switch to vuepress

60 files changed, 14823 insertions, 0 deletions

diff --git a/node_modules/markdown-it/.bin/markdown-it b/node_modules/markdown-it/.bin/markdown-it
new file mode 120000
index 00000000..5b65b773
--- /dev/null
+++ b/node_modules/markdown-it/.bin/markdown-it
@@ -0,0 +1 @@
+../bin/markdown-it.js
\ No newline at end of file
diff --git a/node_modules/markdown-it/CHANGELOG.md b/node_modules/markdown-it/CHANGELOG.md
new file mode 100644
index 00000000..f0914d63
--- /dev/null
+++ b/node_modules/markdown-it/CHANGELOG.md
@@ -0,0 +1,454 @@
+8.4.2 / 2018-02-15
+------------------
+
+- Fix `--no-html` CLI option, #476.
+
+
+8.4.1 / 2018-02-15
+------------------
+
+- Fix smartquotes around softbreaks, #430.
+
+
+8.4.0 / 2017-08-24
+------------------
+
+- Updated CM spec compatibility to 0.28.
+
+
+8.3.2 / 2017-08-03
+------------------
+
+- Fix blockquote termination inside lists, #386.
+
+
+8.3.1 / 2017-03-06
+------------------
+
+- Fix blockquote termination by list item, #338.
+
+
+8.3.0 / 2017-02-16
+------------------
+
+- Fix table indentation issues, #325, #224.
+- Remove tabs at the beginning of the line in paragraphs.
+- Fix blockquote termination inside indented lists, #329.
+-  Better error message for bad input type, #324.
+
+
+8.2.2 / 2016-12-15
+------------------
+
+- Add `-o` / `--output` option to CLI, #312.
+
+
+8.2.1 / 2016-12-02
+------------------
+
+- Add missed h2..h6 to whitelisted block tags.
+
+
+8.2.0 / 2016-12-01
+------------------
+
+- Updated CM spec compatibility to 0.27 (no significant changes).
+- Fix backticks handle inside tables, #303.
+- Fix edge case for fenced blocks with `~~~` in info, #301.
+- Fix fallback to reference if link is not valid, #302.
+
+
+8.1.0 / 2016-11-03
+------------------
+
+- Make link parse helpers (`md.helpers`) pluggable, #299.
+
+
+8.0.1 / 2016-10-18
+------------------
+
+- Tables: allow tab characters in markup
+
+
+8.0.0 / 2016-09-16
+------------------
+
+- Updated CM spec compatibility to 0.26:
+  - Two consecutive newlines no longer terminate a list.
+  - Ordered list terminating a paragraph can now only start with 1.
+  - Adjust emphasis algorithm (`*foo**bar**baz*` is now parsed as `<strong>`
+    inside `<em>`).
+  - Fix tab width calculation inside lists and blockquotes.
+- Benchmarks src cleanup.
+- Remove testing in old nodes (but still use es5).
+
+
+7.0.1 / 2016-08-16
+------------------
+
+- Fence renderer: fix concat of class array, #276.
+- Code renderer: do not render double space before attrs, #275.
+- Replacer: disable replacements inside autolinks, #272.
+
+
+7.0.0 / 2016-06-22
+------------------
+
+- Bump `linkify-it` dependency to 2.0.0.
+  - `---` no longer terminates autodetected links by default.
+  - `md.linkifier.set('---', true)` will return old behaviour.
+- Major version bumped, because internals or `linkify-it` was changed.
+  You will not be affected anyhow, if not used direct access to
+  `require('linkify-it/re')` for customizations.
+
+
+6.1.1 / 2016-06-21
+------------------
+
+- Render `code_inline` & `code_block` attributes if exist.
+
+
+6.1.0 / 2016-06-19
+------------------
+
+- Updated `fence` renderer to not mutate token. Token stream should be
+  immutable after renderer call.
+
+
+6.0.5 / 2016-06-01
+------------------
+
+- Process `\r` the same way as `\n` and `\r\n\`, #252.
+
+
+6.0.4 / 2016-05-30
+------------------
+
+- Added `Token.attrGet()` method for convenience, #251.
+
+
+6.0.3 / 2016-05-30
+------------------
+
+- Security fix: possible ReDOS in `linkify-it` (forced bump of `linkify-it` &
+  `uc-micro` dependencies). New installs will use fixed packages automatically,
+  but we bumped `markdown-it` version for sure & for web builds.
+
+
+6.0.2 / 2016-05-16
+------------------
+
+- Fix: should not escape twice content of image alt attribute, #246.
+
+
+6.0.1 / 2016-04-02
+------------------
+
+- Improve support of missing values in tables, #224.
+
+
+6.0.0 / 2016-02-11
+------------------
+
+- Maintenance release. Version bump caused by notable changes in CM spec
+  (multiline setext headers, no spaces inside links, ...). API was not changed.
+- Fit CM 0.24 spec requirements.
+- Fixed nesting limit check in inline blocks, #197.
+- Fixed posible tail loss in CLI ouput.
+
+
+5.1.0 / 2016-01-07
+------------------
+
+- Token: added `.attrSet()` & `.attrJoin()` methods.
+- Highlighter: allow wrapper override (if result starts with "<pre").
+
+
+5.0.3 / 2016-01-04
+------------------
+
+- Allow single column and mismatched columns count in tables.
+- Smartquotes: take into account adjacent tokens.
+- Fill `content` property in image token with `alt` source.
+
+
+5.0.2 / 2015-11-20
+------------------
+
+- Fix meta information (`token.markup` and `token.info`) for autolink tokens.
+
+
+5.0.1 / 2015-10-30
+------------------
+
+- Improved tables compatibility with github, #120.
+
+
+5.0.0 / 2015-10-05
+------------------
+
+- Internal API change. Due to new CM spec requirements, we had to update
+  internals. That should not touch ordinary users, but can affect some external
+  plugins. If you are plugin developper - see migration guide:
+  https://github.com/markdown-it/markdown-it/blob/master/docs/5.0_migration.md.
+- Updated CM spec compatibility to 0.22:
+  - Keep tabs (don't replace with spaces).
+  - Don't wrap iframes with paragraphs.
+  - Rewritten emphasis algorithm.
+- Fix closure compiler collisions (don't use reserved words), #159.
+
+
+4.4.0 / 2015-07-18
+------------------
+
+- Updated HTML blocks logic to CM 0.21 spec.
+- Minor fixes.
+
+
+4.3.1 / 2015-07-15
+------------------
+
+- Allow numbered lists starting from zero.
+- Fix class name injection in fence renderer.
+
+
+4.3.0 / 2015-06-29
+------------------
+
+- `linkify-it` dependency update (1.2.0). Now accepts dash at the end of links.
+
+
+4.2.2 / 2015-06-10
+------------------
+
+- CM spec 0.20.
+- Added support for multichar substituition in smartquites, #115.
+- Fixed code block render inside blockquites, #116.
+- Doc fixes.
+
+
+4.2.1 / 2015-05-01
+------------------
+
+- Minor emphasis update to match CM spec 0.19.
+
+
+4.2.0 / 2015-04-21
+------------------
+
+- Bumped [linkify-it](https://github.com/markdown-it/linkify-it) version to
+  1.1.0. Now links with IP hosts and without protocols are not linkified by
+  default, due possible collisions with some version numbers patterns (0.5.0.0).
+  You still can return back old behaviour by `md.linkify.set({ fuzzyIP: true })`.
+
+
+4.1.2 / 2015-04-19
+------------------
+
+- Bumped linkifier version. More strict 2-chars tald support for links without
+  schema. Should not linkify things like `io.js` and `node.js`.
+
+
+4.1.1 / 2015-04-15
+------------------
+
+- Improved pipe chars support in table cells, #86 (thanks to @jbt).
+
+
+4.1.0 / 2015-03-31
+------------------
+
+- Security: disabled `data:` URLs by default (except some image mimes), to avoid
+  possible XSS. Version bumped, because features changed (formally). If you did
+  not used `data:` URLs, consider this version as 4.0.4 (no API changes).
+- Simplified link validator code. Now more easy to understand and to copy
+  into your projects for customization.
+
+
+4.0.3 / 2015-03-25
+------------------
+
+- Updated linkifier.
+- Smartquotes rule cleanup (#76).
+- Fixed replacements rule bug in PhantomJS (#77).
+
+
+4.0.2 / 2015-03-22
+------------------
+
+- Fixed emphasis `marker` fields in tokens (#69).
+- Fixed html block tokens with numbers in name (#74).
+
+
+4.0.1 / 2015-03-13
+------------------
+
+- Updated `linkify-it` version.
+- Added custom container plugin demo.
+
+
+4.0.0 / 2015-03-11
+------------------
+
+- Breaking internal API changes. See [v4 migration notes](https://github.com/markdown-it/markdown-it/blob/master/docs/4.0_migration.md). In usual case you will need to update plugins.
+- Token internals changed
+- Unified the most of renderer methods.
+- Changed tokens creation - use `state.push(...)` (see sources)
+- Moved `normalizeUrl()` to root class as `.normalizeLink()` &
+  added `normalizeLinkText()` method.
+- Moved `.validateUrl()` to root class and simplified logic - no more need to
+  replace entities.
+- Joined md unescape & replace entities logic to `utils.unescapeAll()`.
+- Removed `replaceEntities()` in `utils`.
+- `md.utils.lib` now exposes useful libs for plugins.
+- Use entities data from external package.
+- Fixed emphasis regression, caused by CM v0.18 spec (#65).
+
+
+3.1.0 / 2015-03-05
+------------------
+
+- Significantly improved autolinking quality (use `linkify-it` package), #2.
+- Rewritten links normalizer to solve different edge cases (use `mdurl`
+  package), #29.
+- Moved link title entities replace out of renderer.
+- Fixed escaped entities in links (`foo\&amp;/bar`).
+- Improved smartquotes logic, #61.
+- Spec conformance update to 0.18.
+
+
+3.0.7 / 2015-02-22
+------------------
+
+- Match table columns count by header.
+- Added basic CLI support.
+- Added \v \f to valid whitespaces.
+- Use external package for unicode data (punctuation).
+
+
+3.0.6 / 2015-02-12
+------------------
+
+- Fixed hang on long vertical list of links. Appeared in 3.0.5. See #54 for
+  details. Thanks to @fengmk2 for report!
+- Table lines now can have escaped pipe char `\|` (#5).
+- Sync scroll result => source in demo.
+- Moved `normalizeReference()` to utils.
+
+
+3.0.5 / 2015-02-06
+------------------
+
+- Fixed link validator - could skip some kind of javascript links with uppercase
+  digital entities (thanks to @opennota)
+- Significantly improved tests coverage (with dead code removal and other
+  related things).
+
+
+3.0.4 / 2015-01-13
+------------------
+
+- Improved errors processing in url normalizer (for broken sequences).
+- Improved nesting limit processing in inline parser.
+- Reorganised tests & improved coverage.
+- Show inline diffs for failed tests.
+
+
+3.0.3 / 2015-01-11
+------------------
+
+- Fixed punctuation check in emphasis.
+
+
+3.0.2 / 2015-01-09
+------------------
+
+- Allow dashes in HTML tag names (needed for custom HTML tags).
+
+
+3.0.1 / 2015-01-07
+------------------
+
+- Improved link encoder - fix invalid surrogates to avoid errors.
+- Added # to terminator chars.
+
+
+3.0.0 / 2015-01-04
+------------------
+
+- Big split. All "rare" rules moved to external plugins (deflist, abbr, footnote,
+  sub, sup, ins, mark).
+- Updated CM spec conformance to v0.15 (better unicode support).
+- Added `md` (parser instance) link to all state objects (instead of former
+  options/parser).
+- References/Footnotes/Abbrs moved to `block` chain.
+- Input normalization moved to `core` chain.
+- Splitted links and images to separate rules.
+- Renamed some rules.
+- Removed `full` preset. Not needed anymore.
+- enable/disable methods now throw by default on invalid rules (exceptions can
+  be disabled).
+- Fixed inline html comments & cdata parse.
+- Replace NULL characters with 0xFFFD instead of strip.
+- Removed custom fences sugar (overcomplication).
+- Rewritten link components parse helpers.
+- More functions in `md.utils`.
+
+
+2.2.1 / 2014-12-29
+------------------
+
+- Added development info.
+- Fixed line breaks in definitions lists.
+- .use() now pass any number of params to plugins.
+
+
+2.2.0 / 2014-12-28
+------------------
+
+- Updated CM spec conformance to v0.13.
+- API docs.
+- Added 'zero' preset.
+- Fixed several crashes, when some basic rules are disabled
+  (block termination check, references check).
+
+
+2.1.3 / 2014-12-24
+------------------
+
+- Added curring to `set`/`configure`/`enable`/`disable` methods.
+- Demo rework - now can include plugins.
+- Docs update.
+
+
+2.1.2 / 2014-12-23
+------------------
+
+- Exposed helpers into parser instances (for plugins).
+- Removed utils from global export - been in instances seems enougth.
+- Refactored demo & added markdown-it-emoji to it.
+
+
+2.1.1 / 2014-12-22
+------------------
+
+- Refreshed browser builds, missed in prev release.
+- Minor changes.
+
+
+2.1.0 / 2014-12-21
+------------------
+
+- Separated method to enable rules by whitelist (enableOnly).
+- Changed second param of enable/disable ruler methods.
+- Shortcuts in main class for bulk enable/disable rules.
+- ASCII-friendly browserified files.
+- Separate package for spec tests.
+
+
+2.0.0 / 2014-12-20
+------------------
+
+- New project name & home! Now it's `markdown-it`,
+- Sugar for constructor call - `new` is not mandatory now.
+- Renamed presets folder (configs -> presets).
diff --git a/node_modules/markdown-it/LICENSE b/node_modules/markdown-it/LICENSE
new file mode 100644
index 00000000..7ffa058c
--- /dev/null
+++ b/node_modules/markdown-it/LICENSE
@@ -0,0 +1,22 @@
+Copyright (c) 2014 Vitaly Puzrin, Alex Kocharin.
+
+Permission is hereby granted, free of charge, to any person
+obtaining a copy of this software and associated documentation
+files (the "Software"), to deal in the Software without
+restriction, including without limitation the rights to use,
+copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the
+Software is furnished to do so, subject to the following
+conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/markdown-it/README.md b/node_modules/markdown-it/README.md
new file mode 100644
index 00000000..bce39309
--- /dev/null
+++ b/node_modules/markdown-it/README.md
@@ -0,0 +1,294 @@
+# markdown-it
+
+[![Build Status](https://img.shields.io/travis/markdown-it/markdown-it/master.svg?style=flat)](https://travis-ci.org/markdown-it/markdown-it)
+[![NPM version](https://img.shields.io/npm/v/markdown-it.svg?style=flat)](https://www.npmjs.org/package/markdown-it)
+[![Coverage Status](https://coveralls.io/repos/markdown-it/markdown-it/badge.svg?branch=master&service=github)](https://coveralls.io/github/markdown-it/markdown-it?branch=master)
+[![Gitter](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/markdown-it/markdown-it)
+
+> Markdown parser done right. Fast and easy to extend.
+
+__[Live demo](https://markdown-it.github.io)__
+
+- Follows the __[CommonMark spec](http://spec.commonmark.org/)__ + adds syntax extensions & sugar (URL autolinking, typographer).
+- Configurable syntax! You can add new rules and even replace existing ones.
+- High speed.
+- [Safe](https://github.com/markdown-it/markdown-it/tree/master/docs/security.md) by default.
+- Community-written __[plugins](https://www.npmjs.org/browse/keyword/markdown-it-plugin)__ and [other packages](https://www.npmjs.org/browse/keyword/markdown-it) on npm.
+
+__Table of content__
+
+- [Install](#install)
+- [Usage examples](#usage-examples)
+- [API](#api)
+- [Syntax extensions](#syntax-extensions)
+- [Benchmark](#benchmark)
+- [Authors](#authors)
+- [References / Thanks](#references--thanks)
+- [License](#license)
+
+## Install
+
+**node.js** & **bower**:
+
+```bash
+npm install markdown-it --save
+bower install markdown-it --save
+```
+
+**browser (CDN):**
+
+- [jsDeliver CDN](http://www.jsdelivr.com/#!markdown-it "jsDelivr CDN")
+- [cdnjs.com CDN](https://cdnjs.com/libraries/markdown-it "cdnjs.com")
+
+
+## Usage examples
+
+See also:
+
+- __[API documentation](https://markdown-it.github.io/markdown-it/)__ - for more
+  info and examples.
+- [Development info](https://github.com/markdown-it/markdown-it/tree/master/docs) -
+  for plugins writers.
+
+
+### Simple
+
+```js
+// node.js, "classic" way:
+var MarkdownIt = require('markdown-it'),
+    md = new MarkdownIt();
+var result = md.render('# markdown-it rulezz!');
+
+// node.js, the same, but with sugar:
+var md = require('markdown-it')();
+var result = md.render('# markdown-it rulezz!');
+
+// browser without AMD, added to "window" on script load
+// Note, there is no dash in "markdownit".
+var md = window.markdownit();
+var result = md.render('# markdown-it rulezz!');
+```
+
+Single line rendering, without paragraph wrap:
+
+```js
+var md = require('markdown-it')();
+var result = md.renderInline('__markdown-it__ rulezz!');
+```
+
+
+### Init with presets and options
+
+(*) presets define combinations of active rules and options. Can be
+`"commonmark"`, `"zero"` or `"default"` (if skipped). See
+[API docs](https://markdown-it.github.io/markdown-it/#MarkdownIt.new) for more details.
+
+```js
+// commonmark mode
+var md = require('markdown-it')('commonmark');
+
+// default mode
+var md = require('markdown-it')();
+
+// enable everything
+var md = require('markdown-it')({
+  html: true,
+  linkify: true,
+  typographer: true
+});
+
+// full options list (defaults)
+var md = require('markdown-it')({
+  html:         false,        // Enable HTML tags in source
+  xhtmlOut:     false,        // Use '/' to close single tags (<br />).
+                              // This is only for full CommonMark compatibility.
+  breaks:       false,        // Convert '\n' in paragraphs into <br>
+  langPrefix:   'language-',  // CSS language prefix for fenced blocks. Can be
+                              // useful for external highlighters.
+  linkify:      false,        // Autoconvert URL-like text to links
+
+  // Enable some language-neutral replacement + quotes beautification
+  typographer:  false,
+
+  // Double + single quotes replacement pairs, when typographer enabled,
+  // and smartquotes on. Could be either a String or an Array.
+  //
+  // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+  // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+  quotes: '“”‘’',
+
+  // Highlighter function. Should return escaped HTML,
+  // or '' if the source string is not changed and should be escaped externally.
+  // If result starts with <pre... internal wrapper is skipped.
+  highlight: function (/*str, lang*/) { return ''; }
+});
+```
+
+### Plugins load
+
+```js
+var md = require('markdown-it')()
+            .use(plugin1)
+            .use(plugin2, opts, ...)
+            .use(plugin3);
+```
+
+
+### Syntax highlighting
+
+Apply syntax highlighting to fenced code blocks with the `highlight` option:
+
+```js
+var hljs = require('highlight.js'); // https://highlightjs.org/
+
+// Actual default values
+var md = require('markdown-it')({
+  highlight: function (str, lang) {
+    if (lang && hljs.getLanguage(lang)) {
+      try {
+        return hljs.highlight(lang, str).value;
+      } catch (__) {}
+    }
+
+    return ''; // use external default escaping
+  }
+});
+```
+
+Or with full wrapper override (if you need assign class to `<pre>`):
+
+```js
+var hljs = require('highlight.js'); // https://highlightjs.org/
+
+// Actual default values
+var md = require('markdown-it')({
+  highlight: function (str, lang) {
+    if (lang && hljs.getLanguage(lang)) {
+      try {
+        return '<pre class="hljs"><code>' +
+               hljs.highlight(lang, str, true).value +
+               '</code></pre>';
+      } catch (__) {}
+    }
+
+    return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>';
+  }
+});
+```
+
+### Linkify
+
+`linkify: true` uses [linkify-it](https://github.com/markdown-it/linkify-it). To
+configure linkify-it, access the linkify instance through `md.linkify`:
+
+```js
+md.linkify.tlds('.py', false);  // disables .py as top level domain
+```
+
+
+## API
+
+__[API documentation](https://markdown-it.github.io/markdown-it/)__
+
+If you are going to write plugins - take a look at
+[Development info](https://github.com/markdown-it/markdown-it/tree/master/docs).
+
+
+## Syntax extensions
+
+Embedded (enabled by default):
+
+- [Tables](https://help.github.com/articles/organizing-information-with-tables/) (GFM)
+- [Strikethrough](https://help.github.com/articles/basic-writing-and-formatting-syntax/#styling-text) (GFM)
+
+Via plugins:
+
+- [subscript](https://github.com/markdown-it/markdown-it-sub)
+- [superscript](https://github.com/markdown-it/markdown-it-sup)
+- [footnote](https://github.com/markdown-it/markdown-it-footnote)
+- [definition list](https://github.com/markdown-it/markdown-it-deflist)
+- [abbreviation](https://github.com/markdown-it/markdown-it-abbr)
+- [emoji](https://github.com/markdown-it/markdown-it-emoji)
+- [custom container](https://github.com/markdown-it/markdown-it-container)
+- [insert](https://github.com/markdown-it/markdown-it-ins)
+- [mark](https://github.com/markdown-it/markdown-it-mark)
+- ... and [others](https://www.npmjs.org/browse/keyword/markdown-it-plugin)
+
+
+### Manage rules
+
+By default all rules are enabled, but can be restricted by options. On plugin
+load all its rules are enabled automatically.
+
+```js
+// Activate/deactivate rules, with curring
+var md = require('markdown-it')()
+            .disable([ 'link', 'image' ])
+            .enable([ 'link' ])
+            .enable('image');
+
+// Enable everything
+md = require('markdown-it')({
+  html: true,
+  linkify: true,
+  typographer: true,
+});
+```
+
+
+## Benchmark
+
+Here is the result of readme parse at MB Pro Retina 2013 (2.4 GHz):
+
+```bash
+make benchmark-deps
+benchmark/benchmark.js readme
+
+Selected samples: (1 of 28)
+ > README
+
+Sample: README.md (7774 bytes)
+ > commonmark-reference x 1,222 ops/sec ±0.96% (97 runs sampled)
+ > current x 743 ops/sec ±0.84% (97 runs sampled)
+ > current-commonmark x 1,568 ops/sec ±0.84% (98 runs sampled)
+ > marked x 1,587 ops/sec ±4.31% (93 runs sampled)
+```
+
+__Note.__ CommonMark version runs with [simplified link normalizers](https://github.com/markdown-it/markdown-it/blob/master/benchmark/implementations/current-commonmark/index.js)
+for more "honest" compare. Difference is ~ 1.5x.
+
+As you can see, `markdown-it` doesn't pay with speed for it's flexibility.
+Slowdown of "full" version caused by additional features not available in
+other implementations.
+
+
+## Authors
+
+- Alex Kocharin [github/rlidwka](https://github.com/rlidwka)
+- Vitaly Puzrin [github/puzrin](https://github.com/puzrin)
+
+_markdown-it_ is the result of the decision of the authors who contributed to
+99% of the _Remarkable_ code to move to a project with the same authorship but
+new leadership (Vitaly and Alex). It's not a fork.
+
+## References / Thanks
+
+Big thanks to [John MacFarlane](https://github.com/jgm) for his work on the
+CommonMark spec and reference implementations. His work saved us a lot of time
+during this project's development.
+
+**Related Links:**
+
+- https://github.com/jgm/CommonMark - reference CommonMark implementations in C & JS,
+  also contains latest spec & online demo.
+- http://talk.commonmark.org - CommonMark forum, good place to collaborate
+  developers' efforts.
+
+**Ports**
+
+- [motion-markdown-it](https://github.com/digitalmoksha/motion-markdown-it) - Ruby/RubyMotion
+
+
+## License
+
+[MIT](https://github.com/markdown-it/markdown-it/blob/master/LICENSE)
diff --git a/node_modules/markdown-it/bin/markdown-it.js b/node_modules/markdown-it/bin/markdown-it.js
new file mode 100755
index 00000000..5bd321c5
--- /dev/null
+++ b/node_modules/markdown-it/bin/markdown-it.js
@@ -0,0 +1,113 @@
+#!/usr/bin/env node
+/*eslint no-console:0*/
+
+'use strict';
+
+
+var fs = require('fs');
+var argparse = require('argparse');
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+var cli = new argparse.ArgumentParser({
+  prog: 'markdown-it',
+  version: require('../package.json').version,
+  addHelp: true
+});
+
+cli.addArgument([ '--no-html' ], {
+  help:   'Disable embedded HTML',
+  action: 'storeTrue'
+});
+
+cli.addArgument([ '-l', '--linkify' ], {
+  help:   'Autolink text',
+  action: 'storeTrue'
+});
+
+cli.addArgument([ '-t', '--typographer' ], {
+  help:   'Enable smartquotes and other typographic replacements',
+  action: 'storeTrue'
+});
+
+cli.addArgument([ '--trace' ], {
+  help:   'Show stack trace on error',
+  action: 'storeTrue'
+});
+
+cli.addArgument([ 'file' ], {
+  help: 'File to read',
+  nargs: '?',
+  defaultValue: '-'
+});
+
+cli.addArgument([ '-o', '--output' ], {
+  help: 'File to write',
+  defaultValue: '-'
+});
+
+var options = cli.parseArgs();
+
+
+function readFile(filename, encoding, callback) {
+  if (options.file === '-') {
+    // read from stdin
+    var chunks = [];
+
+    process.stdin.on('data', function (chunk) { chunks.push(chunk); });
+
+    process.stdin.on('end', function () {
+      return callback(null, Buffer.concat(chunks).toString(encoding));
+    });
+  } else {
+    fs.readFile(filename, encoding, callback);
+  }
+}
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+readFile(options.file, 'utf8', function (err, input) {
+  var output, md;
+
+  if (err) {
+    if (err.code === 'ENOENT') {
+      console.error('File not found: ' + options.file);
+      process.exit(2);
+    }
+
+    console.error(
+      options.trace && err.stack ||
+      err.message ||
+      String(err));
+
+    process.exit(1);
+  }
+
+  md = require('..')({
+    html: !options.no_html,
+    xhtmlOut: false,
+    typographer: options.typographer,
+    linkify: options.linkify
+  });
+
+  try {
+    output = md.render(input);
+
+  } catch (e) {
+    console.error(
+      options.trace && e.stack ||
+      e.message ||
+      String(e));
+
+    process.exit(1);
+  }
+
+  if (options.output === '-') {
+    // write to stdout
+    process.stdout.write(output);
+  } else {
+    fs.writeFileSync(options.output, output);
+  }
+});
diff --git a/node_modules/markdown-it/dist/markdown-it.js b/node_modules/markdown-it/dist/markdown-it.js
new file mode 100644
index 00000000..cedb7881
--- /dev/null
+++ b/node_modules/markdown-it/dist/markdown-it.js
@@ -0,0 +1,7965 @@
+/*! markdown-it 8.4.2 https://github.com//markdown-it/markdown-it @license MIT */(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.markdownit = f()}})(function(){var define,module,exports;return (function(){function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s}return e})()({1:[function(require,module,exports){
+// HTML5 entities map: { name -> utf16string }
+//
+'use strict';
+
+/*eslint quotes:0*/
+module.exports = require('entities/maps/entities.json');
+
+},{"entities/maps/entities.json":52}],2:[function(require,module,exports){
+// List of valid html blocks names, accorting to commonmark spec
+// http://jgm.github.io/CommonMark/spec.html#html-blocks
+
+'use strict';
+
+
+module.exports = [
+  'address',
+  'article',
+  'aside',
+  'base',
+  'basefont',
+  'blockquote',
+  'body',
+  'caption',
+  'center',
+  'col',
+  'colgroup',
+  'dd',
+  'details',
+  'dialog',
+  'dir',
+  'div',
+  'dl',
+  'dt',
+  'fieldset',
+  'figcaption',
+  'figure',
+  'footer',
+  'form',
+  'frame',
+  'frameset',
+  'h1',
+  'h2',
+  'h3',
+  'h4',
+  'h5',
+  'h6',
+  'head',
+  'header',
+  'hr',
+  'html',
+  'iframe',
+  'legend',
+  'li',
+  'link',
+  'main',
+  'menu',
+  'menuitem',
+  'meta',
+  'nav',
+  'noframes',
+  'ol',
+  'optgroup',
+  'option',
+  'p',
+  'param',
+  'section',
+  'source',
+  'summary',
+  'table',
+  'tbody',
+  'td',
+  'tfoot',
+  'th',
+  'thead',
+  'title',
+  'tr',
+  'track',
+  'ul'
+];
+
+},{}],3:[function(require,module,exports){
+// Regexps to match html elements
+
+'use strict';
+
+var attr_name     = '[a-zA-Z_:][a-zA-Z0-9:._-]*';
+
+var unquoted      = '[^"\'=<>`\\x00-\\x20]+';
+var single_quoted = "'[^']*'";
+var double_quoted = '"[^"]*"';
+
+var attr_value  = '(?:' + unquoted + '|' + single_quoted + '|' + double_quoted + ')';
+
+var attribute   = '(?:\\s+' + attr_name + '(?:\\s*=\\s*' + attr_value + ')?)';
+
+var open_tag    = '<[A-Za-z][A-Za-z0-9\\-]*' + attribute + '*\\s*\\/?>';
+
+var close_tag   = '<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>';
+var comment     = '<!---->|<!--(?:-?[^>-])(?:-?[^-])*-->';
+var processing  = '<[?].*?[?]>';
+var declaration = '<![A-Z]+\\s+[^>]*>';
+var cdata       = '<!\\[CDATA\\[[\\s\\S]*?\\]\\]>';
+
+var HTML_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + '|' + comment +
+                        '|' + processing + '|' + declaration + '|' + cdata + ')');
+var HTML_OPEN_CLOSE_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + ')');
+
+module.exports.HTML_TAG_RE = HTML_TAG_RE;
+module.exports.HTML_OPEN_CLOSE_TAG_RE = HTML_OPEN_CLOSE_TAG_RE;
+
+},{}],4:[function(require,module,exports){
+// Utilities
+//
+'use strict';
+
+
+function _class(obj) { return Object.prototype.toString.call(obj); }
+
+function isString(obj) { return _class(obj) === '[object String]'; }
+
+var _hasOwnProperty = Object.prototype.hasOwnProperty;
+
+function has(object, key) {
+  return _hasOwnProperty.call(object, key);
+}
+
+// Merge objects
+//
+function assign(obj /*from1, from2, from3, ...*/) {
+  var sources = Array.prototype.slice.call(arguments, 1);
+
+  sources.forEach(function (source) {
+    if (!source) { return; }
+
+    if (typeof source !== 'object') {
+      throw new TypeError(source + 'must be object');
+    }
+
+    Object.keys(source).forEach(function (key) {
+      obj[key] = source[key];
+    });
+  });
+
+  return obj;
+}
+
+// Remove element from array and put another array at those position.
+// Useful for some operations with tokens
+function arrayReplaceAt(src, pos, newElements) {
+  return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1));
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+function isValidEntityCode(c) {
+  /*eslint no-bitwise:0*/
+  // broken sequence
+  if (c >= 0xD800 && c <= 0xDFFF) { return false; }
+  // never used
+  if (c >= 0xFDD0 && c <= 0xFDEF) { return false; }
+  if ((c & 0xFFFF) === 0xFFFF || (c & 0xFFFF) === 0xFFFE) { return false; }
+  // control codes
+  if (c >= 0x00 && c <= 0x08) { return false; }
+  if (c === 0x0B) { return false; }
+  if (c >= 0x0E && c <= 0x1F) { return false; }
+  if (c >= 0x7F && c <= 0x9F) { return false; }
+  // out of range
+  if (c > 0x10FFFF) { return false; }
+  return true;
+}
+
+function fromCodePoint(c) {
+  /*eslint no-bitwise:0*/
+  if (c > 0xffff) {
+    c -= 0x10000;
+    var surrogate1 = 0xd800 + (c >> 10),
+        surrogate2 = 0xdc00 + (c & 0x3ff);
+
+    return String.fromCharCode(surrogate1, surrogate2);
+  }
+  return String.fromCharCode(c);
+}
+
+
+var UNESCAPE_MD_RE  = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g;
+var ENTITY_RE       = /&([a-z#][a-z0-9]{1,31});/gi;
+var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + '|' + ENTITY_RE.source, 'gi');
+
+var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;
+
+var entities = require('./entities');
+
+function replaceEntityPattern(match, name) {
+  var code = 0;
+
+  if (has(entities, name)) {
+    return entities[name];
+  }
+
+  if (name.charCodeAt(0) === 0x23/* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) {
+    code = name[1].toLowerCase() === 'x' ?
+      parseInt(name.slice(2), 16)
+    :
+      parseInt(name.slice(1), 10);
+    if (isValidEntityCode(code)) {
+      return fromCodePoint(code);
+    }
+  }
+
+  return match;
+}
+
+/*function replaceEntities(str) {
+  if (str.indexOf('&') < 0) { return str; }
+
+  return str.replace(ENTITY_RE, replaceEntityPattern);
+}*/
+
+function unescapeMd(str) {
+  if (str.indexOf('\\') < 0) { return str; }
+  return str.replace(UNESCAPE_MD_RE, '$1');
+}
+
+function unescapeAll(str) {
+  if (str.indexOf('\\') < 0 && str.indexOf('&') < 0) { return str; }
+
+  return str.replace(UNESCAPE_ALL_RE, function (match, escaped, entity) {
+    if (escaped) { return escaped; }
+    return replaceEntityPattern(match, entity);
+  });
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+var HTML_ESCAPE_TEST_RE = /[&<>"]/;
+var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g;
+var HTML_REPLACEMENTS = {
+  '&': '&amp;',
+  '<': '&lt;',
+  '>': '&gt;',
+  '"': '&quot;'
+};
+
+function replaceUnsafeChar(ch) {
+  return HTML_REPLACEMENTS[ch];
+}
+
+function escapeHtml(str) {
+  if (HTML_ESCAPE_TEST_RE.test(str)) {
+    return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar);
+  }
+  return str;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g;
+
+function escapeRE(str) {
+  return str.replace(REGEXP_ESCAPE_RE, '\\$&');
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+function isSpace(code) {
+  switch (code) {
+    case 0x09:
+    case 0x20:
+      return true;
+  }
+  return false;
+}
+
+// Zs (unicode class) || [\t\f\v\r\n]
+function isWhiteSpace(code) {
+  if (code >= 0x2000 && code <= 0x200A) { return true; }
+  switch (code) {
+    case 0x09: // \t
+    case 0x0A: // \n
+    case 0x0B: // \v
+    case 0x0C: // \f
+    case 0x0D: // \r
+    case 0x20:
+    case 0xA0:
+    case 0x1680:
+    case 0x202F:
+    case 0x205F:
+    case 0x3000:
+      return true;
+  }
+  return false;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+/*eslint-disable max-len*/
+var UNICODE_PUNCT_RE = require('uc.micro/categories/P/regex');
+
+// Currently without astral characters support.
+function isPunctChar(ch) {
+  return UNICODE_PUNCT_RE.test(ch);
+}
+
+
+// Markdown ASCII punctuation characters.
+//
+// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+// http://spec.commonmark.org/0.15/#ascii-punctuation-character
+//
+// Don't confuse with unicode punctuation !!! It lacks some chars in ascii range.
+//
+function isMdAsciiPunct(ch) {
+  switch (ch) {
+    case 0x21/* ! */:
+    case 0x22/* " */:
+    case 0x23/* # */:
+    case 0x24/* $ */:
+    case 0x25/* % */:
+    case 0x26/* & */:
+    case 0x27/* ' */:
+    case 0x28/* ( */:
+    case 0x29/* ) */:
+    case 0x2A/* * */:
+    case 0x2B/* + */:
+    case 0x2C/* , */:
+    case 0x2D/* - */:
+    case 0x2E/* . */:
+    case 0x2F/* / */:
+    case 0x3A/* : */:
+    case 0x3B/* ; */:
+    case 0x3C/* < */:
+    case 0x3D/* = */:
+    case 0x3E/* > */:
+    case 0x3F/* ? */:
+    case 0x40/* @ */:
+    case 0x5B/* [ */:
+    case 0x5C/* \ */:
+    case 0x5D/* ] */:
+    case 0x5E/* ^ */:
+    case 0x5F/* _ */:
+    case 0x60/* ` */:
+    case 0x7B/* { */:
+    case 0x7C/* | */:
+    case 0x7D/* } */:
+    case 0x7E/* ~ */:
+      return true;
+    default:
+      return false;
+  }
+}
+
+// Hepler to unify [reference labels].
+//
+function normalizeReference(str) {
+  // use .toUpperCase() instead of .toLowerCase()
+  // here to avoid a conflict with Object.prototype
+  // members (most notably, `__proto__`)
+  return str.trim().replace(/\s+/g, ' ').toUpperCase();
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+// Re-export libraries commonly used in both markdown-it and its plugins,
+// so plugins won't have to depend on them explicitly, which reduces their
+// bundled size (e.g. a browser build).
+//
+exports.lib                 = {};
+exports.lib.mdurl           = require('mdurl');
+exports.lib.ucmicro         = require('uc.micro');
+
+exports.assign              = assign;
+exports.isString            = isString;
+exports.has                 = has;
+exports.unescapeMd          = unescapeMd;
+exports.unescapeAll         = unescapeAll;
+exports.isValidEntityCode   = isValidEntityCode;
+exports.fromCodePoint       = fromCodePoint;
+// exports.replaceEntities     = replaceEntities;
+exports.escapeHtml          = escapeHtml;
+exports.arrayReplaceAt      = arrayReplaceAt;
+exports.isSpace             = isSpace;
+exports.isWhiteSpace        = isWhiteSpace;
+exports.isMdAsciiPunct      = isMdAsciiPunct;
+exports.isPunctChar         = isPunctChar;
+exports.escapeRE            = escapeRE;
+exports.normalizeReference  = normalizeReference;
+
+},{"./entities":1,"mdurl":58,"uc.micro":65,"uc.micro/categories/P/regex":63}],5:[function(require,module,exports){
+// Just a shortcut for bulk export
+'use strict';
+
+
+exports.parseLinkLabel       = require('./parse_link_label');
+exports.parseLinkDestination = require('./parse_link_destination');
+exports.parseLinkTitle       = require('./parse_link_title');
+
+},{"./parse_link_destination":6,"./parse_link_label":7,"./parse_link_title":8}],6:[function(require,module,exports){
+// Parse link destination
+//
+'use strict';
+
+
+var isSpace     = require('../common/utils').isSpace;
+var unescapeAll = require('../common/utils').unescapeAll;
+
+
+module.exports = function parseLinkDestination(str, pos, max) {
+  var code, level,
+      lines = 0,
+      start = pos,
+      result = {
+        ok: false,
+        pos: 0,
+        lines: 0,
+        str: ''
+      };
+
+  if (str.charCodeAt(pos) === 0x3C /* < */) {
+    pos++;
+    while (pos < max) {
+      code = str.charCodeAt(pos);
+      if (code === 0x0A /* \n */ || isSpace(code)) { return result; }
+      if (code === 0x3E /* > */) {
+        result.pos = pos + 1;
+        result.str = unescapeAll(str.slice(start + 1, pos));
+        result.ok = true;
+        return result;
+      }
+      if (code === 0x5C /* \ */ && pos + 1 < max) {
+        pos += 2;
+        continue;
+      }
+
+      pos++;
+    }
+
+    // no closing '>'
+    return result;
+  }
+
+  // this should be ... } else { ... branch
+
+  level = 0;
+  while (pos < max) {
+    code = str.charCodeAt(pos);
+
+    if (code === 0x20) { break; }
+
+    // ascii control characters
+    if (code < 0x20 || code === 0x7F) { break; }
+
+    if (code === 0x5C /* \ */ && pos + 1 < max) {
+      pos += 2;
+      continue;
+    }
+
+    if (code === 0x28 /* ( */) {
+      level++;
+    }
+
+    if (code === 0x29 /* ) */) {
+      if (level === 0) { break; }
+      level--;
+    }
+
+    pos++;
+  }
+
+  if (start === pos) { return result; }
+  if (level !== 0) { return result; }
+
+  result.str = unescapeAll(str.slice(start, pos));
+  result.lines = lines;
+  result.pos = pos;
+  result.ok = true;
+  return result;
+};
+
+},{"../common/utils":4}],7:[function(require,module,exports){
+// Parse link label
+//
+// this function assumes that first character ("[") already matches;
+// returns the end of the label
+//
+'use strict';
+
+module.exports = function parseLinkLabel(state, start, disableNested) {
+  var level, found, marker, prevPos,
+      labelEnd = -1,
+      max = state.posMax,
+      oldPos = state.pos;
+
+  state.pos = start + 1;
+  level = 1;
+
+  while (state.pos < max) {
+    marker = state.src.charCodeAt(state.pos);
+    if (marker === 0x5D /* ] */) {
+      level--;
+      if (level === 0) {
+        found = true;
+        break;
+      }
+    }
+
+    prevPos = state.pos;
+    state.md.inline.skipToken(state);
+    if (marker === 0x5B /* [ */) {
+      if (prevPos === state.pos - 1) {
+        // increase level if we find text `[`, which is not a part of any token
+        level++;
+      } else if (disableNested) {
+        state.pos = oldPos;
+        return -1;
+      }
+    }
+  }
+
+  if (found) {
+    labelEnd = state.pos;
+  }
+
+  // restore old state
+  state.pos = oldPos;
+
+  return labelEnd;
+};
+
+},{}],8:[function(require,module,exports){
+// Parse link title
+//
+'use strict';
+
+
+var unescapeAll = require('../common/utils').unescapeAll;
+
+
+module.exports = function parseLinkTitle(str, pos, max) {
+  var code,
+      marker,
+      lines = 0,
+      start = pos,
+      result = {
+        ok: false,
+        pos: 0,
+        lines: 0,
+        str: ''
+      };
+
+  if (pos >= max) { return result; }
+
+  marker = str.charCodeAt(pos);
+
+  if (marker !== 0x22 /* " */ && marker !== 0x27 /* ' */ && marker !== 0x28 /* ( */) { return result; }
+
+  pos++;
+
+  // if opening marker is "(", switch it to closing marker ")"
+  if (marker === 0x28) { marker = 0x29; }
+
+  while (pos < max) {
+    code = str.charCodeAt(pos);
+    if (code === marker) {
+      result.pos = pos + 1;
+      result.lines = lines;
+      result.str = unescapeAll(str.slice(start + 1, pos));
+      result.ok = true;
+      return result;
+    } else if (code === 0x0A) {
+      lines++;
+    } else if (code === 0x5C /* \ */ && pos + 1 < max) {
+      pos++;
+      if (str.charCodeAt(pos) === 0x0A) {
+        lines++;
+      }
+    }
+
+    pos++;
+  }
+
+  return result;
+};
+
+},{"../common/utils":4}],9:[function(require,module,exports){
+// Main parser class
+
+'use strict';
+
+
+var utils        = require('./common/utils');
+var helpers      = require('./helpers');
+var Renderer     = require('./renderer');
+var ParserCore   = require('./parser_core');
+var ParserBlock  = require('./parser_block');
+var ParserInline = require('./parser_inline');
+var LinkifyIt    = require('linkify-it');
+var mdurl        = require('mdurl');
+var punycode     = require('punycode');
+
+
+var config = {
+  'default': require('./presets/default'),
+  zero: require('./presets/zero'),
+  commonmark: require('./presets/commonmark')
+};
+
+////////////////////////////////////////////////////////////////////////////////
+//
+// This validator can prohibit more than really needed to prevent XSS. It's a
+// tradeoff to keep code simple and to be secure by default.
+//
+// If you need different setup - override validator method as you wish. Or
+// replace it with dummy function and use external sanitizer.
+//
+
+var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/;
+var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/;
+
+function validateLink(url) {
+  // url should be normalized at this point, and existing entities are decoded
+  var str = url.trim().toLowerCase();
+
+  return BAD_PROTO_RE.test(str) ? (GOOD_DATA_RE.test(str) ? true : false) : true;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+
+var RECODE_HOSTNAME_FOR = [ 'http:', 'https:', 'mailto:' ];
+
+function normalizeLink(url) {
+  var parsed = mdurl.parse(url, true);
+
+  if (parsed.hostname) {
+    // Encode hostnames in urls like:
+    // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+    //
+    // We don't encode unknown schemas, because it's likely that we encode
+    // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+    //
+    if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+      try {
+        parsed.hostname = punycode.toASCII(parsed.hostname);
+      } catch (er) { /**/ }
+    }
+  }
+
+  return mdurl.encode(mdurl.format(parsed));
+}
+
+function normalizeLinkText(url) {
+  var parsed = mdurl.parse(url, true);
+
+  if (parsed.hostname) {
+    // Encode hostnames in urls like:
+    // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+    //
+    // We don't encode unknown schemas, because it's likely that we encode
+    // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+    //
+    if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+      try {
+        parsed.hostname = punycode.toUnicode(parsed.hostname);
+      } catch (er) { /**/ }
+    }
+  }
+
+  return mdurl.decode(mdurl.format(parsed));
+}
+
+
+/**
+ * class MarkdownIt
+ *
+ * Main parser/renderer class.
+ *
+ * ##### Usage
+ *
+ * ```javascript
+ * // node.js, "classic" way:
+ * var MarkdownIt = require('markdown-it'),
+ *     md = new MarkdownIt();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // node.js, the same, but with sugar:
+ * var md = require('markdown-it')();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // browser without AMD, added to "window" on script load
+ * // Note, there are no dash.
+ * var md = window.markdownit();
+ * var result = md.render('# markdown-it rulezz!');
+ * ```
+ *
+ * Single line rendering, without paragraph wrap:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ * var result = md.renderInline('__markdown-it__ rulezz!');
+ * ```
+ **/
+
+/**
+ * new MarkdownIt([presetName, options])
+ * - presetName (String): optional, `commonmark` / `zero`
+ * - options (Object)
+ *
+ * Creates parser instanse with given config. Can be called without `new`.
+ *
+ * ##### presetName
+ *
+ * MarkdownIt provides named presets as a convenience to quickly
+ * enable/disable active syntax rules and options for common use cases.
+ *
+ * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) -
+ *   configures parser to strict [CommonMark](http://commonmark.org/) mode.
+ * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) -
+ *   similar to GFM, used when no preset name given. Enables all available rules,
+ *   but still without html, typographer & autolinker.
+ * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) -
+ *   all rules disabled. Useful to quickly setup your config via `.enable()`.
+ *   For example, when you need only `bold` and `italic` markup and nothing else.
+ *
+ * ##### options:
+ *
+ * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful!
+ *   That's not safe! You may need external sanitizer to protect output from XSS.
+ *   It's better to extend features via plugins, instead of enabling HTML.
+ * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags
+ *   (`<br />`). This is needed only for full CommonMark compatibility. In real
+ *   world you will need HTML output.
+ * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`.
+ * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks.
+ *   Can be useful for external highlighters.
+ * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links.
+ * - __typographer__  - `false`. Set `true` to enable [some language-neutral
+ *   replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) +
+ *   quotes beautification (smartquotes).
+ * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement
+ *   pairs, when typographer enabled and smartquotes on. For example, you can
+ *   use `'«»„“'` for Russian, `'„“‚‘'` for German, and
+ *   `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp).
+ * - __highlight__ - `null`. Highlighter function for fenced code blocks.
+ *   Highlighter `function (str, lang)` should return escaped HTML. It can also
+ *   return empty string if the source was not changed and should be escaped
+ *   externaly. If result starts with <pre... internal wrapper is skipped.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * // commonmark mode
+ * var md = require('markdown-it')('commonmark');
+ *
+ * // default mode
+ * var md = require('markdown-it')();
+ *
+ * // enable everything
+ * var md = require('markdown-it')({
+ *   html: true,
+ *   linkify: true,
+ *   typographer: true
+ * });
+ * ```
+ *
+ * ##### Syntax highlighting
+ *
+ * ```js
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * var md = require('markdown-it')({
+ *   highlight: function (str, lang) {
+ *     if (lang && hljs.getLanguage(lang)) {
+ *       try {
+ *         return hljs.highlight(lang, str, true).value;
+ *       } catch (__) {}
+ *     }
+ *
+ *     return ''; // use external default escaping
+ *   }
+ * });
+ * ```
+ *
+ * Or with full wrapper override (if you need assign class to `<pre>`):
+ *
+ * ```javascript
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * // Actual default values
+ * var md = require('markdown-it')({
+ *   highlight: function (str, lang) {
+ *     if (lang && hljs.getLanguage(lang)) {
+ *       try {
+ *         return '<pre class="hljs"><code>' +
+ *                hljs.highlight(lang, str, true).value +
+ *                '</code></pre>';
+ *       } catch (__) {}
+ *     }
+ *
+ *     return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>';
+ *   }
+ * });
+ * ```
+ *
+ **/
+function MarkdownIt(presetName, options) {
+  if (!(this instanceof MarkdownIt)) {
+    return new MarkdownIt(presetName, options);
+  }
+
+  if (!options) {
+    if (!utils.isString(presetName)) {
+      options = presetName || {};
+      presetName = 'default';
+    }
+  }
+
+  /**
+   * MarkdownIt#inline -> ParserInline
+   *
+   * Instance of [[ParserInline]]. You may need it to add new rules when
+   * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+   * [[MarkdownIt.enable]].
+   **/
+  this.inline = new ParserInline();
+
+  /**
+   * MarkdownIt#block -> ParserBlock
+   *
+   * Instance of [[ParserBlock]]. You may need it to add new rules when
+   * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+   * [[MarkdownIt.enable]].
+   **/
+  this.block = new ParserBlock();
+
+  /**
+   * MarkdownIt#core -> Core
+   *
+   * Instance of [[Core]] chain executor. You may need it to add new rules when
+   * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+   * [[MarkdownIt.enable]].
+   **/
+  this.core = new ParserCore();
+
+  /**
+   * MarkdownIt#renderer -> Renderer
+   *
+   * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering
+   * rules for new token types, generated by plugins.
+   *
+   * ##### Example
+   *
+   * ```javascript
+   * var md = require('markdown-it')();
+   *
+   * function myToken(tokens, idx, options, env, self) {
+   *   //...
+   *   return result;
+   * };
+   *
+   * md.renderer.rules['my_token'] = myToken
+   * ```
+   *
+   * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js).
+   **/
+  this.renderer = new Renderer();
+
+  /**
+   * MarkdownIt#linkify -> LinkifyIt
+   *
+   * [linkify-it](https://github.com/markdown-it/linkify-it) instance.
+   * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js)
+   * rule.
+   **/
+  this.linkify = new LinkifyIt();
+
+  /**
+   * MarkdownIt#validateLink(url) -> Boolean
+   *
+   * Link validation function. CommonMark allows too much in links. By default
+   * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas
+   * except some embedded image types.
+   *
+   * You can change this behaviour:
+   *
+   * ```javascript
+   * var md = require('markdown-it')();
+   * // enable everything
+   * md.validateLink = function () { return true; }
+   * ```
+   **/
+  this.validateLink = validateLink;
+
+  /**
+   * MarkdownIt#normalizeLink(url) -> String
+   *
+   * Function used to encode link url to a machine-readable format,
+   * which includes url-encoding, punycode, etc.
+   **/
+  this.normalizeLink = normalizeLink;
+
+  /**
+   * MarkdownIt#normalizeLinkText(url) -> String
+   *
+   * Function used to decode link url to a human-readable format`
+   **/
+  this.normalizeLinkText = normalizeLinkText;
+
+
+  // Expose utils & helpers for easy acces from plugins
+
+  /**
+   * MarkdownIt#utils -> utils
+   *
+   * Assorted utility functions, useful to write plugins. See details
+   * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js).
+   **/
+  this.utils = utils;
+
+  /**
+   * MarkdownIt#helpers -> helpers
+   *
+   * Link components parser functions, useful to write plugins. See details
+   * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers).
+   **/
+  this.helpers = utils.assign({}, helpers);
+
+
+  this.options = {};
+  this.configure(presetName);
+
+  if (options) { this.set(options); }
+}
+
+
+/** chainable
+ * MarkdownIt.set(options)
+ *
+ * Set parser options (in the same format as in constructor). Probably, you
+ * will never need it, but you can change options after constructor call.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ *             .set({ html: true, breaks: true })
+ *             .set({ typographer, true });
+ * ```
+ *
+ * __Note:__ To achieve the best possible performance, don't modify a
+ * `markdown-it` instance options on the fly. If you need multiple configurations
+ * it's best to create multiple instances and initialize each with separate
+ * config.
+ **/
+MarkdownIt.prototype.set = function (options) {
+  utils.assign(this.options, options);
+  return this;
+};
+
+
+/** chainable, internal
+ * MarkdownIt.configure(presets)
+ *
+ * Batch load of all options and compenent settings. This is internal method,
+ * and you probably will not need it. But if you with - see available presets
+ * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets)
+ *
+ * We strongly recommend to use presets instead of direct config loads. That
+ * will give better compatibility with next versions.
+ **/
+MarkdownIt.prototype.configure = function (presets) {
+  var self = this, presetName;
+
+  if (utils.isString(presets)) {
+    presetName = presets;
+    presets = config[presetName];
+    if (!presets) { throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); }
+  }
+
+  if (!presets) { throw new Error('Wrong `markdown-it` preset, can\'t be empty'); }
+
+  if (presets.options) { self.set(presets.options); }
+
+  if (presets.components) {
+    Object.keys(presets.components).forEach(function (name) {
+      if (presets.components[name].rules) {
+        self[name].ruler.enableOnly(presets.components[name].rules);
+      }
+      if (presets.components[name].rules2) {
+        self[name].ruler2.enableOnly(presets.components[name].rules2);
+      }
+    });
+  }
+  return this;
+};
+
+
+/** chainable
+ * MarkdownIt.enable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to enable
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable list or rules. It will automatically find appropriate components,
+ * containing rules with given names. If rule not found, and `ignoreInvalid`
+ * not set - throws exception.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ *             .enable(['sub', 'sup'])
+ *             .disable('smartquotes');
+ * ```
+ **/
+MarkdownIt.prototype.enable = function (list, ignoreInvalid) {
+  var result = [];
+
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  [ 'core', 'block', 'inline' ].forEach(function (chain) {
+    result = result.concat(this[chain].ruler.enable(list, true));
+  }, this);
+
+  result = result.concat(this.inline.ruler2.enable(list, true));
+
+  var missed = list.filter(function (name) { return result.indexOf(name) < 0; });
+
+  if (missed.length && !ignoreInvalid) {
+    throw new Error('MarkdownIt. Failed to enable unknown rule(s): ' + missed);
+  }
+
+  return this;
+};
+
+
+/** chainable
+ * MarkdownIt.disable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * The same as [[MarkdownIt.enable]], but turn specified rules off.
+ **/
+MarkdownIt.prototype.disable = function (list, ignoreInvalid) {
+  var result = [];
+
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  [ 'core', 'block', 'inline' ].forEach(function (chain) {
+    result = result.concat(this[chain].ruler.disable(list, true));
+  }, this);
+
+  result = result.concat(this.inline.ruler2.disable(list, true));
+
+  var missed = list.filter(function (name) { return result.indexOf(name) < 0; });
+
+  if (missed.length && !ignoreInvalid) {
+    throw new Error('MarkdownIt. Failed to disable unknown rule(s): ' + missed);
+  }
+  return this;
+};
+
+
+/** chainable
+ * MarkdownIt.use(plugin, params)
+ *
+ * Load specified plugin with given params into current parser instance.
+ * It's just a sugar to call `plugin(md, params)` with curring.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var iterator = require('markdown-it-for-inline');
+ * var md = require('markdown-it')()
+ *             .use(iterator, 'foo_replace', 'text', function (tokens, idx) {
+ *               tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar');
+ *             });
+ * ```
+ **/
+MarkdownIt.prototype.use = function (plugin /*, params, ... */) {
+  var args = [ this ].concat(Array.prototype.slice.call(arguments, 1));
+  plugin.apply(plugin, args);
+  return this;
+};
+
+
+/** internal
+ * MarkdownIt.parse(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Parse input string and returns list of block tokens (special token type
+ * "inline" will contain list of inline tokens). You should not call this
+ * method directly, until you write custom renderer (for example, to produce
+ * AST).
+ *
+ * `env` is used to pass data between "distributed" rules and return additional
+ * metadata like reference info, needed for the renderer. It also can be used to
+ * inject data in specific cases. Usually, you will be ok to pass `{}`,
+ * and then pass updated object to renderer.
+ **/
+MarkdownIt.prototype.parse = function (src, env) {
+  if (typeof src !== 'string') {
+    throw new Error('Input data should be a String');
+  }
+
+  var state = new this.core.State(src, this, env);
+
+  this.core.process(state);
+
+  return state.tokens;
+};
+
+
+/**
+ * MarkdownIt.render(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Render markdown string into html. It does all magic for you :).
+ *
+ * `env` can be used to inject additional metadata (`{}` by default).
+ * But you will not need it with high probability. See also comment
+ * in [[MarkdownIt.parse]].
+ **/
+MarkdownIt.prototype.render = function (src, env) {
+  env = env || {};
+
+  return this.renderer.render(this.parse(src, env), this.options, env);
+};
+
+
+/** internal
+ * MarkdownIt.parseInline(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the
+ * block tokens list with the single `inline` element, containing parsed inline
+ * tokens in `children` property. Also updates `env` object.
+ **/
+MarkdownIt.prototype.parseInline = function (src, env) {
+  var state = new this.core.State(src, this, env);
+
+  state.inlineMode = true;
+  this.core.process(state);
+
+  return state.tokens;
+};
+
+
+/**
+ * MarkdownIt.renderInline(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Similar to [[MarkdownIt.render]] but for single paragraph content. Result
+ * will NOT be wrapped into `<p>` tags.
+ **/
+MarkdownIt.prototype.renderInline = function (src, env) {
+  env = env || {};
+
+  return this.renderer.render(this.parseInline(src, env), this.options, env);
+};
+
+
+module.exports = MarkdownIt;
+
+},{"./common/utils":4,"./helpers":5,"./parser_block":10,"./parser_core":11,"./parser_inline":12,"./presets/commonmark":13,"./presets/default":14,"./presets/zero":15,"./renderer":16,"linkify-it":53,"mdurl":58,"punycode":60}],10:[function(require,module,exports){
+/** internal
+ * class ParserBlock
+ *
+ * Block-level tokenizer.
+ **/
+'use strict';
+
+
+var Ruler           = require('./ruler');
+
+
+var _rules = [
+  // First 2 params - rule name & source. Secondary array - list of rules,
+  // which can be terminated by this one.
+  [ 'table',      require('./rules_block/table'),      [ 'paragraph', 'reference' ] ],
+  [ 'code',       require('./rules_block/code') ],
+  [ 'fence',      require('./rules_block/fence'),      [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+  [ 'blockquote', require('./rules_block/blockquote'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+  [ 'hr',         require('./rules_block/hr'),         [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+  [ 'list',       require('./rules_block/list'),       [ 'paragraph', 'reference', 'blockquote' ] ],
+  [ 'reference',  require('./rules_block/reference') ],
+  [ 'heading',    require('./rules_block/heading'),    [ 'paragraph', 'reference', 'blockquote' ] ],
+  [ 'lheading',   require('./rules_block/lheading') ],
+  [ 'html_block', require('./rules_block/html_block'), [ 'paragraph', 'reference', 'blockquote' ] ],
+  [ 'paragraph',  require('./rules_block/paragraph') ]
+];
+
+
+/**
+ * new ParserBlock()
+ **/
+function ParserBlock() {
+  /**
+   * ParserBlock#ruler -> Ruler
+   *
+   * [[Ruler]] instance. Keep configuration of block rules.
+   **/
+  this.ruler = new Ruler();
+
+  for (var i = 0; i < _rules.length; i++) {
+    this.ruler.push(_rules[i][0], _rules[i][1], { alt: (_rules[i][2] || []).slice() });
+  }
+}
+
+
+// Generate tokens for input range
+//
+ParserBlock.prototype.tokenize = function (state, startLine, endLine) {
+  var ok, i,
+      rules = this.ruler.getRules(''),
+      len = rules.length,
+      line = startLine,
+      hasEmptyLines = false,
+      maxNesting = state.md.options.maxNesting;
+
+  while (line < endLine) {
+    state.line = line = state.skipEmptyLines(line);
+    if (line >= endLine) { break; }
+
+    // Termination condition for nested calls.
+    // Nested calls currently used for blockquotes & lists
+    if (state.sCount[line] < state.blkIndent) { break; }
+
+    // If nesting level exceeded - skip tail to the end. That's not ordinary
+    // situation and we should not care about content.
+    if (state.level >= maxNesting) {
+      state.line = endLine;
+      break;
+    }
+
+    // Try all possible rules.
+    // On success, rule should:
+    //
+    // - update `state.line`
+    // - update `state.tokens`
+    // - return true
+
+    for (i = 0; i < len; i++) {
+      ok = rules[i](state, line, endLine, false);
+      if (ok) { break; }
+    }
+
+    // set state.tight if we had an empty line before current tag
+    // i.e. latest empty line should not count
+    state.tight = !hasEmptyLines;
+
+    // paragraph might "eat" one newline after it in nested lists
+    if (state.isEmpty(state.line - 1)) {
+      hasEmptyLines = true;
+    }
+
+    line = state.line;
+
+    if (line < endLine && state.isEmpty(line)) {
+      hasEmptyLines = true;
+      line++;
+      state.line = line;
+    }
+  }
+};
+
+
+/**
+ * ParserBlock.parse(str, md, env, outTokens)
+ *
+ * Process input string and push block tokens into `outTokens`
+ **/
+ParserBlock.prototype.parse = function (src, md, env, outTokens) {
+  var state;
+
+  if (!src) { return; }
+
+  state = new this.State(src, md, env, outTokens);
+
+  this.tokenize(state, state.line, state.lineMax);
+};
+
+
+ParserBlock.prototype.State = require('./rules_block/state_block');
+
+
+module.exports = ParserBlock;
+
+},{"./ruler":17,"./rules_block/blockquote":18,"./rules_block/code":19,"./rules_block/fence":20,"./rules_block/heading":21,"./rules_block/hr":22,"./rules_block/html_block":23,"./rules_block/lheading":24,"./rules_block/list":25,"./rules_block/paragraph":26,"./rules_block/reference":27,"./rules_block/state_block":28,"./rules_block/table":29}],11:[function(require,module,exports){
+/** internal
+ * class Core
+ *
+ * Top-level rules executor. Glues block/inline parsers and does intermediate
+ * transformations.
+ **/
+'use strict';
+
+
+var Ruler  = require('./ruler');
+
+
+var _rules = [
+  [ 'normalize',      require('./rules_core/normalize')      ],
+  [ 'block',          require('./rules_core/block')          ],
+  [ 'inline',         require('./rules_core/inline')         ],
+  [ 'linkify',        require('./rules_core/linkify')        ],
+  [ 'replacements',   require('./rules_core/replacements')   ],
+  [ 'smartquotes',    require('./rules_core/smartquotes')    ]
+];
+
+
+/**
+ * new Core()
+ **/
+function Core() {
+  /**
+   * Core#ruler -> Ruler
+   *
+   * [[Ruler]] instance. Keep configuration of core rules.
+   **/
+  this.ruler = new Ruler();
+
+  for (var i = 0; i < _rules.length; i++) {
+    this.ruler.push(_rules[i][0], _rules[i][1]);
+  }
+}
+
+
+/**
+ * Core.process(state)
+ *
+ * Executes core chain rules.
+ **/
+Core.prototype.process = function (state) {
+  var i, l, rules;
+
+  rules = this.ruler.getRules('');
+
+  for (i = 0, l = rules.length; i < l; i++) {
+    rules[i](state);
+  }
+};
+
+Core.prototype.State = require('./rules_core/state_core');
+
+
+module.exports = Core;
+
+},{"./ruler":17,"./rules_core/block":30,"./rules_core/inline":31,"./rules_core/linkify":32,"./rules_core/normalize":33,"./rules_core/replacements":34,"./rules_core/smartquotes":35,"./rules_core/state_core":36}],12:[function(require,module,exports){
+/** internal
+ * class ParserInline
+ *
+ * Tokenizes paragraph content.
+ **/
+'use strict';
+
+
+var Ruler           = require('./ruler');
+
+
+////////////////////////////////////////////////////////////////////////////////
+// Parser rules
+
+var _rules = [
+  [ 'text',            require('./rules_inline/text') ],
+  [ 'newline',         require('./rules_inline/newline') ],
+  [ 'escape',          require('./rules_inline/escape') ],
+  [ 'backticks',       require('./rules_inline/backticks') ],
+  [ 'strikethrough',   require('./rules_inline/strikethrough').tokenize ],
+  [ 'emphasis',        require('./rules_inline/emphasis').tokenize ],
+  [ 'link',            require('./rules_inline/link') ],
+  [ 'image',           require('./rules_inline/image') ],
+  [ 'autolink',        require('./rules_inline/autolink') ],
+  [ 'html_inline',     require('./rules_inline/html_inline') ],
+  [ 'entity',          require('./rules_inline/entity') ]
+];
+
+var _rules2 = [
+  [ 'balance_pairs',   require('./rules_inline/balance_pairs') ],
+  [ 'strikethrough',   require('./rules_inline/strikethrough').postProcess ],
+  [ 'emphasis',        require('./rules_inline/emphasis').postProcess ],
+  [ 'text_collapse',   require('./rules_inline/text_collapse') ]
+];
+
+
+/**
+ * new ParserInline()
+ **/
+function ParserInline() {
+  var i;
+
+  /**
+   * ParserInline#ruler -> Ruler
+   *
+   * [[Ruler]] instance. Keep configuration of inline rules.
+   **/
+  this.ruler = new Ruler();
+
+  for (i = 0; i < _rules.length; i++) {
+    this.ruler.push(_rules[i][0], _rules[i][1]);
+  }
+
+  /**
+   * ParserInline#ruler2 -> Ruler
+   *
+   * [[Ruler]] instance. Second ruler used for post-processing
+   * (e.g. in emphasis-like rules).
+   **/
+  this.ruler2 = new Ruler();
+
+  for (i = 0; i < _rules2.length; i++) {
+    this.ruler2.push(_rules2[i][0], _rules2[i][1]);
+  }
+}
+
+
+// Skip single token by running all rules in validation mode;
+// returns `true` if any rule reported success
+//
+ParserInline.prototype.skipToken = function (state) {
+  var ok, i, pos = state.pos,
+      rules = this.ruler.getRules(''),
+      len = rules.length,
+      maxNesting = state.md.options.maxNesting,
+      cache = state.cache;
+
+
+  if (typeof cache[pos] !== 'undefined') {
+    state.pos = cache[pos];
+    return;
+  }
+
+  if (state.level < maxNesting) {
+    for (i = 0; i < len; i++) {
+      // Increment state.level and decrement it later to limit recursion.
+      // It's harmless to do here, because no tokens are created. But ideally,
+      // we'd need a separate private state variable for this purpose.
+      //
+      state.level++;
+      ok = rules[i](state, true);
+      state.level--;
+
+      if (ok) { break; }
+    }
+  } else {
+    // Too much nesting, just skip until the end of the paragraph.
+    //
+    // NOTE: this will cause links to behave incorrectly in the following case,
+    //       when an amount of `[` is exactly equal to `maxNesting + 1`:
+    //
+    //       [[[[[[[[[[[[[[[[[[[[[foo]()
+    //
+    // TODO: remove this workaround when CM standard will allow nested links
+    //       (we can replace it by preventing links from being parsed in
+    //       validation mode)
+    //
+    state.pos = state.posMax;
+  }
+
+  if (!ok) { state.pos++; }
+  cache[pos] = state.pos;
+};
+
+
+// Generate tokens for input range
+//
+ParserInline.prototype.tokenize = function (state) {
+  var ok, i,
+      rules = this.ruler.getRules(''),
+      len = rules.length,
+      end = state.posMax,
+      maxNesting = state.md.options.maxNesting;
+
+  while (state.pos < end) {
+    // Try all possible rules.
+    // On success, rule should:
+    //
+    // - update `state.pos`
+    // - update `state.tokens`
+    // - return true
+
+    if (state.level < maxNesting) {
+      for (i = 0; i < len; i++) {
+        ok = rules[i](state, false);
+        if (ok) { break; }
+      }
+    }
+
+    if (ok) {
+      if (state.pos >= end) { break; }
+      continue;
+    }
+
+    state.pending += state.src[state.pos++];
+  }
+
+  if (state.pending) {
+    state.pushPending();
+  }
+};
+
+
+/**
+ * ParserInline.parse(str, md, env, outTokens)
+ *
+ * Process input string and push inline tokens into `outTokens`
+ **/
+ParserInline.prototype.parse = function (str, md, env, outTokens) {
+  var i, rules, len;
+  var state = new this.State(str, md, env, outTokens);
+
+  this.tokenize(state);
+
+  rules = this.ruler2.getRules('');
+  len = rules.length;
+
+  for (i = 0; i < len; i++) {
+    rules[i](state);
+  }
+};
+
+
+ParserInline.prototype.State = require('./rules_inline/state_inline');
+
+
+module.exports = ParserInline;
+
+},{"./ruler":17,"./rules_inline/autolink":37,"./rules_inline/backticks":38,"./rules_inline/balance_pairs":39,"./rules_inline/emphasis":40,"./rules_inline/entity":41,"./rules_inline/escape":42,"./rules_inline/html_inline":43,"./rules_inline/image":44,"./rules_inline/link":45,"./rules_inline/newline":46,"./rules_inline/state_inline":47,"./rules_inline/strikethrough":48,"./rules_inline/text":49,"./rules_inline/text_collapse":50}],13:[function(require,module,exports){
+// Commonmark default options
+
+'use strict';
+
+
+module.exports = {
+  options: {
+    html:         true,         // Enable HTML tags in source
+    xhtmlOut:     true,         // Use '/' to close single tags (<br />)
+    breaks:       false,        // Convert '\n' in paragraphs into <br>
+    langPrefix:   'language-',  // CSS language prefix for fenced blocks
+    linkify:      false,        // autoconvert URL-like texts to links
+
+    // Enable some language-neutral replacements + quotes beautification
+    typographer:  false,
+
+    // Double + single quotes replacement pairs, when typographer enabled,
+    // and smartquotes on. Could be either a String or an Array.
+    //
+    // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+    // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+    quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+    // Highlighter function. Should return escaped HTML,
+    // or '' if the source string is not changed and should be escaped externaly.
+    // If result starts with <pre... internal wrapper is skipped.
+    //
+    // function (/*str, lang*/) { return ''; }
+    //
+    highlight: null,
+
+    maxNesting:   20            // Internal protection, recursion limit
+  },
+
+  components: {
+
+    core: {
+      rules: [
+        'normalize',
+        'block',
+        'inline'
+      ]
+    },
+
+    block: {
+      rules: [
+        'blockquote',
+        'code',
+        'fence',
+        'heading',
+        'hr',
+        'html_block',
+        'lheading',
+        'list',
+        'reference',
+        'paragraph'
+      ]
+    },
+
+    inline: {
+      rules: [
+        'autolink',
+        'backticks',
+        'emphasis',
+        'entity',
+        'escape',
+        'html_inline',
+        'image',
+        'link',
+        'newline',
+        'text'
+      ],
+      rules2: [
+        'balance_pairs',
+        'emphasis',
+        'text_collapse'
+      ]
+    }
+  }
+};
+
+},{}],14:[function(require,module,exports){
+// markdown-it default options
+
+'use strict';
+
+
+module.exports = {
+  options: {
+    html:         false,        // Enable HTML tags in source
+    xhtmlOut:     false,        // Use '/' to close single tags (<br />)
+    breaks:       false,        // Convert '\n' in paragraphs into <br>
+    langPrefix:   'language-',  // CSS language prefix for fenced blocks
+    linkify:      false,        // autoconvert URL-like texts to links
+
+    // Enable some language-neutral replacements + quotes beautification
+    typographer:  false,
+
+    // Double + single quotes replacement pairs, when typographer enabled,
+    // and smartquotes on. Could be either a String or an Array.
+    //
+    // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+    // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+    quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+    // Highlighter function. Should return escaped HTML,
+    // or '' if the source string is not changed and should be escaped externaly.
+    // If result starts with <pre... internal wrapper is skipped.
+    //
+    // function (/*str, lang*/) { return ''; }
+    //
+    highlight: null,
+
+    maxNesting:   100            // Internal protection, recursion limit
+  },
+
+  components: {
+
+    core: {},
+    block: {},
+    inline: {}
+  }
+};
+
+},{}],15:[function(require,module,exports){
+// "Zero" preset, with nothing enabled. Useful for manual configuring of simple
+// modes. For example, to parse bold/italic only.
+
+'use strict';
+
+
+module.exports = {
+  options: {
+    html:         false,        // Enable HTML tags in source
+    xhtmlOut:     false,        // Use '/' to close single tags (<br />)
+    breaks:       false,        // Convert '\n' in paragraphs into <br>
+    langPrefix:   'language-',  // CSS language prefix for fenced blocks
+    linkify:      false,        // autoconvert URL-like texts to links
+
+    // Enable some language-neutral replacements + quotes beautification
+    typographer:  false,
+
+    // Double + single quotes replacement pairs, when typographer enabled,
+    // and smartquotes on. Could be either a String or an Array.
+    //
+    // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+    // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+    quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+    // Highlighter function. Should return escaped HTML,
+    // or '' if the source string is not changed and should be escaped externaly.
+    // If result starts with <pre... internal wrapper is skipped.
+    //
+    // function (/*str, lang*/) { return ''; }
+    //
+    highlight: null,
+
+    maxNesting:   20            // Internal protection, recursion limit
+  },
+
+  components: {
+
+    core: {
+      rules: [
+        'normalize',
+        'block',
+        'inline'
+      ]
+    },
+
+    block: {
+      rules: [
+        'paragraph'
+      ]
+    },
+
+    inline: {
+      rules: [
+        'text'
+      ],
+      rules2: [
+        'balance_pairs',
+        'text_collapse'
+      ]
+    }
+  }
+};
+
+},{}],16:[function(require,module,exports){
+/**
+ * class Renderer
+ *
+ * Generates HTML from parsed token stream. Each instance has independent
+ * copy of rules. Those can be rewritten with ease. Also, you can add new
+ * rules if you create plugin and adds new token types.
+ **/
+'use strict';
+
+
+var assign          = require('./common/utils').assign;
+var unescapeAll     = require('./common/utils').unescapeAll;
+var escapeHtml      = require('./common/utils').escapeHtml;
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+var default_rules = {};
+
+
+default_rules.code_inline = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx];
+
+  return  '<code' + slf.renderAttrs(token) + '>' +
+          escapeHtml(tokens[idx].content) +
+          '</code>';
+};
+
+
+default_rules.code_block = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx];
+
+  return  '<pre' + slf.renderAttrs(token) + '><code>' +
+          escapeHtml(tokens[idx].content) +
+          '</code></pre>\n';
+};
+
+
+default_rules.fence = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx],
+      info = token.info ? unescapeAll(token.info).trim() : '',
+      langName = '',
+      highlighted, i, tmpAttrs, tmpToken;
+
+  if (info) {
+    langName = info.split(/\s+/g)[0];
+  }
+
+  if (options.highlight) {
+    highlighted = options.highlight(token.content, langName) || escapeHtml(token.content);
+  } else {
+    highlighted = escapeHtml(token.content);
+  }
+
+  if (highlighted.indexOf('<pre') === 0) {
+    return highlighted + '\n';
+  }
+
+  // If language exists, inject class gently, without modifying original token.
+  // May be, one day we will add .clone() for token and simplify this part, but
+  // now we prefer to keep things local.
+  if (info) {
+    i        = token.attrIndex('class');
+    tmpAttrs = token.attrs ? token.attrs.slice() : [];
+
+    if (i < 0) {
+      tmpAttrs.push([ 'class', options.langPrefix + langName ]);
+    } else {
+      tmpAttrs[i][1] += ' ' + options.langPrefix + langName;
+    }
+
+    // Fake token just to render attributes
+    tmpToken = {
+      attrs: tmpAttrs
+    };
+
+    return  '<pre><code' + slf.renderAttrs(tmpToken) + '>'
+          + highlighted
+          + '</code></pre>\n';
+  }
+
+
+  return  '<pre><code' + slf.renderAttrs(token) + '>'
+        + highlighted
+        + '</code></pre>\n';
+};
+
+
+default_rules.image = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx];
+
+  // "alt" attr MUST be set, even if empty. Because it's mandatory and
+  // should be placed on proper position for tests.
+  //
+  // Replace content with actual value
+
+  token.attrs[token.attrIndex('alt')][1] =
+    slf.renderInlineAsText(token.children, options, env);
+
+  return slf.renderToken(tokens, idx, options);
+};
+
+
+default_rules.hardbreak = function (tokens, idx, options /*, env */) {
+  return options.xhtmlOut ? '<br />\n' : '<br>\n';
+};
+default_rules.softbreak = function (tokens, idx, options /*, env */) {
+  return options.breaks ? (options.xhtmlOut ? '<br />\n' : '<br>\n') : '\n';
+};
+
+
+default_rules.text = function (tokens, idx /*, options, env */) {
+  return escapeHtml(tokens[idx].content);
+};
+
+
+default_rules.html_block = function (tokens, idx /*, options, env */) {
+  return tokens[idx].content;
+};
+default_rules.html_inline = function (tokens, idx /*, options, env */) {
+  return tokens[idx].content;
+};
+
+
+/**
+ * new Renderer()
+ *
+ * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults.
+ **/
+function Renderer() {
+
+  /**
+   * Renderer#rules -> Object
+   *
+   * Contains render rules for tokens. Can be updated and extended.
+   *
+   * ##### Example
+   *
+   * ```javascript
+   * var md = require('markdown-it')();
+   *
+   * md.renderer.rules.strong_open  = function () { return '<b>'; };
+   * md.renderer.rules.strong_close = function () { return '</b>'; };
+   *
+   * var result = md.renderInline(...);
+   * ```
+   *
+   * Each rule is called as independent static function with fixed signature:
+   *
+   * ```javascript
+   * function my_token_render(tokens, idx, options, env, renderer) {
+   *   // ...
+   *   return renderedHTML;
+   * }
+   * ```
+   *
+   * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js)
+   * for more details and examples.
+   **/
+  this.rules = assign({}, default_rules);
+}
+
+
+/**
+ * Renderer.renderAttrs(token) -> String
+ *
+ * Render token attributes to string.
+ **/
+Renderer.prototype.renderAttrs = function renderAttrs(token) {
+  var i, l, result;
+
+  if (!token.attrs) { return ''; }
+
+  result = '';
+
+  for (i = 0, l = token.attrs.length; i < l; i++) {
+    result += ' ' + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"';
+  }
+
+  return result;
+};
+
+
+/**
+ * Renderer.renderToken(tokens, idx, options) -> String
+ * - tokens (Array): list of tokens
+ * - idx (Numbed): token index to render
+ * - options (Object): params of parser instance
+ *
+ * Default token renderer. Can be overriden by custom function
+ * in [[Renderer#rules]].
+ **/
+Renderer.prototype.renderToken = function renderToken(tokens, idx, options) {
+  var nextToken,
+      result = '',
+      needLf = false,
+      token = tokens[idx];
+
+  // Tight list paragraphs
+  if (token.hidden) {
+    return '';
+  }
+
+  // Insert a newline between hidden paragraph and subsequent opening
+  // block-level tag.
+  //
+  // For example, here we should insert a newline before blockquote:
+  //  - a
+  //    >
+  //
+  if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) {
+    result += '\n';
+  }
+
+  // Add token name, e.g. `<img`
+  result += (token.nesting === -1 ? '</' : '<') + token.tag;
+
+  // Encode attributes, e.g. `<img src="foo"`
+  result += this.renderAttrs(token);
+
+  // Add a slash for self-closing tags, e.g. `<img src="foo" /`
+  if (token.nesting === 0 && options.xhtmlOut) {
+    result += ' /';
+  }
+
+  // Check if we need to add a newline after this tag
+  if (token.block) {
+    needLf = true;
+
+    if (token.nesting === 1) {
+      if (idx + 1 < tokens.length) {
+        nextToken = tokens[idx + 1];
+
+        if (nextToken.type === 'inline' || nextToken.hidden) {
+          // Block-level tag containing an inline tag.
+          //
+          needLf = false;
+
+        } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) {
+          // Opening tag + closing tag of the same type. E.g. `<li></li>`.
+          //
+          needLf = false;
+        }
+      }
+    }
+  }
+
+  result += needLf ? '>\n' : '>';
+
+  return result;
+};
+
+
+/**
+ * Renderer.renderInline(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * The same as [[Renderer.render]], but for single token of `inline` type.
+ **/
+Renderer.prototype.renderInline = function (tokens, options, env) {
+  var type,
+      result = '',
+      rules = this.rules;
+
+  for (var i = 0, len = tokens.length; i < len; i++) {
+    type = tokens[i].type;
+
+    if (typeof rules[type] !== 'undefined') {
+      result += rules[type](tokens, i, options, env, this);
+    } else {
+      result += this.renderToken(tokens, i, options);
+    }
+  }
+
+  return result;
+};
+
+
+/** internal
+ * Renderer.renderInlineAsText(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Special kludge for image `alt` attributes to conform CommonMark spec.
+ * Don't try to use it! Spec requires to show `alt` content with stripped markup,
+ * instead of simple escaping.
+ **/
+Renderer.prototype.renderInlineAsText = function (tokens, options, env) {
+  var result = '';
+
+  for (var i = 0, len = tokens.length; i < len; i++) {
+    if (tokens[i].type === 'text') {
+      result += tokens[i].content;
+    } else if (tokens[i].type === 'image') {
+      result += this.renderInlineAsText(tokens[i].children, options, env);
+    }
+  }
+
+  return result;
+};
+
+
+/**
+ * Renderer.render(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Takes token stream and generates HTML. Probably, you will never need to call
+ * this method directly.
+ **/
+Renderer.prototype.render = function (tokens, options, env) {
+  var i, len, type,
+      result = '',
+      rules = this.rules;
+
+  for (i = 0, len = tokens.length; i < len; i++) {
+    type = tokens[i].type;
+
+    if (type === 'inline') {
+      result += this.renderInline(tokens[i].children, options, env);
+    } else if (typeof rules[type] !== 'undefined') {
+      result += rules[tokens[i].type](tokens, i, options, env, this);
+    } else {
+      result += this.renderToken(tokens, i, options, env);
+    }
+  }
+
+  return result;
+};
+
+module.exports = Renderer;
+
+},{"./common/utils":4}],17:[function(require,module,exports){
+/**
+ * class Ruler
+ *
+ * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and
+ * [[MarkdownIt#inline]] to manage sequences of functions (rules):
+ *
+ * - keep rules in defined order
+ * - assign the name to each rule
+ * - enable/disable rules
+ * - add/replace rules
+ * - allow assign rules to additional named chains (in the same)
+ * - cacheing lists of active rules
+ *
+ * You will not need use this class directly until write plugins. For simple
+ * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and
+ * [[MarkdownIt.use]].
+ **/
+'use strict';
+
+
+/**
+ * new Ruler()
+ **/
+function Ruler() {
+  // List of added rules. Each element is:
+  //
+  // {
+  //   name: XXX,
+  //   enabled: Boolean,
+  //   fn: Function(),
+  //   alt: [ name2, name3 ]
+  // }
+  //
+  this.__rules__ = [];
+
+  // Cached rule chains.
+  //
+  // First level - chain name, '' for default.
+  // Second level - diginal anchor for fast filtering by charcodes.
+  //
+  this.__cache__ = null;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+// Helper methods, should not be used directly
+
+
+// Find rule index by name
+//
+Ruler.prototype.__find__ = function (name) {
+  for (var i = 0; i < this.__rules__.length; i++) {
+    if (this.__rules__[i].name === name) {
+      return i;
+    }
+  }
+  return -1;
+};
+
+
+// Build rules lookup cache
+//
+Ruler.prototype.__compile__ = function () {
+  var self = this;
+  var chains = [ '' ];
+
+  // collect unique names
+  self.__rules__.forEach(function (rule) {
+    if (!rule.enabled) { return; }
+
+    rule.alt.forEach(function (altName) {
+      if (chains.indexOf(altName) < 0) {
+        chains.push(altName);
+      }
+    });
+  });
+
+  self.__cache__ = {};
+
+  chains.forEach(function (chain) {
+    self.__cache__[chain] = [];
+    self.__rules__.forEach(function (rule) {
+      if (!rule.enabled) { return; }
+
+      if (chain && rule.alt.indexOf(chain) < 0) { return; }
+
+      self.__cache__[chain].push(rule.fn);
+    });
+  });
+};
+
+
+/**
+ * Ruler.at(name, fn [, options])
+ * - name (String): rule name to replace.
+ * - fn (Function): new rule function.
+ * - options (Object): new rule options (not mandatory).
+ *
+ * Replace rule by name with new function & options. Throws error if name not
+ * found.
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * Replace existing typographer replacement rule with new one:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.at('replacements', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.at = function (name, fn, options) {
+  var index = this.__find__(name);
+  var opt = options || {};
+
+  if (index === -1) { throw new Error('Parser rule not found: ' + name); }
+
+  this.__rules__[index].fn = fn;
+  this.__rules__[index].alt = opt.alt || [];
+  this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.before(beforeName, ruleName, fn [, options])
+ * - beforeName (String): new rule will be added before this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain before one with given name. See also
+ * [[Ruler.after]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.block.ruler.before('paragraph', 'my_rule', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.before = function (beforeName, ruleName, fn, options) {
+  var index = this.__find__(beforeName);
+  var opt = options || {};
+
+  if (index === -1) { throw new Error('Parser rule not found: ' + beforeName); }
+
+  this.__rules__.splice(index, 0, {
+    name: ruleName,
+    enabled: true,
+    fn: fn,
+    alt: opt.alt || []
+  });
+
+  this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.after(afterName, ruleName, fn [, options])
+ * - afterName (String): new rule will be added after this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain after one with given name. See also
+ * [[Ruler.before]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.inline.ruler.after('text', 'my_rule', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.after = function (afterName, ruleName, fn, options) {
+  var index = this.__find__(afterName);
+  var opt = options || {};
+
+  if (index === -1) { throw new Error('Parser rule not found: ' + afterName); }
+
+  this.__rules__.splice(index + 1, 0, {
+    name: ruleName,
+    enabled: true,
+    fn: fn,
+    alt: opt.alt || []
+  });
+
+  this.__cache__ = null;
+};
+
+/**
+ * Ruler.push(ruleName, fn [, options])
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Push new rule to the end of chain. See also
+ * [[Ruler.before]], [[Ruler.after]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.push('my_rule', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.push = function (ruleName, fn, options) {
+  var opt = options || {};
+
+  this.__rules__.push({
+    name: ruleName,
+    enabled: true,
+    fn: fn,
+    alt: opt.alt || []
+  });
+
+  this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.enable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to enable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.disable]], [[Ruler.enableOnly]].
+ **/
+Ruler.prototype.enable = function (list, ignoreInvalid) {
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  var result = [];
+
+  // Search by name and enable
+  list.forEach(function (name) {
+    var idx = this.__find__(name);
+
+    if (idx < 0) {
+      if (ignoreInvalid) { return; }
+      throw new Error('Rules manager: invalid rule name ' + name);
+    }
+    this.__rules__[idx].enabled = true;
+    result.push(name);
+  }, this);
+
+  this.__cache__ = null;
+  return result;
+};
+
+
+/**
+ * Ruler.enableOnly(list [, ignoreInvalid])
+ * - list (String|Array): list of rule names to enable (whitelist).
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names, and disable everything else. If any rule name
+ * not found - throw Error. Errors can be disabled by second param.
+ *
+ * See also [[Ruler.disable]], [[Ruler.enable]].
+ **/
+Ruler.prototype.enableOnly = function (list, ignoreInvalid) {
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  this.__rules__.forEach(function (rule) { rule.enabled = false; });
+
+  this.enable(list, ignoreInvalid);
+};
+
+
+/**
+ * Ruler.disable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Disable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.enable]], [[Ruler.enableOnly]].
+ **/
+Ruler.prototype.disable = function (list, ignoreInvalid) {
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  var result = [];
+
+  // Search by name and disable
+  list.forEach(function (name) {
+    var idx = this.__find__(name);
+
+    if (idx < 0) {
+      if (ignoreInvalid) { return; }
+      throw new Error('Rules manager: invalid rule name ' + name);
+    }
+    this.__rules__[idx].enabled = false;
+    result.push(name);
+  }, this);
+
+  this.__cache__ = null;
+  return result;
+};
+
+
+/**
+ * Ruler.getRules(chainName) -> Array
+ *
+ * Return array of active functions (rules) for given chain name. It analyzes
+ * rules configuration, compiles caches if not exists and returns result.
+ *
+ * Default chain name is `''` (empty string). It can't be skipped. That's
+ * done intentionally, to keep signature monomorphic for high speed.
+ **/
+Ruler.prototype.getRules = function (chainName) {
+  if (this.__cache__ === null) {
+    this.__compile__();
+  }
+
+  // Chain can be empty, if rules disabled. But we still have to return Array.
+  return this.__cache__[chainName] || [];
+};
+
+module.exports = Ruler;
+
+},{}],18:[function(require,module,exports){
+// Block quotes
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function blockquote(state, startLine, endLine, silent) {
+  var adjustTab,
+      ch,
+      i,
+      initial,
+      l,
+      lastLineEmpty,
+      lines,
+      nextLine,
+      offset,
+      oldBMarks,
+      oldBSCount,
+      oldIndent,
+      oldParentType,
+      oldSCount,
+      oldTShift,
+      spaceAfterMarker,
+      terminate,
+      terminatorRules,
+      token,
+      wasOutdented,
+      oldLineMax = state.lineMax,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  // check the block quote marker
+  if (state.src.charCodeAt(pos++) !== 0x3E/* > */) { return false; }
+
+  // we know that it's going to be a valid blockquote,
+  // so no point trying to find the end of it in silent mode
+  if (silent) { return true; }
+
+  // skip spaces after ">" and re-calculate offset
+  initial = offset = state.sCount[startLine] + pos - (state.bMarks[startLine] + state.tShift[startLine]);
+
+  // skip one optional space after '>'
+  if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+    // ' >   test '
+    //     ^ -- position start of line here:
+    pos++;
+    initial++;
+    offset++;
+    adjustTab = false;
+    spaceAfterMarker = true;
+  } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+    spaceAfterMarker = true;
+
+    if ((state.bsCount[startLine] + offset) % 4 === 3) {
+      // '  >\t  test '
+      //       ^ -- position start of line here (tab has width===1)
+      pos++;
+      initial++;
+      offset++;
+      adjustTab = false;
+    } else {
+      // ' >\t  test '
+      //    ^ -- position start of line here + shift bsCount slightly
+      //         to make extra space appear
+      adjustTab = true;
+    }
+  } else {
+    spaceAfterMarker = false;
+  }
+
+  oldBMarks = [ state.bMarks[startLine] ];
+  state.bMarks[startLine] = pos;
+
+  while (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (isSpace(ch)) {
+      if (ch === 0x09) {
+        offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4;
+      } else {
+        offset++;
+      }
+    } else {
+      break;
+    }
+
+    pos++;
+  }
+
+  oldBSCount = [ state.bsCount[startLine] ];
+  state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0);
+
+  lastLineEmpty = pos >= max;
+
+  oldSCount = [ state.sCount[startLine] ];
+  state.sCount[startLine] = offset - initial;
+
+  oldTShift = [ state.tShift[startLine] ];
+  state.tShift[startLine] = pos - state.bMarks[startLine];
+
+  terminatorRules = state.md.block.ruler.getRules('blockquote');
+
+  oldParentType = state.parentType;
+  state.parentType = 'blockquote';
+  wasOutdented = false;
+
+  // Search the end of the block
+  //
+  // Block ends with either:
+  //  1. an empty line outside:
+  //     ```
+  //     > test
+  //
+  //     ```
+  //  2. an empty line inside:
+  //     ```
+  //     >
+  //     test
+  //     ```
+  //  3. another tag:
+  //     ```
+  //     > test
+  //      - - -
+  //     ```
+  for (nextLine = startLine + 1; nextLine < endLine; nextLine++) {
+    // check if it's outdented, i.e. it's inside list item and indented
+    // less than said list item:
+    //
+    // ```
+    // 1. anything
+    //    > current blockquote
+    // 2. checking this line
+    // ```
+    if (state.sCount[nextLine] < state.blkIndent) wasOutdented = true;
+
+    pos = state.bMarks[nextLine] + state.tShift[nextLine];
+    max = state.eMarks[nextLine];
+
+    if (pos >= max) {
+      // Case 1: line is not inside the blockquote, and this line is empty.
+      break;
+    }
+
+    if (state.src.charCodeAt(pos++) === 0x3E/* > */ && !wasOutdented) {
+      // This line is inside the blockquote.
+
+      // skip spaces after ">" and re-calculate offset
+      initial = offset = state.sCount[nextLine] + pos - (state.bMarks[nextLine] + state.tShift[nextLine]);
+
+      // skip one optional space after '>'
+      if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+        // ' >   test '
+        //     ^ -- position start of line here:
+        pos++;
+        initial++;
+        offset++;
+        adjustTab = false;
+        spaceAfterMarker = true;
+      } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+        spaceAfterMarker = true;
+
+        if ((state.bsCount[nextLine] + offset) % 4 === 3) {
+          // '  >\t  test '
+          //       ^ -- position start of line here (tab has width===1)
+          pos++;
+          initial++;
+          offset++;
+          adjustTab = false;
+        } else {
+          // ' >\t  test '
+          //    ^ -- position start of line here + shift bsCount slightly
+          //         to make extra space appear
+          adjustTab = true;
+        }
+      } else {
+        spaceAfterMarker = false;
+      }
+
+      oldBMarks.push(state.bMarks[nextLine]);
+      state.bMarks[nextLine] = pos;
+
+      while (pos < max) {
+        ch = state.src.charCodeAt(pos);
+
+        if (isSpace(ch)) {
+          if (ch === 0x09) {
+            offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4;
+          } else {
+            offset++;
+          }
+        } else {
+          break;
+        }
+
+        pos++;
+      }
+
+      lastLineEmpty = pos >= max;
+
+      oldBSCount.push(state.bsCount[nextLine]);
+      state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0);
+
+      oldSCount.push(state.sCount[nextLine]);
+      state.sCount[nextLine] = offset - initial;
+
+      oldTShift.push(state.tShift[nextLine]);
+      state.tShift[nextLine] = pos - state.bMarks[nextLine];
+      continue;
+    }
+
+    // Case 2: line is not inside the blockquote, and the last line was empty.
+    if (lastLineEmpty) { break; }
+
+    // Case 3: another tag found.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+
+    if (terminate) {
+      // Quirk to enforce "hard termination mode" for paragraphs;
+      // normally if you call `tokenize(state, startLine, nextLine)`,
+      // paragraphs will look below nextLine for paragraph continuation,
+      // but if blockquote is terminated by another tag, they shouldn't
+      state.lineMax = nextLine;
+
+      if (state.blkIndent !== 0) {
+        // state.blkIndent was non-zero, we now set it to zero,
+        // so we need to re-calculate all offsets to appear as
+        // if indent wasn't changed
+        oldBMarks.push(state.bMarks[nextLine]);
+        oldBSCount.push(state.bsCount[nextLine]);
+        oldTShift.push(state.tShift[nextLine]);
+        oldSCount.push(state.sCount[nextLine]);
+        state.sCount[nextLine] -= state.blkIndent;
+      }
+
+      break;
+    }
+
+    oldBMarks.push(state.bMarks[nextLine]);
+    oldBSCount.push(state.bsCount[nextLine]);
+    oldTShift.push(state.tShift[nextLine]);
+    oldSCount.push(state.sCount[nextLine]);
+
+    // A negative indentation means that this is a paragraph continuation
+    //
+    state.sCount[nextLine] = -1;
+  }
+
+  oldIndent = state.blkIndent;
+  state.blkIndent = 0;
+
+  token        = state.push('blockquote_open', 'blockquote', 1);
+  token.markup = '>';
+  token.map    = lines = [ startLine, 0 ];
+
+  state.md.block.tokenize(state, startLine, nextLine);
+
+  token        = state.push('blockquote_close', 'blockquote', -1);
+  token.markup = '>';
+
+  state.lineMax = oldLineMax;
+  state.parentType = oldParentType;
+  lines[1] = state.line;
+
+  // Restore original tShift; this might not be necessary since the parser
+  // has already been here, but just to make sure we can do that.
+  for (i = 0; i < oldTShift.length; i++) {
+    state.bMarks[i + startLine] = oldBMarks[i];
+    state.tShift[i + startLine] = oldTShift[i];
+    state.sCount[i + startLine] = oldSCount[i];
+    state.bsCount[i + startLine] = oldBSCount[i];
+  }
+  state.blkIndent = oldIndent;
+
+  return true;
+};
+
+},{"../common/utils":4}],19:[function(require,module,exports){
+// Code block (4 spaces padded)
+
+'use strict';
+
+
+module.exports = function code(state, startLine, endLine/*, silent*/) {
+  var nextLine, last, token;
+
+  if (state.sCount[startLine] - state.blkIndent < 4) { return false; }
+
+  last = nextLine = startLine + 1;
+
+  while (nextLine < endLine) {
+    if (state.isEmpty(nextLine)) {
+      nextLine++;
+      continue;
+    }
+
+    if (state.sCount[nextLine] - state.blkIndent >= 4) {
+      nextLine++;
+      last = nextLine;
+      continue;
+    }
+    break;
+  }
+
+  state.line = last;
+
+  token         = state.push('code_block', 'code', 0);
+  token.content = state.getLines(startLine, last, 4 + state.blkIndent, true);
+  token.map     = [ startLine, state.line ];
+
+  return true;
+};
+
+},{}],20:[function(require,module,exports){
+// fences (``` lang, ~~~ lang)
+
+'use strict';
+
+
+module.exports = function fence(state, startLine, endLine, silent) {
+  var marker, len, params, nextLine, mem, token, markup,
+      haveEndMarker = false,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  if (pos + 3 > max) { return false; }
+
+  marker = state.src.charCodeAt(pos);
+
+  if (marker !== 0x7E/* ~ */ && marker !== 0x60 /* ` */) {
+    return false;
+  }
+
+  // scan marker length
+  mem = pos;
+  pos = state.skipChars(pos, marker);
+
+  len = pos - mem;
+
+  if (len < 3) { return false; }
+
+  markup = state.src.slice(mem, pos);
+  params = state.src.slice(pos, max);
+
+  if (params.indexOf(String.fromCharCode(marker)) >= 0) { return false; }
+
+  // Since start is found, we can report success here in validation mode
+  if (silent) { return true; }
+
+  // search end of block
+  nextLine = startLine;
+
+  for (;;) {
+    nextLine++;
+    if (nextLine >= endLine) {
+      // unclosed block should be autoclosed by end of document.
+      // also block seems to be autoclosed by end of parent
+      break;
+    }
+
+    pos = mem = state.bMarks[nextLine] + state.tShift[nextLine];
+    max = state.eMarks[nextLine];
+
+    if (pos < max && state.sCount[nextLine] < state.blkIndent) {
+      // non-empty line with negative indent should stop the list:
+      // - ```
+      //  test
+      break;
+    }
+
+    if (state.src.charCodeAt(pos) !== marker) { continue; }
+
+    if (state.sCount[nextLine] - state.blkIndent >= 4) {
+      // closing fence should be indented less than 4 spaces
+      continue;
+    }
+
+    pos = state.skipChars(pos, marker);
+
+    // closing code fence must be at least as long as the opening one
+    if (pos - mem < len) { continue; }
+
+    // make sure tail has spaces only
+    pos = state.skipSpaces(pos);
+
+    if (pos < max) { continue; }
+
+    haveEndMarker = true;
+    // found!
+    break;
+  }
+
+  // If a fence has heading spaces, they should be removed from its inner block
+  len = state.sCount[startLine];
+
+  state.line = nextLine + (haveEndMarker ? 1 : 0);
+
+  token         = state.push('fence', 'code', 0);
+  token.info    = params;
+  token.content = state.getLines(startLine + 1, nextLine, len, true);
+  token.markup  = markup;
+  token.map     = [ startLine, state.line ];
+
+  return true;
+};
+
+},{}],21:[function(require,module,exports){
+// heading (#, ##, ...)
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function heading(state, startLine, endLine, silent) {
+  var ch, level, tmp, token,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  ch  = state.src.charCodeAt(pos);
+
+  if (ch !== 0x23/* # */ || pos >= max) { return false; }
+
+  // count heading level
+  level = 1;
+  ch = state.src.charCodeAt(++pos);
+  while (ch === 0x23/* # */ && pos < max && level <= 6) {
+    level++;
+    ch = state.src.charCodeAt(++pos);
+  }
+
+  if (level > 6 || (pos < max && !isSpace(ch))) { return false; }
+
+  if (silent) { return true; }
+
+  // Let's cut tails like '    ###  ' from the end of string
+
+  max = state.skipSpacesBack(max, pos);
+  tmp = state.skipCharsBack(max, 0x23, pos); // #
+  if (tmp > pos && isSpace(state.src.charCodeAt(tmp - 1))) {
+    max = tmp;
+  }
+
+  state.line = startLine + 1;
+
+  token        = state.push('heading_open', 'h' + String(level), 1);
+  token.markup = '########'.slice(0, level);
+  token.map    = [ startLine, state.line ];
+
+  token          = state.push('inline', '', 0);
+  token.content  = state.src.slice(pos, max).trim();
+  token.map      = [ startLine, state.line ];
+  token.children = [];
+
+  token        = state.push('heading_close', 'h' + String(level), -1);
+  token.markup = '########'.slice(0, level);
+
+  return true;
+};
+
+},{"../common/utils":4}],22:[function(require,module,exports){
+// Horizontal rule
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function hr(state, startLine, endLine, silent) {
+  var marker, cnt, ch, token,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  marker = state.src.charCodeAt(pos++);
+
+  // Check hr marker
+  if (marker !== 0x2A/* * */ &&
+      marker !== 0x2D/* - */ &&
+      marker !== 0x5F/* _ */) {
+    return false;
+  }
+
+  // markers can be mixed with spaces, but there should be at least 3 of them
+
+  cnt = 1;
+  while (pos < max) {
+    ch = state.src.charCodeAt(pos++);
+    if (ch !== marker && !isSpace(ch)) { return false; }
+    if (ch === marker) { cnt++; }
+  }
+
+  if (cnt < 3) { return false; }
+
+  if (silent) { return true; }
+
+  state.line = startLine + 1;
+
+  token        = state.push('hr', 'hr', 0);
+  token.map    = [ startLine, state.line ];
+  token.markup = Array(cnt + 1).join(String.fromCharCode(marker));
+
+  return true;
+};
+
+},{"../common/utils":4}],23:[function(require,module,exports){
+// HTML block
+
+'use strict';
+
+
+var block_names = require('../common/html_blocks');
+var HTML_OPEN_CLOSE_TAG_RE = require('../common/html_re').HTML_OPEN_CLOSE_TAG_RE;
+
+// An array of opening and corresponding closing sequences for html tags,
+// last argument defines whether it can terminate a paragraph or not
+//
+var HTML_SEQUENCES = [
+  [ /^<(script|pre|style)(?=(\s|>|$))/i, /<\/(script|pre|style)>/i, true ],
+  [ /^<!--/,        /-->/,   true ],
+  [ /^<\?/,         /\?>/,   true ],
+  [ /^<![A-Z]/,     />/,     true ],
+  [ /^<!\[CDATA\[/, /\]\]>/, true ],
+  [ new RegExp('^</?(' + block_names.join('|') + ')(?=(\\s|/?>|$))', 'i'), /^$/, true ],
+  [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + '\\s*$'),  /^$/, false ]
+];
+
+
+module.exports = function html_block(state, startLine, endLine, silent) {
+  var i, nextLine, token, lineText,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  if (!state.md.options.html) { return false; }
+
+  if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+
+  lineText = state.src.slice(pos, max);
+
+  for (i = 0; i < HTML_SEQUENCES.length; i++) {
+    if (HTML_SEQUENCES[i][0].test(lineText)) { break; }
+  }
+
+  if (i === HTML_SEQUENCES.length) { return false; }
+
+  if (silent) {
+    // true if this sequence can be a terminator, false otherwise
+    return HTML_SEQUENCES[i][2];
+  }
+
+  nextLine = startLine + 1;
+
+  // If we are here - we detected HTML block.
+  // Let's roll down till block end.
+  if (!HTML_SEQUENCES[i][1].test(lineText)) {
+    for (; nextLine < endLine; nextLine++) {
+      if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+      pos = state.bMarks[nextLine] + state.tShift[nextLine];
+      max = state.eMarks[nextLine];
+      lineText = state.src.slice(pos, max);
+
+      if (HTML_SEQUENCES[i][1].test(lineText)) {
+        if (lineText.length !== 0) { nextLine++; }
+        break;
+      }
+    }
+  }
+
+  state.line = nextLine;
+
+  token         = state.push('html_block', '', 0);
+  token.map     = [ startLine, nextLine ];
+  token.content = state.getLines(startLine, nextLine, state.blkIndent, true);
+
+  return true;
+};
+
+},{"../common/html_blocks":2,"../common/html_re":3}],24:[function(require,module,exports){
+// lheading (---, ===)
+
+'use strict';
+
+
+module.exports = function lheading(state, startLine, endLine/*, silent*/) {
+  var content, terminate, i, l, token, pos, max, level, marker,
+      nextLine = startLine + 1, oldParentType,
+      terminatorRules = state.md.block.ruler.getRules('paragraph');
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  oldParentType = state.parentType;
+  state.parentType = 'paragraph'; // use paragraph to match terminatorRules
+
+  // jump line-by-line until empty one or EOF
+  for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+    // this would be a code block normally, but after paragraph
+    // it's considered a lazy continuation regardless of what's there
+    if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+    //
+    // Check for underline in setext header
+    //
+    if (state.sCount[nextLine] >= state.blkIndent) {
+      pos = state.bMarks[nextLine] + state.tShift[nextLine];
+      max = state.eMarks[nextLine];
+
+      if (pos < max) {
+        marker = state.src.charCodeAt(pos);
+
+        if (marker === 0x2D/* - */ || marker === 0x3D/* = */) {
+          pos = state.skipChars(pos, marker);
+          pos = state.skipSpaces(pos);
+
+          if (pos >= max) {
+            level = (marker === 0x3D/* = */ ? 1 : 2);
+            break;
+          }
+        }
+      }
+    }
+
+    // quirk for blockquotes, this line should already be checked by that rule
+    if (state.sCount[nextLine] < 0) { continue; }
+
+    // Some tags can terminate paragraph without empty line.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+  }
+
+  if (!level) {
+    // Didn't find valid underline
+    return false;
+  }
+
+  content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+
+  state.line = nextLine + 1;
+
+  token          = state.push('heading_open', 'h' + String(level), 1);
+  token.markup   = String.fromCharCode(marker);
+  token.map      = [ startLine, state.line ];
+
+  token          = state.push('inline', '', 0);
+  token.content  = content;
+  token.map      = [ startLine, state.line - 1 ];
+  token.children = [];
+
+  token          = state.push('heading_close', 'h' + String(level), -1);
+  token.markup   = String.fromCharCode(marker);
+
+  state.parentType = oldParentType;
+
+  return true;
+};
+
+},{}],25:[function(require,module,exports){
+// Lists
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+// Search `[-+*][\n ]`, returns next pos after marker on success
+// or -1 on fail.
+function skipBulletListMarker(state, startLine) {
+  var marker, pos, max, ch;
+
+  pos = state.bMarks[startLine] + state.tShift[startLine];
+  max = state.eMarks[startLine];
+
+  marker = state.src.charCodeAt(pos++);
+  // Check bullet
+  if (marker !== 0x2A/* * */ &&
+      marker !== 0x2D/* - */ &&
+      marker !== 0x2B/* + */) {
+    return -1;
+  }
+
+  if (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (!isSpace(ch)) {
+      // " -test " - is not a list item
+      return -1;
+    }
+  }
+
+  return pos;
+}
+
+// Search `\d+[.)][\n ]`, returns next pos after marker on success
+// or -1 on fail.
+function skipOrderedListMarker(state, startLine) {
+  var ch,
+      start = state.bMarks[startLine] + state.tShift[startLine],
+      pos = start,
+      max = state.eMarks[startLine];
+
+  // List marker should have at least 2 chars (digit + dot)
+  if (pos + 1 >= max) { return -1; }
+
+  ch = state.src.charCodeAt(pos++);
+
+  if (ch < 0x30/* 0 */ || ch > 0x39/* 9 */) { return -1; }
+
+  for (;;) {
+    // EOL -> fail
+    if (pos >= max) { return -1; }
+
+    ch = state.src.charCodeAt(pos++);
+
+    if (ch >= 0x30/* 0 */ && ch <= 0x39/* 9 */) {
+
+      // List marker should have no more than 9 digits
+      // (prevents integer overflow in browsers)
+      if (pos - start >= 10) { return -1; }
+
+      continue;
+    }
+
+    // found valid marker
+    if (ch === 0x29/* ) */ || ch === 0x2e/* . */) {
+      break;
+    }
+
+    return -1;
+  }
+
+
+  if (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (!isSpace(ch)) {
+      // " 1.test " - is not a list item
+      return -1;
+    }
+  }
+  return pos;
+}
+
+function markTightParagraphs(state, idx) {
+  var i, l,
+      level = state.level + 2;
+
+  for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) {
+    if (state.tokens[i].level === level && state.tokens[i].type === 'paragraph_open') {
+      state.tokens[i + 2].hidden = true;
+      state.tokens[i].hidden = true;
+      i += 2;
+    }
+  }
+}
+
+
+module.exports = function list(state, startLine, endLine, silent) {
+  var ch,
+      contentStart,
+      i,
+      indent,
+      indentAfterMarker,
+      initial,
+      isOrdered,
+      itemLines,
+      l,
+      listLines,
+      listTokIdx,
+      markerCharCode,
+      markerValue,
+      max,
+      nextLine,
+      offset,
+      oldIndent,
+      oldLIndent,
+      oldParentType,
+      oldTShift,
+      oldTight,
+      pos,
+      posAfterMarker,
+      prevEmptyEnd,
+      start,
+      terminate,
+      terminatorRules,
+      token,
+      isTerminatingParagraph = false,
+      tight = true;
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  // limit conditions when list can interrupt
+  // a paragraph (validation mode only)
+  if (silent && state.parentType === 'paragraph') {
+    // Next list item should still terminate previous list item;
+    //
+    // This code can fail if plugins use blkIndent as well as lists,
+    // but I hope the spec gets fixed long before that happens.
+    //
+    if (state.tShift[startLine] >= state.blkIndent) {
+      isTerminatingParagraph = true;
+    }
+  }
+
+  // Detect list type and position after marker
+  if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) {
+    isOrdered = true;
+    start = state.bMarks[startLine] + state.tShift[startLine];
+    markerValue = Number(state.src.substr(start, posAfterMarker - start - 1));
+
+    // If we're starting a new ordered list right after
+    // a paragraph, it should start with 1.
+    if (isTerminatingParagraph && markerValue !== 1) return false;
+
+  } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) {
+    isOrdered = false;
+
+  } else {
+    return false;
+  }
+
+  // If we're starting a new unordered list right after
+  // a paragraph, first line should not be empty.
+  if (isTerminatingParagraph) {
+    if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false;
+  }
+
+  // We should terminate list on style change. Remember first one to compare.
+  markerCharCode = state.src.charCodeAt(posAfterMarker - 1);
+
+  // For validation mode we can terminate immediately
+  if (silent) { return true; }
+
+  // Start list
+  listTokIdx = state.tokens.length;
+
+  if (isOrdered) {
+    token       = state.push('ordered_list_open', 'ol', 1);
+    if (markerValue !== 1) {
+      token.attrs = [ [ 'start', markerValue ] ];
+    }
+
+  } else {
+    token       = state.push('bullet_list_open', 'ul', 1);
+  }
+
+  token.map    = listLines = [ startLine, 0 ];
+  token.markup = String.fromCharCode(markerCharCode);
+
+  //
+  // Iterate list items
+  //
+
+  nextLine = startLine;
+  prevEmptyEnd = false;
+  terminatorRules = state.md.block.ruler.getRules('list');
+
+  oldParentType = state.parentType;
+  state.parentType = 'list';
+
+  while (nextLine < endLine) {
+    pos = posAfterMarker;
+    max = state.eMarks[nextLine];
+
+    initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]);
+
+    while (pos < max) {
+      ch = state.src.charCodeAt(pos);
+
+      if (ch === 0x09) {
+        offset += 4 - (offset + state.bsCount[nextLine]) % 4;
+      } else if (ch === 0x20) {
+        offset++;
+      } else {
+        break;
+      }
+
+      pos++;
+    }
+
+    contentStart = pos;
+
+    if (contentStart >= max) {
+      // trimming space in "-    \n  3" case, indent is 1 here
+      indentAfterMarker = 1;
+    } else {
+      indentAfterMarker = offset - initial;
+    }
+
+    // If we have more than 4 spaces, the indent is 1
+    // (the rest is just indented code block)
+    if (indentAfterMarker > 4) { indentAfterMarker = 1; }
+
+    // "  -  test"
+    //  ^^^^^ - calculating total length of this thing
+    indent = initial + indentAfterMarker;
+
+    // Run subparser & write tokens
+    token        = state.push('list_item_open', 'li', 1);
+    token.markup = String.fromCharCode(markerCharCode);
+    token.map    = itemLines = [ startLine, 0 ];
+
+    oldIndent = state.blkIndent;
+    oldTight = state.tight;
+    oldTShift = state.tShift[startLine];
+    oldLIndent = state.sCount[startLine];
+    state.blkIndent = indent;
+    state.tight = true;
+    state.tShift[startLine] = contentStart - state.bMarks[startLine];
+    state.sCount[startLine] = offset;
+
+    if (contentStart >= max && state.isEmpty(startLine + 1)) {
+      // workaround for this case
+      // (list item is empty, list terminates before "foo"):
+      // ~~~~~~~~
+      //   -
+      //
+      //     foo
+      // ~~~~~~~~
+      state.line = Math.min(state.line + 2, endLine);
+    } else {
+      state.md.block.tokenize(state, startLine, endLine, true);
+    }
+
+    // If any of list item is tight, mark list as tight
+    if (!state.tight || prevEmptyEnd) {
+      tight = false;
+    }
+    // Item become loose if finish with empty line,
+    // but we should filter last element, because it means list finish
+    prevEmptyEnd = (state.line - startLine) > 1 && state.isEmpty(state.line - 1);
+
+    state.blkIndent = oldIndent;
+    state.tShift[startLine] = oldTShift;
+    state.sCount[startLine] = oldLIndent;
+    state.tight = oldTight;
+
+    token        = state.push('list_item_close', 'li', -1);
+    token.markup = String.fromCharCode(markerCharCode);
+
+    nextLine = startLine = state.line;
+    itemLines[1] = nextLine;
+    contentStart = state.bMarks[startLine];
+
+    if (nextLine >= endLine) { break; }
+
+    //
+    // Try to check if list is terminated or continued.
+    //
+    if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+    // fail if terminating block found
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+
+    // fail if list has another type
+    if (isOrdered) {
+      posAfterMarker = skipOrderedListMarker(state, nextLine);
+      if (posAfterMarker < 0) { break; }
+    } else {
+      posAfterMarker = skipBulletListMarker(state, nextLine);
+      if (posAfterMarker < 0) { break; }
+    }
+
+    if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { break; }
+  }
+
+  // Finalize list
+  if (isOrdered) {
+    token = state.push('ordered_list_close', 'ol', -1);
+  } else {
+    token = state.push('bullet_list_close', 'ul', -1);
+  }
+  token.markup = String.fromCharCode(markerCharCode);
+
+  listLines[1] = nextLine;
+  state.line = nextLine;
+
+  state.parentType = oldParentType;
+
+  // mark paragraphs tight if needed
+  if (tight) {
+    markTightParagraphs(state, listTokIdx);
+  }
+
+  return true;
+};
+
+},{"../common/utils":4}],26:[function(require,module,exports){
+// Paragraph
+
+'use strict';
+
+
+module.exports = function paragraph(state, startLine/*, endLine*/) {
+  var content, terminate, i, l, token, oldParentType,
+      nextLine = startLine + 1,
+      terminatorRules = state.md.block.ruler.getRules('paragraph'),
+      endLine = state.lineMax;
+
+  oldParentType = state.parentType;
+  state.parentType = 'paragraph';
+
+  // jump line-by-line until empty one or EOF
+  for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+    // this would be a code block normally, but after paragraph
+    // it's considered a lazy continuation regardless of what's there
+    if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+    // quirk for blockquotes, this line should already be checked by that rule
+    if (state.sCount[nextLine] < 0) { continue; }
+
+    // Some tags can terminate paragraph without empty line.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+  }
+
+  content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+
+  state.line = nextLine;
+
+  token          = state.push('paragraph_open', 'p', 1);
+  token.map      = [ startLine, state.line ];
+
+  token          = state.push('inline', '', 0);
+  token.content  = content;
+  token.map      = [ startLine, state.line ];
+  token.children = [];
+
+  token          = state.push('paragraph_close', 'p', -1);
+
+  state.parentType = oldParentType;
+
+  return true;
+};
+
+},{}],27:[function(require,module,exports){
+'use strict';
+
+
+var normalizeReference   = require('../common/utils').normalizeReference;
+var isSpace              = require('../common/utils').isSpace;
+
+
+module.exports = function reference(state, startLine, _endLine, silent) {
+  var ch,
+      destEndPos,
+      destEndLineNo,
+      endLine,
+      href,
+      i,
+      l,
+      label,
+      labelEnd,
+      oldParentType,
+      res,
+      start,
+      str,
+      terminate,
+      terminatorRules,
+      title,
+      lines = 0,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine],
+      nextLine = startLine + 1;
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  if (state.src.charCodeAt(pos) !== 0x5B/* [ */) { return false; }
+
+  // Simple check to quickly interrupt scan on [link](url) at the start of line.
+  // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54
+  while (++pos < max) {
+    if (state.src.charCodeAt(pos) === 0x5D /* ] */ &&
+        state.src.charCodeAt(pos - 1) !== 0x5C/* \ */) {
+      if (pos + 1 === max) { return false; }
+      if (state.src.charCodeAt(pos + 1) !== 0x3A/* : */) { return false; }
+      break;
+    }
+  }
+
+  endLine = state.lineMax;
+
+  // jump line-by-line until empty one or EOF
+  terminatorRules = state.md.block.ruler.getRules('reference');
+
+  oldParentType = state.parentType;
+  state.parentType = 'reference';
+
+  for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+    // this would be a code block normally, but after paragraph
+    // it's considered a lazy continuation regardless of what's there
+    if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+    // quirk for blockquotes, this line should already be checked by that rule
+    if (state.sCount[nextLine] < 0) { continue; }
+
+    // Some tags can terminate paragraph without empty line.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+  }
+
+  str = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+  max = str.length;
+
+  for (pos = 1; pos < max; pos++) {
+    ch = str.charCodeAt(pos);
+    if (ch === 0x5B /* [ */) {
+      return false;
+    } else if (ch === 0x5D /* ] */) {
+      labelEnd = pos;
+      break;
+    } else if (ch === 0x0A /* \n */) {
+      lines++;
+    } else if (ch === 0x5C /* \ */) {
+      pos++;
+      if (pos < max && str.charCodeAt(pos) === 0x0A) {
+        lines++;
+      }
+    }
+  }
+
+  if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 0x3A/* : */) { return false; }
+
+  // [label]:   destination   'title'
+  //         ^^^ skip optional whitespace here
+  for (pos = labelEnd + 2; pos < max; pos++) {
+    ch = str.charCodeAt(pos);
+    if (ch === 0x0A) {
+      lines++;
+    } else if (isSpace(ch)) {
+      /*eslint no-empty:0*/
+    } else {
+      break;
+    }
+  }
+
+  // [label]:   destination   'title'
+  //            ^^^^^^^^^^^ parse this
+  res = state.md.helpers.parseLinkDestination(str, pos, max);
+  if (!res.ok) { return false; }
+
+  href = state.md.normalizeLink(res.str);
+  if (!state.md.validateLink(href)) { return false; }
+
+  pos = res.pos;
+  lines += res.lines;
+
+  // save cursor state, we could require to rollback later
+  destEndPos = pos;
+  destEndLineNo = lines;
+
+  // [label]:   destination   'title'
+  //                       ^^^ skipping those spaces
+  start = pos;
+  for (; pos < max; pos++) {
+    ch = str.charCodeAt(pos);
+    if (ch === 0x0A) {
+      lines++;
+    } else if (isSpace(ch)) {
+      /*eslint no-empty:0*/
+    } else {
+      break;
+    }
+  }
+
+  // [label]:   destination   'title'
+  //                          ^^^^^^^ parse this
+  res = state.md.helpers.parseLinkTitle(str, pos, max);
+  if (pos < max && start !== pos && res.ok) {
+    title = res.str;
+    pos = res.pos;
+    lines += res.lines;
+  } else {
+    title = '';
+    pos = destEndPos;
+    lines = destEndLineNo;
+  }
+
+  // skip trailing spaces until the rest of the line
+  while (pos < max) {
+    ch = str.charCodeAt(pos);
+    if (!isSpace(ch)) { break; }
+    pos++;
+  }
+
+  if (pos < max && str.charCodeAt(pos) !== 0x0A) {
+    if (title) {
+      // garbage at the end of the line after title,
+      // but it could still be a valid reference if we roll back
+      title = '';
+      pos = destEndPos;
+      lines = destEndLineNo;
+      while (pos < max) {
+        ch = str.charCodeAt(pos);
+        if (!isSpace(ch)) { break; }
+        pos++;
+      }
+    }
+  }
+
+  if (pos < max && str.charCodeAt(pos) !== 0x0A) {
+    // garbage at the end of the line
+    return false;
+  }
+
+  label = normalizeReference(str.slice(1, labelEnd));
+  if (!label) {
+    // CommonMark 0.20 disallows empty labels
+    return false;
+  }
+
+  // Reference can not terminate anything. This check is for safety only.
+  /*istanbul ignore if*/
+  if (silent) { return true; }
+
+  if (typeof state.env.references === 'undefined') {
+    state.env.references = {};
+  }
+  if (typeof state.env.references[label] === 'undefined') {
+    state.env.references[label] = { title: title, href: href };
+  }
+
+  state.parentType = oldParentType;
+
+  state.line = startLine + lines + 1;
+  return true;
+};
+
+},{"../common/utils":4}],28:[function(require,module,exports){
+// Parser state class
+
+'use strict';
+
+var Token = require('../token');
+var isSpace = require('../common/utils').isSpace;
+
+
+function StateBlock(src, md, env, tokens) {
+  var ch, s, start, pos, len, indent, offset, indent_found;
+
+  this.src = src;
+
+  // link to parser instance
+  this.md     = md;
+
+  this.env = env;
+
+  //
+  // Internal state vartiables
+  //
+
+  this.tokens = tokens;
+
+  this.bMarks = [];  // line begin offsets for fast jumps
+  this.eMarks = [];  // line end offsets for fast jumps
+  this.tShift = [];  // offsets of the first non-space characters (tabs not expanded)
+  this.sCount = [];  // indents for each line (tabs expanded)
+
+  // An amount of virtual spaces (tabs expanded) between beginning
+  // of each line (bMarks) and real beginning of that line.
+  //
+  // It exists only as a hack because blockquotes override bMarks
+  // losing information in the process.
+  //
+  // It's used only when expanding tabs, you can think about it as
+  // an initial tab length, e.g. bsCount=21 applied to string `\t123`
+  // means first tab should be expanded to 4-21%4 === 3 spaces.
+  //
+  this.bsCount = [];
+
+  // block parser variables
+  this.blkIndent  = 0; // required block content indent
+                       // (for example, if we are in list)
+  this.line       = 0; // line index in src
+  this.lineMax    = 0; // lines count
+  this.tight      = false;  // loose/tight mode for lists
+  this.ddIndent   = -1; // indent of the current dd block (-1 if there isn't any)
+
+  // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference'
+  // used in lists to determine if they interrupt a paragraph
+  this.parentType = 'root';
+
+  this.level = 0;
+
+  // renderer
+  this.result = '';
+
+  // Create caches
+  // Generate markers.
+  s = this.src;
+  indent_found = false;
+
+  for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) {
+    ch = s.charCodeAt(pos);
+
+    if (!indent_found) {
+      if (isSpace(ch)) {
+        indent++;
+
+        if (ch === 0x09) {
+          offset += 4 - offset % 4;
+        } else {
+          offset++;
+        }
+        continue;
+      } else {
+        indent_found = true;
+      }
+    }
+
+    if (ch === 0x0A || pos === len - 1) {
+      if (ch !== 0x0A) { pos++; }
+      this.bMarks.push(start);
+      this.eMarks.push(pos);
+      this.tShift.push(indent);
+      this.sCount.push(offset);
+      this.bsCount.push(0);
+
+      indent_found = false;
+      indent = 0;
+      offset = 0;
+      start = pos + 1;
+    }
+  }
+
+  // Push fake entry to simplify cache bounds checks
+  this.bMarks.push(s.length);
+  this.eMarks.push(s.length);
+  this.tShift.push(0);
+  this.sCount.push(0);
+  this.bsCount.push(0);
+
+  this.lineMax = this.bMarks.length - 1; // don't count last fake line
+}
+
+// Push new token to "stream".
+//
+StateBlock.prototype.push = function (type, tag, nesting) {
+  var token = new Token(type, tag, nesting);
+  token.block = true;
+
+  if (nesting < 0) { this.level--; }
+  token.level = this.level;
+  if (nesting > 0) { this.level++; }
+
+  this.tokens.push(token);
+  return token;
+};
+
+StateBlock.prototype.isEmpty = function isEmpty(line) {
+  return this.bMarks[line] + this.tShift[line] >= this.eMarks[line];
+};
+
+StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) {
+  for (var max = this.lineMax; from < max; from++) {
+    if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) {
+      break;
+    }
+  }
+  return from;
+};
+
+// Skip spaces from given position.
+StateBlock.prototype.skipSpaces = function skipSpaces(pos) {
+  var ch;
+
+  for (var max = this.src.length; pos < max; pos++) {
+    ch = this.src.charCodeAt(pos);
+    if (!isSpace(ch)) { break; }
+  }
+  return pos;
+};
+
+// Skip spaces from given position in reverse.
+StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) {
+  if (pos <= min) { return pos; }
+
+  while (pos > min) {
+    if (!isSpace(this.src.charCodeAt(--pos))) { return pos + 1; }
+  }
+  return pos;
+};
+
+// Skip char codes from given position
+StateBlock.prototype.skipChars = function skipChars(pos, code) {
+  for (var max = this.src.length; pos < max; pos++) {
+    if (this.src.charCodeAt(pos) !== code) { break; }
+  }
+  return pos;
+};
+
+// Skip char codes reverse from given position - 1
+StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) {
+  if (pos <= min) { return pos; }
+
+  while (pos > min) {
+    if (code !== this.src.charCodeAt(--pos)) { return pos + 1; }
+  }
+  return pos;
+};
+
+// cut lines range from source.
+StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) {
+  var i, lineIndent, ch, first, last, queue, lineStart,
+      line = begin;
+
+  if (begin >= end) {
+    return '';
+  }
+
+  queue = new Array(end - begin);
+
+  for (i = 0; line < end; line++, i++) {
+    lineIndent = 0;
+    lineStart = first = this.bMarks[line];
+
+    if (line + 1 < end || keepLastLF) {
+      // No need for bounds check because we have fake entry on tail.
+      last = this.eMarks[line] + 1;
+    } else {
+      last = this.eMarks[line];
+    }
+
+    while (first < last && lineIndent < indent) {
+      ch = this.src.charCodeAt(first);
+
+      if (isSpace(ch)) {
+        if (ch === 0x09) {
+          lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4;
+        } else {
+          lineIndent++;
+        }
+      } else if (first - lineStart < this.tShift[line]) {
+        // patched tShift masked characters to look like spaces (blockquotes, list markers)
+        lineIndent++;
+      } else {
+        break;
+      }
+
+      first++;
+    }
+
+    if (lineIndent > indent) {
+      // partially expanding tabs in code blocks, e.g '\t\tfoobar'
+      // with indent=2 becomes '  \tfoobar'
+      queue[i] = new Array(lineIndent - indent + 1).join(' ') + this.src.slice(first, last);
+    } else {
+      queue[i] = this.src.slice(first, last);
+    }
+  }
+
+  return queue.join('');
+};
+
+// re-export Token class to use in block rules
+StateBlock.prototype.Token = Token;
+
+
+module.exports = StateBlock;
+
+},{"../common/utils":4,"../token":51}],29:[function(require,module,exports){
+// GFM table, non-standard
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+function getLine(state, line) {
+  var pos = state.bMarks[line] + state.blkIndent,
+      max = state.eMarks[line];
+
+  return state.src.substr(pos, max - pos);
+}
+
+function escapedSplit(str) {
+  var result = [],
+      pos = 0,
+      max = str.length,
+      ch,
+      escapes = 0,
+      lastPos = 0,
+      backTicked = false,
+      lastBackTick = 0;
+
+  ch  = str.charCodeAt(pos);
+
+  while (pos < max) {
+    if (ch === 0x60/* ` */) {
+      if (backTicked) {
+        // make \` close code sequence, but not open it;
+        // the reason is: `\` is correct code block
+        backTicked = false;
+        lastBackTick = pos;
+      } else if (escapes % 2 === 0) {
+        backTicked = true;
+        lastBackTick = pos;
+      }
+    } else if (ch === 0x7c/* | */ && (escapes % 2 === 0) && !backTicked) {
+      result.push(str.substring(lastPos, pos));
+      lastPos = pos + 1;
+    }
+
+    if (ch === 0x5c/* \ */) {
+      escapes++;
+    } else {
+      escapes = 0;
+    }
+
+    pos++;
+
+    // If there was an un-closed backtick, go back to just after
+    // the last backtick, but as if it was a normal character
+    if (pos === max && backTicked) {
+      backTicked = false;
+      pos = lastBackTick + 1;
+    }
+
+    ch = str.charCodeAt(pos);
+  }
+
+  result.push(str.substring(lastPos));
+
+  return result;
+}
+
+
+module.exports = function table(state, startLine, endLine, silent) {
+  var ch, lineText, pos, i, nextLine, columns, columnCount, token,
+      aligns, t, tableLines, tbodyLines;
+
+  // should have at least two lines
+  if (startLine + 2 > endLine) { return false; }
+
+  nextLine = startLine + 1;
+
+  if (state.sCount[nextLine] < state.blkIndent) { return false; }
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[nextLine] - state.blkIndent >= 4) { return false; }
+
+  // first character of the second line should be '|', '-', ':',
+  // and no other characters are allowed but spaces;
+  // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp
+
+  pos = state.bMarks[nextLine] + state.tShift[nextLine];
+  if (pos >= state.eMarks[nextLine]) { return false; }
+
+  ch = state.src.charCodeAt(pos++);
+  if (ch !== 0x7C/* | */ && ch !== 0x2D/* - */ && ch !== 0x3A/* : */) { return false; }
+
+  while (pos < state.eMarks[nextLine]) {
+    ch = state.src.charCodeAt(pos);
+
+    if (ch !== 0x7C/* | */ && ch !== 0x2D/* - */ && ch !== 0x3A/* : */ && !isSpace(ch)) { return false; }
+
+    pos++;
+  }
+
+  lineText = getLine(state, startLine + 1);
+
+  columns = lineText.split('|');
+  aligns = [];
+  for (i = 0; i < columns.length; i++) {
+    t = columns[i].trim();
+    if (!t) {
+      // allow empty columns before and after table, but not in between columns;
+      // e.g. allow ` |---| `, disallow ` ---||--- `
+      if (i === 0 || i === columns.length - 1) {
+        continue;
+      } else {
+        return false;
+      }
+    }
+
+    if (!/^:?-+:?$/.test(t)) { return false; }
+    if (t.charCodeAt(t.length - 1) === 0x3A/* : */) {
+      aligns.push(t.charCodeAt(0) === 0x3A/* : */ ? 'center' : 'right');
+    } else if (t.charCodeAt(0) === 0x3A/* : */) {
+      aligns.push('left');
+    } else {
+      aligns.push('');
+    }
+  }
+
+  lineText = getLine(state, startLine).trim();
+  if (lineText.indexOf('|') === -1) { return false; }
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+  columns = escapedSplit(lineText.replace(/^\||\|$/g, ''));
+
+  // header row will define an amount of columns in the entire table,
+  // and align row shouldn't be smaller than that (the rest of the rows can)
+  columnCount = columns.length;
+  if (columnCount > aligns.length) { return false; }
+
+  if (silent) { return true; }
+
+  token     = state.push('table_open', 'table', 1);
+  token.map = tableLines = [ startLine, 0 ];
+
+  token     = state.push('thead_open', 'thead', 1);
+  token.map = [ startLine, startLine + 1 ];
+
+  token     = state.push('tr_open', 'tr', 1);
+  token.map = [ startLine, startLine + 1 ];
+
+  for (i = 0; i < columns.length; i++) {
+    token          = state.push('th_open', 'th', 1);
+    token.map      = [ startLine, startLine + 1 ];
+    if (aligns[i]) {
+      token.attrs  = [ [ 'style', 'text-align:' + aligns[i] ] ];
+    }
+
+    token          = state.push('inline', '', 0);
+    token.content  = columns[i].trim();
+    token.map      = [ startLine, startLine + 1 ];
+    token.children = [];
+
+    token          = state.push('th_close', 'th', -1);
+  }
+
+  token     = state.push('tr_close', 'tr', -1);
+  token     = state.push('thead_close', 'thead', -1);
+
+  token     = state.push('tbody_open', 'tbody', 1);
+  token.map = tbodyLines = [ startLine + 2, 0 ];
+
+  for (nextLine = startLine + 2; nextLine < endLine; nextLine++) {
+    if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+    lineText = getLine(state, nextLine).trim();
+    if (lineText.indexOf('|') === -1) { break; }
+    if (state.sCount[nextLine] - state.blkIndent >= 4) { break; }
+    columns = escapedSplit(lineText.replace(/^\||\|$/g, ''));
+
+    token = state.push('tr_open', 'tr', 1);
+    for (i = 0; i < columnCount; i++) {
+      token          = state.push('td_open', 'td', 1);
+      if (aligns[i]) {
+        token.attrs  = [ [ 'style', 'text-align:' + aligns[i] ] ];
+      }
+
+      token          = state.push('inline', '', 0);
+      token.content  = columns[i] ? columns[i].trim() : '';
+      token.children = [];
+
+      token          = state.push('td_close', 'td', -1);
+    }
+    token = state.push('tr_close', 'tr', -1);
+  }
+  token = state.push('tbody_close', 'tbody', -1);
+  token = state.push('table_close', 'table', -1);
+
+  tableLines[1] = tbodyLines[1] = nextLine;
+  state.line = nextLine;
+  return true;
+};
+
+},{"../common/utils":4}],30:[function(require,module,exports){
+'use strict';
+
+
+module.exports = function block(state) {
+  var token;
+
+  if (state.inlineMode) {
+    token          = new state.Token('inline', '', 0);
+    token.content  = state.src;
+    token.map      = [ 0, 1 ];
+    token.children = [];
+    state.tokens.push(token);
+  } else {
+    state.md.block.parse(state.src, state.md, state.env, state.tokens);
+  }
+};
+
+},{}],31:[function(require,module,exports){
+'use strict';
+
+module.exports = function inline(state) {
+  var tokens = state.tokens, tok, i, l;
+
+  // Parse inlines
+  for (i = 0, l = tokens.length; i < l; i++) {
+    tok = tokens[i];
+    if (tok.type === 'inline') {
+      state.md.inline.parse(tok.content, state.md, state.env, tok.children);
+    }
+  }
+};
+
+},{}],32:[function(require,module,exports){
+// Replace link-like texts with link nodes.
+//
+// Currently restricted by `md.validateLink()` to http/https/ftp
+//
+'use strict';
+
+
+var arrayReplaceAt = require('../common/utils').arrayReplaceAt;
+
+
+function isLinkOpen(str) {
+  return /^<a[>\s]/i.test(str);
+}
+function isLinkClose(str) {
+  return /^<\/a\s*>/i.test(str);
+}
+
+
+module.exports = function linkify(state) {
+  var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos,
+      level, htmlLinkLevel, url, fullUrl, urlText,
+      blockTokens = state.tokens,
+      links;
+
+  if (!state.md.options.linkify) { return; }
+
+  for (j = 0, l = blockTokens.length; j < l; j++) {
+    if (blockTokens[j].type !== 'inline' ||
+        !state.md.linkify.pretest(blockTokens[j].content)) {
+      continue;
+    }
+
+    tokens = blockTokens[j].children;
+
+    htmlLinkLevel = 0;
+
+    // We scan from the end, to keep position when new tags added.
+    // Use reversed logic in links start/end match
+    for (i = tokens.length - 1; i >= 0; i--) {
+      currentToken = tokens[i];
+
+      // Skip content of markdown links
+      if (currentToken.type === 'link_close') {
+        i--;
+        while (tokens[i].level !== currentToken.level && tokens[i].type !== 'link_open') {
+          i--;
+        }
+        continue;
+      }
+
+      // Skip content of html tag links
+      if (currentToken.type === 'html_inline') {
+        if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) {
+          htmlLinkLevel--;
+        }
+        if (isLinkClose(currentToken.content)) {
+          htmlLinkLevel++;
+        }
+      }
+      if (htmlLinkLevel > 0) { continue; }
+
+      if (currentToken.type === 'text' && state.md.linkify.test(currentToken.content)) {
+
+        text = currentToken.content;
+        links = state.md.linkify.match(text);
+
+        // Now split string to nodes
+        nodes = [];
+        level = currentToken.level;
+        lastPos = 0;
+
+        for (ln = 0; ln < links.length; ln++) {
+
+          url = links[ln].url;
+          fullUrl = state.md.normalizeLink(url);
+          if (!state.md.validateLink(fullUrl)) { continue; }
+
+          urlText = links[ln].text;
+
+          // Linkifier might send raw hostnames like "example.com", where url
+          // starts with domain name. So we prepend http:// in those cases,
+          // and remove it afterwards.
+          //
+          if (!links[ln].schema) {
+            urlText = state.md.normalizeLinkText('http://' + urlText).replace(/^http:\/\//, '');
+          } else if (links[ln].schema === 'mailto:' && !/^mailto:/i.test(urlText)) {
+            urlText = state.md.normalizeLinkText('mailto:' + urlText).replace(/^mailto:/, '');
+          } else {
+            urlText = state.md.normalizeLinkText(urlText);
+          }
+
+          pos = links[ln].index;
+
+          if (pos > lastPos) {
+            token         = new state.Token('text', '', 0);
+            token.content = text.slice(lastPos, pos);
+            token.level   = level;
+            nodes.push(token);
+          }
+
+          token         = new state.Token('link_open', 'a', 1);
+          token.attrs   = [ [ 'href', fullUrl ] ];
+          token.level   = level++;
+          token.markup  = 'linkify';
+          token.info    = 'auto';
+          nodes.push(token);
+
+          token         = new state.Token('text', '', 0);
+          token.content = urlText;
+          token.level   = level;
+          nodes.push(token);
+
+          token         = new state.Token('link_close', 'a', -1);
+          token.level   = --level;
+          token.markup  = 'linkify';
+          token.info    = 'auto';
+          nodes.push(token);
+
+          lastPos = links[ln].lastIndex;
+        }
+        if (lastPos < text.length) {
+          token         = new state.Token('text', '', 0);
+          token.content = text.slice(lastPos);
+          token.level   = level;
+          nodes.push(token);
+        }
+
+        // replace current node
+        blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes);
+      }
+    }
+  }
+};
+
+},{"../common/utils":4}],33:[function(require,module,exports){
+// Normalize input string
+
+'use strict';
+
+
+var NEWLINES_RE  = /\r[\n\u0085]?|[\u2424\u2028\u0085]/g;
+var NULL_RE      = /\u0000/g;
+
+
+module.exports = function inline(state) {
+  var str;
+
+  // Normalize newlines
+  str = state.src.replace(NEWLINES_RE, '\n');
+
+  // Replace NULL characters
+  str = str.replace(NULL_RE, '\uFFFD');
+
+  state.src = str;
+};
+
+},{}],34:[function(require,module,exports){
+// Simple typographyc replacements
+//
+// (c) (C) → ©
+// (tm) (TM) → ™
+// (r) (R) → ®
+// +- → ±
+// (p) (P) -> §
+// ... → … (also ?.... → ?.., !.... → !..)
+// ???????? → ???, !!!!! → !!!, `,,` → `,`
+// -- → &ndash;, --- → &mdash;
+//
+'use strict';
+
+// TODO:
+// - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾
+// - miltiplication 2 x 4 -> 2 × 4
+
+var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/;
+
+// Workaround for phantomjs - need regex without /g flag,
+// or root check will fail every second time
+var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i;
+
+var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/ig;
+var SCOPED_ABBR = {
+  c: '©',
+  r: '®',
+  p: '§',
+  tm: '™'
+};
+
+function replaceFn(match, name) {
+  return SCOPED_ABBR[name.toLowerCase()];
+}
+
+function replace_scoped(inlineTokens) {
+  var i, token, inside_autolink = 0;
+
+  for (i = inlineTokens.length - 1; i >= 0; i--) {
+    token = inlineTokens[i];
+
+    if (token.type === 'text' && !inside_autolink) {
+      token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn);
+    }
+
+    if (token.type === 'link_open' && token.info === 'auto') {
+      inside_autolink--;
+    }
+
+    if (token.type === 'link_close' && token.info === 'auto') {
+      inside_autolink++;
+    }
+  }
+}
+
+function replace_rare(inlineTokens) {
+  var i, token, inside_autolink = 0;
+
+  for (i = inlineTokens.length - 1; i >= 0; i--) {
+    token = inlineTokens[i];
+
+    if (token.type === 'text' && !inside_autolink) {
+      if (RARE_RE.test(token.content)) {
+        token.content = token.content
+                    .replace(/\+-/g, '±')
+                    // .., ..., ....... -> …
+                    // but ?..... & !..... -> ?.. & !..
+                    .replace(/\.{2,}/g, '…').replace(/([?!])…/g, '$1..')
+                    .replace(/([?!]){4,}/g, '$1$1$1').replace(/,{2,}/g, ',')
+                    // em-dash
+                    .replace(/(^|[^-])---([^-]|$)/mg, '$1\u2014$2')
+                    // en-dash
+                    .replace(/(^|\s)--(\s|$)/mg, '$1\u2013$2')
+                    .replace(/(^|[^-\s])--([^-\s]|$)/mg, '$1\u2013$2');
+      }
+    }
+
+    if (token.type === 'link_open' && token.info === 'auto') {
+      inside_autolink--;
+    }
+
+    if (token.type === 'link_close' && token.info === 'auto') {
+      inside_autolink++;
+    }
+  }
+}
+
+
+module.exports = function replace(state) {
+  var blkIdx;
+
+  if (!state.md.options.typographer) { return; }
+
+  for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+
+    if (state.tokens[blkIdx].type !== 'inline') { continue; }
+
+    if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) {
+      replace_scoped(state.tokens[blkIdx].children);
+    }
+
+    if (RARE_RE.test(state.tokens[blkIdx].content)) {
+      replace_rare(state.tokens[blkIdx].children);
+    }
+
+  }
+};
+
+},{}],35:[function(require,module,exports){
+// Convert straight quotation marks to typographic ones
+//
+'use strict';
+
+
+var isWhiteSpace   = require('../common/utils').isWhiteSpace;
+var isPunctChar    = require('../common/utils').isPunctChar;
+var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct;
+
+var QUOTE_TEST_RE = /['"]/;
+var QUOTE_RE = /['"]/g;
+var APOSTROPHE = '\u2019'; /* ’ */
+
+
+function replaceAt(str, index, ch) {
+  return str.substr(0, index) + ch + str.substr(index + 1);
+}
+
+function process_inlines(tokens, state) {
+  var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar,
+      isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace,
+      canOpen, canClose, j, isSingle, stack, openQuote, closeQuote;
+
+  stack = [];
+
+  for (i = 0; i < tokens.length; i++) {
+    token = tokens[i];
+
+    thisLevel = tokens[i].level;
+
+    for (j = stack.length - 1; j >= 0; j--) {
+      if (stack[j].level <= thisLevel) { break; }
+    }
+    stack.length = j + 1;
+
+    if (token.type !== 'text') { continue; }
+
+    text = token.content;
+    pos = 0;
+    max = text.length;
+
+    /*eslint no-labels:0,block-scoped-var:0*/
+    OUTER:
+    while (pos < max) {
+      QUOTE_RE.lastIndex = pos;
+      t = QUOTE_RE.exec(text);
+      if (!t) { break; }
+
+      canOpen = canClose = true;
+      pos = t.index + 1;
+      isSingle = (t[0] === "'");
+
+      // Find previous character,
+      // default to space if it's the beginning of the line
+      //
+      lastChar = 0x20;
+
+      if (t.index - 1 >= 0) {
+        lastChar = text.charCodeAt(t.index - 1);
+      } else {
+        for (j = i - 1; j >= 0; j--) {
+          if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // lastChar defaults to 0x20
+          if (tokens[j].type !== 'text') continue;
+
+          lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1);
+          break;
+        }
+      }
+
+      // Find next character,
+      // default to space if it's the end of the line
+      //
+      nextChar = 0x20;
+
+      if (pos < max) {
+        nextChar = text.charCodeAt(pos);
+      } else {
+        for (j = i + 1; j < tokens.length; j++) {
+          if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // nextChar defaults to 0x20
+          if (tokens[j].type !== 'text') continue;
+
+          nextChar = tokens[j].content.charCodeAt(0);
+          break;
+        }
+      }
+
+      isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+      isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+
+      isLastWhiteSpace = isWhiteSpace(lastChar);
+      isNextWhiteSpace = isWhiteSpace(nextChar);
+
+      if (isNextWhiteSpace) {
+        canOpen = false;
+      } else if (isNextPunctChar) {
+        if (!(isLastWhiteSpace || isLastPunctChar)) {
+          canOpen = false;
+        }
+      }
+
+      if (isLastWhiteSpace) {
+        canClose = false;
+      } else if (isLastPunctChar) {
+        if (!(isNextWhiteSpace || isNextPunctChar)) {
+          canClose = false;
+        }
+      }
+
+      if (nextChar === 0x22 /* " */ && t[0] === '"') {
+        if (lastChar >= 0x30 /* 0 */ && lastChar <= 0x39 /* 9 */) {
+          // special case: 1"" - count first quote as an inch
+          canClose = canOpen = false;
+        }
+      }
+
+      if (canOpen && canClose) {
+        // treat this as the middle of the word
+        canOpen = false;
+        canClose = isNextPunctChar;
+      }
+
+      if (!canOpen && !canClose) {
+        // middle of word
+        if (isSingle) {
+          token.content = replaceAt(token.content, t.index, APOSTROPHE);
+        }
+        continue;
+      }
+
+      if (canClose) {
+        // this could be a closing quote, rewind the stack to get a match
+        for (j = stack.length - 1; j >= 0; j--) {
+          item = stack[j];
+          if (stack[j].level < thisLevel) { break; }
+          if (item.single === isSingle && stack[j].level === thisLevel) {
+            item = stack[j];
+
+            if (isSingle) {
+              openQuote = state.md.options.quotes[2];
+              closeQuote = state.md.options.quotes[3];
+            } else {
+              openQuote = state.md.options.quotes[0];
+              closeQuote = state.md.options.quotes[1];
+            }
+
+            // replace token.content *before* tokens[item.token].content,
+            // because, if they are pointing at the same token, replaceAt
+            // could mess up indices when quote length != 1
+            token.content = replaceAt(token.content, t.index, closeQuote);
+            tokens[item.token].content = replaceAt(
+              tokens[item.token].content, item.pos, openQuote);
+
+            pos += closeQuote.length - 1;
+            if (item.token === i) { pos += openQuote.length - 1; }
+
+            text = token.content;
+            max = text.length;
+
+            stack.length = j;
+            continue OUTER;
+          }
+        }
+      }
+
+      if (canOpen) {
+        stack.push({
+          token: i,
+          pos: t.index,
+          single: isSingle,
+          level: thisLevel
+        });
+      } else if (canClose && isSingle) {
+        token.content = replaceAt(token.content, t.index, APOSTROPHE);
+      }
+    }
+  }
+}
+
+
+module.exports = function smartquotes(state) {
+  /*eslint max-depth:0*/
+  var blkIdx;
+
+  if (!state.md.options.typographer) { return; }
+
+  for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+
+    if (state.tokens[blkIdx].type !== 'inline' ||
+        !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) {
+      continue;
+    }
+
+    process_inlines(state.tokens[blkIdx].children, state);
+  }
+};
+
+},{"../common/utils":4}],36:[function(require,module,exports){
+// Core state object
+//
+'use strict';
+
+var Token = require('../token');
+
+
+function StateCore(src, md, env) {
+  this.src = src;
+  this.env = env;
+  this.tokens = [];
+  this.inlineMode = false;
+  this.md = md; // link to parser instance
+}
+
+// re-export Token class to use in core rules
+StateCore.prototype.Token = Token;
+
+
+module.exports = StateCore;
+
+},{"../token":51}],37:[function(require,module,exports){
+// Process autolinks '<protocol:...>'
+
+'use strict';
+
+
+/*eslint max-len:0*/
+var EMAIL_RE    = /^<([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)>/;
+var AUTOLINK_RE = /^<([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)>/;
+
+
+module.exports = function autolink(state, silent) {
+  var tail, linkMatch, emailMatch, url, fullUrl, token,
+      pos = state.pos;
+
+  if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+
+  tail = state.src.slice(pos);
+
+  if (tail.indexOf('>') < 0) { return false; }
+
+  if (AUTOLINK_RE.test(tail)) {
+    linkMatch = tail.match(AUTOLINK_RE);
+
+    url = linkMatch[0].slice(1, -1);
+    fullUrl = state.md.normalizeLink(url);
+    if (!state.md.validateLink(fullUrl)) { return false; }
+
+    if (!silent) {
+      token         = state.push('link_open', 'a', 1);
+      token.attrs   = [ [ 'href', fullUrl ] ];
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+
+      token         = state.push('text', '', 0);
+      token.content = state.md.normalizeLinkText(url);
+
+      token         = state.push('link_close', 'a', -1);
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+    }
+
+    state.pos += linkMatch[0].length;
+    return true;
+  }
+
+  if (EMAIL_RE.test(tail)) {
+    emailMatch = tail.match(EMAIL_RE);
+
+    url = emailMatch[0].slice(1, -1);
+    fullUrl = state.md.normalizeLink('mailto:' + url);
+    if (!state.md.validateLink(fullUrl)) { return false; }
+
+    if (!silent) {
+      token         = state.push('link_open', 'a', 1);
+      token.attrs   = [ [ 'href', fullUrl ] ];
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+
+      token         = state.push('text', '', 0);
+      token.content = state.md.normalizeLinkText(url);
+
+      token         = state.push('link_close', 'a', -1);
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+    }
+
+    state.pos += emailMatch[0].length;
+    return true;
+  }
+
+  return false;
+};
+
+},{}],38:[function(require,module,exports){
+// Parse backticks
+
+'use strict';
+
+module.exports = function backtick(state, silent) {
+  var start, max, marker, matchStart, matchEnd, token,
+      pos = state.pos,
+      ch = state.src.charCodeAt(pos);
+
+  if (ch !== 0x60/* ` */) { return false; }
+
+  start = pos;
+  pos++;
+  max = state.posMax;
+
+  while (pos < max && state.src.charCodeAt(pos) === 0x60/* ` */) { pos++; }
+
+  marker = state.src.slice(start, pos);
+
+  matchStart = matchEnd = pos;
+
+  while ((matchStart = state.src.indexOf('`', matchEnd)) !== -1) {
+    matchEnd = matchStart + 1;
+
+    while (matchEnd < max && state.src.charCodeAt(matchEnd) === 0x60/* ` */) { matchEnd++; }
+
+    if (matchEnd - matchStart === marker.length) {
+      if (!silent) {
+        token         = state.push('code_inline', 'code', 0);
+        token.markup  = marker;
+        token.content = state.src.slice(pos, matchStart)
+                                 .replace(/[ \n]+/g, ' ')
+                                 .trim();
+      }
+      state.pos = matchEnd;
+      return true;
+    }
+  }
+
+  if (!silent) { state.pending += marker; }
+  state.pos += marker.length;
+  return true;
+};
+
+},{}],39:[function(require,module,exports){
+// For each opening emphasis-like marker find a matching closing one
+//
+'use strict';
+
+
+module.exports = function link_pairs(state) {
+  var i, j, lastDelim, currDelim,
+      delimiters = state.delimiters,
+      max = state.delimiters.length;
+
+  for (i = 0; i < max; i++) {
+    lastDelim = delimiters[i];
+
+    if (!lastDelim.close) { continue; }
+
+    j = i - lastDelim.jump - 1;
+
+    while (j >= 0) {
+      currDelim = delimiters[j];
+
+      if (currDelim.open &&
+          currDelim.marker === lastDelim.marker &&
+          currDelim.end < 0 &&
+          currDelim.level === lastDelim.level) {
+
+        // typeofs are for backward compatibility with plugins
+        var odd_match = (currDelim.close || lastDelim.open) &&
+                        typeof currDelim.length !== 'undefined' &&
+                        typeof lastDelim.length !== 'undefined' &&
+                        (currDelim.length + lastDelim.length) % 3 === 0;
+
+        if (!odd_match) {
+          lastDelim.jump = i - j;
+          lastDelim.open = false;
+          currDelim.end  = i;
+          currDelim.jump = 0;
+          break;
+        }
+      }
+
+      j -= currDelim.jump + 1;
+    }
+  }
+};
+
+},{}],40:[function(require,module,exports){
+// Process *this* and _that_
+//
+'use strict';
+
+
+// Insert each marker as a separate text token, and add it to delimiter list
+//
+module.exports.tokenize = function emphasis(state, silent) {
+  var i, scanned, token,
+      start = state.pos,
+      marker = state.src.charCodeAt(start);
+
+  if (silent) { return false; }
+
+  if (marker !== 0x5F /* _ */ && marker !== 0x2A /* * */) { return false; }
+
+  scanned = state.scanDelims(state.pos, marker === 0x2A);
+
+  for (i = 0; i < scanned.length; i++) {
+    token         = state.push('text', '', 0);
+    token.content = String.fromCharCode(marker);
+
+    state.delimiters.push({
+      // Char code of the starting marker (number).
+      //
+      marker: marker,
+
+      // Total length of these series of delimiters.
+      //
+      length: scanned.length,
+
+      // An amount of characters before this one that's equivalent to
+      // current one. In plain English: if this delimiter does not open
+      // an emphasis, neither do previous `jump` characters.
+      //
+      // Used to skip sequences like "*****" in one step, for 1st asterisk
+      // value will be 0, for 2nd it's 1 and so on.
+      //
+      jump:   i,
+
+      // A position of the token this delimiter corresponds to.
+      //
+      token:  state.tokens.length - 1,
+
+      // Token level.
+      //
+      level:  state.level,
+
+      // If this delimiter is matched as a valid opener, `end` will be
+      // equal to its position, otherwise it's `-1`.
+      //
+      end:    -1,
+
+      // Boolean flags that determine if this delimiter could open or close
+      // an emphasis.
+      //
+      open:   scanned.can_open,
+      close:  scanned.can_close
+    });
+  }
+
+  state.pos += scanned.length;
+
+  return true;
+};
+
+
+// Walk through delimiter list and replace text tokens with tags
+//
+module.exports.postProcess = function emphasis(state) {
+  var i,
+      startDelim,
+      endDelim,
+      token,
+      ch,
+      isStrong,
+      delimiters = state.delimiters,
+      max = state.delimiters.length;
+
+  for (i = max - 1; i >= 0; i--) {
+    startDelim = delimiters[i];
+
+    if (startDelim.marker !== 0x5F/* _ */ && startDelim.marker !== 0x2A/* * */) {
+      continue;
+    }
+
+    // Process only opening markers
+    if (startDelim.end === -1) {
+      continue;
+    }
+
+    endDelim = delimiters[startDelim.end];
+
+    // If the previous delimiter has the same marker and is adjacent to this one,
+    // merge those into one strong delimiter.
+    //
+    // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>`
+    //
+    isStrong = i > 0 &&
+               delimiters[i - 1].end === startDelim.end + 1 &&
+               delimiters[i - 1].token === startDelim.token - 1 &&
+               delimiters[startDelim.end + 1].token === endDelim.token + 1 &&
+               delimiters[i - 1].marker === startDelim.marker;
+
+    ch = String.fromCharCode(startDelim.marker);
+
+    token         = state.tokens[startDelim.token];
+    token.type    = isStrong ? 'strong_open' : 'em_open';
+    token.tag     = isStrong ? 'strong' : 'em';
+    token.nesting = 1;
+    token.markup  = isStrong ? ch + ch : ch;
+    token.content = '';
+
+    token         = state.tokens[endDelim.token];
+    token.type    = isStrong ? 'strong_close' : 'em_close';
+    token.tag     = isStrong ? 'strong' : 'em';
+    token.nesting = -1;
+    token.markup  = isStrong ? ch + ch : ch;
+    token.content = '';
+
+    if (isStrong) {
+      state.tokens[delimiters[i - 1].token].content = '';
+      state.tokens[delimiters[startDelim.end + 1].token].content = '';
+      i--;
+    }
+  }
+};
+
+},{}],41:[function(require,module,exports){
+// Process html entity - &#123;, &#xAF;, &quot;, ...
+
+'use strict';
+
+var entities          = require('../common/entities');
+var has               = require('../common/utils').has;
+var isValidEntityCode = require('../common/utils').isValidEntityCode;
+var fromCodePoint     = require('../common/utils').fromCodePoint;
+
+
+var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,8}|[0-9]{1,8}));/i;
+var NAMED_RE   = /^&([a-z][a-z0-9]{1,31});/i;
+
+
+module.exports = function entity(state, silent) {
+  var ch, code, match, pos = state.pos, max = state.posMax;
+
+  if (state.src.charCodeAt(pos) !== 0x26/* & */) { return false; }
+
+  if (pos + 1 < max) {
+    ch = state.src.charCodeAt(pos + 1);
+
+    if (ch === 0x23 /* # */) {
+      match = state.src.slice(pos).match(DIGITAL_RE);
+      if (match) {
+        if (!silent) {
+          code = match[1][0].toLowerCase() === 'x' ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10);
+          state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(0xFFFD);
+        }
+        state.pos += match[0].length;
+        return true;
+      }
+    } else {
+      match = state.src.slice(pos).match(NAMED_RE);
+      if (match) {
+        if (has(entities, match[1])) {
+          if (!silent) { state.pending += entities[match[1]]; }
+          state.pos += match[0].length;
+          return true;
+        }
+      }
+    }
+  }
+
+  if (!silent) { state.pending += '&'; }
+  state.pos++;
+  return true;
+};
+
+},{"../common/entities":1,"../common/utils":4}],42:[function(require,module,exports){
+// Process escaped chars and hardbreaks
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+var ESCAPED = [];
+
+for (var i = 0; i < 256; i++) { ESCAPED.push(0); }
+
+'\\!"#$%&\'()*+,./:;<=>?@[]^_`{|}~-'
+  .split('').forEach(function (ch) { ESCAPED[ch.charCodeAt(0)] = 1; });
+
+
+module.exports = function escape(state, silent) {
+  var ch, pos = state.pos, max = state.posMax;
+
+  if (state.src.charCodeAt(pos) !== 0x5C/* \ */) { return false; }
+
+  pos++;
+
+  if (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (ch < 256 && ESCAPED[ch] !== 0) {
+      if (!silent) { state.pending += state.src[pos]; }
+      state.pos += 2;
+      return true;
+    }
+
+    if (ch === 0x0A) {
+      if (!silent) {
+        state.push('hardbreak', 'br', 0);
+      }
+
+      pos++;
+      // skip leading whitespaces from next line
+      while (pos < max) {
+        ch = state.src.charCodeAt(pos);
+        if (!isSpace(ch)) { break; }
+        pos++;
+      }
+
+      state.pos = pos;
+      return true;
+    }
+  }
+
+  if (!silent) { state.pending += '\\'; }
+  state.pos++;
+  return true;
+};
+
+},{"../common/utils":4}],43:[function(require,module,exports){
+// Process html tags
+
+'use strict';
+
+
+var HTML_TAG_RE = require('../common/html_re').HTML_TAG_RE;
+
+
+function isLetter(ch) {
+  /*eslint no-bitwise:0*/
+  var lc = ch | 0x20; // to lower case
+  return (lc >= 0x61/* a */) && (lc <= 0x7a/* z */);
+}
+
+
+module.exports = function html_inline(state, silent) {
+  var ch, match, max, token,
+      pos = state.pos;
+
+  if (!state.md.options.html) { return false; }
+
+  // Check start
+  max = state.posMax;
+  if (state.src.charCodeAt(pos) !== 0x3C/* < */ ||
+      pos + 2 >= max) {
+    return false;
+  }
+
+  // Quick fail on second char
+  ch = state.src.charCodeAt(pos + 1);
+  if (ch !== 0x21/* ! */ &&
+      ch !== 0x3F/* ? */ &&
+      ch !== 0x2F/* / */ &&
+      !isLetter(ch)) {
+    return false;
+  }
+
+  match = state.src.slice(pos).match(HTML_TAG_RE);
+  if (!match) { return false; }
+
+  if (!silent) {
+    token         = state.push('html_inline', '', 0);
+    token.content = state.src.slice(pos, pos + match[0].length);
+  }
+  state.pos += match[0].length;
+  return true;
+};
+
+},{"../common/html_re":3}],44:[function(require,module,exports){
+// Process ![image](<src> "title")
+
+'use strict';
+
+var normalizeReference   = require('../common/utils').normalizeReference;
+var isSpace              = require('../common/utils').isSpace;
+
+
+module.exports = function image(state, silent) {
+  var attrs,
+      code,
+      content,
+      label,
+      labelEnd,
+      labelStart,
+      pos,
+      ref,
+      res,
+      title,
+      token,
+      tokens,
+      start,
+      href = '',
+      oldPos = state.pos,
+      max = state.posMax;
+
+  if (state.src.charCodeAt(state.pos) !== 0x21/* ! */) { return false; }
+  if (state.src.charCodeAt(state.pos + 1) !== 0x5B/* [ */) { return false; }
+
+  labelStart = state.pos + 2;
+  labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false);
+
+  // parser failed to find ']', so it's not a valid link
+  if (labelEnd < 0) { return false; }
+
+  pos = labelEnd + 1;
+  if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) {
+    //
+    // Inline link
+    //
+
+    // [link](  <href>  "title"  )
+    //        ^^ skipping these spaces
+    pos++;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+    if (pos >= max) { return false; }
+
+    // [link](  <href>  "title"  )
+    //          ^^^^^^ parsing link destination
+    start = pos;
+    res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+    if (res.ok) {
+      href = state.md.normalizeLink(res.str);
+      if (state.md.validateLink(href)) {
+        pos = res.pos;
+      } else {
+        href = '';
+      }
+    }
+
+    // [link](  <href>  "title"  )
+    //                ^^ skipping these spaces
+    start = pos;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+
+    // [link](  <href>  "title"  )
+    //                  ^^^^^^^ parsing link title
+    res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+    if (pos < max && start !== pos && res.ok) {
+      title = res.str;
+      pos = res.pos;
+
+      // [link](  <href>  "title"  )
+      //                         ^^ skipping these spaces
+      for (; pos < max; pos++) {
+        code = state.src.charCodeAt(pos);
+        if (!isSpace(code) && code !== 0x0A) { break; }
+      }
+    } else {
+      title = '';
+    }
+
+    if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) {
+      state.pos = oldPos;
+      return false;
+    }
+    pos++;
+  } else {
+    //
+    // Link reference
+    //
+    if (typeof state.env.references === 'undefined') { return false; }
+
+    if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) {
+      start = pos + 1;
+      pos = state.md.helpers.parseLinkLabel(state, pos);
+      if (pos >= 0) {
+        label = state.src.slice(start, pos++);
+      } else {
+        pos = labelEnd + 1;
+      }
+    } else {
+      pos = labelEnd + 1;
+    }
+
+    // covers label === '' and label === undefined
+    // (collapsed reference link and shortcut reference link respectively)
+    if (!label) { label = state.src.slice(labelStart, labelEnd); }
+
+    ref = state.env.references[normalizeReference(label)];
+    if (!ref) {
+      state.pos = oldPos;
+      return false;
+    }
+    href = ref.href;
+    title = ref.title;
+  }
+
+  //
+  // We found the end of the link, and know for a fact it's a valid link;
+  // so all that's left to do is to call tokenizer.
+  //
+  if (!silent) {
+    content = state.src.slice(labelStart, labelEnd);
+
+    state.md.inline.parse(
+      content,
+      state.md,
+      state.env,
+      tokens = []
+    );
+
+    token          = state.push('image', 'img', 0);
+    token.attrs    = attrs = [ [ 'src', href ], [ 'alt', '' ] ];
+    token.children = tokens;
+    token.content  = content;
+
+    if (title) {
+      attrs.push([ 'title', title ]);
+    }
+  }
+
+  state.pos = pos;
+  state.posMax = max;
+  return true;
+};
+
+},{"../common/utils":4}],45:[function(require,module,exports){
+// Process [link](<to> "stuff")
+
+'use strict';
+
+var normalizeReference   = require('../common/utils').normalizeReference;
+var isSpace              = require('../common/utils').isSpace;
+
+
+module.exports = function link(state, silent) {
+  var attrs,
+      code,
+      label,
+      labelEnd,
+      labelStart,
+      pos,
+      res,
+      ref,
+      title,
+      token,
+      href = '',
+      oldPos = state.pos,
+      max = state.posMax,
+      start = state.pos,
+      parseReference = true;
+
+  if (state.src.charCodeAt(state.pos) !== 0x5B/* [ */) { return false; }
+
+  labelStart = state.pos + 1;
+  labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true);
+
+  // parser failed to find ']', so it's not a valid link
+  if (labelEnd < 0) { return false; }
+
+  pos = labelEnd + 1;
+  if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) {
+    //
+    // Inline link
+    //
+
+    // might have found a valid shortcut link, disable reference parsing
+    parseReference = false;
+
+    // [link](  <href>  "title"  )
+    //        ^^ skipping these spaces
+    pos++;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+    if (pos >= max) { return false; }
+
+    // [link](  <href>  "title"  )
+    //          ^^^^^^ parsing link destination
+    start = pos;
+    res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+    if (res.ok) {
+      href = state.md.normalizeLink(res.str);
+      if (state.md.validateLink(href)) {
+        pos = res.pos;
+      } else {
+        href = '';
+      }
+    }
+
+    // [link](  <href>  "title"  )
+    //                ^^ skipping these spaces
+    start = pos;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+
+    // [link](  <href>  "title"  )
+    //                  ^^^^^^^ parsing link title
+    res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+    if (pos < max && start !== pos && res.ok) {
+      title = res.str;
+      pos = res.pos;
+
+      // [link](  <href>  "title"  )
+      //                         ^^ skipping these spaces
+      for (; pos < max; pos++) {
+        code = state.src.charCodeAt(pos);
+        if (!isSpace(code) && code !== 0x0A) { break; }
+      }
+    } else {
+      title = '';
+    }
+
+    if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) {
+      // parsing a valid shortcut link failed, fallback to reference
+      parseReference = true;
+    }
+    pos++;
+  }
+
+  if (parseReference) {
+    //
+    // Link reference
+    //
+    if (typeof state.env.references === 'undefined') { return false; }
+
+    if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) {
+      start = pos + 1;
+      pos = state.md.helpers.parseLinkLabel(state, pos);
+      if (pos >= 0) {
+        label = state.src.slice(start, pos++);
+      } else {
+        pos = labelEnd + 1;
+      }
+    } else {
+      pos = labelEnd + 1;
+    }
+
+    // covers label === '' and label === undefined
+    // (collapsed reference link and shortcut reference link respectively)
+    if (!label) { label = state.src.slice(labelStart, labelEnd); }
+
+    ref = state.env.references[normalizeReference(label)];
+    if (!ref) {
+      state.pos = oldPos;
+      return false;
+    }
+    href = ref.href;
+    title = ref.title;
+  }
+
+  //
+  // We found the end of the link, and know for a fact it's a valid link;
+  // so all that's left to do is to call tokenizer.
+  //
+  if (!silent) {
+    state.pos = labelStart;
+    state.posMax = labelEnd;
+
+    token        = state.push('link_open', 'a', 1);
+    token.attrs  = attrs = [ [ 'href', href ] ];
+    if (title) {
+      attrs.push([ 'title', title ]);
+    }
+
+    state.md.inline.tokenize(state);
+
+    token        = state.push('link_close', 'a', -1);
+  }
+
+  state.pos = pos;
+  state.posMax = max;
+  return true;
+};
+
+},{"../common/utils":4}],46:[function(require,module,exports){
+// Proceess '\n'
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function newline(state, silent) {
+  var pmax, max, pos = state.pos;
+
+  if (state.src.charCodeAt(pos) !== 0x0A/* \n */) { return false; }
+
+  pmax = state.pending.length - 1;
+  max = state.posMax;
+
+  // '  \n' -> hardbreak
+  // Lookup in pending chars is bad practice! Don't copy to other rules!
+  // Pending string is stored in concat mode, indexed lookups will cause
+  // convertion to flat mode.
+  if (!silent) {
+    if (pmax >= 0 && state.pending.charCodeAt(pmax) === 0x20) {
+      if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 0x20) {
+        state.pending = state.pending.replace(/ +$/, '');
+        state.push('hardbreak', 'br', 0);
+      } else {
+        state.pending = state.pending.slice(0, -1);
+        state.push('softbreak', 'br', 0);
+      }
+
+    } else {
+      state.push('softbreak', 'br', 0);
+    }
+  }
+
+  pos++;
+
+  // skip heading spaces for next line
+  while (pos < max && isSpace(state.src.charCodeAt(pos))) { pos++; }
+
+  state.pos = pos;
+  return true;
+};
+
+},{"../common/utils":4}],47:[function(require,module,exports){
+// Inline parser state
+
+'use strict';
+
+
+var Token          = require('../token');
+var isWhiteSpace   = require('../common/utils').isWhiteSpace;
+var isPunctChar    = require('../common/utils').isPunctChar;
+var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct;
+
+
+function StateInline(src, md, env, outTokens) {
+  this.src = src;
+  this.env = env;
+  this.md = md;
+  this.tokens = outTokens;
+
+  this.pos = 0;
+  this.posMax = this.src.length;
+  this.level = 0;
+  this.pending = '';
+  this.pendingLevel = 0;
+
+  this.cache = {};        // Stores { start: end } pairs. Useful for backtrack
+                          // optimization of pairs parse (emphasis, strikes).
+
+  this.delimiters = [];   // Emphasis-like delimiters
+}
+
+
+// Flush pending text
+//
+StateInline.prototype.pushPending = function () {
+  var token = new Token('text', '', 0);
+  token.content = this.pending;
+  token.level = this.pendingLevel;
+  this.tokens.push(token);
+  this.pending = '';
+  return token;
+};
+
+
+// Push new token to "stream".
+// If pending text exists - flush it as text token
+//
+StateInline.prototype.push = function (type, tag, nesting) {
+  if (this.pending) {
+    this.pushPending();
+  }
+
+  var token = new Token(type, tag, nesting);
+
+  if (nesting < 0) { this.level--; }
+  token.level = this.level;
+  if (nesting > 0) { this.level++; }
+
+  this.pendingLevel = this.level;
+  this.tokens.push(token);
+  return token;
+};
+
+
+// Scan a sequence of emphasis-like markers, and determine whether
+// it can start an emphasis sequence or end an emphasis sequence.
+//
+//  - start - position to scan from (it should point at a valid marker);
+//  - canSplitWord - determine if these markers can be found inside a word
+//
+StateInline.prototype.scanDelims = function (start, canSplitWord) {
+  var pos = start, lastChar, nextChar, count, can_open, can_close,
+      isLastWhiteSpace, isLastPunctChar,
+      isNextWhiteSpace, isNextPunctChar,
+      left_flanking = true,
+      right_flanking = true,
+      max = this.posMax,
+      marker = this.src.charCodeAt(start);
+
+  // treat beginning of the line as a whitespace
+  lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 0x20;
+
+  while (pos < max && this.src.charCodeAt(pos) === marker) { pos++; }
+
+  count = pos - start;
+
+  // treat end of the line as a whitespace
+  nextChar = pos < max ? this.src.charCodeAt(pos) : 0x20;
+
+  isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+  isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+
+  isLastWhiteSpace = isWhiteSpace(lastChar);
+  isNextWhiteSpace = isWhiteSpace(nextChar);
+
+  if (isNextWhiteSpace) {
+    left_flanking = false;
+  } else if (isNextPunctChar) {
+    if (!(isLastWhiteSpace || isLastPunctChar)) {
+      left_flanking = false;
+    }
+  }
+
+  if (isLastWhiteSpace) {
+    right_flanking = false;
+  } else if (isLastPunctChar) {
+    if (!(isNextWhiteSpace || isNextPunctChar)) {
+      right_flanking = false;
+    }
+  }
+
+  if (!canSplitWord) {
+    can_open  = left_flanking  && (!right_flanking || isLastPunctChar);
+    can_close = right_flanking && (!left_flanking  || isNextPunctChar);
+  } else {
+    can_open  = left_flanking;
+    can_close = right_flanking;
+  }
+
+  return {
+    can_open:  can_open,
+    can_close: can_close,
+    length:    count
+  };
+};
+
+
+// re-export Token class to use in block rules
+StateInline.prototype.Token = Token;
+
+
+module.exports = StateInline;
+
+},{"../common/utils":4,"../token":51}],48:[function(require,module,exports){
+// ~~strike through~~
+//
+'use strict';
+
+
+// Insert each marker as a separate text token, and add it to delimiter list
+//
+module.exports.tokenize = function strikethrough(state, silent) {
+  var i, scanned, token, len, ch,
+      start = state.pos,
+      marker = state.src.charCodeAt(start);
+
+  if (silent) { return false; }
+
+  if (marker !== 0x7E/* ~ */) { return false; }
+
+  scanned = state.scanDelims(state.pos, true);
+  len = scanned.length;
+  ch = String.fromCharCode(marker);
+
+  if (len < 2) { return false; }
+
+  if (len % 2) {
+    token         = state.push('text', '', 0);
+    token.content = ch;
+    len--;
+  }
+
+  for (i = 0; i < len; i += 2) {
+    token         = state.push('text', '', 0);
+    token.content = ch + ch;
+
+    state.delimiters.push({
+      marker: marker,
+      jump:   i,
+      token:  state.tokens.length - 1,
+      level:  state.level,
+      end:    -1,
+      open:   scanned.can_open,
+      close:  scanned.can_close
+    });
+  }
+
+  state.pos += scanned.length;
+
+  return true;
+};
+
+
+// Walk through delimiter list and replace text tokens with tags
+//
+module.exports.postProcess = function strikethrough(state) {
+  var i, j,
+      startDelim,
+      endDelim,
+      token,
+      loneMarkers = [],
+      delimiters = state.delimiters,
+      max = state.delimiters.length;
+
+  for (i = 0; i < max; i++) {
+    startDelim = delimiters[i];
+
+    if (startDelim.marker !== 0x7E/* ~ */) {
+      continue;
+    }
+
+    if (startDelim.end === -1) {
+      continue;
+    }
+
+    endDelim = delimiters[startDelim.end];
+
+    token         = state.tokens[startDelim.token];
+    token.type    = 's_open';
+    token.tag     = 's';
+    token.nesting = 1;
+    token.markup  = '~~';
+    token.content = '';
+
+    token         = state.tokens[endDelim.token];
+    token.type    = 's_close';
+    token.tag     = 's';
+    token.nesting = -1;
+    token.markup  = '~~';
+    token.content = '';
+
+    if (state.tokens[endDelim.token - 1].type === 'text' &&
+        state.tokens[endDelim.token - 1].content === '~') {
+
+      loneMarkers.push(endDelim.token - 1);
+    }
+  }
+
+  // If a marker sequence has an odd number of characters, it's splitted
+  // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the
+  // start of the sequence.
+  //
+  // So, we have to move all those markers after subsequent s_close tags.
+  //
+  while (loneMarkers.length) {
+    i = loneMarkers.pop();
+    j = i + 1;
+
+    while (j < state.tokens.length && state.tokens[j].type === 's_close') {
+      j++;
+    }
+
+    j--;
+
+    if (i !== j) {
+      token = state.tokens[j];
+      state.tokens[j] = state.tokens[i];
+      state.tokens[i] = token;
+    }
+  }
+};
+
+},{}],49:[function(require,module,exports){
+// Skip text characters for text token, place those to pending buffer
+// and increment current pos
+
+'use strict';
+
+
+// Rule to skip pure text
+// '{}$%@~+=:' reserved for extentions
+
+// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+
+// !!!! Don't confuse with "Markdown ASCII Punctuation" chars
+// http://spec.commonmark.org/0.15/#ascii-punctuation-character
+function isTerminatorChar(ch) {
+  switch (ch) {
+    case 0x0A/* \n */:
+    case 0x21/* ! */:
+    case 0x23/* # */:
+    case 0x24/* $ */:
+    case 0x25/* % */:
+    case 0x26/* & */:
+    case 0x2A/* * */:
+    case 0x2B/* + */:
+    case 0x2D/* - */:
+    case 0x3A/* : */:
+    case 0x3C/* < */:
+    case 0x3D/* = */:
+    case 0x3E/* > */:
+    case 0x40/* @ */:
+    case 0x5B/* [ */:
+    case 0x5C/* \ */:
+    case 0x5D/* ] */:
+    case 0x5E/* ^ */:
+    case 0x5F/* _ */:
+    case 0x60/* ` */:
+    case 0x7B/* { */:
+    case 0x7D/* } */:
+    case 0x7E/* ~ */:
+      return true;
+    default:
+      return false;
+  }
+}
+
+module.exports = function text(state, silent) {
+  var pos = state.pos;
+
+  while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) {
+    pos++;
+  }
+
+  if (pos === state.pos) { return false; }
+
+  if (!silent) { state.pending += state.src.slice(state.pos, pos); }
+
+  state.pos = pos;
+
+  return true;
+};
+
+// Alternative implementation, for memory.
+//
+// It costs 10% of performance, but allows extend terminators list, if place it
+// to `ParcerInline` property. Probably, will switch to it sometime, such
+// flexibility required.
+
+/*
+var TERMINATOR_RE = /[\n!#$%&*+\-:<=>@[\\\]^_`{}~]/;
+
+module.exports = function text(state, silent) {
+  var pos = state.pos,
+      idx = state.src.slice(pos).search(TERMINATOR_RE);
+
+  // first char is terminator -> empty text
+  if (idx === 0) { return false; }
+
+  // no terminator -> text till end of string
+  if (idx < 0) {
+    if (!silent) { state.pending += state.src.slice(pos); }
+    state.pos = state.src.length;
+    return true;
+  }
+
+  if (!silent) { state.pending += state.src.slice(pos, pos + idx); }
+
+  state.pos += idx;
+
+  return true;
+};*/
+
+},{}],50:[function(require,module,exports){
+// Merge adjacent text nodes into one, and re-calculate all token levels
+//
+'use strict';
+
+
+module.exports = function text_collapse(state) {
+  var curr, last,
+      level = 0,
+      tokens = state.tokens,
+      max = state.tokens.length;
+
+  for (curr = last = 0; curr < max; curr++) {
+    // re-calculate levels
+    level += tokens[curr].nesting;
+    tokens[curr].level = level;
+
+    if (tokens[curr].type === 'text' &&
+        curr + 1 < max &&
+        tokens[curr + 1].type === 'text') {
+
+      // collapse two adjacent text nodes
+      tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content;
+    } else {
+      if (curr !== last) { tokens[last] = tokens[curr]; }
+
+      last++;
+    }
+  }
+
+  if (curr !== last) {
+    tokens.length = last;
+  }
+};
+
+},{}],51:[function(require,module,exports){
+// Token class
+
+'use strict';
+
+
+/**
+ * class Token
+ **/
+
+/**
+ * new Token(type, tag, nesting)
+ *
+ * Create new token and fill passed properties.
+ **/
+function Token(type, tag, nesting) {
+  /**
+   * Token#type -> String
+   *
+   * Type of the token (string, e.g. "paragraph_open")
+   **/
+  this.type     = type;
+
+  /**
+   * Token#tag -> String
+   *
+   * html tag name, e.g. "p"
+   **/
+  this.tag      = tag;
+
+  /**
+   * Token#attrs -> Array
+   *
+   * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]`
+   **/
+  this.attrs    = null;
+
+  /**
+   * Token#map -> Array
+   *
+   * Source map info. Format: `[ line_begin, line_end ]`
+   **/
+  this.map      = null;
+
+  /**
+   * Token#nesting -> Number
+   *
+   * Level change (number in {-1, 0, 1} set), where:
+   *
+   * -  `1` means the tag is opening
+   * -  `0` means the tag is self-closing
+   * - `-1` means the tag is closing
+   **/
+  this.nesting  = nesting;
+
+  /**
+   * Token#level -> Number
+   *
+   * nesting level, the same as `state.level`
+   **/
+  this.level    = 0;
+
+  /**
+   * Token#children -> Array
+   *
+   * An array of child nodes (inline and img tokens)
+   **/
+  this.children = null;
+
+  /**
+   * Token#content -> String
+   *
+   * In a case of self-closing tag (code, html, fence, etc.),
+   * it has contents of this tag.
+   **/
+  this.content  = '';
+
+  /**
+   * Token#markup -> String
+   *
+   * '*' or '_' for emphasis, fence string for fence, etc.
+   **/
+  this.markup   = '';
+
+  /**
+   * Token#info -> String
+   *
+   * fence infostring
+   **/
+  this.info     = '';
+
+  /**
+   * Token#meta -> Object
+   *
+   * A place for plugins to store an arbitrary data
+   **/
+  this.meta     = null;
+
+  /**
+   * Token#block -> Boolean
+   *
+   * True for block-level tokens, false for inline tokens.
+   * Used in renderer to calculate line breaks
+   **/
+  this.block    = false;
+
+  /**
+   * Token#hidden -> Boolean
+   *
+   * If it's true, ignore this element when rendering. Used for tight lists
+   * to hide paragraphs.
+   **/
+  this.hidden   = false;
+}
+
+
+/**
+ * Token.attrIndex(name) -> Number
+ *
+ * Search attribute index by name.
+ **/
+Token.prototype.attrIndex = function attrIndex(name) {
+  var attrs, i, len;
+
+  if (!this.attrs) { return -1; }
+
+  attrs = this.attrs;
+
+  for (i = 0, len = attrs.length; i < len; i++) {
+    if (attrs[i][0] === name) { return i; }
+  }
+  return -1;
+};
+
+
+/**
+ * Token.attrPush(attrData)
+ *
+ * Add `[ name, value ]` attribute to list. Init attrs if necessary
+ **/
+Token.prototype.attrPush = function attrPush(attrData) {
+  if (this.attrs) {
+    this.attrs.push(attrData);
+  } else {
+    this.attrs = [ attrData ];
+  }
+};
+
+
+/**
+ * Token.attrSet(name, value)
+ *
+ * Set `name` attribute to `value`. Override old value if exists.
+ **/
+Token.prototype.attrSet = function attrSet(name, value) {
+  var idx = this.attrIndex(name),
+      attrData = [ name, value ];
+
+  if (idx < 0) {
+    this.attrPush(attrData);
+  } else {
+    this.attrs[idx] = attrData;
+  }
+};
+
+
+/**
+ * Token.attrGet(name)
+ *
+ * Get the value of attribute `name`, or null if it does not exist.
+ **/
+Token.prototype.attrGet = function attrGet(name) {
+  var idx = this.attrIndex(name), value = null;
+  if (idx >= 0) {
+    value = this.attrs[idx][1];
+  }
+  return value;
+};
+
+
+/**
+ * Token.attrJoin(name, value)
+ *
+ * Join value to existing attribute via space. Or create new attribute if not
+ * exists. Useful to operate with token classes.
+ **/
+Token.prototype.attrJoin = function attrJoin(name, value) {
+  var idx = this.attrIndex(name);
+
+  if (idx < 0) {
+    this.attrPush([ name, value ]);
+  } else {
+    this.attrs[idx][1] = this.attrs[idx][1] + ' ' + value;
+  }
+};
+
+
+module.exports = Token;
+
+},{}],52:[function(require,module,exports){
+module.exports={"Aacute":"\u00C1","aacute":"\u00E1","Abreve":"\u0102","abreve":"\u0103","ac":"\u223E","acd":"\u223F","acE":"\u223E\u0333","Acirc":"\u00C2","acirc":"\u00E2","acute":"\u00B4","Acy":"\u0410","acy":"\u0430","AElig":"\u00C6","aelig":"\u00E6","af":"\u2061","Afr":"\uD835\uDD04","afr":"\uD835\uDD1E","Agrave":"\u00C0","agrave":"\u00E0","alefsym":"\u2135","aleph":"\u2135","Alpha":"\u0391","alpha":"\u03B1","Amacr":"\u0100","amacr":"\u0101","amalg":"\u2A3F","amp":"&","AMP":"&","andand":"\u2A55","And":"\u2A53","and":"\u2227","andd":"\u2A5C","andslope":"\u2A58","andv":"\u2A5A","ang":"\u2220","ange":"\u29A4","angle":"\u2220","angmsdaa":"\u29A8","angmsdab":"\u29A9","angmsdac":"\u29AA","angmsdad":"\u29AB","angmsdae":"\u29AC","angmsdaf":"\u29AD","angmsdag":"\u29AE","angmsdah":"\u29AF","angmsd":"\u2221","angrt":"\u221F","angrtvb":"\u22BE","angrtvbd":"\u299D","angsph":"\u2222","angst":"\u00C5","angzarr":"\u237C","Aogon":"\u0104","aogon":"\u0105","Aopf":"\uD835\uDD38","aopf":"\uD835\uDD52","apacir":"\u2A6F","ap":"\u2248","apE":"\u2A70","ape":"\u224A","apid":"\u224B","apos":"'","ApplyFunction":"\u2061","approx":"\u2248","approxeq":"\u224A","Aring":"\u00C5","aring":"\u00E5","Ascr":"\uD835\uDC9C","ascr":"\uD835\uDCB6","Assign":"\u2254","ast":"*","asymp":"\u2248","asympeq":"\u224D","Atilde":"\u00C3","atilde":"\u00E3","Auml":"\u00C4","auml":"\u00E4","awconint":"\u2233","awint":"\u2A11","backcong":"\u224C","backepsilon":"\u03F6","backprime":"\u2035","backsim":"\u223D","backsimeq":"\u22CD","Backslash":"\u2216","Barv":"\u2AE7","barvee":"\u22BD","barwed":"\u2305","Barwed":"\u2306","barwedge":"\u2305","bbrk":"\u23B5","bbrktbrk":"\u23B6","bcong":"\u224C","Bcy":"\u0411","bcy":"\u0431","bdquo":"\u201E","becaus":"\u2235","because":"\u2235","Because":"\u2235","bemptyv":"\u29B0","bepsi":"\u03F6","bernou":"\u212C","Bernoullis":"\u212C","Beta":"\u0392","beta":"\u03B2","beth":"\u2136","between":"\u226C","Bfr":"\uD835\uDD05","bfr":"\uD835\uDD1F","bigcap":"\u22C2","bigcirc":"\u25EF","bigcup":"\u22C3","bigodot":"\u2A00","bigoplus":"\u2A01","bigotimes":"\u2A02","bigsqcup":"\u2A06","bigstar":"\u2605","bigtriangledown":"\u25BD","bigtriangleup":"\u25B3","biguplus":"\u2A04","bigvee":"\u22C1","bigwedge":"\u22C0","bkarow":"\u290D","blacklozenge":"\u29EB","blacksquare":"\u25AA","blacktriangle":"\u25B4","blacktriangledown":"\u25BE","blacktriangleleft":"\u25C2","blacktriangleright":"\u25B8","blank":"\u2423","blk12":"\u2592","blk14":"\u2591","blk34":"\u2593","block":"\u2588","bne":"=\u20E5","bnequiv":"\u2261\u20E5","bNot":"\u2AED","bnot":"\u2310","Bopf":"\uD835\uDD39","bopf":"\uD835\uDD53","bot":"\u22A5","bottom":"\u22A5","bowtie":"\u22C8","boxbox":"\u29C9","boxdl":"\u2510","boxdL":"\u2555","boxDl":"\u2556","boxDL":"\u2557","boxdr":"\u250C","boxdR":"\u2552","boxDr":"\u2553","boxDR":"\u2554","boxh":"\u2500","boxH":"\u2550","boxhd":"\u252C","boxHd":"\u2564","boxhD":"\u2565","boxHD":"\u2566","boxhu":"\u2534","boxHu":"\u2567","boxhU":"\u2568","boxHU":"\u2569","boxminus":"\u229F","boxplus":"\u229E","boxtimes":"\u22A0","boxul":"\u2518","boxuL":"\u255B","boxUl":"\u255C","boxUL":"\u255D","boxur":"\u2514","boxuR":"\u2558","boxUr":"\u2559","boxUR":"\u255A","boxv":"\u2502","boxV":"\u2551","boxvh":"\u253C","boxvH":"\u256A","boxVh":"\u256B","boxVH":"\u256C","boxvl":"\u2524","boxvL":"\u2561","boxVl":"\u2562","boxVL":"\u2563","boxvr":"\u251C","boxvR":"\u255E","boxVr":"\u255F","boxVR":"\u2560","bprime":"\u2035","breve":"\u02D8","Breve":"\u02D8","brvbar":"\u00A6","bscr":"\uD835\uDCB7","Bscr":"\u212C","bsemi":"\u204F","bsim":"\u223D","bsime":"\u22CD","bsolb":"\u29C5","bsol":"\\","bsolhsub":"\u27C8","bull":"\u2022","bullet":"\u2022","bump":"\u224E","bumpE":"\u2AAE","bumpe":"\u224F","Bumpeq":"\u224E","bumpeq":"\u224F","Cacute":"\u0106","cacute":"\u0107","capand":"\u2A44","capbrcup":"\u2A49","capcap":"\u2A4B","cap":"\u2229","Cap":"\u22D2","capcup":"\u2A47","capdot":"\u2A40","CapitalDifferentialD":"\u2145","caps":"\u2229\uFE00","caret":"\u2041","caron":"\u02C7","Cayleys":"\u212D","ccaps":"\u2A4D","Ccaron":"\u010C","ccaron":"\u010D","Ccedil":"\u00C7","ccedil":"\u00E7","Ccirc":"\u0108","ccirc":"\u0109","Cconint":"\u2230","ccups":"\u2A4C","ccupssm":"\u2A50","Cdot":"\u010A","cdot":"\u010B","cedil":"\u00B8","Cedilla":"\u00B8","cemptyv":"\u29B2","cent":"\u00A2","centerdot":"\u00B7","CenterDot":"\u00B7","cfr":"\uD835\uDD20","Cfr":"\u212D","CHcy":"\u0427","chcy":"\u0447","check":"\u2713","checkmark":"\u2713","Chi":"\u03A7","chi":"\u03C7","circ":"\u02C6","circeq":"\u2257","circlearrowleft":"\u21BA","circlearrowright":"\u21BB","circledast":"\u229B","circledcirc":"\u229A","circleddash":"\u229D","CircleDot":"\u2299","circledR":"\u00AE","circledS":"\u24C8","CircleMinus":"\u2296","CirclePlus":"\u2295","CircleTimes":"\u2297","cir":"\u25CB","cirE":"\u29C3","cire":"\u2257","cirfnint":"\u2A10","cirmid":"\u2AEF","cirscir":"\u29C2","ClockwiseContourIntegral":"\u2232","CloseCurlyDoubleQuote":"\u201D","CloseCurlyQuote":"\u2019","clubs":"\u2663","clubsuit":"\u2663","colon":":","Colon":"\u2237","Colone":"\u2A74","colone":"\u2254","coloneq":"\u2254","comma":",","commat":"@","comp":"\u2201","compfn":"\u2218","complement":"\u2201","complexes":"\u2102","cong":"\u2245","congdot":"\u2A6D","Congruent":"\u2261","conint":"\u222E","Conint":"\u222F","ContourIntegral":"\u222E","copf":"\uD835\uDD54","Copf":"\u2102","coprod":"\u2210","Coproduct":"\u2210","copy":"\u00A9","COPY":"\u00A9","copysr":"\u2117","CounterClockwiseContourIntegral":"\u2233","crarr":"\u21B5","cross":"\u2717","Cross":"\u2A2F","Cscr":"\uD835\uDC9E","cscr":"\uD835\uDCB8","csub":"\u2ACF","csube":"\u2AD1","csup":"\u2AD0","csupe":"\u2AD2","ctdot":"\u22EF","cudarrl":"\u2938","cudarrr":"\u2935","cuepr":"\u22DE","cuesc":"\u22DF","cularr":"\u21B6","cularrp":"\u293D","cupbrcap":"\u2A48","cupcap":"\u2A46","CupCap":"\u224D","cup":"\u222A","Cup":"\u22D3","cupcup":"\u2A4A","cupdot":"\u228D","cupor":"\u2A45","cups":"\u222A\uFE00","curarr":"\u21B7","curarrm":"\u293C","curlyeqprec":"\u22DE","curlyeqsucc":"\u22DF","curlyvee":"\u22CE","curlywedge":"\u22CF","curren":"\u00A4","curvearrowleft":"\u21B6","curvearrowright":"\u21B7","cuvee":"\u22CE","cuwed":"\u22CF","cwconint":"\u2232","cwint":"\u2231","cylcty":"\u232D","dagger":"\u2020","Dagger":"\u2021","daleth":"\u2138","darr":"\u2193","Darr":"\u21A1","dArr":"\u21D3","dash":"\u2010","Dashv":"\u2AE4","dashv":"\u22A3","dbkarow":"\u290F","dblac":"\u02DD","Dcaron":"\u010E","dcaron":"\u010F","Dcy":"\u0414","dcy":"\u0434","ddagger":"\u2021","ddarr":"\u21CA","DD":"\u2145","dd":"\u2146","DDotrahd":"\u2911","ddotseq":"\u2A77","deg":"\u00B0","Del":"\u2207","Delta":"\u0394","delta":"\u03B4","demptyv":"\u29B1","dfisht":"\u297F","Dfr":"\uD835\uDD07","dfr":"\uD835\uDD21","dHar":"\u2965","dharl":"\u21C3","dharr":"\u21C2","DiacriticalAcute":"\u00B4","DiacriticalDot":"\u02D9","DiacriticalDoubleAcute":"\u02DD","DiacriticalGrave":"`","DiacriticalTilde":"\u02DC","diam":"\u22C4","diamond":"\u22C4","Diamond":"\u22C4","diamondsuit":"\u2666","diams":"\u2666","die":"\u00A8","DifferentialD":"\u2146","digamma":"\u03DD","disin":"\u22F2","div":"\u00F7","divide":"\u00F7","divideontimes":"\u22C7","divonx":"\u22C7","DJcy":"\u0402","djcy":"\u0452","dlcorn":"\u231E","dlcrop":"\u230D","dollar":"$","Dopf":"\uD835\uDD3B","dopf":"\uD835\uDD55","Dot":"\u00A8","dot":"\u02D9","DotDot":"\u20DC","doteq":"\u2250","doteqdot":"\u2251","DotEqual":"\u2250","dotminus":"\u2238","dotplus":"\u2214","dotsquare":"\u22A1","doublebarwedge":"\u2306","DoubleContourIntegral":"\u222F","DoubleDot":"\u00A8","DoubleDownArrow":"\u21D3","DoubleLeftArrow":"\u21D0","DoubleLeftRightArrow":"\u21D4","DoubleLeftTee":"\u2AE4","DoubleLongLeftArrow":"\u27F8","DoubleLongLeftRightArrow":"\u27FA","DoubleLongRightArrow":"\u27F9","DoubleRightArrow":"\u21D2","DoubleRightTee":"\u22A8","DoubleUpArrow":"\u21D1","DoubleUpDownArrow":"\u21D5","DoubleVerticalBar":"\u2225","DownArrowBar":"\u2913","downarrow":"\u2193","DownArrow":"\u2193","Downarrow":"\u21D3","DownArrowUpArrow":"\u21F5","DownBreve":"\u0311","downdownarrows":"\u21CA","downharpoonleft":"\u21C3","downharpoonright":"\u21C2","DownLeftRightVector":"\u2950","DownLeftTeeVector":"\u295E","DownLeftVectorBar":"\u2956","DownLeftVector":"\u21BD","DownRightTeeVector":"\u295F","DownRightVectorBar":"\u2957","DownRightVector":"\u21C1","DownTeeArrow":"\u21A7","DownTee":"\u22A4","drbkarow":"\u2910","drcorn":"\u231F","drcrop":"\u230C","Dscr":"\uD835\uDC9F","dscr":"\uD835\uDCB9","DScy":"\u0405","dscy":"\u0455","dsol":"\u29F6","Dstrok":"\u0110","dstrok":"\u0111","dtdot":"\u22F1","dtri":"\u25BF","dtrif":"\u25BE","duarr":"\u21F5","duhar":"\u296F","dwangle":"\u29A6","DZcy":"\u040F","dzcy":"\u045F","dzigrarr":"\u27FF","Eacute":"\u00C9","eacute":"\u00E9","easter":"\u2A6E","Ecaron":"\u011A","ecaron":"\u011B","Ecirc":"\u00CA","ecirc":"\u00EA","ecir":"\u2256","ecolon":"\u2255","Ecy":"\u042D","ecy":"\u044D","eDDot":"\u2A77","Edot":"\u0116","edot":"\u0117","eDot":"\u2251","ee":"\u2147","efDot":"\u2252","Efr":"\uD835\uDD08","efr":"\uD835\uDD22","eg":"\u2A9A","Egrave":"\u00C8","egrave":"\u00E8","egs":"\u2A96","egsdot":"\u2A98","el":"\u2A99","Element":"\u2208","elinters":"\u23E7","ell":"\u2113","els":"\u2A95","elsdot":"\u2A97","Emacr":"\u0112","emacr":"\u0113","empty":"\u2205","emptyset":"\u2205","EmptySmallSquare":"\u25FB","emptyv":"\u2205","EmptyVerySmallSquare":"\u25AB","emsp13":"\u2004","emsp14":"\u2005","emsp":"\u2003","ENG":"\u014A","eng":"\u014B","ensp":"\u2002","Eogon":"\u0118","eogon":"\u0119","Eopf":"\uD835\uDD3C","eopf":"\uD835\uDD56","epar":"\u22D5","eparsl":"\u29E3","eplus":"\u2A71","epsi":"\u03B5","Epsilon":"\u0395","epsilon":"\u03B5","epsiv":"\u03F5","eqcirc":"\u2256","eqcolon":"\u2255","eqsim":"\u2242","eqslantgtr":"\u2A96","eqslantless":"\u2A95","Equal":"\u2A75","equals":"=","EqualTilde":"\u2242","equest":"\u225F","Equilibrium":"\u21CC","equiv":"\u2261","equivDD":"\u2A78","eqvparsl":"\u29E5","erarr":"\u2971","erDot":"\u2253","escr":"\u212F","Escr":"\u2130","esdot":"\u2250","Esim":"\u2A73","esim":"\u2242","Eta":"\u0397","eta":"\u03B7","ETH":"\u00D0","eth":"\u00F0","Euml":"\u00CB","euml":"\u00EB","euro":"\u20AC","excl":"!","exist":"\u2203","Exists":"\u2203","expectation":"\u2130","exponentiale":"\u2147","ExponentialE":"\u2147","fallingdotseq":"\u2252","Fcy":"\u0424","fcy":"\u0444","female":"\u2640","ffilig":"\uFB03","fflig":"\uFB00","ffllig":"\uFB04","Ffr":"\uD835\uDD09","ffr":"\uD835\uDD23","filig":"\uFB01","FilledSmallSquare":"\u25FC","FilledVerySmallSquare":"\u25AA","fjlig":"fj","flat":"\u266D","fllig":"\uFB02","fltns":"\u25B1","fnof":"\u0192","Fopf":"\uD835\uDD3D","fopf":"\uD835\uDD57","forall":"\u2200","ForAll":"\u2200","fork":"\u22D4","forkv":"\u2AD9","Fouriertrf":"\u2131","fpartint":"\u2A0D","frac12":"\u00BD","frac13":"\u2153","frac14":"\u00BC","frac15":"\u2155","frac16":"\u2159","frac18":"\u215B","frac23":"\u2154","frac25":"\u2156","frac34":"\u00BE","frac35":"\u2157","frac38":"\u215C","frac45":"\u2158","frac56":"\u215A","frac58":"\u215D","frac78":"\u215E","frasl":"\u2044","frown":"\u2322","fscr":"\uD835\uDCBB","Fscr":"\u2131","gacute":"\u01F5","Gamma":"\u0393","gamma":"\u03B3","Gammad":"\u03DC","gammad":"\u03DD","gap":"\u2A86","Gbreve":"\u011E","gbreve":"\u011F","Gcedil":"\u0122","Gcirc":"\u011C","gcirc":"\u011D","Gcy":"\u0413","gcy":"\u0433","Gdot":"\u0120","gdot":"\u0121","ge":"\u2265","gE":"\u2267","gEl":"\u2A8C","gel":"\u22DB","geq":"\u2265","geqq":"\u2267","geqslant":"\u2A7E","gescc":"\u2AA9","ges":"\u2A7E","gesdot":"\u2A80","gesdoto":"\u2A82","gesdotol":"\u2A84","gesl":"\u22DB\uFE00","gesles":"\u2A94","Gfr":"\uD835\uDD0A","gfr":"\uD835\uDD24","gg":"\u226B","Gg":"\u22D9","ggg":"\u22D9","gimel":"\u2137","GJcy":"\u0403","gjcy":"\u0453","gla":"\u2AA5","gl":"\u2277","glE":"\u2A92","glj":"\u2AA4","gnap":"\u2A8A","gnapprox":"\u2A8A","gne":"\u2A88","gnE":"\u2269","gneq":"\u2A88","gneqq":"\u2269","gnsim":"\u22E7","Gopf":"\uD835\uDD3E","gopf":"\uD835\uDD58","grave":"`","GreaterEqual":"\u2265","GreaterEqualLess":"\u22DB","GreaterFullEqual":"\u2267","GreaterGreater":"\u2AA2","GreaterLess":"\u2277","GreaterSlantEqual":"\u2A7E","GreaterTilde":"\u2273","Gscr":"\uD835\uDCA2","gscr":"\u210A","gsim":"\u2273","gsime":"\u2A8E","gsiml":"\u2A90","gtcc":"\u2AA7","gtcir":"\u2A7A","gt":">","GT":">","Gt":"\u226B","gtdot":"\u22D7","gtlPar":"\u2995","gtquest":"\u2A7C","gtrapprox":"\u2A86","gtrarr":"\u2978","gtrdot":"\u22D7","gtreqless":"\u22DB","gtreqqless":"\u2A8C","gtrless":"\u2277","gtrsim":"\u2273","gvertneqq":"\u2269\uFE00","gvnE":"\u2269\uFE00","Hacek":"\u02C7","hairsp":"\u200A","half":"\u00BD","hamilt":"\u210B","HARDcy":"\u042A","hardcy":"\u044A","harrcir":"\u2948","harr":"\u2194","hArr":"\u21D4","harrw":"\u21AD","Hat":"^","hbar":"\u210F","Hcirc":"\u0124","hcirc":"\u0125","hearts":"\u2665","heartsuit":"\u2665","hellip":"\u2026","hercon":"\u22B9","hfr":"\uD835\uDD25","Hfr":"\u210C","HilbertSpace":"\u210B","hksearow":"\u2925","hkswarow":"\u2926","hoarr":"\u21FF","homtht":"\u223B","hookleftarrow":"\u21A9","hookrightarrow":"\u21AA","hopf":"\uD835\uDD59","Hopf":"\u210D","horbar":"\u2015","HorizontalLine":"\u2500","hscr":"\uD835\uDCBD","Hscr":"\u210B","hslash":"\u210F","Hstrok":"\u0126","hstrok":"\u0127","HumpDownHump":"\u224E","HumpEqual":"\u224F","hybull":"\u2043","hyphen":"\u2010","Iacute":"\u00CD","iacute":"\u00ED","ic":"\u2063","Icirc":"\u00CE","icirc":"\u00EE","Icy":"\u0418","icy":"\u0438","Idot":"\u0130","IEcy":"\u0415","iecy":"\u0435","iexcl":"\u00A1","iff":"\u21D4","ifr":"\uD835\uDD26","Ifr":"\u2111","Igrave":"\u00CC","igrave":"\u00EC","ii":"\u2148","iiiint":"\u2A0C","iiint":"\u222D","iinfin":"\u29DC","iiota":"\u2129","IJlig":"\u0132","ijlig":"\u0133","Imacr":"\u012A","imacr":"\u012B","image":"\u2111","ImaginaryI":"\u2148","imagline":"\u2110","imagpart":"\u2111","imath":"\u0131","Im":"\u2111","imof":"\u22B7","imped":"\u01B5","Implies":"\u21D2","incare":"\u2105","in":"\u2208","infin":"\u221E","infintie":"\u29DD","inodot":"\u0131","intcal":"\u22BA","int":"\u222B","Int":"\u222C","integers":"\u2124","Integral":"\u222B","intercal":"\u22BA","Intersection":"\u22C2","intlarhk":"\u2A17","intprod":"\u2A3C","InvisibleComma":"\u2063","InvisibleTimes":"\u2062","IOcy":"\u0401","iocy":"\u0451","Iogon":"\u012E","iogon":"\u012F","Iopf":"\uD835\uDD40","iopf":"\uD835\uDD5A","Iota":"\u0399","iota":"\u03B9","iprod":"\u2A3C","iquest":"\u00BF","iscr":"\uD835\uDCBE","Iscr":"\u2110","isin":"\u2208","isindot":"\u22F5","isinE":"\u22F9","isins":"\u22F4","isinsv":"\u22F3","isinv":"\u2208","it":"\u2062","Itilde":"\u0128","itilde":"\u0129","Iukcy":"\u0406","iukcy":"\u0456","Iuml":"\u00CF","iuml":"\u00EF","Jcirc":"\u0134","jcirc":"\u0135","Jcy":"\u0419","jcy":"\u0439","Jfr":"\uD835\uDD0D","jfr":"\uD835\uDD27","jmath":"\u0237","Jopf":"\uD835\uDD41","jopf":"\uD835\uDD5B","Jscr":"\uD835\uDCA5","jscr":"\uD835\uDCBF","Jsercy":"\u0408","jsercy":"\u0458","Jukcy":"\u0404","jukcy":"\u0454","Kappa":"\u039A","kappa":"\u03BA","kappav":"\u03F0","Kcedil":"\u0136","kcedil":"\u0137","Kcy":"\u041A","kcy":"\u043A","Kfr":"\uD835\uDD0E","kfr":"\uD835\uDD28","kgreen":"\u0138","KHcy":"\u0425","khcy":"\u0445","KJcy":"\u040C","kjcy":"\u045C","Kopf":"\uD835\uDD42","kopf":"\uD835\uDD5C","Kscr":"\uD835\uDCA6","kscr":"\uD835\uDCC0","lAarr":"\u21DA","Lacute":"\u0139","lacute":"\u013A","laemptyv":"\u29B4","lagran":"\u2112","Lambda":"\u039B","lambda":"\u03BB","lang":"\u27E8","Lang":"\u27EA","langd":"\u2991","langle":"\u27E8","lap":"\u2A85","Laplacetrf":"\u2112","laquo":"\u00AB","larrb":"\u21E4","larrbfs":"\u291F","larr":"\u2190","Larr":"\u219E","lArr":"\u21D0","larrfs":"\u291D","larrhk":"\u21A9","larrlp":"\u21AB","larrpl":"\u2939","larrsim":"\u2973","larrtl":"\u21A2","latail":"\u2919","lAtail":"\u291B","lat":"\u2AAB","late":"\u2AAD","lates":"\u2AAD\uFE00","lbarr":"\u290C","lBarr":"\u290E","lbbrk":"\u2772","lbrace":"{","lbrack":"[","lbrke":"\u298B","lbrksld":"\u298F","lbrkslu":"\u298D","Lcaron":"\u013D","lcaron":"\u013E","Lcedil":"\u013B","lcedil":"\u013C","lceil":"\u2308","lcub":"{","Lcy":"\u041B","lcy":"\u043B","ldca":"\u2936","ldquo":"\u201C","ldquor":"\u201E","ldrdhar":"\u2967","ldrushar":"\u294B","ldsh":"\u21B2","le":"\u2264","lE":"\u2266","LeftAngleBracket":"\u27E8","LeftArrowBar":"\u21E4","leftarrow":"\u2190","LeftArrow":"\u2190","Leftarrow":"\u21D0","LeftArrowRightArrow":"\u21C6","leftarrowtail":"\u21A2","LeftCeiling":"\u2308","LeftDoubleBracket":"\u27E6","LeftDownTeeVector":"\u2961","LeftDownVectorBar":"\u2959","LeftDownVector":"\u21C3","LeftFloor":"\u230A","leftharpoondown":"\u21BD","leftharpoonup":"\u21BC","leftleftarrows":"\u21C7","leftrightarrow":"\u2194","LeftRightArrow":"\u2194","Leftrightarrow":"\u21D4","leftrightarrows":"\u21C6","leftrightharpoons":"\u21CB","leftrightsquigarrow":"\u21AD","LeftRightVector":"\u294E","LeftTeeArrow":"\u21A4","LeftTee":"\u22A3","LeftTeeVector":"\u295A","leftthreetimes":"\u22CB","LeftTriangleBar":"\u29CF","LeftTriangle":"\u22B2","LeftTriangleEqual":"\u22B4","LeftUpDownVector":"\u2951","LeftUpTeeVector":"\u2960","LeftUpVectorBar":"\u2958","LeftUpVector":"\u21BF","LeftVectorBar":"\u2952","LeftVector":"\u21BC","lEg":"\u2A8B","leg":"\u22DA","leq":"\u2264","leqq":"\u2266","leqslant":"\u2A7D","lescc":"\u2AA8","les":"\u2A7D","lesdot":"\u2A7F","lesdoto":"\u2A81","lesdotor":"\u2A83","lesg":"\u22DA\uFE00","lesges":"\u2A93","lessapprox":"\u2A85","lessdot":"\u22D6","lesseqgtr":"\u22DA","lesseqqgtr":"\u2A8B","LessEqualGreater":"\u22DA","LessFullEqual":"\u2266","LessGreater":"\u2276","lessgtr":"\u2276","LessLess":"\u2AA1","lesssim":"\u2272","LessSlantEqual":"\u2A7D","LessTilde":"\u2272","lfisht":"\u297C","lfloor":"\u230A","Lfr":"\uD835\uDD0F","lfr":"\uD835\uDD29","lg":"\u2276","lgE":"\u2A91","lHar":"\u2962","lhard":"\u21BD","lharu":"\u21BC","lharul":"\u296A","lhblk":"\u2584","LJcy":"\u0409","ljcy":"\u0459","llarr":"\u21C7","ll":"\u226A","Ll":"\u22D8","llcorner":"\u231E","Lleftarrow":"\u21DA","llhard":"\u296B","lltri":"\u25FA","Lmidot":"\u013F","lmidot":"\u0140","lmoustache":"\u23B0","lmoust":"\u23B0","lnap":"\u2A89","lnapprox":"\u2A89","lne":"\u2A87","lnE":"\u2268","lneq":"\u2A87","lneqq":"\u2268","lnsim":"\u22E6","loang":"\u27EC","loarr":"\u21FD","lobrk":"\u27E6","longleftarrow":"\u27F5","LongLeftArrow":"\u27F5","Longleftarrow":"\u27F8","longleftrightarrow":"\u27F7","LongLeftRightArrow":"\u27F7","Longleftrightarrow":"\u27FA","longmapsto":"\u27FC","longrightarrow":"\u27F6","LongRightArrow":"\u27F6","Longrightarrow":"\u27F9","looparrowleft":"\u21AB","looparrowright":"\u21AC","lopar":"\u2985","Lopf":"\uD835\uDD43","lopf":"\uD835\uDD5D","loplus":"\u2A2D","lotimes":"\u2A34","lowast":"\u2217","lowbar":"_","LowerLeftArrow":"\u2199","LowerRightArrow":"\u2198","loz":"\u25CA","lozenge":"\u25CA","lozf":"\u29EB","lpar":"(","lparlt":"\u2993","lrarr":"\u21C6","lrcorner":"\u231F","lrhar":"\u21CB","lrhard":"\u296D","lrm":"\u200E","lrtri":"\u22BF","lsaquo":"\u2039","lscr":"\uD835\uDCC1","Lscr":"\u2112","lsh":"\u21B0","Lsh":"\u21B0","lsim":"\u2272","lsime":"\u2A8D","lsimg":"\u2A8F","lsqb":"[","lsquo":"\u2018","lsquor":"\u201A","Lstrok":"\u0141","lstrok":"\u0142","ltcc":"\u2AA6","ltcir":"\u2A79","lt":"<","LT":"<","Lt":"\u226A","ltdot":"\u22D6","lthree":"\u22CB","ltimes":"\u22C9","ltlarr":"\u2976","ltquest":"\u2A7B","ltri":"\u25C3","ltrie":"\u22B4","ltrif":"\u25C2","ltrPar":"\u2996","lurdshar":"\u294A","luruhar":"\u2966","lvertneqq":"\u2268\uFE00","lvnE":"\u2268\uFE00","macr":"\u00AF","male":"\u2642","malt":"\u2720","maltese":"\u2720","Map":"\u2905","map":"\u21A6","mapsto":"\u21A6","mapstodown":"\u21A7","mapstoleft":"\u21A4","mapstoup":"\u21A5","marker":"\u25AE","mcomma":"\u2A29","Mcy":"\u041C","mcy":"\u043C","mdash":"\u2014","mDDot":"\u223A","measuredangle":"\u2221","MediumSpace":"\u205F","Mellintrf":"\u2133","Mfr":"\uD835\uDD10","mfr":"\uD835\uDD2A","mho":"\u2127","micro":"\u00B5","midast":"*","midcir":"\u2AF0","mid":"\u2223","middot":"\u00B7","minusb":"\u229F","minus":"\u2212","minusd":"\u2238","minusdu":"\u2A2A","MinusPlus":"\u2213","mlcp":"\u2ADB","mldr":"\u2026","mnplus":"\u2213","models":"\u22A7","Mopf":"\uD835\uDD44","mopf":"\uD835\uDD5E","mp":"\u2213","mscr":"\uD835\uDCC2","Mscr":"\u2133","mstpos":"\u223E","Mu":"\u039C","mu":"\u03BC","multimap":"\u22B8","mumap":"\u22B8","nabla":"\u2207","Nacute":"\u0143","nacute":"\u0144","nang":"\u2220\u20D2","nap":"\u2249","napE":"\u2A70\u0338","napid":"\u224B\u0338","napos":"\u0149","napprox":"\u2249","natural":"\u266E","naturals":"\u2115","natur":"\u266E","nbsp":"\u00A0","nbump":"\u224E\u0338","nbumpe":"\u224F\u0338","ncap":"\u2A43","Ncaron":"\u0147","ncaron":"\u0148","Ncedil":"\u0145","ncedil":"\u0146","ncong":"\u2247","ncongdot":"\u2A6D\u0338","ncup":"\u2A42","Ncy":"\u041D","ncy":"\u043D","ndash":"\u2013","nearhk":"\u2924","nearr":"\u2197","neArr":"\u21D7","nearrow":"\u2197","ne":"\u2260","nedot":"\u2250\u0338","NegativeMediumSpace":"\u200B","NegativeThickSpace":"\u200B","NegativeThinSpace":"\u200B","NegativeVeryThinSpace":"\u200B","nequiv":"\u2262","nesear":"\u2928","nesim":"\u2242\u0338","NestedGreaterGreater":"\u226B","NestedLessLess":"\u226A","NewLine":"\n","nexist":"\u2204","nexists":"\u2204","Nfr":"\uD835\uDD11","nfr":"\uD835\uDD2B","ngE":"\u2267\u0338","nge":"\u2271","ngeq":"\u2271","ngeqq":"\u2267\u0338","ngeqslant":"\u2A7E\u0338","nges":"\u2A7E\u0338","nGg":"\u22D9\u0338","ngsim":"\u2275","nGt":"\u226B\u20D2","ngt":"\u226F","ngtr":"\u226F","nGtv":"\u226B\u0338","nharr":"\u21AE","nhArr":"\u21CE","nhpar":"\u2AF2","ni":"\u220B","nis":"\u22FC","nisd":"\u22FA","niv":"\u220B","NJcy":"\u040A","njcy":"\u045A","nlarr":"\u219A","nlArr":"\u21CD","nldr":"\u2025","nlE":"\u2266\u0338","nle":"\u2270","nleftarrow":"\u219A","nLeftarrow":"\u21CD","nleftrightarrow":"\u21AE","nLeftrightarrow":"\u21CE","nleq":"\u2270","nleqq":"\u2266\u0338","nleqslant":"\u2A7D\u0338","nles":"\u2A7D\u0338","nless":"\u226E","nLl":"\u22D8\u0338","nlsim":"\u2274","nLt":"\u226A\u20D2","nlt":"\u226E","nltri":"\u22EA","nltrie":"\u22EC","nLtv":"\u226A\u0338","nmid":"\u2224","NoBreak":"\u2060","NonBreakingSpace":"\u00A0","nopf":"\uD835\uDD5F","Nopf":"\u2115","Not":"\u2AEC","not":"\u00AC","NotCongruent":"\u2262","NotCupCap":"\u226D","NotDoubleVerticalBar":"\u2226","NotElement":"\u2209","NotEqual":"\u2260","NotEqualTilde":"\u2242\u0338","NotExists":"\u2204","NotGreater":"\u226F","NotGreaterEqual":"\u2271","NotGreaterFullEqual":"\u2267\u0338","NotGreaterGreater":"\u226B\u0338","NotGreaterLess":"\u2279","NotGreaterSlantEqual":"\u2A7E\u0338","NotGreaterTilde":"\u2275","NotHumpDownHump":"\u224E\u0338","NotHumpEqual":"\u224F\u0338","notin":"\u2209","notindot":"\u22F5\u0338","notinE":"\u22F9\u0338","notinva":"\u2209","notinvb":"\u22F7","notinvc":"\u22F6","NotLeftTriangleBar":"\u29CF\u0338","NotLeftTriangle":"\u22EA","NotLeftTriangleEqual":"\u22EC","NotLess":"\u226E","NotLessEqual":"\u2270","NotLessGreater":"\u2278","NotLessLess":"\u226A\u0338","NotLessSlantEqual":"\u2A7D\u0338","NotLessTilde":"\u2274","NotNestedGreaterGreater":"\u2AA2\u0338","NotNestedLessLess":"\u2AA1\u0338","notni":"\u220C","notniva":"\u220C","notnivb":"\u22FE","notnivc":"\u22FD","NotPrecedes":"\u2280","NotPrecedesEqual":"\u2AAF\u0338","NotPrecedesSlantEqual":"\u22E0","NotReverseElement":"\u220C","NotRightTriangleBar":"\u29D0\u0338","NotRightTriangle":"\u22EB","NotRightTriangleEqual":"\u22ED","NotSquareSubset":"\u228F\u0338","NotSquareSubsetEqual":"\u22E2","NotSquareSuperset":"\u2290\u0338","NotSquareSupersetEqual":"\u22E3","NotSubset":"\u2282\u20D2","NotSubsetEqual":"\u2288","NotSucceeds":"\u2281","NotSucceedsEqual":"\u2AB0\u0338","NotSucceedsSlantEqual":"\u22E1","NotSucceedsTilde":"\u227F\u0338","NotSuperset":"\u2283\u20D2","NotSupersetEqual":"\u2289","NotTilde":"\u2241","NotTildeEqual":"\u2244","NotTildeFullEqual":"\u2247","NotTildeTilde":"\u2249","NotVerticalBar":"\u2224","nparallel":"\u2226","npar":"\u2226","nparsl":"\u2AFD\u20E5","npart":"\u2202\u0338","npolint":"\u2A14","npr":"\u2280","nprcue":"\u22E0","nprec":"\u2280","npreceq":"\u2AAF\u0338","npre":"\u2AAF\u0338","nrarrc":"\u2933\u0338","nrarr":"\u219B","nrArr":"\u21CF","nrarrw":"\u219D\u0338","nrightarrow":"\u219B","nRightarrow":"\u21CF","nrtri":"\u22EB","nrtrie":"\u22ED","nsc":"\u2281","nsccue":"\u22E1","nsce":"\u2AB0\u0338","Nscr":"\uD835\uDCA9","nscr":"\uD835\uDCC3","nshortmid":"\u2224","nshortparallel":"\u2226","nsim":"\u2241","nsime":"\u2244","nsimeq":"\u2244","nsmid":"\u2224","nspar":"\u2226","nsqsube":"\u22E2","nsqsupe":"\u22E3","nsub":"\u2284","nsubE":"\u2AC5\u0338","nsube":"\u2288","nsubset":"\u2282\u20D2","nsubseteq":"\u2288","nsubseteqq":"\u2AC5\u0338","nsucc":"\u2281","nsucceq":"\u2AB0\u0338","nsup":"\u2285","nsupE":"\u2AC6\u0338","nsupe":"\u2289","nsupset":"\u2283\u20D2","nsupseteq":"\u2289","nsupseteqq":"\u2AC6\u0338","ntgl":"\u2279","Ntilde":"\u00D1","ntilde":"\u00F1","ntlg":"\u2278","ntriangleleft":"\u22EA","ntrianglelefteq":"\u22EC","ntriangleright":"\u22EB","ntrianglerighteq":"\u22ED","Nu":"\u039D","nu":"\u03BD","num":"#","numero":"\u2116","numsp":"\u2007","nvap":"\u224D\u20D2","nvdash":"\u22AC","nvDash":"\u22AD","nVdash":"\u22AE","nVDash":"\u22AF","nvge":"\u2265\u20D2","nvgt":">\u20D2","nvHarr":"\u2904","nvinfin":"\u29DE","nvlArr":"\u2902","nvle":"\u2264\u20D2","nvlt":"<\u20D2","nvltrie":"\u22B4\u20D2","nvrArr":"\u2903","nvrtrie":"\u22B5\u20D2","nvsim":"\u223C\u20D2","nwarhk":"\u2923","nwarr":"\u2196","nwArr":"\u21D6","nwarrow":"\u2196","nwnear":"\u2927","Oacute":"\u00D3","oacute":"\u00F3","oast":"\u229B","Ocirc":"\u00D4","ocirc":"\u00F4","ocir":"\u229A","Ocy":"\u041E","ocy":"\u043E","odash":"\u229D","Odblac":"\u0150","odblac":"\u0151","odiv":"\u2A38","odot":"\u2299","odsold":"\u29BC","OElig":"\u0152","oelig":"\u0153","ofcir":"\u29BF","Ofr":"\uD835\uDD12","ofr":"\uD835\uDD2C","ogon":"\u02DB","Ograve":"\u00D2","ograve":"\u00F2","ogt":"\u29C1","ohbar":"\u29B5","ohm":"\u03A9","oint":"\u222E","olarr":"\u21BA","olcir":"\u29BE","olcross":"\u29BB","oline":"\u203E","olt":"\u29C0","Omacr":"\u014C","omacr":"\u014D","Omega":"\u03A9","omega":"\u03C9","Omicron":"\u039F","omicron":"\u03BF","omid":"\u29B6","ominus":"\u2296","Oopf":"\uD835\uDD46","oopf":"\uD835\uDD60","opar":"\u29B7","OpenCurlyDoubleQuote":"\u201C","OpenCurlyQuote":"\u2018","operp":"\u29B9","oplus":"\u2295","orarr":"\u21BB","Or":"\u2A54","or":"\u2228","ord":"\u2A5D","order":"\u2134","orderof":"\u2134","ordf":"\u00AA","ordm":"\u00BA","origof":"\u22B6","oror":"\u2A56","orslope":"\u2A57","orv":"\u2A5B","oS":"\u24C8","Oscr":"\uD835\uDCAA","oscr":"\u2134","Oslash":"\u00D8","oslash":"\u00F8","osol":"\u2298","Otilde":"\u00D5","otilde":"\u00F5","otimesas":"\u2A36","Otimes":"\u2A37","otimes":"\u2297","Ouml":"\u00D6","ouml":"\u00F6","ovbar":"\u233D","OverBar":"\u203E","OverBrace":"\u23DE","OverBracket":"\u23B4","OverParenthesis":"\u23DC","para":"\u00B6","parallel":"\u2225","par":"\u2225","parsim":"\u2AF3","parsl":"\u2AFD","part":"\u2202","PartialD":"\u2202","Pcy":"\u041F","pcy":"\u043F","percnt":"%","period":".","permil":"\u2030","perp":"\u22A5","pertenk":"\u2031","Pfr":"\uD835\uDD13","pfr":"\uD835\uDD2D","Phi":"\u03A6","phi":"\u03C6","phiv":"\u03D5","phmmat":"\u2133","phone":"\u260E","Pi":"\u03A0","pi":"\u03C0","pitchfork":"\u22D4","piv":"\u03D6","planck":"\u210F","planckh":"\u210E","plankv":"\u210F","plusacir":"\u2A23","plusb":"\u229E","pluscir":"\u2A22","plus":"+","plusdo":"\u2214","plusdu":"\u2A25","pluse":"\u2A72","PlusMinus":"\u00B1","plusmn":"\u00B1","plussim":"\u2A26","plustwo":"\u2A27","pm":"\u00B1","Poincareplane":"\u210C","pointint":"\u2A15","popf":"\uD835\uDD61","Popf":"\u2119","pound":"\u00A3","prap":"\u2AB7","Pr":"\u2ABB","pr":"\u227A","prcue":"\u227C","precapprox":"\u2AB7","prec":"\u227A","preccurlyeq":"\u227C","Precedes":"\u227A","PrecedesEqual":"\u2AAF","PrecedesSlantEqual":"\u227C","PrecedesTilde":"\u227E","preceq":"\u2AAF","precnapprox":"\u2AB9","precneqq":"\u2AB5","precnsim":"\u22E8","pre":"\u2AAF","prE":"\u2AB3","precsim":"\u227E","prime":"\u2032","Prime":"\u2033","primes":"\u2119","prnap":"\u2AB9","prnE":"\u2AB5","prnsim":"\u22E8","prod":"\u220F","Product":"\u220F","profalar":"\u232E","profline":"\u2312","profsurf":"\u2313","prop":"\u221D","Proportional":"\u221D","Proportion":"\u2237","propto":"\u221D","prsim":"\u227E","prurel":"\u22B0","Pscr":"\uD835\uDCAB","pscr":"\uD835\uDCC5","Psi":"\u03A8","psi":"\u03C8","puncsp":"\u2008","Qfr":"\uD835\uDD14","qfr":"\uD835\uDD2E","qint":"\u2A0C","qopf":"\uD835\uDD62","Qopf":"\u211A","qprime":"\u2057","Qscr":"\uD835\uDCAC","qscr":"\uD835\uDCC6","quaternions":"\u210D","quatint":"\u2A16","quest":"?","questeq":"\u225F","quot":"\"","QUOT":"\"","rAarr":"\u21DB","race":"\u223D\u0331","Racute":"\u0154","racute":"\u0155","radic":"\u221A","raemptyv":"\u29B3","rang":"\u27E9","Rang":"\u27EB","rangd":"\u2992","range":"\u29A5","rangle":"\u27E9","raquo":"\u00BB","rarrap":"\u2975","rarrb":"\u21E5","rarrbfs":"\u2920","rarrc":"\u2933","rarr":"\u2192","Rarr":"\u21A0","rArr":"\u21D2","rarrfs":"\u291E","rarrhk":"\u21AA","rarrlp":"\u21AC","rarrpl":"\u2945","rarrsim":"\u2974","Rarrtl":"\u2916","rarrtl":"\u21A3","rarrw":"\u219D","ratail":"\u291A","rAtail":"\u291C","ratio":"\u2236","rationals":"\u211A","rbarr":"\u290D","rBarr":"\u290F","RBarr":"\u2910","rbbrk":"\u2773","rbrace":"}","rbrack":"]","rbrke":"\u298C","rbrksld":"\u298E","rbrkslu":"\u2990","Rcaron":"\u0158","rcaron":"\u0159","Rcedil":"\u0156","rcedil":"\u0157","rceil":"\u2309","rcub":"}","Rcy":"\u0420","rcy":"\u0440","rdca":"\u2937","rdldhar":"\u2969","rdquo":"\u201D","rdquor":"\u201D","rdsh":"\u21B3","real":"\u211C","realine":"\u211B","realpart":"\u211C","reals":"\u211D","Re":"\u211C","rect":"\u25AD","reg":"\u00AE","REG":"\u00AE","ReverseElement":"\u220B","ReverseEquilibrium":"\u21CB","ReverseUpEquilibrium":"\u296F","rfisht":"\u297D","rfloor":"\u230B","rfr":"\uD835\uDD2F","Rfr":"\u211C","rHar":"\u2964","rhard":"\u21C1","rharu":"\u21C0","rharul":"\u296C","Rho":"\u03A1","rho":"\u03C1","rhov":"\u03F1","RightAngleBracket":"\u27E9","RightArrowBar":"\u21E5","rightarrow":"\u2192","RightArrow":"\u2192","Rightarrow":"\u21D2","RightArrowLeftArrow":"\u21C4","rightarrowtail":"\u21A3","RightCeiling":"\u2309","RightDoubleBracket":"\u27E7","RightDownTeeVector":"\u295D","RightDownVectorBar":"\u2955","RightDownVector":"\u21C2","RightFloor":"\u230B","rightharpoondown":"\u21C1","rightharpoonup":"\u21C0","rightleftarrows":"\u21C4","rightleftharpoons":"\u21CC","rightrightarrows":"\u21C9","rightsquigarrow":"\u219D","RightTeeArrow":"\u21A6","RightTee":"\u22A2","RightTeeVector":"\u295B","rightthreetimes":"\u22CC","RightTriangleBar":"\u29D0","RightTriangle":"\u22B3","RightTriangleEqual":"\u22B5","RightUpDownVector":"\u294F","RightUpTeeVector":"\u295C","RightUpVectorBar":"\u2954","RightUpVector":"\u21BE","RightVectorBar":"\u2953","RightVector":"\u21C0","ring":"\u02DA","risingdotseq":"\u2253","rlarr":"\u21C4","rlhar":"\u21CC","rlm":"\u200F","rmoustache":"\u23B1","rmoust":"\u23B1","rnmid":"\u2AEE","roang":"\u27ED","roarr":"\u21FE","robrk":"\u27E7","ropar":"\u2986","ropf":"\uD835\uDD63","Ropf":"\u211D","roplus":"\u2A2E","rotimes":"\u2A35","RoundImplies":"\u2970","rpar":")","rpargt":"\u2994","rppolint":"\u2A12","rrarr":"\u21C9","Rrightarrow":"\u21DB","rsaquo":"\u203A","rscr":"\uD835\uDCC7","Rscr":"\u211B","rsh":"\u21B1","Rsh":"\u21B1","rsqb":"]","rsquo":"\u2019","rsquor":"\u2019","rthree":"\u22CC","rtimes":"\u22CA","rtri":"\u25B9","rtrie":"\u22B5","rtrif":"\u25B8","rtriltri":"\u29CE","RuleDelayed":"\u29F4","ruluhar":"\u2968","rx":"\u211E","Sacute":"\u015A","sacute":"\u015B","sbquo":"\u201A","scap":"\u2AB8","Scaron":"\u0160","scaron":"\u0161","Sc":"\u2ABC","sc":"\u227B","sccue":"\u227D","sce":"\u2AB0","scE":"\u2AB4","Scedil":"\u015E","scedil":"\u015F","Scirc":"\u015C","scirc":"\u015D","scnap":"\u2ABA","scnE":"\u2AB6","scnsim":"\u22E9","scpolint":"\u2A13","scsim":"\u227F","Scy":"\u0421","scy":"\u0441","sdotb":"\u22A1","sdot":"\u22C5","sdote":"\u2A66","searhk":"\u2925","searr":"\u2198","seArr":"\u21D8","searrow":"\u2198","sect":"\u00A7","semi":";","seswar":"\u2929","setminus":"\u2216","setmn":"\u2216","sext":"\u2736","Sfr":"\uD835\uDD16","sfr":"\uD835\uDD30","sfrown":"\u2322","sharp":"\u266F","SHCHcy":"\u0429","shchcy":"\u0449","SHcy":"\u0428","shcy":"\u0448","ShortDownArrow":"\u2193","ShortLeftArrow":"\u2190","shortmid":"\u2223","shortparallel":"\u2225","ShortRightArrow":"\u2192","ShortUpArrow":"\u2191","shy":"\u00AD","Sigma":"\u03A3","sigma":"\u03C3","sigmaf":"\u03C2","sigmav":"\u03C2","sim":"\u223C","simdot":"\u2A6A","sime":"\u2243","simeq":"\u2243","simg":"\u2A9E","simgE":"\u2AA0","siml":"\u2A9D","simlE":"\u2A9F","simne":"\u2246","simplus":"\u2A24","simrarr":"\u2972","slarr":"\u2190","SmallCircle":"\u2218","smallsetminus":"\u2216","smashp":"\u2A33","smeparsl":"\u29E4","smid":"\u2223","smile":"\u2323","smt":"\u2AAA","smte":"\u2AAC","smtes":"\u2AAC\uFE00","SOFTcy":"\u042C","softcy":"\u044C","solbar":"\u233F","solb":"\u29C4","sol":"/","Sopf":"\uD835\uDD4A","sopf":"\uD835\uDD64","spades":"\u2660","spadesuit":"\u2660","spar":"\u2225","sqcap":"\u2293","sqcaps":"\u2293\uFE00","sqcup":"\u2294","sqcups":"\u2294\uFE00","Sqrt":"\u221A","sqsub":"\u228F","sqsube":"\u2291","sqsubset":"\u228F","sqsubseteq":"\u2291","sqsup":"\u2290","sqsupe":"\u2292","sqsupset":"\u2290","sqsupseteq":"\u2292","square":"\u25A1","Square":"\u25A1","SquareIntersection":"\u2293","SquareSubset":"\u228F","SquareSubsetEqual":"\u2291","SquareSuperset":"\u2290","SquareSupersetEqual":"\u2292","SquareUnion":"\u2294","squarf":"\u25AA","squ":"\u25A1","squf":"\u25AA","srarr":"\u2192","Sscr":"\uD835\uDCAE","sscr":"\uD835\uDCC8","ssetmn":"\u2216","ssmile":"\u2323","sstarf":"\u22C6","Star":"\u22C6","star":"\u2606","starf":"\u2605","straightepsilon":"\u03F5","straightphi":"\u03D5","strns":"\u00AF","sub":"\u2282","Sub":"\u22D0","subdot":"\u2ABD","subE":"\u2AC5","sube":"\u2286","subedot":"\u2AC3","submult":"\u2AC1","subnE":"\u2ACB","subne":"\u228A","subplus":"\u2ABF","subrarr":"\u2979","subset":"\u2282","Subset":"\u22D0","subseteq":"\u2286","subseteqq":"\u2AC5","SubsetEqual":"\u2286","subsetneq":"\u228A","subsetneqq":"\u2ACB","subsim":"\u2AC7","subsub":"\u2AD5","subsup":"\u2AD3","succapprox":"\u2AB8","succ":"\u227B","succcurlyeq":"\u227D","Succeeds":"\u227B","SucceedsEqual":"\u2AB0","SucceedsSlantEqual":"\u227D","SucceedsTilde":"\u227F","succeq":"\u2AB0","succnapprox":"\u2ABA","succneqq":"\u2AB6","succnsim":"\u22E9","succsim":"\u227F","SuchThat":"\u220B","sum":"\u2211","Sum":"\u2211","sung":"\u266A","sup1":"\u00B9","sup2":"\u00B2","sup3":"\u00B3","sup":"\u2283","Sup":"\u22D1","supdot":"\u2ABE","supdsub":"\u2AD8","supE":"\u2AC6","supe":"\u2287","supedot":"\u2AC4","Superset":"\u2283","SupersetEqual":"\u2287","suphsol":"\u27C9","suphsub":"\u2AD7","suplarr":"\u297B","supmult":"\u2AC2","supnE":"\u2ACC","supne":"\u228B","supplus":"\u2AC0","supset":"\u2283","Supset":"\u22D1","supseteq":"\u2287","supseteqq":"\u2AC6","supsetneq":"\u228B","supsetneqq":"\u2ACC","supsim":"\u2AC8","supsub":"\u2AD4","supsup":"\u2AD6","swarhk":"\u2926","swarr":"\u2199","swArr":"\u21D9","swarrow":"\u2199","swnwar":"\u292A","szlig":"\u00DF","Tab":"\t","target":"\u2316","Tau":"\u03A4","tau":"\u03C4","tbrk":"\u23B4","Tcaron":"\u0164","tcaron":"\u0165","Tcedil":"\u0162","tcedil":"\u0163","Tcy":"\u0422","tcy":"\u0442","tdot":"\u20DB","telrec":"\u2315","Tfr":"\uD835\uDD17","tfr":"\uD835\uDD31","there4":"\u2234","therefore":"\u2234","Therefore":"\u2234","Theta":"\u0398","theta":"\u03B8","thetasym":"\u03D1","thetav":"\u03D1","thickapprox":"\u2248","thicksim":"\u223C","ThickSpace":"\u205F\u200A","ThinSpace":"\u2009","thinsp":"\u2009","thkap":"\u2248","thksim":"\u223C","THORN":"\u00DE","thorn":"\u00FE","tilde":"\u02DC","Tilde":"\u223C","TildeEqual":"\u2243","TildeFullEqual":"\u2245","TildeTilde":"\u2248","timesbar":"\u2A31","timesb":"\u22A0","times":"\u00D7","timesd":"\u2A30","tint":"\u222D","toea":"\u2928","topbot":"\u2336","topcir":"\u2AF1","top":"\u22A4","Topf":"\uD835\uDD4B","topf":"\uD835\uDD65","topfork":"\u2ADA","tosa":"\u2929","tprime":"\u2034","trade":"\u2122","TRADE":"\u2122","triangle":"\u25B5","triangledown":"\u25BF","triangleleft":"\u25C3","trianglelefteq":"\u22B4","triangleq":"\u225C","triangleright":"\u25B9","trianglerighteq":"\u22B5","tridot":"\u25EC","trie":"\u225C","triminus":"\u2A3A","TripleDot":"\u20DB","triplus":"\u2A39","trisb":"\u29CD","tritime":"\u2A3B","trpezium":"\u23E2","Tscr":"\uD835\uDCAF","tscr":"\uD835\uDCC9","TScy":"\u0426","tscy":"\u0446","TSHcy":"\u040B","tshcy":"\u045B","Tstrok":"\u0166","tstrok":"\u0167","twixt":"\u226C","twoheadleftarrow":"\u219E","twoheadrightarrow":"\u21A0","Uacute":"\u00DA","uacute":"\u00FA","uarr":"\u2191","Uarr":"\u219F","uArr":"\u21D1","Uarrocir":"\u2949","Ubrcy":"\u040E","ubrcy":"\u045E","Ubreve":"\u016C","ubreve":"\u016D","Ucirc":"\u00DB","ucirc":"\u00FB","Ucy":"\u0423","ucy":"\u0443","udarr":"\u21C5","Udblac":"\u0170","udblac":"\u0171","udhar":"\u296E","ufisht":"\u297E","Ufr":"\uD835\uDD18","ufr":"\uD835\uDD32","Ugrave":"\u00D9","ugrave":"\u00F9","uHar":"\u2963","uharl":"\u21BF","uharr":"\u21BE","uhblk":"\u2580","ulcorn":"\u231C","ulcorner":"\u231C","ulcrop":"\u230F","ultri":"\u25F8","Umacr":"\u016A","umacr":"\u016B","uml":"\u00A8","UnderBar":"_","UnderBrace":"\u23DF","UnderBracket":"\u23B5","UnderParenthesis":"\u23DD","Union":"\u22C3","UnionPlus":"\u228E","Uogon":"\u0172","uogon":"\u0173","Uopf":"\uD835\uDD4C","uopf":"\uD835\uDD66","UpArrowBar":"\u2912","uparrow":"\u2191","UpArrow":"\u2191","Uparrow":"\u21D1","UpArrowDownArrow":"\u21C5","updownarrow":"\u2195","UpDownArrow":"\u2195","Updownarrow":"\u21D5","UpEquilibrium":"\u296E","upharpoonleft":"\u21BF","upharpoonright":"\u21BE","uplus":"\u228E","UpperLeftArrow":"\u2196","UpperRightArrow":"\u2197","upsi":"\u03C5","Upsi":"\u03D2","upsih":"\u03D2","Upsilon":"\u03A5","upsilon":"\u03C5","UpTeeArrow":"\u21A5","UpTee":"\u22A5","upuparrows":"\u21C8","urcorn":"\u231D","urcorner":"\u231D","urcrop":"\u230E","Uring":"\u016E","uring":"\u016F","urtri":"\u25F9","Uscr":"\uD835\uDCB0","uscr":"\uD835\uDCCA","utdot":"\u22F0","Utilde":"\u0168","utilde":"\u0169","utri":"\u25B5","utrif":"\u25B4","uuarr":"\u21C8","Uuml":"\u00DC","uuml":"\u00FC","uwangle":"\u29A7","vangrt":"\u299C","varepsilon":"\u03F5","varkappa":"\u03F0","varnothing":"\u2205","varphi":"\u03D5","varpi":"\u03D6","varpropto":"\u221D","varr":"\u2195","vArr":"\u21D5","varrho":"\u03F1","varsigma":"\u03C2","varsubsetneq":"\u228A\uFE00","varsubsetneqq":"\u2ACB\uFE00","varsupsetneq":"\u228B\uFE00","varsupsetneqq":"\u2ACC\uFE00","vartheta":"\u03D1","vartriangleleft":"\u22B2","vartriangleright":"\u22B3","vBar":"\u2AE8","Vbar":"\u2AEB","vBarv":"\u2AE9","Vcy":"\u0412","vcy":"\u0432","vdash":"\u22A2","vDash":"\u22A8","Vdash":"\u22A9","VDash":"\u22AB","Vdashl":"\u2AE6","veebar":"\u22BB","vee":"\u2228","Vee":"\u22C1","veeeq":"\u225A","vellip":"\u22EE","verbar":"|","Verbar":"\u2016","vert":"|","Vert":"\u2016","VerticalBar":"\u2223","VerticalLine":"|","VerticalSeparator":"\u2758","VerticalTilde":"\u2240","VeryThinSpace":"\u200A","Vfr":"\uD835\uDD19","vfr":"\uD835\uDD33","vltri":"\u22B2","vnsub":"\u2282\u20D2","vnsup":"\u2283\u20D2","Vopf":"\uD835\uDD4D","vopf":"\uD835\uDD67","vprop":"\u221D","vrtri":"\u22B3","Vscr":"\uD835\uDCB1","vscr":"\uD835\uDCCB","vsubnE":"\u2ACB\uFE00","vsubne":"\u228A\uFE00","vsupnE":"\u2ACC\uFE00","vsupne":"\u228B\uFE00","Vvdash":"\u22AA","vzigzag":"\u299A","Wcirc":"\u0174","wcirc":"\u0175","wedbar":"\u2A5F","wedge":"\u2227","Wedge":"\u22C0","wedgeq":"\u2259","weierp":"\u2118","Wfr":"\uD835\uDD1A","wfr":"\uD835\uDD34","Wopf":"\uD835\uDD4E","wopf":"\uD835\uDD68","wp":"\u2118","wr":"\u2240","wreath":"\u2240","Wscr":"\uD835\uDCB2","wscr":"\uD835\uDCCC","xcap":"\u22C2","xcirc":"\u25EF","xcup":"\u22C3","xdtri":"\u25BD","Xfr":"\uD835\uDD1B","xfr":"\uD835\uDD35","xharr":"\u27F7","xhArr":"\u27FA","Xi":"\u039E","xi":"\u03BE","xlarr":"\u27F5","xlArr":"\u27F8","xmap":"\u27FC","xnis":"\u22FB","xodot":"\u2A00","Xopf":"\uD835\uDD4F","xopf":"\uD835\uDD69","xoplus":"\u2A01","xotime":"\u2A02","xrarr":"\u27F6","xrArr":"\u27F9","Xscr":"\uD835\uDCB3","xscr":"\uD835\uDCCD","xsqcup":"\u2A06","xuplus":"\u2A04","xutri":"\u25B3","xvee":"\u22C1","xwedge":"\u22C0","Yacute":"\u00DD","yacute":"\u00FD","YAcy":"\u042F","yacy":"\u044F","Ycirc":"\u0176","ycirc":"\u0177","Ycy":"\u042B","ycy":"\u044B","yen":"\u00A5","Yfr":"\uD835\uDD1C","yfr":"\uD835\uDD36","YIcy":"\u0407","yicy":"\u0457","Yopf":"\uD835\uDD50","yopf":"\uD835\uDD6A","Yscr":"\uD835\uDCB4","yscr":"\uD835\uDCCE","YUcy":"\u042E","yucy":"\u044E","yuml":"\u00FF","Yuml":"\u0178","Zacute":"\u0179","zacute":"\u017A","Zcaron":"\u017D","zcaron":"\u017E","Zcy":"\u0417","zcy":"\u0437","Zdot":"\u017B","zdot":"\u017C","zeetrf":"\u2128","ZeroWidthSpace":"\u200B","Zeta":"\u0396","zeta":"\u03B6","zfr":"\uD835\uDD37","Zfr":"\u2128","ZHcy":"\u0416","zhcy":"\u0436","zigrarr":"\u21DD","zopf":"\uD835\uDD6B","Zopf":"\u2124","Zscr":"\uD835\uDCB5","zscr":"\uD835\uDCCF","zwj":"\u200D","zwnj":"\u200C"}
+},{}],53:[function(require,module,exports){
+'use strict';
+
+
+////////////////////////////////////////////////////////////////////////////////
+// Helpers
+
+// Merge objects
+//
+function assign(obj /*from1, from2, from3, ...*/) {
+  var sources = Array.prototype.slice.call(arguments, 1);
+
+  sources.forEach(function (source) {
+    if (!source) { return; }
+
+    Object.keys(source).forEach(function (key) {
+      obj[key] = source[key];
+    });
+  });
+
+  return obj;
+}
+
+function _class(obj) { return Object.prototype.toString.call(obj); }
+function isString(obj) { return _class(obj) === '[object String]'; }
+function isObject(obj) { return _class(obj) === '[object Object]'; }
+function isRegExp(obj) { return _class(obj) === '[object RegExp]'; }
+function isFunction(obj) { return _class(obj) === '[object Function]'; }
+
+
+function escapeRE(str) { return str.replace(/[.?*+^$[\]\\(){}|-]/g, '\\$&'); }
+
+////////////////////////////////////////////////////////////////////////////////
+
+
+var defaultOptions = {
+  fuzzyLink: true,
+  fuzzyEmail: true,
+  fuzzyIP: false
+};
+
+
+function isOptionsObj(obj) {
+  return Object.keys(obj || {}).reduce(function (acc, k) {
+    return acc || defaultOptions.hasOwnProperty(k);
+  }, false);
+}
+
+
+var defaultSchemas = {
+  'http:': {
+    validate: function (text, pos, self) {
+      var tail = text.slice(pos);
+
+      if (!self.re.http) {
+        // compile lazily, because "host"-containing variables can change on tlds update.
+        self.re.http =  new RegExp(
+          '^\\/\\/' + self.re.src_auth + self.re.src_host_port_strict + self.re.src_path, 'i'
+        );
+      }
+      if (self.re.http.test(tail)) {
+        return tail.match(self.re.http)[0].length;
+      }
+      return 0;
+    }
+  },
+  'https:':  'http:',
+  'ftp:':    'http:',
+  '//':      {
+    validate: function (text, pos, self) {
+      var tail = text.slice(pos);
+
+      if (!self.re.no_http) {
+      // compile lazily, because "host"-containing variables can change on tlds update.
+        self.re.no_http =  new RegExp(
+          '^' +
+          self.re.src_auth +
+          // Don't allow single-level domains, because of false positives like '//test'
+          // with code comments
+          '(?:localhost|(?:(?:' + self.re.src_domain + ')\\.)+' + self.re.src_domain_root + ')' +
+          self.re.src_port +
+          self.re.src_host_terminator +
+          self.re.src_path,
+
+          'i'
+        );
+      }
+
+      if (self.re.no_http.test(tail)) {
+        // should not be `://` & `///`, that protects from errors in protocol name
+        if (pos >= 3 && text[pos - 3] === ':') { return 0; }
+        if (pos >= 3 && text[pos - 3] === '/') { return 0; }
+        return tail.match(self.re.no_http)[0].length;
+      }
+      return 0;
+    }
+  },
+  'mailto:': {
+    validate: function (text, pos, self) {
+      var tail = text.slice(pos);
+
+      if (!self.re.mailto) {
+        self.re.mailto =  new RegExp(
+          '^' + self.re.src_email_name + '@' + self.re.src_host_strict, 'i'
+        );
+      }
+      if (self.re.mailto.test(tail)) {
+        return tail.match(self.re.mailto)[0].length;
+      }
+      return 0;
+    }
+  }
+};
+
+/*eslint-disable max-len*/
+
+// RE pattern for 2-character tlds (autogenerated by ./support/tlds_2char_gen.js)
+var tlds_2ch_src_re = 'a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]';
+
+// DON'T try to make PRs with changes. Extend TLDs with LinkifyIt.tlds() instead
+var tlds_default = 'biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф'.split('|');
+
+/*eslint-enable max-len*/
+
+////////////////////////////////////////////////////////////////////////////////
+
+function resetScanCache(self) {
+  self.__index__ = -1;
+  self.__text_cache__   = '';
+}
+
+function createValidator(re) {
+  return function (text, pos) {
+    var tail = text.slice(pos);
+
+    if (re.test(tail)) {
+      return tail.match(re)[0].length;
+    }
+    return 0;
+  };
+}
+
+function createNormalizer() {
+  return function (match, self) {
+    self.normalize(match);
+  };
+}
+
+// Schemas compiler. Build regexps.
+//
+function compile(self) {
+
+  // Load & clone RE patterns.
+  var re = self.re = require('./lib/re')(self.__opts__);
+
+  // Define dynamic patterns
+  var tlds = self.__tlds__.slice();
+
+  self.onCompile();
+
+  if (!self.__tlds_replaced__) {
+    tlds.push(tlds_2ch_src_re);
+  }
+  tlds.push(re.src_xn);
+
+  re.src_tlds = tlds.join('|');
+
+  function untpl(tpl) { return tpl.replace('%TLDS%', re.src_tlds); }
+
+  re.email_fuzzy      = RegExp(untpl(re.tpl_email_fuzzy), 'i');
+  re.link_fuzzy       = RegExp(untpl(re.tpl_link_fuzzy), 'i');
+  re.link_no_ip_fuzzy = RegExp(untpl(re.tpl_link_no_ip_fuzzy), 'i');
+  re.host_fuzzy_test  = RegExp(untpl(re.tpl_host_fuzzy_test), 'i');
+
+  //
+  // Compile each schema
+  //
+
+  var aliases = [];
+
+  self.__compiled__ = {}; // Reset compiled data
+
+  function schemaError(name, val) {
+    throw new Error('(LinkifyIt) Invalid schema "' + name + '": ' + val);
+  }
+
+  Object.keys(self.__schemas__).forEach(function (name) {
+    var val = self.__schemas__[name];
+
+    // skip disabled methods
+    if (val === null) { return; }
+
+    var compiled = { validate: null, link: null };
+
+    self.__compiled__[name] = compiled;
+
+    if (isObject(val)) {
+      if (isRegExp(val.validate)) {
+        compiled.validate = createValidator(val.validate);
+      } else if (isFunction(val.validate)) {
+        compiled.validate = val.validate;
+      } else {
+        schemaError(name, val);
+      }
+
+      if (isFunction(val.normalize)) {
+        compiled.normalize = val.normalize;
+      } else if (!val.normalize) {
+        compiled.normalize = createNormalizer();
+      } else {
+        schemaError(name, val);
+      }
+
+      return;
+    }
+
+    if (isString(val)) {
+      aliases.push(name);
+      return;
+    }
+
+    schemaError(name, val);
+  });
+
+  //
+  // Compile postponed aliases
+  //
+
+  aliases.forEach(function (alias) {
+    if (!self.__compiled__[self.__schemas__[alias]]) {
+      // Silently fail on missed schemas to avoid errons on disable.
+      // schemaError(alias, self.__schemas__[alias]);
+      return;
+    }
+
+    self.__compiled__[alias].validate =
+      self.__compiled__[self.__schemas__[alias]].validate;
+    self.__compiled__[alias].normalize =
+      self.__compiled__[self.__schemas__[alias]].normalize;
+  });
+
+  //
+  // Fake record for guessed links
+  //
+  self.__compiled__[''] = { validate: null, normalize: createNormalizer() };
+
+  //
+  // Build schema condition
+  //
+  var slist = Object.keys(self.__compiled__)
+                      .filter(function (name) {
+                        // Filter disabled & fake schemas
+                        return name.length > 0 && self.__compiled__[name];
+                      })
+                      .map(escapeRE)
+                      .join('|');
+  // (?!_) cause 1.5x slowdown
+  self.re.schema_test   = RegExp('(^|(?!_)(?:[><\uff5c]|' + re.src_ZPCc + '))(' + slist + ')', 'i');
+  self.re.schema_search = RegExp('(^|(?!_)(?:[><\uff5c]|' + re.src_ZPCc + '))(' + slist + ')', 'ig');
+
+  self.re.pretest       = RegExp(
+                            '(' + self.re.schema_test.source + ')|' +
+                            '(' + self.re.host_fuzzy_test.source + ')|' +
+                            '@',
+                            'i');
+
+  //
+  // Cleanup
+  //
+
+  resetScanCache(self);
+}
+
+/**
+ * class Match
+ *
+ * Match result. Single element of array, returned by [[LinkifyIt#match]]
+ **/
+function Match(self, shift) {
+  var start = self.__index__,
+      end   = self.__last_index__,
+      text  = self.__text_cache__.slice(start, end);
+
+  /**
+   * Match#schema -> String
+   *
+   * Prefix (protocol) for matched string.
+   **/
+  this.schema    = self.__schema__.toLowerCase();
+  /**
+   * Match#index -> Number
+   *
+   * First position of matched string.
+   **/
+  this.index     = start + shift;
+  /**
+   * Match#lastIndex -> Number
+   *
+   * Next position after matched string.
+   **/
+  this.lastIndex = end + shift;
+  /**
+   * Match#raw -> String
+   *
+   * Matched string.
+   **/
+  this.raw       = text;
+  /**
+   * Match#text -> String
+   *
+   * Notmalized text of matched string.
+   **/
+  this.text      = text;
+  /**
+   * Match#url -> String
+   *
+   * Normalized url of matched string.
+   **/
+  this.url       = text;
+}
+
+function createMatch(self, shift) {
+  var match = new Match(self, shift);
+
+  self.__compiled__[match.schema].normalize(match, self);
+
+  return match;
+}
+
+
+/**
+ * class LinkifyIt
+ **/
+
+/**
+ * new LinkifyIt(schemas, options)
+ * - schemas (Object): Optional. Additional schemas to validate (prefix/validator)
+ * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false }
+ *
+ * Creates new linkifier instance with optional additional schemas.
+ * Can be called without `new` keyword for convenience.
+ *
+ * By default understands:
+ *
+ * - `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links
+ * - "fuzzy" links and emails (example.com, foo@bar.com).
+ *
+ * `schemas` is an object, where each key/value describes protocol/rule:
+ *
+ * - __key__ - link prefix (usually, protocol name with `:` at the end, `skype:`
+ *   for example). `linkify-it` makes shure that prefix is not preceeded with
+ *   alphanumeric char and symbols. Only whitespaces and punctuation allowed.
+ * - __value__ - rule to check tail after link prefix
+ *   - _String_ - just alias to existing rule
+ *   - _Object_
+ *     - _validate_ - validator function (should return matched length on success),
+ *       or `RegExp`.
+ *     - _normalize_ - optional function to normalize text & url of matched result
+ *       (for example, for @twitter mentions).
+ *
+ * `options`:
+ *
+ * - __fuzzyLink__ - recognige URL-s without `http(s):` prefix. Default `true`.
+ * - __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts
+ *   like version numbers. Default `false`.
+ * - __fuzzyEmail__ - recognize emails without `mailto:` prefix.
+ *
+ **/
+function LinkifyIt(schemas, options) {
+  if (!(this instanceof LinkifyIt)) {
+    return new LinkifyIt(schemas, options);
+  }
+
+  if (!options) {
+    if (isOptionsObj(schemas)) {
+      options = schemas;
+      schemas = {};
+    }
+  }
+
+  this.__opts__           = assign({}, defaultOptions, options);
+
+  // Cache last tested result. Used to skip repeating steps on next `match` call.
+  this.__index__          = -1;
+  this.__last_index__     = -1; // Next scan position
+  this.__schema__         = '';
+  this.__text_cache__     = '';
+
+  this.__schemas__        = assign({}, defaultSchemas, schemas);
+  this.__compiled__       = {};
+
+  this.__tlds__           = tlds_default;
+  this.__tlds_replaced__  = false;
+
+  this.re = {};
+
+  compile(this);
+}
+
+
+/** chainable
+ * LinkifyIt#add(schema, definition)
+ * - schema (String): rule name (fixed pattern prefix)
+ * - definition (String|RegExp|Object): schema definition
+ *
+ * Add new rule definition. See constructor description for details.
+ **/
+LinkifyIt.prototype.add = function add(schema, definition) {
+  this.__schemas__[schema] = definition;
+  compile(this);
+  return this;
+};
+
+
+/** chainable
+ * LinkifyIt#set(options)
+ * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false }
+ *
+ * Set recognition options for links without schema.
+ **/
+LinkifyIt.prototype.set = function set(options) {
+  this.__opts__ = assign(this.__opts__, options);
+  return this;
+};
+
+
+/**
+ * LinkifyIt#test(text) -> Boolean
+ *
+ * Searches linkifiable pattern and returns `true` on success or `false` on fail.
+ **/
+LinkifyIt.prototype.test = function test(text) {
+  // Reset scan cache
+  this.__text_cache__ = text;
+  this.__index__      = -1;
+
+  if (!text.length) { return false; }
+
+  var m, ml, me, len, shift, next, re, tld_pos, at_pos;
+
+  // try to scan for link with schema - that's the most simple rule
+  if (this.re.schema_test.test(text)) {
+    re = this.re.schema_search;
+    re.lastIndex = 0;
+    while ((m = re.exec(text)) !== null) {
+      len = this.testSchemaAt(text, m[2], re.lastIndex);
+      if (len) {
+        this.__schema__     = m[2];
+        this.__index__      = m.index + m[1].length;
+        this.__last_index__ = m.index + m[0].length + len;
+        break;
+      }
+    }
+  }
+
+  if (this.__opts__.fuzzyLink && this.__compiled__['http:']) {
+    // guess schemaless links
+    tld_pos = text.search(this.re.host_fuzzy_test);
+    if (tld_pos >= 0) {
+      // if tld is located after found link - no need to check fuzzy pattern
+      if (this.__index__ < 0 || tld_pos < this.__index__) {
+        if ((ml = text.match(this.__opts__.fuzzyIP ? this.re.link_fuzzy : this.re.link_no_ip_fuzzy)) !== null) {
+
+          shift = ml.index + ml[1].length;
+
+          if (this.__index__ < 0 || shift < this.__index__) {
+            this.__schema__     = '';
+            this.__index__      = shift;
+            this.__last_index__ = ml.index + ml[0].length;
+          }
+        }
+      }
+    }
+  }
+
+  if (this.__opts__.fuzzyEmail && this.__compiled__['mailto:']) {
+    // guess schemaless emails
+    at_pos = text.indexOf('@');
+    if (at_pos >= 0) {
+      // We can't skip this check, because this cases are possible:
+      // 192.168.1.1@gmail.com, my.in@example.com
+      if ((me = text.match(this.re.email_fuzzy)) !== null) {
+
+        shift = me.index + me[1].length;
+        next  = me.index + me[0].length;
+
+        if (this.__index__ < 0 || shift < this.__index__ ||
+            (shift === this.__index__ && next > this.__last_index__)) {
+          this.__schema__     = 'mailto:';
+          this.__index__      = shift;
+          this.__last_index__ = next;
+        }
+      }
+    }
+  }
+
+  return this.__index__ >= 0;
+};
+
+
+/**
+ * LinkifyIt#pretest(text) -> Boolean
+ *
+ * Very quick check, that can give false positives. Returns true if link MAY BE
+ * can exists. Can be used for speed optimization, when you need to check that
+ * link NOT exists.
+ **/
+LinkifyIt.prototype.pretest = function pretest(text) {
+  return this.re.pretest.test(text);
+};
+
+
+/**
+ * LinkifyIt#testSchemaAt(text, name, position) -> Number
+ * - text (String): text to scan
+ * - name (String): rule (schema) name
+ * - position (Number): text offset to check from
+ *
+ * Similar to [[LinkifyIt#test]] but checks only specific protocol tail exactly
+ * at given position. Returns length of found pattern (0 on fail).
+ **/
+LinkifyIt.prototype.testSchemaAt = function testSchemaAt(text, schema, pos) {
+  // If not supported schema check requested - terminate
+  if (!this.__compiled__[schema.toLowerCase()]) {
+    return 0;
+  }
+  return this.__compiled__[schema.toLowerCase()].validate(text, pos, this);
+};
+
+
+/**
+ * LinkifyIt#match(text) -> Array|null
+ *
+ * Returns array of found link descriptions or `null` on fail. We strongly
+ * recommend to use [[LinkifyIt#test]] first, for best speed.
+ *
+ * ##### Result match description
+ *
+ * - __schema__ - link schema, can be empty for fuzzy links, or `//` for
+ *   protocol-neutral  links.
+ * - __index__ - offset of matched text
+ * - __lastIndex__ - index of next char after mathch end
+ * - __raw__ - matched text
+ * - __text__ - normalized text
+ * - __url__ - link, generated from matched text
+ **/
+LinkifyIt.prototype.match = function match(text) {
+  var shift = 0, result = [];
+
+  // Try to take previous element from cache, if .test() called before
+  if (this.__index__ >= 0 && this.__text_cache__ === text) {
+    result.push(createMatch(this, shift));
+    shift = this.__last_index__;
+  }
+
+  // Cut head if cache was used
+  var tail = shift ? text.slice(shift) : text;
+
+  // Scan string until end reached
+  while (this.test(tail)) {
+    result.push(createMatch(this, shift));
+
+    tail = tail.slice(this.__last_index__);
+    shift += this.__last_index__;
+  }
+
+  if (result.length) {
+    return result;
+  }
+
+  return null;
+};
+
+
+/** chainable
+ * LinkifyIt#tlds(list [, keepOld]) -> this
+ * - list (Array): list of tlds
+ * - keepOld (Boolean): merge with current list if `true` (`false` by default)
+ *
+ * Load (or merge) new tlds list. Those are user for fuzzy links (without prefix)
+ * to avoid false positives. By default this algorythm used:
+ *
+ * - hostname with any 2-letter root zones are ok.
+ * - biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф
+ *   are ok.
+ * - encoded (`xn--...`) root zones are ok.
+ *
+ * If list is replaced, then exact match for 2-chars root zones will be checked.
+ **/
+LinkifyIt.prototype.tlds = function tlds(list, keepOld) {
+  list = Array.isArray(list) ? list : [ list ];
+
+  if (!keepOld) {
+    this.__tlds__ = list.slice();
+    this.__tlds_replaced__ = true;
+    compile(this);
+    return this;
+  }
+
+  this.__tlds__ = this.__tlds__.concat(list)
+                                  .sort()
+                                  .filter(function (el, idx, arr) {
+                                    return el !== arr[idx - 1];
+                                  })
+                                  .reverse();
+
+  compile(this);
+  return this;
+};
+
+/**
+ * LinkifyIt#normalize(match)
+ *
+ * Default normalizer (if schema does not define it's own).
+ **/
+LinkifyIt.prototype.normalize = function normalize(match) {
+
+  // Do minimal possible changes by default. Need to collect feedback prior
+  // to move forward https://github.com/markdown-it/linkify-it/issues/1
+
+  if (!match.schema) { match.url = 'http://' + match.url; }
+
+  if (match.schema === 'mailto:' && !/^mailto:/i.test(match.url)) {
+    match.url = 'mailto:' + match.url;
+  }
+};
+
+
+/**
+ * LinkifyIt#onCompile()
+ *
+ * Override to modify basic RegExp-s.
+ **/
+LinkifyIt.prototype.onCompile = function onCompile() {
+};
+
+
+module.exports = LinkifyIt;
+
+},{"./lib/re":54}],54:[function(require,module,exports){
+'use strict';
+
+
+module.exports = function (opts) {
+  var re = {};
+
+  // Use direct extract instead of `regenerate` to reduse browserified size
+  re.src_Any = require('uc.micro/properties/Any/regex').source;
+  re.src_Cc  = require('uc.micro/categories/Cc/regex').source;
+  re.src_Z   = require('uc.micro/categories/Z/regex').source;
+  re.src_P   = require('uc.micro/categories/P/regex').source;
+
+  // \p{\Z\P\Cc\CF} (white spaces + control + format + punctuation)
+  re.src_ZPCc = [ re.src_Z, re.src_P, re.src_Cc ].join('|');
+
+  // \p{\Z\Cc} (white spaces + control)
+  re.src_ZCc = [ re.src_Z, re.src_Cc ].join('|');
+
+  // Experimental. List of chars, completely prohibited in links
+  // because can separate it from other part of text
+  var text_separators = '[><\uff5c]';
+
+  // All possible word characters (everything without punctuation, spaces & controls)
+  // Defined via punctuation & spaces to save space
+  // Should be something like \p{\L\N\S\M} (\w but without `_`)
+  re.src_pseudo_letter       = '(?:(?!' + text_separators + '|' + re.src_ZPCc + ')' + re.src_Any + ')';
+  // The same as abothe but without [0-9]
+  // var src_pseudo_letter_non_d = '(?:(?![0-9]|' + src_ZPCc + ')' + src_Any + ')';
+
+  ////////////////////////////////////////////////////////////////////////////////
+
+  re.src_ip4 =
+
+    '(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)';
+
+  // Prohibit any of "@/[]()" in user/pass to avoid wrong domain fetch.
+  re.src_auth    = '(?:(?:(?!' + re.src_ZCc + '|[@/\\[\\]()]).)+@)?';
+
+  re.src_port =
+
+    '(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?';
+
+  re.src_host_terminator =
+
+    '(?=$|' + text_separators + '|' + re.src_ZPCc + ')(?!-|_|:\\d|\\.-|\\.(?!$|' + re.src_ZPCc + '))';
+
+  re.src_path =
+
+    '(?:' +
+      '[/?#]' +
+        '(?:' +
+          '(?!' + re.src_ZCc + '|' + text_separators + '|[()[\\]{}.,"\'?!\\-]).|' +
+          '\\[(?:(?!' + re.src_ZCc + '|\\]).)*\\]|' +
+          '\\((?:(?!' + re.src_ZCc + '|[)]).)*\\)|' +
+          '\\{(?:(?!' + re.src_ZCc + '|[}]).)*\\}|' +
+          '\\"(?:(?!' + re.src_ZCc + '|["]).)+\\"|' +
+          "\\'(?:(?!" + re.src_ZCc + "|[']).)+\\'|" +
+          "\\'(?=" + re.src_pseudo_letter + '|[-]).|' +  // allow `I'm_king` if no pair found
+          '\\.{2,3}[a-zA-Z0-9%/]|' + // github has ... in commit range links. Restrict to
+                                     // - english
+                                     // - percent-encoded
+                                     // - parts of file path
+                                     // until more examples found.
+          '\\.(?!' + re.src_ZCc + '|[.]).|' +
+          (opts && opts['---'] ?
+            '\\-(?!--(?:[^-]|$))(?:-*)|' // `---` => long dash, terminate
+          :
+            '\\-+|'
+          ) +
+          '\\,(?!' + re.src_ZCc + ').|' +      // allow `,,,` in paths
+          '\\!(?!' + re.src_ZCc + '|[!]).|' +
+          '\\?(?!' + re.src_ZCc + '|[?]).' +
+        ')+' +
+      '|\\/' +
+    ')?';
+
+  re.src_email_name =
+
+    '[\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]+';
+
+  re.src_xn =
+
+    'xn--[a-z0-9\\-]{1,59}';
+
+  // More to read about domain names
+  // http://serverfault.com/questions/638260/
+
+  re.src_domain_root =
+
+    // Allow letters & digits (http://test1)
+    '(?:' +
+      re.src_xn +
+      '|' +
+      re.src_pseudo_letter + '{1,63}' +
+    ')';
+
+  re.src_domain =
+
+    '(?:' +
+      re.src_xn +
+      '|' +
+      '(?:' + re.src_pseudo_letter + ')' +
+      '|' +
+      // don't allow `--` in domain names, because:
+      // - that can conflict with markdown &mdash; / &ndash;
+      // - nobody use those anyway
+      '(?:' + re.src_pseudo_letter + '(?:-(?!-)|' + re.src_pseudo_letter + '){0,61}' + re.src_pseudo_letter + ')' +
+    ')';
+
+  re.src_host =
+
+    '(?:' +
+    // Don't need IP check, because digits are already allowed in normal domain names
+    //   src_ip4 +
+    // '|' +
+      '(?:(?:(?:' + re.src_domain + ')\\.)*' + re.src_domain/*_root*/ + ')' +
+    ')';
+
+  re.tpl_host_fuzzy =
+
+    '(?:' +
+      re.src_ip4 +
+    '|' +
+      '(?:(?:(?:' + re.src_domain + ')\\.)+(?:%TLDS%))' +
+    ')';
+
+  re.tpl_host_no_ip_fuzzy =
+
+    '(?:(?:(?:' + re.src_domain + ')\\.)+(?:%TLDS%))';
+
+  re.src_host_strict =
+
+    re.src_host + re.src_host_terminator;
+
+  re.tpl_host_fuzzy_strict =
+
+    re.tpl_host_fuzzy + re.src_host_terminator;
+
+  re.src_host_port_strict =
+
+    re.src_host + re.src_port + re.src_host_terminator;
+
+  re.tpl_host_port_fuzzy_strict =
+
+    re.tpl_host_fuzzy + re.src_port + re.src_host_terminator;
+
+  re.tpl_host_port_no_ip_fuzzy_strict =
+
+    re.tpl_host_no_ip_fuzzy + re.src_port + re.src_host_terminator;
+
+
+  ////////////////////////////////////////////////////////////////////////////////
+  // Main rules
+
+  // Rude test fuzzy links by host, for quick deny
+  re.tpl_host_fuzzy_test =
+
+    'localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:' + re.src_ZPCc + '|>|$))';
+
+  re.tpl_email_fuzzy =
+
+      '(^|' + text_separators + '|\\(|' + re.src_ZCc + ')(' + re.src_email_name + '@' + re.tpl_host_fuzzy_strict + ')';
+
+  re.tpl_link_fuzzy =
+      // Fuzzy link can't be prepended with .:/\- and non punctuation.
+      // but can start with > (markdown blockquote)
+      '(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|' + re.src_ZPCc + '))' +
+      '((?![$+<=>^`|\uff5c])' + re.tpl_host_port_fuzzy_strict + re.src_path + ')';
+
+  re.tpl_link_no_ip_fuzzy =
+      // Fuzzy link can't be prepended with .:/\- and non punctuation.
+      // but can start with > (markdown blockquote)
+      '(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|' + re.src_ZPCc + '))' +
+      '((?![$+<=>^`|\uff5c])' + re.tpl_host_port_no_ip_fuzzy_strict + re.src_path + ')';
+
+  return re;
+};
+
+},{"uc.micro/categories/Cc/regex":61,"uc.micro/categories/P/regex":63,"uc.micro/categories/Z/regex":64,"uc.micro/properties/Any/regex":66}],55:[function(require,module,exports){
+
+'use strict';
+
+
+/* eslint-disable no-bitwise */
+
+var decodeCache = {};
+
+function getDecodeCache(exclude) {
+  var i, ch, cache = decodeCache[exclude];
+  if (cache) { return cache; }
+
+  cache = decodeCache[exclude] = [];
+
+  for (i = 0; i < 128; i++) {
+    ch = String.fromCharCode(i);
+    cache.push(ch);
+  }
+
+  for (i = 0; i < exclude.length; i++) {
+    ch = exclude.charCodeAt(i);
+    cache[ch] = '%' + ('0' + ch.toString(16).toUpperCase()).slice(-2);
+  }
+
+  return cache;
+}
+
+
+// Decode percent-encoded string.
+//
+function decode(string, exclude) {
+  var cache;
+
+  if (typeof exclude !== 'string') {
+    exclude = decode.defaultChars;
+  }
+
+  cache = getDecodeCache(exclude);
+
+  return string.replace(/(%[a-f0-9]{2})+/gi, function(seq) {
+    var i, l, b1, b2, b3, b4, chr,
+        result = '';
+
+    for (i = 0, l = seq.length; i < l; i += 3) {
+      b1 = parseInt(seq.slice(i + 1, i + 3), 16);
+
+      if (b1 < 0x80) {
+        result += cache[b1];
+        continue;
+      }
+
+      if ((b1 & 0xE0) === 0xC0 && (i + 3 < l)) {
+        // 110xxxxx 10xxxxxx
+        b2 = parseInt(seq.slice(i + 4, i + 6), 16);
+
+        if ((b2 & 0xC0) === 0x80) {
+          chr = ((b1 << 6) & 0x7C0) | (b2 & 0x3F);
+
+          if (chr < 0x80) {
+            result += '\ufffd\ufffd';
+          } else {
+            result += String.fromCharCode(chr);
+          }
+
+          i += 3;
+          continue;
+        }
+      }
+
+      if ((b1 & 0xF0) === 0xE0 && (i + 6 < l)) {
+        // 1110xxxx 10xxxxxx 10xxxxxx
+        b2 = parseInt(seq.slice(i + 4, i + 6), 16);
+        b3 = parseInt(seq.slice(i + 7, i + 9), 16);
+
+        if ((b2 & 0xC0) === 0x80 && (b3 & 0xC0) === 0x80) {
+          chr = ((b1 << 12) & 0xF000) | ((b2 << 6) & 0xFC0) | (b3 & 0x3F);
+
+          if (chr < 0x800 || (chr >= 0xD800 && chr <= 0xDFFF)) {
+            result += '\ufffd\ufffd\ufffd';
+          } else {
+            result += String.fromCharCode(chr);
+          }
+
+          i += 6;
+          continue;
+        }
+      }
+
+      if ((b1 & 0xF8) === 0xF0 && (i + 9 < l)) {
+        // 111110xx 10xxxxxx 10xxxxxx 10xxxxxx
+        b2 = parseInt(seq.slice(i + 4, i + 6), 16);
+        b3 = parseInt(seq.slice(i + 7, i + 9), 16);
+        b4 = parseInt(seq.slice(i + 10, i + 12), 16);
+
+        if ((b2 & 0xC0) === 0x80 && (b3 & 0xC0) === 0x80 && (b4 & 0xC0) === 0x80) {
+          chr = ((b1 << 18) & 0x1C0000) | ((b2 << 12) & 0x3F000) | ((b3 << 6) & 0xFC0) | (b4 & 0x3F);
+
+          if (chr < 0x10000 || chr > 0x10FFFF) {
+            result += '\ufffd\ufffd\ufffd\ufffd';
+          } else {
+            chr -= 0x10000;
+            result += String.fromCharCode(0xD800 + (chr >> 10), 0xDC00 + (chr & 0x3FF));
+          }
+
+          i += 9;
+          continue;
+        }
+      }
+
+      result += '\ufffd';
+    }
+
+    return result;
+  });
+}
+
+
+decode.defaultChars   = ';/?:@&=+$,#';
+decode.componentChars = '';
+
+
+module.exports = decode;
+
+},{}],56:[function(require,module,exports){
+
+'use strict';
+
+
+var encodeCache = {};
+
+
+// Create a lookup array where anything but characters in `chars` string
+// and alphanumeric chars is percent-encoded.
+//
+function getEncodeCache(exclude) {
+  var i, ch, cache = encodeCache[exclude];
+  if (cache) { return cache; }
+
+  cache = encodeCache[exclude] = [];
+
+  for (i = 0; i < 128; i++) {
+    ch = String.fromCharCode(i);
+
+    if (/^[0-9a-z]$/i.test(ch)) {
+      // always allow unencoded alphanumeric characters
+      cache.push(ch);
+    } else {
+      cache.push('%' + ('0' + i.toString(16).toUpperCase()).slice(-2));
+    }
+  }
+
+  for (i = 0; i < exclude.length; i++) {
+    cache[exclude.charCodeAt(i)] = exclude[i];
+  }
+
+  return cache;
+}
+
+
+// Encode unsafe characters with percent-encoding, skipping already
+// encoded sequences.
+//
+//  - string       - string to encode
+//  - exclude      - list of characters to ignore (in addition to a-zA-Z0-9)
+//  - keepEscaped  - don't encode '%' in a correct escape sequence (default: true)
+//
+function encode(string, exclude, keepEscaped) {
+  var i, l, code, nextCode, cache,
+      result = '';
+
+  if (typeof exclude !== 'string') {
+    // encode(string, keepEscaped)
+    keepEscaped  = exclude;
+    exclude = encode.defaultChars;
+  }
+
+  if (typeof keepEscaped === 'undefined') {
+    keepEscaped = true;
+  }
+
+  cache = getEncodeCache(exclude);
+
+  for (i = 0, l = string.length; i < l; i++) {
+    code = string.charCodeAt(i);
+
+    if (keepEscaped && code === 0x25 /* % */ && i + 2 < l) {
+      if (/^[0-9a-f]{2}$/i.test(string.slice(i + 1, i + 3))) {
+        result += string.slice(i, i + 3);
+        i += 2;
+        continue;
+      }
+    }
+
+    if (code < 128) {
+      result += cache[code];
+      continue;
+    }
+
+    if (code >= 0xD800 && code <= 0xDFFF) {
+      if (code >= 0xD800 && code <= 0xDBFF && i + 1 < l) {
+        nextCode = string.charCodeAt(i + 1);
+        if (nextCode >= 0xDC00 && nextCode <= 0xDFFF) {
+          result += encodeURIComponent(string[i] + string[i + 1]);
+          i++;
+          continue;
+        }
+      }
+      result += '%EF%BF%BD';
+      continue;
+    }
+
+    result += encodeURIComponent(string[i]);
+  }
+
+  return result;
+}
+
+encode.defaultChars   = ";/?:@&=+$,-_.!~*'()#";
+encode.componentChars = "-_.!~*'()";
+
+
+module.exports = encode;
+
+},{}],57:[function(require,module,exports){
+
+'use strict';
+
+
+module.exports = function format(url) {
+  var result = '';
+
+  result += url.protocol || '';
+  result += url.slashes ? '//' : '';
+  result += url.auth ? url.auth + '@' : '';
+
+  if (url.hostname && url.hostname.indexOf(':') !== -1) {
+    // ipv6 address
+    result += '[' + url.hostname + ']';
+  } else {
+    result += url.hostname || '';
+  }
+
+  result += url.port ? ':' + url.port : '';
+  result += url.pathname || '';
+  result += url.search || '';
+  result += url.hash || '';
+
+  return result;
+};
+
+},{}],58:[function(require,module,exports){
+'use strict';
+
+
+module.exports.encode = require('./encode');
+module.exports.decode = require('./decode');
+module.exports.format = require('./format');
+module.exports.parse  = require('./parse');
+
+},{"./decode":55,"./encode":56,"./format":57,"./parse":59}],59:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+'use strict';
+
+//
+// Changes from joyent/node:
+//
+// 1. No leading slash in paths,
+//    e.g. in `url.parse('http://foo?bar')` pathname is ``, not `/`
+//
+// 2. Backslashes are not replaced with slashes,
+//    so `http:\\example.org\` is treated like a relative path
+//
+// 3. Trailing colon is treated like a part of the path,
+//    i.e. in `http://example.org:foo` pathname is `:foo`
+//
+// 4. Nothing is URL-encoded in the resulting object,
+//    (in joyent/node some chars in auth and paths are encoded)
+//
+// 5. `url.parse()` does not have `parseQueryString` argument
+//
+// 6. Removed extraneous result properties: `host`, `path`, `query`, etc.,
+//    which can be constructed using other parts of the url.
+//
+
+
+function Url() {
+  this.protocol = null;
+  this.slashes = null;
+  this.auth = null;
+  this.port = null;
+  this.hostname = null;
+  this.hash = null;
+  this.search = null;
+  this.pathname = null;
+}
+
+// Reference: RFC 3986, RFC 1808, RFC 2396
+
+// define these here so at least they only have to be
+// compiled once on the first module load.
+var protocolPattern = /^([a-z0-9.+-]+:)/i,
+    portPattern = /:[0-9]*$/,
+
+    // Special case for a simple path URL
+    simplePathPattern = /^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,
+
+    // RFC 2396: characters reserved for delimiting URLs.
+    // We actually just auto-escape these.
+    delims = [ '<', '>', '"', '`', ' ', '\r', '\n', '\t' ],
+
+    // RFC 2396: characters not allowed for various reasons.
+    unwise = [ '{', '}', '|', '\\', '^', '`' ].concat(delims),
+
+    // Allowed by RFCs, but cause of XSS attacks.  Always escape these.
+    autoEscape = [ '\'' ].concat(unwise),
+    // Characters that are never ever allowed in a hostname.
+    // Note that any invalid chars are also handled, but these
+    // are the ones that are *expected* to be seen, so we fast-path
+    // them.
+    nonHostChars = [ '%', '/', '?', ';', '#' ].concat(autoEscape),
+    hostEndingChars = [ '/', '?', '#' ],
+    hostnameMaxLen = 255,
+    hostnamePartPattern = /^[+a-z0-9A-Z_-]{0,63}$/,
+    hostnamePartStart = /^([+a-z0-9A-Z_-]{0,63})(.*)$/,
+    // protocols that can allow "unsafe" and "unwise" chars.
+    /* eslint-disable no-script-url */
+    // protocols that never have a hostname.
+    hostlessProtocol = {
+      'javascript': true,
+      'javascript:': true
+    },
+    // protocols that always contain a // bit.
+    slashedProtocol = {
+      'http': true,
+      'https': true,
+      'ftp': true,
+      'gopher': true,
+      'file': true,
+      'http:': true,
+      'https:': true,
+      'ftp:': true,
+      'gopher:': true,
+      'file:': true
+    };
+    /* eslint-enable no-script-url */
+
+function urlParse(url, slashesDenoteHost) {
+  if (url && url instanceof Url) { return url; }
+
+  var u = new Url();
+  u.parse(url, slashesDenoteHost);
+  return u;
+}
+
+Url.prototype.parse = function(url, slashesDenoteHost) {
+  var i, l, lowerProto, hec, slashes,
+      rest = url;
+
+  // trim before proceeding.
+  // This is to support parse stuff like "  http://foo.com  \n"
+  rest = rest.trim();
+
+  if (!slashesDenoteHost && url.split('#').length === 1) {
+    // Try fast path regexp
+    var simplePath = simplePathPattern.exec(rest);
+    if (simplePath) {
+      this.pathname = simplePath[1];
+      if (simplePath[2]) {
+        this.search = simplePath[2];
+      }
+      return this;
+    }
+  }
+
+  var proto = protocolPattern.exec(rest);
+  if (proto) {
+    proto = proto[0];
+    lowerProto = proto.toLowerCase();
+    this.protocol = proto;
+    rest = rest.substr(proto.length);
+  }
+
+  // figure out if it's got a host
+  // user@server is *always* interpreted as a hostname, and url
+  // resolution will treat //foo/bar as host=foo,path=bar because that's
+  // how the browser resolves relative URLs.
+  if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) {
+    slashes = rest.substr(0, 2) === '//';
+    if (slashes && !(proto && hostlessProtocol[proto])) {
+      rest = rest.substr(2);
+      this.slashes = true;
+    }
+  }
+
+  if (!hostlessProtocol[proto] &&
+      (slashes || (proto && !slashedProtocol[proto]))) {
+
+    // there's a hostname.
+    // the first instance of /, ?, ;, or # ends the host.
+    //
+    // If there is an @ in the hostname, then non-host chars *are* allowed
+    // to the left of the last @ sign, unless some host-ending character
+    // comes *before* the @-sign.
+    // URLs are obnoxious.
+    //
+    // ex:
+    // http://a@b@c/ => user:a@b host:c
+    // http://a@b?@c => user:a host:c path:/?@c
+
+    // v0.12 TODO(isaacs): This is not quite how Chrome does things.
+    // Review our test case against browsers more comprehensively.
+
+    // find the first instance of any hostEndingChars
+    var hostEnd = -1;
+    for (i = 0; i < hostEndingChars.length; i++) {
+      hec = rest.indexOf(hostEndingChars[i]);
+      if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) {
+        hostEnd = hec;
+      }
+    }
+
+    // at this point, either we have an explicit point where the
+    // auth portion cannot go past, or the last @ char is the decider.
+    var auth, atSign;
+    if (hostEnd === -1) {
+      // atSign can be anywhere.
+      atSign = rest.lastIndexOf('@');
+    } else {
+      // atSign must be in auth portion.
+      // http://a@b/c@d => host:b auth:a path:/c@d
+      atSign = rest.lastIndexOf('@', hostEnd);
+    }
+
+    // Now we have a portion which is definitely the auth.
+    // Pull that off.
+    if (atSign !== -1) {
+      auth = rest.slice(0, atSign);
+      rest = rest.slice(atSign + 1);
+      this.auth = auth;
+    }
+
+    // the host is the remaining to the left of the first non-host char
+    hostEnd = -1;
+    for (i = 0; i < nonHostChars.length; i++) {
+      hec = rest.indexOf(nonHostChars[i]);
+      if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) {
+        hostEnd = hec;
+      }
+    }
+    // if we still have not hit it, then the entire thing is a host.
+    if (hostEnd === -1) {
+      hostEnd = rest.length;
+    }
+
+    if (rest[hostEnd - 1] === ':') { hostEnd--; }
+    var host = rest.slice(0, hostEnd);
+    rest = rest.slice(hostEnd);
+
+    // pull out port.
+    this.parseHost(host);
+
+    // we've indicated that there is a hostname,
+    // so even if it's empty, it has to be present.
+    this.hostname = this.hostname || '';
+
+    // if hostname begins with [ and ends with ]
+    // assume that it's an IPv6 address.
+    var ipv6Hostname = this.hostname[0] === '[' &&
+        this.hostname[this.hostname.length - 1] === ']';
+
+    // validate a little.
+    if (!ipv6Hostname) {
+      var hostparts = this.hostname.split(/\./);
+      for (i = 0, l = hostparts.length; i < l; i++) {
+        var part = hostparts[i];
+        if (!part) { continue; }
+        if (!part.match(hostnamePartPattern)) {
+          var newpart = '';
+          for (var j = 0, k = part.length; j < k; j++) {
+            if (part.charCodeAt(j) > 127) {
+              // we replace non-ASCII char with a temporary placeholder
+              // we need this to make sure size of hostname is not
+              // broken by replacing non-ASCII by nothing
+              newpart += 'x';
+            } else {
+              newpart += part[j];
+            }
+          }
+          // we test again with ASCII char only
+          if (!newpart.match(hostnamePartPattern)) {
+            var validParts = hostparts.slice(0, i);
+            var notHost = hostparts.slice(i + 1);
+            var bit = part.match(hostnamePartStart);
+            if (bit) {
+              validParts.push(bit[1]);
+              notHost.unshift(bit[2]);
+            }
+            if (notHost.length) {
+              rest = notHost.join('.') + rest;
+            }
+            this.hostname = validParts.join('.');
+            break;
+          }
+        }
+      }
+    }
+
+    if (this.hostname.length > hostnameMaxLen) {
+      this.hostname = '';
+    }
+
+    // strip [ and ] from the hostname
+    // the host field still retains them, though
+    if (ipv6Hostname) {
+      this.hostname = this.hostname.substr(1, this.hostname.length - 2);
+    }
+  }
+
+  // chop off from the tail first.
+  var hash = rest.indexOf('#');
+  if (hash !== -1) {
+    // got a fragment string.
+    this.hash = rest.substr(hash);
+    rest = rest.slice(0, hash);
+  }
+  var qm = rest.indexOf('?');
+  if (qm !== -1) {
+    this.search = rest.substr(qm);
+    rest = rest.slice(0, qm);
+  }
+  if (rest) { this.pathname = rest; }
+  if (slashedProtocol[lowerProto] &&
+      this.hostname && !this.pathname) {
+    this.pathname = '';
+  }
+
+  return this;
+};
+
+Url.prototype.parseHost = function(host) {
+  var port = portPattern.exec(host);
+  if (port) {
+    port = port[0];
+    if (port !== ':') {
+      this.port = port.substr(1);
+    }
+    host = host.substr(0, host.length - port.length);
+  }
+  if (host) { this.hostname = host; }
+};
+
+module.exports = urlParse;
+
+},{}],60:[function(require,module,exports){
+(function (global){
+/*! https://mths.be/punycode v1.4.1 by @mathias */
+;(function(root) {
+
+	/** Detect free variables */
+	var freeExports = typeof exports == 'object' && exports &&
+		!exports.nodeType && exports;
+	var freeModule = typeof module == 'object' && module &&
+		!module.nodeType && module;
+	var freeGlobal = typeof global == 'object' && global;
+	if (
+		freeGlobal.global === freeGlobal ||
+		freeGlobal.window === freeGlobal ||
+		freeGlobal.self === freeGlobal
+	) {
+		root = freeGlobal;
+	}
+
+	/**
+	 * The `punycode` object.
+	 * @name punycode
+	 * @type Object
+	 */
+	var punycode,
+
+	/** Highest positive signed 32-bit float value */
+	maxInt = 2147483647, // aka. 0x7FFFFFFF or 2^31-1
+
+	/** Bootstring parameters */
+	base = 36,
+	tMin = 1,
+	tMax = 26,
+	skew = 38,
+	damp = 700,
+	initialBias = 72,
+	initialN = 128, // 0x80
+	delimiter = '-', // '\x2D'
+
+	/** Regular expressions */
+	regexPunycode = /^xn--/,
+	regexNonASCII = /[^\x20-\x7E]/, // unprintable ASCII chars + non-ASCII chars
+	regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g, // RFC 3490 separators
+
+	/** Error messages */
+	errors = {
+		'overflow': 'Overflow: input needs wider integers to process',
+		'not-basic': 'Illegal input >= 0x80 (not a basic code point)',
+		'invalid-input': 'Invalid input'
+	},
+
+	/** Convenience shortcuts */
+	baseMinusTMin = base - tMin,
+	floor = Math.floor,
+	stringFromCharCode = String.fromCharCode,
+
+	/** Temporary variable */
+	key;
+
+	/*--------------------------------------------------------------------------*/
+
+	/**
+	 * A generic error utility function.
+	 * @private
+	 * @param {String} type The error type.
+	 * @returns {Error} Throws a `RangeError` with the applicable error message.
+	 */
+	function error(type) {
+		throw new RangeError(errors[type]);
+	}
+
+	/**
+	 * A generic `Array#map` utility function.
+	 * @private
+	 * @param {Array} array The array to iterate over.
+	 * @param {Function} callback The function that gets called for every array
+	 * item.
+	 * @returns {Array} A new array of values returned by the callback function.
+	 */
+	function map(array, fn) {
+		var length = array.length;
+		var result = [];
+		while (length--) {
+			result[length] = fn(array[length]);
+		}
+		return result;
+	}
+
+	/**
+	 * A simple `Array#map`-like wrapper to work with domain name strings or email
+	 * addresses.
+	 * @private
+	 * @param {String} domain The domain name or email address.
+	 * @param {Function} callback The function that gets called for every
+	 * character.
+	 * @returns {Array} A new string of characters returned by the callback
+	 * function.
+	 */
+	function mapDomain(string, fn) {
+		var parts = string.split('@');
+		var result = '';
+		if (parts.length > 1) {
+			// In email addresses, only the domain name should be punycoded. Leave
+			// the local part (i.e. everything up to `@`) intact.
+			result = parts[0] + '@';
+			string = parts[1];
+		}
+		// Avoid `split(regex)` for IE8 compatibility. See #17.
+		string = string.replace(regexSeparators, '\x2E');
+		var labels = string.split('.');
+		var encoded = map(labels, fn).join('.');
+		return result + encoded;
+	}
+
+	/**
+	 * Creates an array containing the numeric code points of each Unicode
+	 * character in the string. While JavaScript uses UCS-2 internally,
+	 * this function will convert a pair of surrogate halves (each of which
+	 * UCS-2 exposes as separate characters) into a single code point,
+	 * matching UTF-16.
+	 * @see `punycode.ucs2.encode`
+	 * @see <https://mathiasbynens.be/notes/javascript-encoding>
+	 * @memberOf punycode.ucs2
+	 * @name decode
+	 * @param {String} string The Unicode input string (UCS-2).
+	 * @returns {Array} The new array of code points.
+	 */
+	function ucs2decode(string) {
+		var output = [],
+		    counter = 0,
+		    length = string.length,
+		    value,
+		    extra;
+		while (counter < length) {
+			value = string.charCodeAt(counter++);
+			if (value >= 0xD800 && value <= 0xDBFF && counter < length) {
+				// high surrogate, and there is a next character
+				extra = string.charCodeAt(counter++);
+				if ((extra & 0xFC00) == 0xDC00) { // low surrogate
+					output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000);
+				} else {
+					// unmatched surrogate; only append this code unit, in case the next
+					// code unit is the high surrogate of a surrogate pair
+					output.push(value);
+					counter--;
+				}
+			} else {
+				output.push(value);
+			}
+		}
+		return output;
+	}
+
+	/**
+	 * Creates a string based on an array of numeric code points.
+	 * @see `punycode.ucs2.decode`
+	 * @memberOf punycode.ucs2
+	 * @name encode
+	 * @param {Array} codePoints The array of numeric code points.
+	 * @returns {String} The new Unicode string (UCS-2).
+	 */
+	function ucs2encode(array) {
+		return map(array, function(value) {
+			var output = '';
+			if (value > 0xFFFF) {
+				value -= 0x10000;
+				output += stringFromCharCode(value >>> 10 & 0x3FF | 0xD800);
+				value = 0xDC00 | value & 0x3FF;
+			}
+			output += stringFromCharCode(value);
+			return output;
+		}).join('');
+	}
+
+	/**
+	 * Converts a basic code point into a digit/integer.
+	 * @see `digitToBasic()`
+	 * @private
+	 * @param {Number} codePoint The basic numeric code point value.
+	 * @returns {Number} The numeric value of a basic code point (for use in
+	 * representing integers) in the range `0` to `base - 1`, or `base` if
+	 * the code point does not represent a value.
+	 */
+	function basicToDigit(codePoint) {
+		if (codePoint - 48 < 10) {
+			return codePoint - 22;
+		}
+		if (codePoint - 65 < 26) {
+			return codePoint - 65;
+		}
+		if (codePoint - 97 < 26) {
+			return codePoint - 97;
+		}
+		return base;
+	}
+
+	/**
+	 * Converts a digit/integer into a basic code point.
+	 * @see `basicToDigit()`
+	 * @private
+	 * @param {Number} digit The numeric value of a basic code point.
+	 * @returns {Number} The basic code point whose value (when used for
+	 * representing integers) is `digit`, which needs to be in the range
+	 * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is
+	 * used; else, the lowercase form is used. The behavior is undefined
+	 * if `flag` is non-zero and `digit` has no uppercase form.
+	 */
+	function digitToBasic(digit, flag) {
+		//  0..25 map to ASCII a..z or A..Z
+		// 26..35 map to ASCII 0..9
+		return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5);
+	}
+
+	/**
+	 * Bias adaptation function as per section 3.4 of RFC 3492.
+	 * https://tools.ietf.org/html/rfc3492#section-3.4
+	 * @private
+	 */
+	function adapt(delta, numPoints, firstTime) {
+		var k = 0;
+		delta = firstTime ? floor(delta / damp) : delta >> 1;
+		delta += floor(delta / numPoints);
+		for (/* no initialization */; delta > baseMinusTMin * tMax >> 1; k += base) {
+			delta = floor(delta / baseMinusTMin);
+		}
+		return floor(k + (baseMinusTMin + 1) * delta / (delta + skew));
+	}
+
+	/**
+	 * Converts a Punycode string of ASCII-only symbols to a string of Unicode
+	 * symbols.
+	 * @memberOf punycode
+	 * @param {String} input The Punycode string of ASCII-only symbols.
+	 * @returns {String} The resulting string of Unicode symbols.
+	 */
+	function decode(input) {
+		// Don't use UCS-2
+		var output = [],
+		    inputLength = input.length,
+		    out,
+		    i = 0,
+		    n = initialN,
+		    bias = initialBias,
+		    basic,
+		    j,
+		    index,
+		    oldi,
+		    w,
+		    k,
+		    digit,
+		    t,
+		    /** Cached calculation results */
+		    baseMinusT;
+
+		// Handle the basic code points: let `basic` be the number of input code
+		// points before the last delimiter, or `0` if there is none, then copy
+		// the first basic code points to the output.
+
+		basic = input.lastIndexOf(delimiter);
+		if (basic < 0) {
+			basic = 0;
+		}
+
+		for (j = 0; j < basic; ++j) {
+			// if it's not a basic code point
+			if (input.charCodeAt(j) >= 0x80) {
+				error('not-basic');
+			}
+			output.push(input.charCodeAt(j));
+		}
+
+		// Main decoding loop: start just after the last delimiter if any basic code
+		// points were copied; start at the beginning otherwise.
+
+		for (index = basic > 0 ? basic + 1 : 0; index < inputLength; /* no final expression */) {
+
+			// `index` is the index of the next character to be consumed.
+			// Decode a generalized variable-length integer into `delta`,
+			// which gets added to `i`. The overflow checking is easier
+			// if we increase `i` as we go, then subtract off its starting
+			// value at the end to obtain `delta`.
+			for (oldi = i, w = 1, k = base; /* no condition */; k += base) {
+
+				if (index >= inputLength) {
+					error('invalid-input');
+				}
+
+				digit = basicToDigit(input.charCodeAt(index++));
+
+				if (digit >= base || digit > floor((maxInt - i) / w)) {
+					error('overflow');
+				}
+
+				i += digit * w;
+				t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias);
+
+				if (digit < t) {
+					break;
+				}
+
+				baseMinusT = base - t;
+				if (w > floor(maxInt / baseMinusT)) {
+					error('overflow');
+				}
+
+				w *= baseMinusT;
+
+			}
+
+			out = output.length + 1;
+			bias = adapt(i - oldi, out, oldi == 0);
+
+			// `i` was supposed to wrap around from `out` to `0`,
+			// incrementing `n` each time, so we'll fix that now:
+			if (floor(i / out) > maxInt - n) {
+				error('overflow');
+			}
+
+			n += floor(i / out);
+			i %= out;
+
+			// Insert `n` at position `i` of the output
+			output.splice(i++, 0, n);
+
+		}
+
+		return ucs2encode(output);
+	}
+
+	/**
+	 * Converts a string of Unicode symbols (e.g. a domain name label) to a
+	 * Punycode string of ASCII-only symbols.
+	 * @memberOf punycode
+	 * @param {String} input The string of Unicode symbols.
+	 * @returns {String} The resulting Punycode string of ASCII-only symbols.
+	 */
+	function encode(input) {
+		var n,
+		    delta,
+		    handledCPCount,
+		    basicLength,
+		    bias,
+		    j,
+		    m,
+		    q,
+		    k,
+		    t,
+		    currentValue,
+		    output = [],
+		    /** `inputLength` will hold the number of code points in `input`. */
+		    inputLength,
+		    /** Cached calculation results */
+		    handledCPCountPlusOne,
+		    baseMinusT,
+		    qMinusT;
+
+		// Convert the input in UCS-2 to Unicode
+		input = ucs2decode(input);
+
+		// Cache the length
+		inputLength = input.length;
+
+		// Initialize the state
+		n = initialN;
+		delta = 0;
+		bias = initialBias;
+
+		// Handle the basic code points
+		for (j = 0; j < inputLength; ++j) {
+			currentValue = input[j];
+			if (currentValue < 0x80) {
+				output.push(stringFromCharCode(currentValue));
+			}
+		}
+
+		handledCPCount = basicLength = output.length;
+
+		// `handledCPCount` is the number of code points that have been handled;
+		// `basicLength` is the number of basic code points.
+
+		// Finish the basic string - if it is not empty - with a delimiter
+		if (basicLength) {
+			output.push(delimiter);
+		}
+
+		// Main encoding loop:
+		while (handledCPCount < inputLength) {
+
+			// All non-basic code points < n have been handled already. Find the next
+			// larger one:
+			for (m = maxInt, j = 0; j < inputLength; ++j) {
+				currentValue = input[j];
+				if (currentValue >= n && currentValue < m) {
+					m = currentValue;
+				}
+			}
+
+			// Increase `delta` enough to advance the decoder's <n,i> state to <m,0>,
+			// but guard against overflow
+			handledCPCountPlusOne = handledCPCount + 1;
+			if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) {
+				error('overflow');
+			}
+
+			delta += (m - n) * handledCPCountPlusOne;
+			n = m;
+
+			for (j = 0; j < inputLength; ++j) {
+				currentValue = input[j];
+
+				if (currentValue < n && ++delta > maxInt) {
+					error('overflow');
+				}
+
+				if (currentValue == n) {
+					// Represent delta as a generalized variable-length integer
+					for (q = delta, k = base; /* no condition */; k += base) {
+						t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias);
+						if (q < t) {
+							break;
+						}
+						qMinusT = q - t;
+						baseMinusT = base - t;
+						output.push(
+							stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))
+						);
+						q = floor(qMinusT / baseMinusT);
+					}
+
+					output.push(stringFromCharCode(digitToBasic(q, 0)));
+					bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength);
+					delta = 0;
+					++handledCPCount;
+				}
+			}
+
+			++delta;
+			++n;
+
+		}
+		return output.join('');
+	}
+
+	/**
+	 * Converts a Punycode string representing a domain name or an email address
+	 * to Unicode. Only the Punycoded parts of the input will be converted, i.e.
+	 * it doesn't matter if you call it on a string that has already been
+	 * converted to Unicode.
+	 * @memberOf punycode
+	 * @param {String} input The Punycoded domain name or email address to
+	 * convert to Unicode.
+	 * @returns {String} The Unicode representation of the given Punycode
+	 * string.
+	 */
+	function toUnicode(input) {
+		return mapDomain(input, function(string) {
+			return regexPunycode.test(string)
+				? decode(string.slice(4).toLowerCase())
+				: string;
+		});
+	}
+
+	/**
+	 * Converts a Unicode string representing a domain name or an email address to
+	 * Punycode. Only the non-ASCII parts of the domain name will be converted,
+	 * i.e. it doesn't matter if you call it with a domain that's already in
+	 * ASCII.
+	 * @memberOf punycode
+	 * @param {String} input The domain name or email address to convert, as a
+	 * Unicode string.
+	 * @returns {String} The Punycode representation of the given domain name or
+	 * email address.
+	 */
+	function toASCII(input) {
+		return mapDomain(input, function(string) {
+			return regexNonASCII.test(string)
+				? 'xn--' + encode(string)
+				: string;
+		});
+	}
+
+	/*--------------------------------------------------------------------------*/
+
+	/** Define the public API */
+	punycode = {
+		/**
+		 * A string representing the current Punycode.js version number.
+		 * @memberOf punycode
+		 * @type String
+		 */
+		'version': '1.4.1',
+		/**
+		 * An object of methods to convert from JavaScript's internal character
+		 * representation (UCS-2) to Unicode code points, and back.
+		 * @see <https://mathiasbynens.be/notes/javascript-encoding>
+		 * @memberOf punycode
+		 * @type Object
+		 */
+		'ucs2': {
+			'decode': ucs2decode,
+			'encode': ucs2encode
+		},
+		'decode': decode,
+		'encode': encode,
+		'toASCII': toASCII,
+		'toUnicode': toUnicode
+	};
+
+	/** Expose `punycode` */
+	// Some AMD build optimizers, like r.js, check for specific condition patterns
+	// like the following:
+	if (
+		typeof define == 'function' &&
+		typeof define.amd == 'object' &&
+		define.amd
+	) {
+		define('punycode', function() {
+			return punycode;
+		});
+	} else if (freeExports && freeModule) {
+		if (module.exports == freeExports) {
+			// in Node.js, io.js, or RingoJS v0.8.0+
+			freeModule.exports = punycode;
+		} else {
+			// in Narwhal or RingoJS v0.7.0-
+			for (key in punycode) {
+				punycode.hasOwnProperty(key) && (freeExports[key] = punycode[key]);
+			}
+		}
+	} else {
+		// in Rhino or a web browser
+		root.punycode = punycode;
+	}
+
+}(this));
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{}],61:[function(require,module,exports){
+module.exports=/[\0-\x1F\x7F-\x9F]/
+},{}],62:[function(require,module,exports){
+module.exports=/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804\uDCBD|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/
+},{}],63:[function(require,module,exports){
+module.exports=/[!-#%-\*,-/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0AF0\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E49\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC9\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/
+},{}],64:[function(require,module,exports){
+module.exports=/[ \xA0\u1680\u2000-\u200A\u202F\u205F\u3000]/
+},{}],65:[function(require,module,exports){
+'use strict';
+
+exports.Any = require('./properties/Any/regex');
+exports.Cc  = require('./categories/Cc/regex');
+exports.Cf  = require('./categories/Cf/regex');
+exports.P   = require('./categories/P/regex');
+exports.Z   = require('./categories/Z/regex');
+
+},{"./categories/Cc/regex":61,"./categories/Cf/regex":62,"./categories/P/regex":63,"./categories/Z/regex":64,"./properties/Any/regex":66}],66:[function(require,module,exports){
+module.exports=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/
+},{}],67:[function(require,module,exports){
+'use strict';
+
+
+module.exports = require('./lib/');
+
+},{"./lib/":9}]},{},[67])(67)
+});
diff --git a/node_modules/markdown-it/dist/markdown-it.min.js b/node_modules/markdown-it/dist/markdown-it.min.js
new file mode 100644
index 00000000..08b7562c
--- /dev/null
+++ b/node_modules/markdown-it/dist/markdown-it.min.js
@@ -0,0 +1 @@
+!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{("undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this).markdownit=e()}}(function(){return function o(i,a,c){function l(t,e){if(!a[t]){if(!i[t]){var r="function"==typeof require&&require;if(!e&&r)return r(t,!0);if(u)return u(t,!0);var n=new Error("Cannot find module '"+t+"'");throw n.code="MODULE_NOT_FOUND",n}var s=a[t]={exports:{}};i[t][0].call(s.exports,function(e){var r=i[t][1][e];return l(r||e)},s,s.exports,o,i,a,c)}return a[t].exports}for(var u="function"==typeof require&&require,e=0;e<c.length;e++)l(c[e]);return l}({1:[function(e,r,t){"use strict";r.exports=e("entities/maps/entities.json")},{"entities/maps/entities.json":52}],2:[function(e,r,t){"use strict";r.exports=["address","article","aside","base","basefont","blockquote","body","caption","center","col","colgroup","dd","details","dialog","dir","div","dl","dt","fieldset","figcaption","figure","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hr","html","iframe","legend","li","link","main","menu","menuitem","meta","nav","noframes","ol","optgroup","option","p","param","section","source","summary","table","tbody","td","tfoot","th","thead","title","tr","track","ul"]},{}],3:[function(e,r,t){"use strict";var n="<[A-Za-z][A-Za-z0-9\\-]*(?:\\s+[a-zA-Z_:][a-zA-Z0-9:._-]*(?:\\s*=\\s*(?:[^\"'=<>`\\x00-\\x20]+|'[^']*'|\"[^\"]*\"))?)*\\s*\\/?>",s="<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>",o=new RegExp("^(?:"+n+"|"+s+"|\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e|<[?].*?[?]>|<![A-Z]+\\s+[^>]*>|<!\\[CDATA\\[[\\s\\S]*?\\]\\]>)"),i=new RegExp("^(?:"+n+"|"+s+")");r.exports.HTML_TAG_RE=o,r.exports.HTML_OPEN_CLOSE_TAG_RE=i},{}],4:[function(e,r,t){"use strict";var n=Object.prototype.hasOwnProperty;function i(e,r){return n.call(e,r)}function a(e){return!(55296<=e&&e<=57343)&&(!(64976<=e&&e<=65007)&&(65535!=(65535&e)&&65534!=(65535&e)&&(!(0<=e&&e<=8)&&(11!==e&&(!(14<=e&&e<=31)&&(!(127<=e&&e<=159)&&!(1114111<e)))))))}function c(e){if(65535<e){var r=55296+((e-=65536)>>10),t=56320+(1023&e);return String.fromCharCode(r,t)}return String.fromCharCode(e)}var s=/\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g,o=new RegExp(s.source+"|"+/&([a-z#][a-z0-9]{1,31});/gi.source,"gi"),l=/^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i,u=e("./entities");var p=/[&<>"]/,h=/[&<>"]/g,f={"&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;"};function d(e){return f[e]}var m=/[.?*+^$[\]\\(){}|-]/g;var _=e("uc.micro/categories/P/regex");t.lib={},t.lib.mdurl=e("mdurl"),t.lib.ucmicro=e("uc.micro"),t.assign=function(t){return Array.prototype.slice.call(arguments,1).forEach(function(r){if(r){if("object"!=typeof r)throw new TypeError(r+"must be object");Object.keys(r).forEach(function(e){t[e]=r[e]})}}),t},t.isString=function(e){return"[object String]"===(r=e,Object.prototype.toString.call(r));var r},t.has=i,t.unescapeMd=function(e){return e.indexOf("\\")<0?e:e.replace(s,"$1")},t.unescapeAll=function(e){return e.indexOf("\\")<0&&e.indexOf("&")<0?e:e.replace(o,function(e,r,t){return r||(n=e,o=0,i(u,s=t)?u[s]:35===s.charCodeAt(0)&&l.test(s)&&a(o="x"===s[1].toLowerCase()?parseInt(s.slice(2),16):parseInt(s.slice(1),10))?c(o):n);var n,s,o})},t.isValidEntityCode=a,t.fromCodePoint=c,t.escapeHtml=function(e){return p.test(e)?e.replace(h,d):e},t.arrayReplaceAt=function(e,r,t){return[].concat(e.slice(0,r),t,e.slice(r+1))},t.isSpace=function(e){switch(e){case 9:case 32:return!0}return!1},t.isWhiteSpace=function(e){if(8192<=e&&e<=8202)return!0;switch(e){case 9:case 10:case 11:case 12:case 13:case 32:case 160:case 5760:case 8239:case 8287:case 12288:return!0}return!1},t.isMdAsciiPunct=function(e){switch(e){case 33:case 34:case 35:case 36:case 37:case 38:case 39:case 40:case 41:case 42:case 43:case 44:case 45:case 46:case 47:case 58:case 59:case 60:case 61:case 62:case 63:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 124:case 125:case 126:return!0;default:return!1}},t.isPunctChar=function(e){return _.test(e)},t.escapeRE=function(e){return e.replace(m,"\\$&")},t.normalizeReference=function(e){return e.trim().replace(/\s+/g," ").toUpperCase()}},{"./entities":1,mdurl:58,"uc.micro":65,"uc.micro/categories/P/regex":63}],5:[function(e,r,t){"use strict";t.parseLinkLabel=e("./parse_link_label"),t.parseLinkDestination=e("./parse_link_destination"),t.parseLinkTitle=e("./parse_link_title")},{"./parse_link_destination":6,"./parse_link_label":7,"./parse_link_title":8}],6:[function(e,r,t){"use strict";var a=e("../common/utils").isSpace,c=e("../common/utils").unescapeAll;r.exports=function(e,r,t){var n,s,o=r,i={ok:!1,pos:0,lines:0,str:""};if(60===e.charCodeAt(r)){for(r++;r<t;){if(10===(n=e.charCodeAt(r))||a(n))return i;if(62===n)return i.pos=r+1,i.str=c(e.slice(o+1,r)),i.ok=!0,i;92===n&&r+1<t?r+=2:r++}return i}for(s=0;r<t&&32!==(n=e.charCodeAt(r))&&!(n<32||127===n);)if(92===n&&r+1<t)r+=2;else{if(40===n&&s++,41===n){if(0===s)break;s--}r++}return o===r||0!==s||(i.str=c(e.slice(o,r)),i.lines=0,i.pos=r,i.ok=!0),i}},{"../common/utils":4}],7:[function(e,r,t){"use strict";r.exports=function(e,r,t){var n,s,o,i,a=-1,c=e.posMax,l=e.pos;for(e.pos=r+1,n=1;e.pos<c;){if(93===(o=e.src.charCodeAt(e.pos))&&0===--n){s=!0;break}if(i=e.pos,e.md.inline.skipToken(e),91===o)if(i===e.pos-1)n++;else if(t)return e.pos=l,-1}return s&&(a=e.pos),e.pos=l,a}},{}],8:[function(e,r,t){"use strict";var c=e("../common/utils").unescapeAll;r.exports=function(e,r,t){var n,s,o=0,i=r,a={ok:!1,pos:0,lines:0,str:""};if(t<=r)return a;if(34!==(s=e.charCodeAt(r))&&39!==s&&40!==s)return a;for(r++,40===s&&(s=41);r<t;){if((n=e.charCodeAt(r))===s)return a.pos=r+1,a.lines=o,a.str=c(e.slice(i+1,r)),a.ok=!0,a;10===n?o++:92===n&&r+1<t&&(r++,10===e.charCodeAt(r)&&o++),r++}return a}},{"../common/utils":4}],9:[function(e,r,t){"use strict";var n=e("./common/utils"),s=e("./helpers"),o=e("./renderer"),i=e("./parser_core"),a=e("./parser_block"),c=e("./parser_inline"),l=e("linkify-it"),u=e("mdurl"),p=e("punycode"),h={default:e("./presets/default"),zero:e("./presets/zero"),commonmark:e("./presets/commonmark")},f=/^(vbscript|javascript|file|data):/,d=/^data:image\/(gif|png|jpeg|webp);/;function m(e){var r=e.trim().toLowerCase();return!f.test(r)||!!d.test(r)}var _=["http:","https:","mailto:"];function g(e){var r=u.parse(e,!0);if(r.hostname&&(!r.protocol||0<=_.indexOf(r.protocol)))try{r.hostname=p.toASCII(r.hostname)}catch(e){}return u.encode(u.format(r))}function b(e){var r=u.parse(e,!0);if(r.hostname&&(!r.protocol||0<=_.indexOf(r.protocol)))try{r.hostname=p.toUnicode(r.hostname)}catch(e){}return u.decode(u.format(r))}function k(e,r){if(!(this instanceof k))return new k(e,r);r||n.isString(e)||(r=e||{},e="default"),this.inline=new c,this.block=new a,this.core=new i,this.renderer=new o,this.linkify=new l,this.validateLink=m,this.normalizeLink=g,this.normalizeLinkText=b,this.utils=n,this.helpers=n.assign({},s),this.options={},this.configure(e),r&&this.set(r)}k.prototype.set=function(e){return n.assign(this.options,e),this},k.prototype.configure=function(r){var e,t=this;if(n.isString(r)&&!(r=h[e=r]))throw new Error('Wrong `markdown-it` preset "'+e+'", check name');if(!r)throw new Error("Wrong `markdown-it` preset, can't be empty");return r.options&&t.set(r.options),r.components&&Object.keys(r.components).forEach(function(e){r.components[e].rules&&t[e].ruler.enableOnly(r.components[e].rules),r.components[e].rules2&&t[e].ruler2.enableOnly(r.components[e].rules2)}),this},k.prototype.enable=function(r,e){var t=[];Array.isArray(r)||(r=[r]),["core","block","inline"].forEach(function(e){t=t.concat(this[e].ruler.enable(r,!0))},this),t=t.concat(this.inline.ruler2.enable(r,!0));var n=r.filter(function(e){return t.indexOf(e)<0});if(n.length&&!e)throw new Error("MarkdownIt. Failed to enable unknown rule(s): "+n);return this},k.prototype.disable=function(r,e){var t=[];Array.isArray(r)||(r=[r]),["core","block","inline"].forEach(function(e){t=t.concat(this[e].ruler.disable(r,!0))},this),t=t.concat(this.inline.ruler2.disable(r,!0));var n=r.filter(function(e){return t.indexOf(e)<0});if(n.length&&!e)throw new Error("MarkdownIt. Failed to disable unknown rule(s): "+n);return this},k.prototype.use=function(e){var r=[this].concat(Array.prototype.slice.call(arguments,1));return e.apply(e,r),this},k.prototype.parse=function(e,r){if("string"!=typeof e)throw new Error("Input data should be a String");var t=new this.core.State(e,this,r);return this.core.process(t),t.tokens},k.prototype.render=function(e,r){return r=r||{},this.renderer.render(this.parse(e,r),this.options,r)},k.prototype.parseInline=function(e,r){var t=new this.core.State(e,this,r);return t.inlineMode=!0,this.core.process(t),t.tokens},k.prototype.renderInline=function(e,r){return r=r||{},this.renderer.render(this.parseInline(e,r),this.options,r)},r.exports=k},{"./common/utils":4,"./helpers":5,"./parser_block":10,"./parser_core":11,"./parser_inline":12,"./presets/commonmark":13,"./presets/default":14,"./presets/zero":15,"./renderer":16,"linkify-it":53,mdurl:58,punycode:60}],10:[function(e,r,t){"use strict";var n=e("./ruler"),s=[["table",e("./rules_block/table"),["paragraph","reference"]],["code",e("./rules_block/code")],["fence",e("./rules_block/fence"),["paragraph","reference","blockquote","list"]],["blockquote",e("./rules_block/blockquote"),["paragraph","reference","blockquote","list"]],["hr",e("./rules_block/hr"),["paragraph","reference","blockquote","list"]],["list",e("./rules_block/list"),["paragraph","reference","blockquote"]],["reference",e("./rules_block/reference")],["heading",e("./rules_block/heading"),["paragraph","reference","blockquote"]],["lheading",e("./rules_block/lheading")],["html_block",e("./rules_block/html_block"),["paragraph","reference","blockquote"]],["paragraph",e("./rules_block/paragraph")]];function o(){this.ruler=new n;for(var e=0;e<s.length;e++)this.ruler.push(s[e][0],s[e][1],{alt:(s[e][2]||[]).slice()})}o.prototype.tokenize=function(e,r,t){for(var n,s=this.ruler.getRules(""),o=s.length,i=r,a=!1,c=e.md.options.maxNesting;i<t&&(e.line=i=e.skipEmptyLines(i),!(t<=i))&&!(e.sCount[i]<e.blkIndent);){if(e.level>=c){e.line=t;break}for(n=0;n<o&&!s[n](e,i,t,!1);n++);e.tight=!a,e.isEmpty(e.line-1)&&(a=!0),(i=e.line)<t&&e.isEmpty(i)&&(a=!0,i++,e.line=i)}},o.prototype.parse=function(e,r,t,n){var s;e&&(s=new this.State(e,r,t,n),this.tokenize(s,s.line,s.lineMax))},o.prototype.State=e("./rules_block/state_block"),r.exports=o},{"./ruler":17,"./rules_block/blockquote":18,"./rules_block/code":19,"./rules_block/fence":20,"./rules_block/heading":21,"./rules_block/hr":22,"./rules_block/html_block":23,"./rules_block/lheading":24,"./rules_block/list":25,"./rules_block/paragraph":26,"./rules_block/reference":27,"./rules_block/state_block":28,"./rules_block/table":29}],11:[function(e,r,t){"use strict";var n=e("./ruler"),s=[["normalize",e("./rules_core/normalize")],["block",e("./rules_core/block")],["inline",e("./rules_core/inline")],["linkify",e("./rules_core/linkify")],["replacements",e("./rules_core/replacements")],["smartquotes",e("./rules_core/smartquotes")]];function o(){this.ruler=new n;for(var e=0;e<s.length;e++)this.ruler.push(s[e][0],s[e][1])}o.prototype.process=function(e){var r,t,n;for(r=0,t=(n=this.ruler.getRules("")).length;r<t;r++)n[r](e)},o.prototype.State=e("./rules_core/state_core"),r.exports=o},{"./ruler":17,"./rules_core/block":30,"./rules_core/inline":31,"./rules_core/linkify":32,"./rules_core/normalize":33,"./rules_core/replacements":34,"./rules_core/smartquotes":35,"./rules_core/state_core":36}],12:[function(e,r,t){"use strict";var n=e("./ruler"),s=[["text",e("./rules_inline/text")],["newline",e("./rules_inline/newline")],["escape",e("./rules_inline/escape")],["backticks",e("./rules_inline/backticks")],["strikethrough",e("./rules_inline/strikethrough").tokenize],["emphasis",e("./rules_inline/emphasis").tokenize],["link",e("./rules_inline/link")],["image",e("./rules_inline/image")],["autolink",e("./rules_inline/autolink")],["html_inline",e("./rules_inline/html_inline")],["entity",e("./rules_inline/entity")]],o=[["balance_pairs",e("./rules_inline/balance_pairs")],["strikethrough",e("./rules_inline/strikethrough").postProcess],["emphasis",e("./rules_inline/emphasis").postProcess],["text_collapse",e("./rules_inline/text_collapse")]];function i(){var e;for(this.ruler=new n,e=0;e<s.length;e++)this.ruler.push(s[e][0],s[e][1]);for(this.ruler2=new n,e=0;e<o.length;e++)this.ruler2.push(o[e][0],o[e][1])}i.prototype.skipToken=function(e){var r,t,n=e.pos,s=this.ruler.getRules(""),o=s.length,i=e.md.options.maxNesting,a=e.cache;if(void 0===a[n]){if(e.level<i)for(t=0;t<o&&(e.level++,r=s[t](e,!0),e.level--,!r);t++);else e.pos=e.posMax;r||e.pos++,a[n]=e.pos}else e.pos=a[n]},i.prototype.tokenize=function(e){for(var r,t,n=this.ruler.getRules(""),s=n.length,o=e.posMax,i=e.md.options.maxNesting;e.pos<o;){if(e.level<i)for(t=0;t<s&&!(r=n[t](e,!1));t++);if(r){if(e.pos>=o)break}else e.pending+=e.src[e.pos++]}e.pending&&e.pushPending()},i.prototype.parse=function(e,r,t,n){var s,o,i,a=new this.State(e,r,t,n);for(this.tokenize(a),i=(o=this.ruler2.getRules("")).length,s=0;s<i;s++)o[s](a)},i.prototype.State=e("./rules_inline/state_inline"),r.exports=i},{"./ruler":17,"./rules_inline/autolink":37,"./rules_inline/backticks":38,"./rules_inline/balance_pairs":39,"./rules_inline/emphasis":40,"./rules_inline/entity":41,"./rules_inline/escape":42,"./rules_inline/html_inline":43,"./rules_inline/image":44,"./rules_inline/link":45,"./rules_inline/newline":46,"./rules_inline/state_inline":47,"./rules_inline/strikethrough":48,"./rules_inline/text":49,"./rules_inline/text_collapse":50}],13:[function(e,r,t){"use strict";r.exports={options:{html:!0,xhtmlOut:!0,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["blockquote","code","fence","heading","hr","html_block","lheading","list","reference","paragraph"]},inline:{rules:["autolink","backticks","emphasis","entity","escape","html_inline","image","link","newline","text"],rules2:["balance_pairs","emphasis","text_collapse"]}}}},{}],14:[function(e,r,t){"use strict";r.exports={options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:100},components:{core:{},block:{},inline:{}}}},{}],15:[function(e,r,t){"use strict";r.exports={options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["paragraph"]},inline:{rules:["text"],rules2:["balance_pairs","text_collapse"]}}}},{}],16:[function(e,r,t){"use strict";var n=e("./common/utils").assign,h=e("./common/utils").unescapeAll,f=e("./common/utils").escapeHtml,s={};function o(){this.rules=n({},s)}s.code_inline=function(e,r,t,n,s){var o=e[r];return"<code"+s.renderAttrs(o)+">"+f(e[r].content)+"</code>"},s.code_block=function(e,r,t,n,s){var o=e[r];return"<pre"+s.renderAttrs(o)+"><code>"+f(e[r].content)+"</code></pre>\n"},s.fence=function(e,r,t,n,s){var o,i,a,c,l=e[r],u=l.info?h(l.info).trim():"",p="";return u&&(p=u.split(/\s+/g)[0]),0===(o=t.highlight&&t.highlight(l.content,p)||f(l.content)).indexOf("<pre")?o+"\n":u?(i=l.attrIndex("class"),a=l.attrs?l.attrs.slice():[],i<0?a.push(["class",t.langPrefix+p]):a[i][1]+=" "+t.langPrefix+p,c={attrs:a},"<pre><code"+s.renderAttrs(c)+">"+o+"</code></pre>\n"):"<pre><code"+s.renderAttrs(l)+">"+o+"</code></pre>\n"},s.image=function(e,r,t,n,s){var o=e[r];return o.attrs[o.attrIndex("alt")][1]=s.renderInlineAsText(o.children,t,n),s.renderToken(e,r,t)},s.hardbreak=function(e,r,t){return t.xhtmlOut?"<br />\n":"<br>\n"},s.softbreak=function(e,r,t){return t.breaks?t.xhtmlOut?"<br />\n":"<br>\n":"\n"},s.text=function(e,r){return f(e[r].content)},s.html_block=function(e,r){return e[r].content},s.html_inline=function(e,r){return e[r].content},o.prototype.renderAttrs=function(e){var r,t,n;if(!e.attrs)return"";for(n="",r=0,t=e.attrs.length;r<t;r++)n+=" "+f(e.attrs[r][0])+'="'+f(e.attrs[r][1])+'"';return n},o.prototype.renderToken=function(e,r,t){var n,s="",o=!1,i=e[r];return i.hidden?"":(i.block&&-1!==i.nesting&&r&&e[r-1].hidden&&(s+="\n"),s+=(-1===i.nesting?"</":"<")+i.tag,s+=this.renderAttrs(i),0===i.nesting&&t.xhtmlOut&&(s+=" /"),i.block&&(o=!0,1===i.nesting&&r+1<e.length&&("inline"===(n=e[r+1]).type||n.hidden?o=!1:-1===n.nesting&&n.tag===i.tag&&(o=!1))),s+=o?">\n":">")},o.prototype.renderInline=function(e,r,t){for(var n,s="",o=this.rules,i=0,a=e.length;i<a;i++)void 0!==o[n=e[i].type]?s+=o[n](e,i,r,t,this):s+=this.renderToken(e,i,r);return s},o.prototype.renderInlineAsText=function(e,r,t){for(var n="",s=0,o=e.length;s<o;s++)"text"===e[s].type?n+=e[s].content:"image"===e[s].type&&(n+=this.renderInlineAsText(e[s].children,r,t));return n},o.prototype.render=function(e,r,t){var n,s,o,i="",a=this.rules;for(n=0,s=e.length;n<s;n++)"inline"===(o=e[n].type)?i+=this.renderInline(e[n].children,r,t):void 0!==a[o]?i+=a[e[n].type](e,n,r,t,this):i+=this.renderToken(e,n,r,t);return i},r.exports=o},{"./common/utils":4}],17:[function(e,r,t){"use strict";function n(){this.__rules__=[],this.__cache__=null}n.prototype.__find__=function(e){for(var r=0;r<this.__rules__.length;r++)if(this.__rules__[r].name===e)return r;return-1},n.prototype.__compile__=function(){var t=this,r=[""];t.__rules__.forEach(function(e){e.enabled&&e.alt.forEach(function(e){r.indexOf(e)<0&&r.push(e)})}),t.__cache__={},r.forEach(function(r){t.__cache__[r]=[],t.__rules__.forEach(function(e){e.enabled&&(r&&e.alt.indexOf(r)<0||t.__cache__[r].push(e.fn))})})},n.prototype.at=function(e,r,t){var n=this.__find__(e),s=t||{};if(-1===n)throw new Error("Parser rule not found: "+e);this.__rules__[n].fn=r,this.__rules__[n].alt=s.alt||[],this.__cache__=null},n.prototype.before=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},n.prototype.after=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s+1,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},n.prototype.push=function(e,r,t){var n=t||{};this.__rules__.push({name:e,enabled:!0,fn:r,alt:n.alt||[]}),this.__cache__=null},n.prototype.enable=function(e,t){Array.isArray(e)||(e=[e]);var n=[];return e.forEach(function(e){var r=this.__find__(e);if(r<0){if(t)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[r].enabled=!0,n.push(e)},this),this.__cache__=null,n},n.prototype.enableOnly=function(e,r){Array.isArray(e)||(e=[e]),this.__rules__.forEach(function(e){e.enabled=!1}),this.enable(e,r)},n.prototype.disable=function(e,t){Array.isArray(e)||(e=[e]);var n=[];return e.forEach(function(e){var r=this.__find__(e);if(r<0){if(t)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[r].enabled=!1,n.push(e)},this),this.__cache__=null,n},n.prototype.getRules=function(e){return null===this.__cache__&&this.__compile__(),this.__cache__[e]||[]},r.exports=n},{}],18:[function(e,r,t){"use strict";var E=e("../common/utils").isSpace;r.exports=function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,_,g,b,k,v,x,y,C,A=e.lineMax,w=e.bMarks[r]+e.tShift[r],D=e.eMarks[r];if(4<=e.sCount[r]-e.blkIndent)return!1;if(62!==e.src.charCodeAt(w++))return!1;if(n)return!0;for(a=h=e.sCount[r]+w-(e.bMarks[r]+e.tShift[r]),32===e.src.charCodeAt(w)?(w++,a++,h++,k=!(s=!1)):9===e.src.charCodeAt(w)?(k=!0,(e.bsCount[r]+h)%4==3?(w++,a++,h++,s=!1):s=!0):k=!1,f=[e.bMarks[r]],e.bMarks[r]=w;w<D&&(o=e.src.charCodeAt(w),E(o));)9===o?h+=4-(h+e.bsCount[r]+(s?1:0))%4:h++,w++;for(d=[e.bsCount[r]],e.bsCount[r]=e.sCount[r]+1+(k?1:0),l=D<=w,g=[e.sCount[r]],e.sCount[r]=h-a,b=[e.tShift[r]],e.tShift[r]=w-e.bMarks[r],x=e.md.block.ruler.getRules("blockquote"),_=e.parentType,C=!(e.parentType="blockquote"),p=r+1;p<t&&(e.sCount[p]<e.blkIndent&&(C=!0),w=e.bMarks[p]+e.tShift[p],!((D=e.eMarks[p])<=w));p++)if(62!==e.src.charCodeAt(w++)||C){if(l)break;for(v=!1,i=0,c=x.length;i<c;i++)if(x[i](e,p,t,!0)){v=!0;break}if(v){e.lineMax=p,0!==e.blkIndent&&(f.push(e.bMarks[p]),d.push(e.bsCount[p]),b.push(e.tShift[p]),g.push(e.sCount[p]),e.sCount[p]-=e.blkIndent);break}f.push(e.bMarks[p]),d.push(e.bsCount[p]),b.push(e.tShift[p]),g.push(e.sCount[p]),e.sCount[p]=-1}else{for(a=h=e.sCount[p]+w-(e.bMarks[p]+e.tShift[p]),32===e.src.charCodeAt(w)?(w++,a++,h++,k=!(s=!1)):9===e.src.charCodeAt(w)?(k=!0,(e.bsCount[p]+h)%4==3?(w++,a++,h++,s=!1):s=!0):k=!1,f.push(e.bMarks[p]),e.bMarks[p]=w;w<D&&(o=e.src.charCodeAt(w),E(o));)9===o?h+=4-(h+e.bsCount[p]+(s?1:0))%4:h++,w++;l=D<=w,d.push(e.bsCount[p]),e.bsCount[p]=e.sCount[p]+1+(k?1:0),g.push(e.sCount[p]),e.sCount[p]=h-a,b.push(e.tShift[p]),e.tShift[p]=w-e.bMarks[p]}for(m=e.blkIndent,e.blkIndent=0,(y=e.push("blockquote_open","blockquote",1)).markup=">",y.map=u=[r,0],e.md.block.tokenize(e,r,p),(y=e.push("blockquote_close","blockquote",-1)).markup=">",e.lineMax=A,e.parentType=_,u[1]=e.line,i=0;i<b.length;i++)e.bMarks[i+r]=f[i],e.tShift[i+r]=b[i],e.sCount[i+r]=g[i],e.bsCount[i+r]=d[i];return e.blkIndent=m,!0}},{"../common/utils":4}],19:[function(e,r,t){"use strict";r.exports=function(e,r,t){var n,s,o;if(e.sCount[r]-e.blkIndent<4)return!1;for(s=n=r+1;n<t;)if(e.isEmpty(n))n++;else{if(!(4<=e.sCount[n]-e.blkIndent))break;s=++n}return e.line=s,(o=e.push("code_block","code",0)).content=e.getLines(r,s,4+e.blkIndent,!0),o.map=[r,e.line],!0}},{}],20:[function(e,r,t){"use strict";r.exports=function(e,r,t,n){var s,o,i,a,c,l,u,p=!1,h=e.bMarks[r]+e.tShift[r],f=e.eMarks[r];if(4<=e.sCount[r]-e.blkIndent)return!1;if(f<h+3)return!1;if(126!==(s=e.src.charCodeAt(h))&&96!==s)return!1;if(c=h,(o=(h=e.skipChars(h,s))-c)<3)return!1;if(u=e.src.slice(c,h),0<=(i=e.src.slice(h,f)).indexOf(String.fromCharCode(s)))return!1;if(n)return!0;for(a=r;!(t<=++a)&&!((h=c=e.bMarks[a]+e.tShift[a])<(f=e.eMarks[a])&&e.sCount[a]<e.blkIndent);)if(e.src.charCodeAt(h)===s&&!(4<=e.sCount[a]-e.blkIndent||(h=e.skipChars(h,s))-c<o||(h=e.skipSpaces(h))<f)){p=!0;break}return o=e.sCount[r],e.line=a+(p?1:0),(l=e.push("fence","code",0)).info=i,l.content=e.getLines(r+1,a,o,!0),l.markup=u,l.map=[r,e.line],!0}},{}],21:[function(e,r,t){"use strict";var u=e("../common/utils").isSpace;r.exports=function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(4<=e.sCount[r]-e.blkIndent)return!1;if(35!==(s=e.src.charCodeAt(c))||l<=c)return!1;for(o=1,s=e.src.charCodeAt(++c);35===s&&c<l&&o<=6;)o++,s=e.src.charCodeAt(++c);return!(6<o||c<l&&!u(s))&&(n||(l=e.skipSpacesBack(l,c),c<(i=e.skipCharsBack(l,35,c))&&u(e.src.charCodeAt(i-1))&&(l=i),e.line=r+1,(a=e.push("heading_open","h"+String(o),1)).markup="########".slice(0,o),a.map=[r,e.line],(a=e.push("inline","",0)).content=e.src.slice(c,l).trim(),a.map=[r,e.line],a.children=[],(a=e.push("heading_close","h"+String(o),-1)).markup="########".slice(0,o)),!0)}},{"../common/utils":4}],22:[function(e,r,t){"use strict";var u=e("../common/utils").isSpace;r.exports=function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(4<=e.sCount[r]-e.blkIndent)return!1;if(42!==(s=e.src.charCodeAt(c++))&&45!==s&&95!==s)return!1;for(o=1;c<l;){if((i=e.src.charCodeAt(c++))!==s&&!u(i))return!1;i===s&&o++}return!(o<3)&&(n||(e.line=r+1,(a=e.push("hr","hr",0)).map=[r,e.line],a.markup=Array(o+1).join(String.fromCharCode(s))),!0)}},{"../common/utils":4}],23:[function(e,r,t){"use strict";var n=e("../common/html_blocks"),s=e("../common/html_re").HTML_OPEN_CLOSE_TAG_RE,u=[[/^<(script|pre|style)(?=(\s|>|$))/i,/<\/(script|pre|style)>/i,!0],[/^<!--/,/-->/,!0],[/^<\?/,/\?>/,!0],[/^<![A-Z]/,/>/,!0],[/^<!\[CDATA\[/,/\]\]>/,!0],[new RegExp("^</?("+n.join("|")+")(?=(\\s|/?>|$))","i"),/^$/,!0],[new RegExp(s.source+"\\s*$"),/^$/,!1]];r.exports=function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(4<=e.sCount[r]-e.blkIndent)return!1;if(!e.md.options.html)return!1;if(60!==e.src.charCodeAt(c))return!1;for(a=e.src.slice(c,l),s=0;s<u.length&&!u[s][0].test(a);s++);if(s===u.length)return!1;if(n)return u[s][2];if(o=r+1,!u[s][1].test(a))for(;o<t&&!(e.sCount[o]<e.blkIndent);o++)if(c=e.bMarks[o]+e.tShift[o],l=e.eMarks[o],a=e.src.slice(c,l),u[s][1].test(a)){0!==a.length&&o++;break}return e.line=o,(i=e.push("html_block","",0)).map=[r,o],i.content=e.getLines(r,o,e.blkIndent,!0),!0}},{"../common/html_blocks":2,"../common/html_re":3}],24:[function(e,r,t){"use strict";r.exports=function(e,r,t){var n,s,o,i,a,c,l,u,p,h,f=r+1,d=e.md.block.ruler.getRules("paragraph");if(4<=e.sCount[r]-e.blkIndent)return!1;for(h=e.parentType,e.parentType="paragraph";f<t&&!e.isEmpty(f);f++)if(!(3<e.sCount[f]-e.blkIndent)){if(e.sCount[f]>=e.blkIndent&&(c=e.bMarks[f]+e.tShift[f])<(l=e.eMarks[f])&&(45===(p=e.src.charCodeAt(c))||61===p)&&(c=e.skipChars(c,p),l<=(c=e.skipSpaces(c)))){u=61===p?1:2;break}if(!(e.sCount[f]<0)){for(s=!1,o=0,i=d.length;o<i;o++)if(d[o](e,f,t,!0)){s=!0;break}if(s)break}}return!!u&&(n=e.getLines(r,f,e.blkIndent,!1).trim(),e.line=f+1,(a=e.push("heading_open","h"+String(u),1)).markup=String.fromCharCode(p),a.map=[r,e.line],(a=e.push("inline","",0)).content=n,a.map=[r,e.line-1],a.children=[],(a=e.push("heading_close","h"+String(u),-1)).markup=String.fromCharCode(p),e.parentType=h,!0)}},{}],25:[function(e,r,t){"use strict";var i=e("../common/utils").isSpace;function I(e,r){var t,n,s,o;return n=e.bMarks[r]+e.tShift[r],s=e.eMarks[r],42!==(t=e.src.charCodeAt(n++))&&45!==t&&43!==t?-1:n<s&&(o=e.src.charCodeAt(n),!i(o))?-1:n}function R(e,r){var t,n=e.bMarks[r]+e.tShift[r],s=n,o=e.eMarks[r];if(o<=s+1)return-1;if((t=e.src.charCodeAt(s++))<48||57<t)return-1;for(;;){if(o<=s)return-1;if(!(48<=(t=e.src.charCodeAt(s++))&&t<=57)){if(41===t||46===t)break;return-1}if(10<=s-n)return-1}return s<o&&(t=e.src.charCodeAt(s),!i(t))?-1:s}r.exports=function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,_,g,b,k,v,x,y,C,A,w,D,E,q,S,F,L,z=!1,T=!0;if(4<=e.sCount[r]-e.blkIndent)return!1;if(n&&"paragraph"===e.parentType&&e.tShift[r]>=e.blkIndent&&(z=!0),0<=(D=R(e,r))){if(u=!0,q=e.bMarks[r]+e.tShift[r],_=Number(e.src.substr(q,D-q-1)),z&&1!==_)return!1}else{if(!(0<=(D=I(e,r))))return!1;u=!1}if(z&&e.skipSpaces(D)>=e.eMarks[r])return!1;if(m=e.src.charCodeAt(D-1),n)return!0;for(d=e.tokens.length,u?(L=e.push("ordered_list_open","ol",1),1!==_&&(L.attrs=[["start",_]])):L=e.push("bullet_list_open","ul",1),L.map=f=[r,0],L.markup=String.fromCharCode(m),b=r,E=!1,F=e.md.block.ruler.getRules("list"),y=e.parentType,e.parentType="list";b<t;){for(w=D,g=e.eMarks[b],l=k=e.sCount[b]+D-(e.bMarks[r]+e.tShift[r]);w<g;){if(9===(s=e.src.charCodeAt(w)))k+=4-(k+e.bsCount[b])%4;else{if(32!==s)break;k++}w++}if(4<(c=g<=(o=w)?1:k-l)&&(c=1),a=l+c,(L=e.push("list_item_open","li",1)).markup=String.fromCharCode(m),L.map=p=[r,0],v=e.blkIndent,A=e.tight,C=e.tShift[r],x=e.sCount[r],e.blkIndent=a,e.tight=!0,e.tShift[r]=o-e.bMarks[r],e.sCount[r]=k,g<=o&&e.isEmpty(r+1)?e.line=Math.min(e.line+2,t):e.md.block.tokenize(e,r,t,!0),e.tight&&!E||(T=!1),E=1<e.line-r&&e.isEmpty(e.line-1),e.blkIndent=v,e.tShift[r]=C,e.sCount[r]=x,e.tight=A,(L=e.push("list_item_close","li",-1)).markup=String.fromCharCode(m),b=r=e.line,p[1]=b,o=e.bMarks[r],t<=b)break;if(e.sCount[b]<e.blkIndent)break;for(S=!1,i=0,h=F.length;i<h;i++)if(F[i](e,b,t,!0)){S=!0;break}if(S)break;if(u){if((D=R(e,b))<0)break}else if((D=I(e,b))<0)break;if(m!==e.src.charCodeAt(D-1))break}return(L=u?e.push("ordered_list_close","ol",-1):e.push("bullet_list_close","ul",-1)).markup=String.fromCharCode(m),f[1]=b,e.line=b,e.parentType=y,T&&function(e,r){var t,n,s=e.level+2;for(t=r+2,n=e.tokens.length-2;t<n;t++)e.tokens[t].level===s&&"paragraph_open"===e.tokens[t].type&&(e.tokens[t+2].hidden=!0,e.tokens[t].hidden=!0,t+=2)}(e,d),!0}},{"../common/utils":4}],26:[function(e,r,t){"use strict";r.exports=function(e,r){var t,n,s,o,i,a,c=r+1,l=e.md.block.ruler.getRules("paragraph"),u=e.lineMax;for(a=e.parentType,e.parentType="paragraph";c<u&&!e.isEmpty(c);c++)if(!(3<e.sCount[c]-e.blkIndent||e.sCount[c]<0)){for(n=!1,s=0,o=l.length;s<o;s++)if(l[s](e,c,u,!0)){n=!0;break}if(n)break}return t=e.getLines(r,c,e.blkIndent,!1).trim(),e.line=c,(i=e.push("paragraph_open","p",1)).map=[r,e.line],(i=e.push("inline","",0)).content=t,i.map=[r,e.line],i.children=[],i=e.push("paragraph_close","p",-1),e.parentType=a,!0}},{}],27:[function(e,r,t){"use strict";var A=e("../common/utils").normalizeReference,w=e("../common/utils").isSpace;r.exports=function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,_,g,b,k,v=0,x=e.bMarks[r]+e.tShift[r],y=e.eMarks[r],C=r+1;if(4<=e.sCount[r]-e.blkIndent)return!1;if(91!==e.src.charCodeAt(x))return!1;for(;++x<y;)if(93===e.src.charCodeAt(x)&&92!==e.src.charCodeAt(x-1)){if(x+1===y)return!1;if(58!==e.src.charCodeAt(x+1))return!1;break}for(a=e.lineMax,b=e.md.block.ruler.getRules("reference"),f=e.parentType,e.parentType="reference";C<a&&!e.isEmpty(C);C++)if(!(3<e.sCount[C]-e.blkIndent||e.sCount[C]<0)){for(g=!1,l=0,u=b.length;l<u;l++)if(b[l](e,C,a,!0)){g=!0;break}if(g)break}for(y=(_=e.getLines(r,C,e.blkIndent,!1).trim()).length,x=1;x<y;x++){if(91===(s=_.charCodeAt(x)))return!1;if(93===s){h=x;break}10===s?v++:92===s&&++x<y&&10===_.charCodeAt(x)&&v++}if(h<0||58!==_.charCodeAt(h+1))return!1;for(x=h+2;x<y;x++)if(10===(s=_.charCodeAt(x)))v++;else if(!w(s))break;if(!(d=e.md.helpers.parseLinkDestination(_,x,y)).ok)return!1;if(c=e.md.normalizeLink(d.str),!e.md.validateLink(c))return!1;for(x=d.pos,i=v+=d.lines,m=o=x;x<y;x++)if(10===(s=_.charCodeAt(x)))v++;else if(!w(s))break;for(d=e.md.helpers.parseLinkTitle(_,x,y),x<y&&m!==x&&d.ok?(k=d.str,x=d.pos,v+=d.lines):(k="",x=o,v=i);x<y&&(s=_.charCodeAt(x),w(s));)x++;if(x<y&&10!==_.charCodeAt(x)&&k)for(k="",x=o,v=i;x<y&&(s=_.charCodeAt(x),w(s));)x++;return!(x<y&&10!==_.charCodeAt(x))&&(!!(p=A(_.slice(1,h)))&&(n||(void 0===e.env.references&&(e.env.references={}),void 0===e.env.references[p]&&(e.env.references[p]={title:k,href:c}),e.parentType=f,e.line=r+v+1),!0))}},{"../common/utils":4}],28:[function(e,r,t){"use strict";var s=e("../token"),h=e("../common/utils").isSpace;function n(e,r,t,n){var s,o,i,a,c,l,u,p;for(this.src=e,this.md=r,this.env=t,this.tokens=n,this.bMarks=[],this.eMarks=[],this.tShift=[],this.sCount=[],this.bsCount=[],this.blkIndent=0,this.line=0,this.lineMax=0,this.tight=!1,this.ddIndent=-1,this.parentType="root",this.level=0,this.result="",p=!1,i=a=l=u=0,c=(o=this.src).length;a<c;a++){if(s=o.charCodeAt(a),!p){if(h(s)){l++,9===s?u+=4-u%4:u++;continue}p=!0}10!==s&&a!==c-1||(10!==s&&a++,this.bMarks.push(i),this.eMarks.push(a),this.tShift.push(l),this.sCount.push(u),this.bsCount.push(0),p=!1,u=l=0,i=a+1)}this.bMarks.push(o.length),this.eMarks.push(o.length),this.tShift.push(0),this.sCount.push(0),this.bsCount.push(0),this.lineMax=this.bMarks.length-1}n.prototype.push=function(e,r,t){var n=new s(e,r,t);return n.block=!0,t<0&&this.level--,n.level=this.level,0<t&&this.level++,this.tokens.push(n),n},n.prototype.isEmpty=function(e){return this.bMarks[e]+this.tShift[e]>=this.eMarks[e]},n.prototype.skipEmptyLines=function(e){for(var r=this.lineMax;e<r&&!(this.bMarks[e]+this.tShift[e]<this.eMarks[e]);e++);return e},n.prototype.skipSpaces=function(e){for(var r,t=this.src.length;e<t&&(r=this.src.charCodeAt(e),h(r));e++);return e},n.prototype.skipSpacesBack=function(e,r){if(e<=r)return e;for(;r<e;)if(!h(this.src.charCodeAt(--e)))return e+1;return e},n.prototype.skipChars=function(e,r){for(var t=this.src.length;e<t&&this.src.charCodeAt(e)===r;e++);return e},n.prototype.skipCharsBack=function(e,r,t){if(e<=t)return e;for(;t<e;)if(r!==this.src.charCodeAt(--e))return e+1;return e},n.prototype.getLines=function(e,r,t,n){var s,o,i,a,c,l,u,p=e;if(r<=e)return"";for(l=new Array(r-e),s=0;p<r;p++,s++){for(o=0,u=a=this.bMarks[p],c=p+1<r||n?this.eMarks[p]+1:this.eMarks[p];a<c&&o<t;){if(i=this.src.charCodeAt(a),h(i))9===i?o+=4-(o+this.bsCount[p])%4:o++;else{if(!(a-u<this.tShift[p]))break;o++}a++}l[s]=t<o?new Array(o-t+1).join(" ")+this.src.slice(a,c):this.src.slice(a,c)}return l.join("")},n.prototype.Token=s,r.exports=n},{"../common/utils":4,"../token":51}],29:[function(e,r,t){"use strict";var _=e("../common/utils").isSpace;function g(e,r){var t=e.bMarks[r]+e.blkIndent,n=e.eMarks[r];return e.src.substr(t,n-t)}function b(e){var r,t=[],n=0,s=e.length,o=0,i=0,a=!1,c=0;for(r=e.charCodeAt(n);n<s;)96===r?a?(a=!1,c=n):o%2==0&&(a=!0,c=n):124!==r||o%2!=0||a||(t.push(e.substring(i,n)),i=n+1),92===r?o++:o=0,++n===s&&a&&(a=!1,n=c+1),r=e.charCodeAt(n);return t.push(e.substring(i)),t}r.exports=function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m;if(t<r+2)return!1;if(c=r+1,e.sCount[c]<e.blkIndent)return!1;if(4<=e.sCount[c]-e.blkIndent)return!1;if((i=e.bMarks[c]+e.tShift[c])>=e.eMarks[c])return!1;if(124!==(s=e.src.charCodeAt(i++))&&45!==s&&58!==s)return!1;for(;i<e.eMarks[c];){if(124!==(s=e.src.charCodeAt(i))&&45!==s&&58!==s&&!_(s))return!1;i++}for(l=(o=g(e,r+1)).split("|"),h=[],a=0;a<l.length;a++){if(!(f=l[a].trim())){if(0===a||a===l.length-1)continue;return!1}if(!/^:?-+:?$/.test(f))return!1;58===f.charCodeAt(f.length-1)?h.push(58===f.charCodeAt(0)?"center":"right"):58===f.charCodeAt(0)?h.push("left"):h.push("")}if(-1===(o=g(e,r).trim()).indexOf("|"))return!1;if(4<=e.sCount[r]-e.blkIndent)return!1;if((u=(l=b(o.replace(/^\||\|$/g,""))).length)>h.length)return!1;if(n)return!0;for((p=e.push("table_open","table",1)).map=d=[r,0],(p=e.push("thead_open","thead",1)).map=[r,r+1],(p=e.push("tr_open","tr",1)).map=[r,r+1],a=0;a<l.length;a++)(p=e.push("th_open","th",1)).map=[r,r+1],h[a]&&(p.attrs=[["style","text-align:"+h[a]]]),(p=e.push("inline","",0)).content=l[a].trim(),p.map=[r,r+1],p.children=[],p=e.push("th_close","th",-1);for(p=e.push("tr_close","tr",-1),p=e.push("thead_close","thead",-1),(p=e.push("tbody_open","tbody",1)).map=m=[r+2,0],c=r+2;c<t&&!(e.sCount[c]<e.blkIndent)&&-1!==(o=g(e,c).trim()).indexOf("|")&&!(4<=e.sCount[c]-e.blkIndent);c++){for(l=b(o.replace(/^\||\|$/g,"")),p=e.push("tr_open","tr",1),a=0;a<u;a++)p=e.push("td_open","td",1),h[a]&&(p.attrs=[["style","text-align:"+h[a]]]),(p=e.push("inline","",0)).content=l[a]?l[a].trim():"",p.children=[],p=e.push("td_close","td",-1);p=e.push("tr_close","tr",-1)}return p=e.push("tbody_close","tbody",-1),p=e.push("table_close","table",-1),d[1]=m[1]=c,e.line=c,!0}},{"../common/utils":4}],30:[function(e,r,t){"use strict";r.exports=function(e){var r;e.inlineMode?((r=new e.Token("inline","",0)).content=e.src,r.map=[0,1],r.children=[],e.tokens.push(r)):e.md.block.parse(e.src,e.md,e.env,e.tokens)}},{}],31:[function(e,r,t){"use strict";r.exports=function(e){var r,t,n,s=e.tokens;for(t=0,n=s.length;t<n;t++)"inline"===(r=s[t]).type&&e.md.inline.parse(r.content,e.md,e.env,r.children)}},{}],32:[function(e,r,t){"use strict";var x=e("../common/utils").arrayReplaceAt;r.exports=function(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,_,g,b,k,v=e.tokens;if(e.md.options.linkify)for(t=0,n=v.length;t<n;t++)if("inline"===v[t].type&&e.md.linkify.pretest(v[t].content))for(f=0,r=(s=v[t].children).length-1;0<=r;r--)if("link_close"!==(i=s[r]).type){if("html_inline"===i.type&&(k=i.content,/^<a[>\s]/i.test(k)&&0<f&&f--,b=i.content,/^<\/a\s*>/i.test(b)&&f++),!(0<f)&&"text"===i.type&&e.md.linkify.test(i.content)){for(l=i.content,g=e.md.linkify.match(l),a=[],h=i.level,c=p=0;c<g.length;c++)d=g[c].url,m=e.md.normalizeLink(d),e.md.validateLink(m)&&(_=g[c].text,_=g[c].schema?"mailto:"!==g[c].schema||/^mailto:/i.test(_)?e.md.normalizeLinkText(_):e.md.normalizeLinkText("mailto:"+_).replace(/^mailto:/,""):e.md.normalizeLinkText("http://"+_).replace(/^http:\/\//,""),p<(u=g[c].index)&&((o=new e.Token("text","",0)).content=l.slice(p,u),o.level=h,a.push(o)),(o=new e.Token("link_open","a",1)).attrs=[["href",m]],o.level=h++,o.markup="linkify",o.info="auto",a.push(o),(o=new e.Token("text","",0)).content=_,o.level=h,a.push(o),(o=new e.Token("link_close","a",-1)).level=--h,o.markup="linkify",o.info="auto",a.push(o),p=g[c].lastIndex);p<l.length&&((o=new e.Token("text","",0)).content=l.slice(p),o.level=h,a.push(o)),v[t].children=s=x(s,r,a)}}else for(r--;s[r].level!==i.level&&"link_open"!==s[r].type;)r--}},{"../common/utils":4}],33:[function(e,r,t){"use strict";var n=/\r[\n\u0085]?|[\u2424\u2028\u0085]/g,s=/\u0000/g;r.exports=function(e){var r;r=(r=e.src.replace(n,"\n")).replace(s,"\ufffd"),e.src=r}},{}],34:[function(e,r,t){"use strict";var s=/\+-|\.\.|\?\?\?\?|!!!!|,,|--/,n=/\((c|tm|r|p)\)/i,o=/\((c|tm|r|p)\)/gi,i={c:"\xa9",r:"\xae",p:"\xa7",tm:"\u2122"};function a(e,r){return i[r.toLowerCase()]}function c(e){var r,t,n=0;for(r=e.length-1;0<=r;r--)"text"!==(t=e[r]).type||n||(t.content=t.content.replace(o,a)),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}function l(e){var r,t,n=0;for(r=e.length-1;0<=r;r--)"text"!==(t=e[r]).type||n||s.test(t.content)&&(t.content=t.content.replace(/\+-/g,"\xb1").replace(/\.{2,}/g,"\u2026").replace(/([?!])\u2026/g,"$1..").replace(/([?!]){4,}/g,"$1$1$1").replace(/,{2,}/g,",").replace(/(^|[^-])---([^-]|$)/gm,"$1\u2014$2").replace(/(^|\s)--(\s|$)/gm,"$1\u2013$2").replace(/(^|[^-\s])--([^-\s]|$)/gm,"$1\u2013$2")),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}r.exports=function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;0<=r;r--)"inline"===e.tokens[r].type&&(n.test(e.tokens[r].content)&&c(e.tokens[r].children),s.test(e.tokens[r].content)&&l(e.tokens[r].children))}},{}],35:[function(e,r,t){"use strict";var C=e("../common/utils").isWhiteSpace,A=e("../common/utils").isPunctChar,w=e("../common/utils").isMdAsciiPunct,n=/['"]/,D=/['"]/g,E="\u2019";function q(e,r,t){return e.substr(0,r)+t+e.substr(r+1)}function s(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m,_,g,b,k,v,x,y;for(v=[],t=0;t<e.length;t++){for(n=e[t],c=e[t].level,b=v.length-1;0<=b&&!(v[b].level<=c);b--);if(v.length=b+1,"text"===n.type){i=0,a=(s=n.content).length;e:for(;i<a&&(D.lastIndex=i,o=D.exec(s));){if(_=g=!0,i=o.index+1,k="'"===o[0],u=32,0<=o.index-1)u=s.charCodeAt(o.index-1);else for(b=t-1;0<=b&&("softbreak"!==e[b].type&&"hardbreak"!==e[b].type);b--)if("text"===e[b].type){u=e[b].content.charCodeAt(e[b].content.length-1);break}if(p=32,i<a)p=s.charCodeAt(i);else for(b=t+1;b<e.length&&("softbreak"!==e[b].type&&"hardbreak"!==e[b].type);b++)if("text"===e[b].type){p=e[b].content.charCodeAt(0);break}if(h=w(u)||A(String.fromCharCode(u)),f=w(p)||A(String.fromCharCode(p)),d=C(u),(m=C(p))?_=!1:f&&(d||h||(_=!1)),d?g=!1:h&&(m||f||(g=!1)),34===p&&'"'===o[0]&&48<=u&&u<=57&&(g=_=!1),_&&g&&(_=!1,g=f),_||g){if(g)for(b=v.length-1;0<=b&&(l=v[b],!(v[b].level<c));b--)if(l.single===k&&v[b].level===c){l=v[b],k?(x=r.md.options.quotes[2],y=r.md.options.quotes[3]):(x=r.md.options.quotes[0],y=r.md.options.quotes[1]),n.content=q(n.content,o.index,y),e[l.token].content=q(e[l.token].content,l.pos,x),i+=y.length-1,l.token===t&&(i+=x.length-1),a=(s=n.content).length,v.length=b;continue e}_?v.push({token:t,pos:o.index,single:k,level:c}):g&&k&&(n.content=q(n.content,o.index,E))}else k&&(n.content=q(n.content,o.index,E))}}}}r.exports=function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;0<=r;r--)"inline"===e.tokens[r].type&&n.test(e.tokens[r].content)&&s(e.tokens[r].children,e)}},{"../common/utils":4}],36:[function(e,r,t){"use strict";var n=e("../token");function s(e,r,t){this.src=e,this.env=t,this.tokens=[],this.inlineMode=!1,this.md=r}s.prototype.Token=n,r.exports=s},{"../token":51}],37:[function(e,r,t){"use strict";var l=/^<([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)>/,u=/^<([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)>/;r.exports=function(e,r){var t,n,s,o,i,a,c=e.pos;return 60===e.src.charCodeAt(c)&&(!((t=e.src.slice(c)).indexOf(">")<0)&&(u.test(t)?(o=(n=t.match(u))[0].slice(1,-1),i=e.md.normalizeLink(o),!!e.md.validateLink(i)&&(r||((a=e.push("link_open","a",1)).attrs=[["href",i]],a.markup="autolink",a.info="auto",(a=e.push("text","",0)).content=e.md.normalizeLinkText(o),(a=e.push("link_close","a",-1)).markup="autolink",a.info="auto"),e.pos+=n[0].length,!0)):!!l.test(t)&&(o=(s=t.match(l))[0].slice(1,-1),i=e.md.normalizeLink("mailto:"+o),!!e.md.validateLink(i)&&(r||((a=e.push("link_open","a",1)).attrs=[["href",i]],a.markup="autolink",a.info="auto",(a=e.push("text","",0)).content=e.md.normalizeLinkText(o),(a=e.push("link_close","a",-1)).markup="autolink",a.info="auto"),e.pos+=s[0].length,!0))))}},{}],38:[function(e,r,t){"use strict";r.exports=function(e,r){var t,n,s,o,i,a,c=e.pos;if(96!==e.src.charCodeAt(c))return!1;for(t=c,c++,n=e.posMax;c<n&&96===e.src.charCodeAt(c);)c++;for(s=e.src.slice(t,c),o=i=c;-1!==(o=e.src.indexOf("`",i));){for(i=o+1;i<n&&96===e.src.charCodeAt(i);)i++;if(i-o===s.length)return r||((a=e.push("code_inline","code",0)).markup=s,a.content=e.src.slice(c,o).replace(/[ \n]+/g," ").trim()),e.pos=i,!0}return r||(e.pending+=s),e.pos+=s.length,!0}},{}],39:[function(e,r,t){"use strict";r.exports=function(e){var r,t,n,s,o=e.delimiters,i=e.delimiters.length;for(r=0;r<i;r++)if((n=o[r]).close)for(t=r-n.jump-1;0<=t;){if((s=o[t]).open&&s.marker===n.marker&&s.end<0&&s.level===n.level)if(!((s.close||n.open)&&void 0!==s.length&&void 0!==n.length&&(s.length+n.length)%3==0)){n.jump=r-t,n.open=!1,s.end=r,s.jump=0;break}t-=s.jump+1}}},{}],40:[function(e,r,t){"use strict";r.exports.tokenize=function(e,r){var t,n,s=e.pos,o=e.src.charCodeAt(s);if(r)return!1;if(95!==o&&42!==o)return!1;for(n=e.scanDelims(e.pos,42===o),t=0;t<n.length;t++)e.push("text","",0).content=String.fromCharCode(o),e.delimiters.push({marker:o,length:n.length,jump:t,token:e.tokens.length-1,level:e.level,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},r.exports.postProcess=function(e){var r,t,n,s,o,i,a=e.delimiters;for(r=e.delimiters.length-1;0<=r;r--)95!==(t=a[r]).marker&&42!==t.marker||-1!==t.end&&(n=a[t.end],i=0<r&&a[r-1].end===t.end+1&&a[r-1].token===t.token-1&&a[t.end+1].token===n.token+1&&a[r-1].marker===t.marker,o=String.fromCharCode(t.marker),(s=e.tokens[t.token]).type=i?"strong_open":"em_open",s.tag=i?"strong":"em",s.nesting=1,s.markup=i?o+o:o,s.content="",(s=e.tokens[n.token]).type=i?"strong_close":"em_close",s.tag=i?"strong":"em",s.nesting=-1,s.markup=i?o+o:o,s.content="",i&&(e.tokens[a[r-1].token].content="",e.tokens[a[t.end+1].token].content="",r--))}},{}],41:[function(e,r,t){"use strict";var i=e("../common/entities"),a=e("../common/utils").has,c=e("../common/utils").isValidEntityCode,l=e("../common/utils").fromCodePoint,u=/^&#((?:x[a-f0-9]{1,8}|[0-9]{1,8}));/i,p=/^&([a-z][a-z0-9]{1,31});/i;r.exports=function(e,r){var t,n,s=e.pos,o=e.posMax;if(38!==e.src.charCodeAt(s))return!1;if(s+1<o)if(35===e.src.charCodeAt(s+1)){if(n=e.src.slice(s).match(u))return r||(t="x"===n[1][0].toLowerCase()?parseInt(n[1].slice(1),16):parseInt(n[1],10),e.pending+=c(t)?l(t):l(65533)),e.pos+=n[0].length,!0}else if((n=e.src.slice(s).match(p))&&a(i,n[1]))return r||(e.pending+=i[n[1]]),e.pos+=n[0].length,!0;return r||(e.pending+="&"),e.pos++,!0}},{"../common/entities":1,"../common/utils":4}],42:[function(e,r,t){"use strict";for(var o=e("../common/utils").isSpace,i=[],n=0;n<256;n++)i.push(0);"\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach(function(e){i[e.charCodeAt(0)]=1}),r.exports=function(e,r){var t,n=e.pos,s=e.posMax;if(92!==e.src.charCodeAt(n))return!1;if(++n<s){if((t=e.src.charCodeAt(n))<256&&0!==i[t])return r||(e.pending+=e.src[n]),e.pos+=2,!0;if(10===t){for(r||e.push("hardbreak","br",0),n++;n<s&&(t=e.src.charCodeAt(n),o(t));)n++;return e.pos=n,!0}}return r||(e.pending+="\\"),e.pos++,!0}},{"../common/utils":4}],43:[function(e,r,t){"use strict";var a=e("../common/html_re").HTML_TAG_RE;r.exports=function(e,r){var t,n,s,o,i=e.pos;return!!e.md.options.html&&(s=e.posMax,!(60!==e.src.charCodeAt(i)||s<=i+2)&&((33===(t=e.src.charCodeAt(i+1))||63===t||47===t||97<=(o=32|t)&&o<=122)&&(!!(n=e.src.slice(i).match(a))&&(r||(e.push("html_inline","",0).content=e.src.slice(i,i+n[0].length)),e.pos+=n[0].length,!0))))}},{"../common/html_re":3}],44:[function(e,r,t){"use strict";var b=e("../common/utils").normalizeReference,k=e("../common/utils").isSpace;r.exports=function(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m="",_=e.pos,g=e.posMax;if(33!==e.src.charCodeAt(e.pos))return!1;if(91!==e.src.charCodeAt(e.pos+1))return!1;if(a=e.pos+2,(i=e.md.helpers.parseLinkLabel(e,e.pos+1,!1))<0)return!1;if((c=i+1)<g&&40===e.src.charCodeAt(c)){for(c++;c<g&&(n=e.src.charCodeAt(c),k(n)||10===n);c++);if(g<=c)return!1;for(d=c,(u=e.md.helpers.parseLinkDestination(e.src,c,e.posMax)).ok&&(m=e.md.normalizeLink(u.str),e.md.validateLink(m)?c=u.pos:m=""),d=c;c<g&&(n=e.src.charCodeAt(c),k(n)||10===n);c++);if(u=e.md.helpers.parseLinkTitle(e.src,c,e.posMax),c<g&&d!==c&&u.ok)for(p=u.str,c=u.pos;c<g&&(n=e.src.charCodeAt(c),k(n)||10===n);c++);else p="";if(g<=c||41!==e.src.charCodeAt(c))return e.pos=_,!1;c++}else{if(void 0===e.env.references)return!1;if(c<g&&91===e.src.charCodeAt(c)?(d=c+1,0<=(c=e.md.helpers.parseLinkLabel(e,c))?o=e.src.slice(d,c++):c=i+1):c=i+1,o||(o=e.src.slice(a,i)),!(l=e.env.references[b(o)]))return e.pos=_,!1;m=l.href,p=l.title}return r||(s=e.src.slice(a,i),e.md.inline.parse(s,e.md,e.env,f=[]),(h=e.push("image","img",0)).attrs=t=[["src",m],["alt",""]],h.children=f,h.content=s,p&&t.push(["title",p])),e.pos=c,e.posMax=g,!0}},{"../common/utils":4}],45:[function(e,r,t){"use strict";var _=e("../common/utils").normalizeReference,g=e("../common/utils").isSpace;r.exports=function(e,r){var t,n,s,o,i,a,c,l,u,p="",h=e.pos,f=e.posMax,d=e.pos,m=!0;if(91!==e.src.charCodeAt(e.pos))return!1;if(i=e.pos+1,(o=e.md.helpers.parseLinkLabel(e,e.pos,!0))<0)return!1;if((a=o+1)<f&&40===e.src.charCodeAt(a)){for(m=!1,a++;a<f&&(n=e.src.charCodeAt(a),g(n)||10===n);a++);if(f<=a)return!1;for(d=a,(c=e.md.helpers.parseLinkDestination(e.src,a,e.posMax)).ok&&(p=e.md.normalizeLink(c.str),e.md.validateLink(p)?a=c.pos:p=""),d=a;a<f&&(n=e.src.charCodeAt(a),g(n)||10===n);a++);if(c=e.md.helpers.parseLinkTitle(e.src,a,e.posMax),a<f&&d!==a&&c.ok)for(u=c.str,a=c.pos;a<f&&(n=e.src.charCodeAt(a),g(n)||10===n);a++);else u="";(f<=a||41!==e.src.charCodeAt(a))&&(m=!0),a++}if(m){if(void 0===e.env.references)return!1;if(a<f&&91===e.src.charCodeAt(a)?(d=a+1,0<=(a=e.md.helpers.parseLinkLabel(e,a))?s=e.src.slice(d,a++):a=o+1):a=o+1,s||(s=e.src.slice(i,o)),!(l=e.env.references[_(s)]))return e.pos=h,!1;p=l.href,u=l.title}return r||(e.pos=i,e.posMax=o,e.push("link_open","a",1).attrs=t=[["href",p]],u&&t.push(["title",u]),e.md.inline.tokenize(e),e.push("link_close","a",-1)),e.pos=a,e.posMax=f,!0}},{"../common/utils":4}],46:[function(e,r,t){"use strict";var o=e("../common/utils").isSpace;r.exports=function(e,r){var t,n,s=e.pos;if(10!==e.src.charCodeAt(s))return!1;for(t=e.pending.length-1,n=e.posMax,r||(0<=t&&32===e.pending.charCodeAt(t)?1<=t&&32===e.pending.charCodeAt(t-1)?(e.pending=e.pending.replace(/ +$/,""),e.push("hardbreak","br",0)):(e.pending=e.pending.slice(0,-1),e.push("softbreak","br",0)):e.push("softbreak","br",0)),s++;s<n&&o(e.src.charCodeAt(s));)s++;return e.pos=s,!0}},{"../common/utils":4}],47:[function(e,r,t){"use strict";var s=e("../token"),_=e("../common/utils").isWhiteSpace,g=e("../common/utils").isPunctChar,b=e("../common/utils").isMdAsciiPunct;function n(e,r,t,n){this.src=e,this.env=t,this.md=r,this.tokens=n,this.pos=0,this.posMax=this.src.length,this.level=0,this.pending="",this.pendingLevel=0,this.cache={},this.delimiters=[]}n.prototype.pushPending=function(){var e=new s("text","",0);return e.content=this.pending,e.level=this.pendingLevel,this.tokens.push(e),this.pending="",e},n.prototype.push=function(e,r,t){this.pending&&this.pushPending();var n=new s(e,r,t);return t<0&&this.level--,n.level=this.level,0<t&&this.level++,this.pendingLevel=this.level,this.tokens.push(n),n},n.prototype.scanDelims=function(e,r){var t,n,s,o,i,a,c,l,u,p=e,h=!0,f=!0,d=this.posMax,m=this.src.charCodeAt(e);for(t=0<e?this.src.charCodeAt(e-1):32;p<d&&this.src.charCodeAt(p)===m;)p++;return s=p-e,n=p<d?this.src.charCodeAt(p):32,c=b(t)||g(String.fromCharCode(t)),u=b(n)||g(String.fromCharCode(n)),a=_(t),(l=_(n))?h=!1:u&&(a||c||(h=!1)),a?f=!1:c&&(l||u||(f=!1)),r?(o=h,i=f):(o=h&&(!f||c),i=f&&(!h||u)),{can_open:o,can_close:i,length:s}},n.prototype.Token=s,r.exports=n},{"../common/utils":4,"../token":51}],48:[function(e,r,t){"use strict";r.exports.tokenize=function(e,r){var t,n,s,o,i=e.pos,a=e.src.charCodeAt(i);if(r)return!1;if(126!==a)return!1;if(s=(n=e.scanDelims(e.pos,!0)).length,o=String.fromCharCode(a),s<2)return!1;for(s%2&&(e.push("text","",0).content=o,s--),t=0;t<s;t+=2)e.push("text","",0).content=o+o,e.delimiters.push({marker:a,jump:t,token:e.tokens.length-1,level:e.level,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},r.exports.postProcess=function(e){var r,t,n,s,o,i=[],a=e.delimiters,c=e.delimiters.length;for(r=0;r<c;r++)126===(n=a[r]).marker&&-1!==n.end&&(s=a[n.end],(o=e.tokens[n.token]).type="s_open",o.tag="s",o.nesting=1,o.markup="~~",o.content="",(o=e.tokens[s.token]).type="s_close",o.tag="s",o.nesting=-1,o.markup="~~",o.content="","text"===e.tokens[s.token-1].type&&"~"===e.tokens[s.token-1].content&&i.push(s.token-1));for(;i.length;){for(t=(r=i.pop())+1;t<e.tokens.length&&"s_close"===e.tokens[t].type;)t++;r!==--t&&(o=e.tokens[t],e.tokens[t]=e.tokens[r],e.tokens[r]=o)}}},{}],49:[function(e,r,t){"use strict";function n(e){switch(e){case 10:case 33:case 35:case 36:case 37:case 38:case 42:case 43:case 45:case 58:case 60:case 61:case 62:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 125:case 126:return!0;default:return!1}}r.exports=function(e,r){for(var t=e.pos;t<e.posMax&&!n(e.src.charCodeAt(t));)t++;return t!==e.pos&&(r||(e.pending+=e.src.slice(e.pos,t)),e.pos=t,!0)}},{}],50:[function(e,r,t){"use strict";r.exports=function(e){var r,t,n=0,s=e.tokens,o=e.tokens.length;for(r=t=0;r<o;r++)n+=s[r].nesting,s[r].level=n,"text"===s[r].type&&r+1<o&&"text"===s[r+1].type?s[r+1].content=s[r].content+s[r+1].content:(r!==t&&(s[t]=s[r]),t++);r!==t&&(s.length=t)}},{}],51:[function(e,r,t){"use strict";function n(e,r,t){this.type=e,this.tag=r,this.attrs=null,this.map=null,this.nesting=t,this.level=0,this.children=null,this.content="",this.markup="",this.info="",this.meta=null,this.block=!1,this.hidden=!1}n.prototype.attrIndex=function(e){var r,t,n;if(!this.attrs)return-1;for(t=0,n=(r=this.attrs).length;t<n;t++)if(r[t][0]===e)return t;return-1},n.prototype.attrPush=function(e){this.attrs?this.attrs.push(e):this.attrs=[e]},n.prototype.attrSet=function(e,r){var t=this.attrIndex(e),n=[e,r];t<0?this.attrPush(n):this.attrs[t]=n},n.prototype.attrGet=function(e){var r=this.attrIndex(e),t=null;return 0<=r&&(t=this.attrs[r][1]),t},n.prototype.attrJoin=function(e,r){var t=this.attrIndex(e);t<0?this.attrPush([e,r]):this.attrs[t][1]=this.attrs[t][1]+" "+r},r.exports=n},{}],52:[function(e,r,t){r.exports={Aacute:"\xc1",aacute:"\xe1",Abreve:"\u0102",abreve:"\u0103",ac:"\u223e",acd:"\u223f",acE:"\u223e\u0333",Acirc:"\xc2",acirc:"\xe2",acute:"\xb4",Acy:"\u0410",acy:"\u0430",AElig:"\xc6",aelig:"\xe6",af:"\u2061",Afr:"\ud835\udd04",afr:"\ud835\udd1e",Agrave:"\xc0",agrave:"\xe0",alefsym:"\u2135",aleph:"\u2135",Alpha:"\u0391",alpha:"\u03b1",Amacr:"\u0100",amacr:"\u0101",amalg:"\u2a3f",amp:"&",AMP:"&",andand:"\u2a55",And:"\u2a53",and:"\u2227",andd:"\u2a5c",andslope:"\u2a58",andv:"\u2a5a",ang:"\u2220",ange:"\u29a4",angle:"\u2220",angmsdaa:"\u29a8",angmsdab:"\u29a9",angmsdac:"\u29aa",angmsdad:"\u29ab",angmsdae:"\u29ac",angmsdaf:"\u29ad",angmsdag:"\u29ae",angmsdah:"\u29af",angmsd:"\u2221",angrt:"\u221f",angrtvb:"\u22be",angrtvbd:"\u299d",angsph:"\u2222",angst:"\xc5",angzarr:"\u237c",Aogon:"\u0104",aogon:"\u0105",Aopf:"\ud835\udd38",aopf:"\ud835\udd52",apacir:"\u2a6f",ap:"\u2248",apE:"\u2a70",ape:"\u224a",apid:"\u224b",apos:"'",ApplyFunction:"\u2061",approx:"\u2248",approxeq:"\u224a",Aring:"\xc5",aring:"\xe5",Ascr:"\ud835\udc9c",ascr:"\ud835\udcb6",Assign:"\u2254",ast:"*",asymp:"\u2248",asympeq:"\u224d",Atilde:"\xc3",atilde:"\xe3",Auml:"\xc4",auml:"\xe4",awconint:"\u2233",awint:"\u2a11",backcong:"\u224c",backepsilon:"\u03f6",backprime:"\u2035",backsim:"\u223d",backsimeq:"\u22cd",Backslash:"\u2216",Barv:"\u2ae7",barvee:"\u22bd",barwed:"\u2305",Barwed:"\u2306",barwedge:"\u2305",bbrk:"\u23b5",bbrktbrk:"\u23b6",bcong:"\u224c",Bcy:"\u0411",bcy:"\u0431",bdquo:"\u201e",becaus:"\u2235",because:"\u2235",Because:"\u2235",bemptyv:"\u29b0",bepsi:"\u03f6",bernou:"\u212c",Bernoullis:"\u212c",Beta:"\u0392",beta:"\u03b2",beth:"\u2136",between:"\u226c",Bfr:"\ud835\udd05",bfr:"\ud835\udd1f",bigcap:"\u22c2",bigcirc:"\u25ef",bigcup:"\u22c3",bigodot:"\u2a00",bigoplus:"\u2a01",bigotimes:"\u2a02",bigsqcup:"\u2a06",bigstar:"\u2605",bigtriangledown:"\u25bd",bigtriangleup:"\u25b3",biguplus:"\u2a04",bigvee:"\u22c1",bigwedge:"\u22c0",bkarow:"\u290d",blacklozenge:"\u29eb",blacksquare:"\u25aa",blacktriangle:"\u25b4",blacktriangledown:"\u25be",blacktriangleleft:"\u25c2",blacktriangleright:"\u25b8",blank:"\u2423",blk12:"\u2592",blk14:"\u2591",blk34:"\u2593",block:"\u2588",bne:"=\u20e5",bnequiv:"\u2261\u20e5",bNot:"\u2aed",bnot:"\u2310",Bopf:"\ud835\udd39",bopf:"\ud835\udd53",bot:"\u22a5",bottom:"\u22a5",bowtie:"\u22c8",boxbox:"\u29c9",boxdl:"\u2510",boxdL:"\u2555",boxDl:"\u2556",boxDL:"\u2557",boxdr:"\u250c",boxdR:"\u2552",boxDr:"\u2553",boxDR:"\u2554",boxh:"\u2500",boxH:"\u2550",boxhd:"\u252c",boxHd:"\u2564",boxhD:"\u2565",boxHD:"\u2566",boxhu:"\u2534",boxHu:"\u2567",boxhU:"\u2568",boxHU:"\u2569",boxminus:"\u229f",boxplus:"\u229e",boxtimes:"\u22a0",boxul:"\u2518",boxuL:"\u255b",boxUl:"\u255c",boxUL:"\u255d",boxur:"\u2514",boxuR:"\u2558",boxUr:"\u2559",boxUR:"\u255a",boxv:"\u2502",boxV:"\u2551",boxvh:"\u253c",boxvH:"\u256a",boxVh:"\u256b",boxVH:"\u256c",boxvl:"\u2524",boxvL:"\u2561",boxVl:"\u2562",boxVL:"\u2563",boxvr:"\u251c",boxvR:"\u255e",boxVr:"\u255f",boxVR:"\u2560",bprime:"\u2035",breve:"\u02d8",Breve:"\u02d8",brvbar:"\xa6",bscr:"\ud835\udcb7",Bscr:"\u212c",bsemi:"\u204f",bsim:"\u223d",bsime:"\u22cd",bsolb:"\u29c5",bsol:"\\",bsolhsub:"\u27c8",bull:"\u2022",bullet:"\u2022",bump:"\u224e",bumpE:"\u2aae",bumpe:"\u224f",Bumpeq:"\u224e",bumpeq:"\u224f",Cacute:"\u0106",cacute:"\u0107",capand:"\u2a44",capbrcup:"\u2a49",capcap:"\u2a4b",cap:"\u2229",Cap:"\u22d2",capcup:"\u2a47",capdot:"\u2a40",CapitalDifferentialD:"\u2145",caps:"\u2229\ufe00",caret:"\u2041",caron:"\u02c7",Cayleys:"\u212d",ccaps:"\u2a4d",Ccaron:"\u010c",ccaron:"\u010d",Ccedil:"\xc7",ccedil:"\xe7",Ccirc:"\u0108",ccirc:"\u0109",Cconint:"\u2230",ccups:"\u2a4c",ccupssm:"\u2a50",Cdot:"\u010a",cdot:"\u010b",cedil:"\xb8",Cedilla:"\xb8",cemptyv:"\u29b2",cent:"\xa2",centerdot:"\xb7",CenterDot:"\xb7",cfr:"\ud835\udd20",Cfr:"\u212d",CHcy:"\u0427",chcy:"\u0447",check:"\u2713",checkmark:"\u2713",Chi:"\u03a7",chi:"\u03c7",circ:"\u02c6",circeq:"\u2257",circlearrowleft:"\u21ba",circlearrowright:"\u21bb",circledast:"\u229b",circledcirc:"\u229a",circleddash:"\u229d",CircleDot:"\u2299",circledR:"\xae",circledS:"\u24c8",CircleMinus:"\u2296",CirclePlus:"\u2295",CircleTimes:"\u2297",cir:"\u25cb",cirE:"\u29c3",cire:"\u2257",cirfnint:"\u2a10",cirmid:"\u2aef",cirscir:"\u29c2",ClockwiseContourIntegral:"\u2232",CloseCurlyDoubleQuote:"\u201d",CloseCurlyQuote:"\u2019",clubs:"\u2663",clubsuit:"\u2663",colon:":",Colon:"\u2237",Colone:"\u2a74",colone:"\u2254",coloneq:"\u2254",comma:",",commat:"@",comp:"\u2201",compfn:"\u2218",complement:"\u2201",complexes:"\u2102",cong:"\u2245",congdot:"\u2a6d",Congruent:"\u2261",conint:"\u222e",Conint:"\u222f",ContourIntegral:"\u222e",copf:"\ud835\udd54",Copf:"\u2102",coprod:"\u2210",Coproduct:"\u2210",copy:"\xa9",COPY:"\xa9",copysr:"\u2117",CounterClockwiseContourIntegral:"\u2233",crarr:"\u21b5",cross:"\u2717",Cross:"\u2a2f",Cscr:"\ud835\udc9e",cscr:"\ud835\udcb8",csub:"\u2acf",csube:"\u2ad1",csup:"\u2ad0",csupe:"\u2ad2",ctdot:"\u22ef",cudarrl:"\u2938",cudarrr:"\u2935",cuepr:"\u22de",cuesc:"\u22df",cularr:"\u21b6",cularrp:"\u293d",cupbrcap:"\u2a48",cupcap:"\u2a46",CupCap:"\u224d",cup:"\u222a",Cup:"\u22d3",cupcup:"\u2a4a",cupdot:"\u228d",cupor:"\u2a45",cups:"\u222a\ufe00",curarr:"\u21b7",curarrm:"\u293c",curlyeqprec:"\u22de",curlyeqsucc:"\u22df",curlyvee:"\u22ce",curlywedge:"\u22cf",curren:"\xa4",curvearrowleft:"\u21b6",curvearrowright:"\u21b7",cuvee:"\u22ce",cuwed:"\u22cf",cwconint:"\u2232",cwint:"\u2231",cylcty:"\u232d",dagger:"\u2020",Dagger:"\u2021",daleth:"\u2138",darr:"\u2193",Darr:"\u21a1",dArr:"\u21d3",dash:"\u2010",Dashv:"\u2ae4",dashv:"\u22a3",dbkarow:"\u290f",dblac:"\u02dd",Dcaron:"\u010e",dcaron:"\u010f",Dcy:"\u0414",dcy:"\u0434",ddagger:"\u2021",ddarr:"\u21ca",DD:"\u2145",dd:"\u2146",DDotrahd:"\u2911",ddotseq:"\u2a77",deg:"\xb0",Del:"\u2207",Delta:"\u0394",delta:"\u03b4",demptyv:"\u29b1",dfisht:"\u297f",Dfr:"\ud835\udd07",dfr:"\ud835\udd21",dHar:"\u2965",dharl:"\u21c3",dharr:"\u21c2",DiacriticalAcute:"\xb4",DiacriticalDot:"\u02d9",DiacriticalDoubleAcute:"\u02dd",DiacriticalGrave:"`",DiacriticalTilde:"\u02dc",diam:"\u22c4",diamond:"\u22c4",Diamond:"\u22c4",diamondsuit:"\u2666",diams:"\u2666",die:"\xa8",DifferentialD:"\u2146",digamma:"\u03dd",disin:"\u22f2",div:"\xf7",divide:"\xf7",divideontimes:"\u22c7",divonx:"\u22c7",DJcy:"\u0402",djcy:"\u0452",dlcorn:"\u231e",dlcrop:"\u230d",dollar:"$",Dopf:"\ud835\udd3b",dopf:"\ud835\udd55",Dot:"\xa8",dot:"\u02d9",DotDot:"\u20dc",doteq:"\u2250",doteqdot:"\u2251",DotEqual:"\u2250",dotminus:"\u2238",dotplus:"\u2214",dotsquare:"\u22a1",doublebarwedge:"\u2306",DoubleContourIntegral:"\u222f",DoubleDot:"\xa8",DoubleDownArrow:"\u21d3",DoubleLeftArrow:"\u21d0",DoubleLeftRightArrow:"\u21d4",DoubleLeftTee:"\u2ae4",DoubleLongLeftArrow:"\u27f8",DoubleLongLeftRightArrow:"\u27fa",DoubleLongRightArrow:"\u27f9",DoubleRightArrow:"\u21d2",DoubleRightTee:"\u22a8",DoubleUpArrow:"\u21d1",DoubleUpDownArrow:"\u21d5",DoubleVerticalBar:"\u2225",DownArrowBar:"\u2913",downarrow:"\u2193",DownArrow:"\u2193",Downarrow:"\u21d3",DownArrowUpArrow:"\u21f5",DownBreve:"\u0311",downdownarrows:"\u21ca",downharpoonleft:"\u21c3",downharpoonright:"\u21c2",DownLeftRightVector:"\u2950",DownLeftTeeVector:"\u295e",DownLeftVectorBar:"\u2956",DownLeftVector:"\u21bd",DownRightTeeVector:"\u295f",DownRightVectorBar:"\u2957",DownRightVector:"\u21c1",DownTeeArrow:"\u21a7",DownTee:"\u22a4",drbkarow:"\u2910",drcorn:"\u231f",drcrop:"\u230c",Dscr:"\ud835\udc9f",dscr:"\ud835\udcb9",DScy:"\u0405",dscy:"\u0455",dsol:"\u29f6",Dstrok:"\u0110",dstrok:"\u0111",dtdot:"\u22f1",dtri:"\u25bf",dtrif:"\u25be",duarr:"\u21f5",duhar:"\u296f",dwangle:"\u29a6",DZcy:"\u040f",dzcy:"\u045f",dzigrarr:"\u27ff",Eacute:"\xc9",eacute:"\xe9",easter:"\u2a6e",Ecaron:"\u011a",ecaron:"\u011b",Ecirc:"\xca",ecirc:"\xea",ecir:"\u2256",ecolon:"\u2255",Ecy:"\u042d",ecy:"\u044d",eDDot:"\u2a77",Edot:"\u0116",edot:"\u0117",eDot:"\u2251",ee:"\u2147",efDot:"\u2252",Efr:"\ud835\udd08",efr:"\ud835\udd22",eg:"\u2a9a",Egrave:"\xc8",egrave:"\xe8",egs:"\u2a96",egsdot:"\u2a98",el:"\u2a99",Element:"\u2208",elinters:"\u23e7",ell:"\u2113",els:"\u2a95",elsdot:"\u2a97",Emacr:"\u0112",emacr:"\u0113",empty:"\u2205",emptyset:"\u2205",EmptySmallSquare:"\u25fb",emptyv:"\u2205",EmptyVerySmallSquare:"\u25ab",emsp13:"\u2004",emsp14:"\u2005",emsp:"\u2003",ENG:"\u014a",eng:"\u014b",ensp:"\u2002",Eogon:"\u0118",eogon:"\u0119",Eopf:"\ud835\udd3c",eopf:"\ud835\udd56",epar:"\u22d5",eparsl:"\u29e3",eplus:"\u2a71",epsi:"\u03b5",Epsilon:"\u0395",epsilon:"\u03b5",epsiv:"\u03f5",eqcirc:"\u2256",eqcolon:"\u2255",eqsim:"\u2242",eqslantgtr:"\u2a96",eqslantless:"\u2a95",Equal:"\u2a75",equals:"=",EqualTilde:"\u2242",equest:"\u225f",Equilibrium:"\u21cc",equiv:"\u2261",equivDD:"\u2a78",eqvparsl:"\u29e5",erarr:"\u2971",erDot:"\u2253",escr:"\u212f",Escr:"\u2130",esdot:"\u2250",Esim:"\u2a73",esim:"\u2242",Eta:"\u0397",eta:"\u03b7",ETH:"\xd0",eth:"\xf0",Euml:"\xcb",euml:"\xeb",euro:"\u20ac",excl:"!",exist:"\u2203",Exists:"\u2203",expectation:"\u2130",exponentiale:"\u2147",ExponentialE:"\u2147",fallingdotseq:"\u2252",Fcy:"\u0424",fcy:"\u0444",female:"\u2640",ffilig:"\ufb03",fflig:"\ufb00",ffllig:"\ufb04",Ffr:"\ud835\udd09",ffr:"\ud835\udd23",filig:"\ufb01",FilledSmallSquare:"\u25fc",FilledVerySmallSquare:"\u25aa",fjlig:"fj",flat:"\u266d",fllig:"\ufb02",fltns:"\u25b1",fnof:"\u0192",Fopf:"\ud835\udd3d",fopf:"\ud835\udd57",forall:"\u2200",ForAll:"\u2200",fork:"\u22d4",forkv:"\u2ad9",Fouriertrf:"\u2131",fpartint:"\u2a0d",frac12:"\xbd",frac13:"\u2153",frac14:"\xbc",frac15:"\u2155",frac16:"\u2159",frac18:"\u215b",frac23:"\u2154",frac25:"\u2156",frac34:"\xbe",frac35:"\u2157",frac38:"\u215c",frac45:"\u2158",frac56:"\u215a",frac58:"\u215d",frac78:"\u215e",frasl:"\u2044",frown:"\u2322",fscr:"\ud835\udcbb",Fscr:"\u2131",gacute:"\u01f5",Gamma:"\u0393",gamma:"\u03b3",Gammad:"\u03dc",gammad:"\u03dd",gap:"\u2a86",Gbreve:"\u011e",gbreve:"\u011f",Gcedil:"\u0122",Gcirc:"\u011c",gcirc:"\u011d",Gcy:"\u0413",gcy:"\u0433",Gdot:"\u0120",gdot:"\u0121",ge:"\u2265",gE:"\u2267",gEl:"\u2a8c",gel:"\u22db",geq:"\u2265",geqq:"\u2267",geqslant:"\u2a7e",gescc:"\u2aa9",ges:"\u2a7e",gesdot:"\u2a80",gesdoto:"\u2a82",gesdotol:"\u2a84",gesl:"\u22db\ufe00",gesles:"\u2a94",Gfr:"\ud835\udd0a",gfr:"\ud835\udd24",gg:"\u226b",Gg:"\u22d9",ggg:"\u22d9",gimel:"\u2137",GJcy:"\u0403",gjcy:"\u0453",gla:"\u2aa5",gl:"\u2277",glE:"\u2a92",glj:"\u2aa4",gnap:"\u2a8a",gnapprox:"\u2a8a",gne:"\u2a88",gnE:"\u2269",gneq:"\u2a88",gneqq:"\u2269",gnsim:"\u22e7",Gopf:"\ud835\udd3e",gopf:"\ud835\udd58",grave:"`",GreaterEqual:"\u2265",GreaterEqualLess:"\u22db",GreaterFullEqual:"\u2267",GreaterGreater:"\u2aa2",GreaterLess:"\u2277",GreaterSlantEqual:"\u2a7e",GreaterTilde:"\u2273",Gscr:"\ud835\udca2",gscr:"\u210a",gsim:"\u2273",gsime:"\u2a8e",gsiml:"\u2a90",gtcc:"\u2aa7",gtcir:"\u2a7a",gt:">",GT:">",Gt:"\u226b",gtdot:"\u22d7",gtlPar:"\u2995",gtquest:"\u2a7c",gtrapprox:"\u2a86",gtrarr:"\u2978",gtrdot:"\u22d7",gtreqless:"\u22db",gtreqqless:"\u2a8c",gtrless:"\u2277",gtrsim:"\u2273",gvertneqq:"\u2269\ufe00",gvnE:"\u2269\ufe00",Hacek:"\u02c7",hairsp:"\u200a",half:"\xbd",hamilt:"\u210b",HARDcy:"\u042a",hardcy:"\u044a",harrcir:"\u2948",harr:"\u2194",hArr:"\u21d4",harrw:"\u21ad",Hat:"^",hbar:"\u210f",Hcirc:"\u0124",hcirc:"\u0125",hearts:"\u2665",heartsuit:"\u2665",hellip:"\u2026",hercon:"\u22b9",hfr:"\ud835\udd25",Hfr:"\u210c",HilbertSpace:"\u210b",hksearow:"\u2925",hkswarow:"\u2926",hoarr:"\u21ff",homtht:"\u223b",hookleftarrow:"\u21a9",hookrightarrow:"\u21aa",hopf:"\ud835\udd59",Hopf:"\u210d",horbar:"\u2015",HorizontalLine:"\u2500",hscr:"\ud835\udcbd",Hscr:"\u210b",hslash:"\u210f",Hstrok:"\u0126",hstrok:"\u0127",HumpDownHump:"\u224e",HumpEqual:"\u224f",hybull:"\u2043",hyphen:"\u2010",Iacute:"\xcd",iacute:"\xed",ic:"\u2063",Icirc:"\xce",icirc:"\xee",Icy:"\u0418",icy:"\u0438",Idot:"\u0130",IEcy:"\u0415",iecy:"\u0435",iexcl:"\xa1",iff:"\u21d4",ifr:"\ud835\udd26",Ifr:"\u2111",Igrave:"\xcc",igrave:"\xec",ii:"\u2148",iiiint:"\u2a0c",iiint:"\u222d",iinfin:"\u29dc",iiota:"\u2129",IJlig:"\u0132",ijlig:"\u0133",Imacr:"\u012a",imacr:"\u012b",image:"\u2111",ImaginaryI:"\u2148",imagline:"\u2110",imagpart:"\u2111",imath:"\u0131",Im:"\u2111",imof:"\u22b7",imped:"\u01b5",Implies:"\u21d2",incare:"\u2105",in:"\u2208",infin:"\u221e",infintie:"\u29dd",inodot:"\u0131",intcal:"\u22ba",int:"\u222b",Int:"\u222c",integers:"\u2124",Integral:"\u222b",intercal:"\u22ba",Intersection:"\u22c2",intlarhk:"\u2a17",intprod:"\u2a3c",InvisibleComma:"\u2063",InvisibleTimes:"\u2062",IOcy:"\u0401",iocy:"\u0451",Iogon:"\u012e",iogon:"\u012f",Iopf:"\ud835\udd40",iopf:"\ud835\udd5a",Iota:"\u0399",iota:"\u03b9",iprod:"\u2a3c",iquest:"\xbf",iscr:"\ud835\udcbe",Iscr:"\u2110",isin:"\u2208",isindot:"\u22f5",isinE:"\u22f9",isins:"\u22f4",isinsv:"\u22f3",isinv:"\u2208",it:"\u2062",Itilde:"\u0128",itilde:"\u0129",Iukcy:"\u0406",iukcy:"\u0456",Iuml:"\xcf",iuml:"\xef",Jcirc:"\u0134",jcirc:"\u0135",Jcy:"\u0419",jcy:"\u0439",Jfr:"\ud835\udd0d",jfr:"\ud835\udd27",jmath:"\u0237",Jopf:"\ud835\udd41",jopf:"\ud835\udd5b",Jscr:"\ud835\udca5",jscr:"\ud835\udcbf",Jsercy:"\u0408",jsercy:"\u0458",Jukcy:"\u0404",jukcy:"\u0454",Kappa:"\u039a",kappa:"\u03ba",kappav:"\u03f0",Kcedil:"\u0136",kcedil:"\u0137",Kcy:"\u041a",kcy:"\u043a",Kfr:"\ud835\udd0e",kfr:"\ud835\udd28",kgreen:"\u0138",KHcy:"\u0425",khcy:"\u0445",KJcy:"\u040c",kjcy:"\u045c",Kopf:"\ud835\udd42",kopf:"\ud835\udd5c",Kscr:"\ud835\udca6",kscr:"\ud835\udcc0",lAarr:"\u21da",Lacute:"\u0139",lacute:"\u013a",laemptyv:"\u29b4",lagran:"\u2112",Lambda:"\u039b",lambda:"\u03bb",lang:"\u27e8",Lang:"\u27ea",langd:"\u2991",langle:"\u27e8",lap:"\u2a85",Laplacetrf:"\u2112",laquo:"\xab",larrb:"\u21e4",larrbfs:"\u291f",larr:"\u2190",Larr:"\u219e",lArr:"\u21d0",larrfs:"\u291d",larrhk:"\u21a9",larrlp:"\u21ab",larrpl:"\u2939",larrsim:"\u2973",larrtl:"\u21a2",latail:"\u2919",lAtail:"\u291b",lat:"\u2aab",late:"\u2aad",lates:"\u2aad\ufe00",lbarr:"\u290c",lBarr:"\u290e",lbbrk:"\u2772",lbrace:"{",lbrack:"[",lbrke:"\u298b",lbrksld:"\u298f",lbrkslu:"\u298d",Lcaron:"\u013d",lcaron:"\u013e",Lcedil:"\u013b",lcedil:"\u013c",lceil:"\u2308",lcub:"{",Lcy:"\u041b",lcy:"\u043b",ldca:"\u2936",ldquo:"\u201c",ldquor:"\u201e",ldrdhar:"\u2967",ldrushar:"\u294b",ldsh:"\u21b2",le:"\u2264",lE:"\u2266",LeftAngleBracket:"\u27e8",LeftArrowBar:"\u21e4",leftarrow:"\u2190",LeftArrow:"\u2190",Leftarrow:"\u21d0",LeftArrowRightArrow:"\u21c6",leftarrowtail:"\u21a2",LeftCeiling:"\u2308",LeftDoubleBracket:"\u27e6",LeftDownTeeVector:"\u2961",LeftDownVectorBar:"\u2959",LeftDownVector:"\u21c3",LeftFloor:"\u230a",leftharpoondown:"\u21bd",leftharpoonup:"\u21bc",leftleftarrows:"\u21c7",leftrightarrow:"\u2194",LeftRightArrow:"\u2194",Leftrightarrow:"\u21d4",leftrightarrows:"\u21c6",leftrightharpoons:"\u21cb",leftrightsquigarrow:"\u21ad",LeftRightVector:"\u294e",LeftTeeArrow:"\u21a4",LeftTee:"\u22a3",LeftTeeVector:"\u295a",leftthreetimes:"\u22cb",LeftTriangleBar:"\u29cf",LeftTriangle:"\u22b2",LeftTriangleEqual:"\u22b4",LeftUpDownVector:"\u2951",LeftUpTeeVector:"\u2960",LeftUpVectorBar:"\u2958",LeftUpVector:"\u21bf",LeftVectorBar:"\u2952",LeftVector:"\u21bc",lEg:"\u2a8b",leg:"\u22da",leq:"\u2264",leqq:"\u2266",leqslant:"\u2a7d",lescc:"\u2aa8",les:"\u2a7d",lesdot:"\u2a7f",lesdoto:"\u2a81",lesdotor:"\u2a83",lesg:"\u22da\ufe00",lesges:"\u2a93",lessapprox:"\u2a85",lessdot:"\u22d6",lesseqgtr:"\u22da",lesseqqgtr:"\u2a8b",LessEqualGreater:"\u22da",LessFullEqual:"\u2266",LessGreater:"\u2276",lessgtr:"\u2276",LessLess:"\u2aa1",lesssim:"\u2272",LessSlantEqual:"\u2a7d",LessTilde:"\u2272",lfisht:"\u297c",lfloor:"\u230a",Lfr:"\ud835\udd0f",lfr:"\ud835\udd29",lg:"\u2276",lgE:"\u2a91",lHar:"\u2962",lhard:"\u21bd",lharu:"\u21bc",lharul:"\u296a",lhblk:"\u2584",LJcy:"\u0409",ljcy:"\u0459",llarr:"\u21c7",ll:"\u226a",Ll:"\u22d8",llcorner:"\u231e",Lleftarrow:"\u21da",llhard:"\u296b",lltri:"\u25fa",Lmidot:"\u013f",lmidot:"\u0140",lmoustache:"\u23b0",lmoust:"\u23b0",lnap:"\u2a89",lnapprox:"\u2a89",lne:"\u2a87",lnE:"\u2268",lneq:"\u2a87",lneqq:"\u2268",lnsim:"\u22e6",loang:"\u27ec",loarr:"\u21fd",lobrk:"\u27e6",longleftarrow:"\u27f5",LongLeftArrow:"\u27f5",Longleftarrow:"\u27f8",longleftrightarrow:"\u27f7",LongLeftRightArrow:"\u27f7",Longleftrightarrow:"\u27fa",longmapsto:"\u27fc",longrightarrow:"\u27f6",LongRightArrow:"\u27f6",Longrightarrow:"\u27f9",looparrowleft:"\u21ab",looparrowright:"\u21ac",lopar:"\u2985",Lopf:"\ud835\udd43",lopf:"\ud835\udd5d",loplus:"\u2a2d",lotimes:"\u2a34",lowast:"\u2217",lowbar:"_",LowerLeftArrow:"\u2199",LowerRightArrow:"\u2198",loz:"\u25ca",lozenge:"\u25ca",lozf:"\u29eb",lpar:"(",lparlt:"\u2993",lrarr:"\u21c6",lrcorner:"\u231f",lrhar:"\u21cb",lrhard:"\u296d",lrm:"\u200e",lrtri:"\u22bf",lsaquo:"\u2039",lscr:"\ud835\udcc1",Lscr:"\u2112",lsh:"\u21b0",Lsh:"\u21b0",lsim:"\u2272",lsime:"\u2a8d",lsimg:"\u2a8f",lsqb:"[",lsquo:"\u2018",lsquor:"\u201a",Lstrok:"\u0141",lstrok:"\u0142",ltcc:"\u2aa6",ltcir:"\u2a79",lt:"<",LT:"<",Lt:"\u226a",ltdot:"\u22d6",lthree:"\u22cb",ltimes:"\u22c9",ltlarr:"\u2976",ltquest:"\u2a7b",ltri:"\u25c3",ltrie:"\u22b4",ltrif:"\u25c2",ltrPar:"\u2996",lurdshar:"\u294a",luruhar:"\u2966",lvertneqq:"\u2268\ufe00",lvnE:"\u2268\ufe00",macr:"\xaf",male:"\u2642",malt:"\u2720",maltese:"\u2720",Map:"\u2905",map:"\u21a6",mapsto:"\u21a6",mapstodown:"\u21a7",mapstoleft:"\u21a4",mapstoup:"\u21a5",marker:"\u25ae",mcomma:"\u2a29",Mcy:"\u041c",mcy:"\u043c",mdash:"\u2014",mDDot:"\u223a",measuredangle:"\u2221",MediumSpace:"\u205f",Mellintrf:"\u2133",Mfr:"\ud835\udd10",mfr:"\ud835\udd2a",mho:"\u2127",micro:"\xb5",midast:"*",midcir:"\u2af0",mid:"\u2223",middot:"\xb7",minusb:"\u229f",minus:"\u2212",minusd:"\u2238",minusdu:"\u2a2a",MinusPlus:"\u2213",mlcp:"\u2adb",mldr:"\u2026",mnplus:"\u2213",models:"\u22a7",Mopf:"\ud835\udd44",mopf:"\ud835\udd5e",mp:"\u2213",mscr:"\ud835\udcc2",Mscr:"\u2133",mstpos:"\u223e",Mu:"\u039c",mu:"\u03bc",multimap:"\u22b8",mumap:"\u22b8",nabla:"\u2207",Nacute:"\u0143",nacute:"\u0144",nang:"\u2220\u20d2",nap:"\u2249",napE:"\u2a70\u0338",napid:"\u224b\u0338",napos:"\u0149",napprox:"\u2249",natural:"\u266e",naturals:"\u2115",natur:"\u266e",nbsp:"\xa0",nbump:"\u224e\u0338",nbumpe:"\u224f\u0338",ncap:"\u2a43",Ncaron:"\u0147",ncaron:"\u0148",Ncedil:"\u0145",ncedil:"\u0146",ncong:"\u2247",ncongdot:"\u2a6d\u0338",ncup:"\u2a42",Ncy:"\u041d",ncy:"\u043d",ndash:"\u2013",nearhk:"\u2924",nearr:"\u2197",neArr:"\u21d7",nearrow:"\u2197",ne:"\u2260",nedot:"\u2250\u0338",NegativeMediumSpace:"\u200b",NegativeThickSpace:"\u200b",NegativeThinSpace:"\u200b",NegativeVeryThinSpace:"\u200b",nequiv:"\u2262",nesear:"\u2928",nesim:"\u2242\u0338",NestedGreaterGreater:"\u226b",NestedLessLess:"\u226a",NewLine:"\n",nexist:"\u2204",nexists:"\u2204",Nfr:"\ud835\udd11",nfr:"\ud835\udd2b",ngE:"\u2267\u0338",nge:"\u2271",ngeq:"\u2271",ngeqq:"\u2267\u0338",ngeqslant:"\u2a7e\u0338",nges:"\u2a7e\u0338",nGg:"\u22d9\u0338",ngsim:"\u2275",nGt:"\u226b\u20d2",ngt:"\u226f",ngtr:"\u226f",nGtv:"\u226b\u0338",nharr:"\u21ae",nhArr:"\u21ce",nhpar:"\u2af2",ni:"\u220b",nis:"\u22fc",nisd:"\u22fa",niv:"\u220b",NJcy:"\u040a",njcy:"\u045a",nlarr:"\u219a",nlArr:"\u21cd",nldr:"\u2025",nlE:"\u2266\u0338",nle:"\u2270",nleftarrow:"\u219a",nLeftarrow:"\u21cd",nleftrightarrow:"\u21ae",nLeftrightarrow:"\u21ce",nleq:"\u2270",nleqq:"\u2266\u0338",nleqslant:"\u2a7d\u0338",nles:"\u2a7d\u0338",nless:"\u226e",nLl:"\u22d8\u0338",nlsim:"\u2274",nLt:"\u226a\u20d2",nlt:"\u226e",nltri:"\u22ea",nltrie:"\u22ec",nLtv:"\u226a\u0338",nmid:"\u2224",NoBreak:"\u2060",NonBreakingSpace:"\xa0",nopf:"\ud835\udd5f",Nopf:"\u2115",Not:"\u2aec",not:"\xac",NotCongruent:"\u2262",NotCupCap:"\u226d",NotDoubleVerticalBar:"\u2226",NotElement:"\u2209",NotEqual:"\u2260",NotEqualTilde:"\u2242\u0338",NotExists:"\u2204",NotGreater:"\u226f",NotGreaterEqual:"\u2271",NotGreaterFullEqual:"\u2267\u0338",NotGreaterGreater:"\u226b\u0338",NotGreaterLess:"\u2279",NotGreaterSlantEqual:"\u2a7e\u0338",NotGreaterTilde:"\u2275",NotHumpDownHump:"\u224e\u0338",NotHumpEqual:"\u224f\u0338",notin:"\u2209",notindot:"\u22f5\u0338",notinE:"\u22f9\u0338",notinva:"\u2209",notinvb:"\u22f7",notinvc:"\u22f6",NotLeftTriangleBar:"\u29cf\u0338",NotLeftTriangle:"\u22ea",NotLeftTriangleEqual:"\u22ec",NotLess:"\u226e",NotLessEqual:"\u2270",NotLessGreater:"\u2278",NotLessLess:"\u226a\u0338",NotLessSlantEqual:"\u2a7d\u0338",NotLessTilde:"\u2274",NotNestedGreaterGreater:"\u2aa2\u0338",NotNestedLessLess:"\u2aa1\u0338",notni:"\u220c",notniva:"\u220c",notnivb:"\u22fe",notnivc:"\u22fd",NotPrecedes:"\u2280",NotPrecedesEqual:"\u2aaf\u0338",NotPrecedesSlantEqual:"\u22e0",NotReverseElement:"\u220c",NotRightTriangleBar:"\u29d0\u0338",NotRightTriangle:"\u22eb",NotRightTriangleEqual:"\u22ed",NotSquareSubset:"\u228f\u0338",NotSquareSubsetEqual:"\u22e2",NotSquareSuperset:"\u2290\u0338",NotSquareSupersetEqual:"\u22e3",NotSubset:"\u2282\u20d2",NotSubsetEqual:"\u2288",NotSucceeds:"\u2281",NotSucceedsEqual:"\u2ab0\u0338",NotSucceedsSlantEqual:"\u22e1",NotSucceedsTilde:"\u227f\u0338",NotSuperset:"\u2283\u20d2",NotSupersetEqual:"\u2289",NotTilde:"\u2241",NotTildeEqual:"\u2244",NotTildeFullEqual:"\u2247",NotTildeTilde:"\u2249",NotVerticalBar:"\u2224",nparallel:"\u2226",npar:"\u2226",nparsl:"\u2afd\u20e5",npart:"\u2202\u0338",npolint:"\u2a14",npr:"\u2280",nprcue:"\u22e0",nprec:"\u2280",npreceq:"\u2aaf\u0338",npre:"\u2aaf\u0338",nrarrc:"\u2933\u0338",nrarr:"\u219b",nrArr:"\u21cf",nrarrw:"\u219d\u0338",nrightarrow:"\u219b",nRightarrow:"\u21cf",nrtri:"\u22eb",nrtrie:"\u22ed",nsc:"\u2281",nsccue:"\u22e1",nsce:"\u2ab0\u0338",Nscr:"\ud835\udca9",nscr:"\ud835\udcc3",nshortmid:"\u2224",nshortparallel:"\u2226",nsim:"\u2241",nsime:"\u2244",nsimeq:"\u2244",nsmid:"\u2224",nspar:"\u2226",nsqsube:"\u22e2",nsqsupe:"\u22e3",nsub:"\u2284",nsubE:"\u2ac5\u0338",nsube:"\u2288",nsubset:"\u2282\u20d2",nsubseteq:"\u2288",nsubseteqq:"\u2ac5\u0338",nsucc:"\u2281",nsucceq:"\u2ab0\u0338",nsup:"\u2285",nsupE:"\u2ac6\u0338",nsupe:"\u2289",nsupset:"\u2283\u20d2",nsupseteq:"\u2289",nsupseteqq:"\u2ac6\u0338",ntgl:"\u2279",Ntilde:"\xd1",ntilde:"\xf1",ntlg:"\u2278",ntriangleleft:"\u22ea",ntrianglelefteq:"\u22ec",ntriangleright:"\u22eb",ntrianglerighteq:"\u22ed",Nu:"\u039d",nu:"\u03bd",num:"#",numero:"\u2116",numsp:"\u2007",nvap:"\u224d\u20d2",nvdash:"\u22ac",nvDash:"\u22ad",nVdash:"\u22ae",nVDash:"\u22af",nvge:"\u2265\u20d2",nvgt:">\u20d2",nvHarr:"\u2904",nvinfin:"\u29de",nvlArr:"\u2902",nvle:"\u2264\u20d2",nvlt:"<\u20d2",nvltrie:"\u22b4\u20d2",nvrArr:"\u2903",nvrtrie:"\u22b5\u20d2",nvsim:"\u223c\u20d2",nwarhk:"\u2923",nwarr:"\u2196",nwArr:"\u21d6",nwarrow:"\u2196",nwnear:"\u2927",Oacute:"\xd3",oacute:"\xf3",oast:"\u229b",Ocirc:"\xd4",ocirc:"\xf4",ocir:"\u229a",Ocy:"\u041e",ocy:"\u043e",odash:"\u229d",Odblac:"\u0150",odblac:"\u0151",odiv:"\u2a38",odot:"\u2299",odsold:"\u29bc",OElig:"\u0152",oelig:"\u0153",ofcir:"\u29bf",Ofr:"\ud835\udd12",ofr:"\ud835\udd2c",ogon:"\u02db",Ograve:"\xd2",ograve:"\xf2",ogt:"\u29c1",ohbar:"\u29b5",ohm:"\u03a9",oint:"\u222e",olarr:"\u21ba",olcir:"\u29be",olcross:"\u29bb",oline:"\u203e",olt:"\u29c0",Omacr:"\u014c",omacr:"\u014d",Omega:"\u03a9",omega:"\u03c9",Omicron:"\u039f",omicron:"\u03bf",omid:"\u29b6",ominus:"\u2296",Oopf:"\ud835\udd46",oopf:"\ud835\udd60",opar:"\u29b7",OpenCurlyDoubleQuote:"\u201c",OpenCurlyQuote:"\u2018",operp:"\u29b9",oplus:"\u2295",orarr:"\u21bb",Or:"\u2a54",or:"\u2228",ord:"\u2a5d",order:"\u2134",orderof:"\u2134",ordf:"\xaa",ordm:"\xba",origof:"\u22b6",oror:"\u2a56",orslope:"\u2a57",orv:"\u2a5b",oS:"\u24c8",Oscr:"\ud835\udcaa",oscr:"\u2134",Oslash:"\xd8",oslash:"\xf8",osol:"\u2298",Otilde:"\xd5",otilde:"\xf5",otimesas:"\u2a36",Otimes:"\u2a37",otimes:"\u2297",Ouml:"\xd6",ouml:"\xf6",ovbar:"\u233d",OverBar:"\u203e",OverBrace:"\u23de",OverBracket:"\u23b4",OverParenthesis:"\u23dc",para:"\xb6",parallel:"\u2225",par:"\u2225",parsim:"\u2af3",parsl:"\u2afd",part:"\u2202",PartialD:"\u2202",Pcy:"\u041f",pcy:"\u043f",percnt:"%",period:".",permil:"\u2030",perp:"\u22a5",pertenk:"\u2031",Pfr:"\ud835\udd13",pfr:"\ud835\udd2d",Phi:"\u03a6",phi:"\u03c6",phiv:"\u03d5",phmmat:"\u2133",phone:"\u260e",Pi:"\u03a0",pi:"\u03c0",pitchfork:"\u22d4",piv:"\u03d6",planck:"\u210f",planckh:"\u210e",plankv:"\u210f",plusacir:"\u2a23",plusb:"\u229e",pluscir:"\u2a22",plus:"+",plusdo:"\u2214",plusdu:"\u2a25",pluse:"\u2a72",PlusMinus:"\xb1",plusmn:"\xb1",plussim:"\u2a26",plustwo:"\u2a27",pm:"\xb1",Poincareplane:"\u210c",pointint:"\u2a15",popf:"\ud835\udd61",Popf:"\u2119",pound:"\xa3",prap:"\u2ab7",Pr:"\u2abb",pr:"\u227a",prcue:"\u227c",precapprox:"\u2ab7",prec:"\u227a",preccurlyeq:"\u227c",Precedes:"\u227a",PrecedesEqual:"\u2aaf",PrecedesSlantEqual:"\u227c",PrecedesTilde:"\u227e",preceq:"\u2aaf",precnapprox:"\u2ab9",precneqq:"\u2ab5",precnsim:"\u22e8",pre:"\u2aaf",prE:"\u2ab3",precsim:"\u227e",prime:"\u2032",Prime:"\u2033",primes:"\u2119",prnap:"\u2ab9",prnE:"\u2ab5",prnsim:"\u22e8",prod:"\u220f",Product:"\u220f",profalar:"\u232e",profline:"\u2312",profsurf:"\u2313",prop:"\u221d",Proportional:"\u221d",Proportion:"\u2237",propto:"\u221d",prsim:"\u227e",prurel:"\u22b0",Pscr:"\ud835\udcab",pscr:"\ud835\udcc5",Psi:"\u03a8",psi:"\u03c8",puncsp:"\u2008",Qfr:"\ud835\udd14",qfr:"\ud835\udd2e",qint:"\u2a0c",qopf:"\ud835\udd62",Qopf:"\u211a",qprime:"\u2057",Qscr:"\ud835\udcac",qscr:"\ud835\udcc6",quaternions:"\u210d",quatint:"\u2a16",quest:"?",questeq:"\u225f",quot:'"',QUOT:'"',rAarr:"\u21db",race:"\u223d\u0331",Racute:"\u0154",racute:"\u0155",radic:"\u221a",raemptyv:"\u29b3",rang:"\u27e9",Rang:"\u27eb",rangd:"\u2992",range:"\u29a5",rangle:"\u27e9",raquo:"\xbb",rarrap:"\u2975",rarrb:"\u21e5",rarrbfs:"\u2920",rarrc:"\u2933",rarr:"\u2192",Rarr:"\u21a0",rArr:"\u21d2",rarrfs:"\u291e",rarrhk:"\u21aa",rarrlp:"\u21ac",rarrpl:"\u2945",rarrsim:"\u2974",Rarrtl:"\u2916",rarrtl:"\u21a3",rarrw:"\u219d",ratail:"\u291a",rAtail:"\u291c",ratio:"\u2236",rationals:"\u211a",rbarr:"\u290d",rBarr:"\u290f",RBarr:"\u2910",rbbrk:"\u2773",rbrace:"}",rbrack:"]",rbrke:"\u298c",rbrksld:"\u298e",rbrkslu:"\u2990",Rcaron:"\u0158",rcaron:"\u0159",Rcedil:"\u0156",rcedil:"\u0157",rceil:"\u2309",rcub:"}",Rcy:"\u0420",rcy:"\u0440",rdca:"\u2937",rdldhar:"\u2969",rdquo:"\u201d",rdquor:"\u201d",rdsh:"\u21b3",real:"\u211c",realine:"\u211b",realpart:"\u211c",reals:"\u211d",Re:"\u211c",rect:"\u25ad",reg:"\xae",REG:"\xae",ReverseElement:"\u220b",ReverseEquilibrium:"\u21cb",ReverseUpEquilibrium:"\u296f",rfisht:"\u297d",rfloor:"\u230b",rfr:"\ud835\udd2f",Rfr:"\u211c",rHar:"\u2964",rhard:"\u21c1",rharu:"\u21c0",rharul:"\u296c",Rho:"\u03a1",rho:"\u03c1",rhov:"\u03f1",RightAngleBracket:"\u27e9",RightArrowBar:"\u21e5",rightarrow:"\u2192",RightArrow:"\u2192",Rightarrow:"\u21d2",RightArrowLeftArrow:"\u21c4",rightarrowtail:"\u21a3",RightCeiling:"\u2309",RightDoubleBracket:"\u27e7",RightDownTeeVector:"\u295d",RightDownVectorBar:"\u2955",RightDownVector:"\u21c2",RightFloor:"\u230b",rightharpoondown:"\u21c1",rightharpoonup:"\u21c0",rightleftarrows:"\u21c4",rightleftharpoons:"\u21cc",rightrightarrows:"\u21c9",rightsquigarrow:"\u219d",RightTeeArrow:"\u21a6",RightTee:"\u22a2",RightTeeVector:"\u295b",rightthreetimes:"\u22cc",RightTriangleBar:"\u29d0",RightTriangle:"\u22b3",RightTriangleEqual:"\u22b5",RightUpDownVector:"\u294f",RightUpTeeVector:"\u295c",RightUpVectorBar:"\u2954",RightUpVector:"\u21be",RightVectorBar:"\u2953",RightVector:"\u21c0",ring:"\u02da",risingdotseq:"\u2253",rlarr:"\u21c4",rlhar:"\u21cc",rlm:"\u200f",rmoustache:"\u23b1",rmoust:"\u23b1",rnmid:"\u2aee",roang:"\u27ed",roarr:"\u21fe",robrk:"\u27e7",ropar:"\u2986",ropf:"\ud835\udd63",Ropf:"\u211d",roplus:"\u2a2e",rotimes:"\u2a35",RoundImplies:"\u2970",rpar:")",rpargt:"\u2994",rppolint:"\u2a12",rrarr:"\u21c9",Rrightarrow:"\u21db",rsaquo:"\u203a",rscr:"\ud835\udcc7",Rscr:"\u211b",rsh:"\u21b1",Rsh:"\u21b1",rsqb:"]",rsquo:"\u2019",rsquor:"\u2019",rthree:"\u22cc",rtimes:"\u22ca",rtri:"\u25b9",rtrie:"\u22b5",rtrif:"\u25b8",rtriltri:"\u29ce",RuleDelayed:"\u29f4",ruluhar:"\u2968",rx:"\u211e",Sacute:"\u015a",sacute:"\u015b",sbquo:"\u201a",scap:"\u2ab8",Scaron:"\u0160",scaron:"\u0161",Sc:"\u2abc",sc:"\u227b",sccue:"\u227d",sce:"\u2ab0",scE:"\u2ab4",Scedil:"\u015e",scedil:"\u015f",Scirc:"\u015c",scirc:"\u015d",scnap:"\u2aba",scnE:"\u2ab6",scnsim:"\u22e9",scpolint:"\u2a13",scsim:"\u227f",Scy:"\u0421",scy:"\u0441",sdotb:"\u22a1",sdot:"\u22c5",sdote:"\u2a66",searhk:"\u2925",searr:"\u2198",seArr:"\u21d8",searrow:"\u2198",sect:"\xa7",semi:";",seswar:"\u2929",setminus:"\u2216",setmn:"\u2216",sext:"\u2736",Sfr:"\ud835\udd16",sfr:"\ud835\udd30",sfrown:"\u2322",sharp:"\u266f",SHCHcy:"\u0429",shchcy:"\u0449",SHcy:"\u0428",shcy:"\u0448",ShortDownArrow:"\u2193",ShortLeftArrow:"\u2190",shortmid:"\u2223",shortparallel:"\u2225",ShortRightArrow:"\u2192",ShortUpArrow:"\u2191",shy:"\xad",Sigma:"\u03a3",sigma:"\u03c3",sigmaf:"\u03c2",sigmav:"\u03c2",sim:"\u223c",simdot:"\u2a6a",sime:"\u2243",simeq:"\u2243",simg:"\u2a9e",simgE:"\u2aa0",siml:"\u2a9d",simlE:"\u2a9f",simne:"\u2246",simplus:"\u2a24",simrarr:"\u2972",slarr:"\u2190",SmallCircle:"\u2218",smallsetminus:"\u2216",smashp:"\u2a33",smeparsl:"\u29e4",smid:"\u2223",smile:"\u2323",smt:"\u2aaa",smte:"\u2aac",smtes:"\u2aac\ufe00",SOFTcy:"\u042c",softcy:"\u044c",solbar:"\u233f",solb:"\u29c4",sol:"/",Sopf:"\ud835\udd4a",sopf:"\ud835\udd64",spades:"\u2660",spadesuit:"\u2660",spar:"\u2225",sqcap:"\u2293",sqcaps:"\u2293\ufe00",sqcup:"\u2294",sqcups:"\u2294\ufe00",Sqrt:"\u221a",sqsub:"\u228f",sqsube:"\u2291",sqsubset:"\u228f",sqsubseteq:"\u2291",sqsup:"\u2290",sqsupe:"\u2292",sqsupset:"\u2290",sqsupseteq:"\u2292",square:"\u25a1",Square:"\u25a1",SquareIntersection:"\u2293",SquareSubset:"\u228f",SquareSubsetEqual:"\u2291",SquareSuperset:"\u2290",SquareSupersetEqual:"\u2292",SquareUnion:"\u2294",squarf:"\u25aa",squ:"\u25a1",squf:"\u25aa",srarr:"\u2192",Sscr:"\ud835\udcae",sscr:"\ud835\udcc8",ssetmn:"\u2216",ssmile:"\u2323",sstarf:"\u22c6",Star:"\u22c6",star:"\u2606",starf:"\u2605",straightepsilon:"\u03f5",straightphi:"\u03d5",strns:"\xaf",sub:"\u2282",Sub:"\u22d0",subdot:"\u2abd",subE:"\u2ac5",sube:"\u2286",subedot:"\u2ac3",submult:"\u2ac1",subnE:"\u2acb",subne:"\u228a",subplus:"\u2abf",subrarr:"\u2979",subset:"\u2282",Subset:"\u22d0",subseteq:"\u2286",subseteqq:"\u2ac5",SubsetEqual:"\u2286",subsetneq:"\u228a",subsetneqq:"\u2acb",subsim:"\u2ac7",subsub:"\u2ad5",subsup:"\u2ad3",succapprox:"\u2ab8",succ:"\u227b",succcurlyeq:"\u227d",Succeeds:"\u227b",SucceedsEqual:"\u2ab0",SucceedsSlantEqual:"\u227d",SucceedsTilde:"\u227f",succeq:"\u2ab0",succnapprox:"\u2aba",succneqq:"\u2ab6",succnsim:"\u22e9",succsim:"\u227f",SuchThat:"\u220b",sum:"\u2211",Sum:"\u2211",sung:"\u266a",sup1:"\xb9",sup2:"\xb2",sup3:"\xb3",sup:"\u2283",Sup:"\u22d1",supdot:"\u2abe",supdsub:"\u2ad8",supE:"\u2ac6",supe:"\u2287",supedot:"\u2ac4",Superset:"\u2283",SupersetEqual:"\u2287",suphsol:"\u27c9",suphsub:"\u2ad7",suplarr:"\u297b",supmult:"\u2ac2",supnE:"\u2acc",supne:"\u228b",supplus:"\u2ac0",supset:"\u2283",Supset:"\u22d1",supseteq:"\u2287",supseteqq:"\u2ac6",supsetneq:"\u228b",supsetneqq:"\u2acc",supsim:"\u2ac8",supsub:"\u2ad4",supsup:"\u2ad6",swarhk:"\u2926",swarr:"\u2199",swArr:"\u21d9",swarrow:"\u2199",swnwar:"\u292a",szlig:"\xdf",Tab:"\t",target:"\u2316",Tau:"\u03a4",tau:"\u03c4",tbrk:"\u23b4",Tcaron:"\u0164",tcaron:"\u0165",Tcedil:"\u0162",tcedil:"\u0163",Tcy:"\u0422",tcy:"\u0442",tdot:"\u20db",telrec:"\u2315",Tfr:"\ud835\udd17",tfr:"\ud835\udd31",there4:"\u2234",therefore:"\u2234",Therefore:"\u2234",Theta:"\u0398",theta:"\u03b8",thetasym:"\u03d1",thetav:"\u03d1",thickapprox:"\u2248",thicksim:"\u223c",ThickSpace:"\u205f\u200a",ThinSpace:"\u2009",thinsp:"\u2009",thkap:"\u2248",thksim:"\u223c",THORN:"\xde",thorn:"\xfe",tilde:"\u02dc",Tilde:"\u223c",TildeEqual:"\u2243",TildeFullEqual:"\u2245",TildeTilde:"\u2248",timesbar:"\u2a31",timesb:"\u22a0",times:"\xd7",timesd:"\u2a30",tint:"\u222d",toea:"\u2928",topbot:"\u2336",topcir:"\u2af1",top:"\u22a4",Topf:"\ud835\udd4b",topf:"\ud835\udd65",topfork:"\u2ada",tosa:"\u2929",tprime:"\u2034",trade:"\u2122",TRADE:"\u2122",triangle:"\u25b5",triangledown:"\u25bf",triangleleft:"\u25c3",trianglelefteq:"\u22b4",triangleq:"\u225c",triangleright:"\u25b9",trianglerighteq:"\u22b5",tridot:"\u25ec",trie:"\u225c",triminus:"\u2a3a",TripleDot:"\u20db",triplus:"\u2a39",trisb:"\u29cd",tritime:"\u2a3b",trpezium:"\u23e2",Tscr:"\ud835\udcaf",tscr:"\ud835\udcc9",TScy:"\u0426",tscy:"\u0446",TSHcy:"\u040b",tshcy:"\u045b",Tstrok:"\u0166",tstrok:"\u0167",twixt:"\u226c",twoheadleftarrow:"\u219e",twoheadrightarrow:"\u21a0",Uacute:"\xda",uacute:"\xfa",uarr:"\u2191",Uarr:"\u219f",uArr:"\u21d1",Uarrocir:"\u2949",Ubrcy:"\u040e",ubrcy:"\u045e",Ubreve:"\u016c",ubreve:"\u016d",Ucirc:"\xdb",ucirc:"\xfb",Ucy:"\u0423",ucy:"\u0443",udarr:"\u21c5",Udblac:"\u0170",udblac:"\u0171",udhar:"\u296e",ufisht:"\u297e",Ufr:"\ud835\udd18",ufr:"\ud835\udd32",Ugrave:"\xd9",ugrave:"\xf9",uHar:"\u2963",uharl:"\u21bf",uharr:"\u21be",uhblk:"\u2580",ulcorn:"\u231c",ulcorner:"\u231c",ulcrop:"\u230f",ultri:"\u25f8",Umacr:"\u016a",umacr:"\u016b",uml:"\xa8",UnderBar:"_",UnderBrace:"\u23df",UnderBracket:"\u23b5",UnderParenthesis:"\u23dd",Union:"\u22c3",UnionPlus:"\u228e",Uogon:"\u0172",uogon:"\u0173",Uopf:"\ud835\udd4c",uopf:"\ud835\udd66",UpArrowBar:"\u2912",uparrow:"\u2191",UpArrow:"\u2191",Uparrow:"\u21d1",UpArrowDownArrow:"\u21c5",updownarrow:"\u2195",UpDownArrow:"\u2195",Updownarrow:"\u21d5",UpEquilibrium:"\u296e",upharpoonleft:"\u21bf",upharpoonright:"\u21be",uplus:"\u228e",UpperLeftArrow:"\u2196",UpperRightArrow:"\u2197",upsi:"\u03c5",Upsi:"\u03d2",upsih:"\u03d2",Upsilon:"\u03a5",upsilon:"\u03c5",UpTeeArrow:"\u21a5",UpTee:"\u22a5",upuparrows:"\u21c8",urcorn:"\u231d",urcorner:"\u231d",urcrop:"\u230e",Uring:"\u016e",uring:"\u016f",urtri:"\u25f9",Uscr:"\ud835\udcb0",uscr:"\ud835\udcca",utdot:"\u22f0",Utilde:"\u0168",utilde:"\u0169",utri:"\u25b5",utrif:"\u25b4",uuarr:"\u21c8",Uuml:"\xdc",uuml:"\xfc",uwangle:"\u29a7",vangrt:"\u299c",varepsilon:"\u03f5",varkappa:"\u03f0",varnothing:"\u2205",varphi:"\u03d5",varpi:"\u03d6",varpropto:"\u221d",varr:"\u2195",vArr:"\u21d5",varrho:"\u03f1",varsigma:"\u03c2",varsubsetneq:"\u228a\ufe00",varsubsetneqq:"\u2acb\ufe00",varsupsetneq:"\u228b\ufe00",varsupsetneqq:"\u2acc\ufe00",vartheta:"\u03d1",vartriangleleft:"\u22b2",vartriangleright:"\u22b3",vBar:"\u2ae8",Vbar:"\u2aeb",vBarv:"\u2ae9",Vcy:"\u0412",vcy:"\u0432",vdash:"\u22a2",vDash:"\u22a8",Vdash:"\u22a9",VDash:"\u22ab",Vdashl:"\u2ae6",veebar:"\u22bb",vee:"\u2228",Vee:"\u22c1",veeeq:"\u225a",vellip:"\u22ee",verbar:"|",Verbar:"\u2016",vert:"|",Vert:"\u2016",VerticalBar:"\u2223",VerticalLine:"|",VerticalSeparator:"\u2758",VerticalTilde:"\u2240",VeryThinSpace:"\u200a",Vfr:"\ud835\udd19",vfr:"\ud835\udd33",vltri:"\u22b2",vnsub:"\u2282\u20d2",vnsup:"\u2283\u20d2",Vopf:"\ud835\udd4d",vopf:"\ud835\udd67",vprop:"\u221d",vrtri:"\u22b3",Vscr:"\ud835\udcb1",vscr:"\ud835\udccb",vsubnE:"\u2acb\ufe00",vsubne:"\u228a\ufe00",vsupnE:"\u2acc\ufe00",vsupne:"\u228b\ufe00",Vvdash:"\u22aa",vzigzag:"\u299a",Wcirc:"\u0174",wcirc:"\u0175",wedbar:"\u2a5f",wedge:"\u2227",Wedge:"\u22c0",wedgeq:"\u2259",weierp:"\u2118",Wfr:"\ud835\udd1a",wfr:"\ud835\udd34",Wopf:"\ud835\udd4e",wopf:"\ud835\udd68",wp:"\u2118",wr:"\u2240",wreath:"\u2240",Wscr:"\ud835\udcb2",wscr:"\ud835\udccc",xcap:"\u22c2",xcirc:"\u25ef",xcup:"\u22c3",xdtri:"\u25bd",Xfr:"\ud835\udd1b",xfr:"\ud835\udd35",xharr:"\u27f7",xhArr:"\u27fa",Xi:"\u039e",xi:"\u03be",xlarr:"\u27f5",xlArr:"\u27f8",xmap:"\u27fc",xnis:"\u22fb",xodot:"\u2a00",Xopf:"\ud835\udd4f",xopf:"\ud835\udd69",xoplus:"\u2a01",xotime:"\u2a02",xrarr:"\u27f6",xrArr:"\u27f9",Xscr:"\ud835\udcb3",xscr:"\ud835\udccd",xsqcup:"\u2a06",xuplus:"\u2a04",xutri:"\u25b3",xvee:"\u22c1",xwedge:"\u22c0",Yacute:"\xdd",yacute:"\xfd",YAcy:"\u042f",yacy:"\u044f",Ycirc:"\u0176",ycirc:"\u0177",Ycy:"\u042b",ycy:"\u044b",yen:"\xa5",Yfr:"\ud835\udd1c",yfr:"\ud835\udd36",YIcy:"\u0407",yicy:"\u0457",Yopf:"\ud835\udd50",yopf:"\ud835\udd6a",Yscr:"\ud835\udcb4",yscr:"\ud835\udcce",YUcy:"\u042e",yucy:"\u044e",yuml:"\xff",Yuml:"\u0178",Zacute:"\u0179",zacute:"\u017a",Zcaron:"\u017d",zcaron:"\u017e",Zcy:"\u0417",zcy:"\u0437",Zdot:"\u017b",zdot:"\u017c",zeetrf:"\u2128",ZeroWidthSpace:"\u200b",Zeta:"\u0396",zeta:"\u03b6",zfr:"\ud835\udd37",Zfr:"\u2128",ZHcy:"\u0416",zhcy:"\u0436",zigrarr:"\u21dd",zopf:"\ud835\udd6b",Zopf:"\u2124",Zscr:"\ud835\udcb5",zscr:"\ud835\udccf",zwj:"\u200d",zwnj:"\u200c"}},{}],53:[function(c,e,r){"use strict";function n(t){return Array.prototype.slice.call(arguments,1).forEach(function(r){r&&Object.keys(r).forEach(function(e){t[e]=r[e]})}),t}function l(e){return Object.prototype.toString.call(e)}function u(e){return"[object Function]"===l(e)}function p(e){return e.replace(/[.?*+^$[\]\\(){}|-]/g,"\\$&")}var s={fuzzyLink:!0,fuzzyEmail:!0,fuzzyIP:!1};var o={"http:":{validate:function(e,r,t){var n=e.slice(r);return t.re.http||(t.re.http=new RegExp("^\\/\\/"+t.re.src_auth+t.re.src_host_port_strict+t.re.src_path,"i")),t.re.http.test(n)?n.match(t.re.http)[0].length:0}},"https:":"http:","ftp:":"http:","//":{validate:function(e,r,t){var n=e.slice(r);return t.re.no_http||(t.re.no_http=new RegExp("^"+t.re.src_auth+"(?:localhost|(?:(?:"+t.re.src_domain+")\\.)+"+t.re.src_domain_root+")"+t.re.src_port+t.re.src_host_terminator+t.re.src_path,"i")),t.re.no_http.test(n)?3<=r&&":"===e[r-3]?0:3<=r&&"/"===e[r-3]?0:n.match(t.re.no_http)[0].length:0}},"mailto:":{validate:function(e,r,t){var n=e.slice(r);return t.re.mailto||(t.re.mailto=new RegExp("^"+t.re.src_email_name+"@"+t.re.src_host_strict,"i")),t.re.mailto.test(n)?n.match(t.re.mailto)[0].length:0}}},h="a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]",i="biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");function a(s){var r=s.re=c("./lib/re")(s.__opts__),e=s.__tlds__.slice();function t(e){return e.replace("%TLDS%",r.src_tlds)}s.onCompile(),s.__tlds_replaced__||e.push(h),e.push(r.src_xn),r.src_tlds=e.join("|"),r.email_fuzzy=RegExp(t(r.tpl_email_fuzzy),"i"),r.link_fuzzy=RegExp(t(r.tpl_link_fuzzy),"i"),r.link_no_ip_fuzzy=RegExp(t(r.tpl_link_no_ip_fuzzy),"i"),r.host_fuzzy_test=RegExp(t(r.tpl_host_fuzzy_test),"i");var o=[];function i(e,r){throw new Error('(LinkifyIt) Invalid schema "'+e+'": '+r)}s.__compiled__={},Object.keys(s.__schemas__).forEach(function(e){var r=s.__schemas__[e];if(null!==r){var n,t={validate:null,link:null};if(s.__compiled__[e]=t,"[object Object]"===l(r))return"[object RegExp]"===l(r.validate)?t.validate=(n=r.validate,function(e,r){var t=e.slice(r);return n.test(t)?t.match(n)[0].length:0}):u(r.validate)?t.validate=r.validate:i(e,r),void(u(r.normalize)?t.normalize=r.normalize:r.normalize?i(e,r):t.normalize=function(e,r){r.normalize(e)});if("[object String]"!==l(r))i(e,r);else o.push(e)}}),o.forEach(function(e){s.__compiled__[s.__schemas__[e]]&&(s.__compiled__[e].validate=s.__compiled__[s.__schemas__[e]].validate,s.__compiled__[e].normalize=s.__compiled__[s.__schemas__[e]].normalize)}),s.__compiled__[""]={validate:null,normalize:function(e,r){r.normalize(e)}};var n,a=Object.keys(s.__compiled__).filter(function(e){return 0<e.length&&s.__compiled__[e]}).map(p).join("|");s.re.schema_test=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","i"),s.re.schema_search=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","ig"),s.re.pretest=RegExp("("+s.re.schema_test.source+")|("+s.re.host_fuzzy_test.source+")|@","i"),(n=s).__index__=-1,n.__text_cache__=""}function f(e,r){var t=new function(e,r){var t=e.__index__,n=e.__last_index__,s=e.__text_cache__.slice(t,n);this.schema=e.__schema__.toLowerCase(),this.index=t+r,this.lastIndex=n+r,this.raw=s,this.text=s,this.url=s}(e,r);return e.__compiled__[t.schema].normalize(t,e),t}function d(e,r){if(!(this instanceof d))return new d(e,r);var t;r||(t=e,Object.keys(t||{}).reduce(function(e,r){return e||s.hasOwnProperty(r)},!1)&&(r=e,e={})),this.__opts__=n({},s,r),this.__index__=-1,this.__last_index__=-1,this.__schema__="",this.__text_cache__="",this.__schemas__=n({},o,e),this.__compiled__={},this.__tlds__=i,this.__tlds_replaced__=!1,this.re={},a(this)}d.prototype.add=function(e,r){return this.__schemas__[e]=r,a(this),this},d.prototype.set=function(e){return this.__opts__=n(this.__opts__,e),this},d.prototype.test=function(e){if(this.__text_cache__=e,this.__index__=-1,!e.length)return!1;var r,t,n,s,o,i,a,c;if(this.re.schema_test.test(e))for((a=this.re.schema_search).lastIndex=0;null!==(r=a.exec(e));)if(s=this.testSchemaAt(e,r[2],a.lastIndex)){this.__schema__=r[2],this.__index__=r.index+r[1].length,this.__last_index__=r.index+r[0].length+s;break}return this.__opts__.fuzzyLink&&this.__compiled__["http:"]&&0<=(c=e.search(this.re.host_fuzzy_test))&&(this.__index__<0||c<this.__index__)&&null!==(t=e.match(this.__opts__.fuzzyIP?this.re.link_fuzzy:this.re.link_no_ip_fuzzy))&&(o=t.index+t[1].length,(this.__index__<0||o<this.__index__)&&(this.__schema__="",this.__index__=o,this.__last_index__=t.index+t[0].length)),this.__opts__.fuzzyEmail&&this.__compiled__["mailto:"]&&0<=e.indexOf("@")&&null!==(n=e.match(this.re.email_fuzzy))&&(o=n.index+n[1].length,i=n.index+n[0].length,(this.__index__<0||o<this.__index__||o===this.__index__&&i>this.__last_index__)&&(this.__schema__="mailto:",this.__index__=o,this.__last_index__=i)),0<=this.__index__},d.prototype.pretest=function(e){return this.re.pretest.test(e)},d.prototype.testSchemaAt=function(e,r,t){return this.__compiled__[r.toLowerCase()]?this.__compiled__[r.toLowerCase()].validate(e,t,this):0},d.prototype.match=function(e){var r=0,t=[];0<=this.__index__&&this.__text_cache__===e&&(t.push(f(this,r)),r=this.__last_index__);for(var n=r?e.slice(r):e;this.test(n);)t.push(f(this,r)),n=n.slice(this.__last_index__),r+=this.__last_index__;return t.length?t:null},d.prototype.tlds=function(e,r){return e=Array.isArray(e)?e:[e],r?this.__tlds__=this.__tlds__.concat(e).sort().filter(function(e,r,t){return e!==t[r-1]}).reverse():(this.__tlds__=e.slice(),this.__tlds_replaced__=!0),a(this),this},d.prototype.normalize=function(e){e.schema||(e.url="http://"+e.url),"mailto:"!==e.schema||/^mailto:/i.test(e.url)||(e.url="mailto:"+e.url)},d.prototype.onCompile=function(){},e.exports=d},{"./lib/re":54}],54:[function(n,e,r){"use strict";e.exports=function(e){var r={};r.src_Any=n("uc.micro/properties/Any/regex").source,r.src_Cc=n("uc.micro/categories/Cc/regex").source,r.src_Z=n("uc.micro/categories/Z/regex").source,r.src_P=n("uc.micro/categories/P/regex").source,r.src_ZPCc=[r.src_Z,r.src_P,r.src_Cc].join("|"),r.src_ZCc=[r.src_Z,r.src_Cc].join("|");var t="[><\uff5c]";return r.src_pseudo_letter="(?:(?![><\uff5c]|"+r.src_ZPCc+")"+r.src_Any+")",r.src_ip4="(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)",r.src_auth="(?:(?:(?!"+r.src_ZCc+"|[@/\\[\\]()]).)+@)?",r.src_port="(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?",r.src_host_terminator="(?=$|[><\uff5c]|"+r.src_ZPCc+")(?!-|_|:\\d|\\.-|\\.(?!$|"+r.src_ZPCc+"))",r.src_path="(?:[/?#](?:(?!"+r.src_ZCc+"|"+t+"|[()[\\]{}.,\"'?!\\-]).|\\[(?:(?!"+r.src_ZCc+"|\\]).)*\\]|\\((?:(?!"+r.src_ZCc+"|[)]).)*\\)|\\{(?:(?!"+r.src_ZCc+'|[}]).)*\\}|\\"(?:(?!'+r.src_ZCc+'|["]).)+\\"|\\\'(?:(?!'+r.src_ZCc+"|[']).)+\\'|\\'(?="+r.src_pseudo_letter+"|[-]).|\\.{2,3}[a-zA-Z0-9%/]|\\.(?!"+r.src_ZCc+"|[.]).|"+(e&&e["---"]?"\\-(?!--(?:[^-]|$))(?:-*)|":"\\-+|")+"\\,(?!"+r.src_ZCc+").|\\!(?!"+r.src_ZCc+"|[!]).|\\?(?!"+r.src_ZCc+"|[?]).)+|\\/)?",r.src_email_name='[\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]+',r.src_xn="xn--[a-z0-9\\-]{1,59}",r.src_domain_root="(?:"+r.src_xn+"|"+r.src_pseudo_letter+"{1,63})",r.src_domain="(?:"+r.src_xn+"|(?:"+r.src_pseudo_letter+")|(?:"+r.src_pseudo_letter+"(?:-(?!-)|"+r.src_pseudo_letter+"){0,61}"+r.src_pseudo_letter+"))",r.src_host="(?:(?:(?:(?:"+r.src_domain+")\\.)*"+r.src_domain+"))",r.tpl_host_fuzzy="(?:"+r.src_ip4+"|(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%)))",r.tpl_host_no_ip_fuzzy="(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%))",r.src_host_strict=r.src_host+r.src_host_terminator,r.tpl_host_fuzzy_strict=r.tpl_host_fuzzy+r.src_host_terminator,r.src_host_port_strict=r.src_host+r.src_port+r.src_host_terminator,r.tpl_host_port_fuzzy_strict=r.tpl_host_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_port_no_ip_fuzzy_strict=r.tpl_host_no_ip_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_fuzzy_test="localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:"+r.src_ZPCc+"|>|$))",r.tpl_email_fuzzy="(^|[><\uff5c]|\\(|"+r.src_ZCc+")("+r.src_email_name+"@"+r.tpl_host_fuzzy_strict+")",r.tpl_link_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_fuzzy_strict+r.src_path+")",r.tpl_link_no_ip_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_no_ip_fuzzy_strict+r.src_path+")",r}},{"uc.micro/categories/Cc/regex":61,"uc.micro/categories/P/regex":63,"uc.micro/categories/Z/regex":64,"uc.micro/properties/Any/regex":66}],55:[function(e,r,t){"use strict";var s={};function n(e,r){var l;return"string"!=typeof r&&(r=n.defaultChars),l=function(e){var r,t,n=s[e];if(n)return n;for(n=s[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),n.push(t);for(r=0;r<e.length;r++)n[t=e.charCodeAt(r)]="%"+("0"+t.toString(16).toUpperCase()).slice(-2);return n}(r),e.replace(/(%[a-f0-9]{2})+/gi,function(e){var r,t,n,s,o,i,a,c="";for(r=0,t=e.length;r<t;r+=3)(n=parseInt(e.slice(r+1,r+3),16))<128?c+=l[n]:192==(224&n)&&r+3<t&&128==(192&(s=parseInt(e.slice(r+4,r+6),16)))?(c+=(a=n<<6&1984|63&s)<128?"\ufffd\ufffd":String.fromCharCode(a),r+=3):224==(240&n)&&r+6<t&&(s=parseInt(e.slice(r+4,r+6),16),o=parseInt(e.slice(r+7,r+9),16),128==(192&s)&&128==(192&o))?(c+=(a=n<<12&61440|s<<6&4032|63&o)<2048||55296<=a&&a<=57343?"\ufffd\ufffd\ufffd":String.fromCharCode(a),r+=6):240==(248&n)&&r+9<t&&(s=parseInt(e.slice(r+4,r+6),16),o=parseInt(e.slice(r+7,r+9),16),i=parseInt(e.slice(r+10,r+12),16),128==(192&s)&&128==(192&o)&&128==(192&i))?((a=n<<18&1835008|s<<12&258048|o<<6&4032|63&i)<65536||1114111<a?c+="\ufffd\ufffd\ufffd\ufffd":(a-=65536,c+=String.fromCharCode(55296+(a>>10),56320+(1023&a))),r+=9):c+="\ufffd";return c})}n.defaultChars=";/?:@&=+$,#",n.componentChars="",r.exports=n},{}],56:[function(e,r,t){"use strict";var l={};function u(e,r,t){var n,s,o,i,a,c="";for("string"!=typeof r&&(t=r,r=u.defaultChars),void 0===t&&(t=!0),a=function(e){var r,t,n=l[e];if(n)return n;for(n=l[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),/^[0-9a-z]$/i.test(t)?n.push(t):n.push("%"+("0"+r.toString(16).toUpperCase()).slice(-2));for(r=0;r<e.length;r++)n[e.charCodeAt(r)]=e[r];return n}(r),n=0,s=e.length;n<s;n++)if(o=e.charCodeAt(n),t&&37===o&&n+2<s&&/^[0-9a-f]{2}$/i.test(e.slice(n+1,n+3)))c+=e.slice(n,n+3),n+=2;else if(o<128)c+=a[o];else if(55296<=o&&o<=57343){if(55296<=o&&o<=56319&&n+1<s&&56320<=(i=e.charCodeAt(n+1))&&i<=57343){c+=encodeURIComponent(e[n]+e[n+1]),n++;continue}c+="%EF%BF%BD"}else c+=encodeURIComponent(e[n]);return c}u.defaultChars=";/?:@&=+$,-_.!~*'()#",u.componentChars="-_.!~*'()",r.exports=u},{}],57:[function(e,r,t){"use strict";r.exports=function(e){var r="";return r+=e.protocol||"",r+=e.slashes?"//":"",r+=e.auth?e.auth+"@":"",e.hostname&&-1!==e.hostname.indexOf(":")?r+="["+e.hostname+"]":r+=e.hostname||"",r+=e.port?":"+e.port:"",r+=e.pathname||"",r+=e.search||"",r+=e.hash||""}},{}],58:[function(e,r,t){"use strict";r.exports.encode=e("./encode"),r.exports.decode=e("./decode"),r.exports.format=e("./format"),r.exports.parse=e("./parse")},{"./decode":55,"./encode":56,"./format":57,"./parse":59}],59:[function(e,r,t){"use strict";function n(){this.protocol=null,this.slashes=null,this.auth=null,this.port=null,this.hostname=null,this.hash=null,this.search=null,this.pathname=null}var w=/^([a-z0-9.+-]+:)/i,s=/:[0-9]*$/,D=/^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,o=["{","}","|","\\","^","`"].concat(["<",">",'"',"`"," ","\r","\n","\t"]),i=["'"].concat(o),E=["%","/","?",";","#"].concat(i),q=["/","?","#"],S=/^[+a-z0-9A-Z_-]{0,63}$/,F=/^([+a-z0-9A-Z_-]{0,63})(.*)$/,L={javascript:!0,"javascript:":!0},z={http:!0,https:!0,ftp:!0,gopher:!0,file:!0,"http:":!0,"https:":!0,"ftp:":!0,"gopher:":!0,"file:":!0};n.prototype.parse=function(e,r){var t,n,s,o,i,a=e;if(a=a.trim(),!r&&1===e.split("#").length){var c=D.exec(a);if(c)return this.pathname=c[1],c[2]&&(this.search=c[2]),this}var l=w.exec(a);if(l&&(s=(l=l[0]).toLowerCase(),this.protocol=l,a=a.substr(l.length)),(r||l||a.match(/^\/\/[^@\/]+@[^@\/]+/))&&(!(i="//"===a.substr(0,2))||l&&L[l]||(a=a.substr(2),this.slashes=!0)),!L[l]&&(i||l&&!z[l])){var u,p,h=-1;for(t=0;t<q.length;t++)-1!==(o=a.indexOf(q[t]))&&(-1===h||o<h)&&(h=o);for(-1!==(p=-1===h?a.lastIndexOf("@"):a.lastIndexOf("@",h))&&(u=a.slice(0,p),a=a.slice(p+1),this.auth=u),h=-1,t=0;t<E.length;t++)-1!==(o=a.indexOf(E[t]))&&(-1===h||o<h)&&(h=o);-1===h&&(h=a.length),":"===a[h-1]&&h--;var f=a.slice(0,h);a=a.slice(h),this.parseHost(f),this.hostname=this.hostname||"";var d="["===this.hostname[0]&&"]"===this.hostname[this.hostname.length-1];if(!d){var m=this.hostname.split(/\./);for(t=0,n=m.length;t<n;t++){var _=m[t];if(_&&!_.match(S)){for(var g="",b=0,k=_.length;b<k;b++)127<_.charCodeAt(b)?g+="x":g+=_[b];if(!g.match(S)){var v=m.slice(0,t),x=m.slice(t+1),y=_.match(F);y&&(v.push(y[1]),x.unshift(y[2])),x.length&&(a=x.join(".")+a),this.hostname=v.join(".");break}}}}255<this.hostname.length&&(this.hostname=""),d&&(this.hostname=this.hostname.substr(1,this.hostname.length-2))}var C=a.indexOf("#");-1!==C&&(this.hash=a.substr(C),a=a.slice(0,C));var A=a.indexOf("?");return-1!==A&&(this.search=a.substr(A),a=a.slice(0,A)),a&&(this.pathname=a),z[s]&&this.hostname&&!this.pathname&&(this.pathname=""),this},n.prototype.parseHost=function(e){var r=s.exec(e);r&&(":"!==(r=r[0])&&(this.port=r.substr(1)),e=e.substr(0,e.length-r.length)),e&&(this.hostname=e)},r.exports=function(e,r){if(e&&e instanceof n)return e;var t=new n;return t.parse(e,r),t}},{}],60:[function(e,z,T){(function(L){!function(e){var r="object"==typeof T&&T&&!T.nodeType&&T,t="object"==typeof z&&z&&!z.nodeType&&z,n="object"==typeof L&&L;n.global!==n&&n.window!==n&&n.self!==n||(e=n);var s,o,g=2147483647,b=36,k=1,v=26,i=38,a=700,x=72,y=128,C="-",c=/^xn--/,l=/[^\x20-\x7E]/,u=/[\x2E\u3002\uFF0E\uFF61]/g,p={overflow:"Overflow: input needs wider integers to process","not-basic":"Illegal input >= 0x80 (not a basic code point)","invalid-input":"Invalid input"},h=b-k,A=Math.floor,w=String.fromCharCode;function D(e){throw new RangeError(p[e])}function f(e,r){for(var t=e.length,n=[];t--;)n[t]=r(e[t]);return n}function d(e,r){var t=e.split("@"),n="";return 1<t.length&&(n=t[0]+"@",e=t[1]),n+f((e=e.replace(u,".")).split("."),r).join(".")}function E(e){for(var r,t,n=[],s=0,o=e.length;s<o;)55296<=(r=e.charCodeAt(s++))&&r<=56319&&s<o?56320==(64512&(t=e.charCodeAt(s++)))?n.push(((1023&r)<<10)+(1023&t)+65536):(n.push(r),s--):n.push(r);return n}function q(e){return f(e,function(e){var r="";return 65535<e&&(r+=w((e-=65536)>>>10&1023|55296),e=56320|1023&e),r+=w(e)}).join("")}function S(e,r){return e+22+75*(e<26)-((0!=r)<<5)}function F(e,r,t){var n=0;for(e=t?A(e/a):e>>1,e+=A(e/r);h*v>>1<e;n+=b)e=A(e/h);return A(n+(h+1)*e/(e+i))}function m(e){var r,t,n,s,o,i,a,c,l,u,p,h=[],f=e.length,d=0,m=y,_=x;for((t=e.lastIndexOf(C))<0&&(t=0),n=0;n<t;++n)128<=e.charCodeAt(n)&&D("not-basic"),h.push(e.charCodeAt(n));for(s=0<t?t+1:0;s<f;){for(o=d,i=1,a=b;f<=s&&D("invalid-input"),p=e.charCodeAt(s++),(b<=(c=p-48<10?p-22:p-65<26?p-65:p-97<26?p-97:b)||c>A((g-d)/i))&&D("overflow"),d+=c*i,!(c<(l=a<=_?k:_+v<=a?v:a-_));a+=b)i>A(g/(u=b-l))&&D("overflow"),i*=u;_=F(d-o,r=h.length+1,0==o),A(d/r)>g-m&&D("overflow"),m+=A(d/r),d%=r,h.splice(d++,0,m)}return q(h)}function _(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,_=[];for(h=(e=E(e)).length,r=y,o=x,i=t=0;i<h;++i)(p=e[i])<128&&_.push(w(p));for(n=s=_.length,s&&_.push(C);n<h;){for(a=g,i=0;i<h;++i)r<=(p=e[i])&&p<a&&(a=p);for(a-r>A((g-t)/(f=n+1))&&D("overflow"),t+=(a-r)*f,r=a,i=0;i<h;++i)if((p=e[i])<r&&++t>g&&D("overflow"),p==r){for(c=t,l=b;!(c<(u=l<=o?k:o+v<=l?v:l-o));l+=b)m=c-u,d=b-u,_.push(w(S(u+m%d,0))),c=A(m/d);_.push(w(S(c,0))),o=F(t,f,n==s),t=0,++n}++t,++r}return _.join("")}if(s={version:"1.4.1",ucs2:{decode:E,encode:q},decode:m,encode:_,toASCII:function(e){return d(e,function(e){return l.test(e)?"xn--"+_(e):e})},toUnicode:function(e){return d(e,function(e){return c.test(e)?m(e.slice(4).toLowerCase()):e})}},r&&t)if(z.exports==r)t.exports=s;else for(o in s)s.hasOwnProperty(o)&&(r[o]=s[o]);else e.punycode=s}(this)}).call(this,"undefined"!=typeof global?global:"undefined"!=typeof self?self:"undefined"!=typeof window?window:{})},{}],61:[function(e,r,t){r.exports=/[\0-\x1F\x7F-\x9F]/},{}],62:[function(e,r,t){r.exports=/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804\uDCBD|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/},{}],63:[function(e,r,t){r.exports=/[!-#%-\*,-/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0AF0\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E49\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC9\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/},{}],64:[function(e,r,t){r.exports=/[ \xA0\u1680\u2000-\u200A\u202F\u205F\u3000]/},{}],65:[function(e,r,t){"use strict";t.Any=e("./properties/Any/regex"),t.Cc=e("./categories/Cc/regex"),t.Cf=e("./categories/Cf/regex"),t.P=e("./categories/P/regex"),t.Z=e("./categories/Z/regex")},{"./categories/Cc/regex":61,"./categories/Cf/regex":62,"./categories/P/regex":63,"./categories/Z/regex":64,"./properties/Any/regex":66}],66:[function(e,r,t){r.exports=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/},{}],67:[function(e,r,t){"use strict";r.exports=e("./lib/")},{"./lib/":9}]},{},[67])(67)});
diff --git a/node_modules/markdown-it/index.js b/node_modules/markdown-it/index.js
new file mode 100644
index 00000000..f71477e5
--- /dev/null
+++ b/node_modules/markdown-it/index.js
@@ -0,0 +1,4 @@
+'use strict';
+
+
+module.exports = require('./lib/');
diff --git a/node_modules/markdown-it/lib/common/entities.js b/node_modules/markdown-it/lib/common/entities.js
new file mode 100644
index 00000000..7380ae84
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/entities.js
@@ -0,0 +1,6 @@
+// HTML5 entities map: { name -> utf16string }
+//
+'use strict';
+
+/*eslint quotes:0*/
+module.exports = require('entities/maps/entities.json');
diff --git a/node_modules/markdown-it/lib/common/html_blocks.js b/node_modules/markdown-it/lib/common/html_blocks.js
new file mode 100644
index 00000000..c97e6eff
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/html_blocks.js
@@ -0,0 +1,71 @@
+// List of valid html blocks names, accorting to commonmark spec
+// http://jgm.github.io/CommonMark/spec.html#html-blocks
+
+'use strict';
+
+
+module.exports = [
+  'address',
+  'article',
+  'aside',
+  'base',
+  'basefont',
+  'blockquote',
+  'body',
+  'caption',
+  'center',
+  'col',
+  'colgroup',
+  'dd',
+  'details',
+  'dialog',
+  'dir',
+  'div',
+  'dl',
+  'dt',
+  'fieldset',
+  'figcaption',
+  'figure',
+  'footer',
+  'form',
+  'frame',
+  'frameset',
+  'h1',
+  'h2',
+  'h3',
+  'h4',
+  'h5',
+  'h6',
+  'head',
+  'header',
+  'hr',
+  'html',
+  'iframe',
+  'legend',
+  'li',
+  'link',
+  'main',
+  'menu',
+  'menuitem',
+  'meta',
+  'nav',
+  'noframes',
+  'ol',
+  'optgroup',
+  'option',
+  'p',
+  'param',
+  'section',
+  'source',
+  'summary',
+  'table',
+  'tbody',
+  'td',
+  'tfoot',
+  'th',
+  'thead',
+  'title',
+  'tr',
+  'track',
+  'ul'
+];
diff --git a/node_modules/markdown-it/lib/common/html_re.js b/node_modules/markdown-it/lib/common/html_re.js
new file mode 100644
index 00000000..4fd93699
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/html_re.js
@@ -0,0 +1,28 @@
+// Regexps to match html elements
+
+'use strict';
+
+var attr_name     = '[a-zA-Z_:][a-zA-Z0-9:._-]*';
+
+var unquoted      = '[^"\'=<>`\\x00-\\x20]+';
+var single_quoted = "'[^']*'";
+var double_quoted = '"[^"]*"';
+
+var attr_value  = '(?:' + unquoted + '|' + single_quoted + '|' + double_quoted + ')';
+
+var attribute   = '(?:\\s+' + attr_name + '(?:\\s*=\\s*' + attr_value + ')?)';
+
+var open_tag    = '<[A-Za-z][A-Za-z0-9\\-]*' + attribute + '*\\s*\\/?>';
+
+var close_tag   = '<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>';
+var comment     = '<!---->|<!--(?:-?[^>-])(?:-?[^-])*-->';
+var processing  = '<[?].*?[?]>';
+var declaration = '<![A-Z]+\\s+[^>]*>';
+var cdata       = '<!\\[CDATA\\[[\\s\\S]*?\\]\\]>';
+
+var HTML_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + '|' + comment +
+                        '|' + processing + '|' + declaration + '|' + cdata + ')');
+var HTML_OPEN_CLOSE_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + ')');
+
+module.exports.HTML_TAG_RE = HTML_TAG_RE;
+module.exports.HTML_OPEN_CLOSE_TAG_RE = HTML_OPEN_CLOSE_TAG_RE;
diff --git a/node_modules/markdown-it/lib/common/utils.js b/node_modules/markdown-it/lib/common/utils.js
new file mode 100644
index 00000000..a2f9540a
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/utils.js
@@ -0,0 +1,275 @@
+// Utilities
+//
+'use strict';
+
+
+function _class(obj) { return Object.prototype.toString.call(obj); }
+
+function isString(obj) { return _class(obj) === '[object String]'; }
+
+var _hasOwnProperty = Object.prototype.hasOwnProperty;
+
+function has(object, key) {
+  return _hasOwnProperty.call(object, key);
+}
+
+// Merge objects
+//
+function assign(obj /*from1, from2, from3, ...*/) {
+  var sources = Array.prototype.slice.call(arguments, 1);
+
+  sources.forEach(function (source) {
+    if (!source) { return; }
+
+    if (typeof source !== 'object') {
+      throw new TypeError(source + 'must be object');
+    }
+
+    Object.keys(source).forEach(function (key) {
+      obj[key] = source[key];
+    });
+  });
+
+  return obj;
+}
+
+// Remove element from array and put another array at those position.
+// Useful for some operations with tokens
+function arrayReplaceAt(src, pos, newElements) {
+  return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1));
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+function isValidEntityCode(c) {
+  /*eslint no-bitwise:0*/
+  // broken sequence
+  if (c >= 0xD800 && c <= 0xDFFF) { return false; }
+  // never used
+  if (c >= 0xFDD0 && c <= 0xFDEF) { return false; }
+  if ((c & 0xFFFF) === 0xFFFF || (c & 0xFFFF) === 0xFFFE) { return false; }
+  // control codes
+  if (c >= 0x00 && c <= 0x08) { return false; }
+  if (c === 0x0B) { return false; }
+  if (c >= 0x0E && c <= 0x1F) { return false; }
+  if (c >= 0x7F && c <= 0x9F) { return false; }
+  // out of range
+  if (c > 0x10FFFF) { return false; }
+  return true;
+}
+
+function fromCodePoint(c) {
+  /*eslint no-bitwise:0*/
+  if (c > 0xffff) {
+    c -= 0x10000;
+    var surrogate1 = 0xd800 + (c >> 10),
+        surrogate2 = 0xdc00 + (c & 0x3ff);
+
+    return String.fromCharCode(surrogate1, surrogate2);
+  }
+  return String.fromCharCode(c);
+}
+
+
+var UNESCAPE_MD_RE  = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g;
+var ENTITY_RE       = /&([a-z#][a-z0-9]{1,31});/gi;
+var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + '|' + ENTITY_RE.source, 'gi');
+
+var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;
+
+var entities = require('./entities');
+
+function replaceEntityPattern(match, name) {
+  var code = 0;
+
+  if (has(entities, name)) {
+    return entities[name];
+  }
+
+  if (name.charCodeAt(0) === 0x23/* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) {
+    code = name[1].toLowerCase() === 'x' ?
+      parseInt(name.slice(2), 16)
+    :
+      parseInt(name.slice(1), 10);
+    if (isValidEntityCode(code)) {
+      return fromCodePoint(code);
+    }
+  }
+
+  return match;
+}
+
+/*function replaceEntities(str) {
+  if (str.indexOf('&') < 0) { return str; }
+
+  return str.replace(ENTITY_RE, replaceEntityPattern);
+}*/
+
+function unescapeMd(str) {
+  if (str.indexOf('\\') < 0) { return str; }
+  return str.replace(UNESCAPE_MD_RE, '$1');
+}
+
+function unescapeAll(str) {
+  if (str.indexOf('\\') < 0 && str.indexOf('&') < 0) { return str; }
+
+  return str.replace(UNESCAPE_ALL_RE, function (match, escaped, entity) {
+    if (escaped) { return escaped; }
+    return replaceEntityPattern(match, entity);
+  });
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+var HTML_ESCAPE_TEST_RE = /[&<>"]/;
+var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g;
+var HTML_REPLACEMENTS = {
+  '&': '&amp;',
+  '<': '&lt;',
+  '>': '&gt;',
+  '"': '&quot;'
+};
+
+function replaceUnsafeChar(ch) {
+  return HTML_REPLACEMENTS[ch];
+}
+
+function escapeHtml(str) {
+  if (HTML_ESCAPE_TEST_RE.test(str)) {
+    return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar);
+  }
+  return str;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g;
+
+function escapeRE(str) {
+  return str.replace(REGEXP_ESCAPE_RE, '\\$&');
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+function isSpace(code) {
+  switch (code) {
+    case 0x09:
+    case 0x20:
+      return true;
+  }
+  return false;
+}
+
+// Zs (unicode class) || [\t\f\v\r\n]
+function isWhiteSpace(code) {
+  if (code >= 0x2000 && code <= 0x200A) { return true; }
+  switch (code) {
+    case 0x09: // \t
+    case 0x0A: // \n
+    case 0x0B: // \v
+    case 0x0C: // \f
+    case 0x0D: // \r
+    case 0x20:
+    case 0xA0:
+    case 0x1680:
+    case 0x202F:
+    case 0x205F:
+    case 0x3000:
+      return true;
+  }
+  return false;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+/*eslint-disable max-len*/
+var UNICODE_PUNCT_RE = require('uc.micro/categories/P/regex');
+
+// Currently without astral characters support.
+function isPunctChar(ch) {
+  return UNICODE_PUNCT_RE.test(ch);
+}
+
+
+// Markdown ASCII punctuation characters.
+//
+// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+// http://spec.commonmark.org/0.15/#ascii-punctuation-character
+//
+// Don't confuse with unicode punctuation !!! It lacks some chars in ascii range.
+//
+function isMdAsciiPunct(ch) {
+  switch (ch) {
+    case 0x21/* ! */:
+    case 0x22/* " */:
+    case 0x23/* # */:
+    case 0x24/* $ */:
+    case 0x25/* % */:
+    case 0x26/* & */:
+    case 0x27/* ' */:
+    case 0x28/* ( */:
+    case 0x29/* ) */:
+    case 0x2A/* * */:
+    case 0x2B/* + */:
+    case 0x2C/* , */:
+    case 0x2D/* - */:
+    case 0x2E/* . */:
+    case 0x2F/* / */:
+    case 0x3A/* : */:
+    case 0x3B/* ; */:
+    case 0x3C/* < */:
+    case 0x3D/* = */:
+    case 0x3E/* > */:
+    case 0x3F/* ? */:
+    case 0x40/* @ */:
+    case 0x5B/* [ */:
+    case 0x5C/* \ */:
+    case 0x5D/* ] */:
+    case 0x5E/* ^ */:
+    case 0x5F/* _ */:
+    case 0x60/* ` */:
+    case 0x7B/* { */:
+    case 0x7C/* | */:
+    case 0x7D/* } */:
+    case 0x7E/* ~ */:
+      return true;
+    default:
+      return false;
+  }
+}
+
+// Hepler to unify [reference labels].
+//
+function normalizeReference(str) {
+  // use .toUpperCase() instead of .toLowerCase()
+  // here to avoid a conflict with Object.prototype
+  // members (most notably, `__proto__`)
+  return str.trim().replace(/\s+/g, ' ').toUpperCase();
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+// Re-export libraries commonly used in both markdown-it and its plugins,
+// so plugins won't have to depend on them explicitly, which reduces their
+// bundled size (e.g. a browser build).
+//
+exports.lib                 = {};
+exports.lib.mdurl           = require('mdurl');
+exports.lib.ucmicro         = require('uc.micro');
+
+exports.assign              = assign;
+exports.isString            = isString;
+exports.has                 = has;
+exports.unescapeMd          = unescapeMd;
+exports.unescapeAll         = unescapeAll;
+exports.isValidEntityCode   = isValidEntityCode;
+exports.fromCodePoint       = fromCodePoint;
+// exports.replaceEntities     = replaceEntities;
+exports.escapeHtml          = escapeHtml;
+exports.arrayReplaceAt      = arrayReplaceAt;
+exports.isSpace             = isSpace;
+exports.isWhiteSpace        = isWhiteSpace;
+exports.isMdAsciiPunct      = isMdAsciiPunct;
+exports.isPunctChar         = isPunctChar;
+exports.escapeRE            = escapeRE;
+exports.normalizeReference  = normalizeReference;
diff --git a/node_modules/markdown-it/lib/helpers/index.js b/node_modules/markdown-it/lib/helpers/index.js
new file mode 100644
index 00000000..bfdbfa20
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/index.js
@@ -0,0 +1,7 @@
+// Just a shortcut for bulk export
+'use strict';
+
+
+exports.parseLinkLabel       = require('./parse_link_label');
+exports.parseLinkDestination = require('./parse_link_destination');
+exports.parseLinkTitle       = require('./parse_link_title');
diff --git a/node_modules/markdown-it/lib/helpers/parse_link_destination.js b/node_modules/markdown-it/lib/helpers/parse_link_destination.js
new file mode 100644
index 00000000..a3030bb9
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/parse_link_destination.js
@@ -0,0 +1,80 @@
+// Parse link destination
+//
+'use strict';
+
+
+var isSpace     = require('../common/utils').isSpace;
+var unescapeAll = require('../common/utils').unescapeAll;
+
+
+module.exports = function parseLinkDestination(str, pos, max) {
+  var code, level,
+      lines = 0,
+      start = pos,
+      result = {
+        ok: false,
+        pos: 0,
+        lines: 0,
+        str: ''
+      };
+
+  if (str.charCodeAt(pos) === 0x3C /* < */) {
+    pos++;
+    while (pos < max) {
+      code = str.charCodeAt(pos);
+      if (code === 0x0A /* \n */ || isSpace(code)) { return result; }
+      if (code === 0x3E /* > */) {
+        result.pos = pos + 1;
+        result.str = unescapeAll(str.slice(start + 1, pos));
+        result.ok = true;
+        return result;
+      }
+      if (code === 0x5C /* \ */ && pos + 1 < max) {
+        pos += 2;
+        continue;
+      }
+
+      pos++;
+    }
+
+    // no closing '>'
+    return result;
+  }
+
+  // this should be ... } else { ... branch
+
+  level = 0;
+  while (pos < max) {
+    code = str.charCodeAt(pos);
+
+    if (code === 0x20) { break; }
+
+    // ascii control characters
+    if (code < 0x20 || code === 0x7F) { break; }
+
+    if (code === 0x5C /* \ */ && pos + 1 < max) {
+      pos += 2;
+      continue;
+    }
+
+    if (code === 0x28 /* ( */) {
+      level++;
+    }
+
+    if (code === 0x29 /* ) */) {
+      if (level === 0) { break; }
+      level--;
+    }
+
+    pos++;
+  }
+
+  if (start === pos) { return result; }
+  if (level !== 0) { return result; }
+
+  result.str = unescapeAll(str.slice(start, pos));
+  result.lines = lines;
+  result.pos = pos;
+  result.ok = true;
+  return result;
+};
diff --git a/node_modules/markdown-it/lib/helpers/parse_link_label.js b/node_modules/markdown-it/lib/helpers/parse_link_label.js
new file mode 100644
index 00000000..5a450fd6
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/parse_link_label.js
@@ -0,0 +1,48 @@
+// Parse link label
+//
+// this function assumes that first character ("[") already matches;
+// returns the end of the label
+//
+'use strict';
+
+module.exports = function parseLinkLabel(state, start, disableNested) {
+  var level, found, marker, prevPos,
+      labelEnd = -1,
+      max = state.posMax,
+      oldPos = state.pos;
+
+  state.pos = start + 1;
+  level = 1;
+
+  while (state.pos < max) {
+    marker = state.src.charCodeAt(state.pos);
+    if (marker === 0x5D /* ] */) {
+      level--;
+      if (level === 0) {
+        found = true;
+        break;
+      }
+    }
+
+    prevPos = state.pos;
+    state.md.inline.skipToken(state);
+    if (marker === 0x5B /* [ */) {
+      if (prevPos === state.pos - 1) {
+        // increase level if we find text `[`, which is not a part of any token
+        level++;
+      } else if (disableNested) {
+        state.pos = oldPos;
+        return -1;
+      }
+    }
+  }
+
+  if (found) {
+    labelEnd = state.pos;
+  }
+
+  // restore old state
+  state.pos = oldPos;
+
+  return labelEnd;
+};
diff --git a/node_modules/markdown-it/lib/helpers/parse_link_title.js b/node_modules/markdown-it/lib/helpers/parse_link_title.js
new file mode 100644
index 00000000..0d66d23d
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/parse_link_title.js
@@ -0,0 +1,53 @@
+// Parse link title
+//
+'use strict';
+
+
+var unescapeAll = require('../common/utils').unescapeAll;
+
+
+module.exports = function parseLinkTitle(str, pos, max) {
+  var code,
+      marker,
+      lines = 0,
+      start = pos,
+      result = {
+        ok: false,
+        pos: 0,
+        lines: 0,
+        str: ''
+      };
+
+  if (pos >= max) { return result; }
+
+  marker = str.charCodeAt(pos);
+
+  if (marker !== 0x22 /* " */ && marker !== 0x27 /* ' */ && marker !== 0x28 /* ( */) { return result; }
+
+  pos++;
+
+  // if opening marker is "(", switch it to closing marker ")"
+  if (marker === 0x28) { marker = 0x29; }
+
+  while (pos < max) {
+    code = str.charCodeAt(pos);
+    if (code === marker) {
+      result.pos = pos + 1;
+      result.lines = lines;
+      result.str = unescapeAll(str.slice(start + 1, pos));
+      result.ok = true;
+      return result;
+    } else if (code === 0x0A) {
+      lines++;
+    } else if (code === 0x5C /* \ */ && pos + 1 < max) {
+      pos++;
+      if (str.charCodeAt(pos) === 0x0A) {
+        lines++;
+      }
+    }
+
+    pos++;
+  }
+
+  return result;
+};
diff --git a/node_modules/markdown-it/lib/index.js b/node_modules/markdown-it/lib/index.js
new file mode 100644
index 00000000..b5317205
--- /dev/null
+++ b/node_modules/markdown-it/lib/index.js
@@ -0,0 +1,581 @@
+// Main parser class
+
+'use strict';
+
+
+var utils        = require('./common/utils');
+var helpers      = require('./helpers');
+var Renderer     = require('./renderer');
+var ParserCore   = require('./parser_core');
+var ParserBlock  = require('./parser_block');
+var ParserInline = require('./parser_inline');
+var LinkifyIt    = require('linkify-it');
+var mdurl        = require('mdurl');
+var punycode     = require('punycode');
+
+
+var config = {
+  'default': require('./presets/default'),
+  zero: require('./presets/zero'),
+  commonmark: require('./presets/commonmark')
+};
+
+////////////////////////////////////////////////////////////////////////////////
+//
+// This validator can prohibit more than really needed to prevent XSS. It's a
+// tradeoff to keep code simple and to be secure by default.
+//
+// If you need different setup - override validator method as you wish. Or
+// replace it with dummy function and use external sanitizer.
+//
+
+var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/;
+var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/;
+
+function validateLink(url) {
+  // url should be normalized at this point, and existing entities are decoded
+  var str = url.trim().toLowerCase();
+
+  return BAD_PROTO_RE.test(str) ? (GOOD_DATA_RE.test(str) ? true : false) : true;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+
+var RECODE_HOSTNAME_FOR = [ 'http:', 'https:', 'mailto:' ];
+
+function normalizeLink(url) {
+  var parsed = mdurl.parse(url, true);
+
+  if (parsed.hostname) {
+    // Encode hostnames in urls like:
+    // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+    //
+    // We don't encode unknown schemas, because it's likely that we encode
+    // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+    //
+    if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+      try {
+        parsed.hostname = punycode.toASCII(parsed.hostname);
+      } catch (er) { /**/ }
+    }
+  }
+
+  return mdurl.encode(mdurl.format(parsed));
+}
+
+function normalizeLinkText(url) {
+  var parsed = mdurl.parse(url, true);
+
+  if (parsed.hostname) {
+    // Encode hostnames in urls like:
+    // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+    //
+    // We don't encode unknown schemas, because it's likely that we encode
+    // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+    //
+    if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+      try {
+        parsed.hostname = punycode.toUnicode(parsed.hostname);
+      } catch (er) { /**/ }
+    }
+  }
+
+  return mdurl.decode(mdurl.format(parsed));
+}
+
+
+/**
+ * class MarkdownIt
+ *
+ * Main parser/renderer class.
+ *
+ * ##### Usage
+ *
+ * ```javascript
+ * // node.js, "classic" way:
+ * var MarkdownIt = require('markdown-it'),
+ *     md = new MarkdownIt();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // node.js, the same, but with sugar:
+ * var md = require('markdown-it')();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // browser without AMD, added to "window" on script load
+ * // Note, there are no dash.
+ * var md = window.markdownit();
+ * var result = md.render('# markdown-it rulezz!');
+ * ```
+ *
+ * Single line rendering, without paragraph wrap:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ * var result = md.renderInline('__markdown-it__ rulezz!');
+ * ```
+ **/
+
+/**
+ * new MarkdownIt([presetName, options])
+ * - presetName (String): optional, `commonmark` / `zero`
+ * - options (Object)
+ *
+ * Creates parser instanse with given config. Can be called without `new`.
+ *
+ * ##### presetName
+ *
+ * MarkdownIt provides named presets as a convenience to quickly
+ * enable/disable active syntax rules and options for common use cases.
+ *
+ * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) -
+ *   configures parser to strict [CommonMark](http://commonmark.org/) mode.
+ * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) -
+ *   similar to GFM, used when no preset name given. Enables all available rules,
+ *   but still without html, typographer & autolinker.
+ * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) -
+ *   all rules disabled. Useful to quickly setup your config via `.enable()`.
+ *   For example, when you need only `bold` and `italic` markup and nothing else.
+ *
+ * ##### options:
+ *
+ * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful!
+ *   That's not safe! You may need external sanitizer to protect output from XSS.
+ *   It's better to extend features via plugins, instead of enabling HTML.
+ * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags
+ *   (`<br />`). This is needed only for full CommonMark compatibility. In real
+ *   world you will need HTML output.
+ * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`.
+ * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks.
+ *   Can be useful for external highlighters.
+ * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links.
+ * - __typographer__  - `false`. Set `true` to enable [some language-neutral
+ *   replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) +
+ *   quotes beautification (smartquotes).
+ * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement
+ *   pairs, when typographer enabled and smartquotes on. For example, you can
+ *   use `'«»„“'` for Russian, `'„“‚‘'` for German, and
+ *   `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp).
+ * - __highlight__ - `null`. Highlighter function for fenced code blocks.
+ *   Highlighter `function (str, lang)` should return escaped HTML. It can also
+ *   return empty string if the source was not changed and should be escaped
+ *   externaly. If result starts with <pre... internal wrapper is skipped.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * // commonmark mode
+ * var md = require('markdown-it')('commonmark');
+ *
+ * // default mode
+ * var md = require('markdown-it')();
+ *
+ * // enable everything
+ * var md = require('markdown-it')({
+ *   html: true,
+ *   linkify: true,
+ *   typographer: true
+ * });
+ * ```
+ *
+ * ##### Syntax highlighting
+ *
+ * ```js
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * var md = require('markdown-it')({
+ *   highlight: function (str, lang) {
+ *     if (lang && hljs.getLanguage(lang)) {
+ *       try {
+ *         return hljs.highlight(lang, str, true).value;
+ *       } catch (__) {}
+ *     }
+ *
+ *     return ''; // use external default escaping
+ *   }
+ * });
+ * ```
+ *
+ * Or with full wrapper override (if you need assign class to `<pre>`):
+ *
+ * ```javascript
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * // Actual default values
+ * var md = require('markdown-it')({
+ *   highlight: function (str, lang) {
+ *     if (lang && hljs.getLanguage(lang)) {
+ *       try {
+ *         return '<pre class="hljs"><code>' +
+ *                hljs.highlight(lang, str, true).value +
+ *                '</code></pre>';
+ *       } catch (__) {}
+ *     }
+ *
+ *     return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>';
+ *   }
+ * });
+ * ```
+ *
+ **/
+function MarkdownIt(presetName, options) {
+  if (!(this instanceof MarkdownIt)) {
+    return new MarkdownIt(presetName, options);
+  }
+
+  if (!options) {
+    if (!utils.isString(presetName)) {
+      options = presetName || {};
+      presetName = 'default';
+    }
+  }
+
+  /**
+   * MarkdownIt#inline -> ParserInline
+   *
+   * Instance of [[ParserInline]]. You may need it to add new rules when
+   * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+   * [[MarkdownIt.enable]].
+   **/
+  this.inline = new ParserInline();
+
+  /**
+   * MarkdownIt#block -> ParserBlock
+   *
+   * Instance of [[ParserBlock]]. You may need it to add new rules when
+   * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+   * [[MarkdownIt.enable]].
+   **/
+  this.block = new ParserBlock();
+
+  /**
+   * MarkdownIt#core -> Core
+   *
+   * Instance of [[Core]] chain executor. You may need it to add new rules when
+   * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+   * [[MarkdownIt.enable]].
+   **/
+  this.core = new ParserCore();
+
+  /**
+   * MarkdownIt#renderer -> Renderer
+   *
+   * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering
+   * rules for new token types, generated by plugins.
+   *
+   * ##### Example
+   *
+   * ```javascript
+   * var md = require('markdown-it')();
+   *
+   * function myToken(tokens, idx, options, env, self) {
+   *   //...
+   *   return result;
+   * };
+   *
+   * md.renderer.rules['my_token'] = myToken
+   * ```
+   *
+   * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js).
+   **/
+  this.renderer = new Renderer();
+
+  /**
+   * MarkdownIt#linkify -> LinkifyIt
+   *
+   * [linkify-it](https://github.com/markdown-it/linkify-it) instance.
+   * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js)
+   * rule.
+   **/
+  this.linkify = new LinkifyIt();
+
+  /**
+   * MarkdownIt#validateLink(url) -> Boolean
+   *
+   * Link validation function. CommonMark allows too much in links. By default
+   * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas
+   * except some embedded image types.
+   *
+   * You can change this behaviour:
+   *
+   * ```javascript
+   * var md = require('markdown-it')();
+   * // enable everything
+   * md.validateLink = function () { return true; }
+   * ```
+   **/
+  this.validateLink = validateLink;
+
+  /**
+   * MarkdownIt#normalizeLink(url) -> String
+   *
+   * Function used to encode link url to a machine-readable format,
+   * which includes url-encoding, punycode, etc.
+   **/
+  this.normalizeLink = normalizeLink;
+
+  /**
+   * MarkdownIt#normalizeLinkText(url) -> String
+   *
+   * Function used to decode link url to a human-readable format`
+   **/
+  this.normalizeLinkText = normalizeLinkText;
+
+
+  // Expose utils & helpers for easy acces from plugins
+
+  /**
+   * MarkdownIt#utils -> utils
+   *
+   * Assorted utility functions, useful to write plugins. See details
+   * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js).
+   **/
+  this.utils = utils;
+
+  /**
+   * MarkdownIt#helpers -> helpers
+   *
+   * Link components parser functions, useful to write plugins. See details
+   * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers).
+   **/
+  this.helpers = utils.assign({}, helpers);
+
+
+  this.options = {};
+  this.configure(presetName);
+
+  if (options) { this.set(options); }
+}
+
+
+/** chainable
+ * MarkdownIt.set(options)
+ *
+ * Set parser options (in the same format as in constructor). Probably, you
+ * will never need it, but you can change options after constructor call.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ *             .set({ html: true, breaks: true })
+ *             .set({ typographer, true });
+ * ```
+ *
+ * __Note:__ To achieve the best possible performance, don't modify a
+ * `markdown-it` instance options on the fly. If you need multiple configurations
+ * it's best to create multiple instances and initialize each with separate
+ * config.
+ **/
+MarkdownIt.prototype.set = function (options) {
+  utils.assign(this.options, options);
+  return this;
+};
+
+
+/** chainable, internal
+ * MarkdownIt.configure(presets)
+ *
+ * Batch load of all options and compenent settings. This is internal method,
+ * and you probably will not need it. But if you with - see available presets
+ * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets)
+ *
+ * We strongly recommend to use presets instead of direct config loads. That
+ * will give better compatibility with next versions.
+ **/
+MarkdownIt.prototype.configure = function (presets) {
+  var self = this, presetName;
+
+  if (utils.isString(presets)) {
+    presetName = presets;
+    presets = config[presetName];
+    if (!presets) { throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); }
+  }
+
+  if (!presets) { throw new Error('Wrong `markdown-it` preset, can\'t be empty'); }
+
+  if (presets.options) { self.set(presets.options); }
+
+  if (presets.components) {
+    Object.keys(presets.components).forEach(function (name) {
+      if (presets.components[name].rules) {
+        self[name].ruler.enableOnly(presets.components[name].rules);
+      }
+      if (presets.components[name].rules2) {
+        self[name].ruler2.enableOnly(presets.components[name].rules2);
+      }
+    });
+  }
+  return this;
+};
+
+
+/** chainable
+ * MarkdownIt.enable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to enable
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable list or rules. It will automatically find appropriate components,
+ * containing rules with given names. If rule not found, and `ignoreInvalid`
+ * not set - throws exception.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ *             .enable(['sub', 'sup'])
+ *             .disable('smartquotes');
+ * ```
+ **/
+MarkdownIt.prototype.enable = function (list, ignoreInvalid) {
+  var result = [];
+
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  [ 'core', 'block', 'inline' ].forEach(function (chain) {
+    result = result.concat(this[chain].ruler.enable(list, true));
+  }, this);
+
+  result = result.concat(this.inline.ruler2.enable(list, true));
+
+  var missed = list.filter(function (name) { return result.indexOf(name) < 0; });
+
+  if (missed.length && !ignoreInvalid) {
+    throw new Error('MarkdownIt. Failed to enable unknown rule(s): ' + missed);
+  }
+
+  return this;
+};
+
+
+/** chainable
+ * MarkdownIt.disable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * The same as [[MarkdownIt.enable]], but turn specified rules off.
+ **/
+MarkdownIt.prototype.disable = function (list, ignoreInvalid) {
+  var result = [];
+
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  [ 'core', 'block', 'inline' ].forEach(function (chain) {
+    result = result.concat(this[chain].ruler.disable(list, true));
+  }, this);
+
+  result = result.concat(this.inline.ruler2.disable(list, true));
+
+  var missed = list.filter(function (name) { return result.indexOf(name) < 0; });
+
+  if (missed.length && !ignoreInvalid) {
+    throw new Error('MarkdownIt. Failed to disable unknown rule(s): ' + missed);
+  }
+  return this;
+};
+
+
+/** chainable
+ * MarkdownIt.use(plugin, params)
+ *
+ * Load specified plugin with given params into current parser instance.
+ * It's just a sugar to call `plugin(md, params)` with curring.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var iterator = require('markdown-it-for-inline');
+ * var md = require('markdown-it')()
+ *             .use(iterator, 'foo_replace', 'text', function (tokens, idx) {
+ *               tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar');
+ *             });
+ * ```
+ **/
+MarkdownIt.prototype.use = function (plugin /*, params, ... */) {
+  var args = [ this ].concat(Array.prototype.slice.call(arguments, 1));
+  plugin.apply(plugin, args);
+  return this;
+};
+
+
+/** internal
+ * MarkdownIt.parse(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Parse input string and returns list of block tokens (special token type
+ * "inline" will contain list of inline tokens). You should not call this
+ * method directly, until you write custom renderer (for example, to produce
+ * AST).
+ *
+ * `env` is used to pass data between "distributed" rules and return additional
+ * metadata like reference info, needed for the renderer. It also can be used to
+ * inject data in specific cases. Usually, you will be ok to pass `{}`,
+ * and then pass updated object to renderer.
+ **/
+MarkdownIt.prototype.parse = function (src, env) {
+  if (typeof src !== 'string') {
+    throw new Error('Input data should be a String');
+  }
+
+  var state = new this.core.State(src, this, env);
+
+  this.core.process(state);
+
+  return state.tokens;
+};
+
+
+/**
+ * MarkdownIt.render(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Render markdown string into html. It does all magic for you :).
+ *
+ * `env` can be used to inject additional metadata (`{}` by default).
+ * But you will not need it with high probability. See also comment
+ * in [[MarkdownIt.parse]].
+ **/
+MarkdownIt.prototype.render = function (src, env) {
+  env = env || {};
+
+  return this.renderer.render(this.parse(src, env), this.options, env);
+};
+
+
+/** internal
+ * MarkdownIt.parseInline(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the
+ * block tokens list with the single `inline` element, containing parsed inline
+ * tokens in `children` property. Also updates `env` object.
+ **/
+MarkdownIt.prototype.parseInline = function (src, env) {
+  var state = new this.core.State(src, this, env);
+
+  state.inlineMode = true;
+  this.core.process(state);
+
+  return state.tokens;
+};
+
+
+/**
+ * MarkdownIt.renderInline(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Similar to [[MarkdownIt.render]] but for single paragraph content. Result
+ * will NOT be wrapped into `<p>` tags.
+ **/
+MarkdownIt.prototype.renderInline = function (src, env) {
+  env = env || {};
+
+  return this.renderer.render(this.parseInline(src, env), this.options, env);
+};
+
+
+module.exports = MarkdownIt;
diff --git a/node_modules/markdown-it/lib/parser_block.js b/node_modules/markdown-it/lib/parser_block.js
new file mode 100644
index 00000000..10505c74
--- /dev/null
+++ b/node_modules/markdown-it/lib/parser_block.js
@@ -0,0 +1,122 @@
+/** internal
+ * class ParserBlock
+ *
+ * Block-level tokenizer.
+ **/
+'use strict';
+
+
+var Ruler           = require('./ruler');
+
+
+var _rules = [
+  // First 2 params - rule name & source. Secondary array - list of rules,
+  // which can be terminated by this one.
+  [ 'table',      require('./rules_block/table'),      [ 'paragraph', 'reference' ] ],
+  [ 'code',       require('./rules_block/code') ],
+  [ 'fence',      require('./rules_block/fence'),      [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+  [ 'blockquote', require('./rules_block/blockquote'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+  [ 'hr',         require('./rules_block/hr'),         [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+  [ 'list',       require('./rules_block/list'),       [ 'paragraph', 'reference', 'blockquote' ] ],
+  [ 'reference',  require('./rules_block/reference') ],
+  [ 'heading',    require('./rules_block/heading'),    [ 'paragraph', 'reference', 'blockquote' ] ],
+  [ 'lheading',   require('./rules_block/lheading') ],
+  [ 'html_block', require('./rules_block/html_block'), [ 'paragraph', 'reference', 'blockquote' ] ],
+  [ 'paragraph',  require('./rules_block/paragraph') ]
+];
+
+
+/**
+ * new ParserBlock()
+ **/
+function ParserBlock() {
+  /**
+   * ParserBlock#ruler -> Ruler
+   *
+   * [[Ruler]] instance. Keep configuration of block rules.
+   **/
+  this.ruler = new Ruler();
+
+  for (var i = 0; i < _rules.length; i++) {
+    this.ruler.push(_rules[i][0], _rules[i][1], { alt: (_rules[i][2] || []).slice() });
+  }
+}
+
+
+// Generate tokens for input range
+//
+ParserBlock.prototype.tokenize = function (state, startLine, endLine) {
+  var ok, i,
+      rules = this.ruler.getRules(''),
+      len = rules.length,
+      line = startLine,
+      hasEmptyLines = false,
+      maxNesting = state.md.options.maxNesting;
+
+  while (line < endLine) {
+    state.line = line = state.skipEmptyLines(line);
+    if (line >= endLine) { break; }
+
+    // Termination condition for nested calls.
+    // Nested calls currently used for blockquotes & lists
+    if (state.sCount[line] < state.blkIndent) { break; }
+
+    // If nesting level exceeded - skip tail to the end. That's not ordinary
+    // situation and we should not care about content.
+    if (state.level >= maxNesting) {
+      state.line = endLine;
+      break;
+    }
+
+    // Try all possible rules.
+    // On success, rule should:
+    //
+    // - update `state.line`
+    // - update `state.tokens`
+    // - return true
+
+    for (i = 0; i < len; i++) {
+      ok = rules[i](state, line, endLine, false);
+      if (ok) { break; }
+    }
+
+    // set state.tight if we had an empty line before current tag
+    // i.e. latest empty line should not count
+    state.tight = !hasEmptyLines;
+
+    // paragraph might "eat" one newline after it in nested lists
+    if (state.isEmpty(state.line - 1)) {
+      hasEmptyLines = true;
+    }
+
+    line = state.line;
+
+    if (line < endLine && state.isEmpty(line)) {
+      hasEmptyLines = true;
+      line++;
+      state.line = line;
+    }
+  }
+};
+
+
+/**
+ * ParserBlock.parse(str, md, env, outTokens)
+ *
+ * Process input string and push block tokens into `outTokens`
+ **/
+ParserBlock.prototype.parse = function (src, md, env, outTokens) {
+  var state;
+
+  if (!src) { return; }
+
+  state = new this.State(src, md, env, outTokens);
+
+  this.tokenize(state, state.line, state.lineMax);
+};
+
+
+ParserBlock.prototype.State = require('./rules_block/state_block');
+
+
+module.exports = ParserBlock;
diff --git a/node_modules/markdown-it/lib/parser_core.js b/node_modules/markdown-it/lib/parser_core.js
new file mode 100644
index 00000000..1eaa2b08
--- /dev/null
+++ b/node_modules/markdown-it/lib/parser_core.js
@@ -0,0 +1,58 @@
+/** internal
+ * class Core
+ *
+ * Top-level rules executor. Glues block/inline parsers and does intermediate
+ * transformations.
+ **/
+'use strict';
+
+
+var Ruler  = require('./ruler');
+
+
+var _rules = [
+  [ 'normalize',      require('./rules_core/normalize')      ],
+  [ 'block',          require('./rules_core/block')          ],
+  [ 'inline',         require('./rules_core/inline')         ],
+  [ 'linkify',        require('./rules_core/linkify')        ],
+  [ 'replacements',   require('./rules_core/replacements')   ],
+  [ 'smartquotes',    require('./rules_core/smartquotes')    ]
+];
+
+
+/**
+ * new Core()
+ **/
+function Core() {
+  /**
+   * Core#ruler -> Ruler
+   *
+   * [[Ruler]] instance. Keep configuration of core rules.
+   **/
+  this.ruler = new Ruler();
+
+  for (var i = 0; i < _rules.length; i++) {
+    this.ruler.push(_rules[i][0], _rules[i][1]);
+  }
+}
+
+
+/**
+ * Core.process(state)
+ *
+ * Executes core chain rules.
+ **/
+Core.prototype.process = function (state) {
+  var i, l, rules;
+
+  rules = this.ruler.getRules('');
+
+  for (i = 0, l = rules.length; i < l; i++) {
+    rules[i](state);
+  }
+};
+
+Core.prototype.State = require('./rules_core/state_core');
+
+
+module.exports = Core;
diff --git a/node_modules/markdown-it/lib/parser_inline.js b/node_modules/markdown-it/lib/parser_inline.js
new file mode 100644
index 00000000..c8e66d30
--- /dev/null
+++ b/node_modules/markdown-it/lib/parser_inline.js
@@ -0,0 +1,177 @@
+/** internal
+ * class ParserInline
+ *
+ * Tokenizes paragraph content.
+ **/
+'use strict';
+
+
+var Ruler           = require('./ruler');
+
+
+////////////////////////////////////////////////////////////////////////////////
+// Parser rules
+
+var _rules = [
+  [ 'text',            require('./rules_inline/text') ],
+  [ 'newline',         require('./rules_inline/newline') ],
+  [ 'escape',          require('./rules_inline/escape') ],
+  [ 'backticks',       require('./rules_inline/backticks') ],
+  [ 'strikethrough',   require('./rules_inline/strikethrough').tokenize ],
+  [ 'emphasis',        require('./rules_inline/emphasis').tokenize ],
+  [ 'link',            require('./rules_inline/link') ],
+  [ 'image',           require('./rules_inline/image') ],
+  [ 'autolink',        require('./rules_inline/autolink') ],
+  [ 'html_inline',     require('./rules_inline/html_inline') ],
+  [ 'entity',          require('./rules_inline/entity') ]
+];
+
+var _rules2 = [
+  [ 'balance_pairs',   require('./rules_inline/balance_pairs') ],
+  [ 'strikethrough',   require('./rules_inline/strikethrough').postProcess ],
+  [ 'emphasis',        require('./rules_inline/emphasis').postProcess ],
+  [ 'text_collapse',   require('./rules_inline/text_collapse') ]
+];
+
+
+/**
+ * new ParserInline()
+ **/
+function ParserInline() {
+  var i;
+
+  /**
+   * ParserInline#ruler -> Ruler
+   *
+   * [[Ruler]] instance. Keep configuration of inline rules.
+   **/
+  this.ruler = new Ruler();
+
+  for (i = 0; i < _rules.length; i++) {
+    this.ruler.push(_rules[i][0], _rules[i][1]);
+  }
+
+  /**
+   * ParserInline#ruler2 -> Ruler
+   *
+   * [[Ruler]] instance. Second ruler used for post-processing
+   * (e.g. in emphasis-like rules).
+   **/
+  this.ruler2 = new Ruler();
+
+  for (i = 0; i < _rules2.length; i++) {
+    this.ruler2.push(_rules2[i][0], _rules2[i][1]);
+  }
+}
+
+
+// Skip single token by running all rules in validation mode;
+// returns `true` if any rule reported success
+//
+ParserInline.prototype.skipToken = function (state) {
+  var ok, i, pos = state.pos,
+      rules = this.ruler.getRules(''),
+      len = rules.length,
+      maxNesting = state.md.options.maxNesting,
+      cache = state.cache;
+
+
+  if (typeof cache[pos] !== 'undefined') {
+    state.pos = cache[pos];
+    return;
+  }
+
+  if (state.level < maxNesting) {
+    for (i = 0; i < len; i++) {
+      // Increment state.level and decrement it later to limit recursion.
+      // It's harmless to do here, because no tokens are created. But ideally,
+      // we'd need a separate private state variable for this purpose.
+      //
+      state.level++;
+      ok = rules[i](state, true);
+      state.level--;
+
+      if (ok) { break; }
+    }
+  } else {
+    // Too much nesting, just skip until the end of the paragraph.
+    //
+    // NOTE: this will cause links to behave incorrectly in the following case,
+    //       when an amount of `[` is exactly equal to `maxNesting + 1`:
+    //
+    //       [[[[[[[[[[[[[[[[[[[[[foo]()
+    //
+    // TODO: remove this workaround when CM standard will allow nested links
+    //       (we can replace it by preventing links from being parsed in
+    //       validation mode)
+    //
+    state.pos = state.posMax;
+  }
+
+  if (!ok) { state.pos++; }
+  cache[pos] = state.pos;
+};
+
+
+// Generate tokens for input range
+//
+ParserInline.prototype.tokenize = function (state) {
+  var ok, i,
+      rules = this.ruler.getRules(''),
+      len = rules.length,
+      end = state.posMax,
+      maxNesting = state.md.options.maxNesting;
+
+  while (state.pos < end) {
+    // Try all possible rules.
+    // On success, rule should:
+    //
+    // - update `state.pos`
+    // - update `state.tokens`
+    // - return true
+
+    if (state.level < maxNesting) {
+      for (i = 0; i < len; i++) {
+        ok = rules[i](state, false);
+        if (ok) { break; }
+      }
+    }
+
+    if (ok) {
+      if (state.pos >= end) { break; }
+      continue;
+    }
+
+    state.pending += state.src[state.pos++];
+  }
+
+  if (state.pending) {
+    state.pushPending();
+  }
+};
+
+
+/**
+ * ParserInline.parse(str, md, env, outTokens)
+ *
+ * Process input string and push inline tokens into `outTokens`
+ **/
+ParserInline.prototype.parse = function (str, md, env, outTokens) {
+  var i, rules, len;
+  var state = new this.State(str, md, env, outTokens);
+
+  this.tokenize(state);
+
+  rules = this.ruler2.getRules('');
+  len = rules.length;
+
+  for (i = 0; i < len; i++) {
+    rules[i](state);
+  }
+};
+
+
+ParserInline.prototype.State = require('./rules_inline/state_inline');
+
+
+module.exports = ParserInline;
diff --git a/node_modules/markdown-it/lib/presets/commonmark.js b/node_modules/markdown-it/lib/presets/commonmark.js
new file mode 100644
index 00000000..70665537
--- /dev/null
+++ b/node_modules/markdown-it/lib/presets/commonmark.js
@@ -0,0 +1,80 @@
+// Commonmark default options
+
+'use strict';
+
+
+module.exports = {
+  options: {
+    html:         true,         // Enable HTML tags in source
+    xhtmlOut:     true,         // Use '/' to close single tags (<br />)
+    breaks:       false,        // Convert '\n' in paragraphs into <br>
+    langPrefix:   'language-',  // CSS language prefix for fenced blocks
+    linkify:      false,        // autoconvert URL-like texts to links
+
+    // Enable some language-neutral replacements + quotes beautification
+    typographer:  false,
+
+    // Double + single quotes replacement pairs, when typographer enabled,
+    // and smartquotes on. Could be either a String or an Array.
+    //
+    // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+    // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+    quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+    // Highlighter function. Should return escaped HTML,
+    // or '' if the source string is not changed and should be escaped externaly.
+    // If result starts with <pre... internal wrapper is skipped.
+    //
+    // function (/*str, lang*/) { return ''; }
+    //
+    highlight: null,
+
+    maxNesting:   20            // Internal protection, recursion limit
+  },
+
+  components: {
+
+    core: {
+      rules: [
+        'normalize',
+        'block',
+        'inline'
+      ]
+    },
+
+    block: {
+      rules: [
+        'blockquote',
+        'code',
+        'fence',
+        'heading',
+        'hr',
+        'html_block',
+        'lheading',
+        'list',
+        'reference',
+        'paragraph'
+      ]
+    },
+
+    inline: {
+      rules: [
+        'autolink',
+        'backticks',
+        'emphasis',
+        'entity',
+        'escape',
+        'html_inline',
+        'image',
+        'link',
+        'newline',
+        'text'
+      ],
+      rules2: [
+        'balance_pairs',
+        'emphasis',
+        'text_collapse'
+      ]
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/presets/default.js b/node_modules/markdown-it/lib/presets/default.js
new file mode 100644
index 00000000..17ecef2a
--- /dev/null
+++ b/node_modules/markdown-it/lib/presets/default.js
@@ -0,0 +1,41 @@
+// markdown-it default options
+
+'use strict';
+
+
+module.exports = {
+  options: {
+    html:         false,        // Enable HTML tags in source
+    xhtmlOut:     false,        // Use '/' to close single tags (<br />)
+    breaks:       false,        // Convert '\n' in paragraphs into <br>
+    langPrefix:   'language-',  // CSS language prefix for fenced blocks
+    linkify:      false,        // autoconvert URL-like texts to links
+
+    // Enable some language-neutral replacements + quotes beautification
+    typographer:  false,
+
+    // Double + single quotes replacement pairs, when typographer enabled,
+    // and smartquotes on. Could be either a String or an Array.
+    //
+    // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+    // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+    quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+    // Highlighter function. Should return escaped HTML,
+    // or '' if the source string is not changed and should be escaped externaly.
+    // If result starts with <pre... internal wrapper is skipped.
+    //
+    // function (/*str, lang*/) { return ''; }
+    //
+    highlight: null,
+
+    maxNesting:   100            // Internal protection, recursion limit
+  },
+
+  components: {
+
+    core: {},
+    block: {},
+    inline: {}
+  }
+};
diff --git a/node_modules/markdown-it/lib/presets/zero.js b/node_modules/markdown-it/lib/presets/zero.js
new file mode 100644
index 00000000..5da413ca
--- /dev/null
+++ b/node_modules/markdown-it/lib/presets/zero.js
@@ -0,0 +1,62 @@
+// "Zero" preset, with nothing enabled. Useful for manual configuring of simple
+// modes. For example, to parse bold/italic only.
+
+'use strict';
+
+
+module.exports = {
+  options: {
+    html:         false,        // Enable HTML tags in source
+    xhtmlOut:     false,        // Use '/' to close single tags (<br />)
+    breaks:       false,        // Convert '\n' in paragraphs into <br>
+    langPrefix:   'language-',  // CSS language prefix for fenced blocks
+    linkify:      false,        // autoconvert URL-like texts to links
+
+    // Enable some language-neutral replacements + quotes beautification
+    typographer:  false,
+
+    // Double + single quotes replacement pairs, when typographer enabled,
+    // and smartquotes on. Could be either a String or an Array.
+    //
+    // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+    // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+    quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+    // Highlighter function. Should return escaped HTML,
+    // or '' if the source string is not changed and should be escaped externaly.
+    // If result starts with <pre... internal wrapper is skipped.
+    //
+    // function (/*str, lang*/) { return ''; }
+    //
+    highlight: null,
+
+    maxNesting:   20            // Internal protection, recursion limit
+  },
+
+  components: {
+
+    core: {
+      rules: [
+        'normalize',
+        'block',
+        'inline'
+      ]
+    },
+
+    block: {
+      rules: [
+        'paragraph'
+      ]
+    },
+
+    inline: {
+      rules: [
+        'text'
+      ],
+      rules2: [
+        'balance_pairs',
+        'text_collapse'
+      ]
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/renderer.js b/node_modules/markdown-it/lib/renderer.js
new file mode 100644
index 00000000..6a9e5244
--- /dev/null
+++ b/node_modules/markdown-it/lib/renderer.js
@@ -0,0 +1,335 @@
+/**
+ * class Renderer
+ *
+ * Generates HTML from parsed token stream. Each instance has independent
+ * copy of rules. Those can be rewritten with ease. Also, you can add new
+ * rules if you create plugin and adds new token types.
+ **/
+'use strict';
+
+
+var assign          = require('./common/utils').assign;
+var unescapeAll     = require('./common/utils').unescapeAll;
+var escapeHtml      = require('./common/utils').escapeHtml;
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+var default_rules = {};
+
+
+default_rules.code_inline = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx];
+
+  return  '<code' + slf.renderAttrs(token) + '>' +
+          escapeHtml(tokens[idx].content) +
+          '</code>';
+};
+
+
+default_rules.code_block = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx];
+
+  return  '<pre' + slf.renderAttrs(token) + '><code>' +
+          escapeHtml(tokens[idx].content) +
+          '</code></pre>\n';
+};
+
+
+default_rules.fence = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx],
+      info = token.info ? unescapeAll(token.info).trim() : '',
+      langName = '',
+      highlighted, i, tmpAttrs, tmpToken;
+
+  if (info) {
+    langName = info.split(/\s+/g)[0];
+  }
+
+  if (options.highlight) {
+    highlighted = options.highlight(token.content, langName) || escapeHtml(token.content);
+  } else {
+    highlighted = escapeHtml(token.content);
+  }
+
+  if (highlighted.indexOf('<pre') === 0) {
+    return highlighted + '\n';
+  }
+
+  // If language exists, inject class gently, without modifying original token.
+  // May be, one day we will add .clone() for token and simplify this part, but
+  // now we prefer to keep things local.
+  if (info) {
+    i        = token.attrIndex('class');
+    tmpAttrs = token.attrs ? token.attrs.slice() : [];
+
+    if (i < 0) {
+      tmpAttrs.push([ 'class', options.langPrefix + langName ]);
+    } else {
+      tmpAttrs[i][1] += ' ' + options.langPrefix + langName;
+    }
+
+    // Fake token just to render attributes
+    tmpToken = {
+      attrs: tmpAttrs
+    };
+
+    return  '<pre><code' + slf.renderAttrs(tmpToken) + '>'
+          + highlighted
+          + '</code></pre>\n';
+  }
+
+
+  return  '<pre><code' + slf.renderAttrs(token) + '>'
+        + highlighted
+        + '</code></pre>\n';
+};
+
+
+default_rules.image = function (tokens, idx, options, env, slf) {
+  var token = tokens[idx];
+
+  // "alt" attr MUST be set, even if empty. Because it's mandatory and
+  // should be placed on proper position for tests.
+  //
+  // Replace content with actual value
+
+  token.attrs[token.attrIndex('alt')][1] =
+    slf.renderInlineAsText(token.children, options, env);
+
+  return slf.renderToken(tokens, idx, options);
+};
+
+
+default_rules.hardbreak = function (tokens, idx, options /*, env */) {
+  return options.xhtmlOut ? '<br />\n' : '<br>\n';
+};
+default_rules.softbreak = function (tokens, idx, options /*, env */) {
+  return options.breaks ? (options.xhtmlOut ? '<br />\n' : '<br>\n') : '\n';
+};
+
+
+default_rules.text = function (tokens, idx /*, options, env */) {
+  return escapeHtml(tokens[idx].content);
+};
+
+
+default_rules.html_block = function (tokens, idx /*, options, env */) {
+  return tokens[idx].content;
+};
+default_rules.html_inline = function (tokens, idx /*, options, env */) {
+  return tokens[idx].content;
+};
+
+
+/**
+ * new Renderer()
+ *
+ * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults.
+ **/
+function Renderer() {
+
+  /**
+   * Renderer#rules -> Object
+   *
+   * Contains render rules for tokens. Can be updated and extended.
+   *
+   * ##### Example
+   *
+   * ```javascript
+   * var md = require('markdown-it')();
+   *
+   * md.renderer.rules.strong_open  = function () { return '<b>'; };
+   * md.renderer.rules.strong_close = function () { return '</b>'; };
+   *
+   * var result = md.renderInline(...);
+   * ```
+   *
+   * Each rule is called as independent static function with fixed signature:
+   *
+   * ```javascript
+   * function my_token_render(tokens, idx, options, env, renderer) {
+   *   // ...
+   *   return renderedHTML;
+   * }
+   * ```
+   *
+   * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js)
+   * for more details and examples.
+   **/
+  this.rules = assign({}, default_rules);
+}
+
+
+/**
+ * Renderer.renderAttrs(token) -> String
+ *
+ * Render token attributes to string.
+ **/
+Renderer.prototype.renderAttrs = function renderAttrs(token) {
+  var i, l, result;
+
+  if (!token.attrs) { return ''; }
+
+  result = '';
+
+  for (i = 0, l = token.attrs.length; i < l; i++) {
+    result += ' ' + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"';
+  }
+
+  return result;
+};
+
+
+/**
+ * Renderer.renderToken(tokens, idx, options) -> String
+ * - tokens (Array): list of tokens
+ * - idx (Numbed): token index to render
+ * - options (Object): params of parser instance
+ *
+ * Default token renderer. Can be overriden by custom function
+ * in [[Renderer#rules]].
+ **/
+Renderer.prototype.renderToken = function renderToken(tokens, idx, options) {
+  var nextToken,
+      result = '',
+      needLf = false,
+      token = tokens[idx];
+
+  // Tight list paragraphs
+  if (token.hidden) {
+    return '';
+  }
+
+  // Insert a newline between hidden paragraph and subsequent opening
+  // block-level tag.
+  //
+  // For example, here we should insert a newline before blockquote:
+  //  - a
+  //    >
+  //
+  if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) {
+    result += '\n';
+  }
+
+  // Add token name, e.g. `<img`
+  result += (token.nesting === -1 ? '</' : '<') + token.tag;
+
+  // Encode attributes, e.g. `<img src="foo"`
+  result += this.renderAttrs(token);
+
+  // Add a slash for self-closing tags, e.g. `<img src="foo" /`
+  if (token.nesting === 0 && options.xhtmlOut) {
+    result += ' /';
+  }
+
+  // Check if we need to add a newline after this tag
+  if (token.block) {
+    needLf = true;
+
+    if (token.nesting === 1) {
+      if (idx + 1 < tokens.length) {
+        nextToken = tokens[idx + 1];
+
+        if (nextToken.type === 'inline' || nextToken.hidden) {
+          // Block-level tag containing an inline tag.
+          //
+          needLf = false;
+
+        } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) {
+          // Opening tag + closing tag of the same type. E.g. `<li></li>`.
+          //
+          needLf = false;
+        }
+      }
+    }
+  }
+
+  result += needLf ? '>\n' : '>';
+
+  return result;
+};
+
+
+/**
+ * Renderer.renderInline(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * The same as [[Renderer.render]], but for single token of `inline` type.
+ **/
+Renderer.prototype.renderInline = function (tokens, options, env) {
+  var type,
+      result = '',
+      rules = this.rules;
+
+  for (var i = 0, len = tokens.length; i < len; i++) {
+    type = tokens[i].type;
+
+    if (typeof rules[type] !== 'undefined') {
+      result += rules[type](tokens, i, options, env, this);
+    } else {
+      result += this.renderToken(tokens, i, options);
+    }
+  }
+
+  return result;
+};
+
+
+/** internal
+ * Renderer.renderInlineAsText(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Special kludge for image `alt` attributes to conform CommonMark spec.
+ * Don't try to use it! Spec requires to show `alt` content with stripped markup,
+ * instead of simple escaping.
+ **/
+Renderer.prototype.renderInlineAsText = function (tokens, options, env) {
+  var result = '';
+
+  for (var i = 0, len = tokens.length; i < len; i++) {
+    if (tokens[i].type === 'text') {
+      result += tokens[i].content;
+    } else if (tokens[i].type === 'image') {
+      result += this.renderInlineAsText(tokens[i].children, options, env);
+    }
+  }
+
+  return result;
+};
+
+
+/**
+ * Renderer.render(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Takes token stream and generates HTML. Probably, you will never need to call
+ * this method directly.
+ **/
+Renderer.prototype.render = function (tokens, options, env) {
+  var i, len, type,
+      result = '',
+      rules = this.rules;
+
+  for (i = 0, len = tokens.length; i < len; i++) {
+    type = tokens[i].type;
+
+    if (type === 'inline') {
+      result += this.renderInline(tokens[i].children, options, env);
+    } else if (typeof rules[type] !== 'undefined') {
+      result += rules[tokens[i].type](tokens, i, options, env, this);
+    } else {
+      result += this.renderToken(tokens, i, options, env);
+    }
+  }
+
+  return result;
+};
+
+module.exports = Renderer;
diff --git a/node_modules/markdown-it/lib/ruler.js b/node_modules/markdown-it/lib/ruler.js
new file mode 100644
index 00000000..9ad5da4a
--- /dev/null
+++ b/node_modules/markdown-it/lib/ruler.js
@@ -0,0 +1,352 @@
+/**
+ * class Ruler
+ *
+ * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and
+ * [[MarkdownIt#inline]] to manage sequences of functions (rules):
+ *
+ * - keep rules in defined order
+ * - assign the name to each rule
+ * - enable/disable rules
+ * - add/replace rules
+ * - allow assign rules to additional named chains (in the same)
+ * - cacheing lists of active rules
+ *
+ * You will not need use this class directly until write plugins. For simple
+ * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and
+ * [[MarkdownIt.use]].
+ **/
+'use strict';
+
+
+/**
+ * new Ruler()
+ **/
+function Ruler() {
+  // List of added rules. Each element is:
+  //
+  // {
+  //   name: XXX,
+  //   enabled: Boolean,
+  //   fn: Function(),
+  //   alt: [ name2, name3 ]
+  // }
+  //
+  this.__rules__ = [];
+
+  // Cached rule chains.
+  //
+  // First level - chain name, '' for default.
+  // Second level - diginal anchor for fast filtering by charcodes.
+  //
+  this.__cache__ = null;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+// Helper methods, should not be used directly
+
+
+// Find rule index by name
+//
+Ruler.prototype.__find__ = function (name) {
+  for (var i = 0; i < this.__rules__.length; i++) {
+    if (this.__rules__[i].name === name) {
+      return i;
+    }
+  }
+  return -1;
+};
+
+
+// Build rules lookup cache
+//
+Ruler.prototype.__compile__ = function () {
+  var self = this;
+  var chains = [ '' ];
+
+  // collect unique names
+  self.__rules__.forEach(function (rule) {
+    if (!rule.enabled) { return; }
+
+    rule.alt.forEach(function (altName) {
+      if (chains.indexOf(altName) < 0) {
+        chains.push(altName);
+      }
+    });
+  });
+
+  self.__cache__ = {};
+
+  chains.forEach(function (chain) {
+    self.__cache__[chain] = [];
+    self.__rules__.forEach(function (rule) {
+      if (!rule.enabled) { return; }
+
+      if (chain && rule.alt.indexOf(chain) < 0) { return; }
+
+      self.__cache__[chain].push(rule.fn);
+    });
+  });
+};
+
+
+/**
+ * Ruler.at(name, fn [, options])
+ * - name (String): rule name to replace.
+ * - fn (Function): new rule function.
+ * - options (Object): new rule options (not mandatory).
+ *
+ * Replace rule by name with new function & options. Throws error if name not
+ * found.
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * Replace existing typographer replacement rule with new one:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.at('replacements', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.at = function (name, fn, options) {
+  var index = this.__find__(name);
+  var opt = options || {};
+
+  if (index === -1) { throw new Error('Parser rule not found: ' + name); }
+
+  this.__rules__[index].fn = fn;
+  this.__rules__[index].alt = opt.alt || [];
+  this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.before(beforeName, ruleName, fn [, options])
+ * - beforeName (String): new rule will be added before this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain before one with given name. See also
+ * [[Ruler.after]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.block.ruler.before('paragraph', 'my_rule', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.before = function (beforeName, ruleName, fn, options) {
+  var index = this.__find__(beforeName);
+  var opt = options || {};
+
+  if (index === -1) { throw new Error('Parser rule not found: ' + beforeName); }
+
+  this.__rules__.splice(index, 0, {
+    name: ruleName,
+    enabled: true,
+    fn: fn,
+    alt: opt.alt || []
+  });
+
+  this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.after(afterName, ruleName, fn [, options])
+ * - afterName (String): new rule will be added after this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain after one with given name. See also
+ * [[Ruler.before]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.inline.ruler.after('text', 'my_rule', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.after = function (afterName, ruleName, fn, options) {
+  var index = this.__find__(afterName);
+  var opt = options || {};
+
+  if (index === -1) { throw new Error('Parser rule not found: ' + afterName); }
+
+  this.__rules__.splice(index + 1, 0, {
+    name: ruleName,
+    enabled: true,
+    fn: fn,
+    alt: opt.alt || []
+  });
+
+  this.__cache__ = null;
+};
+
+/**
+ * Ruler.push(ruleName, fn [, options])
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Push new rule to the end of chain. See also
+ * [[Ruler.before]], [[Ruler.after]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.push('my_rule', function replace(state) {
+ *   //...
+ * });
+ * ```
+ **/
+Ruler.prototype.push = function (ruleName, fn, options) {
+  var opt = options || {};
+
+  this.__rules__.push({
+    name: ruleName,
+    enabled: true,
+    fn: fn,
+    alt: opt.alt || []
+  });
+
+  this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.enable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to enable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.disable]], [[Ruler.enableOnly]].
+ **/
+Ruler.prototype.enable = function (list, ignoreInvalid) {
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  var result = [];
+
+  // Search by name and enable
+  list.forEach(function (name) {
+    var idx = this.__find__(name);
+
+    if (idx < 0) {
+      if (ignoreInvalid) { return; }
+      throw new Error('Rules manager: invalid rule name ' + name);
+    }
+    this.__rules__[idx].enabled = true;
+    result.push(name);
+  }, this);
+
+  this.__cache__ = null;
+  return result;
+};
+
+
+/**
+ * Ruler.enableOnly(list [, ignoreInvalid])
+ * - list (String|Array): list of rule names to enable (whitelist).
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names, and disable everything else. If any rule name
+ * not found - throw Error. Errors can be disabled by second param.
+ *
+ * See also [[Ruler.disable]], [[Ruler.enable]].
+ **/
+Ruler.prototype.enableOnly = function (list, ignoreInvalid) {
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  this.__rules__.forEach(function (rule) { rule.enabled = false; });
+
+  this.enable(list, ignoreInvalid);
+};
+
+
+/**
+ * Ruler.disable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Disable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.enable]], [[Ruler.enableOnly]].
+ **/
+Ruler.prototype.disable = function (list, ignoreInvalid) {
+  if (!Array.isArray(list)) { list = [ list ]; }
+
+  var result = [];
+
+  // Search by name and disable
+  list.forEach(function (name) {
+    var idx = this.__find__(name);
+
+    if (idx < 0) {
+      if (ignoreInvalid) { return; }
+      throw new Error('Rules manager: invalid rule name ' + name);
+    }
+    this.__rules__[idx].enabled = false;
+    result.push(name);
+  }, this);
+
+  this.__cache__ = null;
+  return result;
+};
+
+
+/**
+ * Ruler.getRules(chainName) -> Array
+ *
+ * Return array of active functions (rules) for given chain name. It analyzes
+ * rules configuration, compiles caches if not exists and returns result.
+ *
+ * Default chain name is `''` (empty string). It can't be skipped. That's
+ * done intentionally, to keep signature monomorphic for high speed.
+ **/
+Ruler.prototype.getRules = function (chainName) {
+  if (this.__cache__ === null) {
+    this.__compile__();
+  }
+
+  // Chain can be empty, if rules disabled. But we still have to return Array.
+  return this.__cache__[chainName] || [];
+};
+
+module.exports = Ruler;
diff --git a/node_modules/markdown-it/lib/rules_block/blockquote.js b/node_modules/markdown-it/lib/rules_block/blockquote.js
new file mode 100644
index 00000000..e41704df
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/blockquote.js
@@ -0,0 +1,285 @@
+// Block quotes
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function blockquote(state, startLine, endLine, silent) {
+  var adjustTab,
+      ch,
+      i,
+      initial,
+      l,
+      lastLineEmpty,
+      lines,
+      nextLine,
+      offset,
+      oldBMarks,
+      oldBSCount,
+      oldIndent,
+      oldParentType,
+      oldSCount,
+      oldTShift,
+      spaceAfterMarker,
+      terminate,
+      terminatorRules,
+      token,
+      wasOutdented,
+      oldLineMax = state.lineMax,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  // check the block quote marker
+  if (state.src.charCodeAt(pos++) !== 0x3E/* > */) { return false; }
+
+  // we know that it's going to be a valid blockquote,
+  // so no point trying to find the end of it in silent mode
+  if (silent) { return true; }
+
+  // skip spaces after ">" and re-calculate offset
+  initial = offset = state.sCount[startLine] + pos - (state.bMarks[startLine] + state.tShift[startLine]);
+
+  // skip one optional space after '>'
+  if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+    // ' >   test '
+    //     ^ -- position start of line here:
+    pos++;
+    initial++;
+    offset++;
+    adjustTab = false;
+    spaceAfterMarker = true;
+  } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+    spaceAfterMarker = true;
+
+    if ((state.bsCount[startLine] + offset) % 4 === 3) {
+      // '  >\t  test '
+      //       ^ -- position start of line here (tab has width===1)
+      pos++;
+      initial++;
+      offset++;
+      adjustTab = false;
+    } else {
+      // ' >\t  test '
+      //    ^ -- position start of line here + shift bsCount slightly
+      //         to make extra space appear
+      adjustTab = true;
+    }
+  } else {
+    spaceAfterMarker = false;
+  }
+
+  oldBMarks = [ state.bMarks[startLine] ];
+  state.bMarks[startLine] = pos;
+
+  while (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (isSpace(ch)) {
+      if (ch === 0x09) {
+        offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4;
+      } else {
+        offset++;
+      }
+    } else {
+      break;
+    }
+
+    pos++;
+  }
+
+  oldBSCount = [ state.bsCount[startLine] ];
+  state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0);
+
+  lastLineEmpty = pos >= max;
+
+  oldSCount = [ state.sCount[startLine] ];
+  state.sCount[startLine] = offset - initial;
+
+  oldTShift = [ state.tShift[startLine] ];
+  state.tShift[startLine] = pos - state.bMarks[startLine];
+
+  terminatorRules = state.md.block.ruler.getRules('blockquote');
+
+  oldParentType = state.parentType;
+  state.parentType = 'blockquote';
+  wasOutdented = false;
+
+  // Search the end of the block
+  //
+  // Block ends with either:
+  //  1. an empty line outside:
+  //     ```
+  //     > test
+  //
+  //     ```
+  //  2. an empty line inside:
+  //     ```
+  //     >
+  //     test
+  //     ```
+  //  3. another tag:
+  //     ```
+  //     > test
+  //      - - -
+  //     ```
+  for (nextLine = startLine + 1; nextLine < endLine; nextLine++) {
+    // check if it's outdented, i.e. it's inside list item and indented
+    // less than said list item:
+    //
+    // ```
+    // 1. anything
+    //    > current blockquote
+    // 2. checking this line
+    // ```
+    if (state.sCount[nextLine] < state.blkIndent) wasOutdented = true;
+
+    pos = state.bMarks[nextLine] + state.tShift[nextLine];
+    max = state.eMarks[nextLine];
+
+    if (pos >= max) {
+      // Case 1: line is not inside the blockquote, and this line is empty.
+      break;
+    }
+
+    if (state.src.charCodeAt(pos++) === 0x3E/* > */ && !wasOutdented) {
+      // This line is inside the blockquote.
+
+      // skip spaces after ">" and re-calculate offset
+      initial = offset = state.sCount[nextLine] + pos - (state.bMarks[nextLine] + state.tShift[nextLine]);
+
+      // skip one optional space after '>'
+      if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+        // ' >   test '
+        //     ^ -- position start of line here:
+        pos++;
+        initial++;
+        offset++;
+        adjustTab = false;
+        spaceAfterMarker = true;
+      } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+        spaceAfterMarker = true;
+
+        if ((state.bsCount[nextLine] + offset) % 4 === 3) {
+          // '  >\t  test '
+          //       ^ -- position start of line here (tab has width===1)
+          pos++;
+          initial++;
+          offset++;
+          adjustTab = false;
+        } else {
+          // ' >\t  test '
+          //    ^ -- position start of line here + shift bsCount slightly
+          //         to make extra space appear
+          adjustTab = true;
+        }
+      } else {
+        spaceAfterMarker = false;
+      }
+
+      oldBMarks.push(state.bMarks[nextLine]);
+      state.bMarks[nextLine] = pos;
+
+      while (pos < max) {
+        ch = state.src.charCodeAt(pos);
+
+        if (isSpace(ch)) {
+          if (ch === 0x09) {
+            offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4;
+          } else {
+            offset++;
+          }
+        } else {
+          break;
+        }
+
+        pos++;
+      }
+
+      lastLineEmpty = pos >= max;
+
+      oldBSCount.push(state.bsCount[nextLine]);
+      state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0);
+
+      oldSCount.push(state.sCount[nextLine]);
+      state.sCount[nextLine] = offset - initial;
+
+      oldTShift.push(state.tShift[nextLine]);
+      state.tShift[nextLine] = pos - state.bMarks[nextLine];
+      continue;
+    }
+
+    // Case 2: line is not inside the blockquote, and the last line was empty.
+    if (lastLineEmpty) { break; }
+
+    // Case 3: another tag found.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+
+    if (terminate) {
+      // Quirk to enforce "hard termination mode" for paragraphs;
+      // normally if you call `tokenize(state, startLine, nextLine)`,
+      // paragraphs will look below nextLine for paragraph continuation,
+      // but if blockquote is terminated by another tag, they shouldn't
+      state.lineMax = nextLine;
+
+      if (state.blkIndent !== 0) {
+        // state.blkIndent was non-zero, we now set it to zero,
+        // so we need to re-calculate all offsets to appear as
+        // if indent wasn't changed
+        oldBMarks.push(state.bMarks[nextLine]);
+        oldBSCount.push(state.bsCount[nextLine]);
+        oldTShift.push(state.tShift[nextLine]);
+        oldSCount.push(state.sCount[nextLine]);
+        state.sCount[nextLine] -= state.blkIndent;
+      }
+
+      break;
+    }
+
+    oldBMarks.push(state.bMarks[nextLine]);
+    oldBSCount.push(state.bsCount[nextLine]);
+    oldTShift.push(state.tShift[nextLine]);
+    oldSCount.push(state.sCount[nextLine]);
+
+    // A negative indentation means that this is a paragraph continuation
+    //
+    state.sCount[nextLine] = -1;
+  }
+
+  oldIndent = state.blkIndent;
+  state.blkIndent = 0;
+
+  token        = state.push('blockquote_open', 'blockquote', 1);
+  token.markup = '>';
+  token.map    = lines = [ startLine, 0 ];
+
+  state.md.block.tokenize(state, startLine, nextLine);
+
+  token        = state.push('blockquote_close', 'blockquote', -1);
+  token.markup = '>';
+
+  state.lineMax = oldLineMax;
+  state.parentType = oldParentType;
+  lines[1] = state.line;
+
+  // Restore original tShift; this might not be necessary since the parser
+  // has already been here, but just to make sure we can do that.
+  for (i = 0; i < oldTShift.length; i++) {
+    state.bMarks[i + startLine] = oldBMarks[i];
+    state.tShift[i + startLine] = oldTShift[i];
+    state.sCount[i + startLine] = oldSCount[i];
+    state.bsCount[i + startLine] = oldBSCount[i];
+  }
+  state.blkIndent = oldIndent;
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/code.js b/node_modules/markdown-it/lib/rules_block/code.js
new file mode 100644
index 00000000..a83db116
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/code.js
@@ -0,0 +1,34 @@
+// Code block (4 spaces padded)
+
+'use strict';
+
+
+module.exports = function code(state, startLine, endLine/*, silent*/) {
+  var nextLine, last, token;
+
+  if (state.sCount[startLine] - state.blkIndent < 4) { return false; }
+
+  last = nextLine = startLine + 1;
+
+  while (nextLine < endLine) {
+    if (state.isEmpty(nextLine)) {
+      nextLine++;
+      continue;
+    }
+
+    if (state.sCount[nextLine] - state.blkIndent >= 4) {
+      nextLine++;
+      last = nextLine;
+      continue;
+    }
+    break;
+  }
+
+  state.line = last;
+
+  token         = state.push('code_block', 'code', 0);
+  token.content = state.getLines(startLine, last, 4 + state.blkIndent, true);
+  token.map     = [ startLine, state.line ];
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/fence.js b/node_modules/markdown-it/lib/rules_block/fence.js
new file mode 100644
index 00000000..672c165f
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/fence.js
@@ -0,0 +1,94 @@
+// fences (``` lang, ~~~ lang)
+
+'use strict';
+
+
+module.exports = function fence(state, startLine, endLine, silent) {
+  var marker, len, params, nextLine, mem, token, markup,
+      haveEndMarker = false,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  if (pos + 3 > max) { return false; }
+
+  marker = state.src.charCodeAt(pos);
+
+  if (marker !== 0x7E/* ~ */ && marker !== 0x60 /* ` */) {
+    return false;
+  }
+
+  // scan marker length
+  mem = pos;
+  pos = state.skipChars(pos, marker);
+
+  len = pos - mem;
+
+  if (len < 3) { return false; }
+
+  markup = state.src.slice(mem, pos);
+  params = state.src.slice(pos, max);
+
+  if (params.indexOf(String.fromCharCode(marker)) >= 0) { return false; }
+
+  // Since start is found, we can report success here in validation mode
+  if (silent) { return true; }
+
+  // search end of block
+  nextLine = startLine;
+
+  for (;;) {
+    nextLine++;
+    if (nextLine >= endLine) {
+      // unclosed block should be autoclosed by end of document.
+      // also block seems to be autoclosed by end of parent
+      break;
+    }
+
+    pos = mem = state.bMarks[nextLine] + state.tShift[nextLine];
+    max = state.eMarks[nextLine];
+
+    if (pos < max && state.sCount[nextLine] < state.blkIndent) {
+      // non-empty line with negative indent should stop the list:
+      // - ```
+      //  test
+      break;
+    }
+
+    if (state.src.charCodeAt(pos) !== marker) { continue; }
+
+    if (state.sCount[nextLine] - state.blkIndent >= 4) {
+      // closing fence should be indented less than 4 spaces
+      continue;
+    }
+
+    pos = state.skipChars(pos, marker);
+
+    // closing code fence must be at least as long as the opening one
+    if (pos - mem < len) { continue; }
+
+    // make sure tail has spaces only
+    pos = state.skipSpaces(pos);
+
+    if (pos < max) { continue; }
+
+    haveEndMarker = true;
+    // found!
+    break;
+  }
+
+  // If a fence has heading spaces, they should be removed from its inner block
+  len = state.sCount[startLine];
+
+  state.line = nextLine + (haveEndMarker ? 1 : 0);
+
+  token         = state.push('fence', 'code', 0);
+  token.info    = params;
+  token.content = state.getLines(startLine + 1, nextLine, len, true);
+  token.markup  = markup;
+  token.map     = [ startLine, state.line ];
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/heading.js b/node_modules/markdown-it/lib/rules_block/heading.js
new file mode 100644
index 00000000..9863f48d
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/heading.js
@@ -0,0 +1,55 @@
+// heading (#, ##, ...)
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function heading(state, startLine, endLine, silent) {
+  var ch, level, tmp, token,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  ch  = state.src.charCodeAt(pos);
+
+  if (ch !== 0x23/* # */ || pos >= max) { return false; }
+
+  // count heading level
+  level = 1;
+  ch = state.src.charCodeAt(++pos);
+  while (ch === 0x23/* # */ && pos < max && level <= 6) {
+    level++;
+    ch = state.src.charCodeAt(++pos);
+  }
+
+  if (level > 6 || (pos < max && !isSpace(ch))) { return false; }
+
+  if (silent) { return true; }
+
+  // Let's cut tails like '    ###  ' from the end of string
+
+  max = state.skipSpacesBack(max, pos);
+  tmp = state.skipCharsBack(max, 0x23, pos); // #
+  if (tmp > pos && isSpace(state.src.charCodeAt(tmp - 1))) {
+    max = tmp;
+  }
+
+  state.line = startLine + 1;
+
+  token        = state.push('heading_open', 'h' + String(level), 1);
+  token.markup = '########'.slice(0, level);
+  token.map    = [ startLine, state.line ];
+
+  token          = state.push('inline', '', 0);
+  token.content  = state.src.slice(pos, max).trim();
+  token.map      = [ startLine, state.line ];
+  token.children = [];
+
+  token        = state.push('heading_close', 'h' + String(level), -1);
+  token.markup = '########'.slice(0, level);
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/hr.js b/node_modules/markdown-it/lib/rules_block/hr.js
new file mode 100644
index 00000000..a3bb14eb
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/hr.js
@@ -0,0 +1,45 @@
+// Horizontal rule
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function hr(state, startLine, endLine, silent) {
+  var marker, cnt, ch, token,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  marker = state.src.charCodeAt(pos++);
+
+  // Check hr marker
+  if (marker !== 0x2A/* * */ &&
+      marker !== 0x2D/* - */ &&
+      marker !== 0x5F/* _ */) {
+    return false;
+  }
+
+  // markers can be mixed with spaces, but there should be at least 3 of them
+
+  cnt = 1;
+  while (pos < max) {
+    ch = state.src.charCodeAt(pos++);
+    if (ch !== marker && !isSpace(ch)) { return false; }
+    if (ch === marker) { cnt++; }
+  }
+
+  if (cnt < 3) { return false; }
+
+  if (silent) { return true; }
+
+  state.line = startLine + 1;
+
+  token        = state.push('hr', 'hr', 0);
+  token.map    = [ startLine, state.line ];
+  token.markup = Array(cnt + 1).join(String.fromCharCode(marker));
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/html_block.js b/node_modules/markdown-it/lib/rules_block/html_block.js
new file mode 100644
index 00000000..256b5951
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/html_block.js
@@ -0,0 +1,74 @@
+// HTML block
+
+'use strict';
+
+
+var block_names = require('../common/html_blocks');
+var HTML_OPEN_CLOSE_TAG_RE = require('../common/html_re').HTML_OPEN_CLOSE_TAG_RE;
+
+// An array of opening and corresponding closing sequences for html tags,
+// last argument defines whether it can terminate a paragraph or not
+//
+var HTML_SEQUENCES = [
+  [ /^<(script|pre|style)(?=(\s|>|$))/i, /<\/(script|pre|style)>/i, true ],
+  [ /^<!--/,        /-->/,   true ],
+  [ /^<\?/,         /\?>/,   true ],
+  [ /^<![A-Z]/,     />/,     true ],
+  [ /^<!\[CDATA\[/, /\]\]>/, true ],
+  [ new RegExp('^</?(' + block_names.join('|') + ')(?=(\\s|/?>|$))', 'i'), /^$/, true ],
+  [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + '\\s*$'),  /^$/, false ]
+];
+
+
+module.exports = function html_block(state, startLine, endLine, silent) {
+  var i, nextLine, token, lineText,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine];
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  if (!state.md.options.html) { return false; }
+
+  if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+
+  lineText = state.src.slice(pos, max);
+
+  for (i = 0; i < HTML_SEQUENCES.length; i++) {
+    if (HTML_SEQUENCES[i][0].test(lineText)) { break; }
+  }
+
+  if (i === HTML_SEQUENCES.length) { return false; }
+
+  if (silent) {
+    // true if this sequence can be a terminator, false otherwise
+    return HTML_SEQUENCES[i][2];
+  }
+
+  nextLine = startLine + 1;
+
+  // If we are here - we detected HTML block.
+  // Let's roll down till block end.
+  if (!HTML_SEQUENCES[i][1].test(lineText)) {
+    for (; nextLine < endLine; nextLine++) {
+      if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+      pos = state.bMarks[nextLine] + state.tShift[nextLine];
+      max = state.eMarks[nextLine];
+      lineText = state.src.slice(pos, max);
+
+      if (HTML_SEQUENCES[i][1].test(lineText)) {
+        if (lineText.length !== 0) { nextLine++; }
+        break;
+      }
+    }
+  }
+
+  state.line = nextLine;
+
+  token         = state.push('html_block', '', 0);
+  token.map     = [ startLine, nextLine ];
+  token.content = state.getLines(startLine, nextLine, state.blkIndent, true);
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/lheading.js b/node_modules/markdown-it/lib/rules_block/lheading.js
new file mode 100644
index 00000000..19bdc39a
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/lheading.js
@@ -0,0 +1,83 @@
+// lheading (---, ===)
+
+'use strict';
+
+
+module.exports = function lheading(state, startLine, endLine/*, silent*/) {
+  var content, terminate, i, l, token, pos, max, level, marker,
+      nextLine = startLine + 1, oldParentType,
+      terminatorRules = state.md.block.ruler.getRules('paragraph');
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  oldParentType = state.parentType;
+  state.parentType = 'paragraph'; // use paragraph to match terminatorRules
+
+  // jump line-by-line until empty one or EOF
+  for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+    // this would be a code block normally, but after paragraph
+    // it's considered a lazy continuation regardless of what's there
+    if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+    //
+    // Check for underline in setext header
+    //
+    if (state.sCount[nextLine] >= state.blkIndent) {
+      pos = state.bMarks[nextLine] + state.tShift[nextLine];
+      max = state.eMarks[nextLine];
+
+      if (pos < max) {
+        marker = state.src.charCodeAt(pos);
+
+        if (marker === 0x2D/* - */ || marker === 0x3D/* = */) {
+          pos = state.skipChars(pos, marker);
+          pos = state.skipSpaces(pos);
+
+          if (pos >= max) {
+            level = (marker === 0x3D/* = */ ? 1 : 2);
+            break;
+          }
+        }
+      }
+    }
+
+    // quirk for blockquotes, this line should already be checked by that rule
+    if (state.sCount[nextLine] < 0) { continue; }
+
+    // Some tags can terminate paragraph without empty line.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+  }
+
+  if (!level) {
+    // Didn't find valid underline
+    return false;
+  }
+
+  content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+
+  state.line = nextLine + 1;
+
+  token          = state.push('heading_open', 'h' + String(level), 1);
+  token.markup   = String.fromCharCode(marker);
+  token.map      = [ startLine, state.line ];
+
+  token          = state.push('inline', '', 0);
+  token.content  = content;
+  token.map      = [ startLine, state.line - 1 ];
+  token.children = [];
+
+  token          = state.push('heading_close', 'h' + String(level), -1);
+  token.markup   = String.fromCharCode(marker);
+
+  state.parentType = oldParentType;
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/list.js b/node_modules/markdown-it/lib/rules_block/list.js
new file mode 100644
index 00000000..585f51de
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/list.js
@@ -0,0 +1,336 @@
+// Lists
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+// Search `[-+*][\n ]`, returns next pos after marker on success
+// or -1 on fail.
+function skipBulletListMarker(state, startLine) {
+  var marker, pos, max, ch;
+
+  pos = state.bMarks[startLine] + state.tShift[startLine];
+  max = state.eMarks[startLine];
+
+  marker = state.src.charCodeAt(pos++);
+  // Check bullet
+  if (marker !== 0x2A/* * */ &&
+      marker !== 0x2D/* - */ &&
+      marker !== 0x2B/* + */) {
+    return -1;
+  }
+
+  if (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (!isSpace(ch)) {
+      // " -test " - is not a list item
+      return -1;
+    }
+  }
+
+  return pos;
+}
+
+// Search `\d+[.)][\n ]`, returns next pos after marker on success
+// or -1 on fail.
+function skipOrderedListMarker(state, startLine) {
+  var ch,
+      start = state.bMarks[startLine] + state.tShift[startLine],
+      pos = start,
+      max = state.eMarks[startLine];
+
+  // List marker should have at least 2 chars (digit + dot)
+  if (pos + 1 >= max) { return -1; }
+
+  ch = state.src.charCodeAt(pos++);
+
+  if (ch < 0x30/* 0 */ || ch > 0x39/* 9 */) { return -1; }
+
+  for (;;) {
+    // EOL -> fail
+    if (pos >= max) { return -1; }
+
+    ch = state.src.charCodeAt(pos++);
+
+    if (ch >= 0x30/* 0 */ && ch <= 0x39/* 9 */) {
+
+      // List marker should have no more than 9 digits
+      // (prevents integer overflow in browsers)
+      if (pos - start >= 10) { return -1; }
+
+      continue;
+    }
+
+    // found valid marker
+    if (ch === 0x29/* ) */ || ch === 0x2e/* . */) {
+      break;
+    }
+
+    return -1;
+  }
+
+
+  if (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (!isSpace(ch)) {
+      // " 1.test " - is not a list item
+      return -1;
+    }
+  }
+  return pos;
+}
+
+function markTightParagraphs(state, idx) {
+  var i, l,
+      level = state.level + 2;
+
+  for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) {
+    if (state.tokens[i].level === level && state.tokens[i].type === 'paragraph_open') {
+      state.tokens[i + 2].hidden = true;
+      state.tokens[i].hidden = true;
+      i += 2;
+    }
+  }
+}
+
+
+module.exports = function list(state, startLine, endLine, silent) {
+  var ch,
+      contentStart,
+      i,
+      indent,
+      indentAfterMarker,
+      initial,
+      isOrdered,
+      itemLines,
+      l,
+      listLines,
+      listTokIdx,
+      markerCharCode,
+      markerValue,
+      max,
+      nextLine,
+      offset,
+      oldIndent,
+      oldLIndent,
+      oldParentType,
+      oldTShift,
+      oldTight,
+      pos,
+      posAfterMarker,
+      prevEmptyEnd,
+      start,
+      terminate,
+      terminatorRules,
+      token,
+      isTerminatingParagraph = false,
+      tight = true;
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  // limit conditions when list can interrupt
+  // a paragraph (validation mode only)
+  if (silent && state.parentType === 'paragraph') {
+    // Next list item should still terminate previous list item;
+    //
+    // This code can fail if plugins use blkIndent as well as lists,
+    // but I hope the spec gets fixed long before that happens.
+    //
+    if (state.tShift[startLine] >= state.blkIndent) {
+      isTerminatingParagraph = true;
+    }
+  }
+
+  // Detect list type and position after marker
+  if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) {
+    isOrdered = true;
+    start = state.bMarks[startLine] + state.tShift[startLine];
+    markerValue = Number(state.src.substr(start, posAfterMarker - start - 1));
+
+    // If we're starting a new ordered list right after
+    // a paragraph, it should start with 1.
+    if (isTerminatingParagraph && markerValue !== 1) return false;
+
+  } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) {
+    isOrdered = false;
+
+  } else {
+    return false;
+  }
+
+  // If we're starting a new unordered list right after
+  // a paragraph, first line should not be empty.
+  if (isTerminatingParagraph) {
+    if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false;
+  }
+
+  // We should terminate list on style change. Remember first one to compare.
+  markerCharCode = state.src.charCodeAt(posAfterMarker - 1);
+
+  // For validation mode we can terminate immediately
+  if (silent) { return true; }
+
+  // Start list
+  listTokIdx = state.tokens.length;
+
+  if (isOrdered) {
+    token       = state.push('ordered_list_open', 'ol', 1);
+    if (markerValue !== 1) {
+      token.attrs = [ [ 'start', markerValue ] ];
+    }
+
+  } else {
+    token       = state.push('bullet_list_open', 'ul', 1);
+  }
+
+  token.map    = listLines = [ startLine, 0 ];
+  token.markup = String.fromCharCode(markerCharCode);
+
+  //
+  // Iterate list items
+  //
+
+  nextLine = startLine;
+  prevEmptyEnd = false;
+  terminatorRules = state.md.block.ruler.getRules('list');
+
+  oldParentType = state.parentType;
+  state.parentType = 'list';
+
+  while (nextLine < endLine) {
+    pos = posAfterMarker;
+    max = state.eMarks[nextLine];
+
+    initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]);
+
+    while (pos < max) {
+      ch = state.src.charCodeAt(pos);
+
+      if (ch === 0x09) {
+        offset += 4 - (offset + state.bsCount[nextLine]) % 4;
+      } else if (ch === 0x20) {
+        offset++;
+      } else {
+        break;
+      }
+
+      pos++;
+    }
+
+    contentStart = pos;
+
+    if (contentStart >= max) {
+      // trimming space in "-    \n  3" case, indent is 1 here
+      indentAfterMarker = 1;
+    } else {
+      indentAfterMarker = offset - initial;
+    }
+
+    // If we have more than 4 spaces, the indent is 1
+    // (the rest is just indented code block)
+    if (indentAfterMarker > 4) { indentAfterMarker = 1; }
+
+    // "  -  test"
+    //  ^^^^^ - calculating total length of this thing
+    indent = initial + indentAfterMarker;
+
+    // Run subparser & write tokens
+    token        = state.push('list_item_open', 'li', 1);
+    token.markup = String.fromCharCode(markerCharCode);
+    token.map    = itemLines = [ startLine, 0 ];
+
+    oldIndent = state.blkIndent;
+    oldTight = state.tight;
+    oldTShift = state.tShift[startLine];
+    oldLIndent = state.sCount[startLine];
+    state.blkIndent = indent;
+    state.tight = true;
+    state.tShift[startLine] = contentStart - state.bMarks[startLine];
+    state.sCount[startLine] = offset;
+
+    if (contentStart >= max && state.isEmpty(startLine + 1)) {
+      // workaround for this case
+      // (list item is empty, list terminates before "foo"):
+      // ~~~~~~~~
+      //   -
+      //
+      //     foo
+      // ~~~~~~~~
+      state.line = Math.min(state.line + 2, endLine);
+    } else {
+      state.md.block.tokenize(state, startLine, endLine, true);
+    }
+
+    // If any of list item is tight, mark list as tight
+    if (!state.tight || prevEmptyEnd) {
+      tight = false;
+    }
+    // Item become loose if finish with empty line,
+    // but we should filter last element, because it means list finish
+    prevEmptyEnd = (state.line - startLine) > 1 && state.isEmpty(state.line - 1);
+
+    state.blkIndent = oldIndent;
+    state.tShift[startLine] = oldTShift;
+    state.sCount[startLine] = oldLIndent;
+    state.tight = oldTight;
+
+    token        = state.push('list_item_close', 'li', -1);
+    token.markup = String.fromCharCode(markerCharCode);
+
+    nextLine = startLine = state.line;
+    itemLines[1] = nextLine;
+    contentStart = state.bMarks[startLine];
+
+    if (nextLine >= endLine) { break; }
+
+    //
+    // Try to check if list is terminated or continued.
+    //
+    if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+    // fail if terminating block found
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+
+    // fail if list has another type
+    if (isOrdered) {
+      posAfterMarker = skipOrderedListMarker(state, nextLine);
+      if (posAfterMarker < 0) { break; }
+    } else {
+      posAfterMarker = skipBulletListMarker(state, nextLine);
+      if (posAfterMarker < 0) { break; }
+    }
+
+    if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { break; }
+  }
+
+  // Finalize list
+  if (isOrdered) {
+    token = state.push('ordered_list_close', 'ol', -1);
+  } else {
+    token = state.push('bullet_list_close', 'ul', -1);
+  }
+  token.markup = String.fromCharCode(markerCharCode);
+
+  listLines[1] = nextLine;
+  state.line = nextLine;
+
+  state.parentType = oldParentType;
+
+  // mark paragraphs tight if needed
+  if (tight) {
+    markTightParagraphs(state, listTokIdx);
+  }
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/paragraph.js b/node_modules/markdown-it/lib/rules_block/paragraph.js
new file mode 100644
index 00000000..f0c68729
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/paragraph.js
@@ -0,0 +1,52 @@
+// Paragraph
+
+'use strict';
+
+
+module.exports = function paragraph(state, startLine/*, endLine*/) {
+  var content, terminate, i, l, token, oldParentType,
+      nextLine = startLine + 1,
+      terminatorRules = state.md.block.ruler.getRules('paragraph'),
+      endLine = state.lineMax;
+
+  oldParentType = state.parentType;
+  state.parentType = 'paragraph';
+
+  // jump line-by-line until empty one or EOF
+  for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+    // this would be a code block normally, but after paragraph
+    // it's considered a lazy continuation regardless of what's there
+    if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+    // quirk for blockquotes, this line should already be checked by that rule
+    if (state.sCount[nextLine] < 0) { continue; }
+
+    // Some tags can terminate paragraph without empty line.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+  }
+
+  content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+
+  state.line = nextLine;
+
+  token          = state.push('paragraph_open', 'p', 1);
+  token.map      = [ startLine, state.line ];
+
+  token          = state.push('inline', '', 0);
+  token.content  = content;
+  token.map      = [ startLine, state.line ];
+  token.children = [];
+
+  token          = state.push('paragraph_close', 'p', -1);
+
+  state.parentType = oldParentType;
+
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/reference.js b/node_modules/markdown-it/lib/rules_block/reference.js
new file mode 100644
index 00000000..78daa26c
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/reference.js
@@ -0,0 +1,198 @@
+'use strict';
+
+
+var normalizeReference   = require('../common/utils').normalizeReference;
+var isSpace              = require('../common/utils').isSpace;
+
+
+module.exports = function reference(state, startLine, _endLine, silent) {
+  var ch,
+      destEndPos,
+      destEndLineNo,
+      endLine,
+      href,
+      i,
+      l,
+      label,
+      labelEnd,
+      oldParentType,
+      res,
+      start,
+      str,
+      terminate,
+      terminatorRules,
+      title,
+      lines = 0,
+      pos = state.bMarks[startLine] + state.tShift[startLine],
+      max = state.eMarks[startLine],
+      nextLine = startLine + 1;
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+  if (state.src.charCodeAt(pos) !== 0x5B/* [ */) { return false; }
+
+  // Simple check to quickly interrupt scan on [link](url) at the start of line.
+  // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54
+  while (++pos < max) {
+    if (state.src.charCodeAt(pos) === 0x5D /* ] */ &&
+        state.src.charCodeAt(pos - 1) !== 0x5C/* \ */) {
+      if (pos + 1 === max) { return false; }
+      if (state.src.charCodeAt(pos + 1) !== 0x3A/* : */) { return false; }
+      break;
+    }
+  }
+
+  endLine = state.lineMax;
+
+  // jump line-by-line until empty one or EOF
+  terminatorRules = state.md.block.ruler.getRules('reference');
+
+  oldParentType = state.parentType;
+  state.parentType = 'reference';
+
+  for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+    // this would be a code block normally, but after paragraph
+    // it's considered a lazy continuation regardless of what's there
+    if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+    // quirk for blockquotes, this line should already be checked by that rule
+    if (state.sCount[nextLine] < 0) { continue; }
+
+    // Some tags can terminate paragraph without empty line.
+    terminate = false;
+    for (i = 0, l = terminatorRules.length; i < l; i++) {
+      if (terminatorRules[i](state, nextLine, endLine, true)) {
+        terminate = true;
+        break;
+      }
+    }
+    if (terminate) { break; }
+  }
+
+  str = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+  max = str.length;
+
+  for (pos = 1; pos < max; pos++) {
+    ch = str.charCodeAt(pos);
+    if (ch === 0x5B /* [ */) {
+      return false;
+    } else if (ch === 0x5D /* ] */) {
+      labelEnd = pos;
+      break;
+    } else if (ch === 0x0A /* \n */) {
+      lines++;
+    } else if (ch === 0x5C /* \ */) {
+      pos++;
+      if (pos < max && str.charCodeAt(pos) === 0x0A) {
+        lines++;
+      }
+    }
+  }
+
+  if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 0x3A/* : */) { return false; }
+
+  // [label]:   destination   'title'
+  //         ^^^ skip optional whitespace here
+  for (pos = labelEnd + 2; pos < max; pos++) {
+    ch = str.charCodeAt(pos);
+    if (ch === 0x0A) {
+      lines++;
+    } else if (isSpace(ch)) {
+      /*eslint no-empty:0*/
+    } else {
+      break;
+    }
+  }
+
+  // [label]:   destination   'title'
+  //            ^^^^^^^^^^^ parse this
+  res = state.md.helpers.parseLinkDestination(str, pos, max);
+  if (!res.ok) { return false; }
+
+  href = state.md.normalizeLink(res.str);
+  if (!state.md.validateLink(href)) { return false; }
+
+  pos = res.pos;
+  lines += res.lines;
+
+  // save cursor state, we could require to rollback later
+  destEndPos = pos;
+  destEndLineNo = lines;
+
+  // [label]:   destination   'title'
+  //                       ^^^ skipping those spaces
+  start = pos;
+  for (; pos < max; pos++) {
+    ch = str.charCodeAt(pos);
+    if (ch === 0x0A) {
+      lines++;
+    } else if (isSpace(ch)) {
+      /*eslint no-empty:0*/
+    } else {
+      break;
+    }
+  }
+
+  // [label]:   destination   'title'
+  //                          ^^^^^^^ parse this
+  res = state.md.helpers.parseLinkTitle(str, pos, max);
+  if (pos < max && start !== pos && res.ok) {
+    title = res.str;
+    pos = res.pos;
+    lines += res.lines;
+  } else {
+    title = '';
+    pos = destEndPos;
+    lines = destEndLineNo;
+  }
+
+  // skip trailing spaces until the rest of the line
+  while (pos < max) {
+    ch = str.charCodeAt(pos);
+    if (!isSpace(ch)) { break; }
+    pos++;
+  }
+
+  if (pos < max && str.charCodeAt(pos) !== 0x0A) {
+    if (title) {
+      // garbage at the end of the line after title,
+      // but it could still be a valid reference if we roll back
+      title = '';
+      pos = destEndPos;
+      lines = destEndLineNo;
+      while (pos < max) {
+        ch = str.charCodeAt(pos);
+        if (!isSpace(ch)) { break; }
+        pos++;
+      }
+    }
+  }
+
+  if (pos < max && str.charCodeAt(pos) !== 0x0A) {
+    // garbage at the end of the line
+    return false;
+  }
+
+  label = normalizeReference(str.slice(1, labelEnd));
+  if (!label) {
+    // CommonMark 0.20 disallows empty labels
+    return false;
+  }
+
+  // Reference can not terminate anything. This check is for safety only.
+  /*istanbul ignore if*/
+  if (silent) { return true; }
+
+  if (typeof state.env.references === 'undefined') {
+    state.env.references = {};
+  }
+  if (typeof state.env.references[label] === 'undefined') {
+    state.env.references[label] = { title: title, href: href };
+  }
+
+  state.parentType = oldParentType;
+
+  state.line = startLine + lines + 1;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/state_block.js b/node_modules/markdown-it/lib/rules_block/state_block.js
new file mode 100644
index 00000000..3119ff17
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/state_block.js
@@ -0,0 +1,230 @@
+// Parser state class
+
+'use strict';
+
+var Token = require('../token');
+var isSpace = require('../common/utils').isSpace;
+
+
+function StateBlock(src, md, env, tokens) {
+  var ch, s, start, pos, len, indent, offset, indent_found;
+
+  this.src = src;
+
+  // link to parser instance
+  this.md     = md;
+
+  this.env = env;
+
+  //
+  // Internal state vartiables
+  //
+
+  this.tokens = tokens;
+
+  this.bMarks = [];  // line begin offsets for fast jumps
+  this.eMarks = [];  // line end offsets for fast jumps
+  this.tShift = [];  // offsets of the first non-space characters (tabs not expanded)
+  this.sCount = [];  // indents for each line (tabs expanded)
+
+  // An amount of virtual spaces (tabs expanded) between beginning
+  // of each line (bMarks) and real beginning of that line.
+  //
+  // It exists only as a hack because blockquotes override bMarks
+  // losing information in the process.
+  //
+  // It's used only when expanding tabs, you can think about it as
+  // an initial tab length, e.g. bsCount=21 applied to string `\t123`
+  // means first tab should be expanded to 4-21%4 === 3 spaces.
+  //
+  this.bsCount = [];
+
+  // block parser variables
+  this.blkIndent  = 0; // required block content indent
+                       // (for example, if we are in list)
+  this.line       = 0; // line index in src
+  this.lineMax    = 0; // lines count
+  this.tight      = false;  // loose/tight mode for lists
+  this.ddIndent   = -1; // indent of the current dd block (-1 if there isn't any)
+
+  // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference'
+  // used in lists to determine if they interrupt a paragraph
+  this.parentType = 'root';
+
+  this.level = 0;
+
+  // renderer
+  this.result = '';
+
+  // Create caches
+  // Generate markers.
+  s = this.src;
+  indent_found = false;
+
+  for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) {
+    ch = s.charCodeAt(pos);
+
+    if (!indent_found) {
+      if (isSpace(ch)) {
+        indent++;
+
+        if (ch === 0x09) {
+          offset += 4 - offset % 4;
+        } else {
+          offset++;
+        }
+        continue;
+      } else {
+        indent_found = true;
+      }
+    }
+
+    if (ch === 0x0A || pos === len - 1) {
+      if (ch !== 0x0A) { pos++; }
+      this.bMarks.push(start);
+      this.eMarks.push(pos);
+      this.tShift.push(indent);
+      this.sCount.push(offset);
+      this.bsCount.push(0);
+
+      indent_found = false;
+      indent = 0;
+      offset = 0;
+      start = pos + 1;
+    }
+  }
+
+  // Push fake entry to simplify cache bounds checks
+  this.bMarks.push(s.length);
+  this.eMarks.push(s.length);
+  this.tShift.push(0);
+  this.sCount.push(0);
+  this.bsCount.push(0);
+
+  this.lineMax = this.bMarks.length - 1; // don't count last fake line
+}
+
+// Push new token to "stream".
+//
+StateBlock.prototype.push = function (type, tag, nesting) {
+  var token = new Token(type, tag, nesting);
+  token.block = true;
+
+  if (nesting < 0) { this.level--; }
+  token.level = this.level;
+  if (nesting > 0) { this.level++; }
+
+  this.tokens.push(token);
+  return token;
+};
+
+StateBlock.prototype.isEmpty = function isEmpty(line) {
+  return this.bMarks[line] + this.tShift[line] >= this.eMarks[line];
+};
+
+StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) {
+  for (var max = this.lineMax; from < max; from++) {
+    if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) {
+      break;
+    }
+  }
+  return from;
+};
+
+// Skip spaces from given position.
+StateBlock.prototype.skipSpaces = function skipSpaces(pos) {
+  var ch;
+
+  for (var max = this.src.length; pos < max; pos++) {
+    ch = this.src.charCodeAt(pos);
+    if (!isSpace(ch)) { break; }
+  }
+  return pos;
+};
+
+// Skip spaces from given position in reverse.
+StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) {
+  if (pos <= min) { return pos; }
+
+  while (pos > min) {
+    if (!isSpace(this.src.charCodeAt(--pos))) { return pos + 1; }
+  }
+  return pos;
+};
+
+// Skip char codes from given position
+StateBlock.prototype.skipChars = function skipChars(pos, code) {
+  for (var max = this.src.length; pos < max; pos++) {
+    if (this.src.charCodeAt(pos) !== code) { break; }
+  }
+  return pos;
+};
+
+// Skip char codes reverse from given position - 1
+StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) {
+  if (pos <= min) { return pos; }
+
+  while (pos > min) {
+    if (code !== this.src.charCodeAt(--pos)) { return pos + 1; }
+  }
+  return pos;
+};
+
+// cut lines range from source.
+StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) {
+  var i, lineIndent, ch, first, last, queue, lineStart,
+      line = begin;
+
+  if (begin >= end) {
+    return '';
+  }
+
+  queue = new Array(end - begin);
+
+  for (i = 0; line < end; line++, i++) {
+    lineIndent = 0;
+    lineStart = first = this.bMarks[line];
+
+    if (line + 1 < end || keepLastLF) {
+      // No need for bounds check because we have fake entry on tail.
+      last = this.eMarks[line] + 1;
+    } else {
+      last = this.eMarks[line];
+    }
+
+    while (first < last && lineIndent < indent) {
+      ch = this.src.charCodeAt(first);
+
+      if (isSpace(ch)) {
+        if (ch === 0x09) {
+          lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4;
+        } else {
+          lineIndent++;
+        }
+      } else if (first - lineStart < this.tShift[line]) {
+        // patched tShift masked characters to look like spaces (blockquotes, list markers)
+        lineIndent++;
+      } else {
+        break;
+      }
+
+      first++;
+    }
+
+    if (lineIndent > indent) {
+      // partially expanding tabs in code blocks, e.g '\t\tfoobar'
+      // with indent=2 becomes '  \tfoobar'
+      queue[i] = new Array(lineIndent - indent + 1).join(' ') + this.src.slice(first, last);
+    } else {
+      queue[i] = this.src.slice(first, last);
+    }
+  }
+
+  return queue.join('');
+};
+
+// re-export Token class to use in block rules
+StateBlock.prototype.Token = Token;
+
+
+module.exports = StateBlock;
diff --git a/node_modules/markdown-it/lib/rules_block/table.js b/node_modules/markdown-it/lib/rules_block/table.js
new file mode 100644
index 00000000..16ae20f8
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/table.js
@@ -0,0 +1,196 @@
+// GFM table, non-standard
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+function getLine(state, line) {
+  var pos = state.bMarks[line] + state.blkIndent,
+      max = state.eMarks[line];
+
+  return state.src.substr(pos, max - pos);
+}
+
+function escapedSplit(str) {
+  var result = [],
+      pos = 0,
+      max = str.length,
+      ch,
+      escapes = 0,
+      lastPos = 0,
+      backTicked = false,
+      lastBackTick = 0;
+
+  ch  = str.charCodeAt(pos);
+
+  while (pos < max) {
+    if (ch === 0x60/* ` */) {
+      if (backTicked) {
+        // make \` close code sequence, but not open it;
+        // the reason is: `\` is correct code block
+        backTicked = false;
+        lastBackTick = pos;
+      } else if (escapes % 2 === 0) {
+        backTicked = true;
+        lastBackTick = pos;
+      }
+    } else if (ch === 0x7c/* | */ && (escapes % 2 === 0) && !backTicked) {
+      result.push(str.substring(lastPos, pos));
+      lastPos = pos + 1;
+    }
+
+    if (ch === 0x5c/* \ */) {
+      escapes++;
+    } else {
+      escapes = 0;
+    }
+
+    pos++;
+
+    // If there was an un-closed backtick, go back to just after
+    // the last backtick, but as if it was a normal character
+    if (pos === max && backTicked) {
+      backTicked = false;
+      pos = lastBackTick + 1;
+    }
+
+    ch = str.charCodeAt(pos);
+  }
+
+  result.push(str.substring(lastPos));
+
+  return result;
+}
+
+
+module.exports = function table(state, startLine, endLine, silent) {
+  var ch, lineText, pos, i, nextLine, columns, columnCount, token,
+      aligns, t, tableLines, tbodyLines;
+
+  // should have at least two lines
+  if (startLine + 2 > endLine) { return false; }
+
+  nextLine = startLine + 1;
+
+  if (state.sCount[nextLine] < state.blkIndent) { return false; }
+
+  // if it's indented more than 3 spaces, it should be a code block
+  if (state.sCount[nextLine] - state.blkIndent >= 4) { return false; }
+
+  // first character of the second line should be '|', '-', ':',
+  // and no other characters are allowed but spaces;
+  // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp
+
+  pos = state.bMarks[nextLine] + state.tShift[nextLine];
+  if (pos >= state.eMarks[nextLine]) { return false; }
+
+  ch = state.src.charCodeAt(pos++);
+  if (ch !== 0x7C/* | */ && ch !== 0x2D/* - */ && ch !== 0x3A/* : */) { return false; }
+
+  while (pos < state.eMarks[nextLine]) {
+    ch = state.src.charCodeAt(pos);
+
+    if (ch !== 0x7C/* | */ && ch !== 0x2D/* - */ && ch !== 0x3A/* : */ && !isSpace(ch)) { return false; }
+
+    pos++;
+  }
+
+  lineText = getLine(state, startLine + 1);
+
+  columns = lineText.split('|');
+  aligns = [];
+  for (i = 0; i < columns.length; i++) {
+    t = columns[i].trim();
+    if (!t) {
+      // allow empty columns before and after table, but not in between columns;
+      // e.g. allow ` |---| `, disallow ` ---||--- `
+      if (i === 0 || i === columns.length - 1) {
+        continue;
+      } else {
+        return false;
+      }
+    }
+
+    if (!/^:?-+:?$/.test(t)) { return false; }
+    if (t.charCodeAt(t.length - 1) === 0x3A/* : */) {
+      aligns.push(t.charCodeAt(0) === 0x3A/* : */ ? 'center' : 'right');
+    } else if (t.charCodeAt(0) === 0x3A/* : */) {
+      aligns.push('left');
+    } else {
+      aligns.push('');
+    }
+  }
+
+  lineText = getLine(state, startLine).trim();
+  if (lineText.indexOf('|') === -1) { return false; }
+  if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+  columns = escapedSplit(lineText.replace(/^\||\|$/g, ''));
+
+  // header row will define an amount of columns in the entire table,
+  // and align row shouldn't be smaller than that (the rest of the rows can)
+  columnCount = columns.length;
+  if (columnCount > aligns.length) { return false; }
+
+  if (silent) { return true; }
+
+  token     = state.push('table_open', 'table', 1);
+  token.map = tableLines = [ startLine, 0 ];
+
+  token     = state.push('thead_open', 'thead', 1);
+  token.map = [ startLine, startLine + 1 ];
+
+  token     = state.push('tr_open', 'tr', 1);
+  token.map = [ startLine, startLine + 1 ];
+
+  for (i = 0; i < columns.length; i++) {
+    token          = state.push('th_open', 'th', 1);
+    token.map      = [ startLine, startLine + 1 ];
+    if (aligns[i]) {
+      token.attrs  = [ [ 'style', 'text-align:' + aligns[i] ] ];
+    }
+
+    token          = state.push('inline', '', 0);
+    token.content  = columns[i].trim();
+    token.map      = [ startLine, startLine + 1 ];
+    token.children = [];
+
+    token          = state.push('th_close', 'th', -1);
+  }
+
+  token     = state.push('tr_close', 'tr', -1);
+  token     = state.push('thead_close', 'thead', -1);
+
+  token     = state.push('tbody_open', 'tbody', 1);
+  token.map = tbodyLines = [ startLine + 2, 0 ];
+
+  for (nextLine = startLine + 2; nextLine < endLine; nextLine++) {
+    if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+    lineText = getLine(state, nextLine).trim();
+    if (lineText.indexOf('|') === -1) { break; }
+    if (state.sCount[nextLine] - state.blkIndent >= 4) { break; }
+    columns = escapedSplit(lineText.replace(/^\||\|$/g, ''));
+
+    token = state.push('tr_open', 'tr', 1);
+    for (i = 0; i < columnCount; i++) {
+      token          = state.push('td_open', 'td', 1);
+      if (aligns[i]) {
+        token.attrs  = [ [ 'style', 'text-align:' + aligns[i] ] ];
+      }
+
+      token          = state.push('inline', '', 0);
+      token.content  = columns[i] ? columns[i].trim() : '';
+      token.children = [];
+
+      token          = state.push('td_close', 'td', -1);
+    }
+    token = state.push('tr_close', 'tr', -1);
+  }
+  token = state.push('tbody_close', 'tbody', -1);
+  token = state.push('table_close', 'table', -1);
+
+  tableLines[1] = tbodyLines[1] = nextLine;
+  state.line = nextLine;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_core/block.js b/node_modules/markdown-it/lib/rules_core/block.js
new file mode 100644
index 00000000..2a365fac
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/block.js
@@ -0,0 +1,16 @@
+'use strict';
+
+
+module.exports = function block(state) {
+  var token;
+
+  if (state.inlineMode) {
+    token          = new state.Token('inline', '', 0);
+    token.content  = state.src;
+    token.map      = [ 0, 1 ];
+    token.children = [];
+    state.tokens.push(token);
+  } else {
+    state.md.block.parse(state.src, state.md, state.env, state.tokens);
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/inline.js b/node_modules/markdown-it/lib/rules_core/inline.js
new file mode 100644
index 00000000..4c33d0d7
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/inline.js
@@ -0,0 +1,13 @@
+'use strict';
+
+module.exports = function inline(state) {
+  var tokens = state.tokens, tok, i, l;
+
+  // Parse inlines
+  for (i = 0, l = tokens.length; i < l; i++) {
+    tok = tokens[i];
+    if (tok.type === 'inline') {
+      state.md.inline.parse(tok.content, state.md, state.env, tok.children);
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/linkify.js b/node_modules/markdown-it/lib/rules_core/linkify.js
new file mode 100644
index 00000000..7c3ffc86
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/linkify.js
@@ -0,0 +1,133 @@
+// Replace link-like texts with link nodes.
+//
+// Currently restricted by `md.validateLink()` to http/https/ftp
+//
+'use strict';
+
+
+var arrayReplaceAt = require('../common/utils').arrayReplaceAt;
+
+
+function isLinkOpen(str) {
+  return /^<a[>\s]/i.test(str);
+}
+function isLinkClose(str) {
+  return /^<\/a\s*>/i.test(str);
+}
+
+
+module.exports = function linkify(state) {
+  var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos,
+      level, htmlLinkLevel, url, fullUrl, urlText,
+      blockTokens = state.tokens,
+      links;
+
+  if (!state.md.options.linkify) { return; }
+
+  for (j = 0, l = blockTokens.length; j < l; j++) {
+    if (blockTokens[j].type !== 'inline' ||
+        !state.md.linkify.pretest(blockTokens[j].content)) {
+      continue;
+    }
+
+    tokens = blockTokens[j].children;
+
+    htmlLinkLevel = 0;
+
+    // We scan from the end, to keep position when new tags added.
+    // Use reversed logic in links start/end match
+    for (i = tokens.length - 1; i >= 0; i--) {
+      currentToken = tokens[i];
+
+      // Skip content of markdown links
+      if (currentToken.type === 'link_close') {
+        i--;
+        while (tokens[i].level !== currentToken.level && tokens[i].type !== 'link_open') {
+          i--;
+        }
+        continue;
+      }
+
+      // Skip content of html tag links
+      if (currentToken.type === 'html_inline') {
+        if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) {
+          htmlLinkLevel--;
+        }
+        if (isLinkClose(currentToken.content)) {
+          htmlLinkLevel++;
+        }
+      }
+      if (htmlLinkLevel > 0) { continue; }
+
+      if (currentToken.type === 'text' && state.md.linkify.test(currentToken.content)) {
+
+        text = currentToken.content;
+        links = state.md.linkify.match(text);
+
+        // Now split string to nodes
+        nodes = [];
+        level = currentToken.level;
+        lastPos = 0;
+
+        for (ln = 0; ln < links.length; ln++) {
+
+          url = links[ln].url;
+          fullUrl = state.md.normalizeLink(url);
+          if (!state.md.validateLink(fullUrl)) { continue; }
+
+          urlText = links[ln].text;
+
+          // Linkifier might send raw hostnames like "example.com", where url
+          // starts with domain name. So we prepend http:// in those cases,
+          // and remove it afterwards.
+          //
+          if (!links[ln].schema) {
+            urlText = state.md.normalizeLinkText('http://' + urlText).replace(/^http:\/\//, '');
+          } else if (links[ln].schema === 'mailto:' && !/^mailto:/i.test(urlText)) {
+            urlText = state.md.normalizeLinkText('mailto:' + urlText).replace(/^mailto:/, '');
+          } else {
+            urlText = state.md.normalizeLinkText(urlText);
+          }
+
+          pos = links[ln].index;
+
+          if (pos > lastPos) {
+            token         = new state.Token('text', '', 0);
+            token.content = text.slice(lastPos, pos);
+            token.level   = level;
+            nodes.push(token);
+          }
+
+          token         = new state.Token('link_open', 'a', 1);
+          token.attrs   = [ [ 'href', fullUrl ] ];
+          token.level   = level++;
+          token.markup  = 'linkify';
+          token.info    = 'auto';
+          nodes.push(token);
+
+          token         = new state.Token('text', '', 0);
+          token.content = urlText;
+          token.level   = level;
+          nodes.push(token);
+
+          token         = new state.Token('link_close', 'a', -1);
+          token.level   = --level;
+          token.markup  = 'linkify';
+          token.info    = 'auto';
+          nodes.push(token);
+
+          lastPos = links[ln].lastIndex;
+        }
+        if (lastPos < text.length) {
+          token         = new state.Token('text', '', 0);
+          token.content = text.slice(lastPos);
+          token.level   = level;
+          nodes.push(token);
+        }
+
+        // replace current node
+        blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes);
+      }
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/normalize.js b/node_modules/markdown-it/lib/rules_core/normalize.js
new file mode 100644
index 00000000..60fc3a4f
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/normalize.js
@@ -0,0 +1,20 @@
+// Normalize input string
+
+'use strict';
+
+
+var NEWLINES_RE  = /\r[\n\u0085]?|[\u2424\u2028\u0085]/g;
+var NULL_RE      = /\u0000/g;
+
+
+module.exports = function inline(state) {
+  var str;
+
+  // Normalize newlines
+  str = state.src.replace(NEWLINES_RE, '\n');
+
+  // Replace NULL characters
+  str = str.replace(NULL_RE, '\uFFFD');
+
+  state.src = str;
+};
diff --git a/node_modules/markdown-it/lib/rules_core/replacements.js b/node_modules/markdown-it/lib/rules_core/replacements.js
new file mode 100644
index 00000000..a748b316
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/replacements.js
@@ -0,0 +1,107 @@
+// Simple typographyc replacements
+//
+// (c) (C) → ©
+// (tm) (TM) → ™
+// (r) (R) → ®
+// +- → ±
+// (p) (P) -> §
+// ... → … (also ?.... → ?.., !.... → !..)
+// ???????? → ???, !!!!! → !!!, `,,` → `,`
+// -- → &ndash;, --- → &mdash;
+//
+'use strict';
+
+// TODO:
+// - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾
+// - miltiplication 2 x 4 -> 2 × 4
+
+var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/;
+
+// Workaround for phantomjs - need regex without /g flag,
+// or root check will fail every second time
+var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i;
+
+var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/ig;
+var SCOPED_ABBR = {
+  c: '©',
+  r: '®',
+  p: '§',
+  tm: '™'
+};
+
+function replaceFn(match, name) {
+  return SCOPED_ABBR[name.toLowerCase()];
+}
+
+function replace_scoped(inlineTokens) {
+  var i, token, inside_autolink = 0;
+
+  for (i = inlineTokens.length - 1; i >= 0; i--) {
+    token = inlineTokens[i];
+
+    if (token.type === 'text' && !inside_autolink) {
+      token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn);
+    }
+
+    if (token.type === 'link_open' && token.info === 'auto') {
+      inside_autolink--;
+    }
+
+    if (token.type === 'link_close' && token.info === 'auto') {
+      inside_autolink++;
+    }
+  }
+}
+
+function replace_rare(inlineTokens) {
+  var i, token, inside_autolink = 0;
+
+  for (i = inlineTokens.length - 1; i >= 0; i--) {
+    token = inlineTokens[i];
+
+    if (token.type === 'text' && !inside_autolink) {
+      if (RARE_RE.test(token.content)) {
+        token.content = token.content
+                    .replace(/\+-/g, '±')
+                    // .., ..., ....... -> …
+                    // but ?..... & !..... -> ?.. & !..
+                    .replace(/\.{2,}/g, '…').replace(/([?!])…/g, '$1..')
+                    .replace(/([?!]){4,}/g, '$1$1$1').replace(/,{2,}/g, ',')
+                    // em-dash
+                    .replace(/(^|[^-])---([^-]|$)/mg, '$1\u2014$2')
+                    // en-dash
+                    .replace(/(^|\s)--(\s|$)/mg, '$1\u2013$2')
+                    .replace(/(^|[^-\s])--([^-\s]|$)/mg, '$1\u2013$2');
+      }
+    }
+
+    if (token.type === 'link_open' && token.info === 'auto') {
+      inside_autolink--;
+    }
+
+    if (token.type === 'link_close' && token.info === 'auto') {
+      inside_autolink++;
+    }
+  }
+}
+
+
+module.exports = function replace(state) {
+  var blkIdx;
+
+  if (!state.md.options.typographer) { return; }
+
+  for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+
+    if (state.tokens[blkIdx].type !== 'inline') { continue; }
+
+    if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) {
+      replace_scoped(state.tokens[blkIdx].children);
+    }
+
+    if (RARE_RE.test(state.tokens[blkIdx].content)) {
+      replace_rare(state.tokens[blkIdx].children);
+    }
+
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/smartquotes.js b/node_modules/markdown-it/lib/rules_core/smartquotes.js
new file mode 100644
index 00000000..bff7ef76
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/smartquotes.js
@@ -0,0 +1,195 @@
+// Convert straight quotation marks to typographic ones
+//
+'use strict';
+
+
+var isWhiteSpace   = require('../common/utils').isWhiteSpace;
+var isPunctChar    = require('../common/utils').isPunctChar;
+var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct;
+
+var QUOTE_TEST_RE = /['"]/;
+var QUOTE_RE = /['"]/g;
+var APOSTROPHE = '\u2019'; /* ’ */
+
+
+function replaceAt(str, index, ch) {
+  return str.substr(0, index) + ch + str.substr(index + 1);
+}
+
+function process_inlines(tokens, state) {
+  var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar,
+      isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace,
+      canOpen, canClose, j, isSingle, stack, openQuote, closeQuote;
+
+  stack = [];
+
+  for (i = 0; i < tokens.length; i++) {
+    token = tokens[i];
+
+    thisLevel = tokens[i].level;
+
+    for (j = stack.length - 1; j >= 0; j--) {
+      if (stack[j].level <= thisLevel) { break; }
+    }
+    stack.length = j + 1;
+
+    if (token.type !== 'text') { continue; }
+
+    text = token.content;
+    pos = 0;
+    max = text.length;
+
+    /*eslint no-labels:0,block-scoped-var:0*/
+    OUTER:
+    while (pos < max) {
+      QUOTE_RE.lastIndex = pos;
+      t = QUOTE_RE.exec(text);
+      if (!t) { break; }
+
+      canOpen = canClose = true;
+      pos = t.index + 1;
+      isSingle = (t[0] === "'");
+
+      // Find previous character,
+      // default to space if it's the beginning of the line
+      //
+      lastChar = 0x20;
+
+      if (t.index - 1 >= 0) {
+        lastChar = text.charCodeAt(t.index - 1);
+      } else {
+        for (j = i - 1; j >= 0; j--) {
+          if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // lastChar defaults to 0x20
+          if (tokens[j].type !== 'text') continue;
+
+          lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1);
+          break;
+        }
+      }
+
+      // Find next character,
+      // default to space if it's the end of the line
+      //
+      nextChar = 0x20;
+
+      if (pos < max) {
+        nextChar = text.charCodeAt(pos);
+      } else {
+        for (j = i + 1; j < tokens.length; j++) {
+          if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // nextChar defaults to 0x20
+          if (tokens[j].type !== 'text') continue;
+
+          nextChar = tokens[j].content.charCodeAt(0);
+          break;
+        }
+      }
+
+      isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+      isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+
+      isLastWhiteSpace = isWhiteSpace(lastChar);
+      isNextWhiteSpace = isWhiteSpace(nextChar);
+
+      if (isNextWhiteSpace) {
+        canOpen = false;
+      } else if (isNextPunctChar) {
+        if (!(isLastWhiteSpace || isLastPunctChar)) {
+          canOpen = false;
+        }
+      }
+
+      if (isLastWhiteSpace) {
+        canClose = false;
+      } else if (isLastPunctChar) {
+        if (!(isNextWhiteSpace || isNextPunctChar)) {
+          canClose = false;
+        }
+      }
+
+      if (nextChar === 0x22 /* " */ && t[0] === '"') {
+        if (lastChar >= 0x30 /* 0 */ && lastChar <= 0x39 /* 9 */) {
+          // special case: 1"" - count first quote as an inch
+          canClose = canOpen = false;
+        }
+      }
+
+      if (canOpen && canClose) {
+        // treat this as the middle of the word
+        canOpen = false;
+        canClose = isNextPunctChar;
+      }
+
+      if (!canOpen && !canClose) {
+        // middle of word
+        if (isSingle) {
+          token.content = replaceAt(token.content, t.index, APOSTROPHE);
+        }
+        continue;
+      }
+
+      if (canClose) {
+        // this could be a closing quote, rewind the stack to get a match
+        for (j = stack.length - 1; j >= 0; j--) {
+          item = stack[j];
+          if (stack[j].level < thisLevel) { break; }
+          if (item.single === isSingle && stack[j].level === thisLevel) {
+            item = stack[j];
+
+            if (isSingle) {
+              openQuote = state.md.options.quotes[2];
+              closeQuote = state.md.options.quotes[3];
+            } else {
+              openQuote = state.md.options.quotes[0];
+              closeQuote = state.md.options.quotes[1];
+            }
+
+            // replace token.content *before* tokens[item.token].content,
+            // because, if they are pointing at the same token, replaceAt
+            // could mess up indices when quote length != 1
+            token.content = replaceAt(token.content, t.index, closeQuote);
+            tokens[item.token].content = replaceAt(
+              tokens[item.token].content, item.pos, openQuote);
+
+            pos += closeQuote.length - 1;
+            if (item.token === i) { pos += openQuote.length - 1; }
+
+            text = token.content;
+            max = text.length;
+
+            stack.length = j;
+            continue OUTER;
+          }
+        }
+      }
+
+      if (canOpen) {
+        stack.push({
+          token: i,
+          pos: t.index,
+          single: isSingle,
+          level: thisLevel
+        });
+      } else if (canClose && isSingle) {
+        token.content = replaceAt(token.content, t.index, APOSTROPHE);
+      }
+    }
+  }
+}
+
+
+module.exports = function smartquotes(state) {
+  /*eslint max-depth:0*/
+  var blkIdx;
+
+  if (!state.md.options.typographer) { return; }
+
+  for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+
+    if (state.tokens[blkIdx].type !== 'inline' ||
+        !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) {
+      continue;
+    }
+
+    process_inlines(state.tokens[blkIdx].children, state);
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/state_core.js b/node_modules/markdown-it/lib/rules_core/state_core.js
new file mode 100644
index 00000000..87cfd85c
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/state_core.js
@@ -0,0 +1,20 @@
+// Core state object
+//
+'use strict';
+
+var Token = require('../token');
+
+
+function StateCore(src, md, env) {
+  this.src = src;
+  this.env = env;
+  this.tokens = [];
+  this.inlineMode = false;
+  this.md = md; // link to parser instance
+}
+
+// re-export Token class to use in core rules
+StateCore.prototype.Token = Token;
+
+
+module.exports = StateCore;
diff --git a/node_modules/markdown-it/lib/rules_inline/autolink.js b/node_modules/markdown-it/lib/rules_inline/autolink.js
new file mode 100644
index 00000000..1f0c466d
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/autolink.js
@@ -0,0 +1,72 @@
+// Process autolinks '<protocol:...>'
+
+'use strict';
+
+
+/*eslint max-len:0*/
+var EMAIL_RE    = /^<([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)>/;
+var AUTOLINK_RE = /^<([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)>/;
+
+
+module.exports = function autolink(state, silent) {
+  var tail, linkMatch, emailMatch, url, fullUrl, token,
+      pos = state.pos;
+
+  if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+
+  tail = state.src.slice(pos);
+
+  if (tail.indexOf('>') < 0) { return false; }
+
+  if (AUTOLINK_RE.test(tail)) {
+    linkMatch = tail.match(AUTOLINK_RE);
+
+    url = linkMatch[0].slice(1, -1);
+    fullUrl = state.md.normalizeLink(url);
+    if (!state.md.validateLink(fullUrl)) { return false; }
+
+    if (!silent) {
+      token         = state.push('link_open', 'a', 1);
+      token.attrs   = [ [ 'href', fullUrl ] ];
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+
+      token         = state.push('text', '', 0);
+      token.content = state.md.normalizeLinkText(url);
+
+      token         = state.push('link_close', 'a', -1);
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+    }
+
+    state.pos += linkMatch[0].length;
+    return true;
+  }
+
+  if (EMAIL_RE.test(tail)) {
+    emailMatch = tail.match(EMAIL_RE);
+
+    url = emailMatch[0].slice(1, -1);
+    fullUrl = state.md.normalizeLink('mailto:' + url);
+    if (!state.md.validateLink(fullUrl)) { return false; }
+
+    if (!silent) {
+      token         = state.push('link_open', 'a', 1);
+      token.attrs   = [ [ 'href', fullUrl ] ];
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+
+      token         = state.push('text', '', 0);
+      token.content = state.md.normalizeLinkText(url);
+
+      token         = state.push('link_close', 'a', -1);
+      token.markup  = 'autolink';
+      token.info    = 'auto';
+    }
+
+    state.pos += emailMatch[0].length;
+    return true;
+  }
+
+  return false;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/backticks.js b/node_modules/markdown-it/lib/rules_inline/backticks.js
new file mode 100644
index 00000000..0cd1a992
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/backticks.js
@@ -0,0 +1,43 @@
+// Parse backticks
+
+'use strict';
+
+module.exports = function backtick(state, silent) {
+  var start, max, marker, matchStart, matchEnd, token,
+      pos = state.pos,
+      ch = state.src.charCodeAt(pos);
+
+  if (ch !== 0x60/* ` */) { return false; }
+
+  start = pos;
+  pos++;
+  max = state.posMax;
+
+  while (pos < max && state.src.charCodeAt(pos) === 0x60/* ` */) { pos++; }
+
+  marker = state.src.slice(start, pos);
+
+  matchStart = matchEnd = pos;
+
+  while ((matchStart = state.src.indexOf('`', matchEnd)) !== -1) {
+    matchEnd = matchStart + 1;
+
+    while (matchEnd < max && state.src.charCodeAt(matchEnd) === 0x60/* ` */) { matchEnd++; }
+
+    if (matchEnd - matchStart === marker.length) {
+      if (!silent) {
+        token         = state.push('code_inline', 'code', 0);
+        token.markup  = marker;
+        token.content = state.src.slice(pos, matchStart)
+                                 .replace(/[ \n]+/g, ' ')
+                                 .trim();
+      }
+      state.pos = matchEnd;
+      return true;
+    }
+  }
+
+  if (!silent) { state.pending += marker; }
+  state.pos += marker.length;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/balance_pairs.js b/node_modules/markdown-it/lib/rules_inline/balance_pairs.js
new file mode 100644
index 00000000..f2a52072
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/balance_pairs.js
@@ -0,0 +1,44 @@
+// For each opening emphasis-like marker find a matching closing one
+//
+'use strict';
+
+
+module.exports = function link_pairs(state) {
+  var i, j, lastDelim, currDelim,
+      delimiters = state.delimiters,
+      max = state.delimiters.length;
+
+  for (i = 0; i < max; i++) {
+    lastDelim = delimiters[i];
+
+    if (!lastDelim.close) { continue; }
+
+    j = i - lastDelim.jump - 1;
+
+    while (j >= 0) {
+      currDelim = delimiters[j];
+
+      if (currDelim.open &&
+          currDelim.marker === lastDelim.marker &&
+          currDelim.end < 0 &&
+          currDelim.level === lastDelim.level) {
+
+        // typeofs are for backward compatibility with plugins
+        var odd_match = (currDelim.close || lastDelim.open) &&
+                        typeof currDelim.length !== 'undefined' &&
+                        typeof lastDelim.length !== 'undefined' &&
+                        (currDelim.length + lastDelim.length) % 3 === 0;
+
+        if (!odd_match) {
+          lastDelim.jump = i - j;
+          lastDelim.open = false;
+          currDelim.end  = i;
+          currDelim.jump = 0;
+          break;
+        }
+      }
+
+      j -= currDelim.jump + 1;
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/emphasis.js b/node_modules/markdown-it/lib/rules_inline/emphasis.js
new file mode 100644
index 00000000..54549e39
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/emphasis.js
@@ -0,0 +1,127 @@
+// Process *this* and _that_
+//
+'use strict';
+
+
+// Insert each marker as a separate text token, and add it to delimiter list
+//
+module.exports.tokenize = function emphasis(state, silent) {
+  var i, scanned, token,
+      start = state.pos,
+      marker = state.src.charCodeAt(start);
+
+  if (silent) { return false; }
+
+  if (marker !== 0x5F /* _ */ && marker !== 0x2A /* * */) { return false; }
+
+  scanned = state.scanDelims(state.pos, marker === 0x2A);
+
+  for (i = 0; i < scanned.length; i++) {
+    token         = state.push('text', '', 0);
+    token.content = String.fromCharCode(marker);
+
+    state.delimiters.push({
+      // Char code of the starting marker (number).
+      //
+      marker: marker,
+
+      // Total length of these series of delimiters.
+      //
+      length: scanned.length,
+
+      // An amount of characters before this one that's equivalent to
+      // current one. In plain English: if this delimiter does not open
+      // an emphasis, neither do previous `jump` characters.
+      //
+      // Used to skip sequences like "*****" in one step, for 1st asterisk
+      // value will be 0, for 2nd it's 1 and so on.
+      //
+      jump:   i,
+
+      // A position of the token this delimiter corresponds to.
+      //
+      token:  state.tokens.length - 1,
+
+      // Token level.
+      //
+      level:  state.level,
+
+      // If this delimiter is matched as a valid opener, `end` will be
+      // equal to its position, otherwise it's `-1`.
+      //
+      end:    -1,
+
+      // Boolean flags that determine if this delimiter could open or close
+      // an emphasis.
+      //
+      open:   scanned.can_open,
+      close:  scanned.can_close
+    });
+  }
+
+  state.pos += scanned.length;
+
+  return true;
+};
+
+
+// Walk through delimiter list and replace text tokens with tags
+//
+module.exports.postProcess = function emphasis(state) {
+  var i,
+      startDelim,
+      endDelim,
+      token,
+      ch,
+      isStrong,
+      delimiters = state.delimiters,
+      max = state.delimiters.length;
+
+  for (i = max - 1; i >= 0; i--) {
+    startDelim = delimiters[i];
+
+    if (startDelim.marker !== 0x5F/* _ */ && startDelim.marker !== 0x2A/* * */) {
+      continue;
+    }
+
+    // Process only opening markers
+    if (startDelim.end === -1) {
+      continue;
+    }
+
+    endDelim = delimiters[startDelim.end];
+
+    // If the previous delimiter has the same marker and is adjacent to this one,
+    // merge those into one strong delimiter.
+    //
+    // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>`
+    //
+    isStrong = i > 0 &&
+               delimiters[i - 1].end === startDelim.end + 1 &&
+               delimiters[i - 1].token === startDelim.token - 1 &&
+               delimiters[startDelim.end + 1].token === endDelim.token + 1 &&
+               delimiters[i - 1].marker === startDelim.marker;
+
+    ch = String.fromCharCode(startDelim.marker);
+
+    token         = state.tokens[startDelim.token];
+    token.type    = isStrong ? 'strong_open' : 'em_open';
+    token.tag     = isStrong ? 'strong' : 'em';
+    token.nesting = 1;
+    token.markup  = isStrong ? ch + ch : ch;
+    token.content = '';
+
+    token         = state.tokens[endDelim.token];
+    token.type    = isStrong ? 'strong_close' : 'em_close';
+    token.tag     = isStrong ? 'strong' : 'em';
+    token.nesting = -1;
+    token.markup  = isStrong ? ch + ch : ch;
+    token.content = '';
+
+    if (isStrong) {
+      state.tokens[delimiters[i - 1].token].content = '';
+      state.tokens[delimiters[startDelim.end + 1].token].content = '';
+      i--;
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/entity.js b/node_modules/markdown-it/lib/rules_inline/entity.js
new file mode 100644
index 00000000..52e7cbaf
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/entity.js
@@ -0,0 +1,48 @@
+// Process html entity - &#123;, &#xAF;, &quot;, ...
+
+'use strict';
+
+var entities          = require('../common/entities');
+var has               = require('../common/utils').has;
+var isValidEntityCode = require('../common/utils').isValidEntityCode;
+var fromCodePoint     = require('../common/utils').fromCodePoint;
+
+
+var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,8}|[0-9]{1,8}));/i;
+var NAMED_RE   = /^&([a-z][a-z0-9]{1,31});/i;
+
+
+module.exports = function entity(state, silent) {
+  var ch, code, match, pos = state.pos, max = state.posMax;
+
+  if (state.src.charCodeAt(pos) !== 0x26/* & */) { return false; }
+
+  if (pos + 1 < max) {
+    ch = state.src.charCodeAt(pos + 1);
+
+    if (ch === 0x23 /* # */) {
+      match = state.src.slice(pos).match(DIGITAL_RE);
+      if (match) {
+        if (!silent) {
+          code = match[1][0].toLowerCase() === 'x' ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10);
+          state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(0xFFFD);
+        }
+        state.pos += match[0].length;
+        return true;
+      }
+    } else {
+      match = state.src.slice(pos).match(NAMED_RE);
+      if (match) {
+        if (has(entities, match[1])) {
+          if (!silent) { state.pending += entities[match[1]]; }
+          state.pos += match[0].length;
+          return true;
+        }
+      }
+    }
+  }
+
+  if (!silent) { state.pending += '&'; }
+  state.pos++;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/escape.js b/node_modules/markdown-it/lib/rules_inline/escape.js
new file mode 100644
index 00000000..229ead0a
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/escape.js
@@ -0,0 +1,52 @@
+// Process escaped chars and hardbreaks
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+var ESCAPED = [];
+
+for (var i = 0; i < 256; i++) { ESCAPED.push(0); }
+
+'\\!"#$%&\'()*+,./:;<=>?@[]^_`{|}~-'
+  .split('').forEach(function (ch) { ESCAPED[ch.charCodeAt(0)] = 1; });
+
+
+module.exports = function escape(state, silent) {
+  var ch, pos = state.pos, max = state.posMax;
+
+  if (state.src.charCodeAt(pos) !== 0x5C/* \ */) { return false; }
+
+  pos++;
+
+  if (pos < max) {
+    ch = state.src.charCodeAt(pos);
+
+    if (ch < 256 && ESCAPED[ch] !== 0) {
+      if (!silent) { state.pending += state.src[pos]; }
+      state.pos += 2;
+      return true;
+    }
+
+    if (ch === 0x0A) {
+      if (!silent) {
+        state.push('hardbreak', 'br', 0);
+      }
+
+      pos++;
+      // skip leading whitespaces from next line
+      while (pos < max) {
+        ch = state.src.charCodeAt(pos);
+        if (!isSpace(ch)) { break; }
+        pos++;
+      }
+
+      state.pos = pos;
+      return true;
+    }
+  }
+
+  if (!silent) { state.pending += '\\'; }
+  state.pos++;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/html_inline.js b/node_modules/markdown-it/lib/rules_inline/html_inline.js
new file mode 100644
index 00000000..28c79805
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/html_inline.js
@@ -0,0 +1,47 @@
+// Process html tags
+
+'use strict';
+
+
+var HTML_TAG_RE = require('../common/html_re').HTML_TAG_RE;
+
+
+function isLetter(ch) {
+  /*eslint no-bitwise:0*/
+  var lc = ch | 0x20; // to lower case
+  return (lc >= 0x61/* a */) && (lc <= 0x7a/* z */);
+}
+
+
+module.exports = function html_inline(state, silent) {
+  var ch, match, max, token,
+      pos = state.pos;
+
+  if (!state.md.options.html) { return false; }
+
+  // Check start
+  max = state.posMax;
+  if (state.src.charCodeAt(pos) !== 0x3C/* < */ ||
+      pos + 2 >= max) {
+    return false;
+  }
+
+  // Quick fail on second char
+  ch = state.src.charCodeAt(pos + 1);
+  if (ch !== 0x21/* ! */ &&
+      ch !== 0x3F/* ? */ &&
+      ch !== 0x2F/* / */ &&
+      !isLetter(ch)) {
+    return false;
+  }
+
+  match = state.src.slice(pos).match(HTML_TAG_RE);
+  if (!match) { return false; }
+
+  if (!silent) {
+    token         = state.push('html_inline', '', 0);
+    token.content = state.src.slice(pos, pos + match[0].length);
+  }
+  state.pos += match[0].length;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/image.js b/node_modules/markdown-it/lib/rules_inline/image.js
new file mode 100644
index 00000000..53edd323
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/image.js
@@ -0,0 +1,152 @@
+// Process ![image](<src> "title")
+
+'use strict';
+
+var normalizeReference   = require('../common/utils').normalizeReference;
+var isSpace              = require('../common/utils').isSpace;
+
+
+module.exports = function image(state, silent) {
+  var attrs,
+      code,
+      content,
+      label,
+      labelEnd,
+      labelStart,
+      pos,
+      ref,
+      res,
+      title,
+      token,
+      tokens,
+      start,
+      href = '',
+      oldPos = state.pos,
+      max = state.posMax;
+
+  if (state.src.charCodeAt(state.pos) !== 0x21/* ! */) { return false; }
+  if (state.src.charCodeAt(state.pos + 1) !== 0x5B/* [ */) { return false; }
+
+  labelStart = state.pos + 2;
+  labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false);
+
+  // parser failed to find ']', so it's not a valid link
+  if (labelEnd < 0) { return false; }
+
+  pos = labelEnd + 1;
+  if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) {
+    //
+    // Inline link
+    //
+
+    // [link](  <href>  "title"  )
+    //        ^^ skipping these spaces
+    pos++;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+    if (pos >= max) { return false; }
+
+    // [link](  <href>  "title"  )
+    //          ^^^^^^ parsing link destination
+    start = pos;
+    res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+    if (res.ok) {
+      href = state.md.normalizeLink(res.str);
+      if (state.md.validateLink(href)) {
+        pos = res.pos;
+      } else {
+        href = '';
+      }
+    }
+
+    // [link](  <href>  "title"  )
+    //                ^^ skipping these spaces
+    start = pos;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+
+    // [link](  <href>  "title"  )
+    //                  ^^^^^^^ parsing link title
+    res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+    if (pos < max && start !== pos && res.ok) {
+      title = res.str;
+      pos = res.pos;
+
+      // [link](  <href>  "title"  )
+      //                         ^^ skipping these spaces
+      for (; pos < max; pos++) {
+        code = state.src.charCodeAt(pos);
+        if (!isSpace(code) && code !== 0x0A) { break; }
+      }
+    } else {
+      title = '';
+    }
+
+    if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) {
+      state.pos = oldPos;
+      return false;
+    }
+    pos++;
+  } else {
+    //
+    // Link reference
+    //
+    if (typeof state.env.references === 'undefined') { return false; }
+
+    if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) {
+      start = pos + 1;
+      pos = state.md.helpers.parseLinkLabel(state, pos);
+      if (pos >= 0) {
+        label = state.src.slice(start, pos++);
+      } else {
+        pos = labelEnd + 1;
+      }
+    } else {
+      pos = labelEnd + 1;
+    }
+
+    // covers label === '' and label === undefined
+    // (collapsed reference link and shortcut reference link respectively)
+    if (!label) { label = state.src.slice(labelStart, labelEnd); }
+
+    ref = state.env.references[normalizeReference(label)];
+    if (!ref) {
+      state.pos = oldPos;
+      return false;
+    }
+    href = ref.href;
+    title = ref.title;
+  }
+
+  //
+  // We found the end of the link, and know for a fact it's a valid link;
+  // so all that's left to do is to call tokenizer.
+  //
+  if (!silent) {
+    content = state.src.slice(labelStart, labelEnd);
+
+    state.md.inline.parse(
+      content,
+      state.md,
+      state.env,
+      tokens = []
+    );
+
+    token          = state.push('image', 'img', 0);
+    token.attrs    = attrs = [ [ 'src', href ], [ 'alt', '' ] ];
+    token.children = tokens;
+    token.content  = content;
+
+    if (title) {
+      attrs.push([ 'title', title ]);
+    }
+  }
+
+  state.pos = pos;
+  state.posMax = max;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/link.js b/node_modules/markdown-it/lib/rules_inline/link.js
new file mode 100644
index 00000000..7c9834c0
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/link.js
@@ -0,0 +1,150 @@
+// Process [link](<to> "stuff")
+
+'use strict';
+
+var normalizeReference   = require('../common/utils').normalizeReference;
+var isSpace              = require('../common/utils').isSpace;
+
+
+module.exports = function link(state, silent) {
+  var attrs,
+      code,
+      label,
+      labelEnd,
+      labelStart,
+      pos,
+      res,
+      ref,
+      title,
+      token,
+      href = '',
+      oldPos = state.pos,
+      max = state.posMax,
+      start = state.pos,
+      parseReference = true;
+
+  if (state.src.charCodeAt(state.pos) !== 0x5B/* [ */) { return false; }
+
+  labelStart = state.pos + 1;
+  labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true);
+
+  // parser failed to find ']', so it's not a valid link
+  if (labelEnd < 0) { return false; }
+
+  pos = labelEnd + 1;
+  if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) {
+    //
+    // Inline link
+    //
+
+    // might have found a valid shortcut link, disable reference parsing
+    parseReference = false;
+
+    // [link](  <href>  "title"  )
+    //        ^^ skipping these spaces
+    pos++;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+    if (pos >= max) { return false; }
+
+    // [link](  <href>  "title"  )
+    //          ^^^^^^ parsing link destination
+    start = pos;
+    res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+    if (res.ok) {
+      href = state.md.normalizeLink(res.str);
+      if (state.md.validateLink(href)) {
+        pos = res.pos;
+      } else {
+        href = '';
+      }
+    }
+
+    // [link](  <href>  "title"  )
+    //                ^^ skipping these spaces
+    start = pos;
+    for (; pos < max; pos++) {
+      code = state.src.charCodeAt(pos);
+      if (!isSpace(code) && code !== 0x0A) { break; }
+    }
+
+    // [link](  <href>  "title"  )
+    //                  ^^^^^^^ parsing link title
+    res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+    if (pos < max && start !== pos && res.ok) {
+      title = res.str;
+      pos = res.pos;
+
+      // [link](  <href>  "title"  )
+      //                         ^^ skipping these spaces
+      for (; pos < max; pos++) {
+        code = state.src.charCodeAt(pos);
+        if (!isSpace(code) && code !== 0x0A) { break; }
+      }
+    } else {
+      title = '';
+    }
+
+    if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) {
+      // parsing a valid shortcut link failed, fallback to reference
+      parseReference = true;
+    }
+    pos++;
+  }
+
+  if (parseReference) {
+    //
+    // Link reference
+    //
+    if (typeof state.env.references === 'undefined') { return false; }
+
+    if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) {
+      start = pos + 1;
+      pos = state.md.helpers.parseLinkLabel(state, pos);
+      if (pos >= 0) {
+        label = state.src.slice(start, pos++);
+      } else {
+        pos = labelEnd + 1;
+      }
+    } else {
+      pos = labelEnd + 1;
+    }
+
+    // covers label === '' and label === undefined
+    // (collapsed reference link and shortcut reference link respectively)
+    if (!label) { label = state.src.slice(labelStart, labelEnd); }
+
+    ref = state.env.references[normalizeReference(label)];
+    if (!ref) {
+      state.pos = oldPos;
+      return false;
+    }
+    href = ref.href;
+    title = ref.title;
+  }
+
+  //
+  // We found the end of the link, and know for a fact it's a valid link;
+  // so all that's left to do is to call tokenizer.
+  //
+  if (!silent) {
+    state.pos = labelStart;
+    state.posMax = labelEnd;
+
+    token        = state.push('link_open', 'a', 1);
+    token.attrs  = attrs = [ [ 'href', href ] ];
+    if (title) {
+      attrs.push([ 'title', title ]);
+    }
+
+    state.md.inline.tokenize(state);
+
+    token        = state.push('link_close', 'a', -1);
+  }
+
+  state.pos = pos;
+  state.posMax = max;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/newline.js b/node_modules/markdown-it/lib/rules_inline/newline.js
new file mode 100644
index 00000000..14aa42d1
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/newline.js
@@ -0,0 +1,42 @@
+// Proceess '\n'
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function newline(state, silent) {
+  var pmax, max, pos = state.pos;
+
+  if (state.src.charCodeAt(pos) !== 0x0A/* \n */) { return false; }
+
+  pmax = state.pending.length - 1;
+  max = state.posMax;
+
+  // '  \n' -> hardbreak
+  // Lookup in pending chars is bad practice! Don't copy to other rules!
+  // Pending string is stored in concat mode, indexed lookups will cause
+  // convertion to flat mode.
+  if (!silent) {
+    if (pmax >= 0 && state.pending.charCodeAt(pmax) === 0x20) {
+      if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 0x20) {
+        state.pending = state.pending.replace(/ +$/, '');
+        state.push('hardbreak', 'br', 0);
+      } else {
+        state.pending = state.pending.slice(0, -1);
+        state.push('softbreak', 'br', 0);
+      }
+
+    } else {
+      state.push('softbreak', 'br', 0);
+    }
+  }
+
+  pos++;
+
+  // skip heading spaces for next line
+  while (pos < max && isSpace(state.src.charCodeAt(pos))) { pos++; }
+
+  state.pos = pos;
+  return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/state_inline.js b/node_modules/markdown-it/lib/rules_inline/state_inline.js
new file mode 100644
index 00000000..2847496c
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/state_inline.js
@@ -0,0 +1,130 @@
+// Inline parser state
+
+'use strict';
+
+
+var Token          = require('../token');
+var isWhiteSpace   = require('../common/utils').isWhiteSpace;
+var isPunctChar    = require('../common/utils').isPunctChar;
+var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct;
+
+
+function StateInline(src, md, env, outTokens) {
+  this.src = src;
+  this.env = env;
+  this.md = md;
+  this.tokens = outTokens;
+
+  this.pos = 0;
+  this.posMax = this.src.length;
+  this.level = 0;
+  this.pending = '';
+  this.pendingLevel = 0;
+
+  this.cache = {};        // Stores { start: end } pairs. Useful for backtrack
+                          // optimization of pairs parse (emphasis, strikes).
+
+  this.delimiters = [];   // Emphasis-like delimiters
+}
+
+
+// Flush pending text
+//
+StateInline.prototype.pushPending = function () {
+  var token = new Token('text', '', 0);
+  token.content = this.pending;
+  token.level = this.pendingLevel;
+  this.tokens.push(token);
+  this.pending = '';
+  return token;
+};
+
+
+// Push new token to "stream".
+// If pending text exists - flush it as text token
+//
+StateInline.prototype.push = function (type, tag, nesting) {
+  if (this.pending) {
+    this.pushPending();
+  }
+
+  var token = new Token(type, tag, nesting);
+
+  if (nesting < 0) { this.level--; }
+  token.level = this.level;
+  if (nesting > 0) { this.level++; }
+
+  this.pendingLevel = this.level;
+  this.tokens.push(token);
+  return token;
+};
+
+
+// Scan a sequence of emphasis-like markers, and determine whether
+// it can start an emphasis sequence or end an emphasis sequence.
+//
+//  - start - position to scan from (it should point at a valid marker);
+//  - canSplitWord - determine if these markers can be found inside a word
+//
+StateInline.prototype.scanDelims = function (start, canSplitWord) {
+  var pos = start, lastChar, nextChar, count, can_open, can_close,
+      isLastWhiteSpace, isLastPunctChar,
+      isNextWhiteSpace, isNextPunctChar,
+      left_flanking = true,
+      right_flanking = true,
+      max = this.posMax,
+      marker = this.src.charCodeAt(start);
+
+  // treat beginning of the line as a whitespace
+  lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 0x20;
+
+  while (pos < max && this.src.charCodeAt(pos) === marker) { pos++; }
+
+  count = pos - start;
+
+  // treat end of the line as a whitespace
+  nextChar = pos < max ? this.src.charCodeAt(pos) : 0x20;
+
+  isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+  isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+
+  isLastWhiteSpace = isWhiteSpace(lastChar);
+  isNextWhiteSpace = isWhiteSpace(nextChar);
+
+  if (isNextWhiteSpace) {
+    left_flanking = false;
+  } else if (isNextPunctChar) {
+    if (!(isLastWhiteSpace || isLastPunctChar)) {
+      left_flanking = false;
+    }
+  }
+
+  if (isLastWhiteSpace) {
+    right_flanking = false;
+  } else if (isLastPunctChar) {
+    if (!(isNextWhiteSpace || isNextPunctChar)) {
+      right_flanking = false;
+    }
+  }
+
+  if (!canSplitWord) {
+    can_open  = left_flanking  && (!right_flanking || isLastPunctChar);
+    can_close = right_flanking && (!left_flanking  || isNextPunctChar);
+  } else {
+    can_open  = left_flanking;
+    can_close = right_flanking;
+  }
+
+  return {
+    can_open:  can_open,
+    can_close: can_close,
+    length:    count
+  };
+};
+
+
+// re-export Token class to use in block rules
+StateInline.prototype.Token = Token;
+
+
+module.exports = StateInline;
diff --git a/node_modules/markdown-it/lib/rules_inline/strikethrough.js b/node_modules/markdown-it/lib/rules_inline/strikethrough.js
new file mode 100644
index 00000000..03472412
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/strikethrough.js
@@ -0,0 +1,117 @@
+// ~~strike through~~
+//
+'use strict';
+
+
+// Insert each marker as a separate text token, and add it to delimiter list
+//
+module.exports.tokenize = function strikethrough(state, silent) {
+  var i, scanned, token, len, ch,
+      start = state.pos,
+      marker = state.src.charCodeAt(start);
+
+  if (silent) { return false; }
+
+  if (marker !== 0x7E/* ~ */) { return false; }
+
+  scanned = state.scanDelims(state.pos, true);
+  len = scanned.length;
+  ch = String.fromCharCode(marker);
+
+  if (len < 2) { return false; }
+
+  if (len % 2) {
+    token         = state.push('text', '', 0);
+    token.content = ch;
+    len--;
+  }
+
+  for (i = 0; i < len; i += 2) {
+    token         = state.push('text', '', 0);
+    token.content = ch + ch;
+
+    state.delimiters.push({
+      marker: marker,
+      jump:   i,
+      token:  state.tokens.length - 1,
+      level:  state.level,
+      end:    -1,
+      open:   scanned.can_open,
+      close:  scanned.can_close
+    });
+  }
+
+  state.pos += scanned.length;
+
+  return true;
+};
+
+
+// Walk through delimiter list and replace text tokens with tags
+//
+module.exports.postProcess = function strikethrough(state) {
+  var i, j,
+      startDelim,
+      endDelim,
+      token,
+      loneMarkers = [],
+      delimiters = state.delimiters,
+      max = state.delimiters.length;
+
+  for (i = 0; i < max; i++) {
+    startDelim = delimiters[i];
+
+    if (startDelim.marker !== 0x7E/* ~ */) {
+      continue;
+    }
+
+    if (startDelim.end === -1) {
+      continue;
+    }
+
+    endDelim = delimiters[startDelim.end];
+
+    token         = state.tokens[startDelim.token];
+    token.type    = 's_open';
+    token.tag     = 's';
+    token.nesting = 1;
+    token.markup  = '~~';
+    token.content = '';
+
+    token         = state.tokens[endDelim.token];
+    token.type    = 's_close';
+    token.tag     = 's';
+    token.nesting = -1;
+    token.markup  = '~~';
+    token.content = '';
+
+    if (state.tokens[endDelim.token - 1].type === 'text' &&
+        state.tokens[endDelim.token - 1].content === '~') {
+
+      loneMarkers.push(endDelim.token - 1);
+    }
+  }
+
+  // If a marker sequence has an odd number of characters, it's splitted
+  // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the
+  // start of the sequence.
+  //
+  // So, we have to move all those markers after subsequent s_close tags.
+  //
+  while (loneMarkers.length) {
+    i = loneMarkers.pop();
+    j = i + 1;
+
+    while (j < state.tokens.length && state.tokens[j].type === 's_close') {
+      j++;
+    }
+
+    j--;
+
+    if (i !== j) {
+      token = state.tokens[j];
+      state.tokens[j] = state.tokens[i];
+      state.tokens[i] = token;
+    }
+  }
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/text.js b/node_modules/markdown-it/lib/rules_inline/text.js
new file mode 100644
index 00000000..b19591e1
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/text.js
@@ -0,0 +1,89 @@
+// Skip text characters for text token, place those to pending buffer
+// and increment current pos
+
+'use strict';
+
+
+// Rule to skip pure text
+// '{}$%@~+=:' reserved for extentions
+
+// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+
+// !!!! Don't confuse with "Markdown ASCII Punctuation" chars
+// http://spec.commonmark.org/0.15/#ascii-punctuation-character
+function isTerminatorChar(ch) {
+  switch (ch) {
+    case 0x0A/* \n */:
+    case 0x21/* ! */:
+    case 0x23/* # */:
+    case 0x24/* $ */:
+    case 0x25/* % */:
+    case 0x26/* & */:
+    case 0x2A/* * */:
+    case 0x2B/* + */:
+    case 0x2D/* - */:
+    case 0x3A/* : */:
+    case 0x3C/* < */:
+    case 0x3D/* = */:
+    case 0x3E/* > */:
+    case 0x40/* @ */:
+    case 0x5B/* [ */:
+    case 0x5C/* \ */:
+    case 0x5D/* ] */:
+    case 0x5E/* ^ */:
+    case 0x5F/* _ */:
+    case 0x60/* ` */:
+    case 0x7B/* { */:
+    case 0x7D/* } */:
+    case 0x7E/* ~ */:
+      return true;
+    default:
+      return false;
+  }
+}
+
+module.exports = function text(state, silent) {
+  var pos = state.pos;
+
+  while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) {
+    pos++;
+  }
+
+  if (pos === state.pos) { return false; }
+
+  if (!silent) { state.pending += state.src.slice(state.pos, pos); }
+
+  state.pos = pos;
+
+  return true;
+};
+
+// Alternative implementation, for memory.
+//
+// It costs 10% of performance, but allows extend terminators list, if place it
+// to `ParcerInline` property. Probably, will switch to it sometime, such
+// flexibility required.
+
+/*
+var TERMINATOR_RE = /[\n!#$%&*+\-:<=>@[\\\]^_`{}~]/;
+
+module.exports = function text(state, silent) {
+  var pos = state.pos,
+      idx = state.src.slice(pos).search(TERMINATOR_RE);
+
+  // first char is terminator -> empty text
+  if (idx === 0) { return false; }
+
+  // no terminator -> text till end of string
+  if (idx < 0) {
+    if (!silent) { state.pending += state.src.slice(pos); }
+    state.pos = state.src.length;
+    return true;
+  }
+
+  if (!silent) { state.pending += state.src.slice(pos, pos + idx); }
+
+  state.pos += idx;
+
+  return true;
+};*/
diff --git a/node_modules/markdown-it/lib/rules_inline/text_collapse.js b/node_modules/markdown-it/lib/rules_inline/text_collapse.js
new file mode 100644
index 00000000..3104c0c6
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/text_collapse.js
@@ -0,0 +1,33 @@
+// Merge adjacent text nodes into one, and re-calculate all token levels
+//
+'use strict';
+
+
+module.exports = function text_collapse(state) {
+  var curr, last,
+      level = 0,
+      tokens = state.tokens,
+      max = state.tokens.length;
+
+  for (curr = last = 0; curr < max; curr++) {
+    // re-calculate levels
+    level += tokens[curr].nesting;
+    tokens[curr].level = level;
+
+    if (tokens[curr].type === 'text' &&
+        curr + 1 < max &&
+        tokens[curr + 1].type === 'text') {
+
+      // collapse two adjacent text nodes
+      tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content;
+    } else {
+      if (curr !== last) { tokens[last] = tokens[curr]; }
+
+      last++;
+    }
+  }
+
+  if (curr !== last) {
+    tokens.length = last;
+  }
+};
diff --git a/node_modules/markdown-it/lib/token.js b/node_modules/markdown-it/lib/token.js
new file mode 100644
index 00000000..54e1a5c0
--- /dev/null
+++ b/node_modules/markdown-it/lib/token.js
@@ -0,0 +1,197 @@
+// Token class
+
+'use strict';
+
+
+/**
+ * class Token
+ **/
+
+/**
+ * new Token(type, tag, nesting)
+ *
+ * Create new token and fill passed properties.
+ **/
+function Token(type, tag, nesting) {
+  /**
+   * Token#type -> String
+   *
+   * Type of the token (string, e.g. "paragraph_open")
+   **/
+  this.type     = type;
+
+  /**
+   * Token#tag -> String
+   *
+   * html tag name, e.g. "p"
+   **/
+  this.tag      = tag;
+
+  /**
+   * Token#attrs -> Array
+   *
+   * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]`
+   **/
+  this.attrs    = null;
+
+  /**
+   * Token#map -> Array
+   *
+   * Source map info. Format: `[ line_begin, line_end ]`
+   **/
+  this.map      = null;
+
+  /**
+   * Token#nesting -> Number
+   *
+   * Level change (number in {-1, 0, 1} set), where:
+   *
+   * -  `1` means the tag is opening
+   * -  `0` means the tag is self-closing
+   * - `-1` means the tag is closing
+   **/
+  this.nesting  = nesting;
+
+  /**
+   * Token#level -> Number
+   *
+   * nesting level, the same as `state.level`
+   **/
+  this.level    = 0;
+
+  /**
+   * Token#children -> Array
+   *
+   * An array of child nodes (inline and img tokens)
+   **/
+  this.children = null;
+
+  /**
+   * Token#content -> String
+   *
+   * In a case of self-closing tag (code, html, fence, etc.),
+   * it has contents of this tag.
+   **/
+  this.content  = '';
+
+  /**
+   * Token#markup -> String
+   *
+   * '*' or '_' for emphasis, fence string for fence, etc.
+   **/
+  this.markup   = '';
+
+  /**
+   * Token#info -> String
+   *
+   * fence infostring
+   **/
+  this.info     = '';
+
+  /**
+   * Token#meta -> Object
+   *
+   * A place for plugins to store an arbitrary data
+   **/
+  this.meta     = null;
+
+  /**
+   * Token#block -> Boolean
+   *
+   * True for block-level tokens, false for inline tokens.
+   * Used in renderer to calculate line breaks
+   **/
+  this.block    = false;
+
+  /**
+   * Token#hidden -> Boolean
+   *
+   * If it's true, ignore this element when rendering. Used for tight lists
+   * to hide paragraphs.
+   **/
+  this.hidden   = false;
+}
+
+
+/**
+ * Token.attrIndex(name) -> Number
+ *
+ * Search attribute index by name.
+ **/
+Token.prototype.attrIndex = function attrIndex(name) {
+  var attrs, i, len;
+
+  if (!this.attrs) { return -1; }
+
+  attrs = this.attrs;
+
+  for (i = 0, len = attrs.length; i < len; i++) {
+    if (attrs[i][0] === name) { return i; }
+  }
+  return -1;
+};
+
+
+/**
+ * Token.attrPush(attrData)
+ *
+ * Add `[ name, value ]` attribute to list. Init attrs if necessary
+ **/
+Token.prototype.attrPush = function attrPush(attrData) {
+  if (this.attrs) {
+    this.attrs.push(attrData);
+  } else {
+    this.attrs = [ attrData ];
+  }
+};
+
+
+/**
+ * Token.attrSet(name, value)
+ *
+ * Set `name` attribute to `value`. Override old value if exists.
+ **/
+Token.prototype.attrSet = function attrSet(name, value) {
+  var idx = this.attrIndex(name),
+      attrData = [ name, value ];
+
+  if (idx < 0) {
+    this.attrPush(attrData);
+  } else {
+    this.attrs[idx] = attrData;
+  }
+};
+
+
+/**
+ * Token.attrGet(name)
+ *
+ * Get the value of attribute `name`, or null if it does not exist.
+ **/
+Token.prototype.attrGet = function attrGet(name) {
+  var idx = this.attrIndex(name), value = null;
+  if (idx >= 0) {
+    value = this.attrs[idx][1];
+  }
+  return value;
+};
+
+
+/**
+ * Token.attrJoin(name, value)
+ *
+ * Join value to existing attribute via space. Or create new attribute if not
+ * exists. Useful to operate with token classes.
+ **/
+Token.prototype.attrJoin = function attrJoin(name, value) {
+  var idx = this.attrIndex(name);
+
+  if (idx < 0) {
+    this.attrPush([ name, value ]);
+  } else {
+    this.attrs[idx][1] = this.attrs[idx][1] + ' ' + value;
+  }
+};
+
+
+module.exports = Token;
diff --git a/node_modules/markdown-it/package.json b/node_modules/markdown-it/package.json
new file mode 100644
index 00000000..d77fc3da
--- /dev/null
+++ b/node_modules/markdown-it/package.json
@@ -0,0 +1,64 @@
+{
+  "name": "markdown-it",
+  "version": "8.4.2",
+  "description": "Markdown-it - modern pluggable markdown parser.",
+  "keywords": [
+    "markdown",
+    "parser",
+    "commonmark",
+    "markdown-it",
+    "markdown-it-plugin"
+  ],
+  "repository": "markdown-it/markdown-it",
+  "license": "MIT",
+  "main": "index.js",
+  "bin": {
+    "markdown-it": "bin/markdown-it.js"
+  },
+  "scripts": {
+    "test": "make test",
+    "heroku-postbuild": "npm install express"
+  },
+  "files": [
+    "index.js",
+    "bin/",
+    "lib/",
+    "dist/"
+  ],
+  "dependencies": {
+    "argparse": "^1.0.7",
+    "entities": "~1.1.1",
+    "linkify-it": "^2.0.0",
+    "mdurl": "^1.0.1",
+    "uc.micro": "^1.0.5"
+  },
+  "devDependencies": {
+    "ansi": "^0.3.0",
+    "autoprefixer-stylus": "^0.11.0",
+    "benchmark": "~2.1.0",
+    "browserify": "*",
+    "chai": "^3.4.1",
+    "coveralls": "~2.11.9",
+    "eslint": "^3.5.0",
+    "express": "^4.14.0",
+    "highlight.js": "^9.2.0",
+    "istanbul": "^0.4.5",
+    "jade": "~1.11.0",
+    "markdown-it-abbr": "^1.0.4",
+    "markdown-it-container": "^2.0.0",
+    "markdown-it-deflist": "^2.0.0",
+    "markdown-it-emoji": "^1.1.1",
+    "markdown-it-footnote": "^3.0.1",
+    "markdown-it-for-inline": "~0.1.0",
+    "markdown-it-ins": "^2.0.0",
+    "markdown-it-mark": "^2.0.0",
+    "markdown-it-sub": "^1.0.0",
+    "markdown-it-sup": "^1.0.0",
+    "markdown-it-testgen": "~0.1.3",
+    "mocha": "*",
+    "ndoc": "^5.0.0",
+    "stylus": "~0.54.2",
+    "supertest": "^3.0.0",
+    "uglify-js": "^3.0.18"
+  }
+}