where each member is one of those things.\n\t */\n\tSourceNode.prototype.add = function SourceNode_add(aChunk) {\n\t  if (Array.isArray(aChunk)) {\n\t    aChunk.forEach(function (chunk) {\n\t      this.add(chunk);\n\t    }, this);\n\t  }\n\t  else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n\t    if (aChunk) {\n\t      this.children.push(aChunk);\n\t    }\n\t  }\n\t  else {\n\t    throw new TypeError(\n\t      \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n\t    );\n\t  }\n\t  return this;\n\t};\n\t\n\t/**\n\t * Add a chunk of generated JS to the beginning of this source node.\n\t *\n\t * @param aChunk A string snippet of generated JS code, another instance of\n\t *        SourceNode, or an array where each member is one of those things.\n\t */\n\tSourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {\n\t  if (Array.isArray(aChunk)) {\n\t    for (var i = aChunk.length-1; i >= 0; i--) {\n\t      this.prepend(aChunk[i]);\n\t    }\n\t  }\n\t  else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n\t    this.children.unshift(aChunk);\n\t  }\n\t  else {\n\t    throw new TypeError(\n\t      \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n\t    );\n\t  }\n\t  return this;\n\t};\n\t\n\t/**\n\t * Walk over the tree of JS snippets in this node and its children. The\n\t * walking function is called once for each snippet of JS and is passed that\n\t * snippet and the its original associated source's line/column location.\n\t *\n\t * @param aFn The traversal function.\n\t */\n\tSourceNode.prototype.walk = function SourceNode_walk(aFn) {\n\t  var chunk;\n\t  for (var i = 0, len = this.children.length; i < len; i++) {\n\t    chunk = this.children[i];\n\t    if (chunk[isSourceNode]) {\n\t      chunk.walk(aFn);\n\t    }\n\t    else {\n\t      if (chunk !== '') {\n\t        aFn(chunk, { source: this.source,\n\t                     line: this.line,\n\t                     column: this.column,\n\t                     name: this.name });\n\t      }\n\t    }\n\t  }\n\t};\n\t\n\t/**\n\t * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between\n\t * each of `this.children`.\n\t *\n\t * @param aSep The separator.\n\t */\n\tSourceNode.prototype.join = function SourceNode_join(aSep) {\n\t  var newChildren;\n\t  var i;\n\t  var len = this.children.length;\n\t  if (len > 0) {\n\t    newChildren = [];\n\t    for (i = 0; i < len-1; i++) {\n\t      newChildren.push(this.children[i]);\n\t      newChildren.push(aSep);\n\t    }\n\t    newChildren.push(this.children[i]);\n\t    this.children = newChildren;\n\t  }\n\t  return this;\n\t};\n\t\n\t/**\n\t * Call String.prototype.replace on the very right-most source snippet. Useful\n\t * for trimming whitespace from the end of a source node, etc.\n\t *\n\t * @param aPattern The pattern to replace.\n\t * @param aReplacement The thing to replace the pattern with.\n\t */\n\tSourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {\n\t  var lastChild = this.children[this.children.length - 1];\n\t  if (lastChild[isSourceNode]) {\n\t    lastChild.replaceRight(aPattern, aReplacement);\n\t  }\n\t  else if (typeof lastChild === 'string') {\n\t    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);\n\t  }\n\t  else {\n\t    this.children.push(''.replace(aPattern, aReplacement));\n\t  }\n\t  return this;\n\t};\n\t\n\t/**\n\t * Set the source content for a source file. This will be added to the SourceMapGenerator\n\t * in the sourcesContent field.\n\t *\n\t * @param aSourceFile The filename of the source file\n\t * @param aSourceContent The content of the source file\n\t */\n\tSourceNode.prototype.setSourceContent =\n\t  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {\n\t    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;\n\t  };\n\t\n\t/**\n\t * Walk over the tree of SourceNodes. The walking function is called for each\n\t * source file content and is passed the filename and source content.\n\t *\n\t * @param aFn The traversal function.\n\t */\n\tSourceNode.prototype.walkSourceContents =\n\t  function SourceNode_walkSourceContents(aFn) {\n\t    for (var i = 0, len = this.children.length; i < len; i++) {\n\t      if (this.children[i][isSourceNode]) {\n\t        this.children[i].walkSourceContents(aFn);\n\t      }\n\t    }\n\t\n\t    var sources = Object.keys(this.sourceContents);\n\t    for (var i = 0, len = sources.length; i < len; i++) {\n\t      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);\n\t    }\n\t  };\n\t\n\t/**\n\t * Return the string representation of this source node. Walks over the tree\n\t * and concatenates all the various snippets together to one string.\n\t */\n\tSourceNode.prototype.toString = function SourceNode_toString() {\n\t  var str = \"\";\n\t  this.walk(function (chunk) {\n\t    str += chunk;\n\t  });\n\t  return str;\n\t};\n\t\n\t/**\n\t * Returns the string representation of this source node along with a source\n\t * map.\n\t */\n\tSourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {\n\t  var generated = {\n\t    code: \"\",\n\t    line: 1,\n\t    column: 0\n\t  };\n\t  var map = new SourceMapGenerator(aArgs);\n\t  var sourceMappingActive = false;\n\t  var lastOriginalSource = null;\n\t  var lastOriginalLine = null;\n\t  var lastOriginalColumn = null;\n\t  var lastOriginalName = null;\n\t  this.walk(function (chunk, original) {\n\t    generated.code += chunk;\n\t    if (original.source !== null\n\t        && original.line !== null\n\t        && original.column !== null) {\n\t      if(lastOriginalSource !== original.source\n\t         || lastOriginalLine !== original.line\n\t         || lastOriginalColumn !== original.column\n\t         || lastOriginalName !== original.name) {\n\t        map.addMapping({\n\t          source: original.source,\n\t          original: {\n\t            line: original.line,\n\t            column: original.column\n\t          },\n\t          generated: {\n\t            line: generated.line,\n\t            column: generated.column\n\t          },\n\t          name: original.name\n\t        });\n\t      }\n\t      lastOriginalSource = original.source;\n\t      lastOriginalLine = original.line;\n\t      lastOriginalColumn = original.column;\n\t      lastOriginalName = original.name;\n\t      sourceMappingActive = true;\n\t    } else if (sourceMappingActive) {\n\t      map.addMapping({\n\t        generated: {\n\t          line: generated.line,\n\t          column: generated.column\n\t        }\n\t      });\n\t      lastOriginalSource = null;\n\t      sourceMappingActive = false;\n\t    }\n\t    for (var idx = 0, length = chunk.length; idx < length; idx++) {\n\t      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {\n\t        generated.line++;\n\t        generated.column = 0;\n\t        // Mappings end at eol\n\t        if (idx + 1 === length) {\n\t          lastOriginalSource = null;\n\t          sourceMappingActive = false;\n\t        } else if (sourceMappingActive) {\n\t          map.addMapping({\n\t            source: original.source,\n\t            original: {\n\t              line: original.line,\n\t              column: original.column\n\t            },\n\t            generated: {\n\t              line: generated.line,\n\t              column: generated.column\n\t            },\n\t            name: original.name\n\t          });\n\t        }\n\t      } else {\n\t        generated.column++;\n\t      }\n\t    }\n\t  });\n\t  this.walkSourceContents(function (sourceFile, sourceContent) {\n\t    map.setSourceContent(sourceFile, sourceContent);\n\t  });\n\t\n\t  return { code: generated.code, map: map };\n\t};\n\t\n\texports.SourceNode = SourceNode;\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// source-map.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 42c329f865e32e011afb","/*\n * Copyright 2009-2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE.txt or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\nexports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator;\nexports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer;\nexports.SourceNode = require('./lib/source-node').SourceNode;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./source-map.js\n// module id = 0\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar base64VLQ = require('./base64-vlq');\nvar util = require('./util');\nvar ArraySet = require('./array-set').ArraySet;\nvar MappingList = require('./mapping-list').MappingList;\n\n/**\n * An instance of the SourceMapGenerator represents a source map which is\n * being built incrementally. You may pass an object with the following\n * properties:\n *\n *   - file: The filename of the generated source.\n *   - sourceRoot: A root for all relative URLs in this source map.\n */\nfunction SourceMapGenerator(aArgs) {\n  if (!aArgs) {\n    aArgs = {};\n  }\n  this._file = util.getArg(aArgs, 'file', null);\n  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);\n  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);\n  this._sources = new ArraySet();\n  this._names = new ArraySet();\n  this._mappings = new MappingList();\n  this._sourcesContents = null;\n}\n\nSourceMapGenerator.prototype._version = 3;\n\n/**\n * Creates a new SourceMapGenerator based on a SourceMapConsumer\n *\n * @param aSourceMapConsumer The SourceMap.\n */\nSourceMapGenerator.fromSourceMap =\n  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {\n    var sourceRoot = aSourceMapConsumer.sourceRoot;\n    var generator = new SourceMapGenerator({\n      file: aSourceMapConsumer.file,\n      sourceRoot: sourceRoot\n    });\n    aSourceMapConsumer.eachMapping(function (mapping) {\n      var newMapping = {\n        generated: {\n          line: mapping.generatedLine,\n          column: mapping.generatedColumn\n        }\n      };\n\n      if (mapping.source != null) {\n        newMapping.source = mapping.source;\n        if (sourceRoot != null) {\n          newMapping.source = util.relative(sourceRoot, newMapping.source);\n        }\n\n        newMapping.original = {\n          line: mapping.originalLine,\n          column: mapping.originalColumn\n        };\n\n        if (mapping.name != null) {\n          newMapping.name = mapping.name;\n        }\n      }\n\n      generator.addMapping(newMapping);\n    });\n    aSourceMapConsumer.sources.forEach(function (sourceFile) {\n      var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n      if (content != null) {\n        generator.setSourceContent(sourceFile, content);\n      }\n    });\n    return generator;\n  };\n\n/**\n * Add a single mapping from original source line and column to the generated\n * source's line and column for this source map being created. The mapping\n * object should have the following properties:\n *\n *   - generated: An object with the generated line and column positions.\n *   - original: An object with the original line and column positions.\n *   - source: The original source file (relative to the sourceRoot).\n *   - name: An optional original token name for this mapping.\n */\nSourceMapGenerator.prototype.addMapping =\n  function SourceMapGenerator_addMapping(aArgs) {\n    var generated = util.getArg(aArgs, 'generated');\n    var original = util.getArg(aArgs, 'original', null);\n    var source = util.getArg(aArgs, 'source', null);\n    var name = util.getArg(aArgs, 'name', null);\n\n    if (!this._skipValidation) {\n      this._validateMapping(generated, original, source, name);\n    }\n\n    if (source != null) {\n      source = String(source);\n      if (!this._sources.has(source)) {\n        this._sources.add(source);\n      }\n    }\n\n    if (name != null) {\n      name = String(name);\n      if (!this._names.has(name)) {\n        this._names.add(name);\n      }\n    }\n\n    this._mappings.add({\n      generatedLine: generated.line,\n      generatedColumn: generated.column,\n      originalLine: original != null && original.line,\n      originalColumn: original != null && original.column,\n      source: source,\n      name: name\n    });\n  };\n\n/**\n * Set the source content for a source file.\n */\nSourceMapGenerator.prototype.setSourceContent =\n  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {\n    var source = aSourceFile;\n    if (this._sourceRoot != null) {\n      source = util.relative(this._sourceRoot, source);\n    }\n\n    if (aSourceContent != null) {\n      // Add the source content to the _sourcesContents map.\n      // Create a new _sourcesContents map if the property is null.\n      if (!this._sourcesContents) {\n        this._sourcesContents = Object.create(null);\n      }\n      this._sourcesContents[util.toSetString(source)] = aSourceContent;\n    } else if (this._sourcesContents) {\n      // Remove the source file from the _sourcesContents map.\n      // If the _sourcesContents map is empty, set the property to null.\n      delete this._sourcesContents[util.toSetString(source)];\n      if (Object.keys(this._sourcesContents).length === 0) {\n        this._sourcesContents = null;\n      }\n    }\n  };\n\n/**\n * Applies the mappings of a sub-source-map for a specific source file to the\n * source map being generated. Each mapping to the supplied source file is\n * rewritten using the supplied source map. Note: The resolution for the\n * resulting mappings is the minimium of this map and the supplied map.\n *\n * @param aSourceMapConsumer The source map to be applied.\n * @param aSourceFile Optional. The filename of the source file.\n *        If omitted, SourceMapConsumer's file property will be used.\n * @param aSourceMapPath Optional. The dirname of the path to the source map\n *        to be applied. If relative, it is relative to the SourceMapConsumer.\n *        This parameter is needed when the two source maps aren't in the same\n *        directory, and the source map to be applied contains relative source\n *        paths. If so, those relative source paths need to be rewritten\n *        relative to the SourceMapGenerator.\n */\nSourceMapGenerator.prototype.applySourceMap =\n  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {\n    var sourceFile = aSourceFile;\n    // If aSourceFile is omitted, we will use the file property of the SourceMap\n    if (aSourceFile == null) {\n      if (aSourceMapConsumer.file == null) {\n        throw new Error(\n          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +\n          'or the source map\\'s \"file\" property. Both were omitted.'\n        );\n      }\n      sourceFile = aSourceMapConsumer.file;\n    }\n    var sourceRoot = this._sourceRoot;\n    // Make \"sourceFile\" relative if an absolute Url is passed.\n    if (sourceRoot != null) {\n      sourceFile = util.relative(sourceRoot, sourceFile);\n    }\n    // Applying the SourceMap can add and remove items from the sources and\n    // the names array.\n    var newSources = new ArraySet();\n    var newNames = new ArraySet();\n\n    // Find mappings for the \"sourceFile\"\n    this._mappings.unsortedForEach(function (mapping) {\n      if (mapping.source === sourceFile && mapping.originalLine != null) {\n        // Check if it can be mapped by the source map, then update the mapping.\n        var original = aSourceMapConsumer.originalPositionFor({\n          line: mapping.originalLine,\n          column: mapping.originalColumn\n        });\n        if (original.source != null) {\n          // Copy mapping\n          mapping.source = original.source;\n          if (aSourceMapPath != null) {\n            mapping.source = util.join(aSourceMapPath, mapping.source)\n          }\n          if (sourceRoot != null) {\n            mapping.source = util.relative(sourceRoot, mapping.source);\n          }\n          mapping.originalLine = original.line;\n          mapping.originalColumn = original.column;\n          if (original.name != null) {\n            mapping.name = original.name;\n          }\n        }\n      }\n\n      var source = mapping.source;\n      if (source != null && !newSources.has(source)) {\n        newSources.add(source);\n      }\n\n      var name = mapping.name;\n      if (name != null && !newNames.has(name)) {\n        newNames.add(name);\n      }\n\n    }, this);\n    this._sources = newSources;\n    this._names = newNames;\n\n    // Copy sourcesContents of applied map.\n    aSourceMapConsumer.sources.forEach(function (sourceFile) {\n      var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n      if (content != null) {\n        if (aSourceMapPath != null) {\n          sourceFile = util.join(aSourceMapPath, sourceFile);\n        }\n        if (sourceRoot != null) {\n          sourceFile = util.relative(sourceRoot, sourceFile);\n        }\n        this.setSourceContent(sourceFile, content);\n      }\n    }, this);\n  };\n\n/**\n * A mapping can have one of the three levels of data:\n *\n *   1. Just the generated position.\n *   2. The Generated position, original position, and original source.\n *   3. Generated and original position, original source, as well as a name\n *      token.\n *\n * To maintain consistency, we validate that any new mapping being added falls\n * in to one of these categories.\n */\nSourceMapGenerator.prototype._validateMapping =\n  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,\n                                              aName) {\n    // When aOriginal is truthy but has empty values for .line and .column,\n    // it is most likely a programmer error. In this case we throw a very\n    // specific error message to try to guide them the right way.\n    // For example: https://github.com/Polymer/polymer-bundler/pull/519\n    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {\n        throw new Error(\n            'original.line and original.column are not numbers -- you probably meant to omit ' +\n            'the original mapping entirely and only map the generated position. If so, pass ' +\n            'null for the original mapping instead of an object with empty or null values.'\n        );\n    }\n\n    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n        && aGenerated.line > 0 && aGenerated.column >= 0\n        && !aOriginal && !aSource && !aName) {\n      // Case 1.\n      return;\n    }\n    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n             && aOriginal && 'line' in aOriginal && 'column' in aOriginal\n             && aGenerated.line > 0 && aGenerated.column >= 0\n             && aOriginal.line > 0 && aOriginal.column >= 0\n             && aSource) {\n      // Cases 2 and 3.\n      return;\n    }\n    else {\n      throw new Error('Invalid mapping: ' + JSON.stringify({\n        generated: aGenerated,\n        source: aSource,\n        original: aOriginal,\n        name: aName\n      }));\n    }\n  };\n\n/**\n * Serialize the accumulated mappings in to the stream of base 64 VLQs\n * specified by the source map format.\n */\nSourceMapGenerator.prototype._serializeMappings =\n  function SourceMapGenerator_serializeMappings() {\n    var previousGeneratedColumn = 0;\n    var previousGeneratedLine = 1;\n    var previousOriginalColumn = 0;\n    var previousOriginalLine = 0;\n    var previousName = 0;\n    var previousSource = 0;\n    var result = '';\n    var next;\n    var mapping;\n    var nameIdx;\n    var sourceIdx;\n\n    var mappings = this._mappings.toArray();\n    for (var i = 0, len = mappings.length; i < len; i++) {\n      mapping = mappings[i];\n      next = ''\n\n      if (mapping.generatedLine !== previousGeneratedLine) {\n        previousGeneratedColumn = 0;\n        while (mapping.generatedLine !== previousGeneratedLine) {\n          next += ';';\n          previousGeneratedLine++;\n        }\n      }\n      else {\n        if (i > 0) {\n          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {\n            continue;\n          }\n          next += ',';\n        }\n      }\n\n      next += base64VLQ.encode(mapping.generatedColumn\n                                 - previousGeneratedColumn);\n      previousGeneratedColumn = mapping.generatedColumn;\n\n      if (mapping.source != null) {\n        sourceIdx = this._sources.indexOf(mapping.source);\n        next += base64VLQ.encode(sourceIdx - previousSource);\n        previousSource = sourceIdx;\n\n        // lines are stored 0-based in SourceMap spec version 3\n        next += base64VLQ.encode(mapping.originalLine - 1\n                                   - previousOriginalLine);\n        previousOriginalLine = mapping.originalLine - 1;\n\n        next += base64VLQ.encode(mapping.originalColumn\n                                   - previousOriginalColumn);\n        previousOriginalColumn = mapping.originalColumn;\n\n        if (mapping.name != null) {\n          nameIdx = this._names.indexOf(mapping.name);\n          next += base64VLQ.encode(nameIdx - previousName);\n          previousName = nameIdx;\n        }\n      }\n\n      result += next;\n    }\n\n    return result;\n  };\n\nSourceMapGenerator.prototype._generateSourcesContent =\n  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {\n    return aSources.map(function (source) {\n      if (!this._sourcesContents) {\n        return null;\n      }\n      if (aSourceRoot != null) {\n        source = util.relative(aSourceRoot, source);\n      }\n      var key = util.toSetString(source);\n      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)\n        ? this._sourcesContents[key]\n        : null;\n    }, this);\n  };\n\n/**\n * Externalize the source map.\n */\nSourceMapGenerator.prototype.toJSON =\n  function SourceMapGenerator_toJSON() {\n    var map = {\n      version: this._version,\n      sources: this._sources.toArray(),\n      names: this._names.toArray(),\n      mappings: this._serializeMappings()\n    };\n    if (this._file != null) {\n      map.file = this._file;\n    }\n    if (this._sourceRoot != null) {\n      map.sourceRoot = this._sourceRoot;\n    }\n    if (this._sourcesContents) {\n      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);\n    }\n\n    return map;\n  };\n\n/**\n * Render the source map being generated to a string.\n */\nSourceMapGenerator.prototype.toString =\n  function SourceMapGenerator_toString() {\n    return JSON.stringify(this.toJSON());\n  };\n\nexports.SourceMapGenerator = SourceMapGenerator;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-map-generator.js\n// module id = 1\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n *\n * Based on the Base 64 VLQ implementation in Closure Compiler:\n * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java\n *\n * Copyright 2011 The Closure Compiler Authors. All rights reserved.\n * Redistribution and use in source and binary forms, with or without\n * modification, are permitted provided that the following conditions are\n * met:\n *\n *  * Redistributions of source code must retain the above copyright\n *    notice, this list of conditions and the following disclaimer.\n *  * Redistributions in binary form must reproduce the above\n *    copyright notice, this list of conditions and the following\n *    disclaimer in the documentation and/or other materials provided\n *    with the distribution.\n *  * Neither the name of Google Inc. nor the names of its\n *    contributors may be used to endorse or promote products derived\n *    from this software without specific prior written permission.\n *\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n * \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n */\n\nvar base64 = require('./base64');\n\n// A single base 64 digit can contain 6 bits of data. For the base 64 variable\n// length quantities we use in the source map spec, the first bit is the sign,\n// the next four bits are the actual value, and the 6th bit is the\n// continuation bit. The continuation bit tells us whether there are more\n// digits in this value following this digit.\n//\n//   Continuation\n//   |    Sign\n//   |    |\n//   V    V\n//   101011\n\nvar VLQ_BASE_SHIFT = 5;\n\n// binary: 100000\nvar VLQ_BASE = 1 << VLQ_BASE_SHIFT;\n\n// binary: 011111\nvar VLQ_BASE_MASK = VLQ_BASE - 1;\n\n// binary: 100000\nvar VLQ_CONTINUATION_BIT = VLQ_BASE;\n\n/**\n * Converts from a two-complement value to a value where the sign bit is\n * placed in the least significant bit.  For example, as decimals:\n *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)\n *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)\n */\nfunction toVLQSigned(aValue) {\n  return aValue < 0\n    ? ((-aValue) << 1) + 1\n    : (aValue << 1) + 0;\n}\n\n/**\n * Converts to a two-complement value from a value where the sign bit is\n * placed in the least significant bit.  For example, as decimals:\n *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1\n *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2\n */\nfunction fromVLQSigned(aValue) {\n  var isNegative = (aValue & 1) === 1;\n  var shifted = aValue >> 1;\n  return isNegative\n    ? -shifted\n    : shifted;\n}\n\n/**\n * Returns the base 64 VLQ encoded value.\n */\nexports.encode = function base64VLQ_encode(aValue) {\n  var encoded = \"\";\n  var digit;\n\n  var vlq = toVLQSigned(aValue);\n\n  do {\n    digit = vlq & VLQ_BASE_MASK;\n    vlq >>>= VLQ_BASE_SHIFT;\n    if (vlq > 0) {\n      // There are still more digits in this value, so we must make sure the\n      // continuation bit is marked.\n      digit |= VLQ_CONTINUATION_BIT;\n    }\n    encoded += base64.encode(digit);\n  } while (vlq > 0);\n\n  return encoded;\n};\n\n/**\n * Decodes the next base 64 VLQ value from the given string and returns the\n * value and the rest of the string via the out parameter.\n */\nexports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {\n  var strLen = aStr.length;\n  var result = 0;\n  var shift = 0;\n  var continuation, digit;\n\n  do {\n    if (aIndex >= strLen) {\n      throw new Error(\"Expected more digits in base 64 VLQ value.\");\n    }\n\n    digit = base64.decode(aStr.charCodeAt(aIndex++));\n    if (digit === -1) {\n      throw new Error(\"Invalid base64 digit: \" + aStr.charAt(aIndex - 1));\n    }\n\n    continuation = !!(digit & VLQ_CONTINUATION_BIT);\n    digit &= VLQ_BASE_MASK;\n    result = result + (digit << shift);\n    shift += VLQ_BASE_SHIFT;\n  } while (continuation);\n\n  aOutParam.value = fromVLQSigned(result);\n  aOutParam.rest = aIndex;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/base64-vlq.js\n// module id = 2\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\n/**\n * Encode an integer in the range of 0 to 63 to a single base 64 digit.\n */\nexports.encode = function (number) {\n  if (0 <= number && number < intToCharMap.length) {\n    return intToCharMap[number];\n  }\n  throw new TypeError(\"Must be between 0 and 63: \" + number);\n};\n\n/**\n * Decode a single base 64 character code digit to an integer. Returns -1 on\n * failure.\n */\nexports.decode = function (charCode) {\n  var bigA = 65;     // 'A'\n  var bigZ = 90;     // 'Z'\n\n  var littleA = 97;  // 'a'\n  var littleZ = 122; // 'z'\n\n  var zero = 48;     // '0'\n  var nine = 57;     // '9'\n\n  var plus = 43;     // '+'\n  var slash = 47;    // '/'\n\n  var littleOffset = 26;\n  var numberOffset = 52;\n\n  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ\n  if (bigA <= charCode && charCode <= bigZ) {\n    return (charCode - bigA);\n  }\n\n  // 26 - 51: abcdefghijklmnopqrstuvwxyz\n  if (littleA <= charCode && charCode <= littleZ) {\n    return (charCode - littleA + littleOffset);\n  }\n\n  // 52 - 61: 0123456789\n  if (zero <= charCode && charCode <= nine) {\n    return (charCode - zero + numberOffset);\n  }\n\n  // 62: +\n  if (charCode == plus) {\n    return 62;\n  }\n\n  // 63: /\n  if (charCode == slash) {\n    return 63;\n  }\n\n  // Invalid base64 digit.\n  return -1;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/base64.js\n// module id = 3\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\n/**\n * This is a helper function for getting values from parameter/options\n * objects.\n *\n * @param args The object we are extracting values from\n * @param name The name of the property we are getting.\n * @param defaultValue An optional value to return if the property is missing\n * from the object. If this is not specified and the property is missing, an\n * error will be thrown.\n */\nfunction getArg(aArgs, aName, aDefaultValue) {\n  if (aName in aArgs) {\n    return aArgs[aName];\n  } else if (arguments.length === 3) {\n    return aDefaultValue;\n  } else {\n    throw new Error('\"' + aName + '\" is a required argument.');\n  }\n}\nexports.getArg = getArg;\n\nvar urlRegexp = /^(?:([\\w+\\-.]+):)?\\/\\/(?:(\\w+:\\w+)@)?([\\w.]*)(?::(\\d+))?(\\S*)$/;\nvar dataUrlRegexp = /^data:.+\\,.+$/;\n\nfunction urlParse(aUrl) {\n  var match = aUrl.match(urlRegexp);\n  if (!match) {\n    return null;\n  }\n  return {\n    scheme: match[1],\n    auth: match[2],\n    host: match[3],\n    port: match[4],\n    path: match[5]\n  };\n}\nexports.urlParse = urlParse;\n\nfunction urlGenerate(aParsedUrl) {\n  var url = '';\n  if (aParsedUrl.scheme) {\n    url += aParsedUrl.scheme + ':';\n  }\n  url += '//';\n  if (aParsedUrl.auth) {\n    url += aParsedUrl.auth + '@';\n  }\n  if (aParsedUrl.host) {\n    url += aParsedUrl.host;\n  }\n  if (aParsedUrl.port) {\n    url += \":\" + aParsedUrl.port\n  }\n  if (aParsedUrl.path) {\n    url += aParsedUrl.path;\n  }\n  return url;\n}\nexports.urlGenerate = urlGenerate;\n\n/**\n * Normalizes a path, or the path portion of a URL:\n *\n * - Replaces consecutive slashes with one slash.\n * - Removes unnecessary '.' parts.\n * - Removes unnecessary '<dir>/..' parts.\n *\n * Based on code in the Node.js 'path' core module.\n *\n * @param aPath The path or url to normalize.\n */\nfunction normalize(aPath) {\n  var path = aPath;\n  var url = urlParse(aPath);\n  if (url) {\n    if (!url.path) {\n      return aPath;\n    }\n    path = url.path;\n  }\n  var isAbsolute = exports.isAbsolute(path);\n\n  var parts = path.split(/\\/+/);\n  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {\n    part = parts[i];\n    if (part === '.') {\n      parts.splice(i, 1);\n    } else if (part === '..') {\n      up++;\n    } else if (up > 0) {\n      if (part === '') {\n        // The first part is blank if the path is absolute. Trying to go\n        // above the root is a no-op. Therefore we can remove all '..' parts\n        // directly after the root.\n        parts.splice(i + 1, up);\n        up = 0;\n      } else {\n        parts.splice(i, 2);\n        up--;\n      }\n    }\n  }\n  path = parts.join('/');\n\n  if (path === '') {\n    path = isAbsolute ? '/' : '.';\n  }\n\n  if (url) {\n    url.path = path;\n    return urlGenerate(url);\n  }\n  return path;\n}\nexports.normalize = normalize;\n\n/**\n * Joins two paths/URLs.\n *\n * @param aRoot The root path or URL.\n * @param aPath The path or URL to be joined with the root.\n *\n * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a\n *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended\n *   first.\n * - Otherwise aPath is a path. If aRoot is a URL, then its path portion\n *   is updated with the result and aRoot is returned. Otherwise the result\n *   is returned.\n *   - If aPath is absolute, the result is aPath.\n *   - Otherwise the two paths are joined with a slash.\n * - Joining for example 'http://' and 'www.example.com' is also supported.\n */\nfunction join(aRoot, aPath) {\n  if (aRoot === \"\") {\n    aRoot = \".\";\n  }\n  if (aPath === \"\") {\n    aPath = \".\";\n  }\n  var aPathUrl = urlParse(aPath);\n  var aRootUrl = urlParse(aRoot);\n  if (aRootUrl) {\n    aRoot = aRootUrl.path || '/';\n  }\n\n  // `join(foo, '//www.example.org')`\n  if (aPathUrl && !aPathUrl.scheme) {\n    if (aRootUrl) {\n      aPathUrl.scheme = aRootUrl.scheme;\n    }\n    return urlGenerate(aPathUrl);\n  }\n\n  if (aPathUrl || aPath.match(dataUrlRegexp)) {\n    return aPath;\n  }\n\n  // `join('http://', 'www.example.com')`\n  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {\n    aRootUrl.host = aPath;\n    return urlGenerate(aRootUrl);\n  }\n\n  var joined = aPath.charAt(0) === '/'\n    ? aPath\n    : normalize(aRoot.replace(/\\/+$/, '') + '/' + aPath);\n\n  if (aRootUrl) {\n    aRootUrl.path = joined;\n    return urlGenerate(aRootUrl);\n  }\n  return joined;\n}\nexports.join = join;\n\nexports.isAbsolute = function (aPath) {\n  return aPath.charAt(0) === '/' || !!aPath.match(urlRegexp);\n};\n\n/**\n * Make a path relative to a URL or another path.\n *\n * @param aRoot The root path or URL.\n * @param aPath The path or URL to be made relative to aRoot.\n */\nfunction relative(aRoot, aPath) {\n  if (aRoot === \"\") {\n    aRoot = \".\";\n  }\n\n  aRoot = aRoot.replace(/\\/$/, '');\n\n  // It is possible for the path to be above the root. In this case, simply\n  // checking whether the root is a prefix of the path won't work. Instead, we\n  // need to remove components from the root one by one, until either we find\n  // a prefix that fits, or we run out of components to remove.\n  var level = 0;\n  while (aPath.indexOf(aRoot + '/') !== 0) {\n    var index = aRoot.lastIndexOf(\"/\");\n    if (index < 0) {\n      return aPath;\n    }\n\n    // If the only part of the root that is left is the scheme (i.e. http://,\n    // file:///, etc.), one or more slashes (/), or simply nothing at all, we\n    // have exhausted all components, so the path is not relative to the root.\n    aRoot = aRoot.slice(0, index);\n    if (aRoot.match(/^([^\\/]+:\\/)?\\/*$/)) {\n      return aPath;\n    }\n\n    ++level;\n  }\n\n  // Make sure we add a \"../\" for each component we removed from the root.\n  return Array(level + 1).join(\"../\") + aPath.substr(aRoot.length + 1);\n}\nexports.relative = relative;\n\nvar supportsNullProto = (function () {\n  var obj = Object.create(null);\n  return !('__proto__' in obj);\n}());\n\nfunction identity (s) {\n  return s;\n}\n\n/**\n * Because behavior goes wacky when you set `__proto__` on objects, we\n * have to prefix all the strings in our set with an arbitrary character.\n *\n * See https://github.com/mozilla/source-map/pull/31 and\n * https://github.com/mozilla/source-map/issues/30\n *\n * @param String aStr\n */\nfunction toSetString(aStr) {\n  if (isProtoString(aStr)) {\n    return '$' + aStr;\n  }\n\n  return aStr;\n}\nexports.toSetString = supportsNullProto ? identity : toSetString;\n\nfunction fromSetString(aStr) {\n  if (isProtoString(aStr)) {\n    return aStr.slice(1);\n  }\n\n  return aStr;\n}\nexports.fromSetString = supportsNullProto ? identity : fromSetString;\n\nfunction isProtoString(s) {\n  if (!s) {\n    return false;\n  }\n\n  var length = s.length;\n\n  if (length < 9 /* \"__proto__\".length */) {\n    return false;\n  }\n\n  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||\n      s.charCodeAt(length - 2) !== 95  /* '_' */ ||\n      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||\n      s.charCodeAt(length - 4) !== 116 /* 't' */ ||\n      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||\n      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||\n      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||\n      s.charCodeAt(length - 8) !== 95  /* '_' */ ||\n      s.charCodeAt(length - 9) !== 95  /* '_' */) {\n    return false;\n  }\n\n  for (var i = length - 10; i >= 0; i--) {\n    if (s.charCodeAt(i) !== 36 /* '$' */) {\n      return false;\n    }\n  }\n\n  return true;\n}\n\n/**\n * Comparator between two mappings where the original positions are compared.\n *\n * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n * mappings with the same original source/line/column, but different generated\n * line and column the same. Useful when searching for a mapping with a\n * stubbed out mapping.\n */\nfunction compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {\n  var cmp = mappingA.source - mappingB.source;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.originalLine - mappingB.originalLine;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.originalColumn - mappingB.originalColumn;\n  if (cmp !== 0 || onlyCompareOriginal) {\n    return cmp;\n  }\n\n  cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.generatedLine - mappingB.generatedLine;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  return mappingA.name - mappingB.name;\n}\nexports.compareByOriginalPositions = compareByOriginalPositions;\n\n/**\n * Comparator between two mappings with deflated source and name indices where\n * the generated positions are compared.\n *\n * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n * mappings with the same generated line and column, but different\n * source/name/original line and column the same. Useful when searching for a\n * mapping with a stubbed out mapping.\n */\nfunction compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {\n  var cmp = mappingA.generatedLine - mappingB.generatedLine;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n  if (cmp !== 0 || onlyCompareGenerated) {\n    return cmp;\n  }\n\n  cmp = mappingA.source - mappingB.source;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.originalLine - mappingB.originalLine;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.originalColumn - mappingB.originalColumn;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  return mappingA.name - mappingB.name;\n}\nexports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;\n\nfunction strcmp(aStr1, aStr2) {\n  if (aStr1 === aStr2) {\n    return 0;\n  }\n\n  if (aStr1 > aStr2) {\n    return 1;\n  }\n\n  return -1;\n}\n\n/**\n * Comparator between two mappings with inflated source and name strings where\n * the generated positions are compared.\n */\nfunction compareByGeneratedPositionsInflated(mappingA, mappingB) {\n  var cmp = mappingA.generatedLine - mappingB.generatedLine;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = strcmp(mappingA.source, mappingB.source);\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.originalLine - mappingB.originalLine;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  cmp = mappingA.originalColumn - mappingB.originalColumn;\n  if (cmp !== 0) {\n    return cmp;\n  }\n\n  return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/util.js\n// module id = 4\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\nvar has = Object.prototype.hasOwnProperty;\nvar hasNativeMap = typeof Map !== \"undefined\";\n\n/**\n * A data structure which is a combination of an array and a set. Adding a new\n * member is O(1), testing for membership is O(1), and finding the index of an\n * element is O(1). Removing elements from the set is not supported. Only\n * strings are supported for membership.\n */\nfunction ArraySet() {\n  this._array = [];\n  this._set = hasNativeMap ? new Map() : Object.create(null);\n}\n\n/**\n * Static method for creating ArraySet instances from an existing array.\n */\nArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {\n  var set = new ArraySet();\n  for (var i = 0, len = aArray.length; i < len; i++) {\n    set.add(aArray[i], aAllowDuplicates);\n  }\n  return set;\n};\n\n/**\n * Return how many unique items are in this ArraySet. If duplicates have been\n * added, than those do not count towards the size.\n *\n * @returns Number\n */\nArraySet.prototype.size = function ArraySet_size() {\n  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;\n};\n\n/**\n * Add the given string to this set.\n *\n * @param String aStr\n */\nArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {\n  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);\n  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);\n  var idx = this._array.length;\n  if (!isDuplicate || aAllowDuplicates) {\n    this._array.push(aStr);\n  }\n  if (!isDuplicate) {\n    if (hasNativeMap) {\n      this._set.set(aStr, idx);\n    } else {\n      this._set[sStr] = idx;\n    }\n  }\n};\n\n/**\n * Is the given string a member of this set?\n *\n * @param String aStr\n */\nArraySet.prototype.has = function ArraySet_has(aStr) {\n  if (hasNativeMap) {\n    return this._set.has(aStr);\n  } else {\n    var sStr = util.toSetString(aStr);\n    return has.call(this._set, sStr);\n  }\n};\n\n/**\n * What is the index of the given string in the array?\n *\n * @param String aStr\n */\nArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {\n  if (hasNativeMap) {\n    var idx = this._set.get(aStr);\n    if (idx >= 0) {\n        return idx;\n    }\n  } else {\n    var sStr = util.toSetString(aStr);\n    if (has.call(this._set, sStr)) {\n      return this._set[sStr];\n    }\n  }\n\n  throw new Error('\"' + aStr + '\" is not in the set.');\n};\n\n/**\n * What is the element at the given index?\n *\n * @param Number aIdx\n */\nArraySet.prototype.at = function ArraySet_at(aIdx) {\n  if (aIdx >= 0 && aIdx < this._array.length) {\n    return this._array[aIdx];\n  }\n  throw new Error('No element indexed by ' + aIdx);\n};\n\n/**\n * Returns the array representation of this set (which has the proper indices\n * indicated by indexOf). Note that this is a copy of the internal array used\n * for storing the members so that no one can mess with internal state.\n */\nArraySet.prototype.toArray = function ArraySet_toArray() {\n  return this._array.slice();\n};\n\nexports.ArraySet = ArraySet;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/array-set.js\n// module id = 5\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2014 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\n\n/**\n * Determine whether mappingB is after mappingA with respect to generated\n * position.\n */\nfunction generatedPositionAfter(mappingA, mappingB) {\n  // Optimized for most common case\n  var lineA = mappingA.generatedLine;\n  var lineB = mappingB.generatedLine;\n  var columnA = mappingA.generatedColumn;\n  var columnB = mappingB.generatedColumn;\n  return lineB > lineA || lineB == lineA && columnB >= columnA ||\n         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;\n}\n\n/**\n * A data structure to provide a sorted view of accumulated mappings in a\n * performance conscious manner. It trades a neglibable overhead in general\n * case for a large speedup in case of mappings being added in order.\n */\nfunction MappingList() {\n  this._array = [];\n  this._sorted = true;\n  // Serves as infimum\n  this._last = {generatedLine: -1, generatedColumn: 0};\n}\n\n/**\n * Iterate through internal items. This method takes the same arguments that\n * `Array.prototype.forEach` takes.\n *\n * NOTE: The order of the mappings is NOT guaranteed.\n */\nMappingList.prototype.unsortedForEach =\n  function MappingList_forEach(aCallback, aThisArg) {\n    this._array.forEach(aCallback, aThisArg);\n  };\n\n/**\n * Add the given source mapping.\n *\n * @param Object aMapping\n */\nMappingList.prototype.add = function MappingList_add(aMapping) {\n  if (generatedPositionAfter(this._last, aMapping)) {\n    this._last = aMapping;\n    this._array.push(aMapping);\n  } else {\n    this._sorted = false;\n    this._array.push(aMapping);\n  }\n};\n\n/**\n * Returns the flat, sorted array of mappings. The mappings are sorted by\n * generated position.\n *\n * WARNING: This method returns internal data without copying, for\n * performance. The return value must NOT be mutated, and should be treated as\n * an immutable borrow. If you want to take ownership, you must make your own\n * copy.\n */\nMappingList.prototype.toArray = function MappingList_toArray() {\n  if (!this._sorted) {\n    this._array.sort(util.compareByGeneratedPositionsInflated);\n    this._sorted = true;\n  }\n  return this._array;\n};\n\nexports.MappingList = MappingList;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/mapping-list.js\n// module id = 6\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\nvar binarySearch = require('./binary-search');\nvar ArraySet = require('./array-set').ArraySet;\nvar base64VLQ = require('./base64-vlq');\nvar quickSort = require('./quick-sort').quickSort;\n\nfunction SourceMapConsumer(aSourceMap) {\n  var sourceMap = aSourceMap;\n  if (typeof aSourceMap === 'string') {\n    sourceMap = JSON.parse(aSourceMap.replace(/^\\)\\]\\}'/, ''));\n  }\n\n  return sourceMap.sections != null\n    ? new IndexedSourceMapConsumer(sourceMap)\n    : new BasicSourceMapConsumer(sourceMap);\n}\n\nSourceMapConsumer.fromSourceMap = function(aSourceMap) {\n  return BasicSourceMapConsumer.fromSourceMap(aSourceMap);\n}\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nSourceMapConsumer.prototype._version = 3;\n\n// `__generatedMappings` and `__originalMappings` are arrays that hold the\n// parsed mapping coordinates from the source map's \"mappings\" attribute. They\n// are lazily instantiated, accessed via the `_generatedMappings` and\n// `_originalMappings` getters respectively, and we only parse the mappings\n// and create these arrays once queried for a source location. We jump through\n// these hoops because there can be many thousands of mappings, and parsing\n// them is expensive, so we only want to do it if we must.\n//\n// Each object in the arrays is of the form:\n//\n//     {\n//       generatedLine: The line number in the generated code,\n//       generatedColumn: The column number in the generated code,\n//       source: The path to the original source file that generated this\n//               chunk of code,\n//       originalLine: The line number in the original source that\n//                     corresponds to this chunk of generated code,\n//       originalColumn: The column number in the original source that\n//                       corresponds to this chunk of generated code,\n//       name: The name of the original symbol which generated this chunk of\n//             code.\n//     }\n//\n// All properties except for `generatedLine` and `generatedColumn` can be\n// `null`.\n//\n// `_generatedMappings` is ordered by the generated positions.\n//\n// `_originalMappings` is ordered by the original positions.\n\nSourceMapConsumer.prototype.__generatedMappings = null;\nObject.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {\n  get: function () {\n    if (!this.__generatedMappings) {\n      this._parseMappings(this._mappings, this.sourceRoot);\n    }\n\n    return this.__generatedMappings;\n  }\n});\n\nSourceMapConsumer.prototype.__originalMappings = null;\nObject.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {\n  get: function () {\n    if (!this.__originalMappings) {\n      this._parseMappings(this._mappings, this.sourceRoot);\n    }\n\n    return this.__originalMappings;\n  }\n});\n\nSourceMapConsumer.prototype._charIsMappingSeparator =\n  function SourceMapConsumer_charIsMappingSeparator(aStr, index) {\n    var c = aStr.charAt(index);\n    return c === \";\" || c === \",\";\n  };\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nSourceMapConsumer.prototype._parseMappings =\n  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n    throw new Error(\"Subclasses must implement _parseMappings\");\n  };\n\nSourceMapConsumer.GENERATED_ORDER = 1;\nSourceMapConsumer.ORIGINAL_ORDER = 2;\n\nSourceMapConsumer.GREATEST_LOWER_BOUND = 1;\nSourceMapConsumer.LEAST_UPPER_BOUND = 2;\n\n/**\n * Iterate over each mapping between an original source/line/column and a\n * generated line/column in this source map.\n *\n * @param Function aCallback\n *        The function that is called with each mapping.\n * @param Object aContext\n *        Optional. If specified, this object will be the value of `this` every\n *        time that `aCallback` is called.\n * @param aOrder\n *        Either `SourceMapConsumer.GENERATED_ORDER` or\n *        `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to\n *        iterate over the mappings sorted by the generated file's line/column\n *        order or the original's source/line/column order, respectively. Defaults to\n *        `SourceMapConsumer.GENERATED_ORDER`.\n */\nSourceMapConsumer.prototype.eachMapping =\n  function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {\n    var context = aContext || null;\n    var order = aOrder || SourceMapConsumer.GENERATED_ORDER;\n\n    var mappings;\n    switch (order) {\n    case SourceMapConsumer.GENERATED_ORDER:\n      mappings = this._generatedMappings;\n      break;\n    case SourceMapConsumer.ORIGINAL_ORDER:\n      mappings = this._originalMappings;\n      break;\n    default:\n      throw new Error(\"Unknown order of iteration.\");\n    }\n\n    var sourceRoot = this.sourceRoot;\n    mappings.map(function (mapping) {\n      var source = mapping.source === null ? null : this._sources.at(mapping.source);\n      if (source != null && sourceRoot != null) {\n        source = util.join(sourceRoot, source);\n      }\n      return {\n        source: source,\n        generatedLine: mapping.generatedLine,\n        generatedColumn: mapping.generatedColumn,\n        originalLine: mapping.originalLine,\n        originalColumn: mapping.originalColumn,\n        name: mapping.name === null ? null : this._names.at(mapping.name)\n      };\n    }, this).forEach(aCallback, context);\n  };\n\n/**\n * Returns all generated line and column information for the original source,\n * line, and column provided. If no column is provided, returns all mappings\n * corresponding to a either the line we are searching for or the next\n * closest line that has any mappings. Otherwise, returns all mappings\n * corresponding to the given line and either the column we are searching for\n * or the next closest column that has any offsets.\n *\n * The only argument is an object with the following properties:\n *\n *   - source: The filename of the original source.\n *   - line: The line number in the original source.\n *   - column: Optional. the column number in the original source.\n *\n * and an array of objects is returned, each with the following properties:\n *\n *   - line: The line number in the generated source, or null.\n *   - column: The column number in the generated source, or null.\n */\nSourceMapConsumer.prototype.allGeneratedPositionsFor =\n  function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {\n    var line = util.getArg(aArgs, 'line');\n\n    // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping\n    // returns the index of the closest mapping less than the needle. By\n    // setting needle.originalColumn to 0, we thus find the last mapping for\n    // the given line, provided such a mapping exists.\n    var needle = {\n      source: util.getArg(aArgs, 'source'),\n      originalLine: line,\n      originalColumn: util.getArg(aArgs, 'column', 0)\n    };\n\n    if (this.sourceRoot != null) {\n      needle.source = util.relative(this.sourceRoot, needle.source);\n    }\n    if (!this._sources.has(needle.source)) {\n      return [];\n    }\n    needle.source = this._sources.indexOf(needle.source);\n\n    var mappings = [];\n\n    var index = this._findMapping(needle,\n                                  this._originalMappings,\n                                  \"originalLine\",\n                                  \"originalColumn\",\n                                  util.compareByOriginalPositions,\n                                  binarySearch.LEAST_UPPER_BOUND);\n    if (index >= 0) {\n      var mapping = this._originalMappings[index];\n\n      if (aArgs.column === undefined) {\n        var originalLine = mapping.originalLine;\n\n        // Iterate until either we run out of mappings, or we run into\n        // a mapping for a different line than the one we found. Since\n        // mappings are sorted, this is guaranteed to find all mappings for\n        // the line we found.\n        while (mapping && mapping.originalLine === originalLine) {\n          mappings.push({\n            line: util.getArg(mapping, 'generatedLine', null),\n            column: util.getArg(mapping, 'generatedColumn', null),\n            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n          });\n\n          mapping = this._originalMappings[++index];\n        }\n      } else {\n        var originalColumn = mapping.originalColumn;\n\n        // Iterate until either we run out of mappings, or we run into\n        // a mapping for a different line than the one we were searching for.\n        // Since mappings are sorted, this is guaranteed to find all mappings for\n        // the line we are searching for.\n        while (mapping &&\n               mapping.originalLine === line &&\n               mapping.originalColumn == originalColumn) {\n          mappings.push({\n            line: util.getArg(mapping, 'generatedLine', null),\n            column: util.getArg(mapping, 'generatedColumn', null),\n            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n          });\n\n          mapping = this._originalMappings[++index];\n        }\n      }\n    }\n\n    return mappings;\n  };\n\nexports.SourceMapConsumer = SourceMapConsumer;\n\n/**\n * A BasicSourceMapConsumer instance represents a parsed source map which we can\n * query for information about the original file positions by giving it a file\n * position in the generated source.\n *\n * The only parameter is the raw source map (either as a JSON string, or\n * already parsed to an object). According to the spec, source maps have the\n * following attributes:\n *\n *   - version: Which version of the source map spec this map is following.\n *   - sources: An array of URLs to the original source files.\n *   - names: An array of identifiers which can be referrenced by individual mappings.\n *   - sourceRoot: Optional. The URL root from which all sources are relative.\n *   - sourcesContent: Optional. An array of contents of the original source files.\n *   - mappings: A string of base64 VLQs which contain the actual mappings.\n *   - file: Optional. The generated file this source map is associated with.\n *\n * Here is an example source map, taken from the source map spec[0]:\n *\n *     {\n *       version : 3,\n *       file: \"out.js\",\n *       sourceRoot : \"\",\n *       sources: [\"foo.js\", \"bar.js\"],\n *       names: [\"src\", \"maps\", \"are\", \"fun\"],\n *       mappings: \"AA,AB;;ABCDE;\"\n *     }\n *\n * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#\n */\nfunction BasicSourceMapConsumer(aSourceMap) {\n  var sourceMap = aSourceMap;\n  if (typeof aSourceMap === 'string') {\n    sourceMap = JSON.parse(aSourceMap.replace(/^\\)\\]\\}'/, ''));\n  }\n\n  var version = util.getArg(sourceMap, 'version');\n  var sources = util.getArg(sourceMap, 'sources');\n  // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which\n  // requires the array) to play nice here.\n  var names = util.getArg(sourceMap, 'names', []);\n  var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);\n  var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);\n  var mappings = util.getArg(sourceMap, 'mappings');\n  var file = util.getArg(sourceMap, 'file', null);\n\n  // Once again, Sass deviates from the spec and supplies the version as a\n  // string rather than a number, so we use loose equality checking here.\n  if (version != this._version) {\n    throw new Error('Unsupported version: ' + version);\n  }\n\n  sources = sources\n    .map(String)\n    // Some source maps produce relative source paths like \"./foo.js\" instead of\n    // \"foo.js\".  Normalize these first so that future comparisons will succeed.\n    // See bugzil.la/1090768.\n    .map(util.normalize)\n    // Always ensure that absolute sources are internally stored relative to\n    // the source root, if the source root is absolute. Not doing this would\n    // be particularly problematic when the source root is a prefix of the\n    // source (valid, but why??). See github issue #199 and bugzil.la/1188982.\n    .map(function (source) {\n      return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)\n        ? util.relative(sourceRoot, source)\n        : source;\n    });\n\n  // Pass `true` below to allow duplicate names and sources. While source maps\n  // are intended to be compressed and deduplicated, the TypeScript compiler\n  // sometimes generates source maps with duplicates in them. See Github issue\n  // #72 and bugzil.la/889492.\n  this._names = ArraySet.fromArray(names.map(String), true);\n  this._sources = ArraySet.fromArray(sources, true);\n\n  this.sourceRoot = sourceRoot;\n  this.sourcesContent = sourcesContent;\n  this._mappings = mappings;\n  this.file = file;\n}\n\nBasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\nBasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;\n\n/**\n * Create a BasicSourceMapConsumer from a SourceMapGenerator.\n *\n * @param SourceMapGenerator aSourceMap\n *        The source map that will be consumed.\n * @returns BasicSourceMapConsumer\n */\nBasicSourceMapConsumer.fromSourceMap =\n  function SourceMapConsumer_fromSourceMap(aSourceMap) {\n    var smc = Object.create(BasicSourceMapConsumer.prototype);\n\n    var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);\n    var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);\n    smc.sourceRoot = aSourceMap._sourceRoot;\n    smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),\n                                                            smc.sourceRoot);\n    smc.file = aSourceMap._file;\n\n    // Because we are modifying the entries (by converting string sources and\n    // names to indices into the sources and names ArraySets), we have to make\n    // a copy of the entry or else bad things happen. Shared mutable state\n    // strikes again! See github issue #191.\n\n    var generatedMappings = aSourceMap._mappings.toArray().slice();\n    var destGeneratedMappings = smc.__generatedMappings = [];\n    var destOriginalMappings = smc.__originalMappings = [];\n\n    for (var i = 0, length = generatedMappings.length; i < length; i++) {\n      var srcMapping = generatedMappings[i];\n      var destMapping = new Mapping;\n      destMapping.generatedLine = srcMapping.generatedLine;\n      destMapping.generatedColumn = srcMapping.generatedColumn;\n\n      if (srcMapping.source) {\n        destMapping.source = sources.indexOf(srcMapping.source);\n        destMapping.originalLine = srcMapping.originalLine;\n        destMapping.originalColumn = srcMapping.originalColumn;\n\n        if (srcMapping.name) {\n          destMapping.name = names.indexOf(srcMapping.name);\n        }\n\n        destOriginalMappings.push(destMapping);\n      }\n\n      destGeneratedMappings.push(destMapping);\n    }\n\n    quickSort(smc.__originalMappings, util.compareByOriginalPositions);\n\n    return smc;\n  };\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nBasicSourceMapConsumer.prototype._version = 3;\n\n/**\n * The list of original sources.\n */\nObject.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {\n  get: function () {\n    return this._sources.toArray().map(function (s) {\n      return this.sourceRoot != null ? util.join(this.sourceRoot, s) : s;\n    }, this);\n  }\n});\n\n/**\n * Provide the JIT with a nice shape / hidden class.\n */\nfunction Mapping() {\n  this.generatedLine = 0;\n  this.generatedColumn = 0;\n  this.source = null;\n  this.originalLine = null;\n  this.originalColumn = null;\n  this.name = null;\n}\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nBasicSourceMapConsumer.prototype._parseMappings =\n  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n    var generatedLine = 1;\n    var previousGeneratedColumn = 0;\n    var previousOriginalLine = 0;\n    var previousOriginalColumn = 0;\n    var previousSource = 0;\n    var previousName = 0;\n    var length = aStr.length;\n    var index = 0;\n    var cachedSegments = {};\n    var temp = {};\n    var originalMappings = [];\n    var generatedMappings = [];\n    var mapping, str, segment, end, value;\n\n    while (index < length) {\n      if (aStr.charAt(index) === ';') {\n        generatedLine++;\n        index++;\n        previousGeneratedColumn = 0;\n      }\n      else if (aStr.charAt(index) === ',') {\n        index++;\n      }\n      else {\n        mapping = new Mapping();\n        mapping.generatedLine = generatedLine;\n\n        // Because each offset is encoded relative to the previous one,\n        // many segments often have the same encoding. We can exploit this\n        // fact by caching the parsed variable length fields of each segment,\n        // allowing us to avoid a second parse if we encounter the same\n        // segment again.\n        for (end = index; end < length; end++) {\n          if (this._charIsMappingSeparator(aStr, end)) {\n            break;\n          }\n        }\n        str = aStr.slice(index, end);\n\n        segment = cachedSegments[str];\n        if (segment) {\n          index += str.length;\n        } else {\n          segment = [];\n          while (index < end) {\n            base64VLQ.decode(aStr, index, temp);\n            value = temp.value;\n            index = temp.rest;\n            segment.push(value);\n          }\n\n          if (segment.length === 2) {\n            throw new Error('Found a source, but no line and column');\n          }\n\n          if (segment.length === 3) {\n            throw new Error('Found a source and line, but no column');\n          }\n\n          cachedSegments[str] = segment;\n        }\n\n        // Generated column.\n        mapping.generatedColumn = previousGeneratedColumn + segment[0];\n        previousGeneratedColumn = mapping.generatedColumn;\n\n        if (segment.length > 1) {\n          // Original source.\n          mapping.source = previousSource + segment[1];\n          previousSource += segment[1];\n\n          // Original line.\n          mapping.originalLine = previousOriginalLine + segment[2];\n          previousOriginalLine = mapping.originalLine;\n          // Lines are stored 0-based\n          mapping.originalLine += 1;\n\n          // Original column.\n          mapping.originalColumn = previousOriginalColumn + segment[3];\n          previousOriginalColumn = mapping.originalColumn;\n\n          if (segment.length > 4) {\n            // Original name.\n            mapping.name = previousName + segment[4];\n            previousName += segment[4];\n          }\n        }\n\n        generatedMappings.push(mapping);\n        if (typeof mapping.originalLine === 'number') {\n          originalMappings.push(mapping);\n        }\n      }\n    }\n\n    quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);\n    this.__generatedMappings = generatedMappings;\n\n    quickSort(originalMappings, util.compareByOriginalPositions);\n    this.__originalMappings = originalMappings;\n  };\n\n/**\n * Find the mapping that best matches the hypothetical \"needle\" mapping that\n * we are searching for in the given \"haystack\" of mappings.\n */\nBasicSourceMapConsumer.prototype._findMapping =\n  function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,\n                                         aColumnName, aComparator, aBias) {\n    // To return the position we are searching for, we must first find the\n    // mapping for the given position and then return the opposite position it\n    // points to. Because the mappings are sorted, we can use binary search to\n    // find the best mapping.\n\n    if (aNeedle[aLineName] <= 0) {\n      throw new TypeError('Line must be greater than or equal to 1, got '\n                          + aNeedle[aLineName]);\n    }\n    if (aNeedle[aColumnName] < 0) {\n      throw new TypeError('Column must be greater than or equal to 0, got '\n                          + aNeedle[aColumnName]);\n    }\n\n    return binarySearch.search(aNeedle, aMappings, aComparator, aBias);\n  };\n\n/**\n * Compute the last column for each generated mapping. The last column is\n * inclusive.\n */\nBasicSourceMapConsumer.prototype.computeColumnSpans =\n  function SourceMapConsumer_computeColumnSpans() {\n    for (var index = 0; index < this._generatedMappings.length; ++index) {\n      var mapping = this._generatedMappings[index];\n\n      // Mappings do not contain a field for the last generated columnt. We\n      // can come up with an optimistic estimate, however, by assuming that\n      // mappings are contiguous (i.e. given two consecutive mappings, the\n      // first mapping ends where the second one starts).\n      if (index + 1 < this._generatedMappings.length) {\n        var nextMapping = this._generatedMappings[index + 1];\n\n        if (mapping.generatedLine === nextMapping.generatedLine) {\n          mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;\n          continue;\n        }\n      }\n\n      // The last mapping for each line spans the entire line.\n      mapping.lastGeneratedColumn = Infinity;\n    }\n  };\n\n/**\n * Returns the original source, line, and column information for the generated\n * source's line and column positions provided. The only argument is an object\n * with the following properties:\n *\n *   - line: The line number in the generated source.\n *   - column: The column number in the generated source.\n *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n *     closest element that is smaller than or greater than the one we are\n *     searching for, respectively, if the exact element cannot be found.\n *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n *\n * and an object is returned with the following properties:\n *\n *   - source: The original source file, or null.\n *   - line: The line number in the original source, or null.\n *   - column: The column number in the original source, or null.\n *   - name: The original identifier, or null.\n */\nBasicSourceMapConsumer.prototype.originalPositionFor =\n  function SourceMapConsumer_originalPositionFor(aArgs) {\n    var needle = {\n      generatedLine: util.getArg(aArgs, 'line'),\n      generatedColumn: util.getArg(aArgs, 'column')\n    };\n\n    var index = this._findMapping(\n      needle,\n      this._generatedMappings,\n      \"generatedLine\",\n      \"generatedColumn\",\n      util.compareByGeneratedPositionsDeflated,\n      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n    );\n\n    if (index >= 0) {\n      var mapping = this._generatedMappings[index];\n\n      if (mapping.generatedLine === needle.generatedLine) {\n        var source = util.getArg(mapping, 'source', null);\n        if (source !== null) {\n          source = this._sources.at(source);\n          if (this.sourceRoot != null) {\n            source = util.join(this.sourceRoot, source);\n          }\n        }\n        var name = util.getArg(mapping, 'name', null);\n        if (name !== null) {\n          name = this._names.at(name);\n        }\n        return {\n          source: source,\n          line: util.getArg(mapping, 'originalLine', null),\n          column: util.getArg(mapping, 'originalColumn', null),\n          name: name\n        };\n      }\n    }\n\n    return {\n      source: null,\n      line: null,\n      column: null,\n      name: null\n    };\n  };\n\n/**\n * Return true if we have the source content for every source in the source\n * map, false otherwise.\n */\nBasicSourceMapConsumer.prototype.hasContentsOfAllSources =\n  function BasicSourceMapConsumer_hasContentsOfAllSources() {\n    if (!this.sourcesContent) {\n      return false;\n    }\n    return this.sourcesContent.length >= this._sources.size() &&\n      !this.sourcesContent.some(function (sc) { return sc == null; });\n  };\n\n/**\n * Returns the original source content. The only argument is the url of the\n * original source file. Returns null if no original source content is\n * available.\n */\nBasicSourceMapConsumer.prototype.sourceContentFor =\n  function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n    if (!this.sourcesContent) {\n      return null;\n    }\n\n    if (this.sourceRoot != null) {\n      aSource = util.relative(this.sourceRoot, aSource);\n    }\n\n    if (this._sources.has(aSource)) {\n      return this.sourcesContent[this._sources.indexOf(aSource)];\n    }\n\n    var url;\n    if (this.sourceRoot != null\n        && (url = util.urlParse(this.sourceRoot))) {\n      // XXX: file:// URIs and absolute paths lead to unexpected behavior for\n      // many users. We can help them out when they expect file:// URIs to\n      // behave like it would if they were running a local HTTP server. See\n      // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.\n      var fileUriAbsPath = aSource.replace(/^file:\\/\\//, \"\");\n      if (url.scheme == \"file\"\n          && this._sources.has(fileUriAbsPath)) {\n        return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]\n      }\n\n      if ((!url.path || url.path == \"/\")\n          && this._sources.has(\"/\" + aSource)) {\n        return this.sourcesContent[this._sources.indexOf(\"/\" + aSource)];\n      }\n    }\n\n    // This function is used recursively from\n    // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we\n    // don't want to throw if we can't find the source - we just want to\n    // return null, so we provide a flag to exit gracefully.\n    if (nullOnMissing) {\n      return null;\n    }\n    else {\n      throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n    }\n  };\n\n/**\n * Returns the generated line and column information for the original source,\n * line, and column positions provided. The only argument is an object with\n * the following properties:\n *\n *   - source: The filename of the original source.\n *   - line: The line number in the original source.\n *   - column: The column number in the original source.\n *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n *     closest element that is smaller than or greater than the one we are\n *     searching for, respectively, if the exact element cannot be found.\n *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n *\n * and an object is returned with the following properties:\n *\n *   - line: The line number in the generated source, or null.\n *   - column: The column number in the generated source, or null.\n */\nBasicSourceMapConsumer.prototype.generatedPositionFor =\n  function SourceMapConsumer_generatedPositionFor(aArgs) {\n    var source = util.getArg(aArgs, 'source');\n    if (this.sourceRoot != null) {\n      source = util.relative(this.sourceRoot, source);\n    }\n    if (!this._sources.has(source)) {\n      return {\n        line: null,\n        column: null,\n        lastColumn: null\n      };\n    }\n    source = this._sources.indexOf(source);\n\n    var needle = {\n      source: source,\n      originalLine: util.getArg(aArgs, 'line'),\n      originalColumn: util.getArg(aArgs, 'column')\n    };\n\n    var index = this._findMapping(\n      needle,\n      this._originalMappings,\n      \"originalLine\",\n      \"originalColumn\",\n      util.compareByOriginalPositions,\n      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n    );\n\n    if (index >= 0) {\n      var mapping = this._originalMappings[index];\n\n      if (mapping.source === needle.source) {\n        return {\n          line: util.getArg(mapping, 'generatedLine', null),\n          column: util.getArg(mapping, 'generatedColumn', null),\n          lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n        };\n      }\n    }\n\n    return {\n      line: null,\n      column: null,\n      lastColumn: null\n    };\n  };\n\nexports.BasicSourceMapConsumer = BasicSourceMapConsumer;\n\n/**\n * An IndexedSourceMapConsumer instance represents a parsed source map which\n * we can query for information. It differs from BasicSourceMapConsumer in\n * that it takes \"indexed\" source maps (i.e. ones with a \"sections\" field) as\n * input.\n *\n * The only parameter is a raw source map (either as a JSON string, or already\n * parsed to an object). According to the spec for indexed source maps, they\n * have the following attributes:\n *\n *   - version: Which version of the source map spec this map is following.\n *   - file: Optional. The generated file this source map is associated with.\n *   - sections: A list of section definitions.\n *\n * Each value under the \"sections\" field has two fields:\n *   - offset: The offset into the original specified at which this section\n *       begins to apply, defined as an object with a \"line\" and \"column\"\n *       field.\n *   - map: A source map definition. This source map could also be indexed,\n *       but doesn't have to be.\n *\n * Instead of the \"map\" field, it's also possible to have a \"url\" field\n * specifying a URL to retrieve a source map from, but that's currently\n * unsupported.\n *\n * Here's an example source map, taken from the source map spec[0], but\n * modified to omit a section which uses the \"url\" field.\n *\n *  {\n *    version : 3,\n *    file: \"app.js\",\n *    sections: [{\n *      offset: {line:100, column:10},\n *      map: {\n *        version : 3,\n *        file: \"section.js\",\n *        sources: [\"foo.js\", \"bar.js\"],\n *        names: [\"src\", \"maps\", \"are\", \"fun\"],\n *        mappings: \"AAAA,E;;ABCDE;\"\n *      }\n *    }],\n *  }\n *\n * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt\n */\nfunction IndexedSourceMapConsumer(aSourceMap) {\n  var sourceMap = aSourceMap;\n  if (typeof aSourceMap === 'string') {\n    sourceMap = JSON.parse(aSourceMap.replace(/^\\)\\]\\}'/, ''));\n  }\n\n  var version = util.getArg(sourceMap, 'version');\n  var sections = util.getArg(sourceMap, 'sections');\n\n  if (version != this._version) {\n    throw new Error('Unsupported version: ' + version);\n  }\n\n  this._sources = new ArraySet();\n  this._names = new ArraySet();\n\n  var lastOffset = {\n    line: -1,\n    column: 0\n  };\n  this._sections = sections.map(function (s) {\n    if (s.url) {\n      // The url field will require support for asynchronicity.\n      // See https://github.com/mozilla/source-map/issues/16\n      throw new Error('Support for url field in sections not implemented.');\n    }\n    var offset = util.getArg(s, 'offset');\n    var offsetLine = util.getArg(offset, 'line');\n    var offsetColumn = util.getArg(offset, 'column');\n\n    if (offsetLine < lastOffset.line ||\n        (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {\n      throw new Error('Section offsets must be ordered and non-overlapping.');\n    }\n    lastOffset = offset;\n\n    return {\n      generatedOffset: {\n        // The offset fields are 0-based, but we use 1-based indices when\n        // encoding/decoding from VLQ.\n        generatedLine: offsetLine + 1,\n        generatedColumn: offsetColumn + 1\n      },\n      consumer: new SourceMapConsumer(util.getArg(s, 'map'))\n    }\n  });\n}\n\nIndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\nIndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nIndexedSourceMapConsumer.prototype._version = 3;\n\n/**\n * The list of original sources.\n */\nObject.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {\n  get: function () {\n    var sources = [];\n    for (var i = 0; i < this._sections.length; i++) {\n      for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {\n        sources.push(this._sections[i].consumer.sources[j]);\n      }\n    }\n    return sources;\n  }\n});\n\n/**\n * Returns the original source, line, and column information for the generated\n * source's line and column positions provided. The only argument is an object\n * with the following properties:\n *\n *   - line: The line number in the generated source.\n *   - column: The column number in the generated source.\n *\n * and an object is returned with the following properties:\n *\n *   - source: The original source file, or null.\n *   - line: The line number in the original source, or null.\n *   - column: The column number in the original source, or null.\n *   - name: The original identifier, or null.\n */\nIndexedSourceMapConsumer.prototype.originalPositionFor =\n  function IndexedSourceMapConsumer_originalPositionFor(aArgs) {\n    var needle = {\n      generatedLine: util.getArg(aArgs, 'line'),\n      generatedColumn: util.getArg(aArgs, 'column')\n    };\n\n    // Find the section containing the generated position we're trying to map\n    // to an original position.\n    var sectionIndex = binarySearch.search(needle, this._sections,\n      function(needle, section) {\n        var cmp = needle.generatedLine - section.generatedOffset.generatedLine;\n        if (cmp) {\n          return cmp;\n        }\n\n        return (needle.generatedColumn -\n                section.generatedOffset.generatedColumn);\n      });\n    var section = this._sections[sectionIndex];\n\n    if (!section) {\n      return {\n        source: null,\n        line: null,\n        column: null,\n        name: null\n      };\n    }\n\n    return section.consumer.originalPositionFor({\n      line: needle.generatedLine -\n        (section.generatedOffset.generatedLine - 1),\n      column: needle.generatedColumn -\n        (section.generatedOffset.generatedLine === needle.generatedLine\n         ? section.generatedOffset.generatedColumn - 1\n         : 0),\n      bias: aArgs.bias\n    });\n  };\n\n/**\n * Return true if we have the source content for every source in the source\n * map, false otherwise.\n */\nIndexedSourceMapConsumer.prototype.hasContentsOfAllSources =\n  function IndexedSourceMapConsumer_hasContentsOfAllSources() {\n    return this._sections.every(function (s) {\n      return s.consumer.hasContentsOfAllSources();\n    });\n  };\n\n/**\n * Returns the original source content. The only argument is the url of the\n * original source file. Returns null if no original source content is\n * available.\n */\nIndexedSourceMapConsumer.prototype.sourceContentFor =\n  function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n    for (var i = 0; i < this._sections.length; i++) {\n      var section = this._sections[i];\n\n      var content = section.consumer.sourceContentFor(aSource, true);\n      if (content) {\n        return content;\n      }\n    }\n    if (nullOnMissing) {\n      return null;\n    }\n    else {\n      throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n    }\n  };\n\n/**\n * Returns the generated line and column information for the original source,\n * line, and column positions provided. The only argument is an object with\n * the following properties:\n *\n *   - source: The filename of the original source.\n *   - line: The line number in the original source.\n *   - column: The column number in the original source.\n *\n * and an object is returned with the following properties:\n *\n *   - line: The line number in the generated source, or null.\n *   - column: The column number in the generated source, or null.\n */\nIndexedSourceMapConsumer.prototype.generatedPositionFor =\n  function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {\n    for (var i = 0; i < this._sections.length; i++) {\n      var section = this._sections[i];\n\n      // Only consider this section if the requested source is in the list of\n      // sources of the consumer.\n      if (section.consumer.sources.indexOf(util.getArg(aArgs, 'source')) === -1) {\n        continue;\n      }\n      var generatedPosition = section.consumer.generatedPositionFor(aArgs);\n      if (generatedPosition) {\n        var ret = {\n          line: generatedPosition.line +\n            (section.generatedOffset.generatedLine - 1),\n          column: generatedPosition.column +\n            (section.generatedOffset.generatedLine === generatedPosition.line\n             ? section.generatedOffset.generatedColumn - 1\n             : 0)\n        };\n        return ret;\n      }\n    }\n\n    return {\n      line: null,\n      column: null\n    };\n  };\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nIndexedSourceMapConsumer.prototype._parseMappings =\n  function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n    this.__generatedMappings = [];\n    this.__originalMappings = [];\n    for (var i = 0; i < this._sections.length; i++) {\n      var section = this._sections[i];\n      var sectionMappings = section.consumer._generatedMappings;\n      for (var j = 0; j < sectionMappings.length; j++) {\n        var mapping = sectionMappings[j];\n\n        var source = section.consumer._sources.at(mapping.source);\n        if (section.consumer.sourceRoot !== null) {\n          source = util.join(section.consumer.sourceRoot, source);\n        }\n        this._sources.add(source);\n        source = this._sources.indexOf(source);\n\n        var name = section.consumer._names.at(mapping.name);\n        this._names.add(name);\n        name = this._names.indexOf(name);\n\n        // The mappings coming from the consumer for the section have\n        // generated positions relative to the start of the section, so we\n        // need to offset them to be relative to the start of the concatenated\n        // generated file.\n        var adjustedMapping = {\n          source: source,\n          generatedLine: mapping.generatedLine +\n            (section.generatedOffset.generatedLine - 1),\n          generatedColumn: mapping.generatedColumn +\n            (section.generatedOffset.generatedLine === mapping.generatedLine\n            ? section.generatedOffset.generatedColumn - 1\n            : 0),\n          originalLine: mapping.originalLine,\n          originalColumn: mapping.originalColumn,\n          name: name\n        };\n\n        this.__generatedMappings.push(adjustedMapping);\n        if (typeof adjustedMapping.originalLine === 'number') {\n          this.__originalMappings.push(adjustedMapping);\n        }\n      }\n    }\n\n    quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);\n    quickSort(this.__originalMappings, util.compareByOriginalPositions);\n  };\n\nexports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-map-consumer.js\n// module id = 7\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nexports.GREATEST_LOWER_BOUND = 1;\nexports.LEAST_UPPER_BOUND = 2;\n\n/**\n * Recursive implementation of binary search.\n *\n * @param aLow Indices here and lower do not contain the needle.\n * @param aHigh Indices here and higher do not contain the needle.\n * @param aNeedle The element being searched for.\n * @param aHaystack The non-empty array being searched.\n * @param aCompare Function which takes two elements and returns -1, 0, or 1.\n * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n *     closest element that is smaller than or greater than the one we are\n *     searching for, respectively, if the exact element cannot be found.\n */\nfunction recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {\n  // This function terminates when one of the following is true:\n  //\n  //   1. We find the exact element we are looking for.\n  //\n  //   2. We did not find the exact element, but we can return the index of\n  //      the next-closest element.\n  //\n  //   3. We did not find the exact element, and there is no next-closest\n  //      element than the one we are searching for, so we return -1.\n  var mid = Math.floor((aHigh - aLow) / 2) + aLow;\n  var cmp = aCompare(aNeedle, aHaystack[mid], true);\n  if (cmp === 0) {\n    // Found the element we are looking for.\n    return mid;\n  }\n  else if (cmp > 0) {\n    // Our needle is greater than aHaystack[mid].\n    if (aHigh - mid > 1) {\n      // The element is in the upper half.\n      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);\n    }\n\n    // The exact needle element was not found in this haystack. Determine if\n    // we are in termination case (3) or (2) and return the appropriate thing.\n    if (aBias == exports.LEAST_UPPER_BOUND) {\n      return aHigh < aHaystack.length ? aHigh : -1;\n    } else {\n      return mid;\n    }\n  }\n  else {\n    // Our needle is less than aHaystack[mid].\n    if (mid - aLow > 1) {\n      // The element is in the lower half.\n      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);\n    }\n\n    // we are in termination case (3) or (2) and return the appropriate thing.\n    if (aBias == exports.LEAST_UPPER_BOUND) {\n      return mid;\n    } else {\n      return aLow < 0 ? -1 : aLow;\n    }\n  }\n}\n\n/**\n * This is an implementation of binary search which will always try and return\n * the index of the closest element if there is no exact hit. This is because\n * mappings between original and generated line/col pairs are single points,\n * and there is an implicit region between each of them, so a miss just means\n * that you aren't on the very start of a region.\n *\n * @param aNeedle The element you are looking for.\n * @param aHaystack The array that is being searched.\n * @param aCompare A function which takes the needle and an element in the\n *     array and returns -1, 0, or 1 depending on whether the needle is less\n *     than, equal to, or greater than the element, respectively.\n * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n *     closest element that is smaller than or greater than the one we are\n *     searching for, respectively, if the exact element cannot be found.\n *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.\n */\nexports.search = function search(aNeedle, aHaystack, aCompare, aBias) {\n  if (aHaystack.length === 0) {\n    return -1;\n  }\n\n  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,\n                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);\n  if (index < 0) {\n    return -1;\n  }\n\n  // We have found either the exact element, or the next-closest element than\n  // the one we are searching for. However, there may be more than one such\n  // element. Make sure we always return the smallest of these.\n  while (index - 1 >= 0) {\n    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {\n      break;\n    }\n    --index;\n  }\n\n  return index;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/binary-search.js\n// module id = 8\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\n// It turns out that some (most?) JavaScript engines don't self-host\n// `Array.prototype.sort`. This makes sense because C++ will likely remain\n// faster than JS when doing raw CPU-intensive sorting. However, when using a\n// custom comparator function, calling back and forth between the VM's C++ and\n// JIT'd JS is rather slow *and* loses JIT type information, resulting in\n// worse generated code for the comparator function than would be optimal. In\n// fact, when sorting with a comparator, these costs outweigh the benefits of\n// sorting in C++. By using our own JS-implemented Quick Sort (below), we get\n// a ~3500ms mean speed-up in `bench/bench.html`.\n\n/**\n * Swap the elements indexed by `x` and `y` in the array `ary`.\n *\n * @param {Array} ary\n *        The array.\n * @param {Number} x\n *        The index of the first item.\n * @param {Number} y\n *        The index of the second item.\n */\nfunction swap(ary, x, y) {\n  var temp = ary[x];\n  ary[x] = ary[y];\n  ary[y] = temp;\n}\n\n/**\n * Returns a random integer within the range `low .. high` inclusive.\n *\n * @param {Number} low\n *        The lower bound on the range.\n * @param {Number} high\n *        The upper bound on the range.\n */\nfunction randomIntInRange(low, high) {\n  return Math.round(low + (Math.random() * (high - low)));\n}\n\n/**\n * The Quick Sort algorithm.\n *\n * @param {Array} ary\n *        An array to sort.\n * @param {function} comparator\n *        Function to use to compare two items.\n * @param {Number} p\n *        Start index of the array\n * @param {Number} r\n *        End index of the array\n */\nfunction doQuickSort(ary, comparator, p, r) {\n  // If our lower bound is less than our upper bound, we (1) partition the\n  // array into two pieces and (2) recurse on each half. If it is not, this is\n  // the empty array and our base case.\n\n  if (p < r) {\n    // (1) Partitioning.\n    //\n    // The partitioning chooses a pivot between `p` and `r` and moves all\n    // elements that are less than or equal to the pivot to the before it, and\n    // all the elements that are greater than it after it. The effect is that\n    // once partition is done, the pivot is in the exact place it will be when\n    // the array is put in sorted order, and it will not need to be moved\n    // again. This runs in O(n) time.\n\n    // Always choose a random pivot so that an input array which is reverse\n    // sorted does not cause O(n^2) running time.\n    var pivotIndex = randomIntInRange(p, r);\n    var i = p - 1;\n\n    swap(ary, pivotIndex, r);\n    var pivot = ary[r];\n\n    // Immediately after `j` is incremented in this loop, the following hold\n    // true:\n    //\n    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.\n    //\n    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.\n    for (var j = p; j < r; j++) {\n      if (comparator(ary[j], pivot) <= 0) {\n        i += 1;\n        swap(ary, i, j);\n      }\n    }\n\n    swap(ary, i + 1, j);\n    var q = i + 1;\n\n    // (2) Recurse on each half.\n\n    doQuickSort(ary, comparator, p, q - 1);\n    doQuickSort(ary, comparator, q + 1, r);\n  }\n}\n\n/**\n * Sort the given array in-place with the given comparator function.\n *\n * @param {Array} ary\n *        An array to sort.\n * @param {function} comparator\n *        Function to use to compare two items.\n */\nexports.quickSort = function (ary, comparator) {\n  doQuickSort(ary, comparator, 0, ary.length - 1);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/quick-sort.js\n// module id = 9\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;\nvar util = require('./util');\n\n// Matches a Windows-style `\\r\\n` newline or a `\\n` newline used by all other\n// operating systems these days (capturing the result).\nvar REGEX_NEWLINE = /(\\r?\\n)/;\n\n// Newline character code for charCodeAt() comparisons\nvar NEWLINE_CODE = 10;\n\n// Private symbol for identifying `SourceNode`s when multiple versions of\n// the source-map library are loaded. This MUST NOT CHANGE across\n// versions!\nvar isSourceNode = \"$$$isSourceNode$$$\";\n\n/**\n * SourceNodes provide a way to abstract over interpolating/concatenating\n * snippets of generated JavaScript source code while maintaining the line and\n * column information associated with the original source code.\n *\n * @param aLine The original line number.\n * @param aColumn The original column number.\n * @param aSource The original source's filename.\n * @param aChunks Optional. An array of strings which are snippets of\n *        generated JS, or other SourceNodes.\n * @param aName The original identifier.\n */\nfunction SourceNode(aLine, aColumn, aSource, aChunks, aName) {\n  this.children = [];\n  this.sourceContents = {};\n  this.line = aLine == null ? null : aLine;\n  this.column = aColumn == null ? null : aColumn;\n  this.source = aSource == null ? null : aSource;\n  this.name = aName == null ? null : aName;\n  this[isSourceNode] = true;\n  if (aChunks != null) this.add(aChunks);\n}\n\n/**\n * Creates a SourceNode from generated code and a SourceMapConsumer.\n *\n * @param aGeneratedCode The generated code\n * @param aSourceMapConsumer The SourceMap for the generated code\n * @param aRelativePath Optional. The path that relative sources in the\n *        SourceMapConsumer should be relative to.\n */\nSourceNode.fromStringWithSourceMap =\n  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {\n    // The SourceNode we want to fill with the generated code\n    // and the SourceMap\n    var node = new SourceNode();\n\n    // All even indices of this array are one line of the generated code,\n    // while all odd indices are the newlines between two adjacent lines\n    // (since `REGEX_NEWLINE` captures its match).\n    // Processed fragments are accessed by calling `shiftNextLine`.\n    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);\n    var remainingLinesIndex = 0;\n    var shiftNextLine = function() {\n      var lineContents = getNextLine();\n      // The last line of a file might not have a newline.\n      var newLine = getNextLine() || \"\";\n      return lineContents + newLine;\n\n      function getNextLine() {\n        return remainingLinesIndex < remainingLines.length ?\n            remainingLines[remainingLinesIndex++] : undefined;\n      }\n    };\n\n    // We need to remember the position of \"remainingLines\"\n    var lastGeneratedLine = 1, lastGeneratedColumn = 0;\n\n    // The generate SourceNodes we need a code range.\n    // To extract it current and last mapping is used.\n    // Here we store the last mapping.\n    var lastMapping = null;\n\n    aSourceMapConsumer.eachMapping(function (mapping) {\n      if (lastMapping !== null) {\n        // We add the code from \"lastMapping\" to \"mapping\":\n        // First check if there is a new line in between.\n        if (lastGeneratedLine < mapping.generatedLine) {\n          // Associate first line with \"lastMapping\"\n          addMappingWithCode(lastMapping, shiftNextLine());\n          lastGeneratedLine++;\n          lastGeneratedColumn = 0;\n          // The remaining code is added without mapping\n        } else {\n          // There is no new line in between.\n          // Associate the code between \"lastGeneratedColumn\" and\n          // \"mapping.generatedColumn\" with \"lastMapping\"\n          var nextLine = remainingLines[remainingLinesIndex];\n          var code = nextLine.substr(0, mapping.generatedColumn -\n                                        lastGeneratedColumn);\n          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -\n                                              lastGeneratedColumn);\n          lastGeneratedColumn = mapping.generatedColumn;\n          addMappingWithCode(lastMapping, code);\n          // No more remaining code, continue\n          lastMapping = mapping;\n          return;\n        }\n      }\n      // We add the generated code until the first mapping\n      // to the SourceNode without any mapping.\n      // Each line is added as separate string.\n      while (lastGeneratedLine < mapping.generatedLine) {\n        node.add(shiftNextLine());\n        lastGeneratedLine++;\n      }\n      if (lastGeneratedColumn < mapping.generatedColumn) {\n        var nextLine = remainingLines[remainingLinesIndex];\n        node.add(nextLine.substr(0, mapping.generatedColumn));\n        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);\n        lastGeneratedColumn = mapping.generatedColumn;\n      }\n      lastMapping = mapping;\n    }, this);\n    // We have processed all mappings.\n    if (remainingLinesIndex < remainingLines.length) {\n      if (lastMapping) {\n        // Associate the remaining code in the current line with \"lastMapping\"\n        addMappingWithCode(lastMapping, shiftNextLine());\n      }\n      // and add the remaining lines without any mapping\n      node.add(remainingLines.splice(remainingLinesIndex).join(\"\"));\n    }\n\n    // Copy sourcesContent into SourceNode\n    aSourceMapConsumer.sources.forEach(function (sourceFile) {\n      var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n      if (content != null) {\n        if (aRelativePath != null) {\n          sourceFile = util.join(aRelativePath, sourceFile);\n        }\n        node.setSourceContent(sourceFile, content);\n      }\n    });\n\n    return node;\n\n    function addMappingWithCode(mapping, code) {\n      if (mapping === null || mapping.source === undefined) {\n        node.add(code);\n      } else {\n        var source = aRelativePath\n          ? util.join(aRelativePath, mapping.source)\n          : mapping.source;\n        node.add(new SourceNode(mapping.originalLine,\n                                mapping.originalColumn,\n                                source,\n                                code,\n                                mapping.name));\n      }\n    }\n  };\n\n/**\n * Add a chunk of generated JS to this source node.\n *\n * @param aChunk A string snippet of generated JS code, another instance of\n *        SourceNode, or an array where each member is one of those things.\n */\nSourceNode.prototype.add = function SourceNode_add(aChunk) {\n  if (Array.isArray(aChunk)) {\n    aChunk.forEach(function (chunk) {\n      this.add(chunk);\n    }, this);\n  }\n  else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n    if (aChunk) {\n      this.children.push(aChunk);\n    }\n  }\n  else {\n    throw new TypeError(\n      \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n    );\n  }\n  return this;\n};\n\n/**\n * Add a chunk of generated JS to the beginning of this source node.\n *\n * @param aChunk A string snippet of generated JS code, another instance of\n *        SourceNode, or an array where each member is one of those things.\n */\nSourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {\n  if (Array.isArray(aChunk)) {\n    for (var i = aChunk.length-1; i >= 0; i--) {\n      this.prepend(aChunk[i]);\n    }\n  }\n  else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n    this.children.unshift(aChunk);\n  }\n  else {\n    throw new TypeError(\n      \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n    );\n  }\n  return this;\n};\n\n/**\n * Walk over the tree of JS snippets in this node and its children. The\n * walking function is called once for each snippet of JS and is passed that\n * snippet and the its original associated source's line/column location.\n *\n * @param aFn The traversal function.\n */\nSourceNode.prototype.walk = function SourceNode_walk(aFn) {\n  var chunk;\n  for (var i = 0, len = this.children.length; i < len; i++) {\n    chunk = this.children[i];\n    if (chunk[isSourceNode]) {\n      chunk.walk(aFn);\n    }\n    else {\n      if (chunk !== '') {\n        aFn(chunk, { source: this.source,\n                     line: this.line,\n                     column: this.column,\n                     name: this.name });\n      }\n    }\n  }\n};\n\n/**\n * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between\n * each of `this.children`.\n *\n * @param aSep The separator.\n */\nSourceNode.prototype.join = function SourceNode_join(aSep) {\n  var newChildren;\n  var i;\n  var len = this.children.length;\n  if (len > 0) {\n    newChildren = [];\n    for (i = 0; i < len-1; i++) {\n      newChildren.push(this.children[i]);\n      newChildren.push(aSep);\n    }\n    newChildren.push(this.children[i]);\n    this.children = newChildren;\n  }\n  return this;\n};\n\n/**\n * Call String.prototype.replace on the very right-most source snippet. Useful\n * for trimming whitespace from the end of a source node, etc.\n *\n * @param aPattern The pattern to replace.\n * @param aReplacement The thing to replace the pattern with.\n */\nSourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {\n  var lastChild = this.children[this.children.length - 1];\n  if (lastChild[isSourceNode]) {\n    lastChild.replaceRight(aPattern, aReplacement);\n  }\n  else if (typeof lastChild === 'string') {\n    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);\n  }\n  else {\n    this.children.push(''.replace(aPattern, aReplacement));\n  }\n  return this;\n};\n\n/**\n * Set the source content for a source file. This will be added to the SourceMapGenerator\n * in the sourcesContent field.\n *\n * @param aSourceFile The filename of the source file\n * @param aSourceContent The content of the source file\n */\nSourceNode.prototype.setSourceContent =\n  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {\n    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;\n  };\n\n/**\n * Walk over the tree of SourceNodes. The walking function is called for each\n * source file content and is passed the filename and source content.\n *\n * @param aFn The traversal function.\n */\nSourceNode.prototype.walkSourceContents =\n  function SourceNode_walkSourceContents(aFn) {\n    for (var i = 0, len = this.children.length; i < len; i++) {\n      if (this.children[i][isSourceNode]) {\n        this.children[i].walkSourceContents(aFn);\n      }\n    }\n\n    var sources = Object.keys(this.sourceContents);\n    for (var i = 0, len = sources.length; i < len; i++) {\n      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);\n    }\n  };\n\n/**\n * Return the string representation of this source node. Walks over the tree\n * and concatenates all the various snippets together to one string.\n */\nSourceNode.prototype.toString = function SourceNode_toString() {\n  var str = \"\";\n  this.walk(function (chunk) {\n    str += chunk;\n  });\n  return str;\n};\n\n/**\n * Returns the string representation of this source node along with a source\n * map.\n */\nSourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {\n  var generated = {\n    code: \"\",\n    line: 1,\n    column: 0\n  };\n  var map = new SourceMapGenerator(aArgs);\n  var sourceMappingActive = false;\n  var lastOriginalSource = null;\n  var lastOriginalLine = null;\n  var lastOriginalColumn = null;\n  var lastOriginalName = null;\n  this.walk(function (chunk, original) {\n    generated.code += chunk;\n    if (original.source !== null\n        && original.line !== null\n        && original.column !== null) {\n      if(lastOriginalSource !== original.source\n         || lastOriginalLine !== original.line\n         || lastOriginalColumn !== original.column\n         || lastOriginalName !== original.name) {\n        map.addMapping({\n          source: original.source,\n          original: {\n            line: original.line,\n            column: original.column\n          },\n          generated: {\n            line: generated.line,\n            column: generated.column\n          },\n          name: original.name\n        });\n      }\n      lastOriginalSource = original.source;\n      lastOriginalLine = original.line;\n      lastOriginalColumn = original.column;\n      lastOriginalName = original.name;\n      sourceMappingActive = true;\n    } else if (sourceMappingActive) {\n      map.addMapping({\n        generated: {\n          line: generated.line,\n          column: generated.column\n        }\n      });\n      lastOriginalSource = null;\n      sourceMappingActive = false;\n    }\n    for (var idx = 0, length = chunk.length; idx < length; idx++) {\n      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {\n        generated.line++;\n        generated.column = 0;\n        // Mappings end at eol\n        if (idx + 1 === length) {\n          lastOriginalSource = null;\n          sourceMappingActive = false;\n        } else if (sourceMappingActive) {\n          map.addMapping({\n            source: original.source,\n            original: {\n              line: original.line,\n              column: original.column\n            },\n            generated: {\n              line: generated.line,\n              column: generated.column\n            },\n            name: original.name\n          });\n        }\n      } else {\n        generated.column++;\n      }\n    }\n  });\n  this.walkSourceContents(function (sourceFile, sourceContent) {\n    map.setSourceContent(sourceFile, sourceContent);\n  });\n\n  return { code: generated.code, map: map };\n};\n\nexports.SourceNode = SourceNode;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-node.js\n// module id = 10\n// module chunks = 0"],"sourceRoot":""}
\ No newline at end of file
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/array-set.js b/node_modules/@babel/core/node_modules/source-map/lib/array-set.js
new file mode 100644
index 00000000..fbd5c81c
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/array-set.js
@@ -0,0 +1,121 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+var has = Object.prototype.hasOwnProperty;
+var hasNativeMap = typeof Map !== "undefined";
+
+/**
+ * A data structure which is a combination of an array and a set. Adding a new
+ * member is O(1), testing for membership is O(1), and finding the index of an
+ * element is O(1). Removing elements from the set is not supported. Only
+ * strings are supported for membership.
+ */
+function ArraySet() {
+  this._array = [];
+  this._set = hasNativeMap ? new Map() : Object.create(null);
+}
+
+/**
+ * Static method for creating ArraySet instances from an existing array.
+ */
+ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {
+  var set = new ArraySet();
+  for (var i = 0, len = aArray.length; i < len; i++) {
+    set.add(aArray[i], aAllowDuplicates);
+  }
+  return set;
+};
+
+/**
+ * Return how many unique items are in this ArraySet. If duplicates have been
+ * added, than those do not count towards the size.
+ *
+ * @returns Number
+ */
+ArraySet.prototype.size = function ArraySet_size() {
+  return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;
+};
+
+/**
+ * Add the given string to this set.
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {
+  var sStr = hasNativeMap ? aStr : util.toSetString(aStr);
+  var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);
+  var idx = this._array.length;
+  if (!isDuplicate || aAllowDuplicates) {
+    this._array.push(aStr);
+  }
+  if (!isDuplicate) {
+    if (hasNativeMap) {
+      this._set.set(aStr, idx);
+    } else {
+      this._set[sStr] = idx;
+    }
+  }
+};
+
+/**
+ * Is the given string a member of this set?
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.has = function ArraySet_has(aStr) {
+  if (hasNativeMap) {
+    return this._set.has(aStr);
+  } else {
+    var sStr = util.toSetString(aStr);
+    return has.call(this._set, sStr);
+  }
+};
+
+/**
+ * What is the index of the given string in the array?
+ *
+ * @param String aStr
+ */
+ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {
+  if (hasNativeMap) {
+    var idx = this._set.get(aStr);
+    if (idx >= 0) {
+        return idx;
+    }
+  } else {
+    var sStr = util.toSetString(aStr);
+    if (has.call(this._set, sStr)) {
+      return this._set[sStr];
+    }
+  }
+
+  throw new Error('"' + aStr + '" is not in the set.');
+};
+
+/**
+ * What is the element at the given index?
+ *
+ * @param Number aIdx
+ */
+ArraySet.prototype.at = function ArraySet_at(aIdx) {
+  if (aIdx >= 0 && aIdx < this._array.length) {
+    return this._array[aIdx];
+  }
+  throw new Error('No element indexed by ' + aIdx);
+};
+
+/**
+ * Returns the array representation of this set (which has the proper indices
+ * indicated by indexOf). Note that this is a copy of the internal array used
+ * for storing the members so that no one can mess with internal state.
+ */
+ArraySet.prototype.toArray = function ArraySet_toArray() {
+  return this._array.slice();
+};
+
+exports.ArraySet = ArraySet;
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/base64-vlq.js b/node_modules/@babel/core/node_modules/source-map/lib/base64-vlq.js
new file mode 100644
index 00000000..612b4040
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/base64-vlq.js
@@ -0,0 +1,140 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ *
+ * Based on the Base 64 VLQ implementation in Closure Compiler:
+ * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java
+ *
+ * Copyright 2011 The Closure Compiler Authors. All rights reserved.
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions are
+ * met:
+ *
+ *  * Redistributions of source code must retain the above copyright
+ *    notice, this list of conditions and the following disclaimer.
+ *  * Redistributions in binary form must reproduce the above
+ *    copyright notice, this list of conditions and the following
+ *    disclaimer in the documentation and/or other materials provided
+ *    with the distribution.
+ *  * Neither the name of Google Inc. nor the names of its
+ *    contributors may be used to endorse or promote products derived
+ *    from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+ * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+ * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+ * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+ * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,
+ * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT
+ * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+var base64 = require('./base64');
+
+// A single base 64 digit can contain 6 bits of data. For the base 64 variable
+// length quantities we use in the source map spec, the first bit is the sign,
+// the next four bits are the actual value, and the 6th bit is the
+// continuation bit. The continuation bit tells us whether there are more
+// digits in this value following this digit.
+//
+//   Continuation
+//   |    Sign
+//   |    |
+//   V    V
+//   101011
+
+var VLQ_BASE_SHIFT = 5;
+
+// binary: 100000
+var VLQ_BASE = 1 << VLQ_BASE_SHIFT;
+
+// binary: 011111
+var VLQ_BASE_MASK = VLQ_BASE - 1;
+
+// binary: 100000
+var VLQ_CONTINUATION_BIT = VLQ_BASE;
+
+/**
+ * Converts from a two-complement value to a value where the sign bit is
+ * placed in the least significant bit.  For example, as decimals:
+ *   1 becomes 2 (10 binary), -1 becomes 3 (11 binary)
+ *   2 becomes 4 (100 binary), -2 becomes 5 (101 binary)
+ */
+function toVLQSigned(aValue) {
+  return aValue < 0
+    ? ((-aValue) << 1) + 1
+    : (aValue << 1) + 0;
+}
+
+/**
+ * Converts to a two-complement value from a value where the sign bit is
+ * placed in the least significant bit.  For example, as decimals:
+ *   2 (10 binary) becomes 1, 3 (11 binary) becomes -1
+ *   4 (100 binary) becomes 2, 5 (101 binary) becomes -2
+ */
+function fromVLQSigned(aValue) {
+  var isNegative = (aValue & 1) === 1;
+  var shifted = aValue >> 1;
+  return isNegative
+    ? -shifted
+    : shifted;
+}
+
+/**
+ * Returns the base 64 VLQ encoded value.
+ */
+exports.encode = function base64VLQ_encode(aValue) {
+  var encoded = "";
+  var digit;
+
+  var vlq = toVLQSigned(aValue);
+
+  do {
+    digit = vlq & VLQ_BASE_MASK;
+    vlq >>>= VLQ_BASE_SHIFT;
+    if (vlq > 0) {
+      // There are still more digits in this value, so we must make sure the
+      // continuation bit is marked.
+      digit |= VLQ_CONTINUATION_BIT;
+    }
+    encoded += base64.encode(digit);
+  } while (vlq > 0);
+
+  return encoded;
+};
+
+/**
+ * Decodes the next base 64 VLQ value from the given string and returns the
+ * value and the rest of the string via the out parameter.
+ */
+exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {
+  var strLen = aStr.length;
+  var result = 0;
+  var shift = 0;
+  var continuation, digit;
+
+  do {
+    if (aIndex >= strLen) {
+      throw new Error("Expected more digits in base 64 VLQ value.");
+    }
+
+    digit = base64.decode(aStr.charCodeAt(aIndex++));
+    if (digit === -1) {
+      throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1));
+    }
+
+    continuation = !!(digit & VLQ_CONTINUATION_BIT);
+    digit &= VLQ_BASE_MASK;
+    result = result + (digit << shift);
+    shift += VLQ_BASE_SHIFT;
+  } while (continuation);
+
+  aOutParam.value = fromVLQSigned(result);
+  aOutParam.rest = aIndex;
+};
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/base64.js b/node_modules/@babel/core/node_modules/source-map/lib/base64.js
new file mode 100644
index 00000000..8aa86b30
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/base64.js
@@ -0,0 +1,67 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');
+
+/**
+ * Encode an integer in the range of 0 to 63 to a single base 64 digit.
+ */
+exports.encode = function (number) {
+  if (0 <= number && number < intToCharMap.length) {
+    return intToCharMap[number];
+  }
+  throw new TypeError("Must be between 0 and 63: " + number);
+};
+
+/**
+ * Decode a single base 64 character code digit to an integer. Returns -1 on
+ * failure.
+ */
+exports.decode = function (charCode) {
+  var bigA = 65;     // 'A'
+  var bigZ = 90;     // 'Z'
+
+  var littleA = 97;  // 'a'
+  var littleZ = 122; // 'z'
+
+  var zero = 48;     // '0'
+  var nine = 57;     // '9'
+
+  var plus = 43;     // '+'
+  var slash = 47;    // '/'
+
+  var littleOffset = 26;
+  var numberOffset = 52;
+
+  // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ
+  if (bigA <= charCode && charCode <= bigZ) {
+    return (charCode - bigA);
+  }
+
+  // 26 - 51: abcdefghijklmnopqrstuvwxyz
+  if (littleA <= charCode && charCode <= littleZ) {
+    return (charCode - littleA + littleOffset);
+  }
+
+  // 52 - 61: 0123456789
+  if (zero <= charCode && charCode <= nine) {
+    return (charCode - zero + numberOffset);
+  }
+
+  // 62: +
+  if (charCode == plus) {
+    return 62;
+  }
+
+  // 63: /
+  if (charCode == slash) {
+    return 63;
+  }
+
+  // Invalid base64 digit.
+  return -1;
+};
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/binary-search.js b/node_modules/@babel/core/node_modules/source-map/lib/binary-search.js
new file mode 100644
index 00000000..010ac941
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/binary-search.js
@@ -0,0 +1,111 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+exports.GREATEST_LOWER_BOUND = 1;
+exports.LEAST_UPPER_BOUND = 2;
+
+/**
+ * Recursive implementation of binary search.
+ *
+ * @param aLow Indices here and lower do not contain the needle.
+ * @param aHigh Indices here and higher do not contain the needle.
+ * @param aNeedle The element being searched for.
+ * @param aHaystack The non-empty array being searched.
+ * @param aCompare Function which takes two elements and returns -1, 0, or 1.
+ * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+ *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ */
+function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {
+  // This function terminates when one of the following is true:
+  //
+  //   1. We find the exact element we are looking for.
+  //
+  //   2. We did not find the exact element, but we can return the index of
+  //      the next-closest element.
+  //
+  //   3. We did not find the exact element, and there is no next-closest
+  //      element than the one we are searching for, so we return -1.
+  var mid = Math.floor((aHigh - aLow) / 2) + aLow;
+  var cmp = aCompare(aNeedle, aHaystack[mid], true);
+  if (cmp === 0) {
+    // Found the element we are looking for.
+    return mid;
+  }
+  else if (cmp > 0) {
+    // Our needle is greater than aHaystack[mid].
+    if (aHigh - mid > 1) {
+      // The element is in the upper half.
+      return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);
+    }
+
+    // The exact needle element was not found in this haystack. Determine if
+    // we are in termination case (3) or (2) and return the appropriate thing.
+    if (aBias == exports.LEAST_UPPER_BOUND) {
+      return aHigh < aHaystack.length ? aHigh : -1;
+    } else {
+      return mid;
+    }
+  }
+  else {
+    // Our needle is less than aHaystack[mid].
+    if (mid - aLow > 1) {
+      // The element is in the lower half.
+      return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);
+    }
+
+    // we are in termination case (3) or (2) and return the appropriate thing.
+    if (aBias == exports.LEAST_UPPER_BOUND) {
+      return mid;
+    } else {
+      return aLow < 0 ? -1 : aLow;
+    }
+  }
+}
+
+/**
+ * This is an implementation of binary search which will always try and return
+ * the index of the closest element if there is no exact hit. This is because
+ * mappings between original and generated line/col pairs are single points,
+ * and there is an implicit region between each of them, so a miss just means
+ * that you aren't on the very start of a region.
+ *
+ * @param aNeedle The element you are looking for.
+ * @param aHaystack The array that is being searched.
+ * @param aCompare A function which takes the needle and an element in the
+ *     array and returns -1, 0, or 1 depending on whether the needle is less
+ *     than, equal to, or greater than the element, respectively.
+ * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or
+ *     'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ *     Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.
+ */
+exports.search = function search(aNeedle, aHaystack, aCompare, aBias) {
+  if (aHaystack.length === 0) {
+    return -1;
+  }
+
+  var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,
+                              aCompare, aBias || exports.GREATEST_LOWER_BOUND);
+  if (index < 0) {
+    return -1;
+  }
+
+  // We have found either the exact element, or the next-closest element than
+  // the one we are searching for. However, there may be more than one such
+  // element. Make sure we always return the smallest of these.
+  while (index - 1 >= 0) {
+    if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {
+      break;
+    }
+    --index;
+  }
+
+  return index;
+};
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/mapping-list.js b/node_modules/@babel/core/node_modules/source-map/lib/mapping-list.js
new file mode 100644
index 00000000..06d1274a
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/mapping-list.js
@@ -0,0 +1,79 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2014 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+
+/**
+ * Determine whether mappingB is after mappingA with respect to generated
+ * position.
+ */
+function generatedPositionAfter(mappingA, mappingB) {
+  // Optimized for most common case
+  var lineA = mappingA.generatedLine;
+  var lineB = mappingB.generatedLine;
+  var columnA = mappingA.generatedColumn;
+  var columnB = mappingB.generatedColumn;
+  return lineB > lineA || lineB == lineA && columnB >= columnA ||
+         util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;
+}
+
+/**
+ * A data structure to provide a sorted view of accumulated mappings in a
+ * performance conscious manner. It trades a neglibable overhead in general
+ * case for a large speedup in case of mappings being added in order.
+ */
+function MappingList() {
+  this._array = [];
+  this._sorted = true;
+  // Serves as infimum
+  this._last = {generatedLine: -1, generatedColumn: 0};
+}
+
+/**
+ * Iterate through internal items. This method takes the same arguments that
+ * `Array.prototype.forEach` takes.
+ *
+ * NOTE: The order of the mappings is NOT guaranteed.
+ */
+MappingList.prototype.unsortedForEach =
+  function MappingList_forEach(aCallback, aThisArg) {
+    this._array.forEach(aCallback, aThisArg);
+  };
+
+/**
+ * Add the given source mapping.
+ *
+ * @param Object aMapping
+ */
+MappingList.prototype.add = function MappingList_add(aMapping) {
+  if (generatedPositionAfter(this._last, aMapping)) {
+    this._last = aMapping;
+    this._array.push(aMapping);
+  } else {
+    this._sorted = false;
+    this._array.push(aMapping);
+  }
+};
+
+/**
+ * Returns the flat, sorted array of mappings. The mappings are sorted by
+ * generated position.
+ *
+ * WARNING: This method returns internal data without copying, for
+ * performance. The return value must NOT be mutated, and should be treated as
+ * an immutable borrow. If you want to take ownership, you must make your own
+ * copy.
+ */
+MappingList.prototype.toArray = function MappingList_toArray() {
+  if (!this._sorted) {
+    this._array.sort(util.compareByGeneratedPositionsInflated);
+    this._sorted = true;
+  }
+  return this._array;
+};
+
+exports.MappingList = MappingList;
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/quick-sort.js b/node_modules/@babel/core/node_modules/source-map/lib/quick-sort.js
new file mode 100644
index 00000000..6a7caadb
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/quick-sort.js
@@ -0,0 +1,114 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+// It turns out that some (most?) JavaScript engines don't self-host
+// `Array.prototype.sort`. This makes sense because C++ will likely remain
+// faster than JS when doing raw CPU-intensive sorting. However, when using a
+// custom comparator function, calling back and forth between the VM's C++ and
+// JIT'd JS is rather slow *and* loses JIT type information, resulting in
+// worse generated code for the comparator function than would be optimal. In
+// fact, when sorting with a comparator, these costs outweigh the benefits of
+// sorting in C++. By using our own JS-implemented Quick Sort (below), we get
+// a ~3500ms mean speed-up in `bench/bench.html`.
+
+/**
+ * Swap the elements indexed by `x` and `y` in the array `ary`.
+ *
+ * @param {Array} ary
+ *        The array.
+ * @param {Number} x
+ *        The index of the first item.
+ * @param {Number} y
+ *        The index of the second item.
+ */
+function swap(ary, x, y) {
+  var temp = ary[x];
+  ary[x] = ary[y];
+  ary[y] = temp;
+}
+
+/**
+ * Returns a random integer within the range `low .. high` inclusive.
+ *
+ * @param {Number} low
+ *        The lower bound on the range.
+ * @param {Number} high
+ *        The upper bound on the range.
+ */
+function randomIntInRange(low, high) {
+  return Math.round(low + (Math.random() * (high - low)));
+}
+
+/**
+ * The Quick Sort algorithm.
+ *
+ * @param {Array} ary
+ *        An array to sort.
+ * @param {function} comparator
+ *        Function to use to compare two items.
+ * @param {Number} p
+ *        Start index of the array
+ * @param {Number} r
+ *        End index of the array
+ */
+function doQuickSort(ary, comparator, p, r) {
+  // If our lower bound is less than our upper bound, we (1) partition the
+  // array into two pieces and (2) recurse on each half. If it is not, this is
+  // the empty array and our base case.
+
+  if (p < r) {
+    // (1) Partitioning.
+    //
+    // The partitioning chooses a pivot between `p` and `r` and moves all
+    // elements that are less than or equal to the pivot to the before it, and
+    // all the elements that are greater than it after it. The effect is that
+    // once partition is done, the pivot is in the exact place it will be when
+    // the array is put in sorted order, and it will not need to be moved
+    // again. This runs in O(n) time.
+
+    // Always choose a random pivot so that an input array which is reverse
+    // sorted does not cause O(n^2) running time.
+    var pivotIndex = randomIntInRange(p, r);
+    var i = p - 1;
+
+    swap(ary, pivotIndex, r);
+    var pivot = ary[r];
+
+    // Immediately after `j` is incremented in this loop, the following hold
+    // true:
+    //
+    //   * Every element in `ary[p .. i]` is less than or equal to the pivot.
+    //
+    //   * Every element in `ary[i+1 .. j-1]` is greater than the pivot.
+    for (var j = p; j < r; j++) {
+      if (comparator(ary[j], pivot) <= 0) {
+        i += 1;
+        swap(ary, i, j);
+      }
+    }
+
+    swap(ary, i + 1, j);
+    var q = i + 1;
+
+    // (2) Recurse on each half.
+
+    doQuickSort(ary, comparator, p, q - 1);
+    doQuickSort(ary, comparator, q + 1, r);
+  }
+}
+
+/**
+ * Sort the given array in-place with the given comparator function.
+ *
+ * @param {Array} ary
+ *        An array to sort.
+ * @param {function} comparator
+ *        Function to use to compare two items.
+ */
+exports.quickSort = function (ary, comparator) {
+  doQuickSort(ary, comparator, 0, ary.length - 1);
+};
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/source-map-consumer.js b/node_modules/@babel/core/node_modules/source-map/lib/source-map-consumer.js
new file mode 100644
index 00000000..6abcc280
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/source-map-consumer.js
@@ -0,0 +1,1082 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var util = require('./util');
+var binarySearch = require('./binary-search');
+var ArraySet = require('./array-set').ArraySet;
+var base64VLQ = require('./base64-vlq');
+var quickSort = require('./quick-sort').quickSort;
+
+function SourceMapConsumer(aSourceMap) {
+  var sourceMap = aSourceMap;
+  if (typeof aSourceMap === 'string') {
+    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+  }
+
+  return sourceMap.sections != null
+    ? new IndexedSourceMapConsumer(sourceMap)
+    : new BasicSourceMapConsumer(sourceMap);
+}
+
+SourceMapConsumer.fromSourceMap = function(aSourceMap) {
+  return BasicSourceMapConsumer.fromSourceMap(aSourceMap);
+}
+
+/**
+ * The version of the source mapping spec that we are consuming.
+ */
+SourceMapConsumer.prototype._version = 3;
+
+// `__generatedMappings` and `__originalMappings` are arrays that hold the
+// parsed mapping coordinates from the source map's "mappings" attribute. They
+// are lazily instantiated, accessed via the `_generatedMappings` and
+// `_originalMappings` getters respectively, and we only parse the mappings
+// and create these arrays once queried for a source location. We jump through
+// these hoops because there can be many thousands of mappings, and parsing
+// them is expensive, so we only want to do it if we must.
+//
+// Each object in the arrays is of the form:
+//
+//     {
+//       generatedLine: The line number in the generated code,
+//       generatedColumn: The column number in the generated code,
+//       source: The path to the original source file that generated this
+//               chunk of code,
+//       originalLine: The line number in the original source that
+//                     corresponds to this chunk of generated code,
+//       originalColumn: The column number in the original source that
+//                       corresponds to this chunk of generated code,
+//       name: The name of the original symbol which generated this chunk of
+//             code.
+//     }
+//
+// All properties except for `generatedLine` and `generatedColumn` can be
+// `null`.
+//
+// `_generatedMappings` is ordered by the generated positions.
+//
+// `_originalMappings` is ordered by the original positions.
+
+SourceMapConsumer.prototype.__generatedMappings = null;
+Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {
+  get: function () {
+    if (!this.__generatedMappings) {
+      this._parseMappings(this._mappings, this.sourceRoot);
+    }
+
+    return this.__generatedMappings;
+  }
+});
+
+SourceMapConsumer.prototype.__originalMappings = null;
+Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {
+  get: function () {
+    if (!this.__originalMappings) {
+      this._parseMappings(this._mappings, this.sourceRoot);
+    }
+
+    return this.__originalMappings;
+  }
+});
+
+SourceMapConsumer.prototype._charIsMappingSeparator =
+  function SourceMapConsumer_charIsMappingSeparator(aStr, index) {
+    var c = aStr.charAt(index);
+    return c === ";" || c === ",";
+  };
+
+/**
+ * Parse the mappings in a string in to a data structure which we can easily
+ * query (the ordered arrays in the `this.__generatedMappings` and
+ * `this.__originalMappings` properties).
+ */
+SourceMapConsumer.prototype._parseMappings =
+  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+    throw new Error("Subclasses must implement _parseMappings");
+  };
+
+SourceMapConsumer.GENERATED_ORDER = 1;
+SourceMapConsumer.ORIGINAL_ORDER = 2;
+
+SourceMapConsumer.GREATEST_LOWER_BOUND = 1;
+SourceMapConsumer.LEAST_UPPER_BOUND = 2;
+
+/**
+ * Iterate over each mapping between an original source/line/column and a
+ * generated line/column in this source map.
+ *
+ * @param Function aCallback
+ *        The function that is called with each mapping.
+ * @param Object aContext
+ *        Optional. If specified, this object will be the value of `this` every
+ *        time that `aCallback` is called.
+ * @param aOrder
+ *        Either `SourceMapConsumer.GENERATED_ORDER` or
+ *        `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to
+ *        iterate over the mappings sorted by the generated file's line/column
+ *        order or the original's source/line/column order, respectively. Defaults to
+ *        `SourceMapConsumer.GENERATED_ORDER`.
+ */
+SourceMapConsumer.prototype.eachMapping =
+  function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {
+    var context = aContext || null;
+    var order = aOrder || SourceMapConsumer.GENERATED_ORDER;
+
+    var mappings;
+    switch (order) {
+    case SourceMapConsumer.GENERATED_ORDER:
+      mappings = this._generatedMappings;
+      break;
+    case SourceMapConsumer.ORIGINAL_ORDER:
+      mappings = this._originalMappings;
+      break;
+    default:
+      throw new Error("Unknown order of iteration.");
+    }
+
+    var sourceRoot = this.sourceRoot;
+    mappings.map(function (mapping) {
+      var source = mapping.source === null ? null : this._sources.at(mapping.source);
+      if (source != null && sourceRoot != null) {
+        source = util.join(sourceRoot, source);
+      }
+      return {
+        source: source,
+        generatedLine: mapping.generatedLine,
+        generatedColumn: mapping.generatedColumn,
+        originalLine: mapping.originalLine,
+        originalColumn: mapping.originalColumn,
+        name: mapping.name === null ? null : this._names.at(mapping.name)
+      };
+    }, this).forEach(aCallback, context);
+  };
+
+/**
+ * Returns all generated line and column information for the original source,
+ * line, and column provided. If no column is provided, returns all mappings
+ * corresponding to a either the line we are searching for or the next
+ * closest line that has any mappings. Otherwise, returns all mappings
+ * corresponding to the given line and either the column we are searching for
+ * or the next closest column that has any offsets.
+ *
+ * The only argument is an object with the following properties:
+ *
+ *   - source: The filename of the original source.
+ *   - line: The line number in the original source.
+ *   - column: Optional. the column number in the original source.
+ *
+ * and an array of objects is returned, each with the following properties:
+ *
+ *   - line: The line number in the generated source, or null.
+ *   - column: The column number in the generated source, or null.
+ */
+SourceMapConsumer.prototype.allGeneratedPositionsFor =
+  function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {
+    var line = util.getArg(aArgs, 'line');
+
+    // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping
+    // returns the index of the closest mapping less than the needle. By
+    // setting needle.originalColumn to 0, we thus find the last mapping for
+    // the given line, provided such a mapping exists.
+    var needle = {
+      source: util.getArg(aArgs, 'source'),
+      originalLine: line,
+      originalColumn: util.getArg(aArgs, 'column', 0)
+    };
+
+    if (this.sourceRoot != null) {
+      needle.source = util.relative(this.sourceRoot, needle.source);
+    }
+    if (!this._sources.has(needle.source)) {
+      return [];
+    }
+    needle.source = this._sources.indexOf(needle.source);
+
+    var mappings = [];
+
+    var index = this._findMapping(needle,
+                                  this._originalMappings,
+                                  "originalLine",
+                                  "originalColumn",
+                                  util.compareByOriginalPositions,
+                                  binarySearch.LEAST_UPPER_BOUND);
+    if (index >= 0) {
+      var mapping = this._originalMappings[index];
+
+      if (aArgs.column === undefined) {
+        var originalLine = mapping.originalLine;
+
+        // Iterate until either we run out of mappings, or we run into
+        // a mapping for a different line than the one we found. Since
+        // mappings are sorted, this is guaranteed to find all mappings for
+        // the line we found.
+        while (mapping && mapping.originalLine === originalLine) {
+          mappings.push({
+            line: util.getArg(mapping, 'generatedLine', null),
+            column: util.getArg(mapping, 'generatedColumn', null),
+            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+          });
+
+          mapping = this._originalMappings[++index];
+        }
+      } else {
+        var originalColumn = mapping.originalColumn;
+
+        // Iterate until either we run out of mappings, or we run into
+        // a mapping for a different line than the one we were searching for.
+        // Since mappings are sorted, this is guaranteed to find all mappings for
+        // the line we are searching for.
+        while (mapping &&
+               mapping.originalLine === line &&
+               mapping.originalColumn == originalColumn) {
+          mappings.push({
+            line: util.getArg(mapping, 'generatedLine', null),
+            column: util.getArg(mapping, 'generatedColumn', null),
+            lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+          });
+
+          mapping = this._originalMappings[++index];
+        }
+      }
+    }
+
+    return mappings;
+  };
+
+exports.SourceMapConsumer = SourceMapConsumer;
+
+/**
+ * A BasicSourceMapConsumer instance represents a parsed source map which we can
+ * query for information about the original file positions by giving it a file
+ * position in the generated source.
+ *
+ * The only parameter is the raw source map (either as a JSON string, or
+ * already parsed to an object). According to the spec, source maps have the
+ * following attributes:
+ *
+ *   - version: Which version of the source map spec this map is following.
+ *   - sources: An array of URLs to the original source files.
+ *   - names: An array of identifiers which can be referrenced by individual mappings.
+ *   - sourceRoot: Optional. The URL root from which all sources are relative.
+ *   - sourcesContent: Optional. An array of contents of the original source files.
+ *   - mappings: A string of base64 VLQs which contain the actual mappings.
+ *   - file: Optional. The generated file this source map is associated with.
+ *
+ * Here is an example source map, taken from the source map spec[0]:
+ *
+ *     {
+ *       version : 3,
+ *       file: "out.js",
+ *       sourceRoot : "",
+ *       sources: ["foo.js", "bar.js"],
+ *       names: ["src", "maps", "are", "fun"],
+ *       mappings: "AA,AB;;ABCDE;"
+ *     }
+ *
+ * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#
+ */
+function BasicSourceMapConsumer(aSourceMap) {
+  var sourceMap = aSourceMap;
+  if (typeof aSourceMap === 'string') {
+    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+  }
+
+  var version = util.getArg(sourceMap, 'version');
+  var sources = util.getArg(sourceMap, 'sources');
+  // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which
+  // requires the array) to play nice here.
+  var names = util.getArg(sourceMap, 'names', []);
+  var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);
+  var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);
+  var mappings = util.getArg(sourceMap, 'mappings');
+  var file = util.getArg(sourceMap, 'file', null);
+
+  // Once again, Sass deviates from the spec and supplies the version as a
+  // string rather than a number, so we use loose equality checking here.
+  if (version != this._version) {
+    throw new Error('Unsupported version: ' + version);
+  }
+
+  sources = sources
+    .map(String)
+    // Some source maps produce relative source paths like "./foo.js" instead of
+    // "foo.js".  Normalize these first so that future comparisons will succeed.
+    // See bugzil.la/1090768.
+    .map(util.normalize)
+    // Always ensure that absolute sources are internally stored relative to
+    // the source root, if the source root is absolute. Not doing this would
+    // be particularly problematic when the source root is a prefix of the
+    // source (valid, but why??). See github issue #199 and bugzil.la/1188982.
+    .map(function (source) {
+      return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)
+        ? util.relative(sourceRoot, source)
+        : source;
+    });
+
+  // Pass `true` below to allow duplicate names and sources. While source maps
+  // are intended to be compressed and deduplicated, the TypeScript compiler
+  // sometimes generates source maps with duplicates in them. See Github issue
+  // #72 and bugzil.la/889492.
+  this._names = ArraySet.fromArray(names.map(String), true);
+  this._sources = ArraySet.fromArray(sources, true);
+
+  this.sourceRoot = sourceRoot;
+  this.sourcesContent = sourcesContent;
+  this._mappings = mappings;
+  this.file = file;
+}
+
+BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
+BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;
+
+/**
+ * Create a BasicSourceMapConsumer from a SourceMapGenerator.
+ *
+ * @param SourceMapGenerator aSourceMap
+ *        The source map that will be consumed.
+ * @returns BasicSourceMapConsumer
+ */
+BasicSourceMapConsumer.fromSourceMap =
+  function SourceMapConsumer_fromSourceMap(aSourceMap) {
+    var smc = Object.create(BasicSourceMapConsumer.prototype);
+
+    var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);
+    var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);
+    smc.sourceRoot = aSourceMap._sourceRoot;
+    smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),
+                                                            smc.sourceRoot);
+    smc.file = aSourceMap._file;
+
+    // Because we are modifying the entries (by converting string sources and
+    // names to indices into the sources and names ArraySets), we have to make
+    // a copy of the entry or else bad things happen. Shared mutable state
+    // strikes again! See github issue #191.
+
+    var generatedMappings = aSourceMap._mappings.toArray().slice();
+    var destGeneratedMappings = smc.__generatedMappings = [];
+    var destOriginalMappings = smc.__originalMappings = [];
+
+    for (var i = 0, length = generatedMappings.length; i < length; i++) {
+      var srcMapping = generatedMappings[i];
+      var destMapping = new Mapping;
+      destMapping.generatedLine = srcMapping.generatedLine;
+      destMapping.generatedColumn = srcMapping.generatedColumn;
+
+      if (srcMapping.source) {
+        destMapping.source = sources.indexOf(srcMapping.source);
+        destMapping.originalLine = srcMapping.originalLine;
+        destMapping.originalColumn = srcMapping.originalColumn;
+
+        if (srcMapping.name) {
+          destMapping.name = names.indexOf(srcMapping.name);
+        }
+
+        destOriginalMappings.push(destMapping);
+      }
+
+      destGeneratedMappings.push(destMapping);
+    }
+
+    quickSort(smc.__originalMappings, util.compareByOriginalPositions);
+
+    return smc;
+  };
+
+/**
+ * The version of the source mapping spec that we are consuming.
+ */
+BasicSourceMapConsumer.prototype._version = 3;
+
+/**
+ * The list of original sources.
+ */
+Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {
+  get: function () {
+    return this._sources.toArray().map(function (s) {
+      return this.sourceRoot != null ? util.join(this.sourceRoot, s) : s;
+    }, this);
+  }
+});
+
+/**
+ * Provide the JIT with a nice shape / hidden class.
+ */
+function Mapping() {
+  this.generatedLine = 0;
+  this.generatedColumn = 0;
+  this.source = null;
+  this.originalLine = null;
+  this.originalColumn = null;
+  this.name = null;
+}
+
+/**
+ * Parse the mappings in a string in to a data structure which we can easily
+ * query (the ordered arrays in the `this.__generatedMappings` and
+ * `this.__originalMappings` properties).
+ */
+BasicSourceMapConsumer.prototype._parseMappings =
+  function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+    var generatedLine = 1;
+    var previousGeneratedColumn = 0;
+    var previousOriginalLine = 0;
+    var previousOriginalColumn = 0;
+    var previousSource = 0;
+    var previousName = 0;
+    var length = aStr.length;
+    var index = 0;
+    var cachedSegments = {};
+    var temp = {};
+    var originalMappings = [];
+    var generatedMappings = [];
+    var mapping, str, segment, end, value;
+
+    while (index < length) {
+      if (aStr.charAt(index) === ';') {
+        generatedLine++;
+        index++;
+        previousGeneratedColumn = 0;
+      }
+      else if (aStr.charAt(index) === ',') {
+        index++;
+      }
+      else {
+        mapping = new Mapping();
+        mapping.generatedLine = generatedLine;
+
+        // Because each offset is encoded relative to the previous one,
+        // many segments often have the same encoding. We can exploit this
+        // fact by caching the parsed variable length fields of each segment,
+        // allowing us to avoid a second parse if we encounter the same
+        // segment again.
+        for (end = index; end < length; end++) {
+          if (this._charIsMappingSeparator(aStr, end)) {
+            break;
+          }
+        }
+        str = aStr.slice(index, end);
+
+        segment = cachedSegments[str];
+        if (segment) {
+          index += str.length;
+        } else {
+          segment = [];
+          while (index < end) {
+            base64VLQ.decode(aStr, index, temp);
+            value = temp.value;
+            index = temp.rest;
+            segment.push(value);
+          }
+
+          if (segment.length === 2) {
+            throw new Error('Found a source, but no line and column');
+          }
+
+          if (segment.length === 3) {
+            throw new Error('Found a source and line, but no column');
+          }
+
+          cachedSegments[str] = segment;
+        }
+
+        // Generated column.
+        mapping.generatedColumn = previousGeneratedColumn + segment[0];
+        previousGeneratedColumn = mapping.generatedColumn;
+
+        if (segment.length > 1) {
+          // Original source.
+          mapping.source = previousSource + segment[1];
+          previousSource += segment[1];
+
+          // Original line.
+          mapping.originalLine = previousOriginalLine + segment[2];
+          previousOriginalLine = mapping.originalLine;
+          // Lines are stored 0-based
+          mapping.originalLine += 1;
+
+          // Original column.
+          mapping.originalColumn = previousOriginalColumn + segment[3];
+          previousOriginalColumn = mapping.originalColumn;
+
+          if (segment.length > 4) {
+            // Original name.
+            mapping.name = previousName + segment[4];
+            previousName += segment[4];
+          }
+        }
+
+        generatedMappings.push(mapping);
+        if (typeof mapping.originalLine === 'number') {
+          originalMappings.push(mapping);
+        }
+      }
+    }
+
+    quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);
+    this.__generatedMappings = generatedMappings;
+
+    quickSort(originalMappings, util.compareByOriginalPositions);
+    this.__originalMappings = originalMappings;
+  };
+
+/**
+ * Find the mapping that best matches the hypothetical "needle" mapping that
+ * we are searching for in the given "haystack" of mappings.
+ */
+BasicSourceMapConsumer.prototype._findMapping =
+  function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,
+                                         aColumnName, aComparator, aBias) {
+    // To return the position we are searching for, we must first find the
+    // mapping for the given position and then return the opposite position it
+    // points to. Because the mappings are sorted, we can use binary search to
+    // find the best mapping.
+
+    if (aNeedle[aLineName] <= 0) {
+      throw new TypeError('Line must be greater than or equal to 1, got '
+                          + aNeedle[aLineName]);
+    }
+    if (aNeedle[aColumnName] < 0) {
+      throw new TypeError('Column must be greater than or equal to 0, got '
+                          + aNeedle[aColumnName]);
+    }
+
+    return binarySearch.search(aNeedle, aMappings, aComparator, aBias);
+  };
+
+/**
+ * Compute the last column for each generated mapping. The last column is
+ * inclusive.
+ */
+BasicSourceMapConsumer.prototype.computeColumnSpans =
+  function SourceMapConsumer_computeColumnSpans() {
+    for (var index = 0; index < this._generatedMappings.length; ++index) {
+      var mapping = this._generatedMappings[index];
+
+      // Mappings do not contain a field for the last generated columnt. We
+      // can come up with an optimistic estimate, however, by assuming that
+      // mappings are contiguous (i.e. given two consecutive mappings, the
+      // first mapping ends where the second one starts).
+      if (index + 1 < this._generatedMappings.length) {
+        var nextMapping = this._generatedMappings[index + 1];
+
+        if (mapping.generatedLine === nextMapping.generatedLine) {
+          mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;
+          continue;
+        }
+      }
+
+      // The last mapping for each line spans the entire line.
+      mapping.lastGeneratedColumn = Infinity;
+    }
+  };
+
+/**
+ * Returns the original source, line, and column information for the generated
+ * source's line and column positions provided. The only argument is an object
+ * with the following properties:
+ *
+ *   - line: The line number in the generated source.
+ *   - column: The column number in the generated source.
+ *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
+ *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
+ *
+ * and an object is returned with the following properties:
+ *
+ *   - source: The original source file, or null.
+ *   - line: The line number in the original source, or null.
+ *   - column: The column number in the original source, or null.
+ *   - name: The original identifier, or null.
+ */
+BasicSourceMapConsumer.prototype.originalPositionFor =
+  function SourceMapConsumer_originalPositionFor(aArgs) {
+    var needle = {
+      generatedLine: util.getArg(aArgs, 'line'),
+      generatedColumn: util.getArg(aArgs, 'column')
+    };
+
+    var index = this._findMapping(
+      needle,
+      this._generatedMappings,
+      "generatedLine",
+      "generatedColumn",
+      util.compareByGeneratedPositionsDeflated,
+      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
+    );
+
+    if (index >= 0) {
+      var mapping = this._generatedMappings[index];
+
+      if (mapping.generatedLine === needle.generatedLine) {
+        var source = util.getArg(mapping, 'source', null);
+        if (source !== null) {
+          source = this._sources.at(source);
+          if (this.sourceRoot != null) {
+            source = util.join(this.sourceRoot, source);
+          }
+        }
+        var name = util.getArg(mapping, 'name', null);
+        if (name !== null) {
+          name = this._names.at(name);
+        }
+        return {
+          source: source,
+          line: util.getArg(mapping, 'originalLine', null),
+          column: util.getArg(mapping, 'originalColumn', null),
+          name: name
+        };
+      }
+    }
+
+    return {
+      source: null,
+      line: null,
+      column: null,
+      name: null
+    };
+  };
+
+/**
+ * Return true if we have the source content for every source in the source
+ * map, false otherwise.
+ */
+BasicSourceMapConsumer.prototype.hasContentsOfAllSources =
+  function BasicSourceMapConsumer_hasContentsOfAllSources() {
+    if (!this.sourcesContent) {
+      return false;
+    }
+    return this.sourcesContent.length >= this._sources.size() &&
+      !this.sourcesContent.some(function (sc) { return sc == null; });
+  };
+
+/**
+ * Returns the original source content. The only argument is the url of the
+ * original source file. Returns null if no original source content is
+ * available.
+ */
+BasicSourceMapConsumer.prototype.sourceContentFor =
+  function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
+    if (!this.sourcesContent) {
+      return null;
+    }
+
+    if (this.sourceRoot != null) {
+      aSource = util.relative(this.sourceRoot, aSource);
+    }
+
+    if (this._sources.has(aSource)) {
+      return this.sourcesContent[this._sources.indexOf(aSource)];
+    }
+
+    var url;
+    if (this.sourceRoot != null
+        && (url = util.urlParse(this.sourceRoot))) {
+      // XXX: file:// URIs and absolute paths lead to unexpected behavior for
+      // many users. We can help them out when they expect file:// URIs to
+      // behave like it would if they were running a local HTTP server. See
+      // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.
+      var fileUriAbsPath = aSource.replace(/^file:\/\//, "");
+      if (url.scheme == "file"
+          && this._sources.has(fileUriAbsPath)) {
+        return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]
+      }
+
+      if ((!url.path || url.path == "/")
+          && this._sources.has("/" + aSource)) {
+        return this.sourcesContent[this._sources.indexOf("/" + aSource)];
+      }
+    }
+
+    // This function is used recursively from
+    // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we
+    // don't want to throw if we can't find the source - we just want to
+    // return null, so we provide a flag to exit gracefully.
+    if (nullOnMissing) {
+      return null;
+    }
+    else {
+      throw new Error('"' + aSource + '" is not in the SourceMap.');
+    }
+  };
+
+/**
+ * Returns the generated line and column information for the original source,
+ * line, and column positions provided. The only argument is an object with
+ * the following properties:
+ *
+ *   - source: The filename of the original source.
+ *   - line: The line number in the original source.
+ *   - column: The column number in the original source.
+ *   - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or
+ *     'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the
+ *     closest element that is smaller than or greater than the one we are
+ *     searching for, respectively, if the exact element cannot be found.
+ *     Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.
+ *
+ * and an object is returned with the following properties:
+ *
+ *   - line: The line number in the generated source, or null.
+ *   - column: The column number in the generated source, or null.
+ */
+BasicSourceMapConsumer.prototype.generatedPositionFor =
+  function SourceMapConsumer_generatedPositionFor(aArgs) {
+    var source = util.getArg(aArgs, 'source');
+    if (this.sourceRoot != null) {
+      source = util.relative(this.sourceRoot, source);
+    }
+    if (!this._sources.has(source)) {
+      return {
+        line: null,
+        column: null,
+        lastColumn: null
+      };
+    }
+    source = this._sources.indexOf(source);
+
+    var needle = {
+      source: source,
+      originalLine: util.getArg(aArgs, 'line'),
+      originalColumn: util.getArg(aArgs, 'column')
+    };
+
+    var index = this._findMapping(
+      needle,
+      this._originalMappings,
+      "originalLine",
+      "originalColumn",
+      util.compareByOriginalPositions,
+      util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)
+    );
+
+    if (index >= 0) {
+      var mapping = this._originalMappings[index];
+
+      if (mapping.source === needle.source) {
+        return {
+          line: util.getArg(mapping, 'generatedLine', null),
+          column: util.getArg(mapping, 'generatedColumn', null),
+          lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)
+        };
+      }
+    }
+
+    return {
+      line: null,
+      column: null,
+      lastColumn: null
+    };
+  };
+
+exports.BasicSourceMapConsumer = BasicSourceMapConsumer;
+
+/**
+ * An IndexedSourceMapConsumer instance represents a parsed source map which
+ * we can query for information. It differs from BasicSourceMapConsumer in
+ * that it takes "indexed" source maps (i.e. ones with a "sections" field) as
+ * input.
+ *
+ * The only parameter is a raw source map (either as a JSON string, or already
+ * parsed to an object). According to the spec for indexed source maps, they
+ * have the following attributes:
+ *
+ *   - version: Which version of the source map spec this map is following.
+ *   - file: Optional. The generated file this source map is associated with.
+ *   - sections: A list of section definitions.
+ *
+ * Each value under the "sections" field has two fields:
+ *   - offset: The offset into the original specified at which this section
+ *       begins to apply, defined as an object with a "line" and "column"
+ *       field.
+ *   - map: A source map definition. This source map could also be indexed,
+ *       but doesn't have to be.
+ *
+ * Instead of the "map" field, it's also possible to have a "url" field
+ * specifying a URL to retrieve a source map from, but that's currently
+ * unsupported.
+ *
+ * Here's an example source map, taken from the source map spec[0], but
+ * modified to omit a section which uses the "url" field.
+ *
+ *  {
+ *    version : 3,
+ *    file: "app.js",
+ *    sections: [{
+ *      offset: {line:100, column:10},
+ *      map: {
+ *        version : 3,
+ *        file: "section.js",
+ *        sources: ["foo.js", "bar.js"],
+ *        names: ["src", "maps", "are", "fun"],
+ *        mappings: "AAAA,E;;ABCDE;"
+ *      }
+ *    }],
+ *  }
+ *
+ * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt
+ */
+function IndexedSourceMapConsumer(aSourceMap) {
+  var sourceMap = aSourceMap;
+  if (typeof aSourceMap === 'string') {
+    sourceMap = JSON.parse(aSourceMap.replace(/^\)\]\}'/, ''));
+  }
+
+  var version = util.getArg(sourceMap, 'version');
+  var sections = util.getArg(sourceMap, 'sections');
+
+  if (version != this._version) {
+    throw new Error('Unsupported version: ' + version);
+  }
+
+  this._sources = new ArraySet();
+  this._names = new ArraySet();
+
+  var lastOffset = {
+    line: -1,
+    column: 0
+  };
+  this._sections = sections.map(function (s) {
+    if (s.url) {
+      // The url field will require support for asynchronicity.
+      // See https://github.com/mozilla/source-map/issues/16
+      throw new Error('Support for url field in sections not implemented.');
+    }
+    var offset = util.getArg(s, 'offset');
+    var offsetLine = util.getArg(offset, 'line');
+    var offsetColumn = util.getArg(offset, 'column');
+
+    if (offsetLine < lastOffset.line ||
+        (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {
+      throw new Error('Section offsets must be ordered and non-overlapping.');
+    }
+    lastOffset = offset;
+
+    return {
+      generatedOffset: {
+        // The offset fields are 0-based, but we use 1-based indices when
+        // encoding/decoding from VLQ.
+        generatedLine: offsetLine + 1,
+        generatedColumn: offsetColumn + 1
+      },
+      consumer: new SourceMapConsumer(util.getArg(s, 'map'))
+    }
+  });
+}
+
+IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);
+IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;
+
+/**
+ * The version of the source mapping spec that we are consuming.
+ */
+IndexedSourceMapConsumer.prototype._version = 3;
+
+/**
+ * The list of original sources.
+ */
+Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {
+  get: function () {
+    var sources = [];
+    for (var i = 0; i < this._sections.length; i++) {
+      for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {
+        sources.push(this._sections[i].consumer.sources[j]);
+      }
+    }
+    return sources;
+  }
+});
+
+/**
+ * Returns the original source, line, and column information for the generated
+ * source's line and column positions provided. The only argument is an object
+ * with the following properties:
+ *
+ *   - line: The line number in the generated source.
+ *   - column: The column number in the generated source.
+ *
+ * and an object is returned with the following properties:
+ *
+ *   - source: The original source file, or null.
+ *   - line: The line number in the original source, or null.
+ *   - column: The column number in the original source, or null.
+ *   - name: The original identifier, or null.
+ */
+IndexedSourceMapConsumer.prototype.originalPositionFor =
+  function IndexedSourceMapConsumer_originalPositionFor(aArgs) {
+    var needle = {
+      generatedLine: util.getArg(aArgs, 'line'),
+      generatedColumn: util.getArg(aArgs, 'column')
+    };
+
+    // Find the section containing the generated position we're trying to map
+    // to an original position.
+    var sectionIndex = binarySearch.search(needle, this._sections,
+      function(needle, section) {
+        var cmp = needle.generatedLine - section.generatedOffset.generatedLine;
+        if (cmp) {
+          return cmp;
+        }
+
+        return (needle.generatedColumn -
+                section.generatedOffset.generatedColumn);
+      });
+    var section = this._sections[sectionIndex];
+
+    if (!section) {
+      return {
+        source: null,
+        line: null,
+        column: null,
+        name: null
+      };
+    }
+
+    return section.consumer.originalPositionFor({
+      line: needle.generatedLine -
+        (section.generatedOffset.generatedLine - 1),
+      column: needle.generatedColumn -
+        (section.generatedOffset.generatedLine === needle.generatedLine
+         ? section.generatedOffset.generatedColumn - 1
+         : 0),
+      bias: aArgs.bias
+    });
+  };
+
+/**
+ * Return true if we have the source content for every source in the source
+ * map, false otherwise.
+ */
+IndexedSourceMapConsumer.prototype.hasContentsOfAllSources =
+  function IndexedSourceMapConsumer_hasContentsOfAllSources() {
+    return this._sections.every(function (s) {
+      return s.consumer.hasContentsOfAllSources();
+    });
+  };
+
+/**
+ * Returns the original source content. The only argument is the url of the
+ * original source file. Returns null if no original source content is
+ * available.
+ */
+IndexedSourceMapConsumer.prototype.sourceContentFor =
+  function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {
+    for (var i = 0; i < this._sections.length; i++) {
+      var section = this._sections[i];
+
+      var content = section.consumer.sourceContentFor(aSource, true);
+      if (content) {
+        return content;
+      }
+    }
+    if (nullOnMissing) {
+      return null;
+    }
+    else {
+      throw new Error('"' + aSource + '" is not in the SourceMap.');
+    }
+  };
+
+/**
+ * Returns the generated line and column information for the original source,
+ * line, and column positions provided. The only argument is an object with
+ * the following properties:
+ *
+ *   - source: The filename of the original source.
+ *   - line: The line number in the original source.
+ *   - column: The column number in the original source.
+ *
+ * and an object is returned with the following properties:
+ *
+ *   - line: The line number in the generated source, or null.
+ *   - column: The column number in the generated source, or null.
+ */
+IndexedSourceMapConsumer.prototype.generatedPositionFor =
+  function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {
+    for (var i = 0; i < this._sections.length; i++) {
+      var section = this._sections[i];
+
+      // Only consider this section if the requested source is in the list of
+      // sources of the consumer.
+      if (section.consumer.sources.indexOf(util.getArg(aArgs, 'source')) === -1) {
+        continue;
+      }
+      var generatedPosition = section.consumer.generatedPositionFor(aArgs);
+      if (generatedPosition) {
+        var ret = {
+          line: generatedPosition.line +
+            (section.generatedOffset.generatedLine - 1),
+          column: generatedPosition.column +
+            (section.generatedOffset.generatedLine === generatedPosition.line
+             ? section.generatedOffset.generatedColumn - 1
+             : 0)
+        };
+        return ret;
+      }
+    }
+
+    return {
+      line: null,
+      column: null
+    };
+  };
+
+/**
+ * Parse the mappings in a string in to a data structure which we can easily
+ * query (the ordered arrays in the `this.__generatedMappings` and
+ * `this.__originalMappings` properties).
+ */
+IndexedSourceMapConsumer.prototype._parseMappings =
+  function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {
+    this.__generatedMappings = [];
+    this.__originalMappings = [];
+    for (var i = 0; i < this._sections.length; i++) {
+      var section = this._sections[i];
+      var sectionMappings = section.consumer._generatedMappings;
+      for (var j = 0; j < sectionMappings.length; j++) {
+        var mapping = sectionMappings[j];
+
+        var source = section.consumer._sources.at(mapping.source);
+        if (section.consumer.sourceRoot !== null) {
+          source = util.join(section.consumer.sourceRoot, source);
+        }
+        this._sources.add(source);
+        source = this._sources.indexOf(source);
+
+        var name = section.consumer._names.at(mapping.name);
+        this._names.add(name);
+        name = this._names.indexOf(name);
+
+        // The mappings coming from the consumer for the section have
+        // generated positions relative to the start of the section, so we
+        // need to offset them to be relative to the start of the concatenated
+        // generated file.
+        var adjustedMapping = {
+          source: source,
+          generatedLine: mapping.generatedLine +
+            (section.generatedOffset.generatedLine - 1),
+          generatedColumn: mapping.generatedColumn +
+            (section.generatedOffset.generatedLine === mapping.generatedLine
+            ? section.generatedOffset.generatedColumn - 1
+            : 0),
+          originalLine: mapping.originalLine,
+          originalColumn: mapping.originalColumn,
+          name: name
+        };
+
+        this.__generatedMappings.push(adjustedMapping);
+        if (typeof adjustedMapping.originalLine === 'number') {
+          this.__originalMappings.push(adjustedMapping);
+        }
+      }
+    }
+
+    quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);
+    quickSort(this.__originalMappings, util.compareByOriginalPositions);
+  };
+
+exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/source-map-generator.js b/node_modules/@babel/core/node_modules/source-map/lib/source-map-generator.js
new file mode 100644
index 00000000..aff1e7fb
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/source-map-generator.js
@@ -0,0 +1,416 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var base64VLQ = require('./base64-vlq');
+var util = require('./util');
+var ArraySet = require('./array-set').ArraySet;
+var MappingList = require('./mapping-list').MappingList;
+
+/**
+ * An instance of the SourceMapGenerator represents a source map which is
+ * being built incrementally. You may pass an object with the following
+ * properties:
+ *
+ *   - file: The filename of the generated source.
+ *   - sourceRoot: A root for all relative URLs in this source map.
+ */
+function SourceMapGenerator(aArgs) {
+  if (!aArgs) {
+    aArgs = {};
+  }
+  this._file = util.getArg(aArgs, 'file', null);
+  this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);
+  this._skipValidation = util.getArg(aArgs, 'skipValidation', false);
+  this._sources = new ArraySet();
+  this._names = new ArraySet();
+  this._mappings = new MappingList();
+  this._sourcesContents = null;
+}
+
+SourceMapGenerator.prototype._version = 3;
+
+/**
+ * Creates a new SourceMapGenerator based on a SourceMapConsumer
+ *
+ * @param aSourceMapConsumer The SourceMap.
+ */
+SourceMapGenerator.fromSourceMap =
+  function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {
+    var sourceRoot = aSourceMapConsumer.sourceRoot;
+    var generator = new SourceMapGenerator({
+      file: aSourceMapConsumer.file,
+      sourceRoot: sourceRoot
+    });
+    aSourceMapConsumer.eachMapping(function (mapping) {
+      var newMapping = {
+        generated: {
+          line: mapping.generatedLine,
+          column: mapping.generatedColumn
+        }
+      };
+
+      if (mapping.source != null) {
+        newMapping.source = mapping.source;
+        if (sourceRoot != null) {
+          newMapping.source = util.relative(sourceRoot, newMapping.source);
+        }
+
+        newMapping.original = {
+          line: mapping.originalLine,
+          column: mapping.originalColumn
+        };
+
+        if (mapping.name != null) {
+          newMapping.name = mapping.name;
+        }
+      }
+
+      generator.addMapping(newMapping);
+    });
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        generator.setSourceContent(sourceFile, content);
+      }
+    });
+    return generator;
+  };
+
+/**
+ * Add a single mapping from original source line and column to the generated
+ * source's line and column for this source map being created. The mapping
+ * object should have the following properties:
+ *
+ *   - generated: An object with the generated line and column positions.
+ *   - original: An object with the original line and column positions.
+ *   - source: The original source file (relative to the sourceRoot).
+ *   - name: An optional original token name for this mapping.
+ */
+SourceMapGenerator.prototype.addMapping =
+  function SourceMapGenerator_addMapping(aArgs) {
+    var generated = util.getArg(aArgs, 'generated');
+    var original = util.getArg(aArgs, 'original', null);
+    var source = util.getArg(aArgs, 'source', null);
+    var name = util.getArg(aArgs, 'name', null);
+
+    if (!this._skipValidation) {
+      this._validateMapping(generated, original, source, name);
+    }
+
+    if (source != null) {
+      source = String(source);
+      if (!this._sources.has(source)) {
+        this._sources.add(source);
+      }
+    }
+
+    if (name != null) {
+      name = String(name);
+      if (!this._names.has(name)) {
+        this._names.add(name);
+      }
+    }
+
+    this._mappings.add({
+      generatedLine: generated.line,
+      generatedColumn: generated.column,
+      originalLine: original != null && original.line,
+      originalColumn: original != null && original.column,
+      source: source,
+      name: name
+    });
+  };
+
+/**
+ * Set the source content for a source file.
+ */
+SourceMapGenerator.prototype.setSourceContent =
+  function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {
+    var source = aSourceFile;
+    if (this._sourceRoot != null) {
+      source = util.relative(this._sourceRoot, source);
+    }
+
+    if (aSourceContent != null) {
+      // Add the source content to the _sourcesContents map.
+      // Create a new _sourcesContents map if the property is null.
+      if (!this._sourcesContents) {
+        this._sourcesContents = Object.create(null);
+      }
+      this._sourcesContents[util.toSetString(source)] = aSourceContent;
+    } else if (this._sourcesContents) {
+      // Remove the source file from the _sourcesContents map.
+      // If the _sourcesContents map is empty, set the property to null.
+      delete this._sourcesContents[util.toSetString(source)];
+      if (Object.keys(this._sourcesContents).length === 0) {
+        this._sourcesContents = null;
+      }
+    }
+  };
+
+/**
+ * Applies the mappings of a sub-source-map for a specific source file to the
+ * source map being generated. Each mapping to the supplied source file is
+ * rewritten using the supplied source map. Note: The resolution for the
+ * resulting mappings is the minimium of this map and the supplied map.
+ *
+ * @param aSourceMapConsumer The source map to be applied.
+ * @param aSourceFile Optional. The filename of the source file.
+ *        If omitted, SourceMapConsumer's file property will be used.
+ * @param aSourceMapPath Optional. The dirname of the path to the source map
+ *        to be applied. If relative, it is relative to the SourceMapConsumer.
+ *        This parameter is needed when the two source maps aren't in the same
+ *        directory, and the source map to be applied contains relative source
+ *        paths. If so, those relative source paths need to be rewritten
+ *        relative to the SourceMapGenerator.
+ */
+SourceMapGenerator.prototype.applySourceMap =
+  function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {
+    var sourceFile = aSourceFile;
+    // If aSourceFile is omitted, we will use the file property of the SourceMap
+    if (aSourceFile == null) {
+      if (aSourceMapConsumer.file == null) {
+        throw new Error(
+          'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +
+          'or the source map\'s "file" property. Both were omitted.'
+        );
+      }
+      sourceFile = aSourceMapConsumer.file;
+    }
+    var sourceRoot = this._sourceRoot;
+    // Make "sourceFile" relative if an absolute Url is passed.
+    if (sourceRoot != null) {
+      sourceFile = util.relative(sourceRoot, sourceFile);
+    }
+    // Applying the SourceMap can add and remove items from the sources and
+    // the names array.
+    var newSources = new ArraySet();
+    var newNames = new ArraySet();
+
+    // Find mappings for the "sourceFile"
+    this._mappings.unsortedForEach(function (mapping) {
+      if (mapping.source === sourceFile && mapping.originalLine != null) {
+        // Check if it can be mapped by the source map, then update the mapping.
+        var original = aSourceMapConsumer.originalPositionFor({
+          line: mapping.originalLine,
+          column: mapping.originalColumn
+        });
+        if (original.source != null) {
+          // Copy mapping
+          mapping.source = original.source;
+          if (aSourceMapPath != null) {
+            mapping.source = util.join(aSourceMapPath, mapping.source)
+          }
+          if (sourceRoot != null) {
+            mapping.source = util.relative(sourceRoot, mapping.source);
+          }
+          mapping.originalLine = original.line;
+          mapping.originalColumn = original.column;
+          if (original.name != null) {
+            mapping.name = original.name;
+          }
+        }
+      }
+
+      var source = mapping.source;
+      if (source != null && !newSources.has(source)) {
+        newSources.add(source);
+      }
+
+      var name = mapping.name;
+      if (name != null && !newNames.has(name)) {
+        newNames.add(name);
+      }
+
+    }, this);
+    this._sources = newSources;
+    this._names = newNames;
+
+    // Copy sourcesContents of applied map.
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        if (aSourceMapPath != null) {
+          sourceFile = util.join(aSourceMapPath, sourceFile);
+        }
+        if (sourceRoot != null) {
+          sourceFile = util.relative(sourceRoot, sourceFile);
+        }
+        this.setSourceContent(sourceFile, content);
+      }
+    }, this);
+  };
+
+/**
+ * A mapping can have one of the three levels of data:
+ *
+ *   1. Just the generated position.
+ *   2. The Generated position, original position, and original source.
+ *   3. Generated and original position, original source, as well as a name
+ *      token.
+ *
+ * To maintain consistency, we validate that any new mapping being added falls
+ * in to one of these categories.
+ */
+SourceMapGenerator.prototype._validateMapping =
+  function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,
+                                              aName) {
+    // When aOriginal is truthy but has empty values for .line and .column,
+    // it is most likely a programmer error. In this case we throw a very
+    // specific error message to try to guide them the right way.
+    // For example: https://github.com/Polymer/polymer-bundler/pull/519
+    if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {
+        throw new Error(
+            'original.line and original.column are not numbers -- you probably meant to omit ' +
+            'the original mapping entirely and only map the generated position. If so, pass ' +
+            'null for the original mapping instead of an object with empty or null values.'
+        );
+    }
+
+    if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+        && aGenerated.line > 0 && aGenerated.column >= 0
+        && !aOriginal && !aSource && !aName) {
+      // Case 1.
+      return;
+    }
+    else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated
+             && aOriginal && 'line' in aOriginal && 'column' in aOriginal
+             && aGenerated.line > 0 && aGenerated.column >= 0
+             && aOriginal.line > 0 && aOriginal.column >= 0
+             && aSource) {
+      // Cases 2 and 3.
+      return;
+    }
+    else {
+      throw new Error('Invalid mapping: ' + JSON.stringify({
+        generated: aGenerated,
+        source: aSource,
+        original: aOriginal,
+        name: aName
+      }));
+    }
+  };
+
+/**
+ * Serialize the accumulated mappings in to the stream of base 64 VLQs
+ * specified by the source map format.
+ */
+SourceMapGenerator.prototype._serializeMappings =
+  function SourceMapGenerator_serializeMappings() {
+    var previousGeneratedColumn = 0;
+    var previousGeneratedLine = 1;
+    var previousOriginalColumn = 0;
+    var previousOriginalLine = 0;
+    var previousName = 0;
+    var previousSource = 0;
+    var result = '';
+    var next;
+    var mapping;
+    var nameIdx;
+    var sourceIdx;
+
+    var mappings = this._mappings.toArray();
+    for (var i = 0, len = mappings.length; i < len; i++) {
+      mapping = mappings[i];
+      next = ''
+
+      if (mapping.generatedLine !== previousGeneratedLine) {
+        previousGeneratedColumn = 0;
+        while (mapping.generatedLine !== previousGeneratedLine) {
+          next += ';';
+          previousGeneratedLine++;
+        }
+      }
+      else {
+        if (i > 0) {
+          if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {
+            continue;
+          }
+          next += ',';
+        }
+      }
+
+      next += base64VLQ.encode(mapping.generatedColumn
+                                 - previousGeneratedColumn);
+      previousGeneratedColumn = mapping.generatedColumn;
+
+      if (mapping.source != null) {
+        sourceIdx = this._sources.indexOf(mapping.source);
+        next += base64VLQ.encode(sourceIdx - previousSource);
+        previousSource = sourceIdx;
+
+        // lines are stored 0-based in SourceMap spec version 3
+        next += base64VLQ.encode(mapping.originalLine - 1
+                                   - previousOriginalLine);
+        previousOriginalLine = mapping.originalLine - 1;
+
+        next += base64VLQ.encode(mapping.originalColumn
+                                   - previousOriginalColumn);
+        previousOriginalColumn = mapping.originalColumn;
+
+        if (mapping.name != null) {
+          nameIdx = this._names.indexOf(mapping.name);
+          next += base64VLQ.encode(nameIdx - previousName);
+          previousName = nameIdx;
+        }
+      }
+
+      result += next;
+    }
+
+    return result;
+  };
+
+SourceMapGenerator.prototype._generateSourcesContent =
+  function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {
+    return aSources.map(function (source) {
+      if (!this._sourcesContents) {
+        return null;
+      }
+      if (aSourceRoot != null) {
+        source = util.relative(aSourceRoot, source);
+      }
+      var key = util.toSetString(source);
+      return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)
+        ? this._sourcesContents[key]
+        : null;
+    }, this);
+  };
+
+/**
+ * Externalize the source map.
+ */
+SourceMapGenerator.prototype.toJSON =
+  function SourceMapGenerator_toJSON() {
+    var map = {
+      version: this._version,
+      sources: this._sources.toArray(),
+      names: this._names.toArray(),
+      mappings: this._serializeMappings()
+    };
+    if (this._file != null) {
+      map.file = this._file;
+    }
+    if (this._sourceRoot != null) {
+      map.sourceRoot = this._sourceRoot;
+    }
+    if (this._sourcesContents) {
+      map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);
+    }
+
+    return map;
+  };
+
+/**
+ * Render the source map being generated to a string.
+ */
+SourceMapGenerator.prototype.toString =
+  function SourceMapGenerator_toString() {
+    return JSON.stringify(this.toJSON());
+  };
+
+exports.SourceMapGenerator = SourceMapGenerator;
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/source-node.js b/node_modules/@babel/core/node_modules/source-map/lib/source-node.js
new file mode 100644
index 00000000..d196a53f
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/source-node.js
@@ -0,0 +1,413 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+var SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;
+var util = require('./util');
+
+// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other
+// operating systems these days (capturing the result).
+var REGEX_NEWLINE = /(\r?\n)/;
+
+// Newline character code for charCodeAt() comparisons
+var NEWLINE_CODE = 10;
+
+// Private symbol for identifying `SourceNode`s when multiple versions of
+// the source-map library are loaded. This MUST NOT CHANGE across
+// versions!
+var isSourceNode = "$$$isSourceNode$$$";
+
+/**
+ * SourceNodes provide a way to abstract over interpolating/concatenating
+ * snippets of generated JavaScript source code while maintaining the line and
+ * column information associated with the original source code.
+ *
+ * @param aLine The original line number.
+ * @param aColumn The original column number.
+ * @param aSource The original source's filename.
+ * @param aChunks Optional. An array of strings which are snippets of
+ *        generated JS, or other SourceNodes.
+ * @param aName The original identifier.
+ */
+function SourceNode(aLine, aColumn, aSource, aChunks, aName) {
+  this.children = [];
+  this.sourceContents = {};
+  this.line = aLine == null ? null : aLine;
+  this.column = aColumn == null ? null : aColumn;
+  this.source = aSource == null ? null : aSource;
+  this.name = aName == null ? null : aName;
+  this[isSourceNode] = true;
+  if (aChunks != null) this.add(aChunks);
+}
+
+/**
+ * Creates a SourceNode from generated code and a SourceMapConsumer.
+ *
+ * @param aGeneratedCode The generated code
+ * @param aSourceMapConsumer The SourceMap for the generated code
+ * @param aRelativePath Optional. The path that relative sources in the
+ *        SourceMapConsumer should be relative to.
+ */
+SourceNode.fromStringWithSourceMap =
+  function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {
+    // The SourceNode we want to fill with the generated code
+    // and the SourceMap
+    var node = new SourceNode();
+
+    // All even indices of this array are one line of the generated code,
+    // while all odd indices are the newlines between two adjacent lines
+    // (since `REGEX_NEWLINE` captures its match).
+    // Processed fragments are accessed by calling `shiftNextLine`.
+    var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);
+    var remainingLinesIndex = 0;
+    var shiftNextLine = function() {
+      var lineContents = getNextLine();
+      // The last line of a file might not have a newline.
+      var newLine = getNextLine() || "";
+      return lineContents + newLine;
+
+      function getNextLine() {
+        return remainingLinesIndex < remainingLines.length ?
+            remainingLines[remainingLinesIndex++] : undefined;
+      }
+    };
+
+    // We need to remember the position of "remainingLines"
+    var lastGeneratedLine = 1, lastGeneratedColumn = 0;
+
+    // The generate SourceNodes we need a code range.
+    // To extract it current and last mapping is used.
+    // Here we store the last mapping.
+    var lastMapping = null;
+
+    aSourceMapConsumer.eachMapping(function (mapping) {
+      if (lastMapping !== null) {
+        // We add the code from "lastMapping" to "mapping":
+        // First check if there is a new line in between.
+        if (lastGeneratedLine < mapping.generatedLine) {
+          // Associate first line with "lastMapping"
+          addMappingWithCode(lastMapping, shiftNextLine());
+          lastGeneratedLine++;
+          lastGeneratedColumn = 0;
+          // The remaining code is added without mapping
+        } else {
+          // There is no new line in between.
+          // Associate the code between "lastGeneratedColumn" and
+          // "mapping.generatedColumn" with "lastMapping"
+          var nextLine = remainingLines[remainingLinesIndex];
+          var code = nextLine.substr(0, mapping.generatedColumn -
+                                        lastGeneratedColumn);
+          remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -
+                                              lastGeneratedColumn);
+          lastGeneratedColumn = mapping.generatedColumn;
+          addMappingWithCode(lastMapping, code);
+          // No more remaining code, continue
+          lastMapping = mapping;
+          return;
+        }
+      }
+      // We add the generated code until the first mapping
+      // to the SourceNode without any mapping.
+      // Each line is added as separate string.
+      while (lastGeneratedLine < mapping.generatedLine) {
+        node.add(shiftNextLine());
+        lastGeneratedLine++;
+      }
+      if (lastGeneratedColumn < mapping.generatedColumn) {
+        var nextLine = remainingLines[remainingLinesIndex];
+        node.add(nextLine.substr(0, mapping.generatedColumn));
+        remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);
+        lastGeneratedColumn = mapping.generatedColumn;
+      }
+      lastMapping = mapping;
+    }, this);
+    // We have processed all mappings.
+    if (remainingLinesIndex < remainingLines.length) {
+      if (lastMapping) {
+        // Associate the remaining code in the current line with "lastMapping"
+        addMappingWithCode(lastMapping, shiftNextLine());
+      }
+      // and add the remaining lines without any mapping
+      node.add(remainingLines.splice(remainingLinesIndex).join(""));
+    }
+
+    // Copy sourcesContent into SourceNode
+    aSourceMapConsumer.sources.forEach(function (sourceFile) {
+      var content = aSourceMapConsumer.sourceContentFor(sourceFile);
+      if (content != null) {
+        if (aRelativePath != null) {
+          sourceFile = util.join(aRelativePath, sourceFile);
+        }
+        node.setSourceContent(sourceFile, content);
+      }
+    });
+
+    return node;
+
+    function addMappingWithCode(mapping, code) {
+      if (mapping === null || mapping.source === undefined) {
+        node.add(code);
+      } else {
+        var source = aRelativePath
+          ? util.join(aRelativePath, mapping.source)
+          : mapping.source;
+        node.add(new SourceNode(mapping.originalLine,
+                                mapping.originalColumn,
+                                source,
+                                code,
+                                mapping.name));
+      }
+    }
+  };
+
+/**
+ * Add a chunk of generated JS to this source node.
+ *
+ * @param aChunk A string snippet of generated JS code, another instance of
+ *        SourceNode, or an array where each member is one of those things.
+ */
+SourceNode.prototype.add = function SourceNode_add(aChunk) {
+  if (Array.isArray(aChunk)) {
+    aChunk.forEach(function (chunk) {
+      this.add(chunk);
+    }, this);
+  }
+  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+    if (aChunk) {
+      this.children.push(aChunk);
+    }
+  }
+  else {
+    throw new TypeError(
+      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+    );
+  }
+  return this;
+};
+
+/**
+ * Add a chunk of generated JS to the beginning of this source node.
+ *
+ * @param aChunk A string snippet of generated JS code, another instance of
+ *        SourceNode, or an array where each member is one of those things.
+ */
+SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {
+  if (Array.isArray(aChunk)) {
+    for (var i = aChunk.length-1; i >= 0; i--) {
+      this.prepend(aChunk[i]);
+    }
+  }
+  else if (aChunk[isSourceNode] || typeof aChunk === "string") {
+    this.children.unshift(aChunk);
+  }
+  else {
+    throw new TypeError(
+      "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk
+    );
+  }
+  return this;
+};
+
+/**
+ * Walk over the tree of JS snippets in this node and its children. The
+ * walking function is called once for each snippet of JS and is passed that
+ * snippet and the its original associated source's line/column location.
+ *
+ * @param aFn The traversal function.
+ */
+SourceNode.prototype.walk = function SourceNode_walk(aFn) {
+  var chunk;
+  for (var i = 0, len = this.children.length; i < len; i++) {
+    chunk = this.children[i];
+    if (chunk[isSourceNode]) {
+      chunk.walk(aFn);
+    }
+    else {
+      if (chunk !== '') {
+        aFn(chunk, { source: this.source,
+                     line: this.line,
+                     column: this.column,
+                     name: this.name });
+      }
+    }
+  }
+};
+
+/**
+ * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between
+ * each of `this.children`.
+ *
+ * @param aSep The separator.
+ */
+SourceNode.prototype.join = function SourceNode_join(aSep) {
+  var newChildren;
+  var i;
+  var len = this.children.length;
+  if (len > 0) {
+    newChildren = [];
+    for (i = 0; i < len-1; i++) {
+      newChildren.push(this.children[i]);
+      newChildren.push(aSep);
+    }
+    newChildren.push(this.children[i]);
+    this.children = newChildren;
+  }
+  return this;
+};
+
+/**
+ * Call String.prototype.replace on the very right-most source snippet. Useful
+ * for trimming whitespace from the end of a source node, etc.
+ *
+ * @param aPattern The pattern to replace.
+ * @param aReplacement The thing to replace the pattern with.
+ */
+SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {
+  var lastChild = this.children[this.children.length - 1];
+  if (lastChild[isSourceNode]) {
+    lastChild.replaceRight(aPattern, aReplacement);
+  }
+  else if (typeof lastChild === 'string') {
+    this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);
+  }
+  else {
+    this.children.push(''.replace(aPattern, aReplacement));
+  }
+  return this;
+};
+
+/**
+ * Set the source content for a source file. This will be added to the SourceMapGenerator
+ * in the sourcesContent field.
+ *
+ * @param aSourceFile The filename of the source file
+ * @param aSourceContent The content of the source file
+ */
+SourceNode.prototype.setSourceContent =
+  function SourceNode_setSourceContent(aSourceFile, aSourceContent) {
+    this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;
+  };
+
+/**
+ * Walk over the tree of SourceNodes. The walking function is called for each
+ * source file content and is passed the filename and source content.
+ *
+ * @param aFn The traversal function.
+ */
+SourceNode.prototype.walkSourceContents =
+  function SourceNode_walkSourceContents(aFn) {
+    for (var i = 0, len = this.children.length; i < len; i++) {
+      if (this.children[i][isSourceNode]) {
+        this.children[i].walkSourceContents(aFn);
+      }
+    }
+
+    var sources = Object.keys(this.sourceContents);
+    for (var i = 0, len = sources.length; i < len; i++) {
+      aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);
+    }
+  };
+
+/**
+ * Return the string representation of this source node. Walks over the tree
+ * and concatenates all the various snippets together to one string.
+ */
+SourceNode.prototype.toString = function SourceNode_toString() {
+  var str = "";
+  this.walk(function (chunk) {
+    str += chunk;
+  });
+  return str;
+};
+
+/**
+ * Returns the string representation of this source node along with a source
+ * map.
+ */
+SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {
+  var generated = {
+    code: "",
+    line: 1,
+    column: 0
+  };
+  var map = new SourceMapGenerator(aArgs);
+  var sourceMappingActive = false;
+  var lastOriginalSource = null;
+  var lastOriginalLine = null;
+  var lastOriginalColumn = null;
+  var lastOriginalName = null;
+  this.walk(function (chunk, original) {
+    generated.code += chunk;
+    if (original.source !== null
+        && original.line !== null
+        && original.column !== null) {
+      if(lastOriginalSource !== original.source
+         || lastOriginalLine !== original.line
+         || lastOriginalColumn !== original.column
+         || lastOriginalName !== original.name) {
+        map.addMapping({
+          source: original.source,
+          original: {
+            line: original.line,
+            column: original.column
+          },
+          generated: {
+            line: generated.line,
+            column: generated.column
+          },
+          name: original.name
+        });
+      }
+      lastOriginalSource = original.source;
+      lastOriginalLine = original.line;
+      lastOriginalColumn = original.column;
+      lastOriginalName = original.name;
+      sourceMappingActive = true;
+    } else if (sourceMappingActive) {
+      map.addMapping({
+        generated: {
+          line: generated.line,
+          column: generated.column
+        }
+      });
+      lastOriginalSource = null;
+      sourceMappingActive = false;
+    }
+    for (var idx = 0, length = chunk.length; idx < length; idx++) {
+      if (chunk.charCodeAt(idx) === NEWLINE_CODE) {
+        generated.line++;
+        generated.column = 0;
+        // Mappings end at eol
+        if (idx + 1 === length) {
+          lastOriginalSource = null;
+          sourceMappingActive = false;
+        } else if (sourceMappingActive) {
+          map.addMapping({
+            source: original.source,
+            original: {
+              line: original.line,
+              column: original.column
+            },
+            generated: {
+              line: generated.line,
+              column: generated.column
+            },
+            name: original.name
+          });
+        }
+      } else {
+        generated.column++;
+      }
+    }
+  });
+  this.walkSourceContents(function (sourceFile, sourceContent) {
+    map.setSourceContent(sourceFile, sourceContent);
+  });
+
+  return { code: generated.code, map: map };
+};
+
+exports.SourceNode = SourceNode;
diff --git a/node_modules/@babel/core/node_modules/source-map/lib/util.js b/node_modules/@babel/core/node_modules/source-map/lib/util.js
new file mode 100644
index 00000000..44e0e452
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/lib/util.js
@@ -0,0 +1,417 @@
+/* -*- Mode: js; js-indent-level: 2; -*- */
+/*
+ * Copyright 2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+
+/**
+ * This is a helper function for getting values from parameter/options
+ * objects.
+ *
+ * @param args The object we are extracting values from
+ * @param name The name of the property we are getting.
+ * @param defaultValue An optional value to return if the property is missing
+ * from the object. If this is not specified and the property is missing, an
+ * error will be thrown.
+ */
+function getArg(aArgs, aName, aDefaultValue) {
+  if (aName in aArgs) {
+    return aArgs[aName];
+  } else if (arguments.length === 3) {
+    return aDefaultValue;
+  } else {
+    throw new Error('"' + aName + '" is a required argument.');
+  }
+}
+exports.getArg = getArg;
+
+var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.]*)(?::(\d+))?(\S*)$/;
+var dataUrlRegexp = /^data:.+\,.+$/;
+
+function urlParse(aUrl) {
+  var match = aUrl.match(urlRegexp);
+  if (!match) {
+    return null;
+  }
+  return {
+    scheme: match[1],
+    auth: match[2],
+    host: match[3],
+    port: match[4],
+    path: match[5]
+  };
+}
+exports.urlParse = urlParse;
+
+function urlGenerate(aParsedUrl) {
+  var url = '';
+  if (aParsedUrl.scheme) {
+    url += aParsedUrl.scheme + ':';
+  }
+  url += '//';
+  if (aParsedUrl.auth) {
+    url += aParsedUrl.auth + '@';
+  }
+  if (aParsedUrl.host) {
+    url += aParsedUrl.host;
+  }
+  if (aParsedUrl.port) {
+    url += ":" + aParsedUrl.port
+  }
+  if (aParsedUrl.path) {
+    url += aParsedUrl.path;
+  }
+  return url;
+}
+exports.urlGenerate = urlGenerate;
+
+/**
+ * Normalizes a path, or the path portion of a URL:
+ *
+ * - Replaces consecutive slashes with one slash.
+ * - Removes unnecessary '.' parts.
+ * - Removes unnecessary '<dir>/..' parts.
+ *
+ * Based on code in the Node.js 'path' core module.
+ *
+ * @param aPath The path or url to normalize.
+ */
+function normalize(aPath) {
+  var path = aPath;
+  var url = urlParse(aPath);
+  if (url) {
+    if (!url.path) {
+      return aPath;
+    }
+    path = url.path;
+  }
+  var isAbsolute = exports.isAbsolute(path);
+
+  var parts = path.split(/\/+/);
+  for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {
+    part = parts[i];
+    if (part === '.') {
+      parts.splice(i, 1);
+    } else if (part === '..') {
+      up++;
+    } else if (up > 0) {
+      if (part === '') {
+        // The first part is blank if the path is absolute. Trying to go
+        // above the root is a no-op. Therefore we can remove all '..' parts
+        // directly after the root.
+        parts.splice(i + 1, up);
+        up = 0;
+      } else {
+        parts.splice(i, 2);
+        up--;
+      }
+    }
+  }
+  path = parts.join('/');
+
+  if (path === '') {
+    path = isAbsolute ? '/' : '.';
+  }
+
+  if (url) {
+    url.path = path;
+    return urlGenerate(url);
+  }
+  return path;
+}
+exports.normalize = normalize;
+
+/**
+ * Joins two paths/URLs.
+ *
+ * @param aRoot The root path or URL.
+ * @param aPath The path or URL to be joined with the root.
+ *
+ * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a
+ *   scheme-relative URL: Then the scheme of aRoot, if any, is prepended
+ *   first.
+ * - Otherwise aPath is a path. If aRoot is a URL, then its path portion
+ *   is updated with the result and aRoot is returned. Otherwise the result
+ *   is returned.
+ *   - If aPath is absolute, the result is aPath.
+ *   - Otherwise the two paths are joined with a slash.
+ * - Joining for example 'http://' and 'www.example.com' is also supported.
+ */
+function join(aRoot, aPath) {
+  if (aRoot === "") {
+    aRoot = ".";
+  }
+  if (aPath === "") {
+    aPath = ".";
+  }
+  var aPathUrl = urlParse(aPath);
+  var aRootUrl = urlParse(aRoot);
+  if (aRootUrl) {
+    aRoot = aRootUrl.path || '/';
+  }
+
+  // `join(foo, '//www.example.org')`
+  if (aPathUrl && !aPathUrl.scheme) {
+    if (aRootUrl) {
+      aPathUrl.scheme = aRootUrl.scheme;
+    }
+    return urlGenerate(aPathUrl);
+  }
+
+  if (aPathUrl || aPath.match(dataUrlRegexp)) {
+    return aPath;
+  }
+
+  // `join('http://', 'www.example.com')`
+  if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {
+    aRootUrl.host = aPath;
+    return urlGenerate(aRootUrl);
+  }
+
+  var joined = aPath.charAt(0) === '/'
+    ? aPath
+    : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath);
+
+  if (aRootUrl) {
+    aRootUrl.path = joined;
+    return urlGenerate(aRootUrl);
+  }
+  return joined;
+}
+exports.join = join;
+
+exports.isAbsolute = function (aPath) {
+  return aPath.charAt(0) === '/' || !!aPath.match(urlRegexp);
+};
+
+/**
+ * Make a path relative to a URL or another path.
+ *
+ * @param aRoot The root path or URL.
+ * @param aPath The path or URL to be made relative to aRoot.
+ */
+function relative(aRoot, aPath) {
+  if (aRoot === "") {
+    aRoot = ".";
+  }
+
+  aRoot = aRoot.replace(/\/$/, '');
+
+  // It is possible for the path to be above the root. In this case, simply
+  // checking whether the root is a prefix of the path won't work. Instead, we
+  // need to remove components from the root one by one, until either we find
+  // a prefix that fits, or we run out of components to remove.
+  var level = 0;
+  while (aPath.indexOf(aRoot + '/') !== 0) {
+    var index = aRoot.lastIndexOf("/");
+    if (index < 0) {
+      return aPath;
+    }
+
+    // If the only part of the root that is left is the scheme (i.e. http://,
+    // file:///, etc.), one or more slashes (/), or simply nothing at all, we
+    // have exhausted all components, so the path is not relative to the root.
+    aRoot = aRoot.slice(0, index);
+    if (aRoot.match(/^([^\/]+:\/)?\/*$/)) {
+      return aPath;
+    }
+
+    ++level;
+  }
+
+  // Make sure we add a "../" for each component we removed from the root.
+  return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1);
+}
+exports.relative = relative;
+
+var supportsNullProto = (function () {
+  var obj = Object.create(null);
+  return !('__proto__' in obj);
+}());
+
+function identity (s) {
+  return s;
+}
+
+/**
+ * Because behavior goes wacky when you set `__proto__` on objects, we
+ * have to prefix all the strings in our set with an arbitrary character.
+ *
+ * See https://github.com/mozilla/source-map/pull/31 and
+ * https://github.com/mozilla/source-map/issues/30
+ *
+ * @param String aStr
+ */
+function toSetString(aStr) {
+  if (isProtoString(aStr)) {
+    return '$' + aStr;
+  }
+
+  return aStr;
+}
+exports.toSetString = supportsNullProto ? identity : toSetString;
+
+function fromSetString(aStr) {
+  if (isProtoString(aStr)) {
+    return aStr.slice(1);
+  }
+
+  return aStr;
+}
+exports.fromSetString = supportsNullProto ? identity : fromSetString;
+
+function isProtoString(s) {
+  if (!s) {
+    return false;
+  }
+
+  var length = s.length;
+
+  if (length < 9 /* "__proto__".length */) {
+    return false;
+  }
+
+  if (s.charCodeAt(length - 1) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 2) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 3) !== 111 /* 'o' */ ||
+      s.charCodeAt(length - 4) !== 116 /* 't' */ ||
+      s.charCodeAt(length - 5) !== 111 /* 'o' */ ||
+      s.charCodeAt(length - 6) !== 114 /* 'r' */ ||
+      s.charCodeAt(length - 7) !== 112 /* 'p' */ ||
+      s.charCodeAt(length - 8) !== 95  /* '_' */ ||
+      s.charCodeAt(length - 9) !== 95  /* '_' */) {
+    return false;
+  }
+
+  for (var i = length - 10; i >= 0; i--) {
+    if (s.charCodeAt(i) !== 36 /* '$' */) {
+      return false;
+    }
+  }
+
+  return true;
+}
+
+/**
+ * Comparator between two mappings where the original positions are compared.
+ *
+ * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+ * mappings with the same original source/line/column, but different generated
+ * line and column the same. Useful when searching for a mapping with a
+ * stubbed out mapping.
+ */
+function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {
+  var cmp = mappingA.source - mappingB.source;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0 || onlyCompareOriginal) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return mappingA.name - mappingB.name;
+}
+exports.compareByOriginalPositions = compareByOriginalPositions;
+
+/**
+ * Comparator between two mappings with deflated source and name indices where
+ * the generated positions are compared.
+ *
+ * Optionally pass in `true` as `onlyCompareGenerated` to consider two
+ * mappings with the same generated line and column, but different
+ * source/name/original line and column the same. Useful when searching for a
+ * mapping with a stubbed out mapping.
+ */
+function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {
+  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0 || onlyCompareGenerated) {
+    return cmp;
+  }
+
+  cmp = mappingA.source - mappingB.source;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return mappingA.name - mappingB.name;
+}
+exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;
+
+function strcmp(aStr1, aStr2) {
+  if (aStr1 === aStr2) {
+    return 0;
+  }
+
+  if (aStr1 > aStr2) {
+    return 1;
+  }
+
+  return -1;
+}
+
+/**
+ * Comparator between two mappings with inflated source and name strings where
+ * the generated positions are compared.
+ */
+function compareByGeneratedPositionsInflated(mappingA, mappingB) {
+  var cmp = mappingA.generatedLine - mappingB.generatedLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.generatedColumn - mappingB.generatedColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = strcmp(mappingA.source, mappingB.source);
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalLine - mappingB.originalLine;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  cmp = mappingA.originalColumn - mappingB.originalColumn;
+  if (cmp !== 0) {
+    return cmp;
+  }
+
+  return strcmp(mappingA.name, mappingB.name);
+}
+exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;
diff --git a/node_modules/@babel/core/node_modules/source-map/package.json b/node_modules/@babel/core/node_modules/source-map/package.json
new file mode 100644
index 00000000..048e3ae8
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/package.json
@@ -0,0 +1,72 @@
+{
+  "name": "source-map",
+  "description": "Generates and consumes source maps",
+  "version": "0.5.7",
+  "homepage": "https://github.com/mozilla/source-map",
+  "author": "Nick Fitzgerald <nfitzgerald@mozilla.com>",
+  "contributors": [
+    "Tobias Koppers <tobias.koppers@googlemail.com>",
+    "Duncan Beevers <duncan@dweebd.com>",
+    "Stephen Crane <scrane@mozilla.com>",
+    "Ryan Seddon <seddon.ryan@gmail.com>",
+    "Miles Elam <miles.elam@deem.com>",
+    "Mihai Bazon <mihai.bazon@gmail.com>",
+    "Michael Ficarra <github.public.email@michael.ficarra.me>",
+    "Todd Wolfson <todd@twolfson.com>",
+    "Alexander Solovyov <alexander@solovyov.net>",
+    "Felix Gnass <fgnass@gmail.com>",
+    "Conrad Irwin <conrad.irwin@gmail.com>",
+    "usrbincc <usrbincc@yahoo.com>",
+    "David Glasser <glasser@davidglasser.net>",
+    "Chase Douglas <chase@newrelic.com>",
+    "Evan Wallace <evan.exe@gmail.com>",
+    "Heather Arthur <fayearthur@gmail.com>",
+    "Hugh Kennedy <hughskennedy@gmail.com>",
+    "David Glasser <glasser@davidglasser.net>",
+    "Simon Lydell <simon.lydell@gmail.com>",
+    "Jmeas Smith <jellyes2@gmail.com>",
+    "Michael Z Goddard <mzgoddard@gmail.com>",
+    "azu <azu@users.noreply.github.com>",
+    "John Gozde <john@gozde.ca>",
+    "Adam Kirkton <akirkton@truefitinnovation.com>",
+    "Chris Montgomery <christopher.montgomery@dowjones.com>",
+    "J. Ryan Stinnett <jryans@gmail.com>",
+    "Jack Herrington <jherrington@walmartlabs.com>",
+    "Chris Truter <jeffpalentine@gmail.com>",
+    "Daniel Espeset <daniel@danielespeset.com>",
+    "Jamie Wong <jamie.lf.wong@gmail.com>",
+    "Eddy Bruël <ejpbruel@mozilla.com>",
+    "Hawken Rives <hawkrives@gmail.com>",
+    "Gilad Peleg <giladp007@gmail.com>",
+    "djchie <djchie.dev@gmail.com>",
+    "Gary Ye <garysye@gmail.com>",
+    "Nicolas Lalevée <nicolas.lalevee@hibnet.org>"
+  ],
+  "repository": {
+    "type": "git",
+    "url": "http://github.com/mozilla/source-map.git"
+  },
+  "main": "./source-map.js",
+  "files": [
+    "source-map.js",
+    "lib/",
+    "dist/source-map.debug.js",
+    "dist/source-map.js",
+    "dist/source-map.min.js",
+    "dist/source-map.min.js.map"
+  ],
+  "engines": {
+    "node": ">=0.10.0"
+  },
+  "license": "BSD-3-Clause",
+  "scripts": {
+    "test": "npm run build && node test/run-tests.js",
+    "build": "webpack --color",
+    "toc": "doctoc --title '## Table of Contents' README.md && doctoc --title '## Table of Contents' CONTRIBUTING.md"
+  },
+  "devDependencies": {
+    "doctoc": "^0.15.0",
+    "webpack": "^1.12.0"
+  },
+  "typings": "source-map"
+}
diff --git a/node_modules/@babel/core/node_modules/source-map/source-map.js b/node_modules/@babel/core/node_modules/source-map/source-map.js
new file mode 100644
index 00000000..bc88fe82
--- /dev/null
+++ b/node_modules/@babel/core/node_modules/source-map/source-map.js
@@ -0,0 +1,8 @@
+/*
+ * Copyright 2009-2011 Mozilla Foundation and contributors
+ * Licensed under the New BSD license. See LICENSE.txt or:
+ * http://opensource.org/licenses/BSD-3-Clause
+ */
+exports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator;
+exports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer;
+exports.SourceNode = require('./lib/source-node').SourceNode;
diff --git a/node_modules/@babel/core/package.json b/node_modules/@babel/core/package.json
new file mode 100644
index 00000000..10b801eb
--- /dev/null
+++ b/node_modules/@babel/core/package.json
@@ -0,0 +1,51 @@
+{
+  "name": "@babel/core",
+  "version": "7.0.0-beta.47",
+  "description": "Babel compiler core.",
+  "main": "lib/index.js",
+  "author": "Sebastian McKenzie <sebmck@gmail.com>",
+  "homepage": "https://babeljs.io/",
+  "license": "MIT",
+  "repository": "https://github.com/babel/babel/tree/master/packages/babel-core",
+  "keywords": [
+    "6to5",
+    "babel",
+    "classes",
+    "const",
+    "es6",
+    "harmony",
+    "let",
+    "modules",
+    "transpile",
+    "transpiler",
+    "var",
+    "babel-core",
+    "compiler"
+  ],
+  "browser": {
+    "./lib/config/files/index.js": "./lib/config/files/index-browser.js",
+    "./lib/transform-file.js": "./lib/transform-file-browser.js",
+    "./lib/transform-file-sync.js": "./lib/transform-file-sync-browser.js"
+  },
+  "dependencies": {
+    "@babel/code-frame": "7.0.0-beta.47",
+    "@babel/generator": "7.0.0-beta.47",
+    "@babel/helpers": "7.0.0-beta.47",
+    "@babel/template": "7.0.0-beta.47",
+    "@babel/traverse": "7.0.0-beta.47",
+    "@babel/types": "7.0.0-beta.47",
+    "babylon": "7.0.0-beta.47",
+    "convert-source-map": "^1.1.0",
+    "debug": "^3.1.0",
+    "json5": "^0.5.0",
+    "lodash": "^4.17.5",
+    "micromatch": "^2.3.11",
+    "resolve": "^1.3.2",
+    "semver": "^5.4.1",
+    "source-map": "^0.5.0"
+  },
+  "devDependencies": {
+    "@babel/helper-transform-fixture-test-runner": "7.0.0-beta.47",
+    "@babel/register": "7.0.0-beta.47"
+  }
+}